diff --git a/.release-please-manifest.json b/.release-please-manifest.json index 66c5fb48df5..42cb38ab746 100644 --- a/.release-please-manifest.json +++ b/.release-please-manifest.json @@ -18,6 +18,7 @@ "packages/google-cloud-beyondcorp-clientconnectorservices": "0.2.3", "packages/google-cloud-beyondcorp-clientgateways": "0.2.3", "packages/google-cloud-bigquery-analyticshub": "0.1.2", + "packages/google-cloud-bigquery-connection": "2.0.2", "packages/google-cloud-bigquery-dataexchange": "0.3.2", "packages/google-cloud-bigquery-datapolicies": "0.1.2", "packages/google-cloud-bigquery-datatransfer": "3.1.5", diff --git a/packages/google-cloud-bigquery-connection/.OwlBot.yaml b/packages/google-cloud-bigquery-connection/.OwlBot.yaml new file mode 100644 index 00000000000..749515ecbb6 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.OwlBot.yaml @@ -0,0 +1,26 @@ +# Copyright 2021 Google LLC +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + +deep-remove-regex: + - /owl-bot-staging + +deep-preserve-regex: + - /owl-bot-staging/v1beta1 + +deep-copy-regex: + - source: /google/cloud/bigquery/connection/(.*)/.*-nodejs + dest: /owl-bot-staging/google-cloud-bigquery-connection/$1 + +begin-after-commit-hash: fb91803ccef5d7c695139b22788b309e2197856b + diff --git a/packages/google-cloud-bigquery-connection/.eslintignore b/packages/google-cloud-bigquery-connection/.eslintignore new file mode 100644 index 00000000000..ea5b04aebe6 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.eslintignore @@ -0,0 +1,7 @@ +**/node_modules +**/coverage +test/fixtures +build/ +docs/ +protos/ +samples/generated/ diff --git a/packages/google-cloud-bigquery-connection/.eslintrc.json b/packages/google-cloud-bigquery-connection/.eslintrc.json new file mode 100644 index 00000000000..78215349546 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.eslintrc.json @@ -0,0 +1,3 @@ +{ + "extends": "./node_modules/gts" +} diff --git a/packages/google-cloud-bigquery-connection/.gitattributes b/packages/google-cloud-bigquery-connection/.gitattributes new file mode 100644 index 00000000000..33739cb74e4 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.gitattributes @@ -0,0 +1,4 @@ +*.ts text eol=lf +*.js text eol=lf +protos/* linguist-generated +**/api-extractor.json linguist-language=JSON-with-Comments diff --git a/packages/google-cloud-bigquery-connection/.gitignore b/packages/google-cloud-bigquery-connection/.gitignore new file mode 100644 index 00000000000..5d32b23782f --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.gitignore @@ -0,0 +1,14 @@ +**/*.log +**/node_modules +.coverage +coverage +.nyc_output +docs/ +out/ +build/ +system-test/secrets.js +system-test/*key.json +*.lock +.DS_Store +package-lock.json +__pycache__ diff --git a/packages/google-cloud-bigquery-connection/.jsdoc.js b/packages/google-cloud-bigquery-connection/.jsdoc.js new file mode 100644 index 00000000000..3a128b4e129 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.jsdoc.js @@ -0,0 +1,55 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +'use strict'; + +module.exports = { + opts: { + readme: './README.md', + package: './package.json', + template: './node_modules/jsdoc-fresh', + recurse: true, + verbose: true, + destination: './docs/' + }, + plugins: [ + 'plugins/markdown', + 'jsdoc-region-tag' + ], + source: { + excludePattern: '(^|\\/|\\\\)[._]', + include: [ + 'build/src', + 'protos' + ], + includePattern: '\\.js$' + }, + templates: { + copyright: 'Copyright 2022 Google LLC', + includeDate: false, + sourceFiles: false, + systemName: '@google-cloud/bigquery-connection', + theme: 'lumen', + default: { + outputSourceFiles: false + } + }, + markdown: { + idInHeadings: true + } +}; diff --git a/packages/google-cloud-bigquery-connection/.mocharc.js b/packages/google-cloud-bigquery-connection/.mocharc.js new file mode 100644 index 00000000000..cdb7b752160 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.mocharc.js @@ -0,0 +1,29 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +const config = { + "enable-source-maps": true, + "throw-deprecation": true, + "timeout": 10000, + "recursive": true +} +if (process.env.MOCHA_THROW_DEPRECATION === 'false') { + delete config['throw-deprecation']; +} +if (process.env.MOCHA_REPORTER) { + config.reporter = process.env.MOCHA_REPORTER; +} +if (process.env.MOCHA_REPORTER_OUTPUT) { + config['reporter-option'] = `output=${process.env.MOCHA_REPORTER_OUTPUT}`; +} +module.exports = config diff --git a/packages/google-cloud-bigquery-connection/.nycrc b/packages/google-cloud-bigquery-connection/.nycrc new file mode 100644 index 00000000000..b18d5472b62 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.nycrc @@ -0,0 +1,24 @@ +{ + "report-dir": "./.coverage", + "reporter": ["text", "lcov"], + "exclude": [ + "**/*-test", + "**/.coverage", + "**/apis", + "**/benchmark", + "**/conformance", + "**/docs", + "**/samples", + "**/scripts", + "**/protos", + "**/test", + "**/*.d.ts", + ".jsdoc.js", + "**/.jsdoc.js", + "karma.conf.js", + "webpack-tests.config.js", + "webpack.config.js" + ], + "exclude-after-remap": false, + "all": true +} diff --git a/packages/google-cloud-bigquery-connection/.prettierignore b/packages/google-cloud-bigquery-connection/.prettierignore new file mode 100644 index 00000000000..9340ad9b86d --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.prettierignore @@ -0,0 +1,6 @@ +**/node_modules +**/coverage +test/fixtures +build/ +docs/ +protos/ diff --git a/packages/google-cloud-bigquery-connection/.prettierrc.js b/packages/google-cloud-bigquery-connection/.prettierrc.js new file mode 100644 index 00000000000..d546a4ad546 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.prettierrc.js @@ -0,0 +1,17 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +module.exports = { + ...require('gts/.prettierrc.json') +} diff --git a/packages/google-cloud-bigquery-connection/.repo-metadata.json b/packages/google-cloud-bigquery-connection/.repo-metadata.json new file mode 100644 index 00000000000..984a81e55da --- /dev/null +++ b/packages/google-cloud-bigquery-connection/.repo-metadata.json @@ -0,0 +1,17 @@ +{ + "language": "nodejs", + "repo": "googleapis/google-cloud-node", + "name": "bigqueryconnection", + "issue_tracker": "https://b.corp.google.com/savedsearches/559654", + "default_version": "v1", + "api_id": "bigqueryconnection.googleapis.com", + "distribution_name": "@google-cloud/bigquery-connection", + "requires_billing": true, + "product_documentation": "https://cloud.google.com/bigquery/docs/reference/bigqueryconnection", + "codeowner_team": "@googleapis/api-bigquery", + "name_pretty": "Google BigQuery Connection", + "client_documentation": "https://cloud.google.com/nodejs/docs/reference/bigquery-connection/latest", + "release_level": "stable", + "api_shortname": "bigqueryconnection", + "library_type": "GAPIC_AUTO" +} diff --git a/packages/google-cloud-bigquery-connection/CHANGELOG.md b/packages/google-cloud-bigquery-connection/CHANGELOG.md new file mode 100644 index 00000000000..df79e20d9eb --- /dev/null +++ b/packages/google-cloud-bigquery-connection/CHANGELOG.md @@ -0,0 +1,152 @@ +# Changelog + +## [2.0.2](https://github.com/googleapis/nodejs-bigquery-connection/compare/v2.0.1...v2.0.2) (2022-09-01) + + +### Bug Fixes + +* Allow passing gax instance to client constructor ([#192](https://github.com/googleapis/nodejs-bigquery-connection/issues/192)) ([8c0ff4f](https://github.com/googleapis/nodejs-bigquery-connection/commit/8c0ff4ff10e8f8f2d680de15f703981a769d8e38)) +* Do not import the whole google-gax from proto JS ([#1553](https://github.com/googleapis/nodejs-bigquery-connection/issues/1553)) ([#191](https://github.com/googleapis/nodejs-bigquery-connection/issues/191)) ([4442884](https://github.com/googleapis/nodejs-bigquery-connection/commit/4442884234d2e6e28659379534288839225c7091)) +* Remove pip install statements ([#1546](https://github.com/googleapis/nodejs-bigquery-connection/issues/1546)) ([#189](https://github.com/googleapis/nodejs-bigquery-connection/issues/189)) ([f93111c](https://github.com/googleapis/nodejs-bigquery-connection/commit/f93111c57ebfb6527a14e7af017e2c7ce379dcb8)) + +## [2.0.1](https://github.com/googleapis/nodejs-bigquery-connection/compare/v2.0.0...v2.0.1) (2022-08-23) + + +### Bug Fixes + +* better support for fallback mode ([#187](https://github.com/googleapis/nodejs-bigquery-connection/issues/187)) ([e4dec92](https://github.com/googleapis/nodejs-bigquery-connection/commit/e4dec92bf2dacdedca084095283bab2393f295ed)) +* **docs:** document fallback rest option ([#183](https://github.com/googleapis/nodejs-bigquery-connection/issues/183)) ([777accf](https://github.com/googleapis/nodejs-bigquery-connection/commit/777accfa5875cbe8e6e20ec33f96140cf179532a)) +* update google-gax and remove obsolete deps ([#1545](https://github.com/googleapis/nodejs-bigquery-connection/issues/1545)) ([#188](https://github.com/googleapis/nodejs-bigquery-connection/issues/188)) ([e829fc6](https://github.com/googleapis/nodejs-bigquery-connection/commit/e829fc63f6c492ae78b35cc16c3a224021cf2bb2)) + +## [2.0.0](https://github.com/googleapis/nodejs-bigquery-connection/compare/v1.5.1...v2.0.0) (2022-06-09) + + +### ⚠ BREAKING CHANGES + +* update library to use Node 12 (#177) + +### Features + +* Add Cloud_Resource Connection Support ([#162](https://github.com/googleapis/nodejs-bigquery-connection/issues/162)) ([afc2727](https://github.com/googleapis/nodejs-bigquery-connection/commit/afc272726d3600f425faca2a8b5bf22a6a24314c)) +* AuditConfig for IAM v1 ([#166](https://github.com/googleapis/nodejs-bigquery-connection/issues/166)) ([53bec44](https://github.com/googleapis/nodejs-bigquery-connection/commit/53bec4434eaec4ffba927554f8cee14b45a3c646)) + + +### Build System + +* update library to use Node 12 ([#177](https://github.com/googleapis/nodejs-bigquery-connection/issues/177)) ([b034adf](https://github.com/googleapis/nodejs-bigquery-connection/commit/b034adfbd415d1138d5921b51434d28819990cee)) + +### [1.5.1](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.5.0...v1.5.1) (2021-09-27) + + +### Bug Fixes + +* **deps:** google-gax v2.24.1 ([#123](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/123)) ([2112f0a](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/2112f0a9fe594c5cac19f79dd554ea3b232aae45)) + +## [1.5.0](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.4.2...v1.5.0) (2021-09-13) + + +### Features + +* turns on self-signed JWT feature flag ([#124](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/124)) ([fd91176](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/fd91176a1b7a2c93b68137e66198f93fea8fe939)) + +### [1.4.2](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.4.1...v1.4.2) (2021-08-11) + + +### Bug Fixes + +* **build:** migrate to using main branch ([#121](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/121)) ([b01f5d9](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/b01f5d9be2bb8574218c25efe4afc4bea8535cf4)) + +### [1.4.1](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.4.0...v1.4.1) (2021-07-21) + + +### Bug Fixes + +* Updating WORKSPACE files to use the newest version of the Typescript generator. ([#112](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/112)) ([9a2b5bb](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/9a2b5bb9796be07bd13ca886061f30151c5ba235)) + +## [1.4.0](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.3.5...v1.4.0) (2021-07-14) + + +### Features + +* add cloud spanner connection support ([#110](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/110)) ([18924ba](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/18924bade9c347ca3775ace87dc140743aea4a86)) + +### [1.3.5](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.3.4...v1.3.5) (2021-07-12) + + +### Bug Fixes + +* **deps:** google-gax v2.17.1 ([#108](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/108)) ([b94f6e6](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/b94f6e69c6984ef5180f64e25eb5576d35471573)) + +### [1.3.4](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.3.3...v1.3.4) (2021-07-01) + + +### Bug Fixes + +* **deps:** require google-gax v2.17.0 ([#104](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/104)) ([a03eb4b](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/a03eb4b9be4dac6e3cfc7d2ceb169dcff80617ef)) + +### [1.3.3](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.3.2...v1.3.3) (2021-06-22) + + +### Bug Fixes + +* make request optional in all cases ([#98](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/98)) ([779e30b](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/779e30b0fbd9b2c1ed7b826c41d17e679d3d60db)) + +### [1.3.2](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.3.1...v1.3.2) (2021-06-10) + + +### Bug Fixes + +* GoogleAdsError missing using generator version after 1.3.0 ([#89](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/89)) ([dca26bf](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/dca26bfe396c852e9c7e7481105b8d7387ed1977)) + +### [1.3.1](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.3.0...v1.3.1) (2021-05-12) + + +### Bug Fixes + +* **deps:** require google-gax v2.12.0 ([#81](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/81)) ([4613348](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/46133486a55dc2a4d8f75bae748898397df31714)) +* use require() to load JSON protos ([#84](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/84)) ([00b0814](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/00b0814beadc47856a58c2fea3d9f651f343245b)) + +## [1.3.0](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.2.2...v1.3.0) (2021-01-09) + + +### Features + +* introduce style enumeration ([#60](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/60)) ([44b7182](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/44b7182422254a6267eef8b59271a09796503720)) + +### [1.2.2](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.2.1...v1.2.2) (2020-12-04) + + +### Bug Fixes + +* **deps:** roll back dependency @google-cloud/bigquery-connection to ^1.2.0 ([#52](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/52)) ([14f9872](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/14f9872f2175791f663ccfb6511d2d3e408f4151)) + +### [1.2.1](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.2.0...v1.2.1) (2020-11-25) + + +### Bug Fixes + +* **browser:** check for fetch on window ([5413d69](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/5413d694d4b70eb338a17a5eb4a682f1673abfee)) +* do not modify options object, use defaultScopes ([#46](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/46)) ([07244e4](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/07244e4c6375bdbee47db6c7a2b018594c9b34e5)) + +## [1.2.0](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.1.0...v1.2.0) (2020-10-17) + + +### Features + +* add aws connection support ([#33](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/33)) ([13fecb8](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/13fecb87d0191a4654f14604164072570f640dc6)) + +## [1.1.0](https://www.github.com/googleapis/nodejs-bigquery-connection/compare/v1.0.0...v1.1.0) (2020-08-10) + + +### Features + +* add/correct PHP namespace for BigQuery connection/reservation ([#26](https://www.github.com/googleapis/nodejs-bigquery-connection/issues/26)) ([39313b9](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/39313b930e12a20203d137058899479ca83d51d5)) + +## 1.0.0 (2020-07-09) + + +### Features + +* generate v1 ([6ef8fcb](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/6ef8fcbc9b50f7ccef429347841968fe41ad60cf)) +* generate v1 ([9125a52](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/9125a52480f9259e959a6a4ce706fb574b74ae0a)) +* generate v1 ([f054c74](https://www.github.com/googleapis/nodejs-bigquery-connection/commit/f054c743a5529831a5993fc0e9eb9efbeccae0cb)) diff --git a/packages/google-cloud-bigquery-connection/CODE_OF_CONDUCT.md b/packages/google-cloud-bigquery-connection/CODE_OF_CONDUCT.md new file mode 100644 index 00000000000..2add2547a81 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/CODE_OF_CONDUCT.md @@ -0,0 +1,94 @@ + +# Code of Conduct + +## Our Pledge + +In the interest of fostering an open and welcoming environment, we as +contributors and maintainers pledge to making participation in our project and +our community a harassment-free experience for everyone, regardless of age, body +size, disability, ethnicity, gender identity and expression, level of +experience, education, socio-economic status, nationality, personal appearance, +race, religion, or sexual identity and orientation. + +## Our Standards + +Examples of behavior that contributes to creating a positive environment +include: + +* Using welcoming and inclusive language +* Being respectful of differing viewpoints and experiences +* Gracefully accepting constructive criticism +* Focusing on what is best for the community +* Showing empathy towards other community members + +Examples of unacceptable behavior by participants include: + +* The use of sexualized language or imagery and unwelcome sexual attention or + advances +* Trolling, insulting/derogatory comments, and personal or political attacks +* Public or private harassment +* Publishing others' private information, such as a physical or electronic + address, without explicit permission +* Other conduct which could reasonably be considered inappropriate in a + professional setting + +## Our Responsibilities + +Project maintainers are responsible for clarifying the standards of acceptable +behavior and are expected to take appropriate and fair corrective action in +response to any instances of unacceptable behavior. + +Project maintainers have the right and responsibility to remove, edit, or reject +comments, commits, code, wiki edits, issues, and other contributions that are +not aligned to this Code of Conduct, or to ban temporarily or permanently any +contributor for other behaviors that they deem inappropriate, threatening, +offensive, or harmful. + +## Scope + +This Code of Conduct applies both within project spaces and in public spaces +when an individual is representing the project or its community. Examples of +representing a project or community include using an official project e-mail +address, posting via an official social media account, or acting as an appointed +representative at an online or offline event. Representation of a project may be +further defined and clarified by project maintainers. + +This Code of Conduct also applies outside the project spaces when the Project +Steward has a reasonable belief that an individual's behavior may have a +negative impact on the project or its community. + +## Conflict Resolution + +We do not believe that all conflict is bad; healthy debate and disagreement +often yield positive results. However, it is never okay to be disrespectful or +to engage in behavior that violates the project’s code of conduct. + +If you see someone violating the code of conduct, you are encouraged to address +the behavior directly with those involved. Many issues can be resolved quickly +and easily, and this gives people more control over the outcome of their +dispute. If you are unable to resolve the matter for any reason, or if the +behavior is threatening or harassing, report it. We are dedicated to providing +an environment where participants feel welcome and safe. + +Reports should be directed to *googleapis-stewards@google.com*, the +Project Steward(s) for *Google Cloud Client Libraries*. It is the Project Steward’s duty to +receive and address reported violations of the code of conduct. They will then +work with a committee consisting of representatives from the Open Source +Programs Office and the Google Open Source Strategy team. If for any reason you +are uncomfortable reaching out to the Project Steward, please email +opensource@google.com. + +We will investigate every complaint, but you may not receive a direct response. +We will use our discretion in determining when and how to follow up on reported +incidents, which may range from not taking action to permanent expulsion from +the project and project-sponsored spaces. We will notify the accused of the +report and provide them an opportunity to discuss it before any action is taken. +The identity of the reporter will be omitted from the details of the report +supplied to the accused. In potentially harmful situations, such as ongoing +harassment or threats to anyone's safety, we may take action without notice. + +## Attribution + +This Code of Conduct is adapted from the Contributor Covenant, version 1.4, +available at +https://www.contributor-covenant.org/version/1/4/code-of-conduct.html \ No newline at end of file diff --git a/packages/google-cloud-bigquery-connection/CONTRIBUTING.md b/packages/google-cloud-bigquery-connection/CONTRIBUTING.md new file mode 100644 index 00000000000..6d71be74d3d --- /dev/null +++ b/packages/google-cloud-bigquery-connection/CONTRIBUTING.md @@ -0,0 +1,76 @@ +# How to become a contributor and submit your own code + +**Table of contents** + +* [Contributor License Agreements](#contributor-license-agreements) +* [Contributing a patch](#contributing-a-patch) +* [Running the tests](#running-the-tests) +* [Releasing the library](#releasing-the-library) + +## Contributor License Agreements + +We'd love to accept your sample apps and patches! Before we can take them, we +have to jump a couple of legal hurdles. + +Please fill out either the individual or corporate Contributor License Agreement +(CLA). + + * If you are an individual writing original source code and you're sure you + own the intellectual property, then you'll need to sign an [individual CLA](https://developers.google.com/open-source/cla/individual). + * If you work for a company that wants to allow you to contribute your work, + then you'll need to sign a [corporate CLA](https://developers.google.com/open-source/cla/corporate). + +Follow either of the two links above to access the appropriate CLA and +instructions for how to sign and return it. Once we receive it, we'll be able to +accept your pull requests. + +## Contributing A Patch + +1. Submit an issue describing your proposed change to the repo in question. +1. The repo owner will respond to your issue promptly. +1. If your proposed change is accepted, and you haven't already done so, sign a + Contributor License Agreement (see details above). +1. Fork the desired repo, develop and test your code changes. +1. Ensure that your code adheres to the existing style in the code to which + you are contributing. +1. Ensure that your code has an appropriate set of tests which all pass. +1. Title your pull request following [Conventional Commits](https://www.conventionalcommits.org/) styling. +1. Submit a pull request. + +### Before you begin + +1. [Select or create a Cloud Platform project][projects]. +1. [Enable billing for your project][billing]. +1. [Enable the Google BigQuery Connection API][enable_api]. +1. [Set up authentication with a service account][auth] so you can access the + API from your local workstation. + + +## Running the tests + +1. [Prepare your environment for Node.js setup][setup]. + +1. Install dependencies: + + npm install + +1. Run the tests: + + # Run unit tests. + npm test + + # Run sample integration tests. + npm run samples-test + + # Run all system tests. + npm run system-test + +1. Lint (and maybe fix) any changes: + + npm run fix + +[setup]: https://cloud.google.com/nodejs/docs/setup +[projects]: https://console.cloud.google.com/project +[billing]: https://support.google.com/cloud/answer/6293499#enable-billing +[enable_api]: https://console.cloud.google.com/flows/enableapi?apiid=bigqueryconnection.googleapis.com +[auth]: https://cloud.google.com/docs/authentication/getting-started \ No newline at end of file diff --git a/packages/google-cloud-bigquery-connection/LICENSE b/packages/google-cloud-bigquery-connection/LICENSE new file mode 100644 index 00000000000..d6456956733 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/LICENSE @@ -0,0 +1,202 @@ + + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "[]" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright [yyyy] [name of copyright owner] + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. diff --git a/packages/google-cloud-bigquery-connection/README.md b/packages/google-cloud-bigquery-connection/README.md new file mode 100644 index 00000000000..a592c024462 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/README.md @@ -0,0 +1,171 @@ +[//]: # "This README.md file is auto-generated, all changes to this file will be lost." +[//]: # "To regenerate it, use `python -m synthtool`." +Google Cloud Platform logo + +# [Google BigQuery Connection: Node.js Client](https://github.com/googleapis/google-cloud-node) + +[![release level](https://img.shields.io/badge/release%20level-stable-brightgreen.svg?style=flat)](https://cloud.google.com/terms/launch-stages) +[![npm version](https://img.shields.io/npm/v/@google-cloud/bigquery-connection.svg)](https://www.npmjs.org/package/@google-cloud/bigquery-connection) + + + + +BigQuery Connection client for Node.js + + +A comprehensive list of changes in each version may be found in +[the CHANGELOG](https://github.com/googleapis/google-cloud-node/tree/main/packages/google-cloud-bigquery-connection/CHANGELOG.md). + +* [Google BigQuery Connection Node.js Client API Reference][client-docs] +* [Google BigQuery Connection Documentation][product-docs] +* [github.com/googleapis/google-cloud-node/packages/google-cloud-bigquery-connection](https://github.com/googleapis/google-cloud-node/tree/main/packages/google-cloud-bigquery-connection) + +Read more about the client libraries for Cloud APIs, including the older +Google APIs Client Libraries, in [Client Libraries Explained][explained]. + +[explained]: https://cloud.google.com/apis/docs/client-libraries-explained + +**Table of contents:** + + +* [Quickstart](#quickstart) + * [Before you begin](#before-you-begin) + * [Installing the client library](#installing-the-client-library) + * [Using the client library](#using-the-client-library) +* [Samples](#samples) +* [Versioning](#versioning) +* [Contributing](#contributing) +* [License](#license) + +## Quickstart + +### Before you begin + +1. [Select or create a Cloud Platform project][projects]. +1. [Enable billing for your project][billing]. +1. [Enable the Google BigQuery Connection API][enable_api]. +1. [Set up authentication with a service account][auth] so you can access the + API from your local workstation. + +### Installing the client library + +```bash +npm install @google-cloud/bigquery-connection +``` + + +### Using the client library + +```javascript +// Imports the Google Cloud client library +const { + ConnectionServiceClient, +} = require('@google-cloud/bigquery-connection'); + +// Creates a client +const client = new ConnectionServiceClient(); + +// project = 'my-project' // Project to list connections for. + +const parent = `projects/${project}/locations/US`; + +async function listConnections() { + const [connections] = await client.listConnections({ + parent: parent, + }); + + console.info(`found ${connections.length} connections:`); + console.info(connections); +} +const listConnectionsResponse = listConnections(); + +``` + + + +## Samples + +Samples are in the [`samples/`](https://github.com/googleapis/google-cloud-node/tree/main/samples) directory. Each sample's `README.md` has instructions for running its sample. + +| Sample | Source Code | Try it | +| --------------------------- | --------------------------------- | ------ | +| Connection_service.create_connection | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.create_connection.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.create_connection.js,samples/README.md) | +| Connection_service.delete_connection | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.delete_connection.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.delete_connection.js,samples/README.md) | +| Connection_service.get_connection | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_connection.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_connection.js,samples/README.md) | +| Connection_service.get_iam_policy | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_iam_policy.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_iam_policy.js,samples/README.md) | +| Connection_service.list_connections | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.list_connections.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.list_connections.js,samples/README.md) | +| Connection_service.set_iam_policy | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.set_iam_policy.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.set_iam_policy.js,samples/README.md) | +| Connection_service.test_iam_permissions | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.test_iam_permissions.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.test_iam_permissions.js,samples/README.md) | +| Connection_service.update_connection | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.update_connection.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.update_connection.js,samples/README.md) | +| Quickstart | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/quickstart.js,samples/README.md) | +| Quickstart | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/test/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/test/quickstart.js,samples/README.md) | + + + +The [Google BigQuery Connection Node.js Client API Reference][client-docs] documentation +also contains samples. + +## Supported Node.js Versions + +Our client libraries follow the [Node.js release schedule](https://nodejs.org/en/about/releases/). +Libraries are compatible with all current _active_ and _maintenance_ versions of +Node.js. +If you are using an end-of-life version of Node.js, we recommend that you update +as soon as possible to an actively supported LTS version. + +Google's client libraries support legacy versions of Node.js runtimes on a +best-efforts basis with the following warnings: + +* Legacy versions are not tested in continuous integration. +* Some security patches and features cannot be backported. +* Dependencies cannot be kept up-to-date. + +Client libraries targeting some end-of-life versions of Node.js are available, and +can be installed through npm [dist-tags](https://docs.npmjs.com/cli/dist-tag). +The dist-tags follow the naming convention `legacy-(version)`. +For example, `npm install @google-cloud/bigquery-connection@legacy-8` installs client libraries +for versions compatible with Node.js 8. + +## Versioning + +This library follows [Semantic Versioning](http://semver.org/). + + + +This library is considered to be **stable**. The code surface will not change in backwards-incompatible ways +unless absolutely necessary (e.g. because of critical security issues) or with +an extensive deprecation period. Issues and requests against **stable** libraries +are addressed with the highest priority. + + + + + + +More Information: [Google Cloud Platform Launch Stages][launch_stages] + +[launch_stages]: https://cloud.google.com/terms/launch-stages + +## Contributing + +Contributions welcome! See the [Contributing Guide](https://github.com/googleapis/google-cloud-node/blob/main/CONTRIBUTING.md). + +Please note that this `README.md`, the `samples/README.md`, +and a variety of configuration files in this repository (including `.nycrc` and `tsconfig.json`) +are generated from a central template. To edit one of these files, make an edit +to its templates in +[directory](https://github.com/googleapis/synthtool). + +## License + +Apache Version 2.0 + +See [LICENSE](https://github.com/googleapis/google-cloud-node/blob/main/LICENSE) + +[client-docs]: https://cloud.google.com/nodejs/docs/reference/bigquery-connection/latest +[product-docs]: https://cloud.google.com/bigquery/docs/reference/bigqueryconnection +[shell_img]: https://gstatic.com/cloudssh/images/open-btn.png +[projects]: https://console.cloud.google.com/project +[billing]: https://support.google.com/cloud/answer/6293499#enable-billing +[enable_api]: https://console.cloud.google.com/flows/enableapi?apiid=bigqueryconnection.googleapis.com +[auth]: https://cloud.google.com/docs/authentication/getting-started diff --git a/packages/google-cloud-bigquery-connection/linkinator.config.json b/packages/google-cloud-bigquery-connection/linkinator.config.json new file mode 100644 index 00000000000..befd23c8633 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/linkinator.config.json @@ -0,0 +1,16 @@ +{ + "recurse": true, + "skip": [ + "https://codecov.io/gh/googleapis/", + "www.googleapis.com", + "img.shields.io", + "https://console.cloud.google.com/cloudshell", + "https://support.google.com" + ], + "silent": true, + "concurrency": 5, + "retry": true, + "retryErrors": true, + "retryErrorsCount": 5, + "retryErrorsJitter": 3000 +} diff --git a/packages/google-cloud-bigquery-connection/package.json b/packages/google-cloud-bigquery-connection/package.json new file mode 100644 index 00000000000..81c1312b289 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/package.json @@ -0,0 +1,71 @@ +{ + "name": "@google-cloud/bigquery-connection", + "version": "2.0.2", + "description": "BigQuery Connection client for Node.js", + "repository": { + "type": "git", + "directory": "packages/google-cloud-bigquery-connection", + "url": "https://github.com/googleapis/google-cloud-node.git" + }, + "license": "Apache-2.0", + "author": "Google LLC", + "main": "build/src/index.js", + "files": [ + "build/src", + "build/protos" + ], + "keywords": [ + "google apis client", + "google api client", + "google apis", + "google api", + "google", + "google cloud platform", + "google cloud", + "cloud", + "google connection", + "connection", + "connection service" + ], + "scripts": { + "clean": "gts clean", + "compile": "tsc -p . && cp -r protos build/", + "compile-protos": "compileProtos src", + "docs": "jsdoc -c .jsdoc.js", + "predocs-test": "npm run docs", + "docs-test": "linkinator docs", + "fix": "gts fix", + "prelint": "cd samples/; npm link ../; npm i", + "lint": "gts check", + "prepare": "npm run compile-protos && npm run compile", + "system-test": "npm run compile && c8 mocha build/system-test", + "samples-test": "npm run compile && cd samples/ && npm link ../ && npm i && npm test", + "test": "c8 mocha build/test" + }, + "dependencies": { + "google-gax": "^3.5.2" + }, + "devDependencies": { + "@types/mocha": "^9.0.0", + "@types/node": "^18.0.0", + "@types/sinon": "^10.0.0", + "c8": "^7.2.0", + "gts": "^3.1.0", + "jsdoc": "^4.0.0", + "jsdoc-fresh": "^2.0.0", + "jsdoc-region-tag": "^2.0.0", + "linkinator": "^4.0.0", + "mocha": "^9.2.2", + "null-loader": "^4.0.0", + "pack-n-play": "^1.0.0-2", + "sinon": "^14.0.0", + "ts-loader": "^9.0.0", + "typescript": "^4.6.4", + "webpack": "^5.0.0", + "webpack-cli": "^4.0.0" + }, + "engines": { + "node": ">=12.0.0" + }, + "homepage": "https://github.com/googleapis/google-cloud-node/tree/main/packages/google-cloud-bigquery-connection" +} diff --git a/packages/google-cloud-bigquery-connection/protos/google/cloud/bigquery/connection/v1/connection.proto b/packages/google-cloud-bigquery-connection/protos/google/cloud/bigquery/connection/v1/connection.proto new file mode 100644 index 00000000000..ee0dba14ad8 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/protos/google/cloud/bigquery/connection/v1/connection.proto @@ -0,0 +1,393 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +syntax = "proto3"; + +package google.cloud.bigquery.connection.v1; + +import "google/api/annotations.proto"; +import "google/api/client.proto"; +import "google/api/field_behavior.proto"; +import "google/api/resource.proto"; +import "google/iam/v1/iam_policy.proto"; +import "google/iam/v1/policy.proto"; +import "google/protobuf/empty.proto"; +import "google/protobuf/field_mask.proto"; + +option csharp_namespace = "Google.Cloud.BigQuery.Connection.V1"; +option go_package = "google.golang.org/genproto/googleapis/cloud/bigquery/connection/v1;connection"; +option java_multiple_files = true; +option java_package = "com.google.cloud.bigquery.connection.v1"; +option php_namespace = "Google\\Cloud\\BigQuery\\Connection\\V1"; + +// Manages external data source connections and credentials. +service ConnectionService { + option (google.api.default_host) = "bigqueryconnection.googleapis.com"; + option (google.api.oauth_scopes) = + "https://www.googleapis.com/auth/bigquery," + "https://www.googleapis.com/auth/cloud-platform"; + + // Creates a new connection. + rpc CreateConnection(CreateConnectionRequest) returns (Connection) { + option (google.api.http) = { + post: "/v1/{parent=projects/*/locations/*}/connections" + body: "connection" + }; + option (google.api.method_signature) = "parent,connection,connection_id"; + } + + // Returns specified connection. + rpc GetConnection(GetConnectionRequest) returns (Connection) { + option (google.api.http) = { + get: "/v1/{name=projects/*/locations/*/connections/*}" + }; + option (google.api.method_signature) = "name"; + } + + // Returns a list of connections in the given project. + rpc ListConnections(ListConnectionsRequest) returns (ListConnectionsResponse) { + option (google.api.http) = { + get: "/v1/{parent=projects/*/locations/*}/connections" + }; + option (google.api.method_signature) = "parent"; + } + + // Updates the specified connection. For security reasons, also resets + // credential if connection properties are in the update field mask. + rpc UpdateConnection(UpdateConnectionRequest) returns (Connection) { + option (google.api.http) = { + patch: "/v1/{name=projects/*/locations/*/connections/*}" + body: "connection" + }; + option (google.api.method_signature) = "name,connection,update_mask"; + } + + // Deletes connection and associated credential. + rpc DeleteConnection(DeleteConnectionRequest) returns (google.protobuf.Empty) { + option (google.api.http) = { + delete: "/v1/{name=projects/*/locations/*/connections/*}" + }; + option (google.api.method_signature) = "name"; + } + + // Gets the access control policy for a resource. + // Returns an empty policy if the resource exists and does not have a policy + // set. + rpc GetIamPolicy(google.iam.v1.GetIamPolicyRequest) returns (google.iam.v1.Policy) { + option (google.api.http) = { + post: "/v1/{resource=projects/*/locations/*/connections/*}:getIamPolicy" + body: "*" + }; + option (google.api.method_signature) = "resource,options"; + } + + // Sets the access control policy on the specified resource. Replaces any + // existing policy. + // + // Can return `NOT_FOUND`, `INVALID_ARGUMENT`, and `PERMISSION_DENIED` errors. + rpc SetIamPolicy(google.iam.v1.SetIamPolicyRequest) returns (google.iam.v1.Policy) { + option (google.api.http) = { + post: "/v1/{resource=projects/*/locations/*/connections/*}:setIamPolicy" + body: "*" + }; + option (google.api.method_signature) = "resource,policy"; + } + + // Returns permissions that a caller has on the specified resource. + // If the resource does not exist, this will return an empty set of + // permissions, not a `NOT_FOUND` error. + // + // Note: This operation is designed to be used for building permission-aware + // UIs and command-line tools, not for authorization checking. This operation + // may "fail open" without warning. + rpc TestIamPermissions(google.iam.v1.TestIamPermissionsRequest) returns (google.iam.v1.TestIamPermissionsResponse) { + option (google.api.http) = { + post: "/v1/{resource=projects/*/locations/*/connections/*}:testIamPermissions" + body: "*" + }; + option (google.api.method_signature) = "resource,permissions"; + } +} + +// The request for [ConnectionService.CreateConnection][google.cloud.bigquery.connection.v1.ConnectionService.CreateConnection]. +message CreateConnectionRequest { + // Required. Parent resource name. + // Must be in the format `projects/{project_id}/locations/{location_id}` + string parent = 1 [ + (google.api.field_behavior) = REQUIRED, + (google.api.resource_reference) = { + type: "locations.googleapis.com/Location" + } + ]; + + // Optional. Connection id that should be assigned to the created connection. + string connection_id = 2 [(google.api.field_behavior) = OPTIONAL]; + + // Required. Connection to create. + Connection connection = 3 [(google.api.field_behavior) = REQUIRED]; +} + +// The request for [ConnectionService.GetConnection][google.cloud.bigquery.connection.v1.ConnectionService.GetConnection]. +message GetConnectionRequest { + // Required. Name of the requested connection, for example: + // `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + string name = 1 [ + (google.api.field_behavior) = REQUIRED, + (google.api.resource_reference) = { + type: "bigqueryconnection.googleapis.com/Connection" + } + ]; +} + +// The request for [ConnectionService.ListConnections][google.cloud.bigquery.connection.v1.ConnectionService.ListConnections]. +message ListConnectionsRequest { + // Required. Parent resource name. + // Must be in the form: `projects/{project_id}/locations/{location_id}` + string parent = 1 [ + (google.api.field_behavior) = REQUIRED, + (google.api.resource_reference) = { + type: "locations.googleapis.com/Location" + } + ]; + + // Required. Page size. + int32 page_size = 4 [(google.api.field_behavior) = REQUIRED]; + + // Page token. + string page_token = 3; +} + +// The response for [ConnectionService.ListConnections][google.cloud.bigquery.connection.v1.ConnectionService.ListConnections]. +message ListConnectionsResponse { + // Next page token. + string next_page_token = 1; + + // List of connections. + repeated Connection connections = 2; +} + +// The request for [ConnectionService.UpdateConnection][google.cloud.bigquery.connection.v1.ConnectionService.UpdateConnection]. +message UpdateConnectionRequest { + // Required. Name of the connection to update, for example: + // `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + string name = 1 [ + (google.api.field_behavior) = REQUIRED, + (google.api.resource_reference) = { + type: "bigqueryconnection.googleapis.com/Connection" + } + ]; + + // Required. Connection containing the updated fields. + Connection connection = 2 [(google.api.field_behavior) = REQUIRED]; + + // Required. Update mask for the connection fields to be updated. + google.protobuf.FieldMask update_mask = 3 [(google.api.field_behavior) = REQUIRED]; +} + +// The request for [ConnectionService.DeleteConnectionRequest][]. +message DeleteConnectionRequest { + // Required. Name of the deleted connection, for example: + // `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + string name = 1 [ + (google.api.field_behavior) = REQUIRED, + (google.api.resource_reference) = { + type: "bigqueryconnection.googleapis.com/Connection" + } + ]; +} + +// Configuration parameters to establish connection with an external data +// source, except the credential attributes. +message Connection { + option (google.api.resource) = { + type: "bigqueryconnection.googleapis.com/Connection" + pattern: "projects/{project}/locations/{location}/connections/{connection}" + }; + + // The resource name of the connection in the form of: + // `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + string name = 1; + + // User provided display name for the connection. + string friendly_name = 2; + + // User provided description. + string description = 3; + + // Properties specific to the underlying data source. + oneof properties { + // Cloud SQL properties. + CloudSqlProperties cloud_sql = 4; + + // Amazon Web Services (AWS) properties. + AwsProperties aws = 8; + + // Azure properties. + AzureProperties azure = 11; + + // Cloud Spanner properties. + CloudSpannerProperties cloud_spanner = 21; + + // Cloud Resource properties. + CloudResourceProperties cloud_resource = 22; + } + + // Output only. The creation timestamp of the connection. + int64 creation_time = 5 [(google.api.field_behavior) = OUTPUT_ONLY]; + + // Output only. The last update timestamp of the connection. + int64 last_modified_time = 6 [(google.api.field_behavior) = OUTPUT_ONLY]; + + // Output only. True, if credential is configured for this connection. + bool has_credential = 7 [(google.api.field_behavior) = OUTPUT_ONLY]; +} + +// Connection properties specific to the Cloud SQL. +message CloudSqlProperties { + // Supported Cloud SQL database types. + enum DatabaseType { + // Unspecified database type. + DATABASE_TYPE_UNSPECIFIED = 0; + + // Cloud SQL for PostgreSQL. + POSTGRES = 1; + + // Cloud SQL for MySQL. + MYSQL = 2; + } + + // Cloud SQL instance ID in the form `project:location:instance`. + string instance_id = 1; + + // Database name. + string database = 2; + + // Type of the Cloud SQL database. + DatabaseType type = 3; + + // Input only. Cloud SQL credential. + CloudSqlCredential credential = 4 [(google.api.field_behavior) = INPUT_ONLY]; + + // Output only. The account ID of the service used for the purpose of this connection. + // + // When the connection is used in the context of an operation in + // BigQuery, this service account will serve as identity being used for + // connecting to the CloudSQL instance specified in this connection. + string service_account_id = 5 [(google.api.field_behavior) = OUTPUT_ONLY]; +} + +// Credential info for the Cloud SQL. +message CloudSqlCredential { + // The username for the credential. + string username = 1; + + // The password for the credential. + string password = 2; +} + +// Connection properties specific to Cloud Spanner. +message CloudSpannerProperties { + // Cloud Spanner database in the form `project/instance/database' + string database = 1; + + // If parallelism should be used when reading from Cloud Spanner + bool use_parallelism = 2; +} + +// Connection properties specific to Amazon Web Services (AWS). +message AwsProperties { + // Authentication method chosen at connection creation. + oneof authentication_method { + // Authentication using Google owned AWS IAM user's access key to assume + // into customer's AWS IAM Role. + // Deprecated, do not use. + AwsCrossAccountRole cross_account_role = 2 [deprecated = true]; + + // Authentication using Google owned service account to assume into + // customer's AWS IAM Role. + AwsAccessRole access_role = 3; + } +} + +// Authentication method for Amazon Web Services (AWS) that uses Google owned +// AWS IAM user's access key to assume into customer's AWS IAM Role. +message AwsCrossAccountRole { + // The user’s AWS IAM Role that trusts the Google-owned AWS IAM user + // Connection. + string iam_role_id = 1; + + // Output only. Google-owned AWS IAM User for a Connection. + string iam_user_id = 2 [(google.api.field_behavior) = OUTPUT_ONLY]; + + // Output only. A Google-generated id for representing Connection’s identity in AWS. + // External Id is also used for preventing the Confused Deputy Problem. See + // https://docs.aws.amazon.com/IAM/latest/UserGuide/id_roles_create_for-user_externalid.html + string external_id = 3 [(google.api.field_behavior) = OUTPUT_ONLY]; +} + +// Authentication method for Amazon Web Services (AWS) that uses Google owned +// Google service account to assume into customer's AWS IAM Role. +message AwsAccessRole { + // The user’s AWS IAM Role that trusts the Google-owned AWS IAM user + // Connection. + string iam_role_id = 1; + + // A unique Google-owned and Google-generated identity for the Connection. + // This identity will be used to access the user's AWS IAM Role. + string identity = 2; +} + +// Container for connection properties specific to Azure. +message AzureProperties { + // Output only. The name of the Azure Active Directory Application. + string application = 1 [(google.api.field_behavior) = OUTPUT_ONLY]; + + // Output only. The client id of the Azure Active Directory Application. + string client_id = 2 [(google.api.field_behavior) = OUTPUT_ONLY]; + + // Output only. The object id of the Azure Active Directory Application. + string object_id = 3 [(google.api.field_behavior) = OUTPUT_ONLY]; + + // The id of customer's directory that host the data. + string customer_tenant_id = 4; + + // The URL user will be redirected to after granting consent during connection + // setup. + string redirect_uri = 5; + + // The client id of the user's Azure Active Directory Application used for a + // federated connection. + string federated_application_client_id = 6; + + // Output only. A unique Google-owned and Google-generated identity for the Connection. + // This identity will be used to access the user's Azure Active Directory + // Application. + string identity = 7 [(google.api.field_behavior) = OUTPUT_ONLY]; +} + +// Container for connection properties for delegation of access to GCP +// resources. +message CloudResourceProperties { + // Output only. The account ID of the service created for the purpose of this connection. + // + // The service account does not have any permissions associated with it + // when it is created. After creation, customers delegate permissions + // to the service account. When the connection is used in the context of an + // operation in BigQuery, the service account will be used to connect to the + // desired resources in GCP. + // + // The account ID is in the form of: + // @gcp-sa-bigquery-cloudresource.iam.gserviceaccount.com + string service_account_id = 1 [(google.api.field_behavior) = OUTPUT_ONLY]; +} diff --git a/packages/google-cloud-bigquery-connection/protos/protos.d.ts b/packages/google-cloud-bigquery-connection/protos/protos.d.ts new file mode 100644 index 00000000000..86161cc2fb0 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/protos/protos.d.ts @@ -0,0 +1,7576 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +import type {protobuf as $protobuf} from "google-gax"; +import Long = require("long"); +/** Namespace google. */ +export namespace google { + + /** Namespace cloud. */ + namespace cloud { + + /** Namespace bigquery. */ + namespace bigquery { + + /** Namespace connection. */ + namespace connection { + + /** Namespace v1. */ + namespace v1 { + + /** Represents a ConnectionService */ + class ConnectionService extends $protobuf.rpc.Service { + + /** + * Constructs a new ConnectionService service. + * @param rpcImpl RPC implementation + * @param [requestDelimited=false] Whether requests are length-delimited + * @param [responseDelimited=false] Whether responses are length-delimited + */ + constructor(rpcImpl: $protobuf.RPCImpl, requestDelimited?: boolean, responseDelimited?: boolean); + + /** + * Creates new ConnectionService service using the specified rpc implementation. + * @param rpcImpl RPC implementation + * @param [requestDelimited=false] Whether requests are length-delimited + * @param [responseDelimited=false] Whether responses are length-delimited + * @returns RPC service. Useful where requests and/or responses are streamed. + */ + public static create(rpcImpl: $protobuf.RPCImpl, requestDelimited?: boolean, responseDelimited?: boolean): ConnectionService; + + /** + * Calls CreateConnection. + * @param request CreateConnectionRequest message or plain object + * @param callback Node-style callback called with the error, if any, and Connection + */ + public createConnection(request: google.cloud.bigquery.connection.v1.ICreateConnectionRequest, callback: google.cloud.bigquery.connection.v1.ConnectionService.CreateConnectionCallback): void; + + /** + * Calls CreateConnection. + * @param request CreateConnectionRequest message or plain object + * @returns Promise + */ + public createConnection(request: google.cloud.bigquery.connection.v1.ICreateConnectionRequest): Promise; + + /** + * Calls GetConnection. + * @param request GetConnectionRequest message or plain object + * @param callback Node-style callback called with the error, if any, and Connection + */ + public getConnection(request: google.cloud.bigquery.connection.v1.IGetConnectionRequest, callback: google.cloud.bigquery.connection.v1.ConnectionService.GetConnectionCallback): void; + + /** + * Calls GetConnection. + * @param request GetConnectionRequest message or plain object + * @returns Promise + */ + public getConnection(request: google.cloud.bigquery.connection.v1.IGetConnectionRequest): Promise; + + /** + * Calls ListConnections. + * @param request ListConnectionsRequest message or plain object + * @param callback Node-style callback called with the error, if any, and ListConnectionsResponse + */ + public listConnections(request: google.cloud.bigquery.connection.v1.IListConnectionsRequest, callback: google.cloud.bigquery.connection.v1.ConnectionService.ListConnectionsCallback): void; + + /** + * Calls ListConnections. + * @param request ListConnectionsRequest message or plain object + * @returns Promise + */ + public listConnections(request: google.cloud.bigquery.connection.v1.IListConnectionsRequest): Promise; + + /** + * Calls UpdateConnection. + * @param request UpdateConnectionRequest message or plain object + * @param callback Node-style callback called with the error, if any, and Connection + */ + public updateConnection(request: google.cloud.bigquery.connection.v1.IUpdateConnectionRequest, callback: google.cloud.bigquery.connection.v1.ConnectionService.UpdateConnectionCallback): void; + + /** + * Calls UpdateConnection. + * @param request UpdateConnectionRequest message or plain object + * @returns Promise + */ + public updateConnection(request: google.cloud.bigquery.connection.v1.IUpdateConnectionRequest): Promise; + + /** + * Calls DeleteConnection. + * @param request DeleteConnectionRequest message or plain object + * @param callback Node-style callback called with the error, if any, and Empty + */ + public deleteConnection(request: google.cloud.bigquery.connection.v1.IDeleteConnectionRequest, callback: google.cloud.bigquery.connection.v1.ConnectionService.DeleteConnectionCallback): void; + + /** + * Calls DeleteConnection. + * @param request DeleteConnectionRequest message or plain object + * @returns Promise + */ + public deleteConnection(request: google.cloud.bigquery.connection.v1.IDeleteConnectionRequest): Promise; + + /** + * Calls GetIamPolicy. + * @param request GetIamPolicyRequest message or plain object + * @param callback Node-style callback called with the error, if any, and Policy + */ + public getIamPolicy(request: google.iam.v1.IGetIamPolicyRequest, callback: google.cloud.bigquery.connection.v1.ConnectionService.GetIamPolicyCallback): void; + + /** + * Calls GetIamPolicy. + * @param request GetIamPolicyRequest message or plain object + * @returns Promise + */ + public getIamPolicy(request: google.iam.v1.IGetIamPolicyRequest): Promise; + + /** + * Calls SetIamPolicy. + * @param request SetIamPolicyRequest message or plain object + * @param callback Node-style callback called with the error, if any, and Policy + */ + public setIamPolicy(request: google.iam.v1.ISetIamPolicyRequest, callback: google.cloud.bigquery.connection.v1.ConnectionService.SetIamPolicyCallback): void; + + /** + * Calls SetIamPolicy. + * @param request SetIamPolicyRequest message or plain object + * @returns Promise + */ + public setIamPolicy(request: google.iam.v1.ISetIamPolicyRequest): Promise; + + /** + * Calls TestIamPermissions. + * @param request TestIamPermissionsRequest message or plain object + * @param callback Node-style callback called with the error, if any, and TestIamPermissionsResponse + */ + public testIamPermissions(request: google.iam.v1.ITestIamPermissionsRequest, callback: google.cloud.bigquery.connection.v1.ConnectionService.TestIamPermissionsCallback): void; + + /** + * Calls TestIamPermissions. + * @param request TestIamPermissionsRequest message or plain object + * @returns Promise + */ + public testIamPermissions(request: google.iam.v1.ITestIamPermissionsRequest): Promise; + } + + namespace ConnectionService { + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|createConnection}. + * @param error Error, if any + * @param [response] Connection + */ + type CreateConnectionCallback = (error: (Error|null), response?: google.cloud.bigquery.connection.v1.Connection) => void; + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|getConnection}. + * @param error Error, if any + * @param [response] Connection + */ + type GetConnectionCallback = (error: (Error|null), response?: google.cloud.bigquery.connection.v1.Connection) => void; + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|listConnections}. + * @param error Error, if any + * @param [response] ListConnectionsResponse + */ + type ListConnectionsCallback = (error: (Error|null), response?: google.cloud.bigquery.connection.v1.ListConnectionsResponse) => void; + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|updateConnection}. + * @param error Error, if any + * @param [response] Connection + */ + type UpdateConnectionCallback = (error: (Error|null), response?: google.cloud.bigquery.connection.v1.Connection) => void; + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|deleteConnection}. + * @param error Error, if any + * @param [response] Empty + */ + type DeleteConnectionCallback = (error: (Error|null), response?: google.protobuf.Empty) => void; + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|getIamPolicy}. + * @param error Error, if any + * @param [response] Policy + */ + type GetIamPolicyCallback = (error: (Error|null), response?: google.iam.v1.Policy) => void; + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|setIamPolicy}. + * @param error Error, if any + * @param [response] Policy + */ + type SetIamPolicyCallback = (error: (Error|null), response?: google.iam.v1.Policy) => void; + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|testIamPermissions}. + * @param error Error, if any + * @param [response] TestIamPermissionsResponse + */ + type TestIamPermissionsCallback = (error: (Error|null), response?: google.iam.v1.TestIamPermissionsResponse) => void; + } + + /** Properties of a CreateConnectionRequest. */ + interface ICreateConnectionRequest { + + /** CreateConnectionRequest parent */ + parent?: (string|null); + + /** CreateConnectionRequest connectionId */ + connectionId?: (string|null); + + /** CreateConnectionRequest connection */ + connection?: (google.cloud.bigquery.connection.v1.IConnection|null); + } + + /** Represents a CreateConnectionRequest. */ + class CreateConnectionRequest implements ICreateConnectionRequest { + + /** + * Constructs a new CreateConnectionRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.ICreateConnectionRequest); + + /** CreateConnectionRequest parent. */ + public parent: string; + + /** CreateConnectionRequest connectionId. */ + public connectionId: string; + + /** CreateConnectionRequest connection. */ + public connection?: (google.cloud.bigquery.connection.v1.IConnection|null); + + /** + * Creates a new CreateConnectionRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns CreateConnectionRequest instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.ICreateConnectionRequest): google.cloud.bigquery.connection.v1.CreateConnectionRequest; + + /** + * Encodes the specified CreateConnectionRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CreateConnectionRequest.verify|verify} messages. + * @param message CreateConnectionRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.ICreateConnectionRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified CreateConnectionRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CreateConnectionRequest.verify|verify} messages. + * @param message CreateConnectionRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.ICreateConnectionRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a CreateConnectionRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns CreateConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.CreateConnectionRequest; + + /** + * Decodes a CreateConnectionRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns CreateConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.CreateConnectionRequest; + + /** + * Verifies a CreateConnectionRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a CreateConnectionRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns CreateConnectionRequest + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.CreateConnectionRequest; + + /** + * Creates a plain object from a CreateConnectionRequest message. Also converts values to other types if specified. + * @param message CreateConnectionRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.CreateConnectionRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this CreateConnectionRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for CreateConnectionRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a GetConnectionRequest. */ + interface IGetConnectionRequest { + + /** GetConnectionRequest name */ + name?: (string|null); + } + + /** Represents a GetConnectionRequest. */ + class GetConnectionRequest implements IGetConnectionRequest { + + /** + * Constructs a new GetConnectionRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IGetConnectionRequest); + + /** GetConnectionRequest name. */ + public name: string; + + /** + * Creates a new GetConnectionRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns GetConnectionRequest instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IGetConnectionRequest): google.cloud.bigquery.connection.v1.GetConnectionRequest; + + /** + * Encodes the specified GetConnectionRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.GetConnectionRequest.verify|verify} messages. + * @param message GetConnectionRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IGetConnectionRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified GetConnectionRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.GetConnectionRequest.verify|verify} messages. + * @param message GetConnectionRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IGetConnectionRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a GetConnectionRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns GetConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.GetConnectionRequest; + + /** + * Decodes a GetConnectionRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns GetConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.GetConnectionRequest; + + /** + * Verifies a GetConnectionRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a GetConnectionRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns GetConnectionRequest + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.GetConnectionRequest; + + /** + * Creates a plain object from a GetConnectionRequest message. Also converts values to other types if specified. + * @param message GetConnectionRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.GetConnectionRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this GetConnectionRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for GetConnectionRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a ListConnectionsRequest. */ + interface IListConnectionsRequest { + + /** ListConnectionsRequest parent */ + parent?: (string|null); + + /** ListConnectionsRequest pageSize */ + pageSize?: (number|null); + + /** ListConnectionsRequest pageToken */ + pageToken?: (string|null); + } + + /** Represents a ListConnectionsRequest. */ + class ListConnectionsRequest implements IListConnectionsRequest { + + /** + * Constructs a new ListConnectionsRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IListConnectionsRequest); + + /** ListConnectionsRequest parent. */ + public parent: string; + + /** ListConnectionsRequest pageSize. */ + public pageSize: number; + + /** ListConnectionsRequest pageToken. */ + public pageToken: string; + + /** + * Creates a new ListConnectionsRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns ListConnectionsRequest instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IListConnectionsRequest): google.cloud.bigquery.connection.v1.ListConnectionsRequest; + + /** + * Encodes the specified ListConnectionsRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.ListConnectionsRequest.verify|verify} messages. + * @param message ListConnectionsRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IListConnectionsRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ListConnectionsRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.ListConnectionsRequest.verify|verify} messages. + * @param message ListConnectionsRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IListConnectionsRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ListConnectionsRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ListConnectionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.ListConnectionsRequest; + + /** + * Decodes a ListConnectionsRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ListConnectionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.ListConnectionsRequest; + + /** + * Verifies a ListConnectionsRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ListConnectionsRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ListConnectionsRequest + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.ListConnectionsRequest; + + /** + * Creates a plain object from a ListConnectionsRequest message. Also converts values to other types if specified. + * @param message ListConnectionsRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.ListConnectionsRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ListConnectionsRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ListConnectionsRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a ListConnectionsResponse. */ + interface IListConnectionsResponse { + + /** ListConnectionsResponse nextPageToken */ + nextPageToken?: (string|null); + + /** ListConnectionsResponse connections */ + connections?: (google.cloud.bigquery.connection.v1.IConnection[]|null); + } + + /** Represents a ListConnectionsResponse. */ + class ListConnectionsResponse implements IListConnectionsResponse { + + /** + * Constructs a new ListConnectionsResponse. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IListConnectionsResponse); + + /** ListConnectionsResponse nextPageToken. */ + public nextPageToken: string; + + /** ListConnectionsResponse connections. */ + public connections: google.cloud.bigquery.connection.v1.IConnection[]; + + /** + * Creates a new ListConnectionsResponse instance using the specified properties. + * @param [properties] Properties to set + * @returns ListConnectionsResponse instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IListConnectionsResponse): google.cloud.bigquery.connection.v1.ListConnectionsResponse; + + /** + * Encodes the specified ListConnectionsResponse message. Does not implicitly {@link google.cloud.bigquery.connection.v1.ListConnectionsResponse.verify|verify} messages. + * @param message ListConnectionsResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IListConnectionsResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ListConnectionsResponse message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.ListConnectionsResponse.verify|verify} messages. + * @param message ListConnectionsResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IListConnectionsResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ListConnectionsResponse message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ListConnectionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.ListConnectionsResponse; + + /** + * Decodes a ListConnectionsResponse message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ListConnectionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.ListConnectionsResponse; + + /** + * Verifies a ListConnectionsResponse message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ListConnectionsResponse message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ListConnectionsResponse + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.ListConnectionsResponse; + + /** + * Creates a plain object from a ListConnectionsResponse message. Also converts values to other types if specified. + * @param message ListConnectionsResponse + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.ListConnectionsResponse, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ListConnectionsResponse to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ListConnectionsResponse + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an UpdateConnectionRequest. */ + interface IUpdateConnectionRequest { + + /** UpdateConnectionRequest name */ + name?: (string|null); + + /** UpdateConnectionRequest connection */ + connection?: (google.cloud.bigquery.connection.v1.IConnection|null); + + /** UpdateConnectionRequest updateMask */ + updateMask?: (google.protobuf.IFieldMask|null); + } + + /** Represents an UpdateConnectionRequest. */ + class UpdateConnectionRequest implements IUpdateConnectionRequest { + + /** + * Constructs a new UpdateConnectionRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IUpdateConnectionRequest); + + /** UpdateConnectionRequest name. */ + public name: string; + + /** UpdateConnectionRequest connection. */ + public connection?: (google.cloud.bigquery.connection.v1.IConnection|null); + + /** UpdateConnectionRequest updateMask. */ + public updateMask?: (google.protobuf.IFieldMask|null); + + /** + * Creates a new UpdateConnectionRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns UpdateConnectionRequest instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IUpdateConnectionRequest): google.cloud.bigquery.connection.v1.UpdateConnectionRequest; + + /** + * Encodes the specified UpdateConnectionRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.UpdateConnectionRequest.verify|verify} messages. + * @param message UpdateConnectionRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IUpdateConnectionRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified UpdateConnectionRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.UpdateConnectionRequest.verify|verify} messages. + * @param message UpdateConnectionRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IUpdateConnectionRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an UpdateConnectionRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns UpdateConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.UpdateConnectionRequest; + + /** + * Decodes an UpdateConnectionRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns UpdateConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.UpdateConnectionRequest; + + /** + * Verifies an UpdateConnectionRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an UpdateConnectionRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns UpdateConnectionRequest + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.UpdateConnectionRequest; + + /** + * Creates a plain object from an UpdateConnectionRequest message. Also converts values to other types if specified. + * @param message UpdateConnectionRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.UpdateConnectionRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this UpdateConnectionRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for UpdateConnectionRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a DeleteConnectionRequest. */ + interface IDeleteConnectionRequest { + + /** DeleteConnectionRequest name */ + name?: (string|null); + } + + /** Represents a DeleteConnectionRequest. */ + class DeleteConnectionRequest implements IDeleteConnectionRequest { + + /** + * Constructs a new DeleteConnectionRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IDeleteConnectionRequest); + + /** DeleteConnectionRequest name. */ + public name: string; + + /** + * Creates a new DeleteConnectionRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns DeleteConnectionRequest instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IDeleteConnectionRequest): google.cloud.bigquery.connection.v1.DeleteConnectionRequest; + + /** + * Encodes the specified DeleteConnectionRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.DeleteConnectionRequest.verify|verify} messages. + * @param message DeleteConnectionRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IDeleteConnectionRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified DeleteConnectionRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.DeleteConnectionRequest.verify|verify} messages. + * @param message DeleteConnectionRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IDeleteConnectionRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a DeleteConnectionRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns DeleteConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.DeleteConnectionRequest; + + /** + * Decodes a DeleteConnectionRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns DeleteConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.DeleteConnectionRequest; + + /** + * Verifies a DeleteConnectionRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a DeleteConnectionRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns DeleteConnectionRequest + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.DeleteConnectionRequest; + + /** + * Creates a plain object from a DeleteConnectionRequest message. Also converts values to other types if specified. + * @param message DeleteConnectionRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.DeleteConnectionRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this DeleteConnectionRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for DeleteConnectionRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a Connection. */ + interface IConnection { + + /** Connection name */ + name?: (string|null); + + /** Connection friendlyName */ + friendlyName?: (string|null); + + /** Connection description */ + description?: (string|null); + + /** Connection cloudSql */ + cloudSql?: (google.cloud.bigquery.connection.v1.ICloudSqlProperties|null); + + /** Connection aws */ + aws?: (google.cloud.bigquery.connection.v1.IAwsProperties|null); + + /** Connection azure */ + azure?: (google.cloud.bigquery.connection.v1.IAzureProperties|null); + + /** Connection cloudSpanner */ + cloudSpanner?: (google.cloud.bigquery.connection.v1.ICloudSpannerProperties|null); + + /** Connection cloudResource */ + cloudResource?: (google.cloud.bigquery.connection.v1.ICloudResourceProperties|null); + + /** Connection creationTime */ + creationTime?: (number|Long|string|null); + + /** Connection lastModifiedTime */ + lastModifiedTime?: (number|Long|string|null); + + /** Connection hasCredential */ + hasCredential?: (boolean|null); + } + + /** Represents a Connection. */ + class Connection implements IConnection { + + /** + * Constructs a new Connection. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IConnection); + + /** Connection name. */ + public name: string; + + /** Connection friendlyName. */ + public friendlyName: string; + + /** Connection description. */ + public description: string; + + /** Connection cloudSql. */ + public cloudSql?: (google.cloud.bigquery.connection.v1.ICloudSqlProperties|null); + + /** Connection aws. */ + public aws?: (google.cloud.bigquery.connection.v1.IAwsProperties|null); + + /** Connection azure. */ + public azure?: (google.cloud.bigquery.connection.v1.IAzureProperties|null); + + /** Connection cloudSpanner. */ + public cloudSpanner?: (google.cloud.bigquery.connection.v1.ICloudSpannerProperties|null); + + /** Connection cloudResource. */ + public cloudResource?: (google.cloud.bigquery.connection.v1.ICloudResourceProperties|null); + + /** Connection creationTime. */ + public creationTime: (number|Long|string); + + /** Connection lastModifiedTime. */ + public lastModifiedTime: (number|Long|string); + + /** Connection hasCredential. */ + public hasCredential: boolean; + + /** Connection properties. */ + public properties?: ("cloudSql"|"aws"|"azure"|"cloudSpanner"|"cloudResource"); + + /** + * Creates a new Connection instance using the specified properties. + * @param [properties] Properties to set + * @returns Connection instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IConnection): google.cloud.bigquery.connection.v1.Connection; + + /** + * Encodes the specified Connection message. Does not implicitly {@link google.cloud.bigquery.connection.v1.Connection.verify|verify} messages. + * @param message Connection message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IConnection, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Connection message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.Connection.verify|verify} messages. + * @param message Connection message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IConnection, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Connection message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Connection + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.Connection; + + /** + * Decodes a Connection message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Connection + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.Connection; + + /** + * Verifies a Connection message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Connection message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Connection + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.Connection; + + /** + * Creates a plain object from a Connection message. Also converts values to other types if specified. + * @param message Connection + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.Connection, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Connection to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Connection + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a CloudSqlProperties. */ + interface ICloudSqlProperties { + + /** CloudSqlProperties instanceId */ + instanceId?: (string|null); + + /** CloudSqlProperties database */ + database?: (string|null); + + /** CloudSqlProperties type */ + type?: (google.cloud.bigquery.connection.v1.CloudSqlProperties.DatabaseType|keyof typeof google.cloud.bigquery.connection.v1.CloudSqlProperties.DatabaseType|null); + + /** CloudSqlProperties credential */ + credential?: (google.cloud.bigquery.connection.v1.ICloudSqlCredential|null); + + /** CloudSqlProperties serviceAccountId */ + serviceAccountId?: (string|null); + } + + /** Represents a CloudSqlProperties. */ + class CloudSqlProperties implements ICloudSqlProperties { + + /** + * Constructs a new CloudSqlProperties. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.ICloudSqlProperties); + + /** CloudSqlProperties instanceId. */ + public instanceId: string; + + /** CloudSqlProperties database. */ + public database: string; + + /** CloudSqlProperties type. */ + public type: (google.cloud.bigquery.connection.v1.CloudSqlProperties.DatabaseType|keyof typeof google.cloud.bigquery.connection.v1.CloudSqlProperties.DatabaseType); + + /** CloudSqlProperties credential. */ + public credential?: (google.cloud.bigquery.connection.v1.ICloudSqlCredential|null); + + /** CloudSqlProperties serviceAccountId. */ + public serviceAccountId: string; + + /** + * Creates a new CloudSqlProperties instance using the specified properties. + * @param [properties] Properties to set + * @returns CloudSqlProperties instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.ICloudSqlProperties): google.cloud.bigquery.connection.v1.CloudSqlProperties; + + /** + * Encodes the specified CloudSqlProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSqlProperties.verify|verify} messages. + * @param message CloudSqlProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.ICloudSqlProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified CloudSqlProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSqlProperties.verify|verify} messages. + * @param message CloudSqlProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.ICloudSqlProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a CloudSqlProperties message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns CloudSqlProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.CloudSqlProperties; + + /** + * Decodes a CloudSqlProperties message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns CloudSqlProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.CloudSqlProperties; + + /** + * Verifies a CloudSqlProperties message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a CloudSqlProperties message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns CloudSqlProperties + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.CloudSqlProperties; + + /** + * Creates a plain object from a CloudSqlProperties message. Also converts values to other types if specified. + * @param message CloudSqlProperties + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.CloudSqlProperties, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this CloudSqlProperties to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for CloudSqlProperties + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace CloudSqlProperties { + + /** DatabaseType enum. */ + enum DatabaseType { + DATABASE_TYPE_UNSPECIFIED = 0, + POSTGRES = 1, + MYSQL = 2 + } + } + + /** Properties of a CloudSqlCredential. */ + interface ICloudSqlCredential { + + /** CloudSqlCredential username */ + username?: (string|null); + + /** CloudSqlCredential password */ + password?: (string|null); + } + + /** Represents a CloudSqlCredential. */ + class CloudSqlCredential implements ICloudSqlCredential { + + /** + * Constructs a new CloudSqlCredential. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.ICloudSqlCredential); + + /** CloudSqlCredential username. */ + public username: string; + + /** CloudSqlCredential password. */ + public password: string; + + /** + * Creates a new CloudSqlCredential instance using the specified properties. + * @param [properties] Properties to set + * @returns CloudSqlCredential instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.ICloudSqlCredential): google.cloud.bigquery.connection.v1.CloudSqlCredential; + + /** + * Encodes the specified CloudSqlCredential message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSqlCredential.verify|verify} messages. + * @param message CloudSqlCredential message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.ICloudSqlCredential, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified CloudSqlCredential message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSqlCredential.verify|verify} messages. + * @param message CloudSqlCredential message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.ICloudSqlCredential, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a CloudSqlCredential message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns CloudSqlCredential + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.CloudSqlCredential; + + /** + * Decodes a CloudSqlCredential message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns CloudSqlCredential + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.CloudSqlCredential; + + /** + * Verifies a CloudSqlCredential message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a CloudSqlCredential message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns CloudSqlCredential + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.CloudSqlCredential; + + /** + * Creates a plain object from a CloudSqlCredential message. Also converts values to other types if specified. + * @param message CloudSqlCredential + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.CloudSqlCredential, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this CloudSqlCredential to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for CloudSqlCredential + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a CloudSpannerProperties. */ + interface ICloudSpannerProperties { + + /** CloudSpannerProperties database */ + database?: (string|null); + + /** CloudSpannerProperties useParallelism */ + useParallelism?: (boolean|null); + } + + /** Represents a CloudSpannerProperties. */ + class CloudSpannerProperties implements ICloudSpannerProperties { + + /** + * Constructs a new CloudSpannerProperties. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.ICloudSpannerProperties); + + /** CloudSpannerProperties database. */ + public database: string; + + /** CloudSpannerProperties useParallelism. */ + public useParallelism: boolean; + + /** + * Creates a new CloudSpannerProperties instance using the specified properties. + * @param [properties] Properties to set + * @returns CloudSpannerProperties instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.ICloudSpannerProperties): google.cloud.bigquery.connection.v1.CloudSpannerProperties; + + /** + * Encodes the specified CloudSpannerProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSpannerProperties.verify|verify} messages. + * @param message CloudSpannerProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.ICloudSpannerProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified CloudSpannerProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSpannerProperties.verify|verify} messages. + * @param message CloudSpannerProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.ICloudSpannerProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a CloudSpannerProperties message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns CloudSpannerProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.CloudSpannerProperties; + + /** + * Decodes a CloudSpannerProperties message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns CloudSpannerProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.CloudSpannerProperties; + + /** + * Verifies a CloudSpannerProperties message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a CloudSpannerProperties message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns CloudSpannerProperties + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.CloudSpannerProperties; + + /** + * Creates a plain object from a CloudSpannerProperties message. Also converts values to other types if specified. + * @param message CloudSpannerProperties + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.CloudSpannerProperties, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this CloudSpannerProperties to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for CloudSpannerProperties + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an AwsProperties. */ + interface IAwsProperties { + + /** AwsProperties crossAccountRole */ + crossAccountRole?: (google.cloud.bigquery.connection.v1.IAwsCrossAccountRole|null); + + /** AwsProperties accessRole */ + accessRole?: (google.cloud.bigquery.connection.v1.IAwsAccessRole|null); + } + + /** Represents an AwsProperties. */ + class AwsProperties implements IAwsProperties { + + /** + * Constructs a new AwsProperties. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IAwsProperties); + + /** AwsProperties crossAccountRole. */ + public crossAccountRole?: (google.cloud.bigquery.connection.v1.IAwsCrossAccountRole|null); + + /** AwsProperties accessRole. */ + public accessRole?: (google.cloud.bigquery.connection.v1.IAwsAccessRole|null); + + /** AwsProperties authenticationMethod. */ + public authenticationMethod?: ("crossAccountRole"|"accessRole"); + + /** + * Creates a new AwsProperties instance using the specified properties. + * @param [properties] Properties to set + * @returns AwsProperties instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IAwsProperties): google.cloud.bigquery.connection.v1.AwsProperties; + + /** + * Encodes the specified AwsProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsProperties.verify|verify} messages. + * @param message AwsProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IAwsProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified AwsProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsProperties.verify|verify} messages. + * @param message AwsProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IAwsProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an AwsProperties message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns AwsProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.AwsProperties; + + /** + * Decodes an AwsProperties message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns AwsProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.AwsProperties; + + /** + * Verifies an AwsProperties message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an AwsProperties message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns AwsProperties + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.AwsProperties; + + /** + * Creates a plain object from an AwsProperties message. Also converts values to other types if specified. + * @param message AwsProperties + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.AwsProperties, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this AwsProperties to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for AwsProperties + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an AwsCrossAccountRole. */ + interface IAwsCrossAccountRole { + + /** AwsCrossAccountRole iamRoleId */ + iamRoleId?: (string|null); + + /** AwsCrossAccountRole iamUserId */ + iamUserId?: (string|null); + + /** AwsCrossAccountRole externalId */ + externalId?: (string|null); + } + + /** Represents an AwsCrossAccountRole. */ + class AwsCrossAccountRole implements IAwsCrossAccountRole { + + /** + * Constructs a new AwsCrossAccountRole. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IAwsCrossAccountRole); + + /** AwsCrossAccountRole iamRoleId. */ + public iamRoleId: string; + + /** AwsCrossAccountRole iamUserId. */ + public iamUserId: string; + + /** AwsCrossAccountRole externalId. */ + public externalId: string; + + /** + * Creates a new AwsCrossAccountRole instance using the specified properties. + * @param [properties] Properties to set + * @returns AwsCrossAccountRole instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IAwsCrossAccountRole): google.cloud.bigquery.connection.v1.AwsCrossAccountRole; + + /** + * Encodes the specified AwsCrossAccountRole message. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsCrossAccountRole.verify|verify} messages. + * @param message AwsCrossAccountRole message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IAwsCrossAccountRole, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified AwsCrossAccountRole message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsCrossAccountRole.verify|verify} messages. + * @param message AwsCrossAccountRole message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IAwsCrossAccountRole, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an AwsCrossAccountRole message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns AwsCrossAccountRole + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.AwsCrossAccountRole; + + /** + * Decodes an AwsCrossAccountRole message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns AwsCrossAccountRole + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.AwsCrossAccountRole; + + /** + * Verifies an AwsCrossAccountRole message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an AwsCrossAccountRole message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns AwsCrossAccountRole + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.AwsCrossAccountRole; + + /** + * Creates a plain object from an AwsCrossAccountRole message. Also converts values to other types if specified. + * @param message AwsCrossAccountRole + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.AwsCrossAccountRole, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this AwsCrossAccountRole to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for AwsCrossAccountRole + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an AwsAccessRole. */ + interface IAwsAccessRole { + + /** AwsAccessRole iamRoleId */ + iamRoleId?: (string|null); + + /** AwsAccessRole identity */ + identity?: (string|null); + } + + /** Represents an AwsAccessRole. */ + class AwsAccessRole implements IAwsAccessRole { + + /** + * Constructs a new AwsAccessRole. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IAwsAccessRole); + + /** AwsAccessRole iamRoleId. */ + public iamRoleId: string; + + /** AwsAccessRole identity. */ + public identity: string; + + /** + * Creates a new AwsAccessRole instance using the specified properties. + * @param [properties] Properties to set + * @returns AwsAccessRole instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IAwsAccessRole): google.cloud.bigquery.connection.v1.AwsAccessRole; + + /** + * Encodes the specified AwsAccessRole message. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsAccessRole.verify|verify} messages. + * @param message AwsAccessRole message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IAwsAccessRole, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified AwsAccessRole message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsAccessRole.verify|verify} messages. + * @param message AwsAccessRole message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IAwsAccessRole, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an AwsAccessRole message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns AwsAccessRole + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.AwsAccessRole; + + /** + * Decodes an AwsAccessRole message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns AwsAccessRole + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.AwsAccessRole; + + /** + * Verifies an AwsAccessRole message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an AwsAccessRole message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns AwsAccessRole + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.AwsAccessRole; + + /** + * Creates a plain object from an AwsAccessRole message. Also converts values to other types if specified. + * @param message AwsAccessRole + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.AwsAccessRole, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this AwsAccessRole to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for AwsAccessRole + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an AzureProperties. */ + interface IAzureProperties { + + /** AzureProperties application */ + application?: (string|null); + + /** AzureProperties clientId */ + clientId?: (string|null); + + /** AzureProperties objectId */ + objectId?: (string|null); + + /** AzureProperties customerTenantId */ + customerTenantId?: (string|null); + + /** AzureProperties redirectUri */ + redirectUri?: (string|null); + + /** AzureProperties federatedApplicationClientId */ + federatedApplicationClientId?: (string|null); + + /** AzureProperties identity */ + identity?: (string|null); + } + + /** Represents an AzureProperties. */ + class AzureProperties implements IAzureProperties { + + /** + * Constructs a new AzureProperties. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.IAzureProperties); + + /** AzureProperties application. */ + public application: string; + + /** AzureProperties clientId. */ + public clientId: string; + + /** AzureProperties objectId. */ + public objectId: string; + + /** AzureProperties customerTenantId. */ + public customerTenantId: string; + + /** AzureProperties redirectUri. */ + public redirectUri: string; + + /** AzureProperties federatedApplicationClientId. */ + public federatedApplicationClientId: string; + + /** AzureProperties identity. */ + public identity: string; + + /** + * Creates a new AzureProperties instance using the specified properties. + * @param [properties] Properties to set + * @returns AzureProperties instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.IAzureProperties): google.cloud.bigquery.connection.v1.AzureProperties; + + /** + * Encodes the specified AzureProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.AzureProperties.verify|verify} messages. + * @param message AzureProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.IAzureProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified AzureProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.AzureProperties.verify|verify} messages. + * @param message AzureProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.IAzureProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an AzureProperties message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns AzureProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.AzureProperties; + + /** + * Decodes an AzureProperties message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns AzureProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.AzureProperties; + + /** + * Verifies an AzureProperties message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an AzureProperties message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns AzureProperties + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.AzureProperties; + + /** + * Creates a plain object from an AzureProperties message. Also converts values to other types if specified. + * @param message AzureProperties + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.AzureProperties, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this AzureProperties to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for AzureProperties + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a CloudResourceProperties. */ + interface ICloudResourceProperties { + + /** CloudResourceProperties serviceAccountId */ + serviceAccountId?: (string|null); + } + + /** Represents a CloudResourceProperties. */ + class CloudResourceProperties implements ICloudResourceProperties { + + /** + * Constructs a new CloudResourceProperties. + * @param [properties] Properties to set + */ + constructor(properties?: google.cloud.bigquery.connection.v1.ICloudResourceProperties); + + /** CloudResourceProperties serviceAccountId. */ + public serviceAccountId: string; + + /** + * Creates a new CloudResourceProperties instance using the specified properties. + * @param [properties] Properties to set + * @returns CloudResourceProperties instance + */ + public static create(properties?: google.cloud.bigquery.connection.v1.ICloudResourceProperties): google.cloud.bigquery.connection.v1.CloudResourceProperties; + + /** + * Encodes the specified CloudResourceProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudResourceProperties.verify|verify} messages. + * @param message CloudResourceProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.cloud.bigquery.connection.v1.ICloudResourceProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified CloudResourceProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudResourceProperties.verify|verify} messages. + * @param message CloudResourceProperties message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.cloud.bigquery.connection.v1.ICloudResourceProperties, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a CloudResourceProperties message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns CloudResourceProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.cloud.bigquery.connection.v1.CloudResourceProperties; + + /** + * Decodes a CloudResourceProperties message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns CloudResourceProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.cloud.bigquery.connection.v1.CloudResourceProperties; + + /** + * Verifies a CloudResourceProperties message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a CloudResourceProperties message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns CloudResourceProperties + */ + public static fromObject(object: { [k: string]: any }): google.cloud.bigquery.connection.v1.CloudResourceProperties; + + /** + * Creates a plain object from a CloudResourceProperties message. Also converts values to other types if specified. + * @param message CloudResourceProperties + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.cloud.bigquery.connection.v1.CloudResourceProperties, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this CloudResourceProperties to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for CloudResourceProperties + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + } + } + } + } + + /** Namespace api. */ + namespace api { + + /** Properties of a Http. */ + interface IHttp { + + /** Http rules */ + rules?: (google.api.IHttpRule[]|null); + + /** Http fullyDecodeReservedExpansion */ + fullyDecodeReservedExpansion?: (boolean|null); + } + + /** Represents a Http. */ + class Http implements IHttp { + + /** + * Constructs a new Http. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.IHttp); + + /** Http rules. */ + public rules: google.api.IHttpRule[]; + + /** Http fullyDecodeReservedExpansion. */ + public fullyDecodeReservedExpansion: boolean; + + /** + * Creates a new Http instance using the specified properties. + * @param [properties] Properties to set + * @returns Http instance + */ + public static create(properties?: google.api.IHttp): google.api.Http; + + /** + * Encodes the specified Http message. Does not implicitly {@link google.api.Http.verify|verify} messages. + * @param message Http message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.IHttp, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Http message, length delimited. Does not implicitly {@link google.api.Http.verify|verify} messages. + * @param message Http message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.IHttp, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Http message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Http + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.Http; + + /** + * Decodes a Http message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Http + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.Http; + + /** + * Verifies a Http message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Http message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Http + */ + public static fromObject(object: { [k: string]: any }): google.api.Http; + + /** + * Creates a plain object from a Http message. Also converts values to other types if specified. + * @param message Http + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.Http, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Http to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Http + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a HttpRule. */ + interface IHttpRule { + + /** HttpRule selector */ + selector?: (string|null); + + /** HttpRule get */ + get?: (string|null); + + /** HttpRule put */ + put?: (string|null); + + /** HttpRule post */ + post?: (string|null); + + /** HttpRule delete */ + "delete"?: (string|null); + + /** HttpRule patch */ + patch?: (string|null); + + /** HttpRule custom */ + custom?: (google.api.ICustomHttpPattern|null); + + /** HttpRule body */ + body?: (string|null); + + /** HttpRule responseBody */ + responseBody?: (string|null); + + /** HttpRule additionalBindings */ + additionalBindings?: (google.api.IHttpRule[]|null); + } + + /** Represents a HttpRule. */ + class HttpRule implements IHttpRule { + + /** + * Constructs a new HttpRule. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.IHttpRule); + + /** HttpRule selector. */ + public selector: string; + + /** HttpRule get. */ + public get?: (string|null); + + /** HttpRule put. */ + public put?: (string|null); + + /** HttpRule post. */ + public post?: (string|null); + + /** HttpRule delete. */ + public delete?: (string|null); + + /** HttpRule patch. */ + public patch?: (string|null); + + /** HttpRule custom. */ + public custom?: (google.api.ICustomHttpPattern|null); + + /** HttpRule body. */ + public body: string; + + /** HttpRule responseBody. */ + public responseBody: string; + + /** HttpRule additionalBindings. */ + public additionalBindings: google.api.IHttpRule[]; + + /** HttpRule pattern. */ + public pattern?: ("get"|"put"|"post"|"delete"|"patch"|"custom"); + + /** + * Creates a new HttpRule instance using the specified properties. + * @param [properties] Properties to set + * @returns HttpRule instance + */ + public static create(properties?: google.api.IHttpRule): google.api.HttpRule; + + /** + * Encodes the specified HttpRule message. Does not implicitly {@link google.api.HttpRule.verify|verify} messages. + * @param message HttpRule message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.IHttpRule, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified HttpRule message, length delimited. Does not implicitly {@link google.api.HttpRule.verify|verify} messages. + * @param message HttpRule message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.IHttpRule, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a HttpRule message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns HttpRule + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.HttpRule; + + /** + * Decodes a HttpRule message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns HttpRule + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.HttpRule; + + /** + * Verifies a HttpRule message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a HttpRule message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns HttpRule + */ + public static fromObject(object: { [k: string]: any }): google.api.HttpRule; + + /** + * Creates a plain object from a HttpRule message. Also converts values to other types if specified. + * @param message HttpRule + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.HttpRule, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this HttpRule to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for HttpRule + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a CustomHttpPattern. */ + interface ICustomHttpPattern { + + /** CustomHttpPattern kind */ + kind?: (string|null); + + /** CustomHttpPattern path */ + path?: (string|null); + } + + /** Represents a CustomHttpPattern. */ + class CustomHttpPattern implements ICustomHttpPattern { + + /** + * Constructs a new CustomHttpPattern. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.ICustomHttpPattern); + + /** CustomHttpPattern kind. */ + public kind: string; + + /** CustomHttpPattern path. */ + public path: string; + + /** + * Creates a new CustomHttpPattern instance using the specified properties. + * @param [properties] Properties to set + * @returns CustomHttpPattern instance + */ + public static create(properties?: google.api.ICustomHttpPattern): google.api.CustomHttpPattern; + + /** + * Encodes the specified CustomHttpPattern message. Does not implicitly {@link google.api.CustomHttpPattern.verify|verify} messages. + * @param message CustomHttpPattern message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.ICustomHttpPattern, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified CustomHttpPattern message, length delimited. Does not implicitly {@link google.api.CustomHttpPattern.verify|verify} messages. + * @param message CustomHttpPattern message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.ICustomHttpPattern, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a CustomHttpPattern message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns CustomHttpPattern + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.CustomHttpPattern; + + /** + * Decodes a CustomHttpPattern message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns CustomHttpPattern + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.CustomHttpPattern; + + /** + * Verifies a CustomHttpPattern message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a CustomHttpPattern message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns CustomHttpPattern + */ + public static fromObject(object: { [k: string]: any }): google.api.CustomHttpPattern; + + /** + * Creates a plain object from a CustomHttpPattern message. Also converts values to other types if specified. + * @param message CustomHttpPattern + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.CustomHttpPattern, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this CustomHttpPattern to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for CustomHttpPattern + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** FieldBehavior enum. */ + enum FieldBehavior { + FIELD_BEHAVIOR_UNSPECIFIED = 0, + OPTIONAL = 1, + REQUIRED = 2, + OUTPUT_ONLY = 3, + INPUT_ONLY = 4, + IMMUTABLE = 5, + UNORDERED_LIST = 6, + NON_EMPTY_DEFAULT = 7 + } + + /** Properties of a ResourceDescriptor. */ + interface IResourceDescriptor { + + /** ResourceDescriptor type */ + type?: (string|null); + + /** ResourceDescriptor pattern */ + pattern?: (string[]|null); + + /** ResourceDescriptor nameField */ + nameField?: (string|null); + + /** ResourceDescriptor history */ + history?: (google.api.ResourceDescriptor.History|keyof typeof google.api.ResourceDescriptor.History|null); + + /** ResourceDescriptor plural */ + plural?: (string|null); + + /** ResourceDescriptor singular */ + singular?: (string|null); + + /** ResourceDescriptor style */ + style?: (google.api.ResourceDescriptor.Style[]|null); + } + + /** Represents a ResourceDescriptor. */ + class ResourceDescriptor implements IResourceDescriptor { + + /** + * Constructs a new ResourceDescriptor. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.IResourceDescriptor); + + /** ResourceDescriptor type. */ + public type: string; + + /** ResourceDescriptor pattern. */ + public pattern: string[]; + + /** ResourceDescriptor nameField. */ + public nameField: string; + + /** ResourceDescriptor history. */ + public history: (google.api.ResourceDescriptor.History|keyof typeof google.api.ResourceDescriptor.History); + + /** ResourceDescriptor plural. */ + public plural: string; + + /** ResourceDescriptor singular. */ + public singular: string; + + /** ResourceDescriptor style. */ + public style: google.api.ResourceDescriptor.Style[]; + + /** + * Creates a new ResourceDescriptor instance using the specified properties. + * @param [properties] Properties to set + * @returns ResourceDescriptor instance + */ + public static create(properties?: google.api.IResourceDescriptor): google.api.ResourceDescriptor; + + /** + * Encodes the specified ResourceDescriptor message. Does not implicitly {@link google.api.ResourceDescriptor.verify|verify} messages. + * @param message ResourceDescriptor message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.IResourceDescriptor, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ResourceDescriptor message, length delimited. Does not implicitly {@link google.api.ResourceDescriptor.verify|verify} messages. + * @param message ResourceDescriptor message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.IResourceDescriptor, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ResourceDescriptor message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ResourceDescriptor + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.ResourceDescriptor; + + /** + * Decodes a ResourceDescriptor message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ResourceDescriptor + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.ResourceDescriptor; + + /** + * Verifies a ResourceDescriptor message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ResourceDescriptor message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ResourceDescriptor + */ + public static fromObject(object: { [k: string]: any }): google.api.ResourceDescriptor; + + /** + * Creates a plain object from a ResourceDescriptor message. Also converts values to other types if specified. + * @param message ResourceDescriptor + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.ResourceDescriptor, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ResourceDescriptor to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ResourceDescriptor + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace ResourceDescriptor { + + /** History enum. */ + enum History { + HISTORY_UNSPECIFIED = 0, + ORIGINALLY_SINGLE_PATTERN = 1, + FUTURE_MULTI_PATTERN = 2 + } + + /** Style enum. */ + enum Style { + STYLE_UNSPECIFIED = 0, + DECLARATIVE_FRIENDLY = 1 + } + } + + /** Properties of a ResourceReference. */ + interface IResourceReference { + + /** ResourceReference type */ + type?: (string|null); + + /** ResourceReference childType */ + childType?: (string|null); + } + + /** Represents a ResourceReference. */ + class ResourceReference implements IResourceReference { + + /** + * Constructs a new ResourceReference. + * @param [properties] Properties to set + */ + constructor(properties?: google.api.IResourceReference); + + /** ResourceReference type. */ + public type: string; + + /** ResourceReference childType. */ + public childType: string; + + /** + * Creates a new ResourceReference instance using the specified properties. + * @param [properties] Properties to set + * @returns ResourceReference instance + */ + public static create(properties?: google.api.IResourceReference): google.api.ResourceReference; + + /** + * Encodes the specified ResourceReference message. Does not implicitly {@link google.api.ResourceReference.verify|verify} messages. + * @param message ResourceReference message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.api.IResourceReference, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ResourceReference message, length delimited. Does not implicitly {@link google.api.ResourceReference.verify|verify} messages. + * @param message ResourceReference message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.api.IResourceReference, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ResourceReference message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ResourceReference + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.api.ResourceReference; + + /** + * Decodes a ResourceReference message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ResourceReference + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.api.ResourceReference; + + /** + * Verifies a ResourceReference message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ResourceReference message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ResourceReference + */ + public static fromObject(object: { [k: string]: any }): google.api.ResourceReference; + + /** + * Creates a plain object from a ResourceReference message. Also converts values to other types if specified. + * @param message ResourceReference + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.api.ResourceReference, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ResourceReference to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ResourceReference + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + } + + /** Namespace protobuf. */ + namespace protobuf { + + /** Properties of a FileDescriptorSet. */ + interface IFileDescriptorSet { + + /** FileDescriptorSet file */ + file?: (google.protobuf.IFileDescriptorProto[]|null); + } + + /** Represents a FileDescriptorSet. */ + class FileDescriptorSet implements IFileDescriptorSet { + + /** + * Constructs a new FileDescriptorSet. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFileDescriptorSet); + + /** FileDescriptorSet file. */ + public file: google.protobuf.IFileDescriptorProto[]; + + /** + * Creates a new FileDescriptorSet instance using the specified properties. + * @param [properties] Properties to set + * @returns FileDescriptorSet instance + */ + public static create(properties?: google.protobuf.IFileDescriptorSet): google.protobuf.FileDescriptorSet; + + /** + * Encodes the specified FileDescriptorSet message. Does not implicitly {@link google.protobuf.FileDescriptorSet.verify|verify} messages. + * @param message FileDescriptorSet message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFileDescriptorSet, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FileDescriptorSet message, length delimited. Does not implicitly {@link google.protobuf.FileDescriptorSet.verify|verify} messages. + * @param message FileDescriptorSet message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFileDescriptorSet, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FileDescriptorSet message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FileDescriptorSet + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FileDescriptorSet; + + /** + * Decodes a FileDescriptorSet message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FileDescriptorSet + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FileDescriptorSet; + + /** + * Verifies a FileDescriptorSet message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FileDescriptorSet message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FileDescriptorSet + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FileDescriptorSet; + + /** + * Creates a plain object from a FileDescriptorSet message. Also converts values to other types if specified. + * @param message FileDescriptorSet + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FileDescriptorSet, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FileDescriptorSet to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FileDescriptorSet + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a FileDescriptorProto. */ + interface IFileDescriptorProto { + + /** FileDescriptorProto name */ + name?: (string|null); + + /** FileDescriptorProto package */ + "package"?: (string|null); + + /** FileDescriptorProto dependency */ + dependency?: (string[]|null); + + /** FileDescriptorProto publicDependency */ + publicDependency?: (number[]|null); + + /** FileDescriptorProto weakDependency */ + weakDependency?: (number[]|null); + + /** FileDescriptorProto messageType */ + messageType?: (google.protobuf.IDescriptorProto[]|null); + + /** FileDescriptorProto enumType */ + enumType?: (google.protobuf.IEnumDescriptorProto[]|null); + + /** FileDescriptorProto service */ + service?: (google.protobuf.IServiceDescriptorProto[]|null); + + /** FileDescriptorProto extension */ + extension?: (google.protobuf.IFieldDescriptorProto[]|null); + + /** FileDescriptorProto options */ + options?: (google.protobuf.IFileOptions|null); + + /** FileDescriptorProto sourceCodeInfo */ + sourceCodeInfo?: (google.protobuf.ISourceCodeInfo|null); + + /** FileDescriptorProto syntax */ + syntax?: (string|null); + + /** FileDescriptorProto edition */ + edition?: (string|null); + } + + /** Represents a FileDescriptorProto. */ + class FileDescriptorProto implements IFileDescriptorProto { + + /** + * Constructs a new FileDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFileDescriptorProto); + + /** FileDescriptorProto name. */ + public name: string; + + /** FileDescriptorProto package. */ + public package: string; + + /** FileDescriptorProto dependency. */ + public dependency: string[]; + + /** FileDescriptorProto publicDependency. */ + public publicDependency: number[]; + + /** FileDescriptorProto weakDependency. */ + public weakDependency: number[]; + + /** FileDescriptorProto messageType. */ + public messageType: google.protobuf.IDescriptorProto[]; + + /** FileDescriptorProto enumType. */ + public enumType: google.protobuf.IEnumDescriptorProto[]; + + /** FileDescriptorProto service. */ + public service: google.protobuf.IServiceDescriptorProto[]; + + /** FileDescriptorProto extension. */ + public extension: google.protobuf.IFieldDescriptorProto[]; + + /** FileDescriptorProto options. */ + public options?: (google.protobuf.IFileOptions|null); + + /** FileDescriptorProto sourceCodeInfo. */ + public sourceCodeInfo?: (google.protobuf.ISourceCodeInfo|null); + + /** FileDescriptorProto syntax. */ + public syntax: string; + + /** FileDescriptorProto edition. */ + public edition: string; + + /** + * Creates a new FileDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns FileDescriptorProto instance + */ + public static create(properties?: google.protobuf.IFileDescriptorProto): google.protobuf.FileDescriptorProto; + + /** + * Encodes the specified FileDescriptorProto message. Does not implicitly {@link google.protobuf.FileDescriptorProto.verify|verify} messages. + * @param message FileDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFileDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FileDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.FileDescriptorProto.verify|verify} messages. + * @param message FileDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFileDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FileDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FileDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FileDescriptorProto; + + /** + * Decodes a FileDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FileDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FileDescriptorProto; + + /** + * Verifies a FileDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FileDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FileDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FileDescriptorProto; + + /** + * Creates a plain object from a FileDescriptorProto message. Also converts values to other types if specified. + * @param message FileDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FileDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FileDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FileDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a DescriptorProto. */ + interface IDescriptorProto { + + /** DescriptorProto name */ + name?: (string|null); + + /** DescriptorProto field */ + field?: (google.protobuf.IFieldDescriptorProto[]|null); + + /** DescriptorProto extension */ + extension?: (google.protobuf.IFieldDescriptorProto[]|null); + + /** DescriptorProto nestedType */ + nestedType?: (google.protobuf.IDescriptorProto[]|null); + + /** DescriptorProto enumType */ + enumType?: (google.protobuf.IEnumDescriptorProto[]|null); + + /** DescriptorProto extensionRange */ + extensionRange?: (google.protobuf.DescriptorProto.IExtensionRange[]|null); + + /** DescriptorProto oneofDecl */ + oneofDecl?: (google.protobuf.IOneofDescriptorProto[]|null); + + /** DescriptorProto options */ + options?: (google.protobuf.IMessageOptions|null); + + /** DescriptorProto reservedRange */ + reservedRange?: (google.protobuf.DescriptorProto.IReservedRange[]|null); + + /** DescriptorProto reservedName */ + reservedName?: (string[]|null); + } + + /** Represents a DescriptorProto. */ + class DescriptorProto implements IDescriptorProto { + + /** + * Constructs a new DescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IDescriptorProto); + + /** DescriptorProto name. */ + public name: string; + + /** DescriptorProto field. */ + public field: google.protobuf.IFieldDescriptorProto[]; + + /** DescriptorProto extension. */ + public extension: google.protobuf.IFieldDescriptorProto[]; + + /** DescriptorProto nestedType. */ + public nestedType: google.protobuf.IDescriptorProto[]; + + /** DescriptorProto enumType. */ + public enumType: google.protobuf.IEnumDescriptorProto[]; + + /** DescriptorProto extensionRange. */ + public extensionRange: google.protobuf.DescriptorProto.IExtensionRange[]; + + /** DescriptorProto oneofDecl. */ + public oneofDecl: google.protobuf.IOneofDescriptorProto[]; + + /** DescriptorProto options. */ + public options?: (google.protobuf.IMessageOptions|null); + + /** DescriptorProto reservedRange. */ + public reservedRange: google.protobuf.DescriptorProto.IReservedRange[]; + + /** DescriptorProto reservedName. */ + public reservedName: string[]; + + /** + * Creates a new DescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns DescriptorProto instance + */ + public static create(properties?: google.protobuf.IDescriptorProto): google.protobuf.DescriptorProto; + + /** + * Encodes the specified DescriptorProto message. Does not implicitly {@link google.protobuf.DescriptorProto.verify|verify} messages. + * @param message DescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified DescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.verify|verify} messages. + * @param message DescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a DescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns DescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.DescriptorProto; + + /** + * Decodes a DescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns DescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.DescriptorProto; + + /** + * Verifies a DescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a DescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns DescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.DescriptorProto; + + /** + * Creates a plain object from a DescriptorProto message. Also converts values to other types if specified. + * @param message DescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.DescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this DescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for DescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace DescriptorProto { + + /** Properties of an ExtensionRange. */ + interface IExtensionRange { + + /** ExtensionRange start */ + start?: (number|null); + + /** ExtensionRange end */ + end?: (number|null); + + /** ExtensionRange options */ + options?: (google.protobuf.IExtensionRangeOptions|null); + } + + /** Represents an ExtensionRange. */ + class ExtensionRange implements IExtensionRange { + + /** + * Constructs a new ExtensionRange. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.DescriptorProto.IExtensionRange); + + /** ExtensionRange start. */ + public start: number; + + /** ExtensionRange end. */ + public end: number; + + /** ExtensionRange options. */ + public options?: (google.protobuf.IExtensionRangeOptions|null); + + /** + * Creates a new ExtensionRange instance using the specified properties. + * @param [properties] Properties to set + * @returns ExtensionRange instance + */ + public static create(properties?: google.protobuf.DescriptorProto.IExtensionRange): google.protobuf.DescriptorProto.ExtensionRange; + + /** + * Encodes the specified ExtensionRange message. Does not implicitly {@link google.protobuf.DescriptorProto.ExtensionRange.verify|verify} messages. + * @param message ExtensionRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.DescriptorProto.IExtensionRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ExtensionRange message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.ExtensionRange.verify|verify} messages. + * @param message ExtensionRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.DescriptorProto.IExtensionRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an ExtensionRange message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ExtensionRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.DescriptorProto.ExtensionRange; + + /** + * Decodes an ExtensionRange message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ExtensionRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.DescriptorProto.ExtensionRange; + + /** + * Verifies an ExtensionRange message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an ExtensionRange message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ExtensionRange + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.DescriptorProto.ExtensionRange; + + /** + * Creates a plain object from an ExtensionRange message. Also converts values to other types if specified. + * @param message ExtensionRange + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.DescriptorProto.ExtensionRange, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ExtensionRange to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ExtensionRange + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a ReservedRange. */ + interface IReservedRange { + + /** ReservedRange start */ + start?: (number|null); + + /** ReservedRange end */ + end?: (number|null); + } + + /** Represents a ReservedRange. */ + class ReservedRange implements IReservedRange { + + /** + * Constructs a new ReservedRange. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.DescriptorProto.IReservedRange); + + /** ReservedRange start. */ + public start: number; + + /** ReservedRange end. */ + public end: number; + + /** + * Creates a new ReservedRange instance using the specified properties. + * @param [properties] Properties to set + * @returns ReservedRange instance + */ + public static create(properties?: google.protobuf.DescriptorProto.IReservedRange): google.protobuf.DescriptorProto.ReservedRange; + + /** + * Encodes the specified ReservedRange message. Does not implicitly {@link google.protobuf.DescriptorProto.ReservedRange.verify|verify} messages. + * @param message ReservedRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.DescriptorProto.IReservedRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ReservedRange message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.ReservedRange.verify|verify} messages. + * @param message ReservedRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.DescriptorProto.IReservedRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ReservedRange message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.DescriptorProto.ReservedRange; + + /** + * Decodes a ReservedRange message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.DescriptorProto.ReservedRange; + + /** + * Verifies a ReservedRange message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ReservedRange message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ReservedRange + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.DescriptorProto.ReservedRange; + + /** + * Creates a plain object from a ReservedRange message. Also converts values to other types if specified. + * @param message ReservedRange + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.DescriptorProto.ReservedRange, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ReservedRange to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ReservedRange + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + } + + /** Properties of an ExtensionRangeOptions. */ + interface IExtensionRangeOptions { + + /** ExtensionRangeOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + } + + /** Represents an ExtensionRangeOptions. */ + class ExtensionRangeOptions implements IExtensionRangeOptions { + + /** + * Constructs a new ExtensionRangeOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IExtensionRangeOptions); + + /** ExtensionRangeOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new ExtensionRangeOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns ExtensionRangeOptions instance + */ + public static create(properties?: google.protobuf.IExtensionRangeOptions): google.protobuf.ExtensionRangeOptions; + + /** + * Encodes the specified ExtensionRangeOptions message. Does not implicitly {@link google.protobuf.ExtensionRangeOptions.verify|verify} messages. + * @param message ExtensionRangeOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IExtensionRangeOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ExtensionRangeOptions message, length delimited. Does not implicitly {@link google.protobuf.ExtensionRangeOptions.verify|verify} messages. + * @param message ExtensionRangeOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IExtensionRangeOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an ExtensionRangeOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ExtensionRangeOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.ExtensionRangeOptions; + + /** + * Decodes an ExtensionRangeOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ExtensionRangeOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.ExtensionRangeOptions; + + /** + * Verifies an ExtensionRangeOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an ExtensionRangeOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ExtensionRangeOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.ExtensionRangeOptions; + + /** + * Creates a plain object from an ExtensionRangeOptions message. Also converts values to other types if specified. + * @param message ExtensionRangeOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.ExtensionRangeOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ExtensionRangeOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ExtensionRangeOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a FieldDescriptorProto. */ + interface IFieldDescriptorProto { + + /** FieldDescriptorProto name */ + name?: (string|null); + + /** FieldDescriptorProto number */ + number?: (number|null); + + /** FieldDescriptorProto label */ + label?: (google.protobuf.FieldDescriptorProto.Label|keyof typeof google.protobuf.FieldDescriptorProto.Label|null); + + /** FieldDescriptorProto type */ + type?: (google.protobuf.FieldDescriptorProto.Type|keyof typeof google.protobuf.FieldDescriptorProto.Type|null); + + /** FieldDescriptorProto typeName */ + typeName?: (string|null); + + /** FieldDescriptorProto extendee */ + extendee?: (string|null); + + /** FieldDescriptorProto defaultValue */ + defaultValue?: (string|null); + + /** FieldDescriptorProto oneofIndex */ + oneofIndex?: (number|null); + + /** FieldDescriptorProto jsonName */ + jsonName?: (string|null); + + /** FieldDescriptorProto options */ + options?: (google.protobuf.IFieldOptions|null); + + /** FieldDescriptorProto proto3Optional */ + proto3Optional?: (boolean|null); + } + + /** Represents a FieldDescriptorProto. */ + class FieldDescriptorProto implements IFieldDescriptorProto { + + /** + * Constructs a new FieldDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFieldDescriptorProto); + + /** FieldDescriptorProto name. */ + public name: string; + + /** FieldDescriptorProto number. */ + public number: number; + + /** FieldDescriptorProto label. */ + public label: (google.protobuf.FieldDescriptorProto.Label|keyof typeof google.protobuf.FieldDescriptorProto.Label); + + /** FieldDescriptorProto type. */ + public type: (google.protobuf.FieldDescriptorProto.Type|keyof typeof google.protobuf.FieldDescriptorProto.Type); + + /** FieldDescriptorProto typeName. */ + public typeName: string; + + /** FieldDescriptorProto extendee. */ + public extendee: string; + + /** FieldDescriptorProto defaultValue. */ + public defaultValue: string; + + /** FieldDescriptorProto oneofIndex. */ + public oneofIndex: number; + + /** FieldDescriptorProto jsonName. */ + public jsonName: string; + + /** FieldDescriptorProto options. */ + public options?: (google.protobuf.IFieldOptions|null); + + /** FieldDescriptorProto proto3Optional. */ + public proto3Optional: boolean; + + /** + * Creates a new FieldDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns FieldDescriptorProto instance + */ + public static create(properties?: google.protobuf.IFieldDescriptorProto): google.protobuf.FieldDescriptorProto; + + /** + * Encodes the specified FieldDescriptorProto message. Does not implicitly {@link google.protobuf.FieldDescriptorProto.verify|verify} messages. + * @param message FieldDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFieldDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FieldDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.FieldDescriptorProto.verify|verify} messages. + * @param message FieldDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFieldDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FieldDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FieldDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FieldDescriptorProto; + + /** + * Decodes a FieldDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FieldDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FieldDescriptorProto; + + /** + * Verifies a FieldDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FieldDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FieldDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FieldDescriptorProto; + + /** + * Creates a plain object from a FieldDescriptorProto message. Also converts values to other types if specified. + * @param message FieldDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FieldDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FieldDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FieldDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace FieldDescriptorProto { + + /** Type enum. */ + enum Type { + TYPE_DOUBLE = 1, + TYPE_FLOAT = 2, + TYPE_INT64 = 3, + TYPE_UINT64 = 4, + TYPE_INT32 = 5, + TYPE_FIXED64 = 6, + TYPE_FIXED32 = 7, + TYPE_BOOL = 8, + TYPE_STRING = 9, + TYPE_GROUP = 10, + TYPE_MESSAGE = 11, + TYPE_BYTES = 12, + TYPE_UINT32 = 13, + TYPE_ENUM = 14, + TYPE_SFIXED32 = 15, + TYPE_SFIXED64 = 16, + TYPE_SINT32 = 17, + TYPE_SINT64 = 18 + } + + /** Label enum. */ + enum Label { + LABEL_OPTIONAL = 1, + LABEL_REQUIRED = 2, + LABEL_REPEATED = 3 + } + } + + /** Properties of an OneofDescriptorProto. */ + interface IOneofDescriptorProto { + + /** OneofDescriptorProto name */ + name?: (string|null); + + /** OneofDescriptorProto options */ + options?: (google.protobuf.IOneofOptions|null); + } + + /** Represents an OneofDescriptorProto. */ + class OneofDescriptorProto implements IOneofDescriptorProto { + + /** + * Constructs a new OneofDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IOneofDescriptorProto); + + /** OneofDescriptorProto name. */ + public name: string; + + /** OneofDescriptorProto options. */ + public options?: (google.protobuf.IOneofOptions|null); + + /** + * Creates a new OneofDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns OneofDescriptorProto instance + */ + public static create(properties?: google.protobuf.IOneofDescriptorProto): google.protobuf.OneofDescriptorProto; + + /** + * Encodes the specified OneofDescriptorProto message. Does not implicitly {@link google.protobuf.OneofDescriptorProto.verify|verify} messages. + * @param message OneofDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IOneofDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified OneofDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.OneofDescriptorProto.verify|verify} messages. + * @param message OneofDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IOneofDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an OneofDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns OneofDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.OneofDescriptorProto; + + /** + * Decodes an OneofDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns OneofDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.OneofDescriptorProto; + + /** + * Verifies an OneofDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an OneofDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns OneofDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.OneofDescriptorProto; + + /** + * Creates a plain object from an OneofDescriptorProto message. Also converts values to other types if specified. + * @param message OneofDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.OneofDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this OneofDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for OneofDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an EnumDescriptorProto. */ + interface IEnumDescriptorProto { + + /** EnumDescriptorProto name */ + name?: (string|null); + + /** EnumDescriptorProto value */ + value?: (google.protobuf.IEnumValueDescriptorProto[]|null); + + /** EnumDescriptorProto options */ + options?: (google.protobuf.IEnumOptions|null); + + /** EnumDescriptorProto reservedRange */ + reservedRange?: (google.protobuf.EnumDescriptorProto.IEnumReservedRange[]|null); + + /** EnumDescriptorProto reservedName */ + reservedName?: (string[]|null); + } + + /** Represents an EnumDescriptorProto. */ + class EnumDescriptorProto implements IEnumDescriptorProto { + + /** + * Constructs a new EnumDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IEnumDescriptorProto); + + /** EnumDescriptorProto name. */ + public name: string; + + /** EnumDescriptorProto value. */ + public value: google.protobuf.IEnumValueDescriptorProto[]; + + /** EnumDescriptorProto options. */ + public options?: (google.protobuf.IEnumOptions|null); + + /** EnumDescriptorProto reservedRange. */ + public reservedRange: google.protobuf.EnumDescriptorProto.IEnumReservedRange[]; + + /** EnumDescriptorProto reservedName. */ + public reservedName: string[]; + + /** + * Creates a new EnumDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumDescriptorProto instance + */ + public static create(properties?: google.protobuf.IEnumDescriptorProto): google.protobuf.EnumDescriptorProto; + + /** + * Encodes the specified EnumDescriptorProto message. Does not implicitly {@link google.protobuf.EnumDescriptorProto.verify|verify} messages. + * @param message EnumDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IEnumDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.EnumDescriptorProto.verify|verify} messages. + * @param message EnumDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IEnumDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumDescriptorProto; + + /** + * Decodes an EnumDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumDescriptorProto; + + /** + * Verifies an EnumDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumDescriptorProto; + + /** + * Creates a plain object from an EnumDescriptorProto message. Also converts values to other types if specified. + * @param message EnumDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace EnumDescriptorProto { + + /** Properties of an EnumReservedRange. */ + interface IEnumReservedRange { + + /** EnumReservedRange start */ + start?: (number|null); + + /** EnumReservedRange end */ + end?: (number|null); + } + + /** Represents an EnumReservedRange. */ + class EnumReservedRange implements IEnumReservedRange { + + /** + * Constructs a new EnumReservedRange. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.EnumDescriptorProto.IEnumReservedRange); + + /** EnumReservedRange start. */ + public start: number; + + /** EnumReservedRange end. */ + public end: number; + + /** + * Creates a new EnumReservedRange instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumReservedRange instance + */ + public static create(properties?: google.protobuf.EnumDescriptorProto.IEnumReservedRange): google.protobuf.EnumDescriptorProto.EnumReservedRange; + + /** + * Encodes the specified EnumReservedRange message. Does not implicitly {@link google.protobuf.EnumDescriptorProto.EnumReservedRange.verify|verify} messages. + * @param message EnumReservedRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.EnumDescriptorProto.IEnumReservedRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumReservedRange message, length delimited. Does not implicitly {@link google.protobuf.EnumDescriptorProto.EnumReservedRange.verify|verify} messages. + * @param message EnumReservedRange message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.EnumDescriptorProto.IEnumReservedRange, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumReservedRange message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumDescriptorProto.EnumReservedRange; + + /** + * Decodes an EnumReservedRange message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumDescriptorProto.EnumReservedRange; + + /** + * Verifies an EnumReservedRange message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumReservedRange message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumReservedRange + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumDescriptorProto.EnumReservedRange; + + /** + * Creates a plain object from an EnumReservedRange message. Also converts values to other types if specified. + * @param message EnumReservedRange + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumDescriptorProto.EnumReservedRange, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumReservedRange to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumReservedRange + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + } + + /** Properties of an EnumValueDescriptorProto. */ + interface IEnumValueDescriptorProto { + + /** EnumValueDescriptorProto name */ + name?: (string|null); + + /** EnumValueDescriptorProto number */ + number?: (number|null); + + /** EnumValueDescriptorProto options */ + options?: (google.protobuf.IEnumValueOptions|null); + } + + /** Represents an EnumValueDescriptorProto. */ + class EnumValueDescriptorProto implements IEnumValueDescriptorProto { + + /** + * Constructs a new EnumValueDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IEnumValueDescriptorProto); + + /** EnumValueDescriptorProto name. */ + public name: string; + + /** EnumValueDescriptorProto number. */ + public number: number; + + /** EnumValueDescriptorProto options. */ + public options?: (google.protobuf.IEnumValueOptions|null); + + /** + * Creates a new EnumValueDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumValueDescriptorProto instance + */ + public static create(properties?: google.protobuf.IEnumValueDescriptorProto): google.protobuf.EnumValueDescriptorProto; + + /** + * Encodes the specified EnumValueDescriptorProto message. Does not implicitly {@link google.protobuf.EnumValueDescriptorProto.verify|verify} messages. + * @param message EnumValueDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IEnumValueDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumValueDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.EnumValueDescriptorProto.verify|verify} messages. + * @param message EnumValueDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IEnumValueDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumValueDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumValueDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumValueDescriptorProto; + + /** + * Decodes an EnumValueDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumValueDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumValueDescriptorProto; + + /** + * Verifies an EnumValueDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumValueDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumValueDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumValueDescriptorProto; + + /** + * Creates a plain object from an EnumValueDescriptorProto message. Also converts values to other types if specified. + * @param message EnumValueDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumValueDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumValueDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumValueDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a ServiceDescriptorProto. */ + interface IServiceDescriptorProto { + + /** ServiceDescriptorProto name */ + name?: (string|null); + + /** ServiceDescriptorProto method */ + method?: (google.protobuf.IMethodDescriptorProto[]|null); + + /** ServiceDescriptorProto options */ + options?: (google.protobuf.IServiceOptions|null); + } + + /** Represents a ServiceDescriptorProto. */ + class ServiceDescriptorProto implements IServiceDescriptorProto { + + /** + * Constructs a new ServiceDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IServiceDescriptorProto); + + /** ServiceDescriptorProto name. */ + public name: string; + + /** ServiceDescriptorProto method. */ + public method: google.protobuf.IMethodDescriptorProto[]; + + /** ServiceDescriptorProto options. */ + public options?: (google.protobuf.IServiceOptions|null); + + /** + * Creates a new ServiceDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns ServiceDescriptorProto instance + */ + public static create(properties?: google.protobuf.IServiceDescriptorProto): google.protobuf.ServiceDescriptorProto; + + /** + * Encodes the specified ServiceDescriptorProto message. Does not implicitly {@link google.protobuf.ServiceDescriptorProto.verify|verify} messages. + * @param message ServiceDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IServiceDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ServiceDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.ServiceDescriptorProto.verify|verify} messages. + * @param message ServiceDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IServiceDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ServiceDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ServiceDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.ServiceDescriptorProto; + + /** + * Decodes a ServiceDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ServiceDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.ServiceDescriptorProto; + + /** + * Verifies a ServiceDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ServiceDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ServiceDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.ServiceDescriptorProto; + + /** + * Creates a plain object from a ServiceDescriptorProto message. Also converts values to other types if specified. + * @param message ServiceDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.ServiceDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ServiceDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ServiceDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a MethodDescriptorProto. */ + interface IMethodDescriptorProto { + + /** MethodDescriptorProto name */ + name?: (string|null); + + /** MethodDescriptorProto inputType */ + inputType?: (string|null); + + /** MethodDescriptorProto outputType */ + outputType?: (string|null); + + /** MethodDescriptorProto options */ + options?: (google.protobuf.IMethodOptions|null); + + /** MethodDescriptorProto clientStreaming */ + clientStreaming?: (boolean|null); + + /** MethodDescriptorProto serverStreaming */ + serverStreaming?: (boolean|null); + } + + /** Represents a MethodDescriptorProto. */ + class MethodDescriptorProto implements IMethodDescriptorProto { + + /** + * Constructs a new MethodDescriptorProto. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IMethodDescriptorProto); + + /** MethodDescriptorProto name. */ + public name: string; + + /** MethodDescriptorProto inputType. */ + public inputType: string; + + /** MethodDescriptorProto outputType. */ + public outputType: string; + + /** MethodDescriptorProto options. */ + public options?: (google.protobuf.IMethodOptions|null); + + /** MethodDescriptorProto clientStreaming. */ + public clientStreaming: boolean; + + /** MethodDescriptorProto serverStreaming. */ + public serverStreaming: boolean; + + /** + * Creates a new MethodDescriptorProto instance using the specified properties. + * @param [properties] Properties to set + * @returns MethodDescriptorProto instance + */ + public static create(properties?: google.protobuf.IMethodDescriptorProto): google.protobuf.MethodDescriptorProto; + + /** + * Encodes the specified MethodDescriptorProto message. Does not implicitly {@link google.protobuf.MethodDescriptorProto.verify|verify} messages. + * @param message MethodDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IMethodDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified MethodDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.MethodDescriptorProto.verify|verify} messages. + * @param message MethodDescriptorProto message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IMethodDescriptorProto, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a MethodDescriptorProto message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns MethodDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.MethodDescriptorProto; + + /** + * Decodes a MethodDescriptorProto message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns MethodDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.MethodDescriptorProto; + + /** + * Verifies a MethodDescriptorProto message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a MethodDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns MethodDescriptorProto + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.MethodDescriptorProto; + + /** + * Creates a plain object from a MethodDescriptorProto message. Also converts values to other types if specified. + * @param message MethodDescriptorProto + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.MethodDescriptorProto, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this MethodDescriptorProto to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for MethodDescriptorProto + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a FileOptions. */ + interface IFileOptions { + + /** FileOptions javaPackage */ + javaPackage?: (string|null); + + /** FileOptions javaOuterClassname */ + javaOuterClassname?: (string|null); + + /** FileOptions javaMultipleFiles */ + javaMultipleFiles?: (boolean|null); + + /** FileOptions javaGenerateEqualsAndHash */ + javaGenerateEqualsAndHash?: (boolean|null); + + /** FileOptions javaStringCheckUtf8 */ + javaStringCheckUtf8?: (boolean|null); + + /** FileOptions optimizeFor */ + optimizeFor?: (google.protobuf.FileOptions.OptimizeMode|keyof typeof google.protobuf.FileOptions.OptimizeMode|null); + + /** FileOptions goPackage */ + goPackage?: (string|null); + + /** FileOptions ccGenericServices */ + ccGenericServices?: (boolean|null); + + /** FileOptions javaGenericServices */ + javaGenericServices?: (boolean|null); + + /** FileOptions pyGenericServices */ + pyGenericServices?: (boolean|null); + + /** FileOptions phpGenericServices */ + phpGenericServices?: (boolean|null); + + /** FileOptions deprecated */ + deprecated?: (boolean|null); + + /** FileOptions ccEnableArenas */ + ccEnableArenas?: (boolean|null); + + /** FileOptions objcClassPrefix */ + objcClassPrefix?: (string|null); + + /** FileOptions csharpNamespace */ + csharpNamespace?: (string|null); + + /** FileOptions swiftPrefix */ + swiftPrefix?: (string|null); + + /** FileOptions phpClassPrefix */ + phpClassPrefix?: (string|null); + + /** FileOptions phpNamespace */ + phpNamespace?: (string|null); + + /** FileOptions phpMetadataNamespace */ + phpMetadataNamespace?: (string|null); + + /** FileOptions rubyPackage */ + rubyPackage?: (string|null); + + /** FileOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** FileOptions .google.api.resourceDefinition */ + ".google.api.resourceDefinition"?: (google.api.IResourceDescriptor[]|null); + } + + /** Represents a FileOptions. */ + class FileOptions implements IFileOptions { + + /** + * Constructs a new FileOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFileOptions); + + /** FileOptions javaPackage. */ + public javaPackage: string; + + /** FileOptions javaOuterClassname. */ + public javaOuterClassname: string; + + /** FileOptions javaMultipleFiles. */ + public javaMultipleFiles: boolean; + + /** FileOptions javaGenerateEqualsAndHash. */ + public javaGenerateEqualsAndHash: boolean; + + /** FileOptions javaStringCheckUtf8. */ + public javaStringCheckUtf8: boolean; + + /** FileOptions optimizeFor. */ + public optimizeFor: (google.protobuf.FileOptions.OptimizeMode|keyof typeof google.protobuf.FileOptions.OptimizeMode); + + /** FileOptions goPackage. */ + public goPackage: string; + + /** FileOptions ccGenericServices. */ + public ccGenericServices: boolean; + + /** FileOptions javaGenericServices. */ + public javaGenericServices: boolean; + + /** FileOptions pyGenericServices. */ + public pyGenericServices: boolean; + + /** FileOptions phpGenericServices. */ + public phpGenericServices: boolean; + + /** FileOptions deprecated. */ + public deprecated: boolean; + + /** FileOptions ccEnableArenas. */ + public ccEnableArenas: boolean; + + /** FileOptions objcClassPrefix. */ + public objcClassPrefix: string; + + /** FileOptions csharpNamespace. */ + public csharpNamespace: string; + + /** FileOptions swiftPrefix. */ + public swiftPrefix: string; + + /** FileOptions phpClassPrefix. */ + public phpClassPrefix: string; + + /** FileOptions phpNamespace. */ + public phpNamespace: string; + + /** FileOptions phpMetadataNamespace. */ + public phpMetadataNamespace: string; + + /** FileOptions rubyPackage. */ + public rubyPackage: string; + + /** FileOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new FileOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns FileOptions instance + */ + public static create(properties?: google.protobuf.IFileOptions): google.protobuf.FileOptions; + + /** + * Encodes the specified FileOptions message. Does not implicitly {@link google.protobuf.FileOptions.verify|verify} messages. + * @param message FileOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFileOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FileOptions message, length delimited. Does not implicitly {@link google.protobuf.FileOptions.verify|verify} messages. + * @param message FileOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFileOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FileOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FileOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FileOptions; + + /** + * Decodes a FileOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FileOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FileOptions; + + /** + * Verifies a FileOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FileOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FileOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FileOptions; + + /** + * Creates a plain object from a FileOptions message. Also converts values to other types if specified. + * @param message FileOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FileOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FileOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FileOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace FileOptions { + + /** OptimizeMode enum. */ + enum OptimizeMode { + SPEED = 1, + CODE_SIZE = 2, + LITE_RUNTIME = 3 + } + } + + /** Properties of a MessageOptions. */ + interface IMessageOptions { + + /** MessageOptions messageSetWireFormat */ + messageSetWireFormat?: (boolean|null); + + /** MessageOptions noStandardDescriptorAccessor */ + noStandardDescriptorAccessor?: (boolean|null); + + /** MessageOptions deprecated */ + deprecated?: (boolean|null); + + /** MessageOptions mapEntry */ + mapEntry?: (boolean|null); + + /** MessageOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** MessageOptions .google.api.resource */ + ".google.api.resource"?: (google.api.IResourceDescriptor|null); + } + + /** Represents a MessageOptions. */ + class MessageOptions implements IMessageOptions { + + /** + * Constructs a new MessageOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IMessageOptions); + + /** MessageOptions messageSetWireFormat. */ + public messageSetWireFormat: boolean; + + /** MessageOptions noStandardDescriptorAccessor. */ + public noStandardDescriptorAccessor: boolean; + + /** MessageOptions deprecated. */ + public deprecated: boolean; + + /** MessageOptions mapEntry. */ + public mapEntry: boolean; + + /** MessageOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new MessageOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns MessageOptions instance + */ + public static create(properties?: google.protobuf.IMessageOptions): google.protobuf.MessageOptions; + + /** + * Encodes the specified MessageOptions message. Does not implicitly {@link google.protobuf.MessageOptions.verify|verify} messages. + * @param message MessageOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IMessageOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified MessageOptions message, length delimited. Does not implicitly {@link google.protobuf.MessageOptions.verify|verify} messages. + * @param message MessageOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IMessageOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a MessageOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns MessageOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.MessageOptions; + + /** + * Decodes a MessageOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns MessageOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.MessageOptions; + + /** + * Verifies a MessageOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a MessageOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns MessageOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.MessageOptions; + + /** + * Creates a plain object from a MessageOptions message. Also converts values to other types if specified. + * @param message MessageOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.MessageOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this MessageOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for MessageOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a FieldOptions. */ + interface IFieldOptions { + + /** FieldOptions ctype */ + ctype?: (google.protobuf.FieldOptions.CType|keyof typeof google.protobuf.FieldOptions.CType|null); + + /** FieldOptions packed */ + packed?: (boolean|null); + + /** FieldOptions jstype */ + jstype?: (google.protobuf.FieldOptions.JSType|keyof typeof google.protobuf.FieldOptions.JSType|null); + + /** FieldOptions lazy */ + lazy?: (boolean|null); + + /** FieldOptions unverifiedLazy */ + unverifiedLazy?: (boolean|null); + + /** FieldOptions deprecated */ + deprecated?: (boolean|null); + + /** FieldOptions weak */ + weak?: (boolean|null); + + /** FieldOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** FieldOptions .google.api.fieldBehavior */ + ".google.api.fieldBehavior"?: (google.api.FieldBehavior[]|null); + + /** FieldOptions .google.api.resourceReference */ + ".google.api.resourceReference"?: (google.api.IResourceReference|null); + } + + /** Represents a FieldOptions. */ + class FieldOptions implements IFieldOptions { + + /** + * Constructs a new FieldOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFieldOptions); + + /** FieldOptions ctype. */ + public ctype: (google.protobuf.FieldOptions.CType|keyof typeof google.protobuf.FieldOptions.CType); + + /** FieldOptions packed. */ + public packed: boolean; + + /** FieldOptions jstype. */ + public jstype: (google.protobuf.FieldOptions.JSType|keyof typeof google.protobuf.FieldOptions.JSType); + + /** FieldOptions lazy. */ + public lazy: boolean; + + /** FieldOptions unverifiedLazy. */ + public unverifiedLazy: boolean; + + /** FieldOptions deprecated. */ + public deprecated: boolean; + + /** FieldOptions weak. */ + public weak: boolean; + + /** FieldOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new FieldOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns FieldOptions instance + */ + public static create(properties?: google.protobuf.IFieldOptions): google.protobuf.FieldOptions; + + /** + * Encodes the specified FieldOptions message. Does not implicitly {@link google.protobuf.FieldOptions.verify|verify} messages. + * @param message FieldOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFieldOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FieldOptions message, length delimited. Does not implicitly {@link google.protobuf.FieldOptions.verify|verify} messages. + * @param message FieldOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFieldOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FieldOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FieldOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FieldOptions; + + /** + * Decodes a FieldOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FieldOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FieldOptions; + + /** + * Verifies a FieldOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FieldOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FieldOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FieldOptions; + + /** + * Creates a plain object from a FieldOptions message. Also converts values to other types if specified. + * @param message FieldOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FieldOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FieldOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FieldOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace FieldOptions { + + /** CType enum. */ + enum CType { + STRING = 0, + CORD = 1, + STRING_PIECE = 2 + } + + /** JSType enum. */ + enum JSType { + JS_NORMAL = 0, + JS_STRING = 1, + JS_NUMBER = 2 + } + } + + /** Properties of an OneofOptions. */ + interface IOneofOptions { + + /** OneofOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + } + + /** Represents an OneofOptions. */ + class OneofOptions implements IOneofOptions { + + /** + * Constructs a new OneofOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IOneofOptions); + + /** OneofOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new OneofOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns OneofOptions instance + */ + public static create(properties?: google.protobuf.IOneofOptions): google.protobuf.OneofOptions; + + /** + * Encodes the specified OneofOptions message. Does not implicitly {@link google.protobuf.OneofOptions.verify|verify} messages. + * @param message OneofOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IOneofOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified OneofOptions message, length delimited. Does not implicitly {@link google.protobuf.OneofOptions.verify|verify} messages. + * @param message OneofOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IOneofOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an OneofOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns OneofOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.OneofOptions; + + /** + * Decodes an OneofOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns OneofOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.OneofOptions; + + /** + * Verifies an OneofOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an OneofOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns OneofOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.OneofOptions; + + /** + * Creates a plain object from an OneofOptions message. Also converts values to other types if specified. + * @param message OneofOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.OneofOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this OneofOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for OneofOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an EnumOptions. */ + interface IEnumOptions { + + /** EnumOptions allowAlias */ + allowAlias?: (boolean|null); + + /** EnumOptions deprecated */ + deprecated?: (boolean|null); + + /** EnumOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + } + + /** Represents an EnumOptions. */ + class EnumOptions implements IEnumOptions { + + /** + * Constructs a new EnumOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IEnumOptions); + + /** EnumOptions allowAlias. */ + public allowAlias: boolean; + + /** EnumOptions deprecated. */ + public deprecated: boolean; + + /** EnumOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new EnumOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumOptions instance + */ + public static create(properties?: google.protobuf.IEnumOptions): google.protobuf.EnumOptions; + + /** + * Encodes the specified EnumOptions message. Does not implicitly {@link google.protobuf.EnumOptions.verify|verify} messages. + * @param message EnumOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IEnumOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumOptions message, length delimited. Does not implicitly {@link google.protobuf.EnumOptions.verify|verify} messages. + * @param message EnumOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IEnumOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumOptions; + + /** + * Decodes an EnumOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumOptions; + + /** + * Verifies an EnumOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumOptions; + + /** + * Creates a plain object from an EnumOptions message. Also converts values to other types if specified. + * @param message EnumOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an EnumValueOptions. */ + interface IEnumValueOptions { + + /** EnumValueOptions deprecated */ + deprecated?: (boolean|null); + + /** EnumValueOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + } + + /** Represents an EnumValueOptions. */ + class EnumValueOptions implements IEnumValueOptions { + + /** + * Constructs a new EnumValueOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IEnumValueOptions); + + /** EnumValueOptions deprecated. */ + public deprecated: boolean; + + /** EnumValueOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new EnumValueOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns EnumValueOptions instance + */ + public static create(properties?: google.protobuf.IEnumValueOptions): google.protobuf.EnumValueOptions; + + /** + * Encodes the specified EnumValueOptions message. Does not implicitly {@link google.protobuf.EnumValueOptions.verify|verify} messages. + * @param message EnumValueOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IEnumValueOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified EnumValueOptions message, length delimited. Does not implicitly {@link google.protobuf.EnumValueOptions.verify|verify} messages. + * @param message EnumValueOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IEnumValueOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an EnumValueOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns EnumValueOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.EnumValueOptions; + + /** + * Decodes an EnumValueOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns EnumValueOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.EnumValueOptions; + + /** + * Verifies an EnumValueOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an EnumValueOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns EnumValueOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.EnumValueOptions; + + /** + * Creates a plain object from an EnumValueOptions message. Also converts values to other types if specified. + * @param message EnumValueOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.EnumValueOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this EnumValueOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for EnumValueOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a ServiceOptions. */ + interface IServiceOptions { + + /** ServiceOptions deprecated */ + deprecated?: (boolean|null); + + /** ServiceOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** ServiceOptions .google.api.defaultHost */ + ".google.api.defaultHost"?: (string|null); + + /** ServiceOptions .google.api.oauthScopes */ + ".google.api.oauthScopes"?: (string|null); + } + + /** Represents a ServiceOptions. */ + class ServiceOptions implements IServiceOptions { + + /** + * Constructs a new ServiceOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IServiceOptions); + + /** ServiceOptions deprecated. */ + public deprecated: boolean; + + /** ServiceOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new ServiceOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns ServiceOptions instance + */ + public static create(properties?: google.protobuf.IServiceOptions): google.protobuf.ServiceOptions; + + /** + * Encodes the specified ServiceOptions message. Does not implicitly {@link google.protobuf.ServiceOptions.verify|verify} messages. + * @param message ServiceOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IServiceOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified ServiceOptions message, length delimited. Does not implicitly {@link google.protobuf.ServiceOptions.verify|verify} messages. + * @param message ServiceOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IServiceOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a ServiceOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns ServiceOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.ServiceOptions; + + /** + * Decodes a ServiceOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns ServiceOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.ServiceOptions; + + /** + * Verifies a ServiceOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a ServiceOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns ServiceOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.ServiceOptions; + + /** + * Creates a plain object from a ServiceOptions message. Also converts values to other types if specified. + * @param message ServiceOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.ServiceOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this ServiceOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for ServiceOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a MethodOptions. */ + interface IMethodOptions { + + /** MethodOptions deprecated */ + deprecated?: (boolean|null); + + /** MethodOptions idempotencyLevel */ + idempotencyLevel?: (google.protobuf.MethodOptions.IdempotencyLevel|keyof typeof google.protobuf.MethodOptions.IdempotencyLevel|null); + + /** MethodOptions uninterpretedOption */ + uninterpretedOption?: (google.protobuf.IUninterpretedOption[]|null); + + /** MethodOptions .google.api.http */ + ".google.api.http"?: (google.api.IHttpRule|null); + + /** MethodOptions .google.api.methodSignature */ + ".google.api.methodSignature"?: (string[]|null); + } + + /** Represents a MethodOptions. */ + class MethodOptions implements IMethodOptions { + + /** + * Constructs a new MethodOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IMethodOptions); + + /** MethodOptions deprecated. */ + public deprecated: boolean; + + /** MethodOptions idempotencyLevel. */ + public idempotencyLevel: (google.protobuf.MethodOptions.IdempotencyLevel|keyof typeof google.protobuf.MethodOptions.IdempotencyLevel); + + /** MethodOptions uninterpretedOption. */ + public uninterpretedOption: google.protobuf.IUninterpretedOption[]; + + /** + * Creates a new MethodOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns MethodOptions instance + */ + public static create(properties?: google.protobuf.IMethodOptions): google.protobuf.MethodOptions; + + /** + * Encodes the specified MethodOptions message. Does not implicitly {@link google.protobuf.MethodOptions.verify|verify} messages. + * @param message MethodOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IMethodOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified MethodOptions message, length delimited. Does not implicitly {@link google.protobuf.MethodOptions.verify|verify} messages. + * @param message MethodOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IMethodOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a MethodOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns MethodOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.MethodOptions; + + /** + * Decodes a MethodOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns MethodOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.MethodOptions; + + /** + * Verifies a MethodOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a MethodOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns MethodOptions + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.MethodOptions; + + /** + * Creates a plain object from a MethodOptions message. Also converts values to other types if specified. + * @param message MethodOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.MethodOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this MethodOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for MethodOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace MethodOptions { + + /** IdempotencyLevel enum. */ + enum IdempotencyLevel { + IDEMPOTENCY_UNKNOWN = 0, + NO_SIDE_EFFECTS = 1, + IDEMPOTENT = 2 + } + } + + /** Properties of an UninterpretedOption. */ + interface IUninterpretedOption { + + /** UninterpretedOption name */ + name?: (google.protobuf.UninterpretedOption.INamePart[]|null); + + /** UninterpretedOption identifierValue */ + identifierValue?: (string|null); + + /** UninterpretedOption positiveIntValue */ + positiveIntValue?: (number|Long|string|null); + + /** UninterpretedOption negativeIntValue */ + negativeIntValue?: (number|Long|string|null); + + /** UninterpretedOption doubleValue */ + doubleValue?: (number|null); + + /** UninterpretedOption stringValue */ + stringValue?: (Uint8Array|string|null); + + /** UninterpretedOption aggregateValue */ + aggregateValue?: (string|null); + } + + /** Represents an UninterpretedOption. */ + class UninterpretedOption implements IUninterpretedOption { + + /** + * Constructs a new UninterpretedOption. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IUninterpretedOption); + + /** UninterpretedOption name. */ + public name: google.protobuf.UninterpretedOption.INamePart[]; + + /** UninterpretedOption identifierValue. */ + public identifierValue: string; + + /** UninterpretedOption positiveIntValue. */ + public positiveIntValue: (number|Long|string); + + /** UninterpretedOption negativeIntValue. */ + public negativeIntValue: (number|Long|string); + + /** UninterpretedOption doubleValue. */ + public doubleValue: number; + + /** UninterpretedOption stringValue. */ + public stringValue: (Uint8Array|string); + + /** UninterpretedOption aggregateValue. */ + public aggregateValue: string; + + /** + * Creates a new UninterpretedOption instance using the specified properties. + * @param [properties] Properties to set + * @returns UninterpretedOption instance + */ + public static create(properties?: google.protobuf.IUninterpretedOption): google.protobuf.UninterpretedOption; + + /** + * Encodes the specified UninterpretedOption message. Does not implicitly {@link google.protobuf.UninterpretedOption.verify|verify} messages. + * @param message UninterpretedOption message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IUninterpretedOption, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified UninterpretedOption message, length delimited. Does not implicitly {@link google.protobuf.UninterpretedOption.verify|verify} messages. + * @param message UninterpretedOption message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IUninterpretedOption, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an UninterpretedOption message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns UninterpretedOption + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.UninterpretedOption; + + /** + * Decodes an UninterpretedOption message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns UninterpretedOption + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.UninterpretedOption; + + /** + * Verifies an UninterpretedOption message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an UninterpretedOption message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns UninterpretedOption + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.UninterpretedOption; + + /** + * Creates a plain object from an UninterpretedOption message. Also converts values to other types if specified. + * @param message UninterpretedOption + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.UninterpretedOption, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this UninterpretedOption to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for UninterpretedOption + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace UninterpretedOption { + + /** Properties of a NamePart. */ + interface INamePart { + + /** NamePart namePart */ + namePart: string; + + /** NamePart isExtension */ + isExtension: boolean; + } + + /** Represents a NamePart. */ + class NamePart implements INamePart { + + /** + * Constructs a new NamePart. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.UninterpretedOption.INamePart); + + /** NamePart namePart. */ + public namePart: string; + + /** NamePart isExtension. */ + public isExtension: boolean; + + /** + * Creates a new NamePart instance using the specified properties. + * @param [properties] Properties to set + * @returns NamePart instance + */ + public static create(properties?: google.protobuf.UninterpretedOption.INamePart): google.protobuf.UninterpretedOption.NamePart; + + /** + * Encodes the specified NamePart message. Does not implicitly {@link google.protobuf.UninterpretedOption.NamePart.verify|verify} messages. + * @param message NamePart message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.UninterpretedOption.INamePart, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified NamePart message, length delimited. Does not implicitly {@link google.protobuf.UninterpretedOption.NamePart.verify|verify} messages. + * @param message NamePart message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.UninterpretedOption.INamePart, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a NamePart message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns NamePart + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.UninterpretedOption.NamePart; + + /** + * Decodes a NamePart message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns NamePart + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.UninterpretedOption.NamePart; + + /** + * Verifies a NamePart message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a NamePart message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns NamePart + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.UninterpretedOption.NamePart; + + /** + * Creates a plain object from a NamePart message. Also converts values to other types if specified. + * @param message NamePart + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.UninterpretedOption.NamePart, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this NamePart to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for NamePart + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + } + + /** Properties of a SourceCodeInfo. */ + interface ISourceCodeInfo { + + /** SourceCodeInfo location */ + location?: (google.protobuf.SourceCodeInfo.ILocation[]|null); + } + + /** Represents a SourceCodeInfo. */ + class SourceCodeInfo implements ISourceCodeInfo { + + /** + * Constructs a new SourceCodeInfo. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.ISourceCodeInfo); + + /** SourceCodeInfo location. */ + public location: google.protobuf.SourceCodeInfo.ILocation[]; + + /** + * Creates a new SourceCodeInfo instance using the specified properties. + * @param [properties] Properties to set + * @returns SourceCodeInfo instance + */ + public static create(properties?: google.protobuf.ISourceCodeInfo): google.protobuf.SourceCodeInfo; + + /** + * Encodes the specified SourceCodeInfo message. Does not implicitly {@link google.protobuf.SourceCodeInfo.verify|verify} messages. + * @param message SourceCodeInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.ISourceCodeInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified SourceCodeInfo message, length delimited. Does not implicitly {@link google.protobuf.SourceCodeInfo.verify|verify} messages. + * @param message SourceCodeInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.ISourceCodeInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a SourceCodeInfo message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns SourceCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.SourceCodeInfo; + + /** + * Decodes a SourceCodeInfo message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns SourceCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.SourceCodeInfo; + + /** + * Verifies a SourceCodeInfo message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a SourceCodeInfo message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns SourceCodeInfo + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.SourceCodeInfo; + + /** + * Creates a plain object from a SourceCodeInfo message. Also converts values to other types if specified. + * @param message SourceCodeInfo + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.SourceCodeInfo, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this SourceCodeInfo to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for SourceCodeInfo + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace SourceCodeInfo { + + /** Properties of a Location. */ + interface ILocation { + + /** Location path */ + path?: (number[]|null); + + /** Location span */ + span?: (number[]|null); + + /** Location leadingComments */ + leadingComments?: (string|null); + + /** Location trailingComments */ + trailingComments?: (string|null); + + /** Location leadingDetachedComments */ + leadingDetachedComments?: (string[]|null); + } + + /** Represents a Location. */ + class Location implements ILocation { + + /** + * Constructs a new Location. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.SourceCodeInfo.ILocation); + + /** Location path. */ + public path: number[]; + + /** Location span. */ + public span: number[]; + + /** Location leadingComments. */ + public leadingComments: string; + + /** Location trailingComments. */ + public trailingComments: string; + + /** Location leadingDetachedComments. */ + public leadingDetachedComments: string[]; + + /** + * Creates a new Location instance using the specified properties. + * @param [properties] Properties to set + * @returns Location instance + */ + public static create(properties?: google.protobuf.SourceCodeInfo.ILocation): google.protobuf.SourceCodeInfo.Location; + + /** + * Encodes the specified Location message. Does not implicitly {@link google.protobuf.SourceCodeInfo.Location.verify|verify} messages. + * @param message Location message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.SourceCodeInfo.ILocation, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Location message, length delimited. Does not implicitly {@link google.protobuf.SourceCodeInfo.Location.verify|verify} messages. + * @param message Location message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.SourceCodeInfo.ILocation, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Location message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Location + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.SourceCodeInfo.Location; + + /** + * Decodes a Location message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Location + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.SourceCodeInfo.Location; + + /** + * Verifies a Location message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Location message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Location + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.SourceCodeInfo.Location; + + /** + * Creates a plain object from a Location message. Also converts values to other types if specified. + * @param message Location + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.SourceCodeInfo.Location, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Location to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Location + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + } + + /** Properties of a GeneratedCodeInfo. */ + interface IGeneratedCodeInfo { + + /** GeneratedCodeInfo annotation */ + annotation?: (google.protobuf.GeneratedCodeInfo.IAnnotation[]|null); + } + + /** Represents a GeneratedCodeInfo. */ + class GeneratedCodeInfo implements IGeneratedCodeInfo { + + /** + * Constructs a new GeneratedCodeInfo. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IGeneratedCodeInfo); + + /** GeneratedCodeInfo annotation. */ + public annotation: google.protobuf.GeneratedCodeInfo.IAnnotation[]; + + /** + * Creates a new GeneratedCodeInfo instance using the specified properties. + * @param [properties] Properties to set + * @returns GeneratedCodeInfo instance + */ + public static create(properties?: google.protobuf.IGeneratedCodeInfo): google.protobuf.GeneratedCodeInfo; + + /** + * Encodes the specified GeneratedCodeInfo message. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.verify|verify} messages. + * @param message GeneratedCodeInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IGeneratedCodeInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified GeneratedCodeInfo message, length delimited. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.verify|verify} messages. + * @param message GeneratedCodeInfo message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IGeneratedCodeInfo, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a GeneratedCodeInfo message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns GeneratedCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.GeneratedCodeInfo; + + /** + * Decodes a GeneratedCodeInfo message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns GeneratedCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.GeneratedCodeInfo; + + /** + * Verifies a GeneratedCodeInfo message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a GeneratedCodeInfo message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns GeneratedCodeInfo + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.GeneratedCodeInfo; + + /** + * Creates a plain object from a GeneratedCodeInfo message. Also converts values to other types if specified. + * @param message GeneratedCodeInfo + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.GeneratedCodeInfo, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this GeneratedCodeInfo to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for GeneratedCodeInfo + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace GeneratedCodeInfo { + + /** Properties of an Annotation. */ + interface IAnnotation { + + /** Annotation path */ + path?: (number[]|null); + + /** Annotation sourceFile */ + sourceFile?: (string|null); + + /** Annotation begin */ + begin?: (number|null); + + /** Annotation end */ + end?: (number|null); + + /** Annotation semantic */ + semantic?: (google.protobuf.GeneratedCodeInfo.Annotation.Semantic|keyof typeof google.protobuf.GeneratedCodeInfo.Annotation.Semantic|null); + } + + /** Represents an Annotation. */ + class Annotation implements IAnnotation { + + /** + * Constructs a new Annotation. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.GeneratedCodeInfo.IAnnotation); + + /** Annotation path. */ + public path: number[]; + + /** Annotation sourceFile. */ + public sourceFile: string; + + /** Annotation begin. */ + public begin: number; + + /** Annotation end. */ + public end: number; + + /** Annotation semantic. */ + public semantic: (google.protobuf.GeneratedCodeInfo.Annotation.Semantic|keyof typeof google.protobuf.GeneratedCodeInfo.Annotation.Semantic); + + /** + * Creates a new Annotation instance using the specified properties. + * @param [properties] Properties to set + * @returns Annotation instance + */ + public static create(properties?: google.protobuf.GeneratedCodeInfo.IAnnotation): google.protobuf.GeneratedCodeInfo.Annotation; + + /** + * Encodes the specified Annotation message. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.Annotation.verify|verify} messages. + * @param message Annotation message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.GeneratedCodeInfo.IAnnotation, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Annotation message, length delimited. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.Annotation.verify|verify} messages. + * @param message Annotation message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.GeneratedCodeInfo.IAnnotation, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an Annotation message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Annotation + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.GeneratedCodeInfo.Annotation; + + /** + * Decodes an Annotation message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Annotation + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.GeneratedCodeInfo.Annotation; + + /** + * Verifies an Annotation message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an Annotation message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Annotation + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.GeneratedCodeInfo.Annotation; + + /** + * Creates a plain object from an Annotation message. Also converts values to other types if specified. + * @param message Annotation + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.GeneratedCodeInfo.Annotation, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Annotation to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Annotation + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace Annotation { + + /** Semantic enum. */ + enum Semantic { + NONE = 0, + SET = 1, + ALIAS = 2 + } + } + } + + /** Properties of a FieldMask. */ + interface IFieldMask { + + /** FieldMask paths */ + paths?: (string[]|null); + } + + /** Represents a FieldMask. */ + class FieldMask implements IFieldMask { + + /** + * Constructs a new FieldMask. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IFieldMask); + + /** FieldMask paths. */ + public paths: string[]; + + /** + * Creates a new FieldMask instance using the specified properties. + * @param [properties] Properties to set + * @returns FieldMask instance + */ + public static create(properties?: google.protobuf.IFieldMask): google.protobuf.FieldMask; + + /** + * Encodes the specified FieldMask message. Does not implicitly {@link google.protobuf.FieldMask.verify|verify} messages. + * @param message FieldMask message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IFieldMask, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified FieldMask message, length delimited. Does not implicitly {@link google.protobuf.FieldMask.verify|verify} messages. + * @param message FieldMask message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IFieldMask, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a FieldMask message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns FieldMask + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.FieldMask; + + /** + * Decodes a FieldMask message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns FieldMask + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.FieldMask; + + /** + * Verifies a FieldMask message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a FieldMask message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns FieldMask + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.FieldMask; + + /** + * Creates a plain object from a FieldMask message. Also converts values to other types if specified. + * @param message FieldMask + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.FieldMask, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this FieldMask to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for FieldMask + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an Empty. */ + interface IEmpty { + } + + /** Represents an Empty. */ + class Empty implements IEmpty { + + /** + * Constructs a new Empty. + * @param [properties] Properties to set + */ + constructor(properties?: google.protobuf.IEmpty); + + /** + * Creates a new Empty instance using the specified properties. + * @param [properties] Properties to set + * @returns Empty instance + */ + public static create(properties?: google.protobuf.IEmpty): google.protobuf.Empty; + + /** + * Encodes the specified Empty message. Does not implicitly {@link google.protobuf.Empty.verify|verify} messages. + * @param message Empty message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.protobuf.IEmpty, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Empty message, length delimited. Does not implicitly {@link google.protobuf.Empty.verify|verify} messages. + * @param message Empty message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.protobuf.IEmpty, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an Empty message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Empty + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.protobuf.Empty; + + /** + * Decodes an Empty message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Empty + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.protobuf.Empty; + + /** + * Verifies an Empty message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an Empty message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Empty + */ + public static fromObject(object: { [k: string]: any }): google.protobuf.Empty; + + /** + * Creates a plain object from an Empty message. Also converts values to other types if specified. + * @param message Empty + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.protobuf.Empty, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Empty to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Empty + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + } + + /** Namespace iam. */ + namespace iam { + + /** Namespace v1. */ + namespace v1 { + + /** Represents a IAMPolicy */ + class IAMPolicy extends $protobuf.rpc.Service { + + /** + * Constructs a new IAMPolicy service. + * @param rpcImpl RPC implementation + * @param [requestDelimited=false] Whether requests are length-delimited + * @param [responseDelimited=false] Whether responses are length-delimited + */ + constructor(rpcImpl: $protobuf.RPCImpl, requestDelimited?: boolean, responseDelimited?: boolean); + + /** + * Creates new IAMPolicy service using the specified rpc implementation. + * @param rpcImpl RPC implementation + * @param [requestDelimited=false] Whether requests are length-delimited + * @param [responseDelimited=false] Whether responses are length-delimited + * @returns RPC service. Useful where requests and/or responses are streamed. + */ + public static create(rpcImpl: $protobuf.RPCImpl, requestDelimited?: boolean, responseDelimited?: boolean): IAMPolicy; + + /** + * Calls SetIamPolicy. + * @param request SetIamPolicyRequest message or plain object + * @param callback Node-style callback called with the error, if any, and Policy + */ + public setIamPolicy(request: google.iam.v1.ISetIamPolicyRequest, callback: google.iam.v1.IAMPolicy.SetIamPolicyCallback): void; + + /** + * Calls SetIamPolicy. + * @param request SetIamPolicyRequest message or plain object + * @returns Promise + */ + public setIamPolicy(request: google.iam.v1.ISetIamPolicyRequest): Promise; + + /** + * Calls GetIamPolicy. + * @param request GetIamPolicyRequest message or plain object + * @param callback Node-style callback called with the error, if any, and Policy + */ + public getIamPolicy(request: google.iam.v1.IGetIamPolicyRequest, callback: google.iam.v1.IAMPolicy.GetIamPolicyCallback): void; + + /** + * Calls GetIamPolicy. + * @param request GetIamPolicyRequest message or plain object + * @returns Promise + */ + public getIamPolicy(request: google.iam.v1.IGetIamPolicyRequest): Promise; + + /** + * Calls TestIamPermissions. + * @param request TestIamPermissionsRequest message or plain object + * @param callback Node-style callback called with the error, if any, and TestIamPermissionsResponse + */ + public testIamPermissions(request: google.iam.v1.ITestIamPermissionsRequest, callback: google.iam.v1.IAMPolicy.TestIamPermissionsCallback): void; + + /** + * Calls TestIamPermissions. + * @param request TestIamPermissionsRequest message or plain object + * @returns Promise + */ + public testIamPermissions(request: google.iam.v1.ITestIamPermissionsRequest): Promise; + } + + namespace IAMPolicy { + + /** + * Callback as used by {@link google.iam.v1.IAMPolicy|setIamPolicy}. + * @param error Error, if any + * @param [response] Policy + */ + type SetIamPolicyCallback = (error: (Error|null), response?: google.iam.v1.Policy) => void; + + /** + * Callback as used by {@link google.iam.v1.IAMPolicy|getIamPolicy}. + * @param error Error, if any + * @param [response] Policy + */ + type GetIamPolicyCallback = (error: (Error|null), response?: google.iam.v1.Policy) => void; + + /** + * Callback as used by {@link google.iam.v1.IAMPolicy|testIamPermissions}. + * @param error Error, if any + * @param [response] TestIamPermissionsResponse + */ + type TestIamPermissionsCallback = (error: (Error|null), response?: google.iam.v1.TestIamPermissionsResponse) => void; + } + + /** Properties of a SetIamPolicyRequest. */ + interface ISetIamPolicyRequest { + + /** SetIamPolicyRequest resource */ + resource?: (string|null); + + /** SetIamPolicyRequest policy */ + policy?: (google.iam.v1.IPolicy|null); + + /** SetIamPolicyRequest updateMask */ + updateMask?: (google.protobuf.IFieldMask|null); + } + + /** Represents a SetIamPolicyRequest. */ + class SetIamPolicyRequest implements ISetIamPolicyRequest { + + /** + * Constructs a new SetIamPolicyRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.ISetIamPolicyRequest); + + /** SetIamPolicyRequest resource. */ + public resource: string; + + /** SetIamPolicyRequest policy. */ + public policy?: (google.iam.v1.IPolicy|null); + + /** SetIamPolicyRequest updateMask. */ + public updateMask?: (google.protobuf.IFieldMask|null); + + /** + * Creates a new SetIamPolicyRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns SetIamPolicyRequest instance + */ + public static create(properties?: google.iam.v1.ISetIamPolicyRequest): google.iam.v1.SetIamPolicyRequest; + + /** + * Encodes the specified SetIamPolicyRequest message. Does not implicitly {@link google.iam.v1.SetIamPolicyRequest.verify|verify} messages. + * @param message SetIamPolicyRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.ISetIamPolicyRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified SetIamPolicyRequest message, length delimited. Does not implicitly {@link google.iam.v1.SetIamPolicyRequest.verify|verify} messages. + * @param message SetIamPolicyRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.ISetIamPolicyRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a SetIamPolicyRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns SetIamPolicyRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.SetIamPolicyRequest; + + /** + * Decodes a SetIamPolicyRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns SetIamPolicyRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.SetIamPolicyRequest; + + /** + * Verifies a SetIamPolicyRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a SetIamPolicyRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns SetIamPolicyRequest + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.SetIamPolicyRequest; + + /** + * Creates a plain object from a SetIamPolicyRequest message. Also converts values to other types if specified. + * @param message SetIamPolicyRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.SetIamPolicyRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this SetIamPolicyRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for SetIamPolicyRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a GetIamPolicyRequest. */ + interface IGetIamPolicyRequest { + + /** GetIamPolicyRequest resource */ + resource?: (string|null); + + /** GetIamPolicyRequest options */ + options?: (google.iam.v1.IGetPolicyOptions|null); + } + + /** Represents a GetIamPolicyRequest. */ + class GetIamPolicyRequest implements IGetIamPolicyRequest { + + /** + * Constructs a new GetIamPolicyRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.IGetIamPolicyRequest); + + /** GetIamPolicyRequest resource. */ + public resource: string; + + /** GetIamPolicyRequest options. */ + public options?: (google.iam.v1.IGetPolicyOptions|null); + + /** + * Creates a new GetIamPolicyRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns GetIamPolicyRequest instance + */ + public static create(properties?: google.iam.v1.IGetIamPolicyRequest): google.iam.v1.GetIamPolicyRequest; + + /** + * Encodes the specified GetIamPolicyRequest message. Does not implicitly {@link google.iam.v1.GetIamPolicyRequest.verify|verify} messages. + * @param message GetIamPolicyRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.IGetIamPolicyRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified GetIamPolicyRequest message, length delimited. Does not implicitly {@link google.iam.v1.GetIamPolicyRequest.verify|verify} messages. + * @param message GetIamPolicyRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.IGetIamPolicyRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a GetIamPolicyRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns GetIamPolicyRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.GetIamPolicyRequest; + + /** + * Decodes a GetIamPolicyRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns GetIamPolicyRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.GetIamPolicyRequest; + + /** + * Verifies a GetIamPolicyRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a GetIamPolicyRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns GetIamPolicyRequest + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.GetIamPolicyRequest; + + /** + * Creates a plain object from a GetIamPolicyRequest message. Also converts values to other types if specified. + * @param message GetIamPolicyRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.GetIamPolicyRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this GetIamPolicyRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for GetIamPolicyRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a TestIamPermissionsRequest. */ + interface ITestIamPermissionsRequest { + + /** TestIamPermissionsRequest resource */ + resource?: (string|null); + + /** TestIamPermissionsRequest permissions */ + permissions?: (string[]|null); + } + + /** Represents a TestIamPermissionsRequest. */ + class TestIamPermissionsRequest implements ITestIamPermissionsRequest { + + /** + * Constructs a new TestIamPermissionsRequest. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.ITestIamPermissionsRequest); + + /** TestIamPermissionsRequest resource. */ + public resource: string; + + /** TestIamPermissionsRequest permissions. */ + public permissions: string[]; + + /** + * Creates a new TestIamPermissionsRequest instance using the specified properties. + * @param [properties] Properties to set + * @returns TestIamPermissionsRequest instance + */ + public static create(properties?: google.iam.v1.ITestIamPermissionsRequest): google.iam.v1.TestIamPermissionsRequest; + + /** + * Encodes the specified TestIamPermissionsRequest message. Does not implicitly {@link google.iam.v1.TestIamPermissionsRequest.verify|verify} messages. + * @param message TestIamPermissionsRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.ITestIamPermissionsRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified TestIamPermissionsRequest message, length delimited. Does not implicitly {@link google.iam.v1.TestIamPermissionsRequest.verify|verify} messages. + * @param message TestIamPermissionsRequest message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.ITestIamPermissionsRequest, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a TestIamPermissionsRequest message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns TestIamPermissionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.TestIamPermissionsRequest; + + /** + * Decodes a TestIamPermissionsRequest message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns TestIamPermissionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.TestIamPermissionsRequest; + + /** + * Verifies a TestIamPermissionsRequest message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a TestIamPermissionsRequest message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns TestIamPermissionsRequest + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.TestIamPermissionsRequest; + + /** + * Creates a plain object from a TestIamPermissionsRequest message. Also converts values to other types if specified. + * @param message TestIamPermissionsRequest + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.TestIamPermissionsRequest, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this TestIamPermissionsRequest to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for TestIamPermissionsRequest + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a TestIamPermissionsResponse. */ + interface ITestIamPermissionsResponse { + + /** TestIamPermissionsResponse permissions */ + permissions?: (string[]|null); + } + + /** Represents a TestIamPermissionsResponse. */ + class TestIamPermissionsResponse implements ITestIamPermissionsResponse { + + /** + * Constructs a new TestIamPermissionsResponse. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.ITestIamPermissionsResponse); + + /** TestIamPermissionsResponse permissions. */ + public permissions: string[]; + + /** + * Creates a new TestIamPermissionsResponse instance using the specified properties. + * @param [properties] Properties to set + * @returns TestIamPermissionsResponse instance + */ + public static create(properties?: google.iam.v1.ITestIamPermissionsResponse): google.iam.v1.TestIamPermissionsResponse; + + /** + * Encodes the specified TestIamPermissionsResponse message. Does not implicitly {@link google.iam.v1.TestIamPermissionsResponse.verify|verify} messages. + * @param message TestIamPermissionsResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.ITestIamPermissionsResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified TestIamPermissionsResponse message, length delimited. Does not implicitly {@link google.iam.v1.TestIamPermissionsResponse.verify|verify} messages. + * @param message TestIamPermissionsResponse message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.ITestIamPermissionsResponse, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a TestIamPermissionsResponse message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns TestIamPermissionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.TestIamPermissionsResponse; + + /** + * Decodes a TestIamPermissionsResponse message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns TestIamPermissionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.TestIamPermissionsResponse; + + /** + * Verifies a TestIamPermissionsResponse message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a TestIamPermissionsResponse message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns TestIamPermissionsResponse + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.TestIamPermissionsResponse; + + /** + * Creates a plain object from a TestIamPermissionsResponse message. Also converts values to other types if specified. + * @param message TestIamPermissionsResponse + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.TestIamPermissionsResponse, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this TestIamPermissionsResponse to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for TestIamPermissionsResponse + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a GetPolicyOptions. */ + interface IGetPolicyOptions { + + /** GetPolicyOptions requestedPolicyVersion */ + requestedPolicyVersion?: (number|null); + } + + /** Represents a GetPolicyOptions. */ + class GetPolicyOptions implements IGetPolicyOptions { + + /** + * Constructs a new GetPolicyOptions. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.IGetPolicyOptions); + + /** GetPolicyOptions requestedPolicyVersion. */ + public requestedPolicyVersion: number; + + /** + * Creates a new GetPolicyOptions instance using the specified properties. + * @param [properties] Properties to set + * @returns GetPolicyOptions instance + */ + public static create(properties?: google.iam.v1.IGetPolicyOptions): google.iam.v1.GetPolicyOptions; + + /** + * Encodes the specified GetPolicyOptions message. Does not implicitly {@link google.iam.v1.GetPolicyOptions.verify|verify} messages. + * @param message GetPolicyOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.IGetPolicyOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified GetPolicyOptions message, length delimited. Does not implicitly {@link google.iam.v1.GetPolicyOptions.verify|verify} messages. + * @param message GetPolicyOptions message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.IGetPolicyOptions, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a GetPolicyOptions message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns GetPolicyOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.GetPolicyOptions; + + /** + * Decodes a GetPolicyOptions message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns GetPolicyOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.GetPolicyOptions; + + /** + * Verifies a GetPolicyOptions message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a GetPolicyOptions message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns GetPolicyOptions + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.GetPolicyOptions; + + /** + * Creates a plain object from a GetPolicyOptions message. Also converts values to other types if specified. + * @param message GetPolicyOptions + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.GetPolicyOptions, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this GetPolicyOptions to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for GetPolicyOptions + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a Policy. */ + interface IPolicy { + + /** Policy version */ + version?: (number|null); + + /** Policy bindings */ + bindings?: (google.iam.v1.IBinding[]|null); + + /** Policy auditConfigs */ + auditConfigs?: (google.iam.v1.IAuditConfig[]|null); + + /** Policy etag */ + etag?: (Uint8Array|string|null); + } + + /** Represents a Policy. */ + class Policy implements IPolicy { + + /** + * Constructs a new Policy. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.IPolicy); + + /** Policy version. */ + public version: number; + + /** Policy bindings. */ + public bindings: google.iam.v1.IBinding[]; + + /** Policy auditConfigs. */ + public auditConfigs: google.iam.v1.IAuditConfig[]; + + /** Policy etag. */ + public etag: (Uint8Array|string); + + /** + * Creates a new Policy instance using the specified properties. + * @param [properties] Properties to set + * @returns Policy instance + */ + public static create(properties?: google.iam.v1.IPolicy): google.iam.v1.Policy; + + /** + * Encodes the specified Policy message. Does not implicitly {@link google.iam.v1.Policy.verify|verify} messages. + * @param message Policy message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.IPolicy, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Policy message, length delimited. Does not implicitly {@link google.iam.v1.Policy.verify|verify} messages. + * @param message Policy message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.IPolicy, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Policy message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Policy + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.Policy; + + /** + * Decodes a Policy message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Policy + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.Policy; + + /** + * Verifies a Policy message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Policy message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Policy + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.Policy; + + /** + * Creates a plain object from a Policy message. Also converts values to other types if specified. + * @param message Policy + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.Policy, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Policy to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Policy + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a Binding. */ + interface IBinding { + + /** Binding role */ + role?: (string|null); + + /** Binding members */ + members?: (string[]|null); + + /** Binding condition */ + condition?: (google.type.IExpr|null); + } + + /** Represents a Binding. */ + class Binding implements IBinding { + + /** + * Constructs a new Binding. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.IBinding); + + /** Binding role. */ + public role: string; + + /** Binding members. */ + public members: string[]; + + /** Binding condition. */ + public condition?: (google.type.IExpr|null); + + /** + * Creates a new Binding instance using the specified properties. + * @param [properties] Properties to set + * @returns Binding instance + */ + public static create(properties?: google.iam.v1.IBinding): google.iam.v1.Binding; + + /** + * Encodes the specified Binding message. Does not implicitly {@link google.iam.v1.Binding.verify|verify} messages. + * @param message Binding message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.IBinding, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Binding message, length delimited. Does not implicitly {@link google.iam.v1.Binding.verify|verify} messages. + * @param message Binding message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.IBinding, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a Binding message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Binding + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.Binding; + + /** + * Decodes a Binding message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Binding + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.Binding; + + /** + * Verifies a Binding message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a Binding message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Binding + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.Binding; + + /** + * Creates a plain object from a Binding message. Also converts values to other types if specified. + * @param message Binding + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.Binding, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Binding to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Binding + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an AuditConfig. */ + interface IAuditConfig { + + /** AuditConfig service */ + service?: (string|null); + + /** AuditConfig auditLogConfigs */ + auditLogConfigs?: (google.iam.v1.IAuditLogConfig[]|null); + } + + /** Represents an AuditConfig. */ + class AuditConfig implements IAuditConfig { + + /** + * Constructs a new AuditConfig. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.IAuditConfig); + + /** AuditConfig service. */ + public service: string; + + /** AuditConfig auditLogConfigs. */ + public auditLogConfigs: google.iam.v1.IAuditLogConfig[]; + + /** + * Creates a new AuditConfig instance using the specified properties. + * @param [properties] Properties to set + * @returns AuditConfig instance + */ + public static create(properties?: google.iam.v1.IAuditConfig): google.iam.v1.AuditConfig; + + /** + * Encodes the specified AuditConfig message. Does not implicitly {@link google.iam.v1.AuditConfig.verify|verify} messages. + * @param message AuditConfig message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.IAuditConfig, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified AuditConfig message, length delimited. Does not implicitly {@link google.iam.v1.AuditConfig.verify|verify} messages. + * @param message AuditConfig message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.IAuditConfig, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an AuditConfig message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns AuditConfig + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.AuditConfig; + + /** + * Decodes an AuditConfig message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns AuditConfig + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.AuditConfig; + + /** + * Verifies an AuditConfig message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an AuditConfig message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns AuditConfig + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.AuditConfig; + + /** + * Creates a plain object from an AuditConfig message. Also converts values to other types if specified. + * @param message AuditConfig + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.AuditConfig, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this AuditConfig to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for AuditConfig + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of an AuditLogConfig. */ + interface IAuditLogConfig { + + /** AuditLogConfig logType */ + logType?: (google.iam.v1.AuditLogConfig.LogType|keyof typeof google.iam.v1.AuditLogConfig.LogType|null); + + /** AuditLogConfig exemptedMembers */ + exemptedMembers?: (string[]|null); + } + + /** Represents an AuditLogConfig. */ + class AuditLogConfig implements IAuditLogConfig { + + /** + * Constructs a new AuditLogConfig. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.IAuditLogConfig); + + /** AuditLogConfig logType. */ + public logType: (google.iam.v1.AuditLogConfig.LogType|keyof typeof google.iam.v1.AuditLogConfig.LogType); + + /** AuditLogConfig exemptedMembers. */ + public exemptedMembers: string[]; + + /** + * Creates a new AuditLogConfig instance using the specified properties. + * @param [properties] Properties to set + * @returns AuditLogConfig instance + */ + public static create(properties?: google.iam.v1.IAuditLogConfig): google.iam.v1.AuditLogConfig; + + /** + * Encodes the specified AuditLogConfig message. Does not implicitly {@link google.iam.v1.AuditLogConfig.verify|verify} messages. + * @param message AuditLogConfig message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.IAuditLogConfig, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified AuditLogConfig message, length delimited. Does not implicitly {@link google.iam.v1.AuditLogConfig.verify|verify} messages. + * @param message AuditLogConfig message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.IAuditLogConfig, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an AuditLogConfig message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns AuditLogConfig + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.AuditLogConfig; + + /** + * Decodes an AuditLogConfig message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns AuditLogConfig + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.AuditLogConfig; + + /** + * Verifies an AuditLogConfig message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an AuditLogConfig message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns AuditLogConfig + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.AuditLogConfig; + + /** + * Creates a plain object from an AuditLogConfig message. Also converts values to other types if specified. + * @param message AuditLogConfig + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.AuditLogConfig, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this AuditLogConfig to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for AuditLogConfig + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace AuditLogConfig { + + /** LogType enum. */ + enum LogType { + LOG_TYPE_UNSPECIFIED = 0, + ADMIN_READ = 1, + DATA_WRITE = 2, + DATA_READ = 3 + } + } + + /** Properties of a PolicyDelta. */ + interface IPolicyDelta { + + /** PolicyDelta bindingDeltas */ + bindingDeltas?: (google.iam.v1.IBindingDelta[]|null); + + /** PolicyDelta auditConfigDeltas */ + auditConfigDeltas?: (google.iam.v1.IAuditConfigDelta[]|null); + } + + /** Represents a PolicyDelta. */ + class PolicyDelta implements IPolicyDelta { + + /** + * Constructs a new PolicyDelta. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.IPolicyDelta); + + /** PolicyDelta bindingDeltas. */ + public bindingDeltas: google.iam.v1.IBindingDelta[]; + + /** PolicyDelta auditConfigDeltas. */ + public auditConfigDeltas: google.iam.v1.IAuditConfigDelta[]; + + /** + * Creates a new PolicyDelta instance using the specified properties. + * @param [properties] Properties to set + * @returns PolicyDelta instance + */ + public static create(properties?: google.iam.v1.IPolicyDelta): google.iam.v1.PolicyDelta; + + /** + * Encodes the specified PolicyDelta message. Does not implicitly {@link google.iam.v1.PolicyDelta.verify|verify} messages. + * @param message PolicyDelta message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.IPolicyDelta, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified PolicyDelta message, length delimited. Does not implicitly {@link google.iam.v1.PolicyDelta.verify|verify} messages. + * @param message PolicyDelta message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.IPolicyDelta, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a PolicyDelta message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns PolicyDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.PolicyDelta; + + /** + * Decodes a PolicyDelta message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns PolicyDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.PolicyDelta; + + /** + * Verifies a PolicyDelta message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a PolicyDelta message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns PolicyDelta + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.PolicyDelta; + + /** + * Creates a plain object from a PolicyDelta message. Also converts values to other types if specified. + * @param message PolicyDelta + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.PolicyDelta, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this PolicyDelta to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for PolicyDelta + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + /** Properties of a BindingDelta. */ + interface IBindingDelta { + + /** BindingDelta action */ + action?: (google.iam.v1.BindingDelta.Action|keyof typeof google.iam.v1.BindingDelta.Action|null); + + /** BindingDelta role */ + role?: (string|null); + + /** BindingDelta member */ + member?: (string|null); + + /** BindingDelta condition */ + condition?: (google.type.IExpr|null); + } + + /** Represents a BindingDelta. */ + class BindingDelta implements IBindingDelta { + + /** + * Constructs a new BindingDelta. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.IBindingDelta); + + /** BindingDelta action. */ + public action: (google.iam.v1.BindingDelta.Action|keyof typeof google.iam.v1.BindingDelta.Action); + + /** BindingDelta role. */ + public role: string; + + /** BindingDelta member. */ + public member: string; + + /** BindingDelta condition. */ + public condition?: (google.type.IExpr|null); + + /** + * Creates a new BindingDelta instance using the specified properties. + * @param [properties] Properties to set + * @returns BindingDelta instance + */ + public static create(properties?: google.iam.v1.IBindingDelta): google.iam.v1.BindingDelta; + + /** + * Encodes the specified BindingDelta message. Does not implicitly {@link google.iam.v1.BindingDelta.verify|verify} messages. + * @param message BindingDelta message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.IBindingDelta, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified BindingDelta message, length delimited. Does not implicitly {@link google.iam.v1.BindingDelta.verify|verify} messages. + * @param message BindingDelta message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.IBindingDelta, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes a BindingDelta message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns BindingDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.BindingDelta; + + /** + * Decodes a BindingDelta message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns BindingDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.BindingDelta; + + /** + * Verifies a BindingDelta message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates a BindingDelta message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns BindingDelta + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.BindingDelta; + + /** + * Creates a plain object from a BindingDelta message. Also converts values to other types if specified. + * @param message BindingDelta + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.BindingDelta, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this BindingDelta to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for BindingDelta + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace BindingDelta { + + /** Action enum. */ + enum Action { + ACTION_UNSPECIFIED = 0, + ADD = 1, + REMOVE = 2 + } + } + + /** Properties of an AuditConfigDelta. */ + interface IAuditConfigDelta { + + /** AuditConfigDelta action */ + action?: (google.iam.v1.AuditConfigDelta.Action|keyof typeof google.iam.v1.AuditConfigDelta.Action|null); + + /** AuditConfigDelta service */ + service?: (string|null); + + /** AuditConfigDelta exemptedMember */ + exemptedMember?: (string|null); + + /** AuditConfigDelta logType */ + logType?: (string|null); + } + + /** Represents an AuditConfigDelta. */ + class AuditConfigDelta implements IAuditConfigDelta { + + /** + * Constructs a new AuditConfigDelta. + * @param [properties] Properties to set + */ + constructor(properties?: google.iam.v1.IAuditConfigDelta); + + /** AuditConfigDelta action. */ + public action: (google.iam.v1.AuditConfigDelta.Action|keyof typeof google.iam.v1.AuditConfigDelta.Action); + + /** AuditConfigDelta service. */ + public service: string; + + /** AuditConfigDelta exemptedMember. */ + public exemptedMember: string; + + /** AuditConfigDelta logType. */ + public logType: string; + + /** + * Creates a new AuditConfigDelta instance using the specified properties. + * @param [properties] Properties to set + * @returns AuditConfigDelta instance + */ + public static create(properties?: google.iam.v1.IAuditConfigDelta): google.iam.v1.AuditConfigDelta; + + /** + * Encodes the specified AuditConfigDelta message. Does not implicitly {@link google.iam.v1.AuditConfigDelta.verify|verify} messages. + * @param message AuditConfigDelta message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.iam.v1.IAuditConfigDelta, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified AuditConfigDelta message, length delimited. Does not implicitly {@link google.iam.v1.AuditConfigDelta.verify|verify} messages. + * @param message AuditConfigDelta message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.iam.v1.IAuditConfigDelta, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an AuditConfigDelta message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns AuditConfigDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.iam.v1.AuditConfigDelta; + + /** + * Decodes an AuditConfigDelta message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns AuditConfigDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.iam.v1.AuditConfigDelta; + + /** + * Verifies an AuditConfigDelta message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an AuditConfigDelta message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns AuditConfigDelta + */ + public static fromObject(object: { [k: string]: any }): google.iam.v1.AuditConfigDelta; + + /** + * Creates a plain object from an AuditConfigDelta message. Also converts values to other types if specified. + * @param message AuditConfigDelta + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.iam.v1.AuditConfigDelta, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this AuditConfigDelta to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for AuditConfigDelta + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + + namespace AuditConfigDelta { + + /** Action enum. */ + enum Action { + ACTION_UNSPECIFIED = 0, + ADD = 1, + REMOVE = 2 + } + } + } + } + + /** Namespace type. */ + namespace type { + + /** Properties of an Expr. */ + interface IExpr { + + /** Expr expression */ + expression?: (string|null); + + /** Expr title */ + title?: (string|null); + + /** Expr description */ + description?: (string|null); + + /** Expr location */ + location?: (string|null); + } + + /** Represents an Expr. */ + class Expr implements IExpr { + + /** + * Constructs a new Expr. + * @param [properties] Properties to set + */ + constructor(properties?: google.type.IExpr); + + /** Expr expression. */ + public expression: string; + + /** Expr title. */ + public title: string; + + /** Expr description. */ + public description: string; + + /** Expr location. */ + public location: string; + + /** + * Creates a new Expr instance using the specified properties. + * @param [properties] Properties to set + * @returns Expr instance + */ + public static create(properties?: google.type.IExpr): google.type.Expr; + + /** + * Encodes the specified Expr message. Does not implicitly {@link google.type.Expr.verify|verify} messages. + * @param message Expr message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encode(message: google.type.IExpr, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Encodes the specified Expr message, length delimited. Does not implicitly {@link google.type.Expr.verify|verify} messages. + * @param message Expr message or plain object to encode + * @param [writer] Writer to encode to + * @returns Writer + */ + public static encodeDelimited(message: google.type.IExpr, writer?: $protobuf.Writer): $protobuf.Writer; + + /** + * Decodes an Expr message from the specified reader or buffer. + * @param reader Reader or buffer to decode from + * @param [length] Message length if known beforehand + * @returns Expr + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decode(reader: ($protobuf.Reader|Uint8Array), length?: number): google.type.Expr; + + /** + * Decodes an Expr message from the specified reader or buffer, length delimited. + * @param reader Reader or buffer to decode from + * @returns Expr + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + public static decodeDelimited(reader: ($protobuf.Reader|Uint8Array)): google.type.Expr; + + /** + * Verifies an Expr message. + * @param message Plain object to verify + * @returns `null` if valid, otherwise the reason why it is not + */ + public static verify(message: { [k: string]: any }): (string|null); + + /** + * Creates an Expr message from a plain object. Also converts values to their respective internal types. + * @param object Plain object + * @returns Expr + */ + public static fromObject(object: { [k: string]: any }): google.type.Expr; + + /** + * Creates a plain object from an Expr message. Also converts values to other types if specified. + * @param message Expr + * @param [options] Conversion options + * @returns Plain object + */ + public static toObject(message: google.type.Expr, options?: $protobuf.IConversionOptions): { [k: string]: any }; + + /** + * Converts this Expr to JSON. + * @returns JSON object + */ + public toJSON(): { [k: string]: any }; + + /** + * Gets the default type url for Expr + * @param [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns The default type url + */ + public static getTypeUrl(typeUrlPrefix?: string): string; + } + } +} diff --git a/packages/google-cloud-bigquery-connection/protos/protos.js b/packages/google-cloud-bigquery-connection/protos/protos.js new file mode 100644 index 00000000000..712b43fe3de --- /dev/null +++ b/packages/google-cloud-bigquery-connection/protos/protos.js @@ -0,0 +1,19525 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +/*eslint-disable block-scoped-var, id-length, no-control-regex, no-magic-numbers, no-prototype-builtins, no-redeclare, no-shadow, no-var, sort-vars*/ +(function(global, factory) { /* global define, require, module */ + + /* AMD */ if (typeof define === 'function' && define.amd) + define(["protobufjs/minimal"], factory); + + /* CommonJS */ else if (typeof require === 'function' && typeof module === 'object' && module && module.exports) + module.exports = factory(require("google-gax/build/src/protobuf").protobufMinimal); + +})(this, function($protobuf) { + "use strict"; + + // Common aliases + var $Reader = $protobuf.Reader, $Writer = $protobuf.Writer, $util = $protobuf.util; + + // Exported root namespace + var $root = $protobuf.roots._google_cloud_bigquery_connection_protos || ($protobuf.roots._google_cloud_bigquery_connection_protos = {}); + + $root.google = (function() { + + /** + * Namespace google. + * @exports google + * @namespace + */ + var google = {}; + + google.cloud = (function() { + + /** + * Namespace cloud. + * @memberof google + * @namespace + */ + var cloud = {}; + + cloud.bigquery = (function() { + + /** + * Namespace bigquery. + * @memberof google.cloud + * @namespace + */ + var bigquery = {}; + + bigquery.connection = (function() { + + /** + * Namespace connection. + * @memberof google.cloud.bigquery + * @namespace + */ + var connection = {}; + + connection.v1 = (function() { + + /** + * Namespace v1. + * @memberof google.cloud.bigquery.connection + * @namespace + */ + var v1 = {}; + + v1.ConnectionService = (function() { + + /** + * Constructs a new ConnectionService service. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a ConnectionService + * @extends $protobuf.rpc.Service + * @constructor + * @param {$protobuf.RPCImpl} rpcImpl RPC implementation + * @param {boolean} [requestDelimited=false] Whether requests are length-delimited + * @param {boolean} [responseDelimited=false] Whether responses are length-delimited + */ + function ConnectionService(rpcImpl, requestDelimited, responseDelimited) { + $protobuf.rpc.Service.call(this, rpcImpl, requestDelimited, responseDelimited); + } + + (ConnectionService.prototype = Object.create($protobuf.rpc.Service.prototype)).constructor = ConnectionService; + + /** + * Creates new ConnectionService service using the specified rpc implementation. + * @function create + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @static + * @param {$protobuf.RPCImpl} rpcImpl RPC implementation + * @param {boolean} [requestDelimited=false] Whether requests are length-delimited + * @param {boolean} [responseDelimited=false] Whether responses are length-delimited + * @returns {ConnectionService} RPC service. Useful where requests and/or responses are streamed. + */ + ConnectionService.create = function create(rpcImpl, requestDelimited, responseDelimited) { + return new this(rpcImpl, requestDelimited, responseDelimited); + }; + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|createConnection}. + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @typedef CreateConnectionCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.cloud.bigquery.connection.v1.Connection} [response] Connection + */ + + /** + * Calls CreateConnection. + * @function createConnection + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.ICreateConnectionRequest} request CreateConnectionRequest message or plain object + * @param {google.cloud.bigquery.connection.v1.ConnectionService.CreateConnectionCallback} callback Node-style callback called with the error, if any, and Connection + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(ConnectionService.prototype.createConnection = function createConnection(request, callback) { + return this.rpcCall(createConnection, $root.google.cloud.bigquery.connection.v1.CreateConnectionRequest, $root.google.cloud.bigquery.connection.v1.Connection, request, callback); + }, "name", { value: "CreateConnection" }); + + /** + * Calls CreateConnection. + * @function createConnection + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.ICreateConnectionRequest} request CreateConnectionRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|getConnection}. + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @typedef GetConnectionCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.cloud.bigquery.connection.v1.Connection} [response] Connection + */ + + /** + * Calls GetConnection. + * @function getConnection + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.IGetConnectionRequest} request GetConnectionRequest message or plain object + * @param {google.cloud.bigquery.connection.v1.ConnectionService.GetConnectionCallback} callback Node-style callback called with the error, if any, and Connection + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(ConnectionService.prototype.getConnection = function getConnection(request, callback) { + return this.rpcCall(getConnection, $root.google.cloud.bigquery.connection.v1.GetConnectionRequest, $root.google.cloud.bigquery.connection.v1.Connection, request, callback); + }, "name", { value: "GetConnection" }); + + /** + * Calls GetConnection. + * @function getConnection + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.IGetConnectionRequest} request GetConnectionRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|listConnections}. + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @typedef ListConnectionsCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.cloud.bigquery.connection.v1.ListConnectionsResponse} [response] ListConnectionsResponse + */ + + /** + * Calls ListConnections. + * @function listConnections + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.IListConnectionsRequest} request ListConnectionsRequest message or plain object + * @param {google.cloud.bigquery.connection.v1.ConnectionService.ListConnectionsCallback} callback Node-style callback called with the error, if any, and ListConnectionsResponse + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(ConnectionService.prototype.listConnections = function listConnections(request, callback) { + return this.rpcCall(listConnections, $root.google.cloud.bigquery.connection.v1.ListConnectionsRequest, $root.google.cloud.bigquery.connection.v1.ListConnectionsResponse, request, callback); + }, "name", { value: "ListConnections" }); + + /** + * Calls ListConnections. + * @function listConnections + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.IListConnectionsRequest} request ListConnectionsRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|updateConnection}. + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @typedef UpdateConnectionCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.cloud.bigquery.connection.v1.Connection} [response] Connection + */ + + /** + * Calls UpdateConnection. + * @function updateConnection + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.IUpdateConnectionRequest} request UpdateConnectionRequest message or plain object + * @param {google.cloud.bigquery.connection.v1.ConnectionService.UpdateConnectionCallback} callback Node-style callback called with the error, if any, and Connection + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(ConnectionService.prototype.updateConnection = function updateConnection(request, callback) { + return this.rpcCall(updateConnection, $root.google.cloud.bigquery.connection.v1.UpdateConnectionRequest, $root.google.cloud.bigquery.connection.v1.Connection, request, callback); + }, "name", { value: "UpdateConnection" }); + + /** + * Calls UpdateConnection. + * @function updateConnection + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.IUpdateConnectionRequest} request UpdateConnectionRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|deleteConnection}. + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @typedef DeleteConnectionCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.protobuf.Empty} [response] Empty + */ + + /** + * Calls DeleteConnection. + * @function deleteConnection + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.IDeleteConnectionRequest} request DeleteConnectionRequest message or plain object + * @param {google.cloud.bigquery.connection.v1.ConnectionService.DeleteConnectionCallback} callback Node-style callback called with the error, if any, and Empty + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(ConnectionService.prototype.deleteConnection = function deleteConnection(request, callback) { + return this.rpcCall(deleteConnection, $root.google.cloud.bigquery.connection.v1.DeleteConnectionRequest, $root.google.protobuf.Empty, request, callback); + }, "name", { value: "DeleteConnection" }); + + /** + * Calls DeleteConnection. + * @function deleteConnection + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.cloud.bigquery.connection.v1.IDeleteConnectionRequest} request DeleteConnectionRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|getIamPolicy}. + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @typedef GetIamPolicyCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.iam.v1.Policy} [response] Policy + */ + + /** + * Calls GetIamPolicy. + * @function getIamPolicy + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.iam.v1.IGetIamPolicyRequest} request GetIamPolicyRequest message or plain object + * @param {google.cloud.bigquery.connection.v1.ConnectionService.GetIamPolicyCallback} callback Node-style callback called with the error, if any, and Policy + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(ConnectionService.prototype.getIamPolicy = function getIamPolicy(request, callback) { + return this.rpcCall(getIamPolicy, $root.google.iam.v1.GetIamPolicyRequest, $root.google.iam.v1.Policy, request, callback); + }, "name", { value: "GetIamPolicy" }); + + /** + * Calls GetIamPolicy. + * @function getIamPolicy + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.iam.v1.IGetIamPolicyRequest} request GetIamPolicyRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|setIamPolicy}. + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @typedef SetIamPolicyCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.iam.v1.Policy} [response] Policy + */ + + /** + * Calls SetIamPolicy. + * @function setIamPolicy + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.iam.v1.ISetIamPolicyRequest} request SetIamPolicyRequest message or plain object + * @param {google.cloud.bigquery.connection.v1.ConnectionService.SetIamPolicyCallback} callback Node-style callback called with the error, if any, and Policy + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(ConnectionService.prototype.setIamPolicy = function setIamPolicy(request, callback) { + return this.rpcCall(setIamPolicy, $root.google.iam.v1.SetIamPolicyRequest, $root.google.iam.v1.Policy, request, callback); + }, "name", { value: "SetIamPolicy" }); + + /** + * Calls SetIamPolicy. + * @function setIamPolicy + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.iam.v1.ISetIamPolicyRequest} request SetIamPolicyRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + /** + * Callback as used by {@link google.cloud.bigquery.connection.v1.ConnectionService|testIamPermissions}. + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @typedef TestIamPermissionsCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.iam.v1.TestIamPermissionsResponse} [response] TestIamPermissionsResponse + */ + + /** + * Calls TestIamPermissions. + * @function testIamPermissions + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.iam.v1.ITestIamPermissionsRequest} request TestIamPermissionsRequest message or plain object + * @param {google.cloud.bigquery.connection.v1.ConnectionService.TestIamPermissionsCallback} callback Node-style callback called with the error, if any, and TestIamPermissionsResponse + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(ConnectionService.prototype.testIamPermissions = function testIamPermissions(request, callback) { + return this.rpcCall(testIamPermissions, $root.google.iam.v1.TestIamPermissionsRequest, $root.google.iam.v1.TestIamPermissionsResponse, request, callback); + }, "name", { value: "TestIamPermissions" }); + + /** + * Calls TestIamPermissions. + * @function testIamPermissions + * @memberof google.cloud.bigquery.connection.v1.ConnectionService + * @instance + * @param {google.iam.v1.ITestIamPermissionsRequest} request TestIamPermissionsRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + return ConnectionService; + })(); + + v1.CreateConnectionRequest = (function() { + + /** + * Properties of a CreateConnectionRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @interface ICreateConnectionRequest + * @property {string|null} [parent] CreateConnectionRequest parent + * @property {string|null} [connectionId] CreateConnectionRequest connectionId + * @property {google.cloud.bigquery.connection.v1.IConnection|null} [connection] CreateConnectionRequest connection + */ + + /** + * Constructs a new CreateConnectionRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a CreateConnectionRequest. + * @implements ICreateConnectionRequest + * @constructor + * @param {google.cloud.bigquery.connection.v1.ICreateConnectionRequest=} [properties] Properties to set + */ + function CreateConnectionRequest(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * CreateConnectionRequest parent. + * @member {string} parent + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @instance + */ + CreateConnectionRequest.prototype.parent = ""; + + /** + * CreateConnectionRequest connectionId. + * @member {string} connectionId + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @instance + */ + CreateConnectionRequest.prototype.connectionId = ""; + + /** + * CreateConnectionRequest connection. + * @member {google.cloud.bigquery.connection.v1.IConnection|null|undefined} connection + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @instance + */ + CreateConnectionRequest.prototype.connection = null; + + /** + * Creates a new CreateConnectionRequest instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.ICreateConnectionRequest=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.CreateConnectionRequest} CreateConnectionRequest instance + */ + CreateConnectionRequest.create = function create(properties) { + return new CreateConnectionRequest(properties); + }; + + /** + * Encodes the specified CreateConnectionRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CreateConnectionRequest.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.ICreateConnectionRequest} message CreateConnectionRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CreateConnectionRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.parent != null && Object.hasOwnProperty.call(message, "parent")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.parent); + if (message.connectionId != null && Object.hasOwnProperty.call(message, "connectionId")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.connectionId); + if (message.connection != null && Object.hasOwnProperty.call(message, "connection")) + $root.google.cloud.bigquery.connection.v1.Connection.encode(message.connection, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified CreateConnectionRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CreateConnectionRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.ICreateConnectionRequest} message CreateConnectionRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CreateConnectionRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a CreateConnectionRequest message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.CreateConnectionRequest} CreateConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CreateConnectionRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.CreateConnectionRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.parent = reader.string(); + break; + } + case 2: { + message.connectionId = reader.string(); + break; + } + case 3: { + message.connection = $root.google.cloud.bigquery.connection.v1.Connection.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a CreateConnectionRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.CreateConnectionRequest} CreateConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CreateConnectionRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a CreateConnectionRequest message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + CreateConnectionRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.parent != null && message.hasOwnProperty("parent")) + if (!$util.isString(message.parent)) + return "parent: string expected"; + if (message.connectionId != null && message.hasOwnProperty("connectionId")) + if (!$util.isString(message.connectionId)) + return "connectionId: string expected"; + if (message.connection != null && message.hasOwnProperty("connection")) { + var error = $root.google.cloud.bigquery.connection.v1.Connection.verify(message.connection); + if (error) + return "connection." + error; + } + return null; + }; + + /** + * Creates a CreateConnectionRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.CreateConnectionRequest} CreateConnectionRequest + */ + CreateConnectionRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.CreateConnectionRequest) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.CreateConnectionRequest(); + if (object.parent != null) + message.parent = String(object.parent); + if (object.connectionId != null) + message.connectionId = String(object.connectionId); + if (object.connection != null) { + if (typeof object.connection !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.CreateConnectionRequest.connection: object expected"); + message.connection = $root.google.cloud.bigquery.connection.v1.Connection.fromObject(object.connection); + } + return message; + }; + + /** + * Creates a plain object from a CreateConnectionRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.CreateConnectionRequest} message CreateConnectionRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + CreateConnectionRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.parent = ""; + object.connectionId = ""; + object.connection = null; + } + if (message.parent != null && message.hasOwnProperty("parent")) + object.parent = message.parent; + if (message.connectionId != null && message.hasOwnProperty("connectionId")) + object.connectionId = message.connectionId; + if (message.connection != null && message.hasOwnProperty("connection")) + object.connection = $root.google.cloud.bigquery.connection.v1.Connection.toObject(message.connection, options); + return object; + }; + + /** + * Converts this CreateConnectionRequest to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @instance + * @returns {Object.} JSON object + */ + CreateConnectionRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for CreateConnectionRequest + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.CreateConnectionRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + CreateConnectionRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.CreateConnectionRequest"; + }; + + return CreateConnectionRequest; + })(); + + v1.GetConnectionRequest = (function() { + + /** + * Properties of a GetConnectionRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IGetConnectionRequest + * @property {string|null} [name] GetConnectionRequest name + */ + + /** + * Constructs a new GetConnectionRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a GetConnectionRequest. + * @implements IGetConnectionRequest + * @constructor + * @param {google.cloud.bigquery.connection.v1.IGetConnectionRequest=} [properties] Properties to set + */ + function GetConnectionRequest(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * GetConnectionRequest name. + * @member {string} name + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @instance + */ + GetConnectionRequest.prototype.name = ""; + + /** + * Creates a new GetConnectionRequest instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IGetConnectionRequest=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.GetConnectionRequest} GetConnectionRequest instance + */ + GetConnectionRequest.create = function create(properties) { + return new GetConnectionRequest(properties); + }; + + /** + * Encodes the specified GetConnectionRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.GetConnectionRequest.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IGetConnectionRequest} message GetConnectionRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GetConnectionRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + return writer; + }; + + /** + * Encodes the specified GetConnectionRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.GetConnectionRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IGetConnectionRequest} message GetConnectionRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GetConnectionRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a GetConnectionRequest message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.GetConnectionRequest} GetConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GetConnectionRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.GetConnectionRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a GetConnectionRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.GetConnectionRequest} GetConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GetConnectionRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a GetConnectionRequest message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + GetConnectionRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + return null; + }; + + /** + * Creates a GetConnectionRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.GetConnectionRequest} GetConnectionRequest + */ + GetConnectionRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.GetConnectionRequest) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.GetConnectionRequest(); + if (object.name != null) + message.name = String(object.name); + return message; + }; + + /** + * Creates a plain object from a GetConnectionRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.GetConnectionRequest} message GetConnectionRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + GetConnectionRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) + object.name = ""; + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + return object; + }; + + /** + * Converts this GetConnectionRequest to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @instance + * @returns {Object.} JSON object + */ + GetConnectionRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for GetConnectionRequest + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.GetConnectionRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + GetConnectionRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.GetConnectionRequest"; + }; + + return GetConnectionRequest; + })(); + + v1.ListConnectionsRequest = (function() { + + /** + * Properties of a ListConnectionsRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IListConnectionsRequest + * @property {string|null} [parent] ListConnectionsRequest parent + * @property {number|null} [pageSize] ListConnectionsRequest pageSize + * @property {string|null} [pageToken] ListConnectionsRequest pageToken + */ + + /** + * Constructs a new ListConnectionsRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a ListConnectionsRequest. + * @implements IListConnectionsRequest + * @constructor + * @param {google.cloud.bigquery.connection.v1.IListConnectionsRequest=} [properties] Properties to set + */ + function ListConnectionsRequest(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ListConnectionsRequest parent. + * @member {string} parent + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @instance + */ + ListConnectionsRequest.prototype.parent = ""; + + /** + * ListConnectionsRequest pageSize. + * @member {number} pageSize + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @instance + */ + ListConnectionsRequest.prototype.pageSize = 0; + + /** + * ListConnectionsRequest pageToken. + * @member {string} pageToken + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @instance + */ + ListConnectionsRequest.prototype.pageToken = ""; + + /** + * Creates a new ListConnectionsRequest instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IListConnectionsRequest=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.ListConnectionsRequest} ListConnectionsRequest instance + */ + ListConnectionsRequest.create = function create(properties) { + return new ListConnectionsRequest(properties); + }; + + /** + * Encodes the specified ListConnectionsRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.ListConnectionsRequest.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IListConnectionsRequest} message ListConnectionsRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ListConnectionsRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.parent != null && Object.hasOwnProperty.call(message, "parent")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.parent); + if (message.pageToken != null && Object.hasOwnProperty.call(message, "pageToken")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.pageToken); + if (message.pageSize != null && Object.hasOwnProperty.call(message, "pageSize")) + writer.uint32(/* id 4, wireType 0 =*/32).int32(message.pageSize); + return writer; + }; + + /** + * Encodes the specified ListConnectionsRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.ListConnectionsRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IListConnectionsRequest} message ListConnectionsRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ListConnectionsRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ListConnectionsRequest message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.ListConnectionsRequest} ListConnectionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ListConnectionsRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.ListConnectionsRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.parent = reader.string(); + break; + } + case 4: { + message.pageSize = reader.int32(); + break; + } + case 3: { + message.pageToken = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ListConnectionsRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.ListConnectionsRequest} ListConnectionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ListConnectionsRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ListConnectionsRequest message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ListConnectionsRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.parent != null && message.hasOwnProperty("parent")) + if (!$util.isString(message.parent)) + return "parent: string expected"; + if (message.pageSize != null && message.hasOwnProperty("pageSize")) + if (!$util.isInteger(message.pageSize)) + return "pageSize: integer expected"; + if (message.pageToken != null && message.hasOwnProperty("pageToken")) + if (!$util.isString(message.pageToken)) + return "pageToken: string expected"; + return null; + }; + + /** + * Creates a ListConnectionsRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.ListConnectionsRequest} ListConnectionsRequest + */ + ListConnectionsRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.ListConnectionsRequest) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.ListConnectionsRequest(); + if (object.parent != null) + message.parent = String(object.parent); + if (object.pageSize != null) + message.pageSize = object.pageSize | 0; + if (object.pageToken != null) + message.pageToken = String(object.pageToken); + return message; + }; + + /** + * Creates a plain object from a ListConnectionsRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @static + * @param {google.cloud.bigquery.connection.v1.ListConnectionsRequest} message ListConnectionsRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ListConnectionsRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.parent = ""; + object.pageToken = ""; + object.pageSize = 0; + } + if (message.parent != null && message.hasOwnProperty("parent")) + object.parent = message.parent; + if (message.pageToken != null && message.hasOwnProperty("pageToken")) + object.pageToken = message.pageToken; + if (message.pageSize != null && message.hasOwnProperty("pageSize")) + object.pageSize = message.pageSize; + return object; + }; + + /** + * Converts this ListConnectionsRequest to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @instance + * @returns {Object.} JSON object + */ + ListConnectionsRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for ListConnectionsRequest + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ListConnectionsRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.ListConnectionsRequest"; + }; + + return ListConnectionsRequest; + })(); + + v1.ListConnectionsResponse = (function() { + + /** + * Properties of a ListConnectionsResponse. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IListConnectionsResponse + * @property {string|null} [nextPageToken] ListConnectionsResponse nextPageToken + * @property {Array.|null} [connections] ListConnectionsResponse connections + */ + + /** + * Constructs a new ListConnectionsResponse. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a ListConnectionsResponse. + * @implements IListConnectionsResponse + * @constructor + * @param {google.cloud.bigquery.connection.v1.IListConnectionsResponse=} [properties] Properties to set + */ + function ListConnectionsResponse(properties) { + this.connections = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ListConnectionsResponse nextPageToken. + * @member {string} nextPageToken + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @instance + */ + ListConnectionsResponse.prototype.nextPageToken = ""; + + /** + * ListConnectionsResponse connections. + * @member {Array.} connections + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @instance + */ + ListConnectionsResponse.prototype.connections = $util.emptyArray; + + /** + * Creates a new ListConnectionsResponse instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @static + * @param {google.cloud.bigquery.connection.v1.IListConnectionsResponse=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.ListConnectionsResponse} ListConnectionsResponse instance + */ + ListConnectionsResponse.create = function create(properties) { + return new ListConnectionsResponse(properties); + }; + + /** + * Encodes the specified ListConnectionsResponse message. Does not implicitly {@link google.cloud.bigquery.connection.v1.ListConnectionsResponse.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @static + * @param {google.cloud.bigquery.connection.v1.IListConnectionsResponse} message ListConnectionsResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ListConnectionsResponse.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.nextPageToken != null && Object.hasOwnProperty.call(message, "nextPageToken")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.nextPageToken); + if (message.connections != null && message.connections.length) + for (var i = 0; i < message.connections.length; ++i) + $root.google.cloud.bigquery.connection.v1.Connection.encode(message.connections[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified ListConnectionsResponse message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.ListConnectionsResponse.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @static + * @param {google.cloud.bigquery.connection.v1.IListConnectionsResponse} message ListConnectionsResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ListConnectionsResponse.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ListConnectionsResponse message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.ListConnectionsResponse} ListConnectionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ListConnectionsResponse.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.ListConnectionsResponse(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.nextPageToken = reader.string(); + break; + } + case 2: { + if (!(message.connections && message.connections.length)) + message.connections = []; + message.connections.push($root.google.cloud.bigquery.connection.v1.Connection.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ListConnectionsResponse message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.ListConnectionsResponse} ListConnectionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ListConnectionsResponse.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ListConnectionsResponse message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ListConnectionsResponse.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.nextPageToken != null && message.hasOwnProperty("nextPageToken")) + if (!$util.isString(message.nextPageToken)) + return "nextPageToken: string expected"; + if (message.connections != null && message.hasOwnProperty("connections")) { + if (!Array.isArray(message.connections)) + return "connections: array expected"; + for (var i = 0; i < message.connections.length; ++i) { + var error = $root.google.cloud.bigquery.connection.v1.Connection.verify(message.connections[i]); + if (error) + return "connections." + error; + } + } + return null; + }; + + /** + * Creates a ListConnectionsResponse message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.ListConnectionsResponse} ListConnectionsResponse + */ + ListConnectionsResponse.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.ListConnectionsResponse) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.ListConnectionsResponse(); + if (object.nextPageToken != null) + message.nextPageToken = String(object.nextPageToken); + if (object.connections) { + if (!Array.isArray(object.connections)) + throw TypeError(".google.cloud.bigquery.connection.v1.ListConnectionsResponse.connections: array expected"); + message.connections = []; + for (var i = 0; i < object.connections.length; ++i) { + if (typeof object.connections[i] !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.ListConnectionsResponse.connections: object expected"); + message.connections[i] = $root.google.cloud.bigquery.connection.v1.Connection.fromObject(object.connections[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a ListConnectionsResponse message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @static + * @param {google.cloud.bigquery.connection.v1.ListConnectionsResponse} message ListConnectionsResponse + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ListConnectionsResponse.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.connections = []; + if (options.defaults) + object.nextPageToken = ""; + if (message.nextPageToken != null && message.hasOwnProperty("nextPageToken")) + object.nextPageToken = message.nextPageToken; + if (message.connections && message.connections.length) { + object.connections = []; + for (var j = 0; j < message.connections.length; ++j) + object.connections[j] = $root.google.cloud.bigquery.connection.v1.Connection.toObject(message.connections[j], options); + } + return object; + }; + + /** + * Converts this ListConnectionsResponse to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @instance + * @returns {Object.} JSON object + */ + ListConnectionsResponse.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for ListConnectionsResponse + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.ListConnectionsResponse + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ListConnectionsResponse.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.ListConnectionsResponse"; + }; + + return ListConnectionsResponse; + })(); + + v1.UpdateConnectionRequest = (function() { + + /** + * Properties of an UpdateConnectionRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IUpdateConnectionRequest + * @property {string|null} [name] UpdateConnectionRequest name + * @property {google.cloud.bigquery.connection.v1.IConnection|null} [connection] UpdateConnectionRequest connection + * @property {google.protobuf.IFieldMask|null} [updateMask] UpdateConnectionRequest updateMask + */ + + /** + * Constructs a new UpdateConnectionRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents an UpdateConnectionRequest. + * @implements IUpdateConnectionRequest + * @constructor + * @param {google.cloud.bigquery.connection.v1.IUpdateConnectionRequest=} [properties] Properties to set + */ + function UpdateConnectionRequest(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * UpdateConnectionRequest name. + * @member {string} name + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @instance + */ + UpdateConnectionRequest.prototype.name = ""; + + /** + * UpdateConnectionRequest connection. + * @member {google.cloud.bigquery.connection.v1.IConnection|null|undefined} connection + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @instance + */ + UpdateConnectionRequest.prototype.connection = null; + + /** + * UpdateConnectionRequest updateMask. + * @member {google.protobuf.IFieldMask|null|undefined} updateMask + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @instance + */ + UpdateConnectionRequest.prototype.updateMask = null; + + /** + * Creates a new UpdateConnectionRequest instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IUpdateConnectionRequest=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.UpdateConnectionRequest} UpdateConnectionRequest instance + */ + UpdateConnectionRequest.create = function create(properties) { + return new UpdateConnectionRequest(properties); + }; + + /** + * Encodes the specified UpdateConnectionRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.UpdateConnectionRequest.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IUpdateConnectionRequest} message UpdateConnectionRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + UpdateConnectionRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.connection != null && Object.hasOwnProperty.call(message, "connection")) + $root.google.cloud.bigquery.connection.v1.Connection.encode(message.connection, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.updateMask != null && Object.hasOwnProperty.call(message, "updateMask")) + $root.google.protobuf.FieldMask.encode(message.updateMask, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified UpdateConnectionRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.UpdateConnectionRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IUpdateConnectionRequest} message UpdateConnectionRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + UpdateConnectionRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an UpdateConnectionRequest message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.UpdateConnectionRequest} UpdateConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + UpdateConnectionRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.UpdateConnectionRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message.connection = $root.google.cloud.bigquery.connection.v1.Connection.decode(reader, reader.uint32()); + break; + } + case 3: { + message.updateMask = $root.google.protobuf.FieldMask.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an UpdateConnectionRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.UpdateConnectionRequest} UpdateConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + UpdateConnectionRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an UpdateConnectionRequest message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + UpdateConnectionRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.connection != null && message.hasOwnProperty("connection")) { + var error = $root.google.cloud.bigquery.connection.v1.Connection.verify(message.connection); + if (error) + return "connection." + error; + } + if (message.updateMask != null && message.hasOwnProperty("updateMask")) { + var error = $root.google.protobuf.FieldMask.verify(message.updateMask); + if (error) + return "updateMask." + error; + } + return null; + }; + + /** + * Creates an UpdateConnectionRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.UpdateConnectionRequest} UpdateConnectionRequest + */ + UpdateConnectionRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.UpdateConnectionRequest) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.UpdateConnectionRequest(); + if (object.name != null) + message.name = String(object.name); + if (object.connection != null) { + if (typeof object.connection !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.UpdateConnectionRequest.connection: object expected"); + message.connection = $root.google.cloud.bigquery.connection.v1.Connection.fromObject(object.connection); + } + if (object.updateMask != null) { + if (typeof object.updateMask !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.UpdateConnectionRequest.updateMask: object expected"); + message.updateMask = $root.google.protobuf.FieldMask.fromObject(object.updateMask); + } + return message; + }; + + /** + * Creates a plain object from an UpdateConnectionRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.UpdateConnectionRequest} message UpdateConnectionRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + UpdateConnectionRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.connection = null; + object.updateMask = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.connection != null && message.hasOwnProperty("connection")) + object.connection = $root.google.cloud.bigquery.connection.v1.Connection.toObject(message.connection, options); + if (message.updateMask != null && message.hasOwnProperty("updateMask")) + object.updateMask = $root.google.protobuf.FieldMask.toObject(message.updateMask, options); + return object; + }; + + /** + * Converts this UpdateConnectionRequest to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @instance + * @returns {Object.} JSON object + */ + UpdateConnectionRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for UpdateConnectionRequest + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.UpdateConnectionRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + UpdateConnectionRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.UpdateConnectionRequest"; + }; + + return UpdateConnectionRequest; + })(); + + v1.DeleteConnectionRequest = (function() { + + /** + * Properties of a DeleteConnectionRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IDeleteConnectionRequest + * @property {string|null} [name] DeleteConnectionRequest name + */ + + /** + * Constructs a new DeleteConnectionRequest. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a DeleteConnectionRequest. + * @implements IDeleteConnectionRequest + * @constructor + * @param {google.cloud.bigquery.connection.v1.IDeleteConnectionRequest=} [properties] Properties to set + */ + function DeleteConnectionRequest(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * DeleteConnectionRequest name. + * @member {string} name + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @instance + */ + DeleteConnectionRequest.prototype.name = ""; + + /** + * Creates a new DeleteConnectionRequest instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IDeleteConnectionRequest=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.DeleteConnectionRequest} DeleteConnectionRequest instance + */ + DeleteConnectionRequest.create = function create(properties) { + return new DeleteConnectionRequest(properties); + }; + + /** + * Encodes the specified DeleteConnectionRequest message. Does not implicitly {@link google.cloud.bigquery.connection.v1.DeleteConnectionRequest.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IDeleteConnectionRequest} message DeleteConnectionRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + DeleteConnectionRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + return writer; + }; + + /** + * Encodes the specified DeleteConnectionRequest message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.DeleteConnectionRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.IDeleteConnectionRequest} message DeleteConnectionRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + DeleteConnectionRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a DeleteConnectionRequest message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.DeleteConnectionRequest} DeleteConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + DeleteConnectionRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.DeleteConnectionRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a DeleteConnectionRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.DeleteConnectionRequest} DeleteConnectionRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + DeleteConnectionRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a DeleteConnectionRequest message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + DeleteConnectionRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + return null; + }; + + /** + * Creates a DeleteConnectionRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.DeleteConnectionRequest} DeleteConnectionRequest + */ + DeleteConnectionRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.DeleteConnectionRequest) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.DeleteConnectionRequest(); + if (object.name != null) + message.name = String(object.name); + return message; + }; + + /** + * Creates a plain object from a DeleteConnectionRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @static + * @param {google.cloud.bigquery.connection.v1.DeleteConnectionRequest} message DeleteConnectionRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + DeleteConnectionRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) + object.name = ""; + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + return object; + }; + + /** + * Converts this DeleteConnectionRequest to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @instance + * @returns {Object.} JSON object + */ + DeleteConnectionRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for DeleteConnectionRequest + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.DeleteConnectionRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + DeleteConnectionRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.DeleteConnectionRequest"; + }; + + return DeleteConnectionRequest; + })(); + + v1.Connection = (function() { + + /** + * Properties of a Connection. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IConnection + * @property {string|null} [name] Connection name + * @property {string|null} [friendlyName] Connection friendlyName + * @property {string|null} [description] Connection description + * @property {google.cloud.bigquery.connection.v1.ICloudSqlProperties|null} [cloudSql] Connection cloudSql + * @property {google.cloud.bigquery.connection.v1.IAwsProperties|null} [aws] Connection aws + * @property {google.cloud.bigquery.connection.v1.IAzureProperties|null} [azure] Connection azure + * @property {google.cloud.bigquery.connection.v1.ICloudSpannerProperties|null} [cloudSpanner] Connection cloudSpanner + * @property {google.cloud.bigquery.connection.v1.ICloudResourceProperties|null} [cloudResource] Connection cloudResource + * @property {number|Long|null} [creationTime] Connection creationTime + * @property {number|Long|null} [lastModifiedTime] Connection lastModifiedTime + * @property {boolean|null} [hasCredential] Connection hasCredential + */ + + /** + * Constructs a new Connection. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a Connection. + * @implements IConnection + * @constructor + * @param {google.cloud.bigquery.connection.v1.IConnection=} [properties] Properties to set + */ + function Connection(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Connection name. + * @member {string} name + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.name = ""; + + /** + * Connection friendlyName. + * @member {string} friendlyName + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.friendlyName = ""; + + /** + * Connection description. + * @member {string} description + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.description = ""; + + /** + * Connection cloudSql. + * @member {google.cloud.bigquery.connection.v1.ICloudSqlProperties|null|undefined} cloudSql + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.cloudSql = null; + + /** + * Connection aws. + * @member {google.cloud.bigquery.connection.v1.IAwsProperties|null|undefined} aws + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.aws = null; + + /** + * Connection azure. + * @member {google.cloud.bigquery.connection.v1.IAzureProperties|null|undefined} azure + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.azure = null; + + /** + * Connection cloudSpanner. + * @member {google.cloud.bigquery.connection.v1.ICloudSpannerProperties|null|undefined} cloudSpanner + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.cloudSpanner = null; + + /** + * Connection cloudResource. + * @member {google.cloud.bigquery.connection.v1.ICloudResourceProperties|null|undefined} cloudResource + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.cloudResource = null; + + /** + * Connection creationTime. + * @member {number|Long} creationTime + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.creationTime = $util.Long ? $util.Long.fromBits(0,0,false) : 0; + + /** + * Connection lastModifiedTime. + * @member {number|Long} lastModifiedTime + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.lastModifiedTime = $util.Long ? $util.Long.fromBits(0,0,false) : 0; + + /** + * Connection hasCredential. + * @member {boolean} hasCredential + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Connection.prototype.hasCredential = false; + + // OneOf field names bound to virtual getters and setters + var $oneOfFields; + + /** + * Connection properties. + * @member {"cloudSql"|"aws"|"azure"|"cloudSpanner"|"cloudResource"|undefined} properties + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + */ + Object.defineProperty(Connection.prototype, "properties", { + get: $util.oneOfGetter($oneOfFields = ["cloudSql", "aws", "azure", "cloudSpanner", "cloudResource"]), + set: $util.oneOfSetter($oneOfFields) + }); + + /** + * Creates a new Connection instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.Connection + * @static + * @param {google.cloud.bigquery.connection.v1.IConnection=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.Connection} Connection instance + */ + Connection.create = function create(properties) { + return new Connection(properties); + }; + + /** + * Encodes the specified Connection message. Does not implicitly {@link google.cloud.bigquery.connection.v1.Connection.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.Connection + * @static + * @param {google.cloud.bigquery.connection.v1.IConnection} message Connection message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Connection.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.friendlyName != null && Object.hasOwnProperty.call(message, "friendlyName")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.friendlyName); + if (message.description != null && Object.hasOwnProperty.call(message, "description")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.description); + if (message.cloudSql != null && Object.hasOwnProperty.call(message, "cloudSql")) + $root.google.cloud.bigquery.connection.v1.CloudSqlProperties.encode(message.cloudSql, writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.creationTime != null && Object.hasOwnProperty.call(message, "creationTime")) + writer.uint32(/* id 5, wireType 0 =*/40).int64(message.creationTime); + if (message.lastModifiedTime != null && Object.hasOwnProperty.call(message, "lastModifiedTime")) + writer.uint32(/* id 6, wireType 0 =*/48).int64(message.lastModifiedTime); + if (message.hasCredential != null && Object.hasOwnProperty.call(message, "hasCredential")) + writer.uint32(/* id 7, wireType 0 =*/56).bool(message.hasCredential); + if (message.aws != null && Object.hasOwnProperty.call(message, "aws")) + $root.google.cloud.bigquery.connection.v1.AwsProperties.encode(message.aws, writer.uint32(/* id 8, wireType 2 =*/66).fork()).ldelim(); + if (message.azure != null && Object.hasOwnProperty.call(message, "azure")) + $root.google.cloud.bigquery.connection.v1.AzureProperties.encode(message.azure, writer.uint32(/* id 11, wireType 2 =*/90).fork()).ldelim(); + if (message.cloudSpanner != null && Object.hasOwnProperty.call(message, "cloudSpanner")) + $root.google.cloud.bigquery.connection.v1.CloudSpannerProperties.encode(message.cloudSpanner, writer.uint32(/* id 21, wireType 2 =*/170).fork()).ldelim(); + if (message.cloudResource != null && Object.hasOwnProperty.call(message, "cloudResource")) + $root.google.cloud.bigquery.connection.v1.CloudResourceProperties.encode(message.cloudResource, writer.uint32(/* id 22, wireType 2 =*/178).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified Connection message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.Connection.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.Connection + * @static + * @param {google.cloud.bigquery.connection.v1.IConnection} message Connection message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Connection.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Connection message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.Connection + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.Connection} Connection + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Connection.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.Connection(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message.friendlyName = reader.string(); + break; + } + case 3: { + message.description = reader.string(); + break; + } + case 4: { + message.cloudSql = $root.google.cloud.bigquery.connection.v1.CloudSqlProperties.decode(reader, reader.uint32()); + break; + } + case 8: { + message.aws = $root.google.cloud.bigquery.connection.v1.AwsProperties.decode(reader, reader.uint32()); + break; + } + case 11: { + message.azure = $root.google.cloud.bigquery.connection.v1.AzureProperties.decode(reader, reader.uint32()); + break; + } + case 21: { + message.cloudSpanner = $root.google.cloud.bigquery.connection.v1.CloudSpannerProperties.decode(reader, reader.uint32()); + break; + } + case 22: { + message.cloudResource = $root.google.cloud.bigquery.connection.v1.CloudResourceProperties.decode(reader, reader.uint32()); + break; + } + case 5: { + message.creationTime = reader.int64(); + break; + } + case 6: { + message.lastModifiedTime = reader.int64(); + break; + } + case 7: { + message.hasCredential = reader.bool(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Connection message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.Connection + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.Connection} Connection + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Connection.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Connection message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.Connection + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Connection.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + var properties = {}; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.friendlyName != null && message.hasOwnProperty("friendlyName")) + if (!$util.isString(message.friendlyName)) + return "friendlyName: string expected"; + if (message.description != null && message.hasOwnProperty("description")) + if (!$util.isString(message.description)) + return "description: string expected"; + if (message.cloudSql != null && message.hasOwnProperty("cloudSql")) { + properties.properties = 1; + { + var error = $root.google.cloud.bigquery.connection.v1.CloudSqlProperties.verify(message.cloudSql); + if (error) + return "cloudSql." + error; + } + } + if (message.aws != null && message.hasOwnProperty("aws")) { + if (properties.properties === 1) + return "properties: multiple values"; + properties.properties = 1; + { + var error = $root.google.cloud.bigquery.connection.v1.AwsProperties.verify(message.aws); + if (error) + return "aws." + error; + } + } + if (message.azure != null && message.hasOwnProperty("azure")) { + if (properties.properties === 1) + return "properties: multiple values"; + properties.properties = 1; + { + var error = $root.google.cloud.bigquery.connection.v1.AzureProperties.verify(message.azure); + if (error) + return "azure." + error; + } + } + if (message.cloudSpanner != null && message.hasOwnProperty("cloudSpanner")) { + if (properties.properties === 1) + return "properties: multiple values"; + properties.properties = 1; + { + var error = $root.google.cloud.bigquery.connection.v1.CloudSpannerProperties.verify(message.cloudSpanner); + if (error) + return "cloudSpanner." + error; + } + } + if (message.cloudResource != null && message.hasOwnProperty("cloudResource")) { + if (properties.properties === 1) + return "properties: multiple values"; + properties.properties = 1; + { + var error = $root.google.cloud.bigquery.connection.v1.CloudResourceProperties.verify(message.cloudResource); + if (error) + return "cloudResource." + error; + } + } + if (message.creationTime != null && message.hasOwnProperty("creationTime")) + if (!$util.isInteger(message.creationTime) && !(message.creationTime && $util.isInteger(message.creationTime.low) && $util.isInteger(message.creationTime.high))) + return "creationTime: integer|Long expected"; + if (message.lastModifiedTime != null && message.hasOwnProperty("lastModifiedTime")) + if (!$util.isInteger(message.lastModifiedTime) && !(message.lastModifiedTime && $util.isInteger(message.lastModifiedTime.low) && $util.isInteger(message.lastModifiedTime.high))) + return "lastModifiedTime: integer|Long expected"; + if (message.hasCredential != null && message.hasOwnProperty("hasCredential")) + if (typeof message.hasCredential !== "boolean") + return "hasCredential: boolean expected"; + return null; + }; + + /** + * Creates a Connection message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.Connection + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.Connection} Connection + */ + Connection.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.Connection) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.Connection(); + if (object.name != null) + message.name = String(object.name); + if (object.friendlyName != null) + message.friendlyName = String(object.friendlyName); + if (object.description != null) + message.description = String(object.description); + if (object.cloudSql != null) { + if (typeof object.cloudSql !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.Connection.cloudSql: object expected"); + message.cloudSql = $root.google.cloud.bigquery.connection.v1.CloudSqlProperties.fromObject(object.cloudSql); + } + if (object.aws != null) { + if (typeof object.aws !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.Connection.aws: object expected"); + message.aws = $root.google.cloud.bigquery.connection.v1.AwsProperties.fromObject(object.aws); + } + if (object.azure != null) { + if (typeof object.azure !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.Connection.azure: object expected"); + message.azure = $root.google.cloud.bigquery.connection.v1.AzureProperties.fromObject(object.azure); + } + if (object.cloudSpanner != null) { + if (typeof object.cloudSpanner !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.Connection.cloudSpanner: object expected"); + message.cloudSpanner = $root.google.cloud.bigquery.connection.v1.CloudSpannerProperties.fromObject(object.cloudSpanner); + } + if (object.cloudResource != null) { + if (typeof object.cloudResource !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.Connection.cloudResource: object expected"); + message.cloudResource = $root.google.cloud.bigquery.connection.v1.CloudResourceProperties.fromObject(object.cloudResource); + } + if (object.creationTime != null) + if ($util.Long) + (message.creationTime = $util.Long.fromValue(object.creationTime)).unsigned = false; + else if (typeof object.creationTime === "string") + message.creationTime = parseInt(object.creationTime, 10); + else if (typeof object.creationTime === "number") + message.creationTime = object.creationTime; + else if (typeof object.creationTime === "object") + message.creationTime = new $util.LongBits(object.creationTime.low >>> 0, object.creationTime.high >>> 0).toNumber(); + if (object.lastModifiedTime != null) + if ($util.Long) + (message.lastModifiedTime = $util.Long.fromValue(object.lastModifiedTime)).unsigned = false; + else if (typeof object.lastModifiedTime === "string") + message.lastModifiedTime = parseInt(object.lastModifiedTime, 10); + else if (typeof object.lastModifiedTime === "number") + message.lastModifiedTime = object.lastModifiedTime; + else if (typeof object.lastModifiedTime === "object") + message.lastModifiedTime = new $util.LongBits(object.lastModifiedTime.low >>> 0, object.lastModifiedTime.high >>> 0).toNumber(); + if (object.hasCredential != null) + message.hasCredential = Boolean(object.hasCredential); + return message; + }; + + /** + * Creates a plain object from a Connection message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.Connection + * @static + * @param {google.cloud.bigquery.connection.v1.Connection} message Connection + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Connection.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.friendlyName = ""; + object.description = ""; + if ($util.Long) { + var long = new $util.Long(0, 0, false); + object.creationTime = options.longs === String ? long.toString() : options.longs === Number ? long.toNumber() : long; + } else + object.creationTime = options.longs === String ? "0" : 0; + if ($util.Long) { + var long = new $util.Long(0, 0, false); + object.lastModifiedTime = options.longs === String ? long.toString() : options.longs === Number ? long.toNumber() : long; + } else + object.lastModifiedTime = options.longs === String ? "0" : 0; + object.hasCredential = false; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.friendlyName != null && message.hasOwnProperty("friendlyName")) + object.friendlyName = message.friendlyName; + if (message.description != null && message.hasOwnProperty("description")) + object.description = message.description; + if (message.cloudSql != null && message.hasOwnProperty("cloudSql")) { + object.cloudSql = $root.google.cloud.bigquery.connection.v1.CloudSqlProperties.toObject(message.cloudSql, options); + if (options.oneofs) + object.properties = "cloudSql"; + } + if (message.creationTime != null && message.hasOwnProperty("creationTime")) + if (typeof message.creationTime === "number") + object.creationTime = options.longs === String ? String(message.creationTime) : message.creationTime; + else + object.creationTime = options.longs === String ? $util.Long.prototype.toString.call(message.creationTime) : options.longs === Number ? new $util.LongBits(message.creationTime.low >>> 0, message.creationTime.high >>> 0).toNumber() : message.creationTime; + if (message.lastModifiedTime != null && message.hasOwnProperty("lastModifiedTime")) + if (typeof message.lastModifiedTime === "number") + object.lastModifiedTime = options.longs === String ? String(message.lastModifiedTime) : message.lastModifiedTime; + else + object.lastModifiedTime = options.longs === String ? $util.Long.prototype.toString.call(message.lastModifiedTime) : options.longs === Number ? new $util.LongBits(message.lastModifiedTime.low >>> 0, message.lastModifiedTime.high >>> 0).toNumber() : message.lastModifiedTime; + if (message.hasCredential != null && message.hasOwnProperty("hasCredential")) + object.hasCredential = message.hasCredential; + if (message.aws != null && message.hasOwnProperty("aws")) { + object.aws = $root.google.cloud.bigquery.connection.v1.AwsProperties.toObject(message.aws, options); + if (options.oneofs) + object.properties = "aws"; + } + if (message.azure != null && message.hasOwnProperty("azure")) { + object.azure = $root.google.cloud.bigquery.connection.v1.AzureProperties.toObject(message.azure, options); + if (options.oneofs) + object.properties = "azure"; + } + if (message.cloudSpanner != null && message.hasOwnProperty("cloudSpanner")) { + object.cloudSpanner = $root.google.cloud.bigquery.connection.v1.CloudSpannerProperties.toObject(message.cloudSpanner, options); + if (options.oneofs) + object.properties = "cloudSpanner"; + } + if (message.cloudResource != null && message.hasOwnProperty("cloudResource")) { + object.cloudResource = $root.google.cloud.bigquery.connection.v1.CloudResourceProperties.toObject(message.cloudResource, options); + if (options.oneofs) + object.properties = "cloudResource"; + } + return object; + }; + + /** + * Converts this Connection to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.Connection + * @instance + * @returns {Object.} JSON object + */ + Connection.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for Connection + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.Connection + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Connection.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.Connection"; + }; + + return Connection; + })(); + + v1.CloudSqlProperties = (function() { + + /** + * Properties of a CloudSqlProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @interface ICloudSqlProperties + * @property {string|null} [instanceId] CloudSqlProperties instanceId + * @property {string|null} [database] CloudSqlProperties database + * @property {google.cloud.bigquery.connection.v1.CloudSqlProperties.DatabaseType|null} [type] CloudSqlProperties type + * @property {google.cloud.bigquery.connection.v1.ICloudSqlCredential|null} [credential] CloudSqlProperties credential + * @property {string|null} [serviceAccountId] CloudSqlProperties serviceAccountId + */ + + /** + * Constructs a new CloudSqlProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a CloudSqlProperties. + * @implements ICloudSqlProperties + * @constructor + * @param {google.cloud.bigquery.connection.v1.ICloudSqlProperties=} [properties] Properties to set + */ + function CloudSqlProperties(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * CloudSqlProperties instanceId. + * @member {string} instanceId + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @instance + */ + CloudSqlProperties.prototype.instanceId = ""; + + /** + * CloudSqlProperties database. + * @member {string} database + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @instance + */ + CloudSqlProperties.prototype.database = ""; + + /** + * CloudSqlProperties type. + * @member {google.cloud.bigquery.connection.v1.CloudSqlProperties.DatabaseType} type + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @instance + */ + CloudSqlProperties.prototype.type = 0; + + /** + * CloudSqlProperties credential. + * @member {google.cloud.bigquery.connection.v1.ICloudSqlCredential|null|undefined} credential + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @instance + */ + CloudSqlProperties.prototype.credential = null; + + /** + * CloudSqlProperties serviceAccountId. + * @member {string} serviceAccountId + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @instance + */ + CloudSqlProperties.prototype.serviceAccountId = ""; + + /** + * Creates a new CloudSqlProperties instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudSqlProperties=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.CloudSqlProperties} CloudSqlProperties instance + */ + CloudSqlProperties.create = function create(properties) { + return new CloudSqlProperties(properties); + }; + + /** + * Encodes the specified CloudSqlProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSqlProperties.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudSqlProperties} message CloudSqlProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CloudSqlProperties.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.instanceId != null && Object.hasOwnProperty.call(message, "instanceId")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.instanceId); + if (message.database != null && Object.hasOwnProperty.call(message, "database")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.database); + if (message.type != null && Object.hasOwnProperty.call(message, "type")) + writer.uint32(/* id 3, wireType 0 =*/24).int32(message.type); + if (message.credential != null && Object.hasOwnProperty.call(message, "credential")) + $root.google.cloud.bigquery.connection.v1.CloudSqlCredential.encode(message.credential, writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.serviceAccountId != null && Object.hasOwnProperty.call(message, "serviceAccountId")) + writer.uint32(/* id 5, wireType 2 =*/42).string(message.serviceAccountId); + return writer; + }; + + /** + * Encodes the specified CloudSqlProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSqlProperties.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudSqlProperties} message CloudSqlProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CloudSqlProperties.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a CloudSqlProperties message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.CloudSqlProperties} CloudSqlProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CloudSqlProperties.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.CloudSqlProperties(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.instanceId = reader.string(); + break; + } + case 2: { + message.database = reader.string(); + break; + } + case 3: { + message.type = reader.int32(); + break; + } + case 4: { + message.credential = $root.google.cloud.bigquery.connection.v1.CloudSqlCredential.decode(reader, reader.uint32()); + break; + } + case 5: { + message.serviceAccountId = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a CloudSqlProperties message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.CloudSqlProperties} CloudSqlProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CloudSqlProperties.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a CloudSqlProperties message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + CloudSqlProperties.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.instanceId != null && message.hasOwnProperty("instanceId")) + if (!$util.isString(message.instanceId)) + return "instanceId: string expected"; + if (message.database != null && message.hasOwnProperty("database")) + if (!$util.isString(message.database)) + return "database: string expected"; + if (message.type != null && message.hasOwnProperty("type")) + switch (message.type) { + default: + return "type: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.credential != null && message.hasOwnProperty("credential")) { + var error = $root.google.cloud.bigquery.connection.v1.CloudSqlCredential.verify(message.credential); + if (error) + return "credential." + error; + } + if (message.serviceAccountId != null && message.hasOwnProperty("serviceAccountId")) + if (!$util.isString(message.serviceAccountId)) + return "serviceAccountId: string expected"; + return null; + }; + + /** + * Creates a CloudSqlProperties message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.CloudSqlProperties} CloudSqlProperties + */ + CloudSqlProperties.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.CloudSqlProperties) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.CloudSqlProperties(); + if (object.instanceId != null) + message.instanceId = String(object.instanceId); + if (object.database != null) + message.database = String(object.database); + switch (object.type) { + default: + if (typeof object.type === "number") { + message.type = object.type; + break; + } + break; + case "DATABASE_TYPE_UNSPECIFIED": + case 0: + message.type = 0; + break; + case "POSTGRES": + case 1: + message.type = 1; + break; + case "MYSQL": + case 2: + message.type = 2; + break; + } + if (object.credential != null) { + if (typeof object.credential !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.CloudSqlProperties.credential: object expected"); + message.credential = $root.google.cloud.bigquery.connection.v1.CloudSqlCredential.fromObject(object.credential); + } + if (object.serviceAccountId != null) + message.serviceAccountId = String(object.serviceAccountId); + return message; + }; + + /** + * Creates a plain object from a CloudSqlProperties message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @static + * @param {google.cloud.bigquery.connection.v1.CloudSqlProperties} message CloudSqlProperties + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + CloudSqlProperties.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.instanceId = ""; + object.database = ""; + object.type = options.enums === String ? "DATABASE_TYPE_UNSPECIFIED" : 0; + object.credential = null; + object.serviceAccountId = ""; + } + if (message.instanceId != null && message.hasOwnProperty("instanceId")) + object.instanceId = message.instanceId; + if (message.database != null && message.hasOwnProperty("database")) + object.database = message.database; + if (message.type != null && message.hasOwnProperty("type")) + object.type = options.enums === String ? $root.google.cloud.bigquery.connection.v1.CloudSqlProperties.DatabaseType[message.type] === undefined ? message.type : $root.google.cloud.bigquery.connection.v1.CloudSqlProperties.DatabaseType[message.type] : message.type; + if (message.credential != null && message.hasOwnProperty("credential")) + object.credential = $root.google.cloud.bigquery.connection.v1.CloudSqlCredential.toObject(message.credential, options); + if (message.serviceAccountId != null && message.hasOwnProperty("serviceAccountId")) + object.serviceAccountId = message.serviceAccountId; + return object; + }; + + /** + * Converts this CloudSqlProperties to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @instance + * @returns {Object.} JSON object + */ + CloudSqlProperties.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for CloudSqlProperties + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.CloudSqlProperties + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + CloudSqlProperties.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.CloudSqlProperties"; + }; + + /** + * DatabaseType enum. + * @name google.cloud.bigquery.connection.v1.CloudSqlProperties.DatabaseType + * @enum {number} + * @property {number} DATABASE_TYPE_UNSPECIFIED=0 DATABASE_TYPE_UNSPECIFIED value + * @property {number} POSTGRES=1 POSTGRES value + * @property {number} MYSQL=2 MYSQL value + */ + CloudSqlProperties.DatabaseType = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "DATABASE_TYPE_UNSPECIFIED"] = 0; + values[valuesById[1] = "POSTGRES"] = 1; + values[valuesById[2] = "MYSQL"] = 2; + return values; + })(); + + return CloudSqlProperties; + })(); + + v1.CloudSqlCredential = (function() { + + /** + * Properties of a CloudSqlCredential. + * @memberof google.cloud.bigquery.connection.v1 + * @interface ICloudSqlCredential + * @property {string|null} [username] CloudSqlCredential username + * @property {string|null} [password] CloudSqlCredential password + */ + + /** + * Constructs a new CloudSqlCredential. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a CloudSqlCredential. + * @implements ICloudSqlCredential + * @constructor + * @param {google.cloud.bigquery.connection.v1.ICloudSqlCredential=} [properties] Properties to set + */ + function CloudSqlCredential(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * CloudSqlCredential username. + * @member {string} username + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @instance + */ + CloudSqlCredential.prototype.username = ""; + + /** + * CloudSqlCredential password. + * @member {string} password + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @instance + */ + CloudSqlCredential.prototype.password = ""; + + /** + * Creates a new CloudSqlCredential instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudSqlCredential=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.CloudSqlCredential} CloudSqlCredential instance + */ + CloudSqlCredential.create = function create(properties) { + return new CloudSqlCredential(properties); + }; + + /** + * Encodes the specified CloudSqlCredential message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSqlCredential.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudSqlCredential} message CloudSqlCredential message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CloudSqlCredential.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.username != null && Object.hasOwnProperty.call(message, "username")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.username); + if (message.password != null && Object.hasOwnProperty.call(message, "password")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.password); + return writer; + }; + + /** + * Encodes the specified CloudSqlCredential message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSqlCredential.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudSqlCredential} message CloudSqlCredential message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CloudSqlCredential.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a CloudSqlCredential message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.CloudSqlCredential} CloudSqlCredential + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CloudSqlCredential.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.CloudSqlCredential(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.username = reader.string(); + break; + } + case 2: { + message.password = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a CloudSqlCredential message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.CloudSqlCredential} CloudSqlCredential + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CloudSqlCredential.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a CloudSqlCredential message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + CloudSqlCredential.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.username != null && message.hasOwnProperty("username")) + if (!$util.isString(message.username)) + return "username: string expected"; + if (message.password != null && message.hasOwnProperty("password")) + if (!$util.isString(message.password)) + return "password: string expected"; + return null; + }; + + /** + * Creates a CloudSqlCredential message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.CloudSqlCredential} CloudSqlCredential + */ + CloudSqlCredential.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.CloudSqlCredential) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.CloudSqlCredential(); + if (object.username != null) + message.username = String(object.username); + if (object.password != null) + message.password = String(object.password); + return message; + }; + + /** + * Creates a plain object from a CloudSqlCredential message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @static + * @param {google.cloud.bigquery.connection.v1.CloudSqlCredential} message CloudSqlCredential + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + CloudSqlCredential.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.username = ""; + object.password = ""; + } + if (message.username != null && message.hasOwnProperty("username")) + object.username = message.username; + if (message.password != null && message.hasOwnProperty("password")) + object.password = message.password; + return object; + }; + + /** + * Converts this CloudSqlCredential to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @instance + * @returns {Object.} JSON object + */ + CloudSqlCredential.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for CloudSqlCredential + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.CloudSqlCredential + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + CloudSqlCredential.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.CloudSqlCredential"; + }; + + return CloudSqlCredential; + })(); + + v1.CloudSpannerProperties = (function() { + + /** + * Properties of a CloudSpannerProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @interface ICloudSpannerProperties + * @property {string|null} [database] CloudSpannerProperties database + * @property {boolean|null} [useParallelism] CloudSpannerProperties useParallelism + */ + + /** + * Constructs a new CloudSpannerProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a CloudSpannerProperties. + * @implements ICloudSpannerProperties + * @constructor + * @param {google.cloud.bigquery.connection.v1.ICloudSpannerProperties=} [properties] Properties to set + */ + function CloudSpannerProperties(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * CloudSpannerProperties database. + * @member {string} database + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @instance + */ + CloudSpannerProperties.prototype.database = ""; + + /** + * CloudSpannerProperties useParallelism. + * @member {boolean} useParallelism + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @instance + */ + CloudSpannerProperties.prototype.useParallelism = false; + + /** + * Creates a new CloudSpannerProperties instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudSpannerProperties=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.CloudSpannerProperties} CloudSpannerProperties instance + */ + CloudSpannerProperties.create = function create(properties) { + return new CloudSpannerProperties(properties); + }; + + /** + * Encodes the specified CloudSpannerProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSpannerProperties.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudSpannerProperties} message CloudSpannerProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CloudSpannerProperties.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.database != null && Object.hasOwnProperty.call(message, "database")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.database); + if (message.useParallelism != null && Object.hasOwnProperty.call(message, "useParallelism")) + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.useParallelism); + return writer; + }; + + /** + * Encodes the specified CloudSpannerProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudSpannerProperties.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudSpannerProperties} message CloudSpannerProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CloudSpannerProperties.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a CloudSpannerProperties message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.CloudSpannerProperties} CloudSpannerProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CloudSpannerProperties.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.CloudSpannerProperties(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.database = reader.string(); + break; + } + case 2: { + message.useParallelism = reader.bool(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a CloudSpannerProperties message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.CloudSpannerProperties} CloudSpannerProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CloudSpannerProperties.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a CloudSpannerProperties message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + CloudSpannerProperties.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.database != null && message.hasOwnProperty("database")) + if (!$util.isString(message.database)) + return "database: string expected"; + if (message.useParallelism != null && message.hasOwnProperty("useParallelism")) + if (typeof message.useParallelism !== "boolean") + return "useParallelism: boolean expected"; + return null; + }; + + /** + * Creates a CloudSpannerProperties message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.CloudSpannerProperties} CloudSpannerProperties + */ + CloudSpannerProperties.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.CloudSpannerProperties) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.CloudSpannerProperties(); + if (object.database != null) + message.database = String(object.database); + if (object.useParallelism != null) + message.useParallelism = Boolean(object.useParallelism); + return message; + }; + + /** + * Creates a plain object from a CloudSpannerProperties message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @static + * @param {google.cloud.bigquery.connection.v1.CloudSpannerProperties} message CloudSpannerProperties + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + CloudSpannerProperties.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.database = ""; + object.useParallelism = false; + } + if (message.database != null && message.hasOwnProperty("database")) + object.database = message.database; + if (message.useParallelism != null && message.hasOwnProperty("useParallelism")) + object.useParallelism = message.useParallelism; + return object; + }; + + /** + * Converts this CloudSpannerProperties to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @instance + * @returns {Object.} JSON object + */ + CloudSpannerProperties.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for CloudSpannerProperties + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.CloudSpannerProperties + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + CloudSpannerProperties.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.CloudSpannerProperties"; + }; + + return CloudSpannerProperties; + })(); + + v1.AwsProperties = (function() { + + /** + * Properties of an AwsProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IAwsProperties + * @property {google.cloud.bigquery.connection.v1.IAwsCrossAccountRole|null} [crossAccountRole] AwsProperties crossAccountRole + * @property {google.cloud.bigquery.connection.v1.IAwsAccessRole|null} [accessRole] AwsProperties accessRole + */ + + /** + * Constructs a new AwsProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents an AwsProperties. + * @implements IAwsProperties + * @constructor + * @param {google.cloud.bigquery.connection.v1.IAwsProperties=} [properties] Properties to set + */ + function AwsProperties(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * AwsProperties crossAccountRole. + * @member {google.cloud.bigquery.connection.v1.IAwsCrossAccountRole|null|undefined} crossAccountRole + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @instance + */ + AwsProperties.prototype.crossAccountRole = null; + + /** + * AwsProperties accessRole. + * @member {google.cloud.bigquery.connection.v1.IAwsAccessRole|null|undefined} accessRole + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @instance + */ + AwsProperties.prototype.accessRole = null; + + // OneOf field names bound to virtual getters and setters + var $oneOfFields; + + /** + * AwsProperties authenticationMethod. + * @member {"crossAccountRole"|"accessRole"|undefined} authenticationMethod + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @instance + */ + Object.defineProperty(AwsProperties.prototype, "authenticationMethod", { + get: $util.oneOfGetter($oneOfFields = ["crossAccountRole", "accessRole"]), + set: $util.oneOfSetter($oneOfFields) + }); + + /** + * Creates a new AwsProperties instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @static + * @param {google.cloud.bigquery.connection.v1.IAwsProperties=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.AwsProperties} AwsProperties instance + */ + AwsProperties.create = function create(properties) { + return new AwsProperties(properties); + }; + + /** + * Encodes the specified AwsProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsProperties.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @static + * @param {google.cloud.bigquery.connection.v1.IAwsProperties} message AwsProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AwsProperties.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.crossAccountRole != null && Object.hasOwnProperty.call(message, "crossAccountRole")) + $root.google.cloud.bigquery.connection.v1.AwsCrossAccountRole.encode(message.crossAccountRole, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.accessRole != null && Object.hasOwnProperty.call(message, "accessRole")) + $root.google.cloud.bigquery.connection.v1.AwsAccessRole.encode(message.accessRole, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified AwsProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsProperties.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @static + * @param {google.cloud.bigquery.connection.v1.IAwsProperties} message AwsProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AwsProperties.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an AwsProperties message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.AwsProperties} AwsProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AwsProperties.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.AwsProperties(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 2: { + message.crossAccountRole = $root.google.cloud.bigquery.connection.v1.AwsCrossAccountRole.decode(reader, reader.uint32()); + break; + } + case 3: { + message.accessRole = $root.google.cloud.bigquery.connection.v1.AwsAccessRole.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an AwsProperties message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.AwsProperties} AwsProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AwsProperties.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an AwsProperties message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + AwsProperties.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + var properties = {}; + if (message.crossAccountRole != null && message.hasOwnProperty("crossAccountRole")) { + properties.authenticationMethod = 1; + { + var error = $root.google.cloud.bigquery.connection.v1.AwsCrossAccountRole.verify(message.crossAccountRole); + if (error) + return "crossAccountRole." + error; + } + } + if (message.accessRole != null && message.hasOwnProperty("accessRole")) { + if (properties.authenticationMethod === 1) + return "authenticationMethod: multiple values"; + properties.authenticationMethod = 1; + { + var error = $root.google.cloud.bigquery.connection.v1.AwsAccessRole.verify(message.accessRole); + if (error) + return "accessRole." + error; + } + } + return null; + }; + + /** + * Creates an AwsProperties message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.AwsProperties} AwsProperties + */ + AwsProperties.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.AwsProperties) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.AwsProperties(); + if (object.crossAccountRole != null) { + if (typeof object.crossAccountRole !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.AwsProperties.crossAccountRole: object expected"); + message.crossAccountRole = $root.google.cloud.bigquery.connection.v1.AwsCrossAccountRole.fromObject(object.crossAccountRole); + } + if (object.accessRole != null) { + if (typeof object.accessRole !== "object") + throw TypeError(".google.cloud.bigquery.connection.v1.AwsProperties.accessRole: object expected"); + message.accessRole = $root.google.cloud.bigquery.connection.v1.AwsAccessRole.fromObject(object.accessRole); + } + return message; + }; + + /** + * Creates a plain object from an AwsProperties message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @static + * @param {google.cloud.bigquery.connection.v1.AwsProperties} message AwsProperties + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + AwsProperties.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (message.crossAccountRole != null && message.hasOwnProperty("crossAccountRole")) { + object.crossAccountRole = $root.google.cloud.bigquery.connection.v1.AwsCrossAccountRole.toObject(message.crossAccountRole, options); + if (options.oneofs) + object.authenticationMethod = "crossAccountRole"; + } + if (message.accessRole != null && message.hasOwnProperty("accessRole")) { + object.accessRole = $root.google.cloud.bigquery.connection.v1.AwsAccessRole.toObject(message.accessRole, options); + if (options.oneofs) + object.authenticationMethod = "accessRole"; + } + return object; + }; + + /** + * Converts this AwsProperties to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @instance + * @returns {Object.} JSON object + */ + AwsProperties.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for AwsProperties + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.AwsProperties + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + AwsProperties.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.AwsProperties"; + }; + + return AwsProperties; + })(); + + v1.AwsCrossAccountRole = (function() { + + /** + * Properties of an AwsCrossAccountRole. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IAwsCrossAccountRole + * @property {string|null} [iamRoleId] AwsCrossAccountRole iamRoleId + * @property {string|null} [iamUserId] AwsCrossAccountRole iamUserId + * @property {string|null} [externalId] AwsCrossAccountRole externalId + */ + + /** + * Constructs a new AwsCrossAccountRole. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents an AwsCrossAccountRole. + * @implements IAwsCrossAccountRole + * @constructor + * @param {google.cloud.bigquery.connection.v1.IAwsCrossAccountRole=} [properties] Properties to set + */ + function AwsCrossAccountRole(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * AwsCrossAccountRole iamRoleId. + * @member {string} iamRoleId + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @instance + */ + AwsCrossAccountRole.prototype.iamRoleId = ""; + + /** + * AwsCrossAccountRole iamUserId. + * @member {string} iamUserId + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @instance + */ + AwsCrossAccountRole.prototype.iamUserId = ""; + + /** + * AwsCrossAccountRole externalId. + * @member {string} externalId + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @instance + */ + AwsCrossAccountRole.prototype.externalId = ""; + + /** + * Creates a new AwsCrossAccountRole instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @static + * @param {google.cloud.bigquery.connection.v1.IAwsCrossAccountRole=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.AwsCrossAccountRole} AwsCrossAccountRole instance + */ + AwsCrossAccountRole.create = function create(properties) { + return new AwsCrossAccountRole(properties); + }; + + /** + * Encodes the specified AwsCrossAccountRole message. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsCrossAccountRole.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @static + * @param {google.cloud.bigquery.connection.v1.IAwsCrossAccountRole} message AwsCrossAccountRole message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AwsCrossAccountRole.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.iamRoleId != null && Object.hasOwnProperty.call(message, "iamRoleId")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.iamRoleId); + if (message.iamUserId != null && Object.hasOwnProperty.call(message, "iamUserId")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.iamUserId); + if (message.externalId != null && Object.hasOwnProperty.call(message, "externalId")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.externalId); + return writer; + }; + + /** + * Encodes the specified AwsCrossAccountRole message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsCrossAccountRole.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @static + * @param {google.cloud.bigquery.connection.v1.IAwsCrossAccountRole} message AwsCrossAccountRole message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AwsCrossAccountRole.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an AwsCrossAccountRole message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.AwsCrossAccountRole} AwsCrossAccountRole + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AwsCrossAccountRole.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.AwsCrossAccountRole(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.iamRoleId = reader.string(); + break; + } + case 2: { + message.iamUserId = reader.string(); + break; + } + case 3: { + message.externalId = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an AwsCrossAccountRole message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.AwsCrossAccountRole} AwsCrossAccountRole + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AwsCrossAccountRole.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an AwsCrossAccountRole message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + AwsCrossAccountRole.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.iamRoleId != null && message.hasOwnProperty("iamRoleId")) + if (!$util.isString(message.iamRoleId)) + return "iamRoleId: string expected"; + if (message.iamUserId != null && message.hasOwnProperty("iamUserId")) + if (!$util.isString(message.iamUserId)) + return "iamUserId: string expected"; + if (message.externalId != null && message.hasOwnProperty("externalId")) + if (!$util.isString(message.externalId)) + return "externalId: string expected"; + return null; + }; + + /** + * Creates an AwsCrossAccountRole message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.AwsCrossAccountRole} AwsCrossAccountRole + */ + AwsCrossAccountRole.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.AwsCrossAccountRole) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.AwsCrossAccountRole(); + if (object.iamRoleId != null) + message.iamRoleId = String(object.iamRoleId); + if (object.iamUserId != null) + message.iamUserId = String(object.iamUserId); + if (object.externalId != null) + message.externalId = String(object.externalId); + return message; + }; + + /** + * Creates a plain object from an AwsCrossAccountRole message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @static + * @param {google.cloud.bigquery.connection.v1.AwsCrossAccountRole} message AwsCrossAccountRole + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + AwsCrossAccountRole.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.iamRoleId = ""; + object.iamUserId = ""; + object.externalId = ""; + } + if (message.iamRoleId != null && message.hasOwnProperty("iamRoleId")) + object.iamRoleId = message.iamRoleId; + if (message.iamUserId != null && message.hasOwnProperty("iamUserId")) + object.iamUserId = message.iamUserId; + if (message.externalId != null && message.hasOwnProperty("externalId")) + object.externalId = message.externalId; + return object; + }; + + /** + * Converts this AwsCrossAccountRole to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @instance + * @returns {Object.} JSON object + */ + AwsCrossAccountRole.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for AwsCrossAccountRole + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.AwsCrossAccountRole + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + AwsCrossAccountRole.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.AwsCrossAccountRole"; + }; + + return AwsCrossAccountRole; + })(); + + v1.AwsAccessRole = (function() { + + /** + * Properties of an AwsAccessRole. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IAwsAccessRole + * @property {string|null} [iamRoleId] AwsAccessRole iamRoleId + * @property {string|null} [identity] AwsAccessRole identity + */ + + /** + * Constructs a new AwsAccessRole. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents an AwsAccessRole. + * @implements IAwsAccessRole + * @constructor + * @param {google.cloud.bigquery.connection.v1.IAwsAccessRole=} [properties] Properties to set + */ + function AwsAccessRole(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * AwsAccessRole iamRoleId. + * @member {string} iamRoleId + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @instance + */ + AwsAccessRole.prototype.iamRoleId = ""; + + /** + * AwsAccessRole identity. + * @member {string} identity + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @instance + */ + AwsAccessRole.prototype.identity = ""; + + /** + * Creates a new AwsAccessRole instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @static + * @param {google.cloud.bigquery.connection.v1.IAwsAccessRole=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.AwsAccessRole} AwsAccessRole instance + */ + AwsAccessRole.create = function create(properties) { + return new AwsAccessRole(properties); + }; + + /** + * Encodes the specified AwsAccessRole message. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsAccessRole.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @static + * @param {google.cloud.bigquery.connection.v1.IAwsAccessRole} message AwsAccessRole message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AwsAccessRole.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.iamRoleId != null && Object.hasOwnProperty.call(message, "iamRoleId")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.iamRoleId); + if (message.identity != null && Object.hasOwnProperty.call(message, "identity")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.identity); + return writer; + }; + + /** + * Encodes the specified AwsAccessRole message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.AwsAccessRole.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @static + * @param {google.cloud.bigquery.connection.v1.IAwsAccessRole} message AwsAccessRole message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AwsAccessRole.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an AwsAccessRole message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.AwsAccessRole} AwsAccessRole + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AwsAccessRole.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.AwsAccessRole(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.iamRoleId = reader.string(); + break; + } + case 2: { + message.identity = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an AwsAccessRole message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.AwsAccessRole} AwsAccessRole + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AwsAccessRole.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an AwsAccessRole message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + AwsAccessRole.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.iamRoleId != null && message.hasOwnProperty("iamRoleId")) + if (!$util.isString(message.iamRoleId)) + return "iamRoleId: string expected"; + if (message.identity != null && message.hasOwnProperty("identity")) + if (!$util.isString(message.identity)) + return "identity: string expected"; + return null; + }; + + /** + * Creates an AwsAccessRole message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.AwsAccessRole} AwsAccessRole + */ + AwsAccessRole.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.AwsAccessRole) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.AwsAccessRole(); + if (object.iamRoleId != null) + message.iamRoleId = String(object.iamRoleId); + if (object.identity != null) + message.identity = String(object.identity); + return message; + }; + + /** + * Creates a plain object from an AwsAccessRole message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @static + * @param {google.cloud.bigquery.connection.v1.AwsAccessRole} message AwsAccessRole + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + AwsAccessRole.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.iamRoleId = ""; + object.identity = ""; + } + if (message.iamRoleId != null && message.hasOwnProperty("iamRoleId")) + object.iamRoleId = message.iamRoleId; + if (message.identity != null && message.hasOwnProperty("identity")) + object.identity = message.identity; + return object; + }; + + /** + * Converts this AwsAccessRole to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @instance + * @returns {Object.} JSON object + */ + AwsAccessRole.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for AwsAccessRole + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.AwsAccessRole + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + AwsAccessRole.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.AwsAccessRole"; + }; + + return AwsAccessRole; + })(); + + v1.AzureProperties = (function() { + + /** + * Properties of an AzureProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @interface IAzureProperties + * @property {string|null} [application] AzureProperties application + * @property {string|null} [clientId] AzureProperties clientId + * @property {string|null} [objectId] AzureProperties objectId + * @property {string|null} [customerTenantId] AzureProperties customerTenantId + * @property {string|null} [redirectUri] AzureProperties redirectUri + * @property {string|null} [federatedApplicationClientId] AzureProperties federatedApplicationClientId + * @property {string|null} [identity] AzureProperties identity + */ + + /** + * Constructs a new AzureProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents an AzureProperties. + * @implements IAzureProperties + * @constructor + * @param {google.cloud.bigquery.connection.v1.IAzureProperties=} [properties] Properties to set + */ + function AzureProperties(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * AzureProperties application. + * @member {string} application + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @instance + */ + AzureProperties.prototype.application = ""; + + /** + * AzureProperties clientId. + * @member {string} clientId + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @instance + */ + AzureProperties.prototype.clientId = ""; + + /** + * AzureProperties objectId. + * @member {string} objectId + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @instance + */ + AzureProperties.prototype.objectId = ""; + + /** + * AzureProperties customerTenantId. + * @member {string} customerTenantId + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @instance + */ + AzureProperties.prototype.customerTenantId = ""; + + /** + * AzureProperties redirectUri. + * @member {string} redirectUri + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @instance + */ + AzureProperties.prototype.redirectUri = ""; + + /** + * AzureProperties federatedApplicationClientId. + * @member {string} federatedApplicationClientId + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @instance + */ + AzureProperties.prototype.federatedApplicationClientId = ""; + + /** + * AzureProperties identity. + * @member {string} identity + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @instance + */ + AzureProperties.prototype.identity = ""; + + /** + * Creates a new AzureProperties instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @static + * @param {google.cloud.bigquery.connection.v1.IAzureProperties=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.AzureProperties} AzureProperties instance + */ + AzureProperties.create = function create(properties) { + return new AzureProperties(properties); + }; + + /** + * Encodes the specified AzureProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.AzureProperties.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @static + * @param {google.cloud.bigquery.connection.v1.IAzureProperties} message AzureProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AzureProperties.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.application != null && Object.hasOwnProperty.call(message, "application")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.application); + if (message.clientId != null && Object.hasOwnProperty.call(message, "clientId")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.clientId); + if (message.objectId != null && Object.hasOwnProperty.call(message, "objectId")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.objectId); + if (message.customerTenantId != null && Object.hasOwnProperty.call(message, "customerTenantId")) + writer.uint32(/* id 4, wireType 2 =*/34).string(message.customerTenantId); + if (message.redirectUri != null && Object.hasOwnProperty.call(message, "redirectUri")) + writer.uint32(/* id 5, wireType 2 =*/42).string(message.redirectUri); + if (message.federatedApplicationClientId != null && Object.hasOwnProperty.call(message, "federatedApplicationClientId")) + writer.uint32(/* id 6, wireType 2 =*/50).string(message.federatedApplicationClientId); + if (message.identity != null && Object.hasOwnProperty.call(message, "identity")) + writer.uint32(/* id 7, wireType 2 =*/58).string(message.identity); + return writer; + }; + + /** + * Encodes the specified AzureProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.AzureProperties.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @static + * @param {google.cloud.bigquery.connection.v1.IAzureProperties} message AzureProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AzureProperties.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an AzureProperties message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.AzureProperties} AzureProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AzureProperties.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.AzureProperties(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.application = reader.string(); + break; + } + case 2: { + message.clientId = reader.string(); + break; + } + case 3: { + message.objectId = reader.string(); + break; + } + case 4: { + message.customerTenantId = reader.string(); + break; + } + case 5: { + message.redirectUri = reader.string(); + break; + } + case 6: { + message.federatedApplicationClientId = reader.string(); + break; + } + case 7: { + message.identity = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an AzureProperties message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.AzureProperties} AzureProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AzureProperties.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an AzureProperties message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + AzureProperties.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.application != null && message.hasOwnProperty("application")) + if (!$util.isString(message.application)) + return "application: string expected"; + if (message.clientId != null && message.hasOwnProperty("clientId")) + if (!$util.isString(message.clientId)) + return "clientId: string expected"; + if (message.objectId != null && message.hasOwnProperty("objectId")) + if (!$util.isString(message.objectId)) + return "objectId: string expected"; + if (message.customerTenantId != null && message.hasOwnProperty("customerTenantId")) + if (!$util.isString(message.customerTenantId)) + return "customerTenantId: string expected"; + if (message.redirectUri != null && message.hasOwnProperty("redirectUri")) + if (!$util.isString(message.redirectUri)) + return "redirectUri: string expected"; + if (message.federatedApplicationClientId != null && message.hasOwnProperty("federatedApplicationClientId")) + if (!$util.isString(message.federatedApplicationClientId)) + return "federatedApplicationClientId: string expected"; + if (message.identity != null && message.hasOwnProperty("identity")) + if (!$util.isString(message.identity)) + return "identity: string expected"; + return null; + }; + + /** + * Creates an AzureProperties message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.AzureProperties} AzureProperties + */ + AzureProperties.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.AzureProperties) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.AzureProperties(); + if (object.application != null) + message.application = String(object.application); + if (object.clientId != null) + message.clientId = String(object.clientId); + if (object.objectId != null) + message.objectId = String(object.objectId); + if (object.customerTenantId != null) + message.customerTenantId = String(object.customerTenantId); + if (object.redirectUri != null) + message.redirectUri = String(object.redirectUri); + if (object.federatedApplicationClientId != null) + message.federatedApplicationClientId = String(object.federatedApplicationClientId); + if (object.identity != null) + message.identity = String(object.identity); + return message; + }; + + /** + * Creates a plain object from an AzureProperties message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @static + * @param {google.cloud.bigquery.connection.v1.AzureProperties} message AzureProperties + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + AzureProperties.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.application = ""; + object.clientId = ""; + object.objectId = ""; + object.customerTenantId = ""; + object.redirectUri = ""; + object.federatedApplicationClientId = ""; + object.identity = ""; + } + if (message.application != null && message.hasOwnProperty("application")) + object.application = message.application; + if (message.clientId != null && message.hasOwnProperty("clientId")) + object.clientId = message.clientId; + if (message.objectId != null && message.hasOwnProperty("objectId")) + object.objectId = message.objectId; + if (message.customerTenantId != null && message.hasOwnProperty("customerTenantId")) + object.customerTenantId = message.customerTenantId; + if (message.redirectUri != null && message.hasOwnProperty("redirectUri")) + object.redirectUri = message.redirectUri; + if (message.federatedApplicationClientId != null && message.hasOwnProperty("federatedApplicationClientId")) + object.federatedApplicationClientId = message.federatedApplicationClientId; + if (message.identity != null && message.hasOwnProperty("identity")) + object.identity = message.identity; + return object; + }; + + /** + * Converts this AzureProperties to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @instance + * @returns {Object.} JSON object + */ + AzureProperties.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for AzureProperties + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.AzureProperties + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + AzureProperties.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.AzureProperties"; + }; + + return AzureProperties; + })(); + + v1.CloudResourceProperties = (function() { + + /** + * Properties of a CloudResourceProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @interface ICloudResourceProperties + * @property {string|null} [serviceAccountId] CloudResourceProperties serviceAccountId + */ + + /** + * Constructs a new CloudResourceProperties. + * @memberof google.cloud.bigquery.connection.v1 + * @classdesc Represents a CloudResourceProperties. + * @implements ICloudResourceProperties + * @constructor + * @param {google.cloud.bigquery.connection.v1.ICloudResourceProperties=} [properties] Properties to set + */ + function CloudResourceProperties(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * CloudResourceProperties serviceAccountId. + * @member {string} serviceAccountId + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @instance + */ + CloudResourceProperties.prototype.serviceAccountId = ""; + + /** + * Creates a new CloudResourceProperties instance using the specified properties. + * @function create + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudResourceProperties=} [properties] Properties to set + * @returns {google.cloud.bigquery.connection.v1.CloudResourceProperties} CloudResourceProperties instance + */ + CloudResourceProperties.create = function create(properties) { + return new CloudResourceProperties(properties); + }; + + /** + * Encodes the specified CloudResourceProperties message. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudResourceProperties.verify|verify} messages. + * @function encode + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudResourceProperties} message CloudResourceProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CloudResourceProperties.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.serviceAccountId != null && Object.hasOwnProperty.call(message, "serviceAccountId")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.serviceAccountId); + return writer; + }; + + /** + * Encodes the specified CloudResourceProperties message, length delimited. Does not implicitly {@link google.cloud.bigquery.connection.v1.CloudResourceProperties.verify|verify} messages. + * @function encodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @static + * @param {google.cloud.bigquery.connection.v1.ICloudResourceProperties} message CloudResourceProperties message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CloudResourceProperties.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a CloudResourceProperties message from the specified reader or buffer. + * @function decode + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.cloud.bigquery.connection.v1.CloudResourceProperties} CloudResourceProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CloudResourceProperties.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.cloud.bigquery.connection.v1.CloudResourceProperties(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.serviceAccountId = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a CloudResourceProperties message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.cloud.bigquery.connection.v1.CloudResourceProperties} CloudResourceProperties + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CloudResourceProperties.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a CloudResourceProperties message. + * @function verify + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + CloudResourceProperties.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.serviceAccountId != null && message.hasOwnProperty("serviceAccountId")) + if (!$util.isString(message.serviceAccountId)) + return "serviceAccountId: string expected"; + return null; + }; + + /** + * Creates a CloudResourceProperties message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @static + * @param {Object.} object Plain object + * @returns {google.cloud.bigquery.connection.v1.CloudResourceProperties} CloudResourceProperties + */ + CloudResourceProperties.fromObject = function fromObject(object) { + if (object instanceof $root.google.cloud.bigquery.connection.v1.CloudResourceProperties) + return object; + var message = new $root.google.cloud.bigquery.connection.v1.CloudResourceProperties(); + if (object.serviceAccountId != null) + message.serviceAccountId = String(object.serviceAccountId); + return message; + }; + + /** + * Creates a plain object from a CloudResourceProperties message. Also converts values to other types if specified. + * @function toObject + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @static + * @param {google.cloud.bigquery.connection.v1.CloudResourceProperties} message CloudResourceProperties + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + CloudResourceProperties.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) + object.serviceAccountId = ""; + if (message.serviceAccountId != null && message.hasOwnProperty("serviceAccountId")) + object.serviceAccountId = message.serviceAccountId; + return object; + }; + + /** + * Converts this CloudResourceProperties to JSON. + * @function toJSON + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @instance + * @returns {Object.} JSON object + */ + CloudResourceProperties.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for CloudResourceProperties + * @function getTypeUrl + * @memberof google.cloud.bigquery.connection.v1.CloudResourceProperties + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + CloudResourceProperties.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.cloud.bigquery.connection.v1.CloudResourceProperties"; + }; + + return CloudResourceProperties; + })(); + + return v1; + })(); + + return connection; + })(); + + return bigquery; + })(); + + return cloud; + })(); + + google.api = (function() { + + /** + * Namespace api. + * @memberof google + * @namespace + */ + var api = {}; + + api.Http = (function() { + + /** + * Properties of a Http. + * @memberof google.api + * @interface IHttp + * @property {Array.|null} [rules] Http rules + * @property {boolean|null} [fullyDecodeReservedExpansion] Http fullyDecodeReservedExpansion + */ + + /** + * Constructs a new Http. + * @memberof google.api + * @classdesc Represents a Http. + * @implements IHttp + * @constructor + * @param {google.api.IHttp=} [properties] Properties to set + */ + function Http(properties) { + this.rules = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Http rules. + * @member {Array.} rules + * @memberof google.api.Http + * @instance + */ + Http.prototype.rules = $util.emptyArray; + + /** + * Http fullyDecodeReservedExpansion. + * @member {boolean} fullyDecodeReservedExpansion + * @memberof google.api.Http + * @instance + */ + Http.prototype.fullyDecodeReservedExpansion = false; + + /** + * Creates a new Http instance using the specified properties. + * @function create + * @memberof google.api.Http + * @static + * @param {google.api.IHttp=} [properties] Properties to set + * @returns {google.api.Http} Http instance + */ + Http.create = function create(properties) { + return new Http(properties); + }; + + /** + * Encodes the specified Http message. Does not implicitly {@link google.api.Http.verify|verify} messages. + * @function encode + * @memberof google.api.Http + * @static + * @param {google.api.IHttp} message Http message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Http.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.rules != null && message.rules.length) + for (var i = 0; i < message.rules.length; ++i) + $root.google.api.HttpRule.encode(message.rules[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + if (message.fullyDecodeReservedExpansion != null && Object.hasOwnProperty.call(message, "fullyDecodeReservedExpansion")) + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.fullyDecodeReservedExpansion); + return writer; + }; + + /** + * Encodes the specified Http message, length delimited. Does not implicitly {@link google.api.Http.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.Http + * @static + * @param {google.api.IHttp} message Http message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Http.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Http message from the specified reader or buffer. + * @function decode + * @memberof google.api.Http + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.Http} Http + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Http.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.Http(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + if (!(message.rules && message.rules.length)) + message.rules = []; + message.rules.push($root.google.api.HttpRule.decode(reader, reader.uint32())); + break; + } + case 2: { + message.fullyDecodeReservedExpansion = reader.bool(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Http message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.Http + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.Http} Http + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Http.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Http message. + * @function verify + * @memberof google.api.Http + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Http.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.rules != null && message.hasOwnProperty("rules")) { + if (!Array.isArray(message.rules)) + return "rules: array expected"; + for (var i = 0; i < message.rules.length; ++i) { + var error = $root.google.api.HttpRule.verify(message.rules[i]); + if (error) + return "rules." + error; + } + } + if (message.fullyDecodeReservedExpansion != null && message.hasOwnProperty("fullyDecodeReservedExpansion")) + if (typeof message.fullyDecodeReservedExpansion !== "boolean") + return "fullyDecodeReservedExpansion: boolean expected"; + return null; + }; + + /** + * Creates a Http message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.Http + * @static + * @param {Object.} object Plain object + * @returns {google.api.Http} Http + */ + Http.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.Http) + return object; + var message = new $root.google.api.Http(); + if (object.rules) { + if (!Array.isArray(object.rules)) + throw TypeError(".google.api.Http.rules: array expected"); + message.rules = []; + for (var i = 0; i < object.rules.length; ++i) { + if (typeof object.rules[i] !== "object") + throw TypeError(".google.api.Http.rules: object expected"); + message.rules[i] = $root.google.api.HttpRule.fromObject(object.rules[i]); + } + } + if (object.fullyDecodeReservedExpansion != null) + message.fullyDecodeReservedExpansion = Boolean(object.fullyDecodeReservedExpansion); + return message; + }; + + /** + * Creates a plain object from a Http message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.Http + * @static + * @param {google.api.Http} message Http + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Http.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.rules = []; + if (options.defaults) + object.fullyDecodeReservedExpansion = false; + if (message.rules && message.rules.length) { + object.rules = []; + for (var j = 0; j < message.rules.length; ++j) + object.rules[j] = $root.google.api.HttpRule.toObject(message.rules[j], options); + } + if (message.fullyDecodeReservedExpansion != null && message.hasOwnProperty("fullyDecodeReservedExpansion")) + object.fullyDecodeReservedExpansion = message.fullyDecodeReservedExpansion; + return object; + }; + + /** + * Converts this Http to JSON. + * @function toJSON + * @memberof google.api.Http + * @instance + * @returns {Object.} JSON object + */ + Http.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for Http + * @function getTypeUrl + * @memberof google.api.Http + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Http.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.Http"; + }; + + return Http; + })(); + + api.HttpRule = (function() { + + /** + * Properties of a HttpRule. + * @memberof google.api + * @interface IHttpRule + * @property {string|null} [selector] HttpRule selector + * @property {string|null} [get] HttpRule get + * @property {string|null} [put] HttpRule put + * @property {string|null} [post] HttpRule post + * @property {string|null} ["delete"] HttpRule delete + * @property {string|null} [patch] HttpRule patch + * @property {google.api.ICustomHttpPattern|null} [custom] HttpRule custom + * @property {string|null} [body] HttpRule body + * @property {string|null} [responseBody] HttpRule responseBody + * @property {Array.|null} [additionalBindings] HttpRule additionalBindings + */ + + /** + * Constructs a new HttpRule. + * @memberof google.api + * @classdesc Represents a HttpRule. + * @implements IHttpRule + * @constructor + * @param {google.api.IHttpRule=} [properties] Properties to set + */ + function HttpRule(properties) { + this.additionalBindings = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * HttpRule selector. + * @member {string} selector + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.selector = ""; + + /** + * HttpRule get. + * @member {string|null|undefined} get + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.get = null; + + /** + * HttpRule put. + * @member {string|null|undefined} put + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.put = null; + + /** + * HttpRule post. + * @member {string|null|undefined} post + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.post = null; + + /** + * HttpRule delete. + * @member {string|null|undefined} delete + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype["delete"] = null; + + /** + * HttpRule patch. + * @member {string|null|undefined} patch + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.patch = null; + + /** + * HttpRule custom. + * @member {google.api.ICustomHttpPattern|null|undefined} custom + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.custom = null; + + /** + * HttpRule body. + * @member {string} body + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.body = ""; + + /** + * HttpRule responseBody. + * @member {string} responseBody + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.responseBody = ""; + + /** + * HttpRule additionalBindings. + * @member {Array.} additionalBindings + * @memberof google.api.HttpRule + * @instance + */ + HttpRule.prototype.additionalBindings = $util.emptyArray; + + // OneOf field names bound to virtual getters and setters + var $oneOfFields; + + /** + * HttpRule pattern. + * @member {"get"|"put"|"post"|"delete"|"patch"|"custom"|undefined} pattern + * @memberof google.api.HttpRule + * @instance + */ + Object.defineProperty(HttpRule.prototype, "pattern", { + get: $util.oneOfGetter($oneOfFields = ["get", "put", "post", "delete", "patch", "custom"]), + set: $util.oneOfSetter($oneOfFields) + }); + + /** + * Creates a new HttpRule instance using the specified properties. + * @function create + * @memberof google.api.HttpRule + * @static + * @param {google.api.IHttpRule=} [properties] Properties to set + * @returns {google.api.HttpRule} HttpRule instance + */ + HttpRule.create = function create(properties) { + return new HttpRule(properties); + }; + + /** + * Encodes the specified HttpRule message. Does not implicitly {@link google.api.HttpRule.verify|verify} messages. + * @function encode + * @memberof google.api.HttpRule + * @static + * @param {google.api.IHttpRule} message HttpRule message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + HttpRule.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.selector != null && Object.hasOwnProperty.call(message, "selector")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.selector); + if (message.get != null && Object.hasOwnProperty.call(message, "get")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.get); + if (message.put != null && Object.hasOwnProperty.call(message, "put")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.put); + if (message.post != null && Object.hasOwnProperty.call(message, "post")) + writer.uint32(/* id 4, wireType 2 =*/34).string(message.post); + if (message["delete"] != null && Object.hasOwnProperty.call(message, "delete")) + writer.uint32(/* id 5, wireType 2 =*/42).string(message["delete"]); + if (message.patch != null && Object.hasOwnProperty.call(message, "patch")) + writer.uint32(/* id 6, wireType 2 =*/50).string(message.patch); + if (message.body != null && Object.hasOwnProperty.call(message, "body")) + writer.uint32(/* id 7, wireType 2 =*/58).string(message.body); + if (message.custom != null && Object.hasOwnProperty.call(message, "custom")) + $root.google.api.CustomHttpPattern.encode(message.custom, writer.uint32(/* id 8, wireType 2 =*/66).fork()).ldelim(); + if (message.additionalBindings != null && message.additionalBindings.length) + for (var i = 0; i < message.additionalBindings.length; ++i) + $root.google.api.HttpRule.encode(message.additionalBindings[i], writer.uint32(/* id 11, wireType 2 =*/90).fork()).ldelim(); + if (message.responseBody != null && Object.hasOwnProperty.call(message, "responseBody")) + writer.uint32(/* id 12, wireType 2 =*/98).string(message.responseBody); + return writer; + }; + + /** + * Encodes the specified HttpRule message, length delimited. Does not implicitly {@link google.api.HttpRule.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.HttpRule + * @static + * @param {google.api.IHttpRule} message HttpRule message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + HttpRule.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a HttpRule message from the specified reader or buffer. + * @function decode + * @memberof google.api.HttpRule + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.HttpRule} HttpRule + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + HttpRule.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.HttpRule(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.selector = reader.string(); + break; + } + case 2: { + message.get = reader.string(); + break; + } + case 3: { + message.put = reader.string(); + break; + } + case 4: { + message.post = reader.string(); + break; + } + case 5: { + message["delete"] = reader.string(); + break; + } + case 6: { + message.patch = reader.string(); + break; + } + case 8: { + message.custom = $root.google.api.CustomHttpPattern.decode(reader, reader.uint32()); + break; + } + case 7: { + message.body = reader.string(); + break; + } + case 12: { + message.responseBody = reader.string(); + break; + } + case 11: { + if (!(message.additionalBindings && message.additionalBindings.length)) + message.additionalBindings = []; + message.additionalBindings.push($root.google.api.HttpRule.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a HttpRule message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.HttpRule + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.HttpRule} HttpRule + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + HttpRule.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a HttpRule message. + * @function verify + * @memberof google.api.HttpRule + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + HttpRule.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + var properties = {}; + if (message.selector != null && message.hasOwnProperty("selector")) + if (!$util.isString(message.selector)) + return "selector: string expected"; + if (message.get != null && message.hasOwnProperty("get")) { + properties.pattern = 1; + if (!$util.isString(message.get)) + return "get: string expected"; + } + if (message.put != null && message.hasOwnProperty("put")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + if (!$util.isString(message.put)) + return "put: string expected"; + } + if (message.post != null && message.hasOwnProperty("post")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + if (!$util.isString(message.post)) + return "post: string expected"; + } + if (message["delete"] != null && message.hasOwnProperty("delete")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + if (!$util.isString(message["delete"])) + return "delete: string expected"; + } + if (message.patch != null && message.hasOwnProperty("patch")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + if (!$util.isString(message.patch)) + return "patch: string expected"; + } + if (message.custom != null && message.hasOwnProperty("custom")) { + if (properties.pattern === 1) + return "pattern: multiple values"; + properties.pattern = 1; + { + var error = $root.google.api.CustomHttpPattern.verify(message.custom); + if (error) + return "custom." + error; + } + } + if (message.body != null && message.hasOwnProperty("body")) + if (!$util.isString(message.body)) + return "body: string expected"; + if (message.responseBody != null && message.hasOwnProperty("responseBody")) + if (!$util.isString(message.responseBody)) + return "responseBody: string expected"; + if (message.additionalBindings != null && message.hasOwnProperty("additionalBindings")) { + if (!Array.isArray(message.additionalBindings)) + return "additionalBindings: array expected"; + for (var i = 0; i < message.additionalBindings.length; ++i) { + var error = $root.google.api.HttpRule.verify(message.additionalBindings[i]); + if (error) + return "additionalBindings." + error; + } + } + return null; + }; + + /** + * Creates a HttpRule message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.HttpRule + * @static + * @param {Object.} object Plain object + * @returns {google.api.HttpRule} HttpRule + */ + HttpRule.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.HttpRule) + return object; + var message = new $root.google.api.HttpRule(); + if (object.selector != null) + message.selector = String(object.selector); + if (object.get != null) + message.get = String(object.get); + if (object.put != null) + message.put = String(object.put); + if (object.post != null) + message.post = String(object.post); + if (object["delete"] != null) + message["delete"] = String(object["delete"]); + if (object.patch != null) + message.patch = String(object.patch); + if (object.custom != null) { + if (typeof object.custom !== "object") + throw TypeError(".google.api.HttpRule.custom: object expected"); + message.custom = $root.google.api.CustomHttpPattern.fromObject(object.custom); + } + if (object.body != null) + message.body = String(object.body); + if (object.responseBody != null) + message.responseBody = String(object.responseBody); + if (object.additionalBindings) { + if (!Array.isArray(object.additionalBindings)) + throw TypeError(".google.api.HttpRule.additionalBindings: array expected"); + message.additionalBindings = []; + for (var i = 0; i < object.additionalBindings.length; ++i) { + if (typeof object.additionalBindings[i] !== "object") + throw TypeError(".google.api.HttpRule.additionalBindings: object expected"); + message.additionalBindings[i] = $root.google.api.HttpRule.fromObject(object.additionalBindings[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a HttpRule message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.HttpRule + * @static + * @param {google.api.HttpRule} message HttpRule + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + HttpRule.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.additionalBindings = []; + if (options.defaults) { + object.selector = ""; + object.body = ""; + object.responseBody = ""; + } + if (message.selector != null && message.hasOwnProperty("selector")) + object.selector = message.selector; + if (message.get != null && message.hasOwnProperty("get")) { + object.get = message.get; + if (options.oneofs) + object.pattern = "get"; + } + if (message.put != null && message.hasOwnProperty("put")) { + object.put = message.put; + if (options.oneofs) + object.pattern = "put"; + } + if (message.post != null && message.hasOwnProperty("post")) { + object.post = message.post; + if (options.oneofs) + object.pattern = "post"; + } + if (message["delete"] != null && message.hasOwnProperty("delete")) { + object["delete"] = message["delete"]; + if (options.oneofs) + object.pattern = "delete"; + } + if (message.patch != null && message.hasOwnProperty("patch")) { + object.patch = message.patch; + if (options.oneofs) + object.pattern = "patch"; + } + if (message.body != null && message.hasOwnProperty("body")) + object.body = message.body; + if (message.custom != null && message.hasOwnProperty("custom")) { + object.custom = $root.google.api.CustomHttpPattern.toObject(message.custom, options); + if (options.oneofs) + object.pattern = "custom"; + } + if (message.additionalBindings && message.additionalBindings.length) { + object.additionalBindings = []; + for (var j = 0; j < message.additionalBindings.length; ++j) + object.additionalBindings[j] = $root.google.api.HttpRule.toObject(message.additionalBindings[j], options); + } + if (message.responseBody != null && message.hasOwnProperty("responseBody")) + object.responseBody = message.responseBody; + return object; + }; + + /** + * Converts this HttpRule to JSON. + * @function toJSON + * @memberof google.api.HttpRule + * @instance + * @returns {Object.} JSON object + */ + HttpRule.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for HttpRule + * @function getTypeUrl + * @memberof google.api.HttpRule + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + HttpRule.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.HttpRule"; + }; + + return HttpRule; + })(); + + api.CustomHttpPattern = (function() { + + /** + * Properties of a CustomHttpPattern. + * @memberof google.api + * @interface ICustomHttpPattern + * @property {string|null} [kind] CustomHttpPattern kind + * @property {string|null} [path] CustomHttpPattern path + */ + + /** + * Constructs a new CustomHttpPattern. + * @memberof google.api + * @classdesc Represents a CustomHttpPattern. + * @implements ICustomHttpPattern + * @constructor + * @param {google.api.ICustomHttpPattern=} [properties] Properties to set + */ + function CustomHttpPattern(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * CustomHttpPattern kind. + * @member {string} kind + * @memberof google.api.CustomHttpPattern + * @instance + */ + CustomHttpPattern.prototype.kind = ""; + + /** + * CustomHttpPattern path. + * @member {string} path + * @memberof google.api.CustomHttpPattern + * @instance + */ + CustomHttpPattern.prototype.path = ""; + + /** + * Creates a new CustomHttpPattern instance using the specified properties. + * @function create + * @memberof google.api.CustomHttpPattern + * @static + * @param {google.api.ICustomHttpPattern=} [properties] Properties to set + * @returns {google.api.CustomHttpPattern} CustomHttpPattern instance + */ + CustomHttpPattern.create = function create(properties) { + return new CustomHttpPattern(properties); + }; + + /** + * Encodes the specified CustomHttpPattern message. Does not implicitly {@link google.api.CustomHttpPattern.verify|verify} messages. + * @function encode + * @memberof google.api.CustomHttpPattern + * @static + * @param {google.api.ICustomHttpPattern} message CustomHttpPattern message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CustomHttpPattern.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.kind != null && Object.hasOwnProperty.call(message, "kind")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.kind); + if (message.path != null && Object.hasOwnProperty.call(message, "path")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.path); + return writer; + }; + + /** + * Encodes the specified CustomHttpPattern message, length delimited. Does not implicitly {@link google.api.CustomHttpPattern.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.CustomHttpPattern + * @static + * @param {google.api.ICustomHttpPattern} message CustomHttpPattern message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + CustomHttpPattern.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a CustomHttpPattern message from the specified reader or buffer. + * @function decode + * @memberof google.api.CustomHttpPattern + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.CustomHttpPattern} CustomHttpPattern + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CustomHttpPattern.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.CustomHttpPattern(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.kind = reader.string(); + break; + } + case 2: { + message.path = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a CustomHttpPattern message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.CustomHttpPattern + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.CustomHttpPattern} CustomHttpPattern + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + CustomHttpPattern.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a CustomHttpPattern message. + * @function verify + * @memberof google.api.CustomHttpPattern + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + CustomHttpPattern.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.kind != null && message.hasOwnProperty("kind")) + if (!$util.isString(message.kind)) + return "kind: string expected"; + if (message.path != null && message.hasOwnProperty("path")) + if (!$util.isString(message.path)) + return "path: string expected"; + return null; + }; + + /** + * Creates a CustomHttpPattern message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.CustomHttpPattern + * @static + * @param {Object.} object Plain object + * @returns {google.api.CustomHttpPattern} CustomHttpPattern + */ + CustomHttpPattern.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.CustomHttpPattern) + return object; + var message = new $root.google.api.CustomHttpPattern(); + if (object.kind != null) + message.kind = String(object.kind); + if (object.path != null) + message.path = String(object.path); + return message; + }; + + /** + * Creates a plain object from a CustomHttpPattern message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.CustomHttpPattern + * @static + * @param {google.api.CustomHttpPattern} message CustomHttpPattern + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + CustomHttpPattern.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.kind = ""; + object.path = ""; + } + if (message.kind != null && message.hasOwnProperty("kind")) + object.kind = message.kind; + if (message.path != null && message.hasOwnProperty("path")) + object.path = message.path; + return object; + }; + + /** + * Converts this CustomHttpPattern to JSON. + * @function toJSON + * @memberof google.api.CustomHttpPattern + * @instance + * @returns {Object.} JSON object + */ + CustomHttpPattern.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for CustomHttpPattern + * @function getTypeUrl + * @memberof google.api.CustomHttpPattern + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + CustomHttpPattern.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.CustomHttpPattern"; + }; + + return CustomHttpPattern; + })(); + + /** + * FieldBehavior enum. + * @name google.api.FieldBehavior + * @enum {number} + * @property {number} FIELD_BEHAVIOR_UNSPECIFIED=0 FIELD_BEHAVIOR_UNSPECIFIED value + * @property {number} OPTIONAL=1 OPTIONAL value + * @property {number} REQUIRED=2 REQUIRED value + * @property {number} OUTPUT_ONLY=3 OUTPUT_ONLY value + * @property {number} INPUT_ONLY=4 INPUT_ONLY value + * @property {number} IMMUTABLE=5 IMMUTABLE value + * @property {number} UNORDERED_LIST=6 UNORDERED_LIST value + * @property {number} NON_EMPTY_DEFAULT=7 NON_EMPTY_DEFAULT value + */ + api.FieldBehavior = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "FIELD_BEHAVIOR_UNSPECIFIED"] = 0; + values[valuesById[1] = "OPTIONAL"] = 1; + values[valuesById[2] = "REQUIRED"] = 2; + values[valuesById[3] = "OUTPUT_ONLY"] = 3; + values[valuesById[4] = "INPUT_ONLY"] = 4; + values[valuesById[5] = "IMMUTABLE"] = 5; + values[valuesById[6] = "UNORDERED_LIST"] = 6; + values[valuesById[7] = "NON_EMPTY_DEFAULT"] = 7; + return values; + })(); + + api.ResourceDescriptor = (function() { + + /** + * Properties of a ResourceDescriptor. + * @memberof google.api + * @interface IResourceDescriptor + * @property {string|null} [type] ResourceDescriptor type + * @property {Array.|null} [pattern] ResourceDescriptor pattern + * @property {string|null} [nameField] ResourceDescriptor nameField + * @property {google.api.ResourceDescriptor.History|null} [history] ResourceDescriptor history + * @property {string|null} [plural] ResourceDescriptor plural + * @property {string|null} [singular] ResourceDescriptor singular + * @property {Array.|null} [style] ResourceDescriptor style + */ + + /** + * Constructs a new ResourceDescriptor. + * @memberof google.api + * @classdesc Represents a ResourceDescriptor. + * @implements IResourceDescriptor + * @constructor + * @param {google.api.IResourceDescriptor=} [properties] Properties to set + */ + function ResourceDescriptor(properties) { + this.pattern = []; + this.style = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ResourceDescriptor type. + * @member {string} type + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.type = ""; + + /** + * ResourceDescriptor pattern. + * @member {Array.} pattern + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.pattern = $util.emptyArray; + + /** + * ResourceDescriptor nameField. + * @member {string} nameField + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.nameField = ""; + + /** + * ResourceDescriptor history. + * @member {google.api.ResourceDescriptor.History} history + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.history = 0; + + /** + * ResourceDescriptor plural. + * @member {string} plural + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.plural = ""; + + /** + * ResourceDescriptor singular. + * @member {string} singular + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.singular = ""; + + /** + * ResourceDescriptor style. + * @member {Array.} style + * @memberof google.api.ResourceDescriptor + * @instance + */ + ResourceDescriptor.prototype.style = $util.emptyArray; + + /** + * Creates a new ResourceDescriptor instance using the specified properties. + * @function create + * @memberof google.api.ResourceDescriptor + * @static + * @param {google.api.IResourceDescriptor=} [properties] Properties to set + * @returns {google.api.ResourceDescriptor} ResourceDescriptor instance + */ + ResourceDescriptor.create = function create(properties) { + return new ResourceDescriptor(properties); + }; + + /** + * Encodes the specified ResourceDescriptor message. Does not implicitly {@link google.api.ResourceDescriptor.verify|verify} messages. + * @function encode + * @memberof google.api.ResourceDescriptor + * @static + * @param {google.api.IResourceDescriptor} message ResourceDescriptor message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ResourceDescriptor.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.type != null && Object.hasOwnProperty.call(message, "type")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.type); + if (message.pattern != null && message.pattern.length) + for (var i = 0; i < message.pattern.length; ++i) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.pattern[i]); + if (message.nameField != null && Object.hasOwnProperty.call(message, "nameField")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.nameField); + if (message.history != null && Object.hasOwnProperty.call(message, "history")) + writer.uint32(/* id 4, wireType 0 =*/32).int32(message.history); + if (message.plural != null && Object.hasOwnProperty.call(message, "plural")) + writer.uint32(/* id 5, wireType 2 =*/42).string(message.plural); + if (message.singular != null && Object.hasOwnProperty.call(message, "singular")) + writer.uint32(/* id 6, wireType 2 =*/50).string(message.singular); + if (message.style != null && message.style.length) { + writer.uint32(/* id 10, wireType 2 =*/82).fork(); + for (var i = 0; i < message.style.length; ++i) + writer.int32(message.style[i]); + writer.ldelim(); + } + return writer; + }; + + /** + * Encodes the specified ResourceDescriptor message, length delimited. Does not implicitly {@link google.api.ResourceDescriptor.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.ResourceDescriptor + * @static + * @param {google.api.IResourceDescriptor} message ResourceDescriptor message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ResourceDescriptor.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ResourceDescriptor message from the specified reader or buffer. + * @function decode + * @memberof google.api.ResourceDescriptor + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.ResourceDescriptor} ResourceDescriptor + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ResourceDescriptor.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.ResourceDescriptor(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.type = reader.string(); + break; + } + case 2: { + if (!(message.pattern && message.pattern.length)) + message.pattern = []; + message.pattern.push(reader.string()); + break; + } + case 3: { + message.nameField = reader.string(); + break; + } + case 4: { + message.history = reader.int32(); + break; + } + case 5: { + message.plural = reader.string(); + break; + } + case 6: { + message.singular = reader.string(); + break; + } + case 10: { + if (!(message.style && message.style.length)) + message.style = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.style.push(reader.int32()); + } else + message.style.push(reader.int32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ResourceDescriptor message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.ResourceDescriptor + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.ResourceDescriptor} ResourceDescriptor + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ResourceDescriptor.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ResourceDescriptor message. + * @function verify + * @memberof google.api.ResourceDescriptor + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ResourceDescriptor.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.type != null && message.hasOwnProperty("type")) + if (!$util.isString(message.type)) + return "type: string expected"; + if (message.pattern != null && message.hasOwnProperty("pattern")) { + if (!Array.isArray(message.pattern)) + return "pattern: array expected"; + for (var i = 0; i < message.pattern.length; ++i) + if (!$util.isString(message.pattern[i])) + return "pattern: string[] expected"; + } + if (message.nameField != null && message.hasOwnProperty("nameField")) + if (!$util.isString(message.nameField)) + return "nameField: string expected"; + if (message.history != null && message.hasOwnProperty("history")) + switch (message.history) { + default: + return "history: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.plural != null && message.hasOwnProperty("plural")) + if (!$util.isString(message.plural)) + return "plural: string expected"; + if (message.singular != null && message.hasOwnProperty("singular")) + if (!$util.isString(message.singular)) + return "singular: string expected"; + if (message.style != null && message.hasOwnProperty("style")) { + if (!Array.isArray(message.style)) + return "style: array expected"; + for (var i = 0; i < message.style.length; ++i) + switch (message.style[i]) { + default: + return "style: enum value[] expected"; + case 0: + case 1: + break; + } + } + return null; + }; + + /** + * Creates a ResourceDescriptor message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.ResourceDescriptor + * @static + * @param {Object.} object Plain object + * @returns {google.api.ResourceDescriptor} ResourceDescriptor + */ + ResourceDescriptor.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.ResourceDescriptor) + return object; + var message = new $root.google.api.ResourceDescriptor(); + if (object.type != null) + message.type = String(object.type); + if (object.pattern) { + if (!Array.isArray(object.pattern)) + throw TypeError(".google.api.ResourceDescriptor.pattern: array expected"); + message.pattern = []; + for (var i = 0; i < object.pattern.length; ++i) + message.pattern[i] = String(object.pattern[i]); + } + if (object.nameField != null) + message.nameField = String(object.nameField); + switch (object.history) { + default: + if (typeof object.history === "number") { + message.history = object.history; + break; + } + break; + case "HISTORY_UNSPECIFIED": + case 0: + message.history = 0; + break; + case "ORIGINALLY_SINGLE_PATTERN": + case 1: + message.history = 1; + break; + case "FUTURE_MULTI_PATTERN": + case 2: + message.history = 2; + break; + } + if (object.plural != null) + message.plural = String(object.plural); + if (object.singular != null) + message.singular = String(object.singular); + if (object.style) { + if (!Array.isArray(object.style)) + throw TypeError(".google.api.ResourceDescriptor.style: array expected"); + message.style = []; + for (var i = 0; i < object.style.length; ++i) + switch (object.style[i]) { + default: + if (typeof object.style[i] === "number") { + message.style[i] = object.style[i]; + break; + } + case "STYLE_UNSPECIFIED": + case 0: + message.style[i] = 0; + break; + case "DECLARATIVE_FRIENDLY": + case 1: + message.style[i] = 1; + break; + } + } + return message; + }; + + /** + * Creates a plain object from a ResourceDescriptor message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.ResourceDescriptor + * @static + * @param {google.api.ResourceDescriptor} message ResourceDescriptor + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ResourceDescriptor.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.pattern = []; + object.style = []; + } + if (options.defaults) { + object.type = ""; + object.nameField = ""; + object.history = options.enums === String ? "HISTORY_UNSPECIFIED" : 0; + object.plural = ""; + object.singular = ""; + } + if (message.type != null && message.hasOwnProperty("type")) + object.type = message.type; + if (message.pattern && message.pattern.length) { + object.pattern = []; + for (var j = 0; j < message.pattern.length; ++j) + object.pattern[j] = message.pattern[j]; + } + if (message.nameField != null && message.hasOwnProperty("nameField")) + object.nameField = message.nameField; + if (message.history != null && message.hasOwnProperty("history")) + object.history = options.enums === String ? $root.google.api.ResourceDescriptor.History[message.history] === undefined ? message.history : $root.google.api.ResourceDescriptor.History[message.history] : message.history; + if (message.plural != null && message.hasOwnProperty("plural")) + object.plural = message.plural; + if (message.singular != null && message.hasOwnProperty("singular")) + object.singular = message.singular; + if (message.style && message.style.length) { + object.style = []; + for (var j = 0; j < message.style.length; ++j) + object.style[j] = options.enums === String ? $root.google.api.ResourceDescriptor.Style[message.style[j]] === undefined ? message.style[j] : $root.google.api.ResourceDescriptor.Style[message.style[j]] : message.style[j]; + } + return object; + }; + + /** + * Converts this ResourceDescriptor to JSON. + * @function toJSON + * @memberof google.api.ResourceDescriptor + * @instance + * @returns {Object.} JSON object + */ + ResourceDescriptor.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for ResourceDescriptor + * @function getTypeUrl + * @memberof google.api.ResourceDescriptor + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ResourceDescriptor.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.ResourceDescriptor"; + }; + + /** + * History enum. + * @name google.api.ResourceDescriptor.History + * @enum {number} + * @property {number} HISTORY_UNSPECIFIED=0 HISTORY_UNSPECIFIED value + * @property {number} ORIGINALLY_SINGLE_PATTERN=1 ORIGINALLY_SINGLE_PATTERN value + * @property {number} FUTURE_MULTI_PATTERN=2 FUTURE_MULTI_PATTERN value + */ + ResourceDescriptor.History = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "HISTORY_UNSPECIFIED"] = 0; + values[valuesById[1] = "ORIGINALLY_SINGLE_PATTERN"] = 1; + values[valuesById[2] = "FUTURE_MULTI_PATTERN"] = 2; + return values; + })(); + + /** + * Style enum. + * @name google.api.ResourceDescriptor.Style + * @enum {number} + * @property {number} STYLE_UNSPECIFIED=0 STYLE_UNSPECIFIED value + * @property {number} DECLARATIVE_FRIENDLY=1 DECLARATIVE_FRIENDLY value + */ + ResourceDescriptor.Style = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "STYLE_UNSPECIFIED"] = 0; + values[valuesById[1] = "DECLARATIVE_FRIENDLY"] = 1; + return values; + })(); + + return ResourceDescriptor; + })(); + + api.ResourceReference = (function() { + + /** + * Properties of a ResourceReference. + * @memberof google.api + * @interface IResourceReference + * @property {string|null} [type] ResourceReference type + * @property {string|null} [childType] ResourceReference childType + */ + + /** + * Constructs a new ResourceReference. + * @memberof google.api + * @classdesc Represents a ResourceReference. + * @implements IResourceReference + * @constructor + * @param {google.api.IResourceReference=} [properties] Properties to set + */ + function ResourceReference(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ResourceReference type. + * @member {string} type + * @memberof google.api.ResourceReference + * @instance + */ + ResourceReference.prototype.type = ""; + + /** + * ResourceReference childType. + * @member {string} childType + * @memberof google.api.ResourceReference + * @instance + */ + ResourceReference.prototype.childType = ""; + + /** + * Creates a new ResourceReference instance using the specified properties. + * @function create + * @memberof google.api.ResourceReference + * @static + * @param {google.api.IResourceReference=} [properties] Properties to set + * @returns {google.api.ResourceReference} ResourceReference instance + */ + ResourceReference.create = function create(properties) { + return new ResourceReference(properties); + }; + + /** + * Encodes the specified ResourceReference message. Does not implicitly {@link google.api.ResourceReference.verify|verify} messages. + * @function encode + * @memberof google.api.ResourceReference + * @static + * @param {google.api.IResourceReference} message ResourceReference message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ResourceReference.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.type != null && Object.hasOwnProperty.call(message, "type")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.type); + if (message.childType != null && Object.hasOwnProperty.call(message, "childType")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.childType); + return writer; + }; + + /** + * Encodes the specified ResourceReference message, length delimited. Does not implicitly {@link google.api.ResourceReference.verify|verify} messages. + * @function encodeDelimited + * @memberof google.api.ResourceReference + * @static + * @param {google.api.IResourceReference} message ResourceReference message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ResourceReference.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ResourceReference message from the specified reader or buffer. + * @function decode + * @memberof google.api.ResourceReference + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.api.ResourceReference} ResourceReference + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ResourceReference.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.api.ResourceReference(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.type = reader.string(); + break; + } + case 2: { + message.childType = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ResourceReference message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.api.ResourceReference + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.api.ResourceReference} ResourceReference + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ResourceReference.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ResourceReference message. + * @function verify + * @memberof google.api.ResourceReference + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ResourceReference.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.type != null && message.hasOwnProperty("type")) + if (!$util.isString(message.type)) + return "type: string expected"; + if (message.childType != null && message.hasOwnProperty("childType")) + if (!$util.isString(message.childType)) + return "childType: string expected"; + return null; + }; + + /** + * Creates a ResourceReference message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.api.ResourceReference + * @static + * @param {Object.} object Plain object + * @returns {google.api.ResourceReference} ResourceReference + */ + ResourceReference.fromObject = function fromObject(object) { + if (object instanceof $root.google.api.ResourceReference) + return object; + var message = new $root.google.api.ResourceReference(); + if (object.type != null) + message.type = String(object.type); + if (object.childType != null) + message.childType = String(object.childType); + return message; + }; + + /** + * Creates a plain object from a ResourceReference message. Also converts values to other types if specified. + * @function toObject + * @memberof google.api.ResourceReference + * @static + * @param {google.api.ResourceReference} message ResourceReference + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ResourceReference.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.type = ""; + object.childType = ""; + } + if (message.type != null && message.hasOwnProperty("type")) + object.type = message.type; + if (message.childType != null && message.hasOwnProperty("childType")) + object.childType = message.childType; + return object; + }; + + /** + * Converts this ResourceReference to JSON. + * @function toJSON + * @memberof google.api.ResourceReference + * @instance + * @returns {Object.} JSON object + */ + ResourceReference.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for ResourceReference + * @function getTypeUrl + * @memberof google.api.ResourceReference + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ResourceReference.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.api.ResourceReference"; + }; + + return ResourceReference; + })(); + + return api; + })(); + + google.protobuf = (function() { + + /** + * Namespace protobuf. + * @memberof google + * @namespace + */ + var protobuf = {}; + + protobuf.FileDescriptorSet = (function() { + + /** + * Properties of a FileDescriptorSet. + * @memberof google.protobuf + * @interface IFileDescriptorSet + * @property {Array.|null} [file] FileDescriptorSet file + */ + + /** + * Constructs a new FileDescriptorSet. + * @memberof google.protobuf + * @classdesc Represents a FileDescriptorSet. + * @implements IFileDescriptorSet + * @constructor + * @param {google.protobuf.IFileDescriptorSet=} [properties] Properties to set + */ + function FileDescriptorSet(properties) { + this.file = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FileDescriptorSet file. + * @member {Array.} file + * @memberof google.protobuf.FileDescriptorSet + * @instance + */ + FileDescriptorSet.prototype.file = $util.emptyArray; + + /** + * Creates a new FileDescriptorSet instance using the specified properties. + * @function create + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {google.protobuf.IFileDescriptorSet=} [properties] Properties to set + * @returns {google.protobuf.FileDescriptorSet} FileDescriptorSet instance + */ + FileDescriptorSet.create = function create(properties) { + return new FileDescriptorSet(properties); + }; + + /** + * Encodes the specified FileDescriptorSet message. Does not implicitly {@link google.protobuf.FileDescriptorSet.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {google.protobuf.IFileDescriptorSet} message FileDescriptorSet message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileDescriptorSet.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.file != null && message.file.length) + for (var i = 0; i < message.file.length; ++i) + $root.google.protobuf.FileDescriptorProto.encode(message.file[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified FileDescriptorSet message, length delimited. Does not implicitly {@link google.protobuf.FileDescriptorSet.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {google.protobuf.IFileDescriptorSet} message FileDescriptorSet message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileDescriptorSet.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FileDescriptorSet message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FileDescriptorSet} FileDescriptorSet + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileDescriptorSet.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FileDescriptorSet(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + if (!(message.file && message.file.length)) + message.file = []; + message.file.push($root.google.protobuf.FileDescriptorProto.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FileDescriptorSet message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FileDescriptorSet} FileDescriptorSet + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileDescriptorSet.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FileDescriptorSet message. + * @function verify + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FileDescriptorSet.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.file != null && message.hasOwnProperty("file")) { + if (!Array.isArray(message.file)) + return "file: array expected"; + for (var i = 0; i < message.file.length; ++i) { + var error = $root.google.protobuf.FileDescriptorProto.verify(message.file[i]); + if (error) + return "file." + error; + } + } + return null; + }; + + /** + * Creates a FileDescriptorSet message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FileDescriptorSet} FileDescriptorSet + */ + FileDescriptorSet.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FileDescriptorSet) + return object; + var message = new $root.google.protobuf.FileDescriptorSet(); + if (object.file) { + if (!Array.isArray(object.file)) + throw TypeError(".google.protobuf.FileDescriptorSet.file: array expected"); + message.file = []; + for (var i = 0; i < object.file.length; ++i) { + if (typeof object.file[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorSet.file: object expected"); + message.file[i] = $root.google.protobuf.FileDescriptorProto.fromObject(object.file[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a FileDescriptorSet message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {google.protobuf.FileDescriptorSet} message FileDescriptorSet + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FileDescriptorSet.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.file = []; + if (message.file && message.file.length) { + object.file = []; + for (var j = 0; j < message.file.length; ++j) + object.file[j] = $root.google.protobuf.FileDescriptorProto.toObject(message.file[j], options); + } + return object; + }; + + /** + * Converts this FileDescriptorSet to JSON. + * @function toJSON + * @memberof google.protobuf.FileDescriptorSet + * @instance + * @returns {Object.} JSON object + */ + FileDescriptorSet.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for FileDescriptorSet + * @function getTypeUrl + * @memberof google.protobuf.FileDescriptorSet + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FileDescriptorSet.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FileDescriptorSet"; + }; + + return FileDescriptorSet; + })(); + + protobuf.FileDescriptorProto = (function() { + + /** + * Properties of a FileDescriptorProto. + * @memberof google.protobuf + * @interface IFileDescriptorProto + * @property {string|null} [name] FileDescriptorProto name + * @property {string|null} ["package"] FileDescriptorProto package + * @property {Array.|null} [dependency] FileDescriptorProto dependency + * @property {Array.|null} [publicDependency] FileDescriptorProto publicDependency + * @property {Array.|null} [weakDependency] FileDescriptorProto weakDependency + * @property {Array.|null} [messageType] FileDescriptorProto messageType + * @property {Array.|null} [enumType] FileDescriptorProto enumType + * @property {Array.|null} [service] FileDescriptorProto service + * @property {Array.|null} [extension] FileDescriptorProto extension + * @property {google.protobuf.IFileOptions|null} [options] FileDescriptorProto options + * @property {google.protobuf.ISourceCodeInfo|null} [sourceCodeInfo] FileDescriptorProto sourceCodeInfo + * @property {string|null} [syntax] FileDescriptorProto syntax + * @property {string|null} [edition] FileDescriptorProto edition + */ + + /** + * Constructs a new FileDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a FileDescriptorProto. + * @implements IFileDescriptorProto + * @constructor + * @param {google.protobuf.IFileDescriptorProto=} [properties] Properties to set + */ + function FileDescriptorProto(properties) { + this.dependency = []; + this.publicDependency = []; + this.weakDependency = []; + this.messageType = []; + this.enumType = []; + this.service = []; + this.extension = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FileDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.name = ""; + + /** + * FileDescriptorProto package. + * @member {string} package + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype["package"] = ""; + + /** + * FileDescriptorProto dependency. + * @member {Array.} dependency + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.dependency = $util.emptyArray; + + /** + * FileDescriptorProto publicDependency. + * @member {Array.} publicDependency + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.publicDependency = $util.emptyArray; + + /** + * FileDescriptorProto weakDependency. + * @member {Array.} weakDependency + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.weakDependency = $util.emptyArray; + + /** + * FileDescriptorProto messageType. + * @member {Array.} messageType + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.messageType = $util.emptyArray; + + /** + * FileDescriptorProto enumType. + * @member {Array.} enumType + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.enumType = $util.emptyArray; + + /** + * FileDescriptorProto service. + * @member {Array.} service + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.service = $util.emptyArray; + + /** + * FileDescriptorProto extension. + * @member {Array.} extension + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.extension = $util.emptyArray; + + /** + * FileDescriptorProto options. + * @member {google.protobuf.IFileOptions|null|undefined} options + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.options = null; + + /** + * FileDescriptorProto sourceCodeInfo. + * @member {google.protobuf.ISourceCodeInfo|null|undefined} sourceCodeInfo + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.sourceCodeInfo = null; + + /** + * FileDescriptorProto syntax. + * @member {string} syntax + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.syntax = ""; + + /** + * FileDescriptorProto edition. + * @member {string} edition + * @memberof google.protobuf.FileDescriptorProto + * @instance + */ + FileDescriptorProto.prototype.edition = ""; + + /** + * Creates a new FileDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {google.protobuf.IFileDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.FileDescriptorProto} FileDescriptorProto instance + */ + FileDescriptorProto.create = function create(properties) { + return new FileDescriptorProto(properties); + }; + + /** + * Encodes the specified FileDescriptorProto message. Does not implicitly {@link google.protobuf.FileDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {google.protobuf.IFileDescriptorProto} message FileDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message["package"] != null && Object.hasOwnProperty.call(message, "package")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message["package"]); + if (message.dependency != null && message.dependency.length) + for (var i = 0; i < message.dependency.length; ++i) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.dependency[i]); + if (message.messageType != null && message.messageType.length) + for (var i = 0; i < message.messageType.length; ++i) + $root.google.protobuf.DescriptorProto.encode(message.messageType[i], writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.enumType != null && message.enumType.length) + for (var i = 0; i < message.enumType.length; ++i) + $root.google.protobuf.EnumDescriptorProto.encode(message.enumType[i], writer.uint32(/* id 5, wireType 2 =*/42).fork()).ldelim(); + if (message.service != null && message.service.length) + for (var i = 0; i < message.service.length; ++i) + $root.google.protobuf.ServiceDescriptorProto.encode(message.service[i], writer.uint32(/* id 6, wireType 2 =*/50).fork()).ldelim(); + if (message.extension != null && message.extension.length) + for (var i = 0; i < message.extension.length; ++i) + $root.google.protobuf.FieldDescriptorProto.encode(message.extension[i], writer.uint32(/* id 7, wireType 2 =*/58).fork()).ldelim(); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.FileOptions.encode(message.options, writer.uint32(/* id 8, wireType 2 =*/66).fork()).ldelim(); + if (message.sourceCodeInfo != null && Object.hasOwnProperty.call(message, "sourceCodeInfo")) + $root.google.protobuf.SourceCodeInfo.encode(message.sourceCodeInfo, writer.uint32(/* id 9, wireType 2 =*/74).fork()).ldelim(); + if (message.publicDependency != null && message.publicDependency.length) + for (var i = 0; i < message.publicDependency.length; ++i) + writer.uint32(/* id 10, wireType 0 =*/80).int32(message.publicDependency[i]); + if (message.weakDependency != null && message.weakDependency.length) + for (var i = 0; i < message.weakDependency.length; ++i) + writer.uint32(/* id 11, wireType 0 =*/88).int32(message.weakDependency[i]); + if (message.syntax != null && Object.hasOwnProperty.call(message, "syntax")) + writer.uint32(/* id 12, wireType 2 =*/98).string(message.syntax); + if (message.edition != null && Object.hasOwnProperty.call(message, "edition")) + writer.uint32(/* id 13, wireType 2 =*/106).string(message.edition); + return writer; + }; + + /** + * Encodes the specified FileDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.FileDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {google.protobuf.IFileDescriptorProto} message FileDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FileDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FileDescriptorProto} FileDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FileDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message["package"] = reader.string(); + break; + } + case 3: { + if (!(message.dependency && message.dependency.length)) + message.dependency = []; + message.dependency.push(reader.string()); + break; + } + case 10: { + if (!(message.publicDependency && message.publicDependency.length)) + message.publicDependency = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.publicDependency.push(reader.int32()); + } else + message.publicDependency.push(reader.int32()); + break; + } + case 11: { + if (!(message.weakDependency && message.weakDependency.length)) + message.weakDependency = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.weakDependency.push(reader.int32()); + } else + message.weakDependency.push(reader.int32()); + break; + } + case 4: { + if (!(message.messageType && message.messageType.length)) + message.messageType = []; + message.messageType.push($root.google.protobuf.DescriptorProto.decode(reader, reader.uint32())); + break; + } + case 5: { + if (!(message.enumType && message.enumType.length)) + message.enumType = []; + message.enumType.push($root.google.protobuf.EnumDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 6: { + if (!(message.service && message.service.length)) + message.service = []; + message.service.push($root.google.protobuf.ServiceDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 7: { + if (!(message.extension && message.extension.length)) + message.extension = []; + message.extension.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 8: { + message.options = $root.google.protobuf.FileOptions.decode(reader, reader.uint32()); + break; + } + case 9: { + message.sourceCodeInfo = $root.google.protobuf.SourceCodeInfo.decode(reader, reader.uint32()); + break; + } + case 12: { + message.syntax = reader.string(); + break; + } + case 13: { + message.edition = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FileDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FileDescriptorProto} FileDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FileDescriptorProto message. + * @function verify + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FileDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message["package"] != null && message.hasOwnProperty("package")) + if (!$util.isString(message["package"])) + return "package: string expected"; + if (message.dependency != null && message.hasOwnProperty("dependency")) { + if (!Array.isArray(message.dependency)) + return "dependency: array expected"; + for (var i = 0; i < message.dependency.length; ++i) + if (!$util.isString(message.dependency[i])) + return "dependency: string[] expected"; + } + if (message.publicDependency != null && message.hasOwnProperty("publicDependency")) { + if (!Array.isArray(message.publicDependency)) + return "publicDependency: array expected"; + for (var i = 0; i < message.publicDependency.length; ++i) + if (!$util.isInteger(message.publicDependency[i])) + return "publicDependency: integer[] expected"; + } + if (message.weakDependency != null && message.hasOwnProperty("weakDependency")) { + if (!Array.isArray(message.weakDependency)) + return "weakDependency: array expected"; + for (var i = 0; i < message.weakDependency.length; ++i) + if (!$util.isInteger(message.weakDependency[i])) + return "weakDependency: integer[] expected"; + } + if (message.messageType != null && message.hasOwnProperty("messageType")) { + if (!Array.isArray(message.messageType)) + return "messageType: array expected"; + for (var i = 0; i < message.messageType.length; ++i) { + var error = $root.google.protobuf.DescriptorProto.verify(message.messageType[i]); + if (error) + return "messageType." + error; + } + } + if (message.enumType != null && message.hasOwnProperty("enumType")) { + if (!Array.isArray(message.enumType)) + return "enumType: array expected"; + for (var i = 0; i < message.enumType.length; ++i) { + var error = $root.google.protobuf.EnumDescriptorProto.verify(message.enumType[i]); + if (error) + return "enumType." + error; + } + } + if (message.service != null && message.hasOwnProperty("service")) { + if (!Array.isArray(message.service)) + return "service: array expected"; + for (var i = 0; i < message.service.length; ++i) { + var error = $root.google.protobuf.ServiceDescriptorProto.verify(message.service[i]); + if (error) + return "service." + error; + } + } + if (message.extension != null && message.hasOwnProperty("extension")) { + if (!Array.isArray(message.extension)) + return "extension: array expected"; + for (var i = 0; i < message.extension.length; ++i) { + var error = $root.google.protobuf.FieldDescriptorProto.verify(message.extension[i]); + if (error) + return "extension." + error; + } + } + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.FileOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.sourceCodeInfo != null && message.hasOwnProperty("sourceCodeInfo")) { + var error = $root.google.protobuf.SourceCodeInfo.verify(message.sourceCodeInfo); + if (error) + return "sourceCodeInfo." + error; + } + if (message.syntax != null && message.hasOwnProperty("syntax")) + if (!$util.isString(message.syntax)) + return "syntax: string expected"; + if (message.edition != null && message.hasOwnProperty("edition")) + if (!$util.isString(message.edition)) + return "edition: string expected"; + return null; + }; + + /** + * Creates a FileDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FileDescriptorProto} FileDescriptorProto + */ + FileDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FileDescriptorProto) + return object; + var message = new $root.google.protobuf.FileDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object["package"] != null) + message["package"] = String(object["package"]); + if (object.dependency) { + if (!Array.isArray(object.dependency)) + throw TypeError(".google.protobuf.FileDescriptorProto.dependency: array expected"); + message.dependency = []; + for (var i = 0; i < object.dependency.length; ++i) + message.dependency[i] = String(object.dependency[i]); + } + if (object.publicDependency) { + if (!Array.isArray(object.publicDependency)) + throw TypeError(".google.protobuf.FileDescriptorProto.publicDependency: array expected"); + message.publicDependency = []; + for (var i = 0; i < object.publicDependency.length; ++i) + message.publicDependency[i] = object.publicDependency[i] | 0; + } + if (object.weakDependency) { + if (!Array.isArray(object.weakDependency)) + throw TypeError(".google.protobuf.FileDescriptorProto.weakDependency: array expected"); + message.weakDependency = []; + for (var i = 0; i < object.weakDependency.length; ++i) + message.weakDependency[i] = object.weakDependency[i] | 0; + } + if (object.messageType) { + if (!Array.isArray(object.messageType)) + throw TypeError(".google.protobuf.FileDescriptorProto.messageType: array expected"); + message.messageType = []; + for (var i = 0; i < object.messageType.length; ++i) { + if (typeof object.messageType[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.messageType: object expected"); + message.messageType[i] = $root.google.protobuf.DescriptorProto.fromObject(object.messageType[i]); + } + } + if (object.enumType) { + if (!Array.isArray(object.enumType)) + throw TypeError(".google.protobuf.FileDescriptorProto.enumType: array expected"); + message.enumType = []; + for (var i = 0; i < object.enumType.length; ++i) { + if (typeof object.enumType[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.enumType: object expected"); + message.enumType[i] = $root.google.protobuf.EnumDescriptorProto.fromObject(object.enumType[i]); + } + } + if (object.service) { + if (!Array.isArray(object.service)) + throw TypeError(".google.protobuf.FileDescriptorProto.service: array expected"); + message.service = []; + for (var i = 0; i < object.service.length; ++i) { + if (typeof object.service[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.service: object expected"); + message.service[i] = $root.google.protobuf.ServiceDescriptorProto.fromObject(object.service[i]); + } + } + if (object.extension) { + if (!Array.isArray(object.extension)) + throw TypeError(".google.protobuf.FileDescriptorProto.extension: array expected"); + message.extension = []; + for (var i = 0; i < object.extension.length; ++i) { + if (typeof object.extension[i] !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.extension: object expected"); + message.extension[i] = $root.google.protobuf.FieldDescriptorProto.fromObject(object.extension[i]); + } + } + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.FileOptions.fromObject(object.options); + } + if (object.sourceCodeInfo != null) { + if (typeof object.sourceCodeInfo !== "object") + throw TypeError(".google.protobuf.FileDescriptorProto.sourceCodeInfo: object expected"); + message.sourceCodeInfo = $root.google.protobuf.SourceCodeInfo.fromObject(object.sourceCodeInfo); + } + if (object.syntax != null) + message.syntax = String(object.syntax); + if (object.edition != null) + message.edition = String(object.edition); + return message; + }; + + /** + * Creates a plain object from a FileDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {google.protobuf.FileDescriptorProto} message FileDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FileDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.dependency = []; + object.messageType = []; + object.enumType = []; + object.service = []; + object.extension = []; + object.publicDependency = []; + object.weakDependency = []; + } + if (options.defaults) { + object.name = ""; + object["package"] = ""; + object.options = null; + object.sourceCodeInfo = null; + object.syntax = ""; + object.edition = ""; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message["package"] != null && message.hasOwnProperty("package")) + object["package"] = message["package"]; + if (message.dependency && message.dependency.length) { + object.dependency = []; + for (var j = 0; j < message.dependency.length; ++j) + object.dependency[j] = message.dependency[j]; + } + if (message.messageType && message.messageType.length) { + object.messageType = []; + for (var j = 0; j < message.messageType.length; ++j) + object.messageType[j] = $root.google.protobuf.DescriptorProto.toObject(message.messageType[j], options); + } + if (message.enumType && message.enumType.length) { + object.enumType = []; + for (var j = 0; j < message.enumType.length; ++j) + object.enumType[j] = $root.google.protobuf.EnumDescriptorProto.toObject(message.enumType[j], options); + } + if (message.service && message.service.length) { + object.service = []; + for (var j = 0; j < message.service.length; ++j) + object.service[j] = $root.google.protobuf.ServiceDescriptorProto.toObject(message.service[j], options); + } + if (message.extension && message.extension.length) { + object.extension = []; + for (var j = 0; j < message.extension.length; ++j) + object.extension[j] = $root.google.protobuf.FieldDescriptorProto.toObject(message.extension[j], options); + } + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.FileOptions.toObject(message.options, options); + if (message.sourceCodeInfo != null && message.hasOwnProperty("sourceCodeInfo")) + object.sourceCodeInfo = $root.google.protobuf.SourceCodeInfo.toObject(message.sourceCodeInfo, options); + if (message.publicDependency && message.publicDependency.length) { + object.publicDependency = []; + for (var j = 0; j < message.publicDependency.length; ++j) + object.publicDependency[j] = message.publicDependency[j]; + } + if (message.weakDependency && message.weakDependency.length) { + object.weakDependency = []; + for (var j = 0; j < message.weakDependency.length; ++j) + object.weakDependency[j] = message.weakDependency[j]; + } + if (message.syntax != null && message.hasOwnProperty("syntax")) + object.syntax = message.syntax; + if (message.edition != null && message.hasOwnProperty("edition")) + object.edition = message.edition; + return object; + }; + + /** + * Converts this FileDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.FileDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + FileDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for FileDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.FileDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FileDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FileDescriptorProto"; + }; + + return FileDescriptorProto; + })(); + + protobuf.DescriptorProto = (function() { + + /** + * Properties of a DescriptorProto. + * @memberof google.protobuf + * @interface IDescriptorProto + * @property {string|null} [name] DescriptorProto name + * @property {Array.|null} [field] DescriptorProto field + * @property {Array.|null} [extension] DescriptorProto extension + * @property {Array.|null} [nestedType] DescriptorProto nestedType + * @property {Array.|null} [enumType] DescriptorProto enumType + * @property {Array.|null} [extensionRange] DescriptorProto extensionRange + * @property {Array.|null} [oneofDecl] DescriptorProto oneofDecl + * @property {google.protobuf.IMessageOptions|null} [options] DescriptorProto options + * @property {Array.|null} [reservedRange] DescriptorProto reservedRange + * @property {Array.|null} [reservedName] DescriptorProto reservedName + */ + + /** + * Constructs a new DescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a DescriptorProto. + * @implements IDescriptorProto + * @constructor + * @param {google.protobuf.IDescriptorProto=} [properties] Properties to set + */ + function DescriptorProto(properties) { + this.field = []; + this.extension = []; + this.nestedType = []; + this.enumType = []; + this.extensionRange = []; + this.oneofDecl = []; + this.reservedRange = []; + this.reservedName = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * DescriptorProto name. + * @member {string} name + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.name = ""; + + /** + * DescriptorProto field. + * @member {Array.} field + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.field = $util.emptyArray; + + /** + * DescriptorProto extension. + * @member {Array.} extension + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.extension = $util.emptyArray; + + /** + * DescriptorProto nestedType. + * @member {Array.} nestedType + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.nestedType = $util.emptyArray; + + /** + * DescriptorProto enumType. + * @member {Array.} enumType + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.enumType = $util.emptyArray; + + /** + * DescriptorProto extensionRange. + * @member {Array.} extensionRange + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.extensionRange = $util.emptyArray; + + /** + * DescriptorProto oneofDecl. + * @member {Array.} oneofDecl + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.oneofDecl = $util.emptyArray; + + /** + * DescriptorProto options. + * @member {google.protobuf.IMessageOptions|null|undefined} options + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.options = null; + + /** + * DescriptorProto reservedRange. + * @member {Array.} reservedRange + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.reservedRange = $util.emptyArray; + + /** + * DescriptorProto reservedName. + * @member {Array.} reservedName + * @memberof google.protobuf.DescriptorProto + * @instance + */ + DescriptorProto.prototype.reservedName = $util.emptyArray; + + /** + * Creates a new DescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.DescriptorProto + * @static + * @param {google.protobuf.IDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.DescriptorProto} DescriptorProto instance + */ + DescriptorProto.create = function create(properties) { + return new DescriptorProto(properties); + }; + + /** + * Encodes the specified DescriptorProto message. Does not implicitly {@link google.protobuf.DescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.DescriptorProto + * @static + * @param {google.protobuf.IDescriptorProto} message DescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + DescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.field != null && message.field.length) + for (var i = 0; i < message.field.length; ++i) + $root.google.protobuf.FieldDescriptorProto.encode(message.field[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.nestedType != null && message.nestedType.length) + for (var i = 0; i < message.nestedType.length; ++i) + $root.google.protobuf.DescriptorProto.encode(message.nestedType[i], writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + if (message.enumType != null && message.enumType.length) + for (var i = 0; i < message.enumType.length; ++i) + $root.google.protobuf.EnumDescriptorProto.encode(message.enumType[i], writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.extensionRange != null && message.extensionRange.length) + for (var i = 0; i < message.extensionRange.length; ++i) + $root.google.protobuf.DescriptorProto.ExtensionRange.encode(message.extensionRange[i], writer.uint32(/* id 5, wireType 2 =*/42).fork()).ldelim(); + if (message.extension != null && message.extension.length) + for (var i = 0; i < message.extension.length; ++i) + $root.google.protobuf.FieldDescriptorProto.encode(message.extension[i], writer.uint32(/* id 6, wireType 2 =*/50).fork()).ldelim(); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.MessageOptions.encode(message.options, writer.uint32(/* id 7, wireType 2 =*/58).fork()).ldelim(); + if (message.oneofDecl != null && message.oneofDecl.length) + for (var i = 0; i < message.oneofDecl.length; ++i) + $root.google.protobuf.OneofDescriptorProto.encode(message.oneofDecl[i], writer.uint32(/* id 8, wireType 2 =*/66).fork()).ldelim(); + if (message.reservedRange != null && message.reservedRange.length) + for (var i = 0; i < message.reservedRange.length; ++i) + $root.google.protobuf.DescriptorProto.ReservedRange.encode(message.reservedRange[i], writer.uint32(/* id 9, wireType 2 =*/74).fork()).ldelim(); + if (message.reservedName != null && message.reservedName.length) + for (var i = 0; i < message.reservedName.length; ++i) + writer.uint32(/* id 10, wireType 2 =*/82).string(message.reservedName[i]); + return writer; + }; + + /** + * Encodes the specified DescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.DescriptorProto + * @static + * @param {google.protobuf.IDescriptorProto} message DescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + DescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a DescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.DescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.DescriptorProto} DescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + DescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.DescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 2: { + if (!(message.field && message.field.length)) + message.field = []; + message.field.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 6: { + if (!(message.extension && message.extension.length)) + message.extension = []; + message.extension.push($root.google.protobuf.FieldDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 3: { + if (!(message.nestedType && message.nestedType.length)) + message.nestedType = []; + message.nestedType.push($root.google.protobuf.DescriptorProto.decode(reader, reader.uint32())); + break; + } + case 4: { + if (!(message.enumType && message.enumType.length)) + message.enumType = []; + message.enumType.push($root.google.protobuf.EnumDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 5: { + if (!(message.extensionRange && message.extensionRange.length)) + message.extensionRange = []; + message.extensionRange.push($root.google.protobuf.DescriptorProto.ExtensionRange.decode(reader, reader.uint32())); + break; + } + case 8: { + if (!(message.oneofDecl && message.oneofDecl.length)) + message.oneofDecl = []; + message.oneofDecl.push($root.google.protobuf.OneofDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 7: { + message.options = $root.google.protobuf.MessageOptions.decode(reader, reader.uint32()); + break; + } + case 9: { + if (!(message.reservedRange && message.reservedRange.length)) + message.reservedRange = []; + message.reservedRange.push($root.google.protobuf.DescriptorProto.ReservedRange.decode(reader, reader.uint32())); + break; + } + case 10: { + if (!(message.reservedName && message.reservedName.length)) + message.reservedName = []; + message.reservedName.push(reader.string()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a DescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.DescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.DescriptorProto} DescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + DescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a DescriptorProto message. + * @function verify + * @memberof google.protobuf.DescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + DescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.field != null && message.hasOwnProperty("field")) { + if (!Array.isArray(message.field)) + return "field: array expected"; + for (var i = 0; i < message.field.length; ++i) { + var error = $root.google.protobuf.FieldDescriptorProto.verify(message.field[i]); + if (error) + return "field." + error; + } + } + if (message.extension != null && message.hasOwnProperty("extension")) { + if (!Array.isArray(message.extension)) + return "extension: array expected"; + for (var i = 0; i < message.extension.length; ++i) { + var error = $root.google.protobuf.FieldDescriptorProto.verify(message.extension[i]); + if (error) + return "extension." + error; + } + } + if (message.nestedType != null && message.hasOwnProperty("nestedType")) { + if (!Array.isArray(message.nestedType)) + return "nestedType: array expected"; + for (var i = 0; i < message.nestedType.length; ++i) { + var error = $root.google.protobuf.DescriptorProto.verify(message.nestedType[i]); + if (error) + return "nestedType." + error; + } + } + if (message.enumType != null && message.hasOwnProperty("enumType")) { + if (!Array.isArray(message.enumType)) + return "enumType: array expected"; + for (var i = 0; i < message.enumType.length; ++i) { + var error = $root.google.protobuf.EnumDescriptorProto.verify(message.enumType[i]); + if (error) + return "enumType." + error; + } + } + if (message.extensionRange != null && message.hasOwnProperty("extensionRange")) { + if (!Array.isArray(message.extensionRange)) + return "extensionRange: array expected"; + for (var i = 0; i < message.extensionRange.length; ++i) { + var error = $root.google.protobuf.DescriptorProto.ExtensionRange.verify(message.extensionRange[i]); + if (error) + return "extensionRange." + error; + } + } + if (message.oneofDecl != null && message.hasOwnProperty("oneofDecl")) { + if (!Array.isArray(message.oneofDecl)) + return "oneofDecl: array expected"; + for (var i = 0; i < message.oneofDecl.length; ++i) { + var error = $root.google.protobuf.OneofDescriptorProto.verify(message.oneofDecl[i]); + if (error) + return "oneofDecl." + error; + } + } + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.MessageOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.reservedRange != null && message.hasOwnProperty("reservedRange")) { + if (!Array.isArray(message.reservedRange)) + return "reservedRange: array expected"; + for (var i = 0; i < message.reservedRange.length; ++i) { + var error = $root.google.protobuf.DescriptorProto.ReservedRange.verify(message.reservedRange[i]); + if (error) + return "reservedRange." + error; + } + } + if (message.reservedName != null && message.hasOwnProperty("reservedName")) { + if (!Array.isArray(message.reservedName)) + return "reservedName: array expected"; + for (var i = 0; i < message.reservedName.length; ++i) + if (!$util.isString(message.reservedName[i])) + return "reservedName: string[] expected"; + } + return null; + }; + + /** + * Creates a DescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.DescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.DescriptorProto} DescriptorProto + */ + DescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.DescriptorProto) + return object; + var message = new $root.google.protobuf.DescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.field) { + if (!Array.isArray(object.field)) + throw TypeError(".google.protobuf.DescriptorProto.field: array expected"); + message.field = []; + for (var i = 0; i < object.field.length; ++i) { + if (typeof object.field[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.field: object expected"); + message.field[i] = $root.google.protobuf.FieldDescriptorProto.fromObject(object.field[i]); + } + } + if (object.extension) { + if (!Array.isArray(object.extension)) + throw TypeError(".google.protobuf.DescriptorProto.extension: array expected"); + message.extension = []; + for (var i = 0; i < object.extension.length; ++i) { + if (typeof object.extension[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.extension: object expected"); + message.extension[i] = $root.google.protobuf.FieldDescriptorProto.fromObject(object.extension[i]); + } + } + if (object.nestedType) { + if (!Array.isArray(object.nestedType)) + throw TypeError(".google.protobuf.DescriptorProto.nestedType: array expected"); + message.nestedType = []; + for (var i = 0; i < object.nestedType.length; ++i) { + if (typeof object.nestedType[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.nestedType: object expected"); + message.nestedType[i] = $root.google.protobuf.DescriptorProto.fromObject(object.nestedType[i]); + } + } + if (object.enumType) { + if (!Array.isArray(object.enumType)) + throw TypeError(".google.protobuf.DescriptorProto.enumType: array expected"); + message.enumType = []; + for (var i = 0; i < object.enumType.length; ++i) { + if (typeof object.enumType[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.enumType: object expected"); + message.enumType[i] = $root.google.protobuf.EnumDescriptorProto.fromObject(object.enumType[i]); + } + } + if (object.extensionRange) { + if (!Array.isArray(object.extensionRange)) + throw TypeError(".google.protobuf.DescriptorProto.extensionRange: array expected"); + message.extensionRange = []; + for (var i = 0; i < object.extensionRange.length; ++i) { + if (typeof object.extensionRange[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.extensionRange: object expected"); + message.extensionRange[i] = $root.google.protobuf.DescriptorProto.ExtensionRange.fromObject(object.extensionRange[i]); + } + } + if (object.oneofDecl) { + if (!Array.isArray(object.oneofDecl)) + throw TypeError(".google.protobuf.DescriptorProto.oneofDecl: array expected"); + message.oneofDecl = []; + for (var i = 0; i < object.oneofDecl.length; ++i) { + if (typeof object.oneofDecl[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.oneofDecl: object expected"); + message.oneofDecl[i] = $root.google.protobuf.OneofDescriptorProto.fromObject(object.oneofDecl[i]); + } + } + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.DescriptorProto.options: object expected"); + message.options = $root.google.protobuf.MessageOptions.fromObject(object.options); + } + if (object.reservedRange) { + if (!Array.isArray(object.reservedRange)) + throw TypeError(".google.protobuf.DescriptorProto.reservedRange: array expected"); + message.reservedRange = []; + for (var i = 0; i < object.reservedRange.length; ++i) { + if (typeof object.reservedRange[i] !== "object") + throw TypeError(".google.protobuf.DescriptorProto.reservedRange: object expected"); + message.reservedRange[i] = $root.google.protobuf.DescriptorProto.ReservedRange.fromObject(object.reservedRange[i]); + } + } + if (object.reservedName) { + if (!Array.isArray(object.reservedName)) + throw TypeError(".google.protobuf.DescriptorProto.reservedName: array expected"); + message.reservedName = []; + for (var i = 0; i < object.reservedName.length; ++i) + message.reservedName[i] = String(object.reservedName[i]); + } + return message; + }; + + /** + * Creates a plain object from a DescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.DescriptorProto + * @static + * @param {google.protobuf.DescriptorProto} message DescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + DescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.field = []; + object.nestedType = []; + object.enumType = []; + object.extensionRange = []; + object.extension = []; + object.oneofDecl = []; + object.reservedRange = []; + object.reservedName = []; + } + if (options.defaults) { + object.name = ""; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.field && message.field.length) { + object.field = []; + for (var j = 0; j < message.field.length; ++j) + object.field[j] = $root.google.protobuf.FieldDescriptorProto.toObject(message.field[j], options); + } + if (message.nestedType && message.nestedType.length) { + object.nestedType = []; + for (var j = 0; j < message.nestedType.length; ++j) + object.nestedType[j] = $root.google.protobuf.DescriptorProto.toObject(message.nestedType[j], options); + } + if (message.enumType && message.enumType.length) { + object.enumType = []; + for (var j = 0; j < message.enumType.length; ++j) + object.enumType[j] = $root.google.protobuf.EnumDescriptorProto.toObject(message.enumType[j], options); + } + if (message.extensionRange && message.extensionRange.length) { + object.extensionRange = []; + for (var j = 0; j < message.extensionRange.length; ++j) + object.extensionRange[j] = $root.google.protobuf.DescriptorProto.ExtensionRange.toObject(message.extensionRange[j], options); + } + if (message.extension && message.extension.length) { + object.extension = []; + for (var j = 0; j < message.extension.length; ++j) + object.extension[j] = $root.google.protobuf.FieldDescriptorProto.toObject(message.extension[j], options); + } + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.MessageOptions.toObject(message.options, options); + if (message.oneofDecl && message.oneofDecl.length) { + object.oneofDecl = []; + for (var j = 0; j < message.oneofDecl.length; ++j) + object.oneofDecl[j] = $root.google.protobuf.OneofDescriptorProto.toObject(message.oneofDecl[j], options); + } + if (message.reservedRange && message.reservedRange.length) { + object.reservedRange = []; + for (var j = 0; j < message.reservedRange.length; ++j) + object.reservedRange[j] = $root.google.protobuf.DescriptorProto.ReservedRange.toObject(message.reservedRange[j], options); + } + if (message.reservedName && message.reservedName.length) { + object.reservedName = []; + for (var j = 0; j < message.reservedName.length; ++j) + object.reservedName[j] = message.reservedName[j]; + } + return object; + }; + + /** + * Converts this DescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.DescriptorProto + * @instance + * @returns {Object.} JSON object + */ + DescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for DescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.DescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + DescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.DescriptorProto"; + }; + + DescriptorProto.ExtensionRange = (function() { + + /** + * Properties of an ExtensionRange. + * @memberof google.protobuf.DescriptorProto + * @interface IExtensionRange + * @property {number|null} [start] ExtensionRange start + * @property {number|null} [end] ExtensionRange end + * @property {google.protobuf.IExtensionRangeOptions|null} [options] ExtensionRange options + */ + + /** + * Constructs a new ExtensionRange. + * @memberof google.protobuf.DescriptorProto + * @classdesc Represents an ExtensionRange. + * @implements IExtensionRange + * @constructor + * @param {google.protobuf.DescriptorProto.IExtensionRange=} [properties] Properties to set + */ + function ExtensionRange(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ExtensionRange start. + * @member {number} start + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @instance + */ + ExtensionRange.prototype.start = 0; + + /** + * ExtensionRange end. + * @member {number} end + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @instance + */ + ExtensionRange.prototype.end = 0; + + /** + * ExtensionRange options. + * @member {google.protobuf.IExtensionRangeOptions|null|undefined} options + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @instance + */ + ExtensionRange.prototype.options = null; + + /** + * Creates a new ExtensionRange instance using the specified properties. + * @function create + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {google.protobuf.DescriptorProto.IExtensionRange=} [properties] Properties to set + * @returns {google.protobuf.DescriptorProto.ExtensionRange} ExtensionRange instance + */ + ExtensionRange.create = function create(properties) { + return new ExtensionRange(properties); + }; + + /** + * Encodes the specified ExtensionRange message. Does not implicitly {@link google.protobuf.DescriptorProto.ExtensionRange.verify|verify} messages. + * @function encode + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {google.protobuf.DescriptorProto.IExtensionRange} message ExtensionRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ExtensionRange.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.start != null && Object.hasOwnProperty.call(message, "start")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.start); + if (message.end != null && Object.hasOwnProperty.call(message, "end")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.end); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.ExtensionRangeOptions.encode(message.options, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified ExtensionRange message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.ExtensionRange.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {google.protobuf.DescriptorProto.IExtensionRange} message ExtensionRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ExtensionRange.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an ExtensionRange message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.DescriptorProto.ExtensionRange} ExtensionRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ExtensionRange.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.DescriptorProto.ExtensionRange(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.start = reader.int32(); + break; + } + case 2: { + message.end = reader.int32(); + break; + } + case 3: { + message.options = $root.google.protobuf.ExtensionRangeOptions.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an ExtensionRange message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.DescriptorProto.ExtensionRange} ExtensionRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ExtensionRange.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an ExtensionRange message. + * @function verify + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ExtensionRange.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.start != null && message.hasOwnProperty("start")) + if (!$util.isInteger(message.start)) + return "start: integer expected"; + if (message.end != null && message.hasOwnProperty("end")) + if (!$util.isInteger(message.end)) + return "end: integer expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.ExtensionRangeOptions.verify(message.options); + if (error) + return "options." + error; + } + return null; + }; + + /** + * Creates an ExtensionRange message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.DescriptorProto.ExtensionRange} ExtensionRange + */ + ExtensionRange.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.DescriptorProto.ExtensionRange) + return object; + var message = new $root.google.protobuf.DescriptorProto.ExtensionRange(); + if (object.start != null) + message.start = object.start | 0; + if (object.end != null) + message.end = object.end | 0; + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.DescriptorProto.ExtensionRange.options: object expected"); + message.options = $root.google.protobuf.ExtensionRangeOptions.fromObject(object.options); + } + return message; + }; + + /** + * Creates a plain object from an ExtensionRange message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {google.protobuf.DescriptorProto.ExtensionRange} message ExtensionRange + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ExtensionRange.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.start = 0; + object.end = 0; + object.options = null; + } + if (message.start != null && message.hasOwnProperty("start")) + object.start = message.start; + if (message.end != null && message.hasOwnProperty("end")) + object.end = message.end; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.ExtensionRangeOptions.toObject(message.options, options); + return object; + }; + + /** + * Converts this ExtensionRange to JSON. + * @function toJSON + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @instance + * @returns {Object.} JSON object + */ + ExtensionRange.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for ExtensionRange + * @function getTypeUrl + * @memberof google.protobuf.DescriptorProto.ExtensionRange + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ExtensionRange.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.DescriptorProto.ExtensionRange"; + }; + + return ExtensionRange; + })(); + + DescriptorProto.ReservedRange = (function() { + + /** + * Properties of a ReservedRange. + * @memberof google.protobuf.DescriptorProto + * @interface IReservedRange + * @property {number|null} [start] ReservedRange start + * @property {number|null} [end] ReservedRange end + */ + + /** + * Constructs a new ReservedRange. + * @memberof google.protobuf.DescriptorProto + * @classdesc Represents a ReservedRange. + * @implements IReservedRange + * @constructor + * @param {google.protobuf.DescriptorProto.IReservedRange=} [properties] Properties to set + */ + function ReservedRange(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ReservedRange start. + * @member {number} start + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @instance + */ + ReservedRange.prototype.start = 0; + + /** + * ReservedRange end. + * @member {number} end + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @instance + */ + ReservedRange.prototype.end = 0; + + /** + * Creates a new ReservedRange instance using the specified properties. + * @function create + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {google.protobuf.DescriptorProto.IReservedRange=} [properties] Properties to set + * @returns {google.protobuf.DescriptorProto.ReservedRange} ReservedRange instance + */ + ReservedRange.create = function create(properties) { + return new ReservedRange(properties); + }; + + /** + * Encodes the specified ReservedRange message. Does not implicitly {@link google.protobuf.DescriptorProto.ReservedRange.verify|verify} messages. + * @function encode + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {google.protobuf.DescriptorProto.IReservedRange} message ReservedRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ReservedRange.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.start != null && Object.hasOwnProperty.call(message, "start")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.start); + if (message.end != null && Object.hasOwnProperty.call(message, "end")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.end); + return writer; + }; + + /** + * Encodes the specified ReservedRange message, length delimited. Does not implicitly {@link google.protobuf.DescriptorProto.ReservedRange.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {google.protobuf.DescriptorProto.IReservedRange} message ReservedRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ReservedRange.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ReservedRange message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.DescriptorProto.ReservedRange} ReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ReservedRange.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.DescriptorProto.ReservedRange(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.start = reader.int32(); + break; + } + case 2: { + message.end = reader.int32(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ReservedRange message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.DescriptorProto.ReservedRange} ReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ReservedRange.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ReservedRange message. + * @function verify + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ReservedRange.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.start != null && message.hasOwnProperty("start")) + if (!$util.isInteger(message.start)) + return "start: integer expected"; + if (message.end != null && message.hasOwnProperty("end")) + if (!$util.isInteger(message.end)) + return "end: integer expected"; + return null; + }; + + /** + * Creates a ReservedRange message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.DescriptorProto.ReservedRange} ReservedRange + */ + ReservedRange.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.DescriptorProto.ReservedRange) + return object; + var message = new $root.google.protobuf.DescriptorProto.ReservedRange(); + if (object.start != null) + message.start = object.start | 0; + if (object.end != null) + message.end = object.end | 0; + return message; + }; + + /** + * Creates a plain object from a ReservedRange message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {google.protobuf.DescriptorProto.ReservedRange} message ReservedRange + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ReservedRange.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.start = 0; + object.end = 0; + } + if (message.start != null && message.hasOwnProperty("start")) + object.start = message.start; + if (message.end != null && message.hasOwnProperty("end")) + object.end = message.end; + return object; + }; + + /** + * Converts this ReservedRange to JSON. + * @function toJSON + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @instance + * @returns {Object.} JSON object + */ + ReservedRange.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for ReservedRange + * @function getTypeUrl + * @memberof google.protobuf.DescriptorProto.ReservedRange + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ReservedRange.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.DescriptorProto.ReservedRange"; + }; + + return ReservedRange; + })(); + + return DescriptorProto; + })(); + + protobuf.ExtensionRangeOptions = (function() { + + /** + * Properties of an ExtensionRangeOptions. + * @memberof google.protobuf + * @interface IExtensionRangeOptions + * @property {Array.|null} [uninterpretedOption] ExtensionRangeOptions uninterpretedOption + */ + + /** + * Constructs a new ExtensionRangeOptions. + * @memberof google.protobuf + * @classdesc Represents an ExtensionRangeOptions. + * @implements IExtensionRangeOptions + * @constructor + * @param {google.protobuf.IExtensionRangeOptions=} [properties] Properties to set + */ + function ExtensionRangeOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ExtensionRangeOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.ExtensionRangeOptions + * @instance + */ + ExtensionRangeOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * Creates a new ExtensionRangeOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {google.protobuf.IExtensionRangeOptions=} [properties] Properties to set + * @returns {google.protobuf.ExtensionRangeOptions} ExtensionRangeOptions instance + */ + ExtensionRangeOptions.create = function create(properties) { + return new ExtensionRangeOptions(properties); + }; + + /** + * Encodes the specified ExtensionRangeOptions message. Does not implicitly {@link google.protobuf.ExtensionRangeOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {google.protobuf.IExtensionRangeOptions} message ExtensionRangeOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ExtensionRangeOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified ExtensionRangeOptions message, length delimited. Does not implicitly {@link google.protobuf.ExtensionRangeOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {google.protobuf.IExtensionRangeOptions} message ExtensionRangeOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ExtensionRangeOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an ExtensionRangeOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.ExtensionRangeOptions} ExtensionRangeOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ExtensionRangeOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.ExtensionRangeOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an ExtensionRangeOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.ExtensionRangeOptions} ExtensionRangeOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ExtensionRangeOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an ExtensionRangeOptions message. + * @function verify + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ExtensionRangeOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + return null; + }; + + /** + * Creates an ExtensionRangeOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.ExtensionRangeOptions} ExtensionRangeOptions + */ + ExtensionRangeOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.ExtensionRangeOptions) + return object; + var message = new $root.google.protobuf.ExtensionRangeOptions(); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.ExtensionRangeOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.ExtensionRangeOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + return message; + }; + + /** + * Creates a plain object from an ExtensionRangeOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {google.protobuf.ExtensionRangeOptions} message ExtensionRangeOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ExtensionRangeOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + return object; + }; + + /** + * Converts this ExtensionRangeOptions to JSON. + * @function toJSON + * @memberof google.protobuf.ExtensionRangeOptions + * @instance + * @returns {Object.} JSON object + */ + ExtensionRangeOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for ExtensionRangeOptions + * @function getTypeUrl + * @memberof google.protobuf.ExtensionRangeOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ExtensionRangeOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.ExtensionRangeOptions"; + }; + + return ExtensionRangeOptions; + })(); + + protobuf.FieldDescriptorProto = (function() { + + /** + * Properties of a FieldDescriptorProto. + * @memberof google.protobuf + * @interface IFieldDescriptorProto + * @property {string|null} [name] FieldDescriptorProto name + * @property {number|null} [number] FieldDescriptorProto number + * @property {google.protobuf.FieldDescriptorProto.Label|null} [label] FieldDescriptorProto label + * @property {google.protobuf.FieldDescriptorProto.Type|null} [type] FieldDescriptorProto type + * @property {string|null} [typeName] FieldDescriptorProto typeName + * @property {string|null} [extendee] FieldDescriptorProto extendee + * @property {string|null} [defaultValue] FieldDescriptorProto defaultValue + * @property {number|null} [oneofIndex] FieldDescriptorProto oneofIndex + * @property {string|null} [jsonName] FieldDescriptorProto jsonName + * @property {google.protobuf.IFieldOptions|null} [options] FieldDescriptorProto options + * @property {boolean|null} [proto3Optional] FieldDescriptorProto proto3Optional + */ + + /** + * Constructs a new FieldDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a FieldDescriptorProto. + * @implements IFieldDescriptorProto + * @constructor + * @param {google.protobuf.IFieldDescriptorProto=} [properties] Properties to set + */ + function FieldDescriptorProto(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FieldDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.name = ""; + + /** + * FieldDescriptorProto number. + * @member {number} number + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.number = 0; + + /** + * FieldDescriptorProto label. + * @member {google.protobuf.FieldDescriptorProto.Label} label + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.label = 1; + + /** + * FieldDescriptorProto type. + * @member {google.protobuf.FieldDescriptorProto.Type} type + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.type = 1; + + /** + * FieldDescriptorProto typeName. + * @member {string} typeName + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.typeName = ""; + + /** + * FieldDescriptorProto extendee. + * @member {string} extendee + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.extendee = ""; + + /** + * FieldDescriptorProto defaultValue. + * @member {string} defaultValue + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.defaultValue = ""; + + /** + * FieldDescriptorProto oneofIndex. + * @member {number} oneofIndex + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.oneofIndex = 0; + + /** + * FieldDescriptorProto jsonName. + * @member {string} jsonName + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.jsonName = ""; + + /** + * FieldDescriptorProto options. + * @member {google.protobuf.IFieldOptions|null|undefined} options + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.options = null; + + /** + * FieldDescriptorProto proto3Optional. + * @member {boolean} proto3Optional + * @memberof google.protobuf.FieldDescriptorProto + * @instance + */ + FieldDescriptorProto.prototype.proto3Optional = false; + + /** + * Creates a new FieldDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {google.protobuf.IFieldDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.FieldDescriptorProto} FieldDescriptorProto instance + */ + FieldDescriptorProto.create = function create(properties) { + return new FieldDescriptorProto(properties); + }; + + /** + * Encodes the specified FieldDescriptorProto message. Does not implicitly {@link google.protobuf.FieldDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {google.protobuf.IFieldDescriptorProto} message FieldDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.extendee != null && Object.hasOwnProperty.call(message, "extendee")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.extendee); + if (message.number != null && Object.hasOwnProperty.call(message, "number")) + writer.uint32(/* id 3, wireType 0 =*/24).int32(message.number); + if (message.label != null && Object.hasOwnProperty.call(message, "label")) + writer.uint32(/* id 4, wireType 0 =*/32).int32(message.label); + if (message.type != null && Object.hasOwnProperty.call(message, "type")) + writer.uint32(/* id 5, wireType 0 =*/40).int32(message.type); + if (message.typeName != null && Object.hasOwnProperty.call(message, "typeName")) + writer.uint32(/* id 6, wireType 2 =*/50).string(message.typeName); + if (message.defaultValue != null && Object.hasOwnProperty.call(message, "defaultValue")) + writer.uint32(/* id 7, wireType 2 =*/58).string(message.defaultValue); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.FieldOptions.encode(message.options, writer.uint32(/* id 8, wireType 2 =*/66).fork()).ldelim(); + if (message.oneofIndex != null && Object.hasOwnProperty.call(message, "oneofIndex")) + writer.uint32(/* id 9, wireType 0 =*/72).int32(message.oneofIndex); + if (message.jsonName != null && Object.hasOwnProperty.call(message, "jsonName")) + writer.uint32(/* id 10, wireType 2 =*/82).string(message.jsonName); + if (message.proto3Optional != null && Object.hasOwnProperty.call(message, "proto3Optional")) + writer.uint32(/* id 17, wireType 0 =*/136).bool(message.proto3Optional); + return writer; + }; + + /** + * Encodes the specified FieldDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.FieldDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {google.protobuf.IFieldDescriptorProto} message FieldDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FieldDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FieldDescriptorProto} FieldDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FieldDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 3: { + message.number = reader.int32(); + break; + } + case 4: { + message.label = reader.int32(); + break; + } + case 5: { + message.type = reader.int32(); + break; + } + case 6: { + message.typeName = reader.string(); + break; + } + case 2: { + message.extendee = reader.string(); + break; + } + case 7: { + message.defaultValue = reader.string(); + break; + } + case 9: { + message.oneofIndex = reader.int32(); + break; + } + case 10: { + message.jsonName = reader.string(); + break; + } + case 8: { + message.options = $root.google.protobuf.FieldOptions.decode(reader, reader.uint32()); + break; + } + case 17: { + message.proto3Optional = reader.bool(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FieldDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FieldDescriptorProto} FieldDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FieldDescriptorProto message. + * @function verify + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FieldDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.number != null && message.hasOwnProperty("number")) + if (!$util.isInteger(message.number)) + return "number: integer expected"; + if (message.label != null && message.hasOwnProperty("label")) + switch (message.label) { + default: + return "label: enum value expected"; + case 1: + case 2: + case 3: + break; + } + if (message.type != null && message.hasOwnProperty("type")) + switch (message.type) { + default: + return "type: enum value expected"; + case 1: + case 2: + case 3: + case 4: + case 5: + case 6: + case 7: + case 8: + case 9: + case 10: + case 11: + case 12: + case 13: + case 14: + case 15: + case 16: + case 17: + case 18: + break; + } + if (message.typeName != null && message.hasOwnProperty("typeName")) + if (!$util.isString(message.typeName)) + return "typeName: string expected"; + if (message.extendee != null && message.hasOwnProperty("extendee")) + if (!$util.isString(message.extendee)) + return "extendee: string expected"; + if (message.defaultValue != null && message.hasOwnProperty("defaultValue")) + if (!$util.isString(message.defaultValue)) + return "defaultValue: string expected"; + if (message.oneofIndex != null && message.hasOwnProperty("oneofIndex")) + if (!$util.isInteger(message.oneofIndex)) + return "oneofIndex: integer expected"; + if (message.jsonName != null && message.hasOwnProperty("jsonName")) + if (!$util.isString(message.jsonName)) + return "jsonName: string expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.FieldOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.proto3Optional != null && message.hasOwnProperty("proto3Optional")) + if (typeof message.proto3Optional !== "boolean") + return "proto3Optional: boolean expected"; + return null; + }; + + /** + * Creates a FieldDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FieldDescriptorProto} FieldDescriptorProto + */ + FieldDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FieldDescriptorProto) + return object; + var message = new $root.google.protobuf.FieldDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.number != null) + message.number = object.number | 0; + switch (object.label) { + default: + if (typeof object.label === "number") { + message.label = object.label; + break; + } + break; + case "LABEL_OPTIONAL": + case 1: + message.label = 1; + break; + case "LABEL_REQUIRED": + case 2: + message.label = 2; + break; + case "LABEL_REPEATED": + case 3: + message.label = 3; + break; + } + switch (object.type) { + default: + if (typeof object.type === "number") { + message.type = object.type; + break; + } + break; + case "TYPE_DOUBLE": + case 1: + message.type = 1; + break; + case "TYPE_FLOAT": + case 2: + message.type = 2; + break; + case "TYPE_INT64": + case 3: + message.type = 3; + break; + case "TYPE_UINT64": + case 4: + message.type = 4; + break; + case "TYPE_INT32": + case 5: + message.type = 5; + break; + case "TYPE_FIXED64": + case 6: + message.type = 6; + break; + case "TYPE_FIXED32": + case 7: + message.type = 7; + break; + case "TYPE_BOOL": + case 8: + message.type = 8; + break; + case "TYPE_STRING": + case 9: + message.type = 9; + break; + case "TYPE_GROUP": + case 10: + message.type = 10; + break; + case "TYPE_MESSAGE": + case 11: + message.type = 11; + break; + case "TYPE_BYTES": + case 12: + message.type = 12; + break; + case "TYPE_UINT32": + case 13: + message.type = 13; + break; + case "TYPE_ENUM": + case 14: + message.type = 14; + break; + case "TYPE_SFIXED32": + case 15: + message.type = 15; + break; + case "TYPE_SFIXED64": + case 16: + message.type = 16; + break; + case "TYPE_SINT32": + case 17: + message.type = 17; + break; + case "TYPE_SINT64": + case 18: + message.type = 18; + break; + } + if (object.typeName != null) + message.typeName = String(object.typeName); + if (object.extendee != null) + message.extendee = String(object.extendee); + if (object.defaultValue != null) + message.defaultValue = String(object.defaultValue); + if (object.oneofIndex != null) + message.oneofIndex = object.oneofIndex | 0; + if (object.jsonName != null) + message.jsonName = String(object.jsonName); + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.FieldDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.FieldOptions.fromObject(object.options); + } + if (object.proto3Optional != null) + message.proto3Optional = Boolean(object.proto3Optional); + return message; + }; + + /** + * Creates a plain object from a FieldDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {google.protobuf.FieldDescriptorProto} message FieldDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FieldDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.extendee = ""; + object.number = 0; + object.label = options.enums === String ? "LABEL_OPTIONAL" : 1; + object.type = options.enums === String ? "TYPE_DOUBLE" : 1; + object.typeName = ""; + object.defaultValue = ""; + object.options = null; + object.oneofIndex = 0; + object.jsonName = ""; + object.proto3Optional = false; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.extendee != null && message.hasOwnProperty("extendee")) + object.extendee = message.extendee; + if (message.number != null && message.hasOwnProperty("number")) + object.number = message.number; + if (message.label != null && message.hasOwnProperty("label")) + object.label = options.enums === String ? $root.google.protobuf.FieldDescriptorProto.Label[message.label] === undefined ? message.label : $root.google.protobuf.FieldDescriptorProto.Label[message.label] : message.label; + if (message.type != null && message.hasOwnProperty("type")) + object.type = options.enums === String ? $root.google.protobuf.FieldDescriptorProto.Type[message.type] === undefined ? message.type : $root.google.protobuf.FieldDescriptorProto.Type[message.type] : message.type; + if (message.typeName != null && message.hasOwnProperty("typeName")) + object.typeName = message.typeName; + if (message.defaultValue != null && message.hasOwnProperty("defaultValue")) + object.defaultValue = message.defaultValue; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.FieldOptions.toObject(message.options, options); + if (message.oneofIndex != null && message.hasOwnProperty("oneofIndex")) + object.oneofIndex = message.oneofIndex; + if (message.jsonName != null && message.hasOwnProperty("jsonName")) + object.jsonName = message.jsonName; + if (message.proto3Optional != null && message.hasOwnProperty("proto3Optional")) + object.proto3Optional = message.proto3Optional; + return object; + }; + + /** + * Converts this FieldDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.FieldDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + FieldDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for FieldDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.FieldDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FieldDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FieldDescriptorProto"; + }; + + /** + * Type enum. + * @name google.protobuf.FieldDescriptorProto.Type + * @enum {number} + * @property {number} TYPE_DOUBLE=1 TYPE_DOUBLE value + * @property {number} TYPE_FLOAT=2 TYPE_FLOAT value + * @property {number} TYPE_INT64=3 TYPE_INT64 value + * @property {number} TYPE_UINT64=4 TYPE_UINT64 value + * @property {number} TYPE_INT32=5 TYPE_INT32 value + * @property {number} TYPE_FIXED64=6 TYPE_FIXED64 value + * @property {number} TYPE_FIXED32=7 TYPE_FIXED32 value + * @property {number} TYPE_BOOL=8 TYPE_BOOL value + * @property {number} TYPE_STRING=9 TYPE_STRING value + * @property {number} TYPE_GROUP=10 TYPE_GROUP value + * @property {number} TYPE_MESSAGE=11 TYPE_MESSAGE value + * @property {number} TYPE_BYTES=12 TYPE_BYTES value + * @property {number} TYPE_UINT32=13 TYPE_UINT32 value + * @property {number} TYPE_ENUM=14 TYPE_ENUM value + * @property {number} TYPE_SFIXED32=15 TYPE_SFIXED32 value + * @property {number} TYPE_SFIXED64=16 TYPE_SFIXED64 value + * @property {number} TYPE_SINT32=17 TYPE_SINT32 value + * @property {number} TYPE_SINT64=18 TYPE_SINT64 value + */ + FieldDescriptorProto.Type = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[1] = "TYPE_DOUBLE"] = 1; + values[valuesById[2] = "TYPE_FLOAT"] = 2; + values[valuesById[3] = "TYPE_INT64"] = 3; + values[valuesById[4] = "TYPE_UINT64"] = 4; + values[valuesById[5] = "TYPE_INT32"] = 5; + values[valuesById[6] = "TYPE_FIXED64"] = 6; + values[valuesById[7] = "TYPE_FIXED32"] = 7; + values[valuesById[8] = "TYPE_BOOL"] = 8; + values[valuesById[9] = "TYPE_STRING"] = 9; + values[valuesById[10] = "TYPE_GROUP"] = 10; + values[valuesById[11] = "TYPE_MESSAGE"] = 11; + values[valuesById[12] = "TYPE_BYTES"] = 12; + values[valuesById[13] = "TYPE_UINT32"] = 13; + values[valuesById[14] = "TYPE_ENUM"] = 14; + values[valuesById[15] = "TYPE_SFIXED32"] = 15; + values[valuesById[16] = "TYPE_SFIXED64"] = 16; + values[valuesById[17] = "TYPE_SINT32"] = 17; + values[valuesById[18] = "TYPE_SINT64"] = 18; + return values; + })(); + + /** + * Label enum. + * @name google.protobuf.FieldDescriptorProto.Label + * @enum {number} + * @property {number} LABEL_OPTIONAL=1 LABEL_OPTIONAL value + * @property {number} LABEL_REQUIRED=2 LABEL_REQUIRED value + * @property {number} LABEL_REPEATED=3 LABEL_REPEATED value + */ + FieldDescriptorProto.Label = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[1] = "LABEL_OPTIONAL"] = 1; + values[valuesById[2] = "LABEL_REQUIRED"] = 2; + values[valuesById[3] = "LABEL_REPEATED"] = 3; + return values; + })(); + + return FieldDescriptorProto; + })(); + + protobuf.OneofDescriptorProto = (function() { + + /** + * Properties of an OneofDescriptorProto. + * @memberof google.protobuf + * @interface IOneofDescriptorProto + * @property {string|null} [name] OneofDescriptorProto name + * @property {google.protobuf.IOneofOptions|null} [options] OneofDescriptorProto options + */ + + /** + * Constructs a new OneofDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents an OneofDescriptorProto. + * @implements IOneofDescriptorProto + * @constructor + * @param {google.protobuf.IOneofDescriptorProto=} [properties] Properties to set + */ + function OneofDescriptorProto(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * OneofDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.OneofDescriptorProto + * @instance + */ + OneofDescriptorProto.prototype.name = ""; + + /** + * OneofDescriptorProto options. + * @member {google.protobuf.IOneofOptions|null|undefined} options + * @memberof google.protobuf.OneofDescriptorProto + * @instance + */ + OneofDescriptorProto.prototype.options = null; + + /** + * Creates a new OneofDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {google.protobuf.IOneofDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.OneofDescriptorProto} OneofDescriptorProto instance + */ + OneofDescriptorProto.create = function create(properties) { + return new OneofDescriptorProto(properties); + }; + + /** + * Encodes the specified OneofDescriptorProto message. Does not implicitly {@link google.protobuf.OneofDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {google.protobuf.IOneofDescriptorProto} message OneofDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + OneofDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.OneofOptions.encode(message.options, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified OneofDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.OneofDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {google.protobuf.IOneofDescriptorProto} message OneofDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + OneofDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an OneofDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.OneofDescriptorProto} OneofDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + OneofDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.OneofDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message.options = $root.google.protobuf.OneofOptions.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an OneofDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.OneofDescriptorProto} OneofDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + OneofDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an OneofDescriptorProto message. + * @function verify + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + OneofDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.OneofOptions.verify(message.options); + if (error) + return "options." + error; + } + return null; + }; + + /** + * Creates an OneofDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.OneofDescriptorProto} OneofDescriptorProto + */ + OneofDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.OneofDescriptorProto) + return object; + var message = new $root.google.protobuf.OneofDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.OneofDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.OneofOptions.fromObject(object.options); + } + return message; + }; + + /** + * Creates a plain object from an OneofDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {google.protobuf.OneofDescriptorProto} message OneofDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + OneofDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.OneofOptions.toObject(message.options, options); + return object; + }; + + /** + * Converts this OneofDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.OneofDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + OneofDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for OneofDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.OneofDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + OneofDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.OneofDescriptorProto"; + }; + + return OneofDescriptorProto; + })(); + + protobuf.EnumDescriptorProto = (function() { + + /** + * Properties of an EnumDescriptorProto. + * @memberof google.protobuf + * @interface IEnumDescriptorProto + * @property {string|null} [name] EnumDescriptorProto name + * @property {Array.|null} [value] EnumDescriptorProto value + * @property {google.protobuf.IEnumOptions|null} [options] EnumDescriptorProto options + * @property {Array.|null} [reservedRange] EnumDescriptorProto reservedRange + * @property {Array.|null} [reservedName] EnumDescriptorProto reservedName + */ + + /** + * Constructs a new EnumDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents an EnumDescriptorProto. + * @implements IEnumDescriptorProto + * @constructor + * @param {google.protobuf.IEnumDescriptorProto=} [properties] Properties to set + */ + function EnumDescriptorProto(properties) { + this.value = []; + this.reservedRange = []; + this.reservedName = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.name = ""; + + /** + * EnumDescriptorProto value. + * @member {Array.} value + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.value = $util.emptyArray; + + /** + * EnumDescriptorProto options. + * @member {google.protobuf.IEnumOptions|null|undefined} options + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.options = null; + + /** + * EnumDescriptorProto reservedRange. + * @member {Array.} reservedRange + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.reservedRange = $util.emptyArray; + + /** + * EnumDescriptorProto reservedName. + * @member {Array.} reservedName + * @memberof google.protobuf.EnumDescriptorProto + * @instance + */ + EnumDescriptorProto.prototype.reservedName = $util.emptyArray; + + /** + * Creates a new EnumDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {google.protobuf.IEnumDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.EnumDescriptorProto} EnumDescriptorProto instance + */ + EnumDescriptorProto.create = function create(properties) { + return new EnumDescriptorProto(properties); + }; + + /** + * Encodes the specified EnumDescriptorProto message. Does not implicitly {@link google.protobuf.EnumDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {google.protobuf.IEnumDescriptorProto} message EnumDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.value != null && message.value.length) + for (var i = 0; i < message.value.length; ++i) + $root.google.protobuf.EnumValueDescriptorProto.encode(message.value[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.EnumOptions.encode(message.options, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + if (message.reservedRange != null && message.reservedRange.length) + for (var i = 0; i < message.reservedRange.length; ++i) + $root.google.protobuf.EnumDescriptorProto.EnumReservedRange.encode(message.reservedRange[i], writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.reservedName != null && message.reservedName.length) + for (var i = 0; i < message.reservedName.length; ++i) + writer.uint32(/* id 5, wireType 2 =*/42).string(message.reservedName[i]); + return writer; + }; + + /** + * Encodes the specified EnumDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.EnumDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {google.protobuf.IEnumDescriptorProto} message EnumDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumDescriptorProto} EnumDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 2: { + if (!(message.value && message.value.length)) + message.value = []; + message.value.push($root.google.protobuf.EnumValueDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 3: { + message.options = $root.google.protobuf.EnumOptions.decode(reader, reader.uint32()); + break; + } + case 4: { + if (!(message.reservedRange && message.reservedRange.length)) + message.reservedRange = []; + message.reservedRange.push($root.google.protobuf.EnumDescriptorProto.EnumReservedRange.decode(reader, reader.uint32())); + break; + } + case 5: { + if (!(message.reservedName && message.reservedName.length)) + message.reservedName = []; + message.reservedName.push(reader.string()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumDescriptorProto} EnumDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumDescriptorProto message. + * @function verify + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.value != null && message.hasOwnProperty("value")) { + if (!Array.isArray(message.value)) + return "value: array expected"; + for (var i = 0; i < message.value.length; ++i) { + var error = $root.google.protobuf.EnumValueDescriptorProto.verify(message.value[i]); + if (error) + return "value." + error; + } + } + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.EnumOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.reservedRange != null && message.hasOwnProperty("reservedRange")) { + if (!Array.isArray(message.reservedRange)) + return "reservedRange: array expected"; + for (var i = 0; i < message.reservedRange.length; ++i) { + var error = $root.google.protobuf.EnumDescriptorProto.EnumReservedRange.verify(message.reservedRange[i]); + if (error) + return "reservedRange." + error; + } + } + if (message.reservedName != null && message.hasOwnProperty("reservedName")) { + if (!Array.isArray(message.reservedName)) + return "reservedName: array expected"; + for (var i = 0; i < message.reservedName.length; ++i) + if (!$util.isString(message.reservedName[i])) + return "reservedName: string[] expected"; + } + return null; + }; + + /** + * Creates an EnumDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumDescriptorProto} EnumDescriptorProto + */ + EnumDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumDescriptorProto) + return object; + var message = new $root.google.protobuf.EnumDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.value) { + if (!Array.isArray(object.value)) + throw TypeError(".google.protobuf.EnumDescriptorProto.value: array expected"); + message.value = []; + for (var i = 0; i < object.value.length; ++i) { + if (typeof object.value[i] !== "object") + throw TypeError(".google.protobuf.EnumDescriptorProto.value: object expected"); + message.value[i] = $root.google.protobuf.EnumValueDescriptorProto.fromObject(object.value[i]); + } + } + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.EnumDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.EnumOptions.fromObject(object.options); + } + if (object.reservedRange) { + if (!Array.isArray(object.reservedRange)) + throw TypeError(".google.protobuf.EnumDescriptorProto.reservedRange: array expected"); + message.reservedRange = []; + for (var i = 0; i < object.reservedRange.length; ++i) { + if (typeof object.reservedRange[i] !== "object") + throw TypeError(".google.protobuf.EnumDescriptorProto.reservedRange: object expected"); + message.reservedRange[i] = $root.google.protobuf.EnumDescriptorProto.EnumReservedRange.fromObject(object.reservedRange[i]); + } + } + if (object.reservedName) { + if (!Array.isArray(object.reservedName)) + throw TypeError(".google.protobuf.EnumDescriptorProto.reservedName: array expected"); + message.reservedName = []; + for (var i = 0; i < object.reservedName.length; ++i) + message.reservedName[i] = String(object.reservedName[i]); + } + return message; + }; + + /** + * Creates a plain object from an EnumDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {google.protobuf.EnumDescriptorProto} message EnumDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.value = []; + object.reservedRange = []; + object.reservedName = []; + } + if (options.defaults) { + object.name = ""; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.value && message.value.length) { + object.value = []; + for (var j = 0; j < message.value.length; ++j) + object.value[j] = $root.google.protobuf.EnumValueDescriptorProto.toObject(message.value[j], options); + } + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.EnumOptions.toObject(message.options, options); + if (message.reservedRange && message.reservedRange.length) { + object.reservedRange = []; + for (var j = 0; j < message.reservedRange.length; ++j) + object.reservedRange[j] = $root.google.protobuf.EnumDescriptorProto.EnumReservedRange.toObject(message.reservedRange[j], options); + } + if (message.reservedName && message.reservedName.length) { + object.reservedName = []; + for (var j = 0; j < message.reservedName.length; ++j) + object.reservedName[j] = message.reservedName[j]; + } + return object; + }; + + /** + * Converts this EnumDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.EnumDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + EnumDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for EnumDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.EnumDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumDescriptorProto"; + }; + + EnumDescriptorProto.EnumReservedRange = (function() { + + /** + * Properties of an EnumReservedRange. + * @memberof google.protobuf.EnumDescriptorProto + * @interface IEnumReservedRange + * @property {number|null} [start] EnumReservedRange start + * @property {number|null} [end] EnumReservedRange end + */ + + /** + * Constructs a new EnumReservedRange. + * @memberof google.protobuf.EnumDescriptorProto + * @classdesc Represents an EnumReservedRange. + * @implements IEnumReservedRange + * @constructor + * @param {google.protobuf.EnumDescriptorProto.IEnumReservedRange=} [properties] Properties to set + */ + function EnumReservedRange(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumReservedRange start. + * @member {number} start + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @instance + */ + EnumReservedRange.prototype.start = 0; + + /** + * EnumReservedRange end. + * @member {number} end + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @instance + */ + EnumReservedRange.prototype.end = 0; + + /** + * Creates a new EnumReservedRange instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {google.protobuf.EnumDescriptorProto.IEnumReservedRange=} [properties] Properties to set + * @returns {google.protobuf.EnumDescriptorProto.EnumReservedRange} EnumReservedRange instance + */ + EnumReservedRange.create = function create(properties) { + return new EnumReservedRange(properties); + }; + + /** + * Encodes the specified EnumReservedRange message. Does not implicitly {@link google.protobuf.EnumDescriptorProto.EnumReservedRange.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {google.protobuf.EnumDescriptorProto.IEnumReservedRange} message EnumReservedRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumReservedRange.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.start != null && Object.hasOwnProperty.call(message, "start")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.start); + if (message.end != null && Object.hasOwnProperty.call(message, "end")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.end); + return writer; + }; + + /** + * Encodes the specified EnumReservedRange message, length delimited. Does not implicitly {@link google.protobuf.EnumDescriptorProto.EnumReservedRange.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {google.protobuf.EnumDescriptorProto.IEnumReservedRange} message EnumReservedRange message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumReservedRange.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumReservedRange message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumDescriptorProto.EnumReservedRange} EnumReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumReservedRange.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumDescriptorProto.EnumReservedRange(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.start = reader.int32(); + break; + } + case 2: { + message.end = reader.int32(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumReservedRange message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumDescriptorProto.EnumReservedRange} EnumReservedRange + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumReservedRange.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumReservedRange message. + * @function verify + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumReservedRange.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.start != null && message.hasOwnProperty("start")) + if (!$util.isInteger(message.start)) + return "start: integer expected"; + if (message.end != null && message.hasOwnProperty("end")) + if (!$util.isInteger(message.end)) + return "end: integer expected"; + return null; + }; + + /** + * Creates an EnumReservedRange message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumDescriptorProto.EnumReservedRange} EnumReservedRange + */ + EnumReservedRange.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumDescriptorProto.EnumReservedRange) + return object; + var message = new $root.google.protobuf.EnumDescriptorProto.EnumReservedRange(); + if (object.start != null) + message.start = object.start | 0; + if (object.end != null) + message.end = object.end | 0; + return message; + }; + + /** + * Creates a plain object from an EnumReservedRange message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {google.protobuf.EnumDescriptorProto.EnumReservedRange} message EnumReservedRange + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumReservedRange.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.start = 0; + object.end = 0; + } + if (message.start != null && message.hasOwnProperty("start")) + object.start = message.start; + if (message.end != null && message.hasOwnProperty("end")) + object.end = message.end; + return object; + }; + + /** + * Converts this EnumReservedRange to JSON. + * @function toJSON + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @instance + * @returns {Object.} JSON object + */ + EnumReservedRange.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for EnumReservedRange + * @function getTypeUrl + * @memberof google.protobuf.EnumDescriptorProto.EnumReservedRange + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumReservedRange.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumDescriptorProto.EnumReservedRange"; + }; + + return EnumReservedRange; + })(); + + return EnumDescriptorProto; + })(); + + protobuf.EnumValueDescriptorProto = (function() { + + /** + * Properties of an EnumValueDescriptorProto. + * @memberof google.protobuf + * @interface IEnumValueDescriptorProto + * @property {string|null} [name] EnumValueDescriptorProto name + * @property {number|null} [number] EnumValueDescriptorProto number + * @property {google.protobuf.IEnumValueOptions|null} [options] EnumValueDescriptorProto options + */ + + /** + * Constructs a new EnumValueDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents an EnumValueDescriptorProto. + * @implements IEnumValueDescriptorProto + * @constructor + * @param {google.protobuf.IEnumValueDescriptorProto=} [properties] Properties to set + */ + function EnumValueDescriptorProto(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumValueDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.EnumValueDescriptorProto + * @instance + */ + EnumValueDescriptorProto.prototype.name = ""; + + /** + * EnumValueDescriptorProto number. + * @member {number} number + * @memberof google.protobuf.EnumValueDescriptorProto + * @instance + */ + EnumValueDescriptorProto.prototype.number = 0; + + /** + * EnumValueDescriptorProto options. + * @member {google.protobuf.IEnumValueOptions|null|undefined} options + * @memberof google.protobuf.EnumValueDescriptorProto + * @instance + */ + EnumValueDescriptorProto.prototype.options = null; + + /** + * Creates a new EnumValueDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {google.protobuf.IEnumValueDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.EnumValueDescriptorProto} EnumValueDescriptorProto instance + */ + EnumValueDescriptorProto.create = function create(properties) { + return new EnumValueDescriptorProto(properties); + }; + + /** + * Encodes the specified EnumValueDescriptorProto message. Does not implicitly {@link google.protobuf.EnumValueDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {google.protobuf.IEnumValueDescriptorProto} message EnumValueDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumValueDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.number != null && Object.hasOwnProperty.call(message, "number")) + writer.uint32(/* id 2, wireType 0 =*/16).int32(message.number); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.EnumValueOptions.encode(message.options, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified EnumValueDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.EnumValueDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {google.protobuf.IEnumValueDescriptorProto} message EnumValueDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumValueDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumValueDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumValueDescriptorProto} EnumValueDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumValueDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumValueDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message.number = reader.int32(); + break; + } + case 3: { + message.options = $root.google.protobuf.EnumValueOptions.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumValueDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumValueDescriptorProto} EnumValueDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumValueDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumValueDescriptorProto message. + * @function verify + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumValueDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.number != null && message.hasOwnProperty("number")) + if (!$util.isInteger(message.number)) + return "number: integer expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.EnumValueOptions.verify(message.options); + if (error) + return "options." + error; + } + return null; + }; + + /** + * Creates an EnumValueDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumValueDescriptorProto} EnumValueDescriptorProto + */ + EnumValueDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumValueDescriptorProto) + return object; + var message = new $root.google.protobuf.EnumValueDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.number != null) + message.number = object.number | 0; + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.EnumValueDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.EnumValueOptions.fromObject(object.options); + } + return message; + }; + + /** + * Creates a plain object from an EnumValueDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {google.protobuf.EnumValueDescriptorProto} message EnumValueDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumValueDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.number = 0; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.number != null && message.hasOwnProperty("number")) + object.number = message.number; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.EnumValueOptions.toObject(message.options, options); + return object; + }; + + /** + * Converts this EnumValueDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.EnumValueDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + EnumValueDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for EnumValueDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.EnumValueDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumValueDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumValueDescriptorProto"; + }; + + return EnumValueDescriptorProto; + })(); + + protobuf.ServiceDescriptorProto = (function() { + + /** + * Properties of a ServiceDescriptorProto. + * @memberof google.protobuf + * @interface IServiceDescriptorProto + * @property {string|null} [name] ServiceDescriptorProto name + * @property {Array.|null} [method] ServiceDescriptorProto method + * @property {google.protobuf.IServiceOptions|null} [options] ServiceDescriptorProto options + */ + + /** + * Constructs a new ServiceDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a ServiceDescriptorProto. + * @implements IServiceDescriptorProto + * @constructor + * @param {google.protobuf.IServiceDescriptorProto=} [properties] Properties to set + */ + function ServiceDescriptorProto(properties) { + this.method = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ServiceDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.ServiceDescriptorProto + * @instance + */ + ServiceDescriptorProto.prototype.name = ""; + + /** + * ServiceDescriptorProto method. + * @member {Array.} method + * @memberof google.protobuf.ServiceDescriptorProto + * @instance + */ + ServiceDescriptorProto.prototype.method = $util.emptyArray; + + /** + * ServiceDescriptorProto options. + * @member {google.protobuf.IServiceOptions|null|undefined} options + * @memberof google.protobuf.ServiceDescriptorProto + * @instance + */ + ServiceDescriptorProto.prototype.options = null; + + /** + * Creates a new ServiceDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {google.protobuf.IServiceDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.ServiceDescriptorProto} ServiceDescriptorProto instance + */ + ServiceDescriptorProto.create = function create(properties) { + return new ServiceDescriptorProto(properties); + }; + + /** + * Encodes the specified ServiceDescriptorProto message. Does not implicitly {@link google.protobuf.ServiceDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {google.protobuf.IServiceDescriptorProto} message ServiceDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ServiceDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.method != null && message.method.length) + for (var i = 0; i < message.method.length; ++i) + $root.google.protobuf.MethodDescriptorProto.encode(message.method[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.ServiceOptions.encode(message.options, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified ServiceDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.ServiceDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {google.protobuf.IServiceDescriptorProto} message ServiceDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ServiceDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ServiceDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.ServiceDescriptorProto} ServiceDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ServiceDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.ServiceDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 2: { + if (!(message.method && message.method.length)) + message.method = []; + message.method.push($root.google.protobuf.MethodDescriptorProto.decode(reader, reader.uint32())); + break; + } + case 3: { + message.options = $root.google.protobuf.ServiceOptions.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ServiceDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.ServiceDescriptorProto} ServiceDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ServiceDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ServiceDescriptorProto message. + * @function verify + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ServiceDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.method != null && message.hasOwnProperty("method")) { + if (!Array.isArray(message.method)) + return "method: array expected"; + for (var i = 0; i < message.method.length; ++i) { + var error = $root.google.protobuf.MethodDescriptorProto.verify(message.method[i]); + if (error) + return "method." + error; + } + } + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.ServiceOptions.verify(message.options); + if (error) + return "options." + error; + } + return null; + }; + + /** + * Creates a ServiceDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.ServiceDescriptorProto} ServiceDescriptorProto + */ + ServiceDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.ServiceDescriptorProto) + return object; + var message = new $root.google.protobuf.ServiceDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.method) { + if (!Array.isArray(object.method)) + throw TypeError(".google.protobuf.ServiceDescriptorProto.method: array expected"); + message.method = []; + for (var i = 0; i < object.method.length; ++i) { + if (typeof object.method[i] !== "object") + throw TypeError(".google.protobuf.ServiceDescriptorProto.method: object expected"); + message.method[i] = $root.google.protobuf.MethodDescriptorProto.fromObject(object.method[i]); + } + } + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.ServiceDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.ServiceOptions.fromObject(object.options); + } + return message; + }; + + /** + * Creates a plain object from a ServiceDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {google.protobuf.ServiceDescriptorProto} message ServiceDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ServiceDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.method = []; + if (options.defaults) { + object.name = ""; + object.options = null; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.method && message.method.length) { + object.method = []; + for (var j = 0; j < message.method.length; ++j) + object.method[j] = $root.google.protobuf.MethodDescriptorProto.toObject(message.method[j], options); + } + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.ServiceOptions.toObject(message.options, options); + return object; + }; + + /** + * Converts this ServiceDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.ServiceDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + ServiceDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for ServiceDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.ServiceDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ServiceDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.ServiceDescriptorProto"; + }; + + return ServiceDescriptorProto; + })(); + + protobuf.MethodDescriptorProto = (function() { + + /** + * Properties of a MethodDescriptorProto. + * @memberof google.protobuf + * @interface IMethodDescriptorProto + * @property {string|null} [name] MethodDescriptorProto name + * @property {string|null} [inputType] MethodDescriptorProto inputType + * @property {string|null} [outputType] MethodDescriptorProto outputType + * @property {google.protobuf.IMethodOptions|null} [options] MethodDescriptorProto options + * @property {boolean|null} [clientStreaming] MethodDescriptorProto clientStreaming + * @property {boolean|null} [serverStreaming] MethodDescriptorProto serverStreaming + */ + + /** + * Constructs a new MethodDescriptorProto. + * @memberof google.protobuf + * @classdesc Represents a MethodDescriptorProto. + * @implements IMethodDescriptorProto + * @constructor + * @param {google.protobuf.IMethodDescriptorProto=} [properties] Properties to set + */ + function MethodDescriptorProto(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * MethodDescriptorProto name. + * @member {string} name + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.name = ""; + + /** + * MethodDescriptorProto inputType. + * @member {string} inputType + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.inputType = ""; + + /** + * MethodDescriptorProto outputType. + * @member {string} outputType + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.outputType = ""; + + /** + * MethodDescriptorProto options. + * @member {google.protobuf.IMethodOptions|null|undefined} options + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.options = null; + + /** + * MethodDescriptorProto clientStreaming. + * @member {boolean} clientStreaming + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.clientStreaming = false; + + /** + * MethodDescriptorProto serverStreaming. + * @member {boolean} serverStreaming + * @memberof google.protobuf.MethodDescriptorProto + * @instance + */ + MethodDescriptorProto.prototype.serverStreaming = false; + + /** + * Creates a new MethodDescriptorProto instance using the specified properties. + * @function create + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {google.protobuf.IMethodDescriptorProto=} [properties] Properties to set + * @returns {google.protobuf.MethodDescriptorProto} MethodDescriptorProto instance + */ + MethodDescriptorProto.create = function create(properties) { + return new MethodDescriptorProto(properties); + }; + + /** + * Encodes the specified MethodDescriptorProto message. Does not implicitly {@link google.protobuf.MethodDescriptorProto.verify|verify} messages. + * @function encode + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {google.protobuf.IMethodDescriptorProto} message MethodDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MethodDescriptorProto.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && Object.hasOwnProperty.call(message, "name")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.name); + if (message.inputType != null && Object.hasOwnProperty.call(message, "inputType")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.inputType); + if (message.outputType != null && Object.hasOwnProperty.call(message, "outputType")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.outputType); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.protobuf.MethodOptions.encode(message.options, writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.clientStreaming != null && Object.hasOwnProperty.call(message, "clientStreaming")) + writer.uint32(/* id 5, wireType 0 =*/40).bool(message.clientStreaming); + if (message.serverStreaming != null && Object.hasOwnProperty.call(message, "serverStreaming")) + writer.uint32(/* id 6, wireType 0 =*/48).bool(message.serverStreaming); + return writer; + }; + + /** + * Encodes the specified MethodDescriptorProto message, length delimited. Does not implicitly {@link google.protobuf.MethodDescriptorProto.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {google.protobuf.IMethodDescriptorProto} message MethodDescriptorProto message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MethodDescriptorProto.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a MethodDescriptorProto message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.MethodDescriptorProto} MethodDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MethodDescriptorProto.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.MethodDescriptorProto(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.name = reader.string(); + break; + } + case 2: { + message.inputType = reader.string(); + break; + } + case 3: { + message.outputType = reader.string(); + break; + } + case 4: { + message.options = $root.google.protobuf.MethodOptions.decode(reader, reader.uint32()); + break; + } + case 5: { + message.clientStreaming = reader.bool(); + break; + } + case 6: { + message.serverStreaming = reader.bool(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a MethodDescriptorProto message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.MethodDescriptorProto} MethodDescriptorProto + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MethodDescriptorProto.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a MethodDescriptorProto message. + * @function verify + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + MethodDescriptorProto.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) + if (!$util.isString(message.name)) + return "name: string expected"; + if (message.inputType != null && message.hasOwnProperty("inputType")) + if (!$util.isString(message.inputType)) + return "inputType: string expected"; + if (message.outputType != null && message.hasOwnProperty("outputType")) + if (!$util.isString(message.outputType)) + return "outputType: string expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.protobuf.MethodOptions.verify(message.options); + if (error) + return "options." + error; + } + if (message.clientStreaming != null && message.hasOwnProperty("clientStreaming")) + if (typeof message.clientStreaming !== "boolean") + return "clientStreaming: boolean expected"; + if (message.serverStreaming != null && message.hasOwnProperty("serverStreaming")) + if (typeof message.serverStreaming !== "boolean") + return "serverStreaming: boolean expected"; + return null; + }; + + /** + * Creates a MethodDescriptorProto message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.MethodDescriptorProto} MethodDescriptorProto + */ + MethodDescriptorProto.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.MethodDescriptorProto) + return object; + var message = new $root.google.protobuf.MethodDescriptorProto(); + if (object.name != null) + message.name = String(object.name); + if (object.inputType != null) + message.inputType = String(object.inputType); + if (object.outputType != null) + message.outputType = String(object.outputType); + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.protobuf.MethodDescriptorProto.options: object expected"); + message.options = $root.google.protobuf.MethodOptions.fromObject(object.options); + } + if (object.clientStreaming != null) + message.clientStreaming = Boolean(object.clientStreaming); + if (object.serverStreaming != null) + message.serverStreaming = Boolean(object.serverStreaming); + return message; + }; + + /** + * Creates a plain object from a MethodDescriptorProto message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {google.protobuf.MethodDescriptorProto} message MethodDescriptorProto + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + MethodDescriptorProto.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.name = ""; + object.inputType = ""; + object.outputType = ""; + object.options = null; + object.clientStreaming = false; + object.serverStreaming = false; + } + if (message.name != null && message.hasOwnProperty("name")) + object.name = message.name; + if (message.inputType != null && message.hasOwnProperty("inputType")) + object.inputType = message.inputType; + if (message.outputType != null && message.hasOwnProperty("outputType")) + object.outputType = message.outputType; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.protobuf.MethodOptions.toObject(message.options, options); + if (message.clientStreaming != null && message.hasOwnProperty("clientStreaming")) + object.clientStreaming = message.clientStreaming; + if (message.serverStreaming != null && message.hasOwnProperty("serverStreaming")) + object.serverStreaming = message.serverStreaming; + return object; + }; + + /** + * Converts this MethodDescriptorProto to JSON. + * @function toJSON + * @memberof google.protobuf.MethodDescriptorProto + * @instance + * @returns {Object.} JSON object + */ + MethodDescriptorProto.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for MethodDescriptorProto + * @function getTypeUrl + * @memberof google.protobuf.MethodDescriptorProto + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + MethodDescriptorProto.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.MethodDescriptorProto"; + }; + + return MethodDescriptorProto; + })(); + + protobuf.FileOptions = (function() { + + /** + * Properties of a FileOptions. + * @memberof google.protobuf + * @interface IFileOptions + * @property {string|null} [javaPackage] FileOptions javaPackage + * @property {string|null} [javaOuterClassname] FileOptions javaOuterClassname + * @property {boolean|null} [javaMultipleFiles] FileOptions javaMultipleFiles + * @property {boolean|null} [javaGenerateEqualsAndHash] FileOptions javaGenerateEqualsAndHash + * @property {boolean|null} [javaStringCheckUtf8] FileOptions javaStringCheckUtf8 + * @property {google.protobuf.FileOptions.OptimizeMode|null} [optimizeFor] FileOptions optimizeFor + * @property {string|null} [goPackage] FileOptions goPackage + * @property {boolean|null} [ccGenericServices] FileOptions ccGenericServices + * @property {boolean|null} [javaGenericServices] FileOptions javaGenericServices + * @property {boolean|null} [pyGenericServices] FileOptions pyGenericServices + * @property {boolean|null} [phpGenericServices] FileOptions phpGenericServices + * @property {boolean|null} [deprecated] FileOptions deprecated + * @property {boolean|null} [ccEnableArenas] FileOptions ccEnableArenas + * @property {string|null} [objcClassPrefix] FileOptions objcClassPrefix + * @property {string|null} [csharpNamespace] FileOptions csharpNamespace + * @property {string|null} [swiftPrefix] FileOptions swiftPrefix + * @property {string|null} [phpClassPrefix] FileOptions phpClassPrefix + * @property {string|null} [phpNamespace] FileOptions phpNamespace + * @property {string|null} [phpMetadataNamespace] FileOptions phpMetadataNamespace + * @property {string|null} [rubyPackage] FileOptions rubyPackage + * @property {Array.|null} [uninterpretedOption] FileOptions uninterpretedOption + * @property {Array.|null} [".google.api.resourceDefinition"] FileOptions .google.api.resourceDefinition + */ + + /** + * Constructs a new FileOptions. + * @memberof google.protobuf + * @classdesc Represents a FileOptions. + * @implements IFileOptions + * @constructor + * @param {google.protobuf.IFileOptions=} [properties] Properties to set + */ + function FileOptions(properties) { + this.uninterpretedOption = []; + this[".google.api.resourceDefinition"] = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FileOptions javaPackage. + * @member {string} javaPackage + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaPackage = ""; + + /** + * FileOptions javaOuterClassname. + * @member {string} javaOuterClassname + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaOuterClassname = ""; + + /** + * FileOptions javaMultipleFiles. + * @member {boolean} javaMultipleFiles + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaMultipleFiles = false; + + /** + * FileOptions javaGenerateEqualsAndHash. + * @member {boolean} javaGenerateEqualsAndHash + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaGenerateEqualsAndHash = false; + + /** + * FileOptions javaStringCheckUtf8. + * @member {boolean} javaStringCheckUtf8 + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaStringCheckUtf8 = false; + + /** + * FileOptions optimizeFor. + * @member {google.protobuf.FileOptions.OptimizeMode} optimizeFor + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.optimizeFor = 1; + + /** + * FileOptions goPackage. + * @member {string} goPackage + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.goPackage = ""; + + /** + * FileOptions ccGenericServices. + * @member {boolean} ccGenericServices + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.ccGenericServices = false; + + /** + * FileOptions javaGenericServices. + * @member {boolean} javaGenericServices + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.javaGenericServices = false; + + /** + * FileOptions pyGenericServices. + * @member {boolean} pyGenericServices + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.pyGenericServices = false; + + /** + * FileOptions phpGenericServices. + * @member {boolean} phpGenericServices + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.phpGenericServices = false; + + /** + * FileOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.deprecated = false; + + /** + * FileOptions ccEnableArenas. + * @member {boolean} ccEnableArenas + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.ccEnableArenas = true; + + /** + * FileOptions objcClassPrefix. + * @member {string} objcClassPrefix + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.objcClassPrefix = ""; + + /** + * FileOptions csharpNamespace. + * @member {string} csharpNamespace + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.csharpNamespace = ""; + + /** + * FileOptions swiftPrefix. + * @member {string} swiftPrefix + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.swiftPrefix = ""; + + /** + * FileOptions phpClassPrefix. + * @member {string} phpClassPrefix + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.phpClassPrefix = ""; + + /** + * FileOptions phpNamespace. + * @member {string} phpNamespace + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.phpNamespace = ""; + + /** + * FileOptions phpMetadataNamespace. + * @member {string} phpMetadataNamespace + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.phpMetadataNamespace = ""; + + /** + * FileOptions rubyPackage. + * @member {string} rubyPackage + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.rubyPackage = ""; + + /** + * FileOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * FileOptions .google.api.resourceDefinition. + * @member {Array.} .google.api.resourceDefinition + * @memberof google.protobuf.FileOptions + * @instance + */ + FileOptions.prototype[".google.api.resourceDefinition"] = $util.emptyArray; + + /** + * Creates a new FileOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.FileOptions + * @static + * @param {google.protobuf.IFileOptions=} [properties] Properties to set + * @returns {google.protobuf.FileOptions} FileOptions instance + */ + FileOptions.create = function create(properties) { + return new FileOptions(properties); + }; + + /** + * Encodes the specified FileOptions message. Does not implicitly {@link google.protobuf.FileOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FileOptions + * @static + * @param {google.protobuf.IFileOptions} message FileOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.javaPackage != null && Object.hasOwnProperty.call(message, "javaPackage")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.javaPackage); + if (message.javaOuterClassname != null && Object.hasOwnProperty.call(message, "javaOuterClassname")) + writer.uint32(/* id 8, wireType 2 =*/66).string(message.javaOuterClassname); + if (message.optimizeFor != null && Object.hasOwnProperty.call(message, "optimizeFor")) + writer.uint32(/* id 9, wireType 0 =*/72).int32(message.optimizeFor); + if (message.javaMultipleFiles != null && Object.hasOwnProperty.call(message, "javaMultipleFiles")) + writer.uint32(/* id 10, wireType 0 =*/80).bool(message.javaMultipleFiles); + if (message.goPackage != null && Object.hasOwnProperty.call(message, "goPackage")) + writer.uint32(/* id 11, wireType 2 =*/90).string(message.goPackage); + if (message.ccGenericServices != null && Object.hasOwnProperty.call(message, "ccGenericServices")) + writer.uint32(/* id 16, wireType 0 =*/128).bool(message.ccGenericServices); + if (message.javaGenericServices != null && Object.hasOwnProperty.call(message, "javaGenericServices")) + writer.uint32(/* id 17, wireType 0 =*/136).bool(message.javaGenericServices); + if (message.pyGenericServices != null && Object.hasOwnProperty.call(message, "pyGenericServices")) + writer.uint32(/* id 18, wireType 0 =*/144).bool(message.pyGenericServices); + if (message.javaGenerateEqualsAndHash != null && Object.hasOwnProperty.call(message, "javaGenerateEqualsAndHash")) + writer.uint32(/* id 20, wireType 0 =*/160).bool(message.javaGenerateEqualsAndHash); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 23, wireType 0 =*/184).bool(message.deprecated); + if (message.javaStringCheckUtf8 != null && Object.hasOwnProperty.call(message, "javaStringCheckUtf8")) + writer.uint32(/* id 27, wireType 0 =*/216).bool(message.javaStringCheckUtf8); + if (message.ccEnableArenas != null && Object.hasOwnProperty.call(message, "ccEnableArenas")) + writer.uint32(/* id 31, wireType 0 =*/248).bool(message.ccEnableArenas); + if (message.objcClassPrefix != null && Object.hasOwnProperty.call(message, "objcClassPrefix")) + writer.uint32(/* id 36, wireType 2 =*/290).string(message.objcClassPrefix); + if (message.csharpNamespace != null && Object.hasOwnProperty.call(message, "csharpNamespace")) + writer.uint32(/* id 37, wireType 2 =*/298).string(message.csharpNamespace); + if (message.swiftPrefix != null && Object.hasOwnProperty.call(message, "swiftPrefix")) + writer.uint32(/* id 39, wireType 2 =*/314).string(message.swiftPrefix); + if (message.phpClassPrefix != null && Object.hasOwnProperty.call(message, "phpClassPrefix")) + writer.uint32(/* id 40, wireType 2 =*/322).string(message.phpClassPrefix); + if (message.phpNamespace != null && Object.hasOwnProperty.call(message, "phpNamespace")) + writer.uint32(/* id 41, wireType 2 =*/330).string(message.phpNamespace); + if (message.phpGenericServices != null && Object.hasOwnProperty.call(message, "phpGenericServices")) + writer.uint32(/* id 42, wireType 0 =*/336).bool(message.phpGenericServices); + if (message.phpMetadataNamespace != null && Object.hasOwnProperty.call(message, "phpMetadataNamespace")) + writer.uint32(/* id 44, wireType 2 =*/354).string(message.phpMetadataNamespace); + if (message.rubyPackage != null && Object.hasOwnProperty.call(message, "rubyPackage")) + writer.uint32(/* id 45, wireType 2 =*/362).string(message.rubyPackage); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.resourceDefinition"] != null && message[".google.api.resourceDefinition"].length) + for (var i = 0; i < message[".google.api.resourceDefinition"].length; ++i) + $root.google.api.ResourceDescriptor.encode(message[".google.api.resourceDefinition"][i], writer.uint32(/* id 1053, wireType 2 =*/8426).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified FileOptions message, length delimited. Does not implicitly {@link google.protobuf.FileOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FileOptions + * @static + * @param {google.protobuf.IFileOptions} message FileOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FileOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FileOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FileOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FileOptions} FileOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FileOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.javaPackage = reader.string(); + break; + } + case 8: { + message.javaOuterClassname = reader.string(); + break; + } + case 10: { + message.javaMultipleFiles = reader.bool(); + break; + } + case 20: { + message.javaGenerateEqualsAndHash = reader.bool(); + break; + } + case 27: { + message.javaStringCheckUtf8 = reader.bool(); + break; + } + case 9: { + message.optimizeFor = reader.int32(); + break; + } + case 11: { + message.goPackage = reader.string(); + break; + } + case 16: { + message.ccGenericServices = reader.bool(); + break; + } + case 17: { + message.javaGenericServices = reader.bool(); + break; + } + case 18: { + message.pyGenericServices = reader.bool(); + break; + } + case 42: { + message.phpGenericServices = reader.bool(); + break; + } + case 23: { + message.deprecated = reader.bool(); + break; + } + case 31: { + message.ccEnableArenas = reader.bool(); + break; + } + case 36: { + message.objcClassPrefix = reader.string(); + break; + } + case 37: { + message.csharpNamespace = reader.string(); + break; + } + case 39: { + message.swiftPrefix = reader.string(); + break; + } + case 40: { + message.phpClassPrefix = reader.string(); + break; + } + case 41: { + message.phpNamespace = reader.string(); + break; + } + case 44: { + message.phpMetadataNamespace = reader.string(); + break; + } + case 45: { + message.rubyPackage = reader.string(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 1053: { + if (!(message[".google.api.resourceDefinition"] && message[".google.api.resourceDefinition"].length)) + message[".google.api.resourceDefinition"] = []; + message[".google.api.resourceDefinition"].push($root.google.api.ResourceDescriptor.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FileOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FileOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FileOptions} FileOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FileOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FileOptions message. + * @function verify + * @memberof google.protobuf.FileOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FileOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.javaPackage != null && message.hasOwnProperty("javaPackage")) + if (!$util.isString(message.javaPackage)) + return "javaPackage: string expected"; + if (message.javaOuterClassname != null && message.hasOwnProperty("javaOuterClassname")) + if (!$util.isString(message.javaOuterClassname)) + return "javaOuterClassname: string expected"; + if (message.javaMultipleFiles != null && message.hasOwnProperty("javaMultipleFiles")) + if (typeof message.javaMultipleFiles !== "boolean") + return "javaMultipleFiles: boolean expected"; + if (message.javaGenerateEqualsAndHash != null && message.hasOwnProperty("javaGenerateEqualsAndHash")) + if (typeof message.javaGenerateEqualsAndHash !== "boolean") + return "javaGenerateEqualsAndHash: boolean expected"; + if (message.javaStringCheckUtf8 != null && message.hasOwnProperty("javaStringCheckUtf8")) + if (typeof message.javaStringCheckUtf8 !== "boolean") + return "javaStringCheckUtf8: boolean expected"; + if (message.optimizeFor != null && message.hasOwnProperty("optimizeFor")) + switch (message.optimizeFor) { + default: + return "optimizeFor: enum value expected"; + case 1: + case 2: + case 3: + break; + } + if (message.goPackage != null && message.hasOwnProperty("goPackage")) + if (!$util.isString(message.goPackage)) + return "goPackage: string expected"; + if (message.ccGenericServices != null && message.hasOwnProperty("ccGenericServices")) + if (typeof message.ccGenericServices !== "boolean") + return "ccGenericServices: boolean expected"; + if (message.javaGenericServices != null && message.hasOwnProperty("javaGenericServices")) + if (typeof message.javaGenericServices !== "boolean") + return "javaGenericServices: boolean expected"; + if (message.pyGenericServices != null && message.hasOwnProperty("pyGenericServices")) + if (typeof message.pyGenericServices !== "boolean") + return "pyGenericServices: boolean expected"; + if (message.phpGenericServices != null && message.hasOwnProperty("phpGenericServices")) + if (typeof message.phpGenericServices !== "boolean") + return "phpGenericServices: boolean expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.ccEnableArenas != null && message.hasOwnProperty("ccEnableArenas")) + if (typeof message.ccEnableArenas !== "boolean") + return "ccEnableArenas: boolean expected"; + if (message.objcClassPrefix != null && message.hasOwnProperty("objcClassPrefix")) + if (!$util.isString(message.objcClassPrefix)) + return "objcClassPrefix: string expected"; + if (message.csharpNamespace != null && message.hasOwnProperty("csharpNamespace")) + if (!$util.isString(message.csharpNamespace)) + return "csharpNamespace: string expected"; + if (message.swiftPrefix != null && message.hasOwnProperty("swiftPrefix")) + if (!$util.isString(message.swiftPrefix)) + return "swiftPrefix: string expected"; + if (message.phpClassPrefix != null && message.hasOwnProperty("phpClassPrefix")) + if (!$util.isString(message.phpClassPrefix)) + return "phpClassPrefix: string expected"; + if (message.phpNamespace != null && message.hasOwnProperty("phpNamespace")) + if (!$util.isString(message.phpNamespace)) + return "phpNamespace: string expected"; + if (message.phpMetadataNamespace != null && message.hasOwnProperty("phpMetadataNamespace")) + if (!$util.isString(message.phpMetadataNamespace)) + return "phpMetadataNamespace: string expected"; + if (message.rubyPackage != null && message.hasOwnProperty("rubyPackage")) + if (!$util.isString(message.rubyPackage)) + return "rubyPackage: string expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.resourceDefinition"] != null && message.hasOwnProperty(".google.api.resourceDefinition")) { + if (!Array.isArray(message[".google.api.resourceDefinition"])) + return ".google.api.resourceDefinition: array expected"; + for (var i = 0; i < message[".google.api.resourceDefinition"].length; ++i) { + var error = $root.google.api.ResourceDescriptor.verify(message[".google.api.resourceDefinition"][i]); + if (error) + return ".google.api.resourceDefinition." + error; + } + } + return null; + }; + + /** + * Creates a FileOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FileOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FileOptions} FileOptions + */ + FileOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FileOptions) + return object; + var message = new $root.google.protobuf.FileOptions(); + if (object.javaPackage != null) + message.javaPackage = String(object.javaPackage); + if (object.javaOuterClassname != null) + message.javaOuterClassname = String(object.javaOuterClassname); + if (object.javaMultipleFiles != null) + message.javaMultipleFiles = Boolean(object.javaMultipleFiles); + if (object.javaGenerateEqualsAndHash != null) + message.javaGenerateEqualsAndHash = Boolean(object.javaGenerateEqualsAndHash); + if (object.javaStringCheckUtf8 != null) + message.javaStringCheckUtf8 = Boolean(object.javaStringCheckUtf8); + switch (object.optimizeFor) { + default: + if (typeof object.optimizeFor === "number") { + message.optimizeFor = object.optimizeFor; + break; + } + break; + case "SPEED": + case 1: + message.optimizeFor = 1; + break; + case "CODE_SIZE": + case 2: + message.optimizeFor = 2; + break; + case "LITE_RUNTIME": + case 3: + message.optimizeFor = 3; + break; + } + if (object.goPackage != null) + message.goPackage = String(object.goPackage); + if (object.ccGenericServices != null) + message.ccGenericServices = Boolean(object.ccGenericServices); + if (object.javaGenericServices != null) + message.javaGenericServices = Boolean(object.javaGenericServices); + if (object.pyGenericServices != null) + message.pyGenericServices = Boolean(object.pyGenericServices); + if (object.phpGenericServices != null) + message.phpGenericServices = Boolean(object.phpGenericServices); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.ccEnableArenas != null) + message.ccEnableArenas = Boolean(object.ccEnableArenas); + if (object.objcClassPrefix != null) + message.objcClassPrefix = String(object.objcClassPrefix); + if (object.csharpNamespace != null) + message.csharpNamespace = String(object.csharpNamespace); + if (object.swiftPrefix != null) + message.swiftPrefix = String(object.swiftPrefix); + if (object.phpClassPrefix != null) + message.phpClassPrefix = String(object.phpClassPrefix); + if (object.phpNamespace != null) + message.phpNamespace = String(object.phpNamespace); + if (object.phpMetadataNamespace != null) + message.phpMetadataNamespace = String(object.phpMetadataNamespace); + if (object.rubyPackage != null) + message.rubyPackage = String(object.rubyPackage); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.FileOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.FileOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.resourceDefinition"]) { + if (!Array.isArray(object[".google.api.resourceDefinition"])) + throw TypeError(".google.protobuf.FileOptions..google.api.resourceDefinition: array expected"); + message[".google.api.resourceDefinition"] = []; + for (var i = 0; i < object[".google.api.resourceDefinition"].length; ++i) { + if (typeof object[".google.api.resourceDefinition"][i] !== "object") + throw TypeError(".google.protobuf.FileOptions..google.api.resourceDefinition: object expected"); + message[".google.api.resourceDefinition"][i] = $root.google.api.ResourceDescriptor.fromObject(object[".google.api.resourceDefinition"][i]); + } + } + return message; + }; + + /** + * Creates a plain object from a FileOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FileOptions + * @static + * @param {google.protobuf.FileOptions} message FileOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FileOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.uninterpretedOption = []; + object[".google.api.resourceDefinition"] = []; + } + if (options.defaults) { + object.javaPackage = ""; + object.javaOuterClassname = ""; + object.optimizeFor = options.enums === String ? "SPEED" : 1; + object.javaMultipleFiles = false; + object.goPackage = ""; + object.ccGenericServices = false; + object.javaGenericServices = false; + object.pyGenericServices = false; + object.javaGenerateEqualsAndHash = false; + object.deprecated = false; + object.javaStringCheckUtf8 = false; + object.ccEnableArenas = true; + object.objcClassPrefix = ""; + object.csharpNamespace = ""; + object.swiftPrefix = ""; + object.phpClassPrefix = ""; + object.phpNamespace = ""; + object.phpGenericServices = false; + object.phpMetadataNamespace = ""; + object.rubyPackage = ""; + } + if (message.javaPackage != null && message.hasOwnProperty("javaPackage")) + object.javaPackage = message.javaPackage; + if (message.javaOuterClassname != null && message.hasOwnProperty("javaOuterClassname")) + object.javaOuterClassname = message.javaOuterClassname; + if (message.optimizeFor != null && message.hasOwnProperty("optimizeFor")) + object.optimizeFor = options.enums === String ? $root.google.protobuf.FileOptions.OptimizeMode[message.optimizeFor] === undefined ? message.optimizeFor : $root.google.protobuf.FileOptions.OptimizeMode[message.optimizeFor] : message.optimizeFor; + if (message.javaMultipleFiles != null && message.hasOwnProperty("javaMultipleFiles")) + object.javaMultipleFiles = message.javaMultipleFiles; + if (message.goPackage != null && message.hasOwnProperty("goPackage")) + object.goPackage = message.goPackage; + if (message.ccGenericServices != null && message.hasOwnProperty("ccGenericServices")) + object.ccGenericServices = message.ccGenericServices; + if (message.javaGenericServices != null && message.hasOwnProperty("javaGenericServices")) + object.javaGenericServices = message.javaGenericServices; + if (message.pyGenericServices != null && message.hasOwnProperty("pyGenericServices")) + object.pyGenericServices = message.pyGenericServices; + if (message.javaGenerateEqualsAndHash != null && message.hasOwnProperty("javaGenerateEqualsAndHash")) + object.javaGenerateEqualsAndHash = message.javaGenerateEqualsAndHash; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.javaStringCheckUtf8 != null && message.hasOwnProperty("javaStringCheckUtf8")) + object.javaStringCheckUtf8 = message.javaStringCheckUtf8; + if (message.ccEnableArenas != null && message.hasOwnProperty("ccEnableArenas")) + object.ccEnableArenas = message.ccEnableArenas; + if (message.objcClassPrefix != null && message.hasOwnProperty("objcClassPrefix")) + object.objcClassPrefix = message.objcClassPrefix; + if (message.csharpNamespace != null && message.hasOwnProperty("csharpNamespace")) + object.csharpNamespace = message.csharpNamespace; + if (message.swiftPrefix != null && message.hasOwnProperty("swiftPrefix")) + object.swiftPrefix = message.swiftPrefix; + if (message.phpClassPrefix != null && message.hasOwnProperty("phpClassPrefix")) + object.phpClassPrefix = message.phpClassPrefix; + if (message.phpNamespace != null && message.hasOwnProperty("phpNamespace")) + object.phpNamespace = message.phpNamespace; + if (message.phpGenericServices != null && message.hasOwnProperty("phpGenericServices")) + object.phpGenericServices = message.phpGenericServices; + if (message.phpMetadataNamespace != null && message.hasOwnProperty("phpMetadataNamespace")) + object.phpMetadataNamespace = message.phpMetadataNamespace; + if (message.rubyPackage != null && message.hasOwnProperty("rubyPackage")) + object.rubyPackage = message.rubyPackage; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.resourceDefinition"] && message[".google.api.resourceDefinition"].length) { + object[".google.api.resourceDefinition"] = []; + for (var j = 0; j < message[".google.api.resourceDefinition"].length; ++j) + object[".google.api.resourceDefinition"][j] = $root.google.api.ResourceDescriptor.toObject(message[".google.api.resourceDefinition"][j], options); + } + return object; + }; + + /** + * Converts this FileOptions to JSON. + * @function toJSON + * @memberof google.protobuf.FileOptions + * @instance + * @returns {Object.} JSON object + */ + FileOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for FileOptions + * @function getTypeUrl + * @memberof google.protobuf.FileOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FileOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FileOptions"; + }; + + /** + * OptimizeMode enum. + * @name google.protobuf.FileOptions.OptimizeMode + * @enum {number} + * @property {number} SPEED=1 SPEED value + * @property {number} CODE_SIZE=2 CODE_SIZE value + * @property {number} LITE_RUNTIME=3 LITE_RUNTIME value + */ + FileOptions.OptimizeMode = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[1] = "SPEED"] = 1; + values[valuesById[2] = "CODE_SIZE"] = 2; + values[valuesById[3] = "LITE_RUNTIME"] = 3; + return values; + })(); + + return FileOptions; + })(); + + protobuf.MessageOptions = (function() { + + /** + * Properties of a MessageOptions. + * @memberof google.protobuf + * @interface IMessageOptions + * @property {boolean|null} [messageSetWireFormat] MessageOptions messageSetWireFormat + * @property {boolean|null} [noStandardDescriptorAccessor] MessageOptions noStandardDescriptorAccessor + * @property {boolean|null} [deprecated] MessageOptions deprecated + * @property {boolean|null} [mapEntry] MessageOptions mapEntry + * @property {Array.|null} [uninterpretedOption] MessageOptions uninterpretedOption + * @property {google.api.IResourceDescriptor|null} [".google.api.resource"] MessageOptions .google.api.resource + */ + + /** + * Constructs a new MessageOptions. + * @memberof google.protobuf + * @classdesc Represents a MessageOptions. + * @implements IMessageOptions + * @constructor + * @param {google.protobuf.IMessageOptions=} [properties] Properties to set + */ + function MessageOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * MessageOptions messageSetWireFormat. + * @member {boolean} messageSetWireFormat + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.messageSetWireFormat = false; + + /** + * MessageOptions noStandardDescriptorAccessor. + * @member {boolean} noStandardDescriptorAccessor + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.noStandardDescriptorAccessor = false; + + /** + * MessageOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.deprecated = false; + + /** + * MessageOptions mapEntry. + * @member {boolean} mapEntry + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.mapEntry = false; + + /** + * MessageOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * MessageOptions .google.api.resource. + * @member {google.api.IResourceDescriptor|null|undefined} .google.api.resource + * @memberof google.protobuf.MessageOptions + * @instance + */ + MessageOptions.prototype[".google.api.resource"] = null; + + /** + * Creates a new MessageOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.MessageOptions + * @static + * @param {google.protobuf.IMessageOptions=} [properties] Properties to set + * @returns {google.protobuf.MessageOptions} MessageOptions instance + */ + MessageOptions.create = function create(properties) { + return new MessageOptions(properties); + }; + + /** + * Encodes the specified MessageOptions message. Does not implicitly {@link google.protobuf.MessageOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.MessageOptions + * @static + * @param {google.protobuf.IMessageOptions} message MessageOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MessageOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.messageSetWireFormat != null && Object.hasOwnProperty.call(message, "messageSetWireFormat")) + writer.uint32(/* id 1, wireType 0 =*/8).bool(message.messageSetWireFormat); + if (message.noStandardDescriptorAccessor != null && Object.hasOwnProperty.call(message, "noStandardDescriptorAccessor")) + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.noStandardDescriptorAccessor); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 3, wireType 0 =*/24).bool(message.deprecated); + if (message.mapEntry != null && Object.hasOwnProperty.call(message, "mapEntry")) + writer.uint32(/* id 7, wireType 0 =*/56).bool(message.mapEntry); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.resource"] != null && Object.hasOwnProperty.call(message, ".google.api.resource")) + $root.google.api.ResourceDescriptor.encode(message[".google.api.resource"], writer.uint32(/* id 1053, wireType 2 =*/8426).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified MessageOptions message, length delimited. Does not implicitly {@link google.protobuf.MessageOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.MessageOptions + * @static + * @param {google.protobuf.IMessageOptions} message MessageOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MessageOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a MessageOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.MessageOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.MessageOptions} MessageOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MessageOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.MessageOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.messageSetWireFormat = reader.bool(); + break; + } + case 2: { + message.noStandardDescriptorAccessor = reader.bool(); + break; + } + case 3: { + message.deprecated = reader.bool(); + break; + } + case 7: { + message.mapEntry = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 1053: { + message[".google.api.resource"] = $root.google.api.ResourceDescriptor.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a MessageOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.MessageOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.MessageOptions} MessageOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MessageOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a MessageOptions message. + * @function verify + * @memberof google.protobuf.MessageOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + MessageOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.messageSetWireFormat != null && message.hasOwnProperty("messageSetWireFormat")) + if (typeof message.messageSetWireFormat !== "boolean") + return "messageSetWireFormat: boolean expected"; + if (message.noStandardDescriptorAccessor != null && message.hasOwnProperty("noStandardDescriptorAccessor")) + if (typeof message.noStandardDescriptorAccessor !== "boolean") + return "noStandardDescriptorAccessor: boolean expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.mapEntry != null && message.hasOwnProperty("mapEntry")) + if (typeof message.mapEntry !== "boolean") + return "mapEntry: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.resource"] != null && message.hasOwnProperty(".google.api.resource")) { + var error = $root.google.api.ResourceDescriptor.verify(message[".google.api.resource"]); + if (error) + return ".google.api.resource." + error; + } + return null; + }; + + /** + * Creates a MessageOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.MessageOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.MessageOptions} MessageOptions + */ + MessageOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.MessageOptions) + return object; + var message = new $root.google.protobuf.MessageOptions(); + if (object.messageSetWireFormat != null) + message.messageSetWireFormat = Boolean(object.messageSetWireFormat); + if (object.noStandardDescriptorAccessor != null) + message.noStandardDescriptorAccessor = Boolean(object.noStandardDescriptorAccessor); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.mapEntry != null) + message.mapEntry = Boolean(object.mapEntry); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.MessageOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.MessageOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.resource"] != null) { + if (typeof object[".google.api.resource"] !== "object") + throw TypeError(".google.protobuf.MessageOptions..google.api.resource: object expected"); + message[".google.api.resource"] = $root.google.api.ResourceDescriptor.fromObject(object[".google.api.resource"]); + } + return message; + }; + + /** + * Creates a plain object from a MessageOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.MessageOptions + * @static + * @param {google.protobuf.MessageOptions} message MessageOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + MessageOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (options.defaults) { + object.messageSetWireFormat = false; + object.noStandardDescriptorAccessor = false; + object.deprecated = false; + object.mapEntry = false; + object[".google.api.resource"] = null; + } + if (message.messageSetWireFormat != null && message.hasOwnProperty("messageSetWireFormat")) + object.messageSetWireFormat = message.messageSetWireFormat; + if (message.noStandardDescriptorAccessor != null && message.hasOwnProperty("noStandardDescriptorAccessor")) + object.noStandardDescriptorAccessor = message.noStandardDescriptorAccessor; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.mapEntry != null && message.hasOwnProperty("mapEntry")) + object.mapEntry = message.mapEntry; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.resource"] != null && message.hasOwnProperty(".google.api.resource")) + object[".google.api.resource"] = $root.google.api.ResourceDescriptor.toObject(message[".google.api.resource"], options); + return object; + }; + + /** + * Converts this MessageOptions to JSON. + * @function toJSON + * @memberof google.protobuf.MessageOptions + * @instance + * @returns {Object.} JSON object + */ + MessageOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for MessageOptions + * @function getTypeUrl + * @memberof google.protobuf.MessageOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + MessageOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.MessageOptions"; + }; + + return MessageOptions; + })(); + + protobuf.FieldOptions = (function() { + + /** + * Properties of a FieldOptions. + * @memberof google.protobuf + * @interface IFieldOptions + * @property {google.protobuf.FieldOptions.CType|null} [ctype] FieldOptions ctype + * @property {boolean|null} [packed] FieldOptions packed + * @property {google.protobuf.FieldOptions.JSType|null} [jstype] FieldOptions jstype + * @property {boolean|null} [lazy] FieldOptions lazy + * @property {boolean|null} [unverifiedLazy] FieldOptions unverifiedLazy + * @property {boolean|null} [deprecated] FieldOptions deprecated + * @property {boolean|null} [weak] FieldOptions weak + * @property {Array.|null} [uninterpretedOption] FieldOptions uninterpretedOption + * @property {Array.|null} [".google.api.fieldBehavior"] FieldOptions .google.api.fieldBehavior + * @property {google.api.IResourceReference|null} [".google.api.resourceReference"] FieldOptions .google.api.resourceReference + */ + + /** + * Constructs a new FieldOptions. + * @memberof google.protobuf + * @classdesc Represents a FieldOptions. + * @implements IFieldOptions + * @constructor + * @param {google.protobuf.IFieldOptions=} [properties] Properties to set + */ + function FieldOptions(properties) { + this.uninterpretedOption = []; + this[".google.api.fieldBehavior"] = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FieldOptions ctype. + * @member {google.protobuf.FieldOptions.CType} ctype + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.ctype = 0; + + /** + * FieldOptions packed. + * @member {boolean} packed + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.packed = false; + + /** + * FieldOptions jstype. + * @member {google.protobuf.FieldOptions.JSType} jstype + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.jstype = 0; + + /** + * FieldOptions lazy. + * @member {boolean} lazy + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.lazy = false; + + /** + * FieldOptions unverifiedLazy. + * @member {boolean} unverifiedLazy + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.unverifiedLazy = false; + + /** + * FieldOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.deprecated = false; + + /** + * FieldOptions weak. + * @member {boolean} weak + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.weak = false; + + /** + * FieldOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * FieldOptions .google.api.fieldBehavior. + * @member {Array.} .google.api.fieldBehavior + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype[".google.api.fieldBehavior"] = $util.emptyArray; + + /** + * FieldOptions .google.api.resourceReference. + * @member {google.api.IResourceReference|null|undefined} .google.api.resourceReference + * @memberof google.protobuf.FieldOptions + * @instance + */ + FieldOptions.prototype[".google.api.resourceReference"] = null; + + /** + * Creates a new FieldOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.FieldOptions + * @static + * @param {google.protobuf.IFieldOptions=} [properties] Properties to set + * @returns {google.protobuf.FieldOptions} FieldOptions instance + */ + FieldOptions.create = function create(properties) { + return new FieldOptions(properties); + }; + + /** + * Encodes the specified FieldOptions message. Does not implicitly {@link google.protobuf.FieldOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FieldOptions + * @static + * @param {google.protobuf.IFieldOptions} message FieldOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.ctype != null && Object.hasOwnProperty.call(message, "ctype")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.ctype); + if (message.packed != null && Object.hasOwnProperty.call(message, "packed")) + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.packed); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 3, wireType 0 =*/24).bool(message.deprecated); + if (message.lazy != null && Object.hasOwnProperty.call(message, "lazy")) + writer.uint32(/* id 5, wireType 0 =*/40).bool(message.lazy); + if (message.jstype != null && Object.hasOwnProperty.call(message, "jstype")) + writer.uint32(/* id 6, wireType 0 =*/48).int32(message.jstype); + if (message.weak != null && Object.hasOwnProperty.call(message, "weak")) + writer.uint32(/* id 10, wireType 0 =*/80).bool(message.weak); + if (message.unverifiedLazy != null && Object.hasOwnProperty.call(message, "unverifiedLazy")) + writer.uint32(/* id 15, wireType 0 =*/120).bool(message.unverifiedLazy); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.fieldBehavior"] != null && message[".google.api.fieldBehavior"].length) { + writer.uint32(/* id 1052, wireType 2 =*/8418).fork(); + for (var i = 0; i < message[".google.api.fieldBehavior"].length; ++i) + writer.int32(message[".google.api.fieldBehavior"][i]); + writer.ldelim(); + } + if (message[".google.api.resourceReference"] != null && Object.hasOwnProperty.call(message, ".google.api.resourceReference")) + $root.google.api.ResourceReference.encode(message[".google.api.resourceReference"], writer.uint32(/* id 1055, wireType 2 =*/8442).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified FieldOptions message, length delimited. Does not implicitly {@link google.protobuf.FieldOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FieldOptions + * @static + * @param {google.protobuf.IFieldOptions} message FieldOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FieldOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FieldOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FieldOptions} FieldOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FieldOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.ctype = reader.int32(); + break; + } + case 2: { + message.packed = reader.bool(); + break; + } + case 6: { + message.jstype = reader.int32(); + break; + } + case 5: { + message.lazy = reader.bool(); + break; + } + case 15: { + message.unverifiedLazy = reader.bool(); + break; + } + case 3: { + message.deprecated = reader.bool(); + break; + } + case 10: { + message.weak = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 1052: { + if (!(message[".google.api.fieldBehavior"] && message[".google.api.fieldBehavior"].length)) + message[".google.api.fieldBehavior"] = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message[".google.api.fieldBehavior"].push(reader.int32()); + } else + message[".google.api.fieldBehavior"].push(reader.int32()); + break; + } + case 1055: { + message[".google.api.resourceReference"] = $root.google.api.ResourceReference.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FieldOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FieldOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FieldOptions} FieldOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FieldOptions message. + * @function verify + * @memberof google.protobuf.FieldOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FieldOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.ctype != null && message.hasOwnProperty("ctype")) + switch (message.ctype) { + default: + return "ctype: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.packed != null && message.hasOwnProperty("packed")) + if (typeof message.packed !== "boolean") + return "packed: boolean expected"; + if (message.jstype != null && message.hasOwnProperty("jstype")) + switch (message.jstype) { + default: + return "jstype: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.lazy != null && message.hasOwnProperty("lazy")) + if (typeof message.lazy !== "boolean") + return "lazy: boolean expected"; + if (message.unverifiedLazy != null && message.hasOwnProperty("unverifiedLazy")) + if (typeof message.unverifiedLazy !== "boolean") + return "unverifiedLazy: boolean expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.weak != null && message.hasOwnProperty("weak")) + if (typeof message.weak !== "boolean") + return "weak: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.fieldBehavior"] != null && message.hasOwnProperty(".google.api.fieldBehavior")) { + if (!Array.isArray(message[".google.api.fieldBehavior"])) + return ".google.api.fieldBehavior: array expected"; + for (var i = 0; i < message[".google.api.fieldBehavior"].length; ++i) + switch (message[".google.api.fieldBehavior"][i]) { + default: + return ".google.api.fieldBehavior: enum value[] expected"; + case 0: + case 1: + case 2: + case 3: + case 4: + case 5: + case 6: + case 7: + break; + } + } + if (message[".google.api.resourceReference"] != null && message.hasOwnProperty(".google.api.resourceReference")) { + var error = $root.google.api.ResourceReference.verify(message[".google.api.resourceReference"]); + if (error) + return ".google.api.resourceReference." + error; + } + return null; + }; + + /** + * Creates a FieldOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FieldOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FieldOptions} FieldOptions + */ + FieldOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FieldOptions) + return object; + var message = new $root.google.protobuf.FieldOptions(); + switch (object.ctype) { + default: + if (typeof object.ctype === "number") { + message.ctype = object.ctype; + break; + } + break; + case "STRING": + case 0: + message.ctype = 0; + break; + case "CORD": + case 1: + message.ctype = 1; + break; + case "STRING_PIECE": + case 2: + message.ctype = 2; + break; + } + if (object.packed != null) + message.packed = Boolean(object.packed); + switch (object.jstype) { + default: + if (typeof object.jstype === "number") { + message.jstype = object.jstype; + break; + } + break; + case "JS_NORMAL": + case 0: + message.jstype = 0; + break; + case "JS_STRING": + case 1: + message.jstype = 1; + break; + case "JS_NUMBER": + case 2: + message.jstype = 2; + break; + } + if (object.lazy != null) + message.lazy = Boolean(object.lazy); + if (object.unverifiedLazy != null) + message.unverifiedLazy = Boolean(object.unverifiedLazy); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.weak != null) + message.weak = Boolean(object.weak); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.FieldOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.FieldOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.fieldBehavior"]) { + if (!Array.isArray(object[".google.api.fieldBehavior"])) + throw TypeError(".google.protobuf.FieldOptions..google.api.fieldBehavior: array expected"); + message[".google.api.fieldBehavior"] = []; + for (var i = 0; i < object[".google.api.fieldBehavior"].length; ++i) + switch (object[".google.api.fieldBehavior"][i]) { + default: + if (typeof object[".google.api.fieldBehavior"][i] === "number") { + message[".google.api.fieldBehavior"][i] = object[".google.api.fieldBehavior"][i]; + break; + } + case "FIELD_BEHAVIOR_UNSPECIFIED": + case 0: + message[".google.api.fieldBehavior"][i] = 0; + break; + case "OPTIONAL": + case 1: + message[".google.api.fieldBehavior"][i] = 1; + break; + case "REQUIRED": + case 2: + message[".google.api.fieldBehavior"][i] = 2; + break; + case "OUTPUT_ONLY": + case 3: + message[".google.api.fieldBehavior"][i] = 3; + break; + case "INPUT_ONLY": + case 4: + message[".google.api.fieldBehavior"][i] = 4; + break; + case "IMMUTABLE": + case 5: + message[".google.api.fieldBehavior"][i] = 5; + break; + case "UNORDERED_LIST": + case 6: + message[".google.api.fieldBehavior"][i] = 6; + break; + case "NON_EMPTY_DEFAULT": + case 7: + message[".google.api.fieldBehavior"][i] = 7; + break; + } + } + if (object[".google.api.resourceReference"] != null) { + if (typeof object[".google.api.resourceReference"] !== "object") + throw TypeError(".google.protobuf.FieldOptions..google.api.resourceReference: object expected"); + message[".google.api.resourceReference"] = $root.google.api.ResourceReference.fromObject(object[".google.api.resourceReference"]); + } + return message; + }; + + /** + * Creates a plain object from a FieldOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FieldOptions + * @static + * @param {google.protobuf.FieldOptions} message FieldOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FieldOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.uninterpretedOption = []; + object[".google.api.fieldBehavior"] = []; + } + if (options.defaults) { + object.ctype = options.enums === String ? "STRING" : 0; + object.packed = false; + object.deprecated = false; + object.lazy = false; + object.jstype = options.enums === String ? "JS_NORMAL" : 0; + object.weak = false; + object.unverifiedLazy = false; + object[".google.api.resourceReference"] = null; + } + if (message.ctype != null && message.hasOwnProperty("ctype")) + object.ctype = options.enums === String ? $root.google.protobuf.FieldOptions.CType[message.ctype] === undefined ? message.ctype : $root.google.protobuf.FieldOptions.CType[message.ctype] : message.ctype; + if (message.packed != null && message.hasOwnProperty("packed")) + object.packed = message.packed; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.lazy != null && message.hasOwnProperty("lazy")) + object.lazy = message.lazy; + if (message.jstype != null && message.hasOwnProperty("jstype")) + object.jstype = options.enums === String ? $root.google.protobuf.FieldOptions.JSType[message.jstype] === undefined ? message.jstype : $root.google.protobuf.FieldOptions.JSType[message.jstype] : message.jstype; + if (message.weak != null && message.hasOwnProperty("weak")) + object.weak = message.weak; + if (message.unverifiedLazy != null && message.hasOwnProperty("unverifiedLazy")) + object.unverifiedLazy = message.unverifiedLazy; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.fieldBehavior"] && message[".google.api.fieldBehavior"].length) { + object[".google.api.fieldBehavior"] = []; + for (var j = 0; j < message[".google.api.fieldBehavior"].length; ++j) + object[".google.api.fieldBehavior"][j] = options.enums === String ? $root.google.api.FieldBehavior[message[".google.api.fieldBehavior"][j]] === undefined ? message[".google.api.fieldBehavior"][j] : $root.google.api.FieldBehavior[message[".google.api.fieldBehavior"][j]] : message[".google.api.fieldBehavior"][j]; + } + if (message[".google.api.resourceReference"] != null && message.hasOwnProperty(".google.api.resourceReference")) + object[".google.api.resourceReference"] = $root.google.api.ResourceReference.toObject(message[".google.api.resourceReference"], options); + return object; + }; + + /** + * Converts this FieldOptions to JSON. + * @function toJSON + * @memberof google.protobuf.FieldOptions + * @instance + * @returns {Object.} JSON object + */ + FieldOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for FieldOptions + * @function getTypeUrl + * @memberof google.protobuf.FieldOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FieldOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FieldOptions"; + }; + + /** + * CType enum. + * @name google.protobuf.FieldOptions.CType + * @enum {number} + * @property {number} STRING=0 STRING value + * @property {number} CORD=1 CORD value + * @property {number} STRING_PIECE=2 STRING_PIECE value + */ + FieldOptions.CType = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "STRING"] = 0; + values[valuesById[1] = "CORD"] = 1; + values[valuesById[2] = "STRING_PIECE"] = 2; + return values; + })(); + + /** + * JSType enum. + * @name google.protobuf.FieldOptions.JSType + * @enum {number} + * @property {number} JS_NORMAL=0 JS_NORMAL value + * @property {number} JS_STRING=1 JS_STRING value + * @property {number} JS_NUMBER=2 JS_NUMBER value + */ + FieldOptions.JSType = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "JS_NORMAL"] = 0; + values[valuesById[1] = "JS_STRING"] = 1; + values[valuesById[2] = "JS_NUMBER"] = 2; + return values; + })(); + + return FieldOptions; + })(); + + protobuf.OneofOptions = (function() { + + /** + * Properties of an OneofOptions. + * @memberof google.protobuf + * @interface IOneofOptions + * @property {Array.|null} [uninterpretedOption] OneofOptions uninterpretedOption + */ + + /** + * Constructs a new OneofOptions. + * @memberof google.protobuf + * @classdesc Represents an OneofOptions. + * @implements IOneofOptions + * @constructor + * @param {google.protobuf.IOneofOptions=} [properties] Properties to set + */ + function OneofOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * OneofOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.OneofOptions + * @instance + */ + OneofOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * Creates a new OneofOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.OneofOptions + * @static + * @param {google.protobuf.IOneofOptions=} [properties] Properties to set + * @returns {google.protobuf.OneofOptions} OneofOptions instance + */ + OneofOptions.create = function create(properties) { + return new OneofOptions(properties); + }; + + /** + * Encodes the specified OneofOptions message. Does not implicitly {@link google.protobuf.OneofOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.OneofOptions + * @static + * @param {google.protobuf.IOneofOptions} message OneofOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + OneofOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified OneofOptions message, length delimited. Does not implicitly {@link google.protobuf.OneofOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.OneofOptions + * @static + * @param {google.protobuf.IOneofOptions} message OneofOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + OneofOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an OneofOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.OneofOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.OneofOptions} OneofOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + OneofOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.OneofOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an OneofOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.OneofOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.OneofOptions} OneofOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + OneofOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an OneofOptions message. + * @function verify + * @memberof google.protobuf.OneofOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + OneofOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + return null; + }; + + /** + * Creates an OneofOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.OneofOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.OneofOptions} OneofOptions + */ + OneofOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.OneofOptions) + return object; + var message = new $root.google.protobuf.OneofOptions(); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.OneofOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.OneofOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + return message; + }; + + /** + * Creates a plain object from an OneofOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.OneofOptions + * @static + * @param {google.protobuf.OneofOptions} message OneofOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + OneofOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + return object; + }; + + /** + * Converts this OneofOptions to JSON. + * @function toJSON + * @memberof google.protobuf.OneofOptions + * @instance + * @returns {Object.} JSON object + */ + OneofOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for OneofOptions + * @function getTypeUrl + * @memberof google.protobuf.OneofOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + OneofOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.OneofOptions"; + }; + + return OneofOptions; + })(); + + protobuf.EnumOptions = (function() { + + /** + * Properties of an EnumOptions. + * @memberof google.protobuf + * @interface IEnumOptions + * @property {boolean|null} [allowAlias] EnumOptions allowAlias + * @property {boolean|null} [deprecated] EnumOptions deprecated + * @property {Array.|null} [uninterpretedOption] EnumOptions uninterpretedOption + */ + + /** + * Constructs a new EnumOptions. + * @memberof google.protobuf + * @classdesc Represents an EnumOptions. + * @implements IEnumOptions + * @constructor + * @param {google.protobuf.IEnumOptions=} [properties] Properties to set + */ + function EnumOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumOptions allowAlias. + * @member {boolean} allowAlias + * @memberof google.protobuf.EnumOptions + * @instance + */ + EnumOptions.prototype.allowAlias = false; + + /** + * EnumOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.EnumOptions + * @instance + */ + EnumOptions.prototype.deprecated = false; + + /** + * EnumOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.EnumOptions + * @instance + */ + EnumOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * Creates a new EnumOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumOptions + * @static + * @param {google.protobuf.IEnumOptions=} [properties] Properties to set + * @returns {google.protobuf.EnumOptions} EnumOptions instance + */ + EnumOptions.create = function create(properties) { + return new EnumOptions(properties); + }; + + /** + * Encodes the specified EnumOptions message. Does not implicitly {@link google.protobuf.EnumOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumOptions + * @static + * @param {google.protobuf.IEnumOptions} message EnumOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.allowAlias != null && Object.hasOwnProperty.call(message, "allowAlias")) + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.allowAlias); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 3, wireType 0 =*/24).bool(message.deprecated); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified EnumOptions message, length delimited. Does not implicitly {@link google.protobuf.EnumOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumOptions + * @static + * @param {google.protobuf.IEnumOptions} message EnumOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumOptions} EnumOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 2: { + message.allowAlias = reader.bool(); + break; + } + case 3: { + message.deprecated = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumOptions} EnumOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumOptions message. + * @function verify + * @memberof google.protobuf.EnumOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.allowAlias != null && message.hasOwnProperty("allowAlias")) + if (typeof message.allowAlias !== "boolean") + return "allowAlias: boolean expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + return null; + }; + + /** + * Creates an EnumOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumOptions} EnumOptions + */ + EnumOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumOptions) + return object; + var message = new $root.google.protobuf.EnumOptions(); + if (object.allowAlias != null) + message.allowAlias = Boolean(object.allowAlias); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.EnumOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.EnumOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + return message; + }; + + /** + * Creates a plain object from an EnumOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumOptions + * @static + * @param {google.protobuf.EnumOptions} message EnumOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (options.defaults) { + object.allowAlias = false; + object.deprecated = false; + } + if (message.allowAlias != null && message.hasOwnProperty("allowAlias")) + object.allowAlias = message.allowAlias; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + return object; + }; + + /** + * Converts this EnumOptions to JSON. + * @function toJSON + * @memberof google.protobuf.EnumOptions + * @instance + * @returns {Object.} JSON object + */ + EnumOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for EnumOptions + * @function getTypeUrl + * @memberof google.protobuf.EnumOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumOptions"; + }; + + return EnumOptions; + })(); + + protobuf.EnumValueOptions = (function() { + + /** + * Properties of an EnumValueOptions. + * @memberof google.protobuf + * @interface IEnumValueOptions + * @property {boolean|null} [deprecated] EnumValueOptions deprecated + * @property {Array.|null} [uninterpretedOption] EnumValueOptions uninterpretedOption + */ + + /** + * Constructs a new EnumValueOptions. + * @memberof google.protobuf + * @classdesc Represents an EnumValueOptions. + * @implements IEnumValueOptions + * @constructor + * @param {google.protobuf.IEnumValueOptions=} [properties] Properties to set + */ + function EnumValueOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * EnumValueOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.EnumValueOptions + * @instance + */ + EnumValueOptions.prototype.deprecated = false; + + /** + * EnumValueOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.EnumValueOptions + * @instance + */ + EnumValueOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * Creates a new EnumValueOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {google.protobuf.IEnumValueOptions=} [properties] Properties to set + * @returns {google.protobuf.EnumValueOptions} EnumValueOptions instance + */ + EnumValueOptions.create = function create(properties) { + return new EnumValueOptions(properties); + }; + + /** + * Encodes the specified EnumValueOptions message. Does not implicitly {@link google.protobuf.EnumValueOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {google.protobuf.IEnumValueOptions} message EnumValueOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumValueOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 1, wireType 0 =*/8).bool(message.deprecated); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified EnumValueOptions message, length delimited. Does not implicitly {@link google.protobuf.EnumValueOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {google.protobuf.IEnumValueOptions} message EnumValueOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + EnumValueOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an EnumValueOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.EnumValueOptions} EnumValueOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumValueOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.EnumValueOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.deprecated = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an EnumValueOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.EnumValueOptions} EnumValueOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + EnumValueOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an EnumValueOptions message. + * @function verify + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + EnumValueOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + return null; + }; + + /** + * Creates an EnumValueOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.EnumValueOptions} EnumValueOptions + */ + EnumValueOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.EnumValueOptions) + return object; + var message = new $root.google.protobuf.EnumValueOptions(); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.EnumValueOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.EnumValueOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + return message; + }; + + /** + * Creates a plain object from an EnumValueOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {google.protobuf.EnumValueOptions} message EnumValueOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + EnumValueOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (options.defaults) + object.deprecated = false; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + return object; + }; + + /** + * Converts this EnumValueOptions to JSON. + * @function toJSON + * @memberof google.protobuf.EnumValueOptions + * @instance + * @returns {Object.} JSON object + */ + EnumValueOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for EnumValueOptions + * @function getTypeUrl + * @memberof google.protobuf.EnumValueOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + EnumValueOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.EnumValueOptions"; + }; + + return EnumValueOptions; + })(); + + protobuf.ServiceOptions = (function() { + + /** + * Properties of a ServiceOptions. + * @memberof google.protobuf + * @interface IServiceOptions + * @property {boolean|null} [deprecated] ServiceOptions deprecated + * @property {Array.|null} [uninterpretedOption] ServiceOptions uninterpretedOption + * @property {string|null} [".google.api.defaultHost"] ServiceOptions .google.api.defaultHost + * @property {string|null} [".google.api.oauthScopes"] ServiceOptions .google.api.oauthScopes + */ + + /** + * Constructs a new ServiceOptions. + * @memberof google.protobuf + * @classdesc Represents a ServiceOptions. + * @implements IServiceOptions + * @constructor + * @param {google.protobuf.IServiceOptions=} [properties] Properties to set + */ + function ServiceOptions(properties) { + this.uninterpretedOption = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * ServiceOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.ServiceOptions + * @instance + */ + ServiceOptions.prototype.deprecated = false; + + /** + * ServiceOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.ServiceOptions + * @instance + */ + ServiceOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * ServiceOptions .google.api.defaultHost. + * @member {string} .google.api.defaultHost + * @memberof google.protobuf.ServiceOptions + * @instance + */ + ServiceOptions.prototype[".google.api.defaultHost"] = ""; + + /** + * ServiceOptions .google.api.oauthScopes. + * @member {string} .google.api.oauthScopes + * @memberof google.protobuf.ServiceOptions + * @instance + */ + ServiceOptions.prototype[".google.api.oauthScopes"] = ""; + + /** + * Creates a new ServiceOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.ServiceOptions + * @static + * @param {google.protobuf.IServiceOptions=} [properties] Properties to set + * @returns {google.protobuf.ServiceOptions} ServiceOptions instance + */ + ServiceOptions.create = function create(properties) { + return new ServiceOptions(properties); + }; + + /** + * Encodes the specified ServiceOptions message. Does not implicitly {@link google.protobuf.ServiceOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.ServiceOptions + * @static + * @param {google.protobuf.IServiceOptions} message ServiceOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ServiceOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 33, wireType 0 =*/264).bool(message.deprecated); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.defaultHost"] != null && Object.hasOwnProperty.call(message, ".google.api.defaultHost")) + writer.uint32(/* id 1049, wireType 2 =*/8394).string(message[".google.api.defaultHost"]); + if (message[".google.api.oauthScopes"] != null && Object.hasOwnProperty.call(message, ".google.api.oauthScopes")) + writer.uint32(/* id 1050, wireType 2 =*/8402).string(message[".google.api.oauthScopes"]); + return writer; + }; + + /** + * Encodes the specified ServiceOptions message, length delimited. Does not implicitly {@link google.protobuf.ServiceOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.ServiceOptions + * @static + * @param {google.protobuf.IServiceOptions} message ServiceOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + ServiceOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a ServiceOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.ServiceOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.ServiceOptions} ServiceOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ServiceOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.ServiceOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 33: { + message.deprecated = reader.bool(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 1049: { + message[".google.api.defaultHost"] = reader.string(); + break; + } + case 1050: { + message[".google.api.oauthScopes"] = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a ServiceOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.ServiceOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.ServiceOptions} ServiceOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + ServiceOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a ServiceOptions message. + * @function verify + * @memberof google.protobuf.ServiceOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + ServiceOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.defaultHost"] != null && message.hasOwnProperty(".google.api.defaultHost")) + if (!$util.isString(message[".google.api.defaultHost"])) + return ".google.api.defaultHost: string expected"; + if (message[".google.api.oauthScopes"] != null && message.hasOwnProperty(".google.api.oauthScopes")) + if (!$util.isString(message[".google.api.oauthScopes"])) + return ".google.api.oauthScopes: string expected"; + return null; + }; + + /** + * Creates a ServiceOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.ServiceOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.ServiceOptions} ServiceOptions + */ + ServiceOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.ServiceOptions) + return object; + var message = new $root.google.protobuf.ServiceOptions(); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.ServiceOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.ServiceOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.defaultHost"] != null) + message[".google.api.defaultHost"] = String(object[".google.api.defaultHost"]); + if (object[".google.api.oauthScopes"] != null) + message[".google.api.oauthScopes"] = String(object[".google.api.oauthScopes"]); + return message; + }; + + /** + * Creates a plain object from a ServiceOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.ServiceOptions + * @static + * @param {google.protobuf.ServiceOptions} message ServiceOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + ServiceOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.uninterpretedOption = []; + if (options.defaults) { + object.deprecated = false; + object[".google.api.defaultHost"] = ""; + object[".google.api.oauthScopes"] = ""; + } + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.defaultHost"] != null && message.hasOwnProperty(".google.api.defaultHost")) + object[".google.api.defaultHost"] = message[".google.api.defaultHost"]; + if (message[".google.api.oauthScopes"] != null && message.hasOwnProperty(".google.api.oauthScopes")) + object[".google.api.oauthScopes"] = message[".google.api.oauthScopes"]; + return object; + }; + + /** + * Converts this ServiceOptions to JSON. + * @function toJSON + * @memberof google.protobuf.ServiceOptions + * @instance + * @returns {Object.} JSON object + */ + ServiceOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for ServiceOptions + * @function getTypeUrl + * @memberof google.protobuf.ServiceOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + ServiceOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.ServiceOptions"; + }; + + return ServiceOptions; + })(); + + protobuf.MethodOptions = (function() { + + /** + * Properties of a MethodOptions. + * @memberof google.protobuf + * @interface IMethodOptions + * @property {boolean|null} [deprecated] MethodOptions deprecated + * @property {google.protobuf.MethodOptions.IdempotencyLevel|null} [idempotencyLevel] MethodOptions idempotencyLevel + * @property {Array.|null} [uninterpretedOption] MethodOptions uninterpretedOption + * @property {google.api.IHttpRule|null} [".google.api.http"] MethodOptions .google.api.http + * @property {Array.|null} [".google.api.methodSignature"] MethodOptions .google.api.methodSignature + */ + + /** + * Constructs a new MethodOptions. + * @memberof google.protobuf + * @classdesc Represents a MethodOptions. + * @implements IMethodOptions + * @constructor + * @param {google.protobuf.IMethodOptions=} [properties] Properties to set + */ + function MethodOptions(properties) { + this.uninterpretedOption = []; + this[".google.api.methodSignature"] = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * MethodOptions deprecated. + * @member {boolean} deprecated + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype.deprecated = false; + + /** + * MethodOptions idempotencyLevel. + * @member {google.protobuf.MethodOptions.IdempotencyLevel} idempotencyLevel + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype.idempotencyLevel = 0; + + /** + * MethodOptions uninterpretedOption. + * @member {Array.} uninterpretedOption + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype.uninterpretedOption = $util.emptyArray; + + /** + * MethodOptions .google.api.http. + * @member {google.api.IHttpRule|null|undefined} .google.api.http + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype[".google.api.http"] = null; + + /** + * MethodOptions .google.api.methodSignature. + * @member {Array.} .google.api.methodSignature + * @memberof google.protobuf.MethodOptions + * @instance + */ + MethodOptions.prototype[".google.api.methodSignature"] = $util.emptyArray; + + /** + * Creates a new MethodOptions instance using the specified properties. + * @function create + * @memberof google.protobuf.MethodOptions + * @static + * @param {google.protobuf.IMethodOptions=} [properties] Properties to set + * @returns {google.protobuf.MethodOptions} MethodOptions instance + */ + MethodOptions.create = function create(properties) { + return new MethodOptions(properties); + }; + + /** + * Encodes the specified MethodOptions message. Does not implicitly {@link google.protobuf.MethodOptions.verify|verify} messages. + * @function encode + * @memberof google.protobuf.MethodOptions + * @static + * @param {google.protobuf.IMethodOptions} message MethodOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MethodOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.deprecated != null && Object.hasOwnProperty.call(message, "deprecated")) + writer.uint32(/* id 33, wireType 0 =*/264).bool(message.deprecated); + if (message.idempotencyLevel != null && Object.hasOwnProperty.call(message, "idempotencyLevel")) + writer.uint32(/* id 34, wireType 0 =*/272).int32(message.idempotencyLevel); + if (message.uninterpretedOption != null && message.uninterpretedOption.length) + for (var i = 0; i < message.uninterpretedOption.length; ++i) + $root.google.protobuf.UninterpretedOption.encode(message.uninterpretedOption[i], writer.uint32(/* id 999, wireType 2 =*/7994).fork()).ldelim(); + if (message[".google.api.methodSignature"] != null && message[".google.api.methodSignature"].length) + for (var i = 0; i < message[".google.api.methodSignature"].length; ++i) + writer.uint32(/* id 1051, wireType 2 =*/8410).string(message[".google.api.methodSignature"][i]); + if (message[".google.api.http"] != null && Object.hasOwnProperty.call(message, ".google.api.http")) + $root.google.api.HttpRule.encode(message[".google.api.http"], writer.uint32(/* id 72295728, wireType 2 =*/578365826).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified MethodOptions message, length delimited. Does not implicitly {@link google.protobuf.MethodOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.MethodOptions + * @static + * @param {google.protobuf.IMethodOptions} message MethodOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + MethodOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a MethodOptions message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.MethodOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.MethodOptions} MethodOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MethodOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.MethodOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 33: { + message.deprecated = reader.bool(); + break; + } + case 34: { + message.idempotencyLevel = reader.int32(); + break; + } + case 999: { + if (!(message.uninterpretedOption && message.uninterpretedOption.length)) + message.uninterpretedOption = []; + message.uninterpretedOption.push($root.google.protobuf.UninterpretedOption.decode(reader, reader.uint32())); + break; + } + case 72295728: { + message[".google.api.http"] = $root.google.api.HttpRule.decode(reader, reader.uint32()); + break; + } + case 1051: { + if (!(message[".google.api.methodSignature"] && message[".google.api.methodSignature"].length)) + message[".google.api.methodSignature"] = []; + message[".google.api.methodSignature"].push(reader.string()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a MethodOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.MethodOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.MethodOptions} MethodOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + MethodOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a MethodOptions message. + * @function verify + * @memberof google.protobuf.MethodOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + MethodOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + if (typeof message.deprecated !== "boolean") + return "deprecated: boolean expected"; + if (message.idempotencyLevel != null && message.hasOwnProperty("idempotencyLevel")) + switch (message.idempotencyLevel) { + default: + return "idempotencyLevel: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.uninterpretedOption != null && message.hasOwnProperty("uninterpretedOption")) { + if (!Array.isArray(message.uninterpretedOption)) + return "uninterpretedOption: array expected"; + for (var i = 0; i < message.uninterpretedOption.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.verify(message.uninterpretedOption[i]); + if (error) + return "uninterpretedOption." + error; + } + } + if (message[".google.api.http"] != null && message.hasOwnProperty(".google.api.http")) { + var error = $root.google.api.HttpRule.verify(message[".google.api.http"]); + if (error) + return ".google.api.http." + error; + } + if (message[".google.api.methodSignature"] != null && message.hasOwnProperty(".google.api.methodSignature")) { + if (!Array.isArray(message[".google.api.methodSignature"])) + return ".google.api.methodSignature: array expected"; + for (var i = 0; i < message[".google.api.methodSignature"].length; ++i) + if (!$util.isString(message[".google.api.methodSignature"][i])) + return ".google.api.methodSignature: string[] expected"; + } + return null; + }; + + /** + * Creates a MethodOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.MethodOptions + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.MethodOptions} MethodOptions + */ + MethodOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.MethodOptions) + return object; + var message = new $root.google.protobuf.MethodOptions(); + if (object.deprecated != null) + message.deprecated = Boolean(object.deprecated); + switch (object.idempotencyLevel) { + default: + if (typeof object.idempotencyLevel === "number") { + message.idempotencyLevel = object.idempotencyLevel; + break; + } + break; + case "IDEMPOTENCY_UNKNOWN": + case 0: + message.idempotencyLevel = 0; + break; + case "NO_SIDE_EFFECTS": + case 1: + message.idempotencyLevel = 1; + break; + case "IDEMPOTENT": + case 2: + message.idempotencyLevel = 2; + break; + } + if (object.uninterpretedOption) { + if (!Array.isArray(object.uninterpretedOption)) + throw TypeError(".google.protobuf.MethodOptions.uninterpretedOption: array expected"); + message.uninterpretedOption = []; + for (var i = 0; i < object.uninterpretedOption.length; ++i) { + if (typeof object.uninterpretedOption[i] !== "object") + throw TypeError(".google.protobuf.MethodOptions.uninterpretedOption: object expected"); + message.uninterpretedOption[i] = $root.google.protobuf.UninterpretedOption.fromObject(object.uninterpretedOption[i]); + } + } + if (object[".google.api.http"] != null) { + if (typeof object[".google.api.http"] !== "object") + throw TypeError(".google.protobuf.MethodOptions..google.api.http: object expected"); + message[".google.api.http"] = $root.google.api.HttpRule.fromObject(object[".google.api.http"]); + } + if (object[".google.api.methodSignature"]) { + if (!Array.isArray(object[".google.api.methodSignature"])) + throw TypeError(".google.protobuf.MethodOptions..google.api.methodSignature: array expected"); + message[".google.api.methodSignature"] = []; + for (var i = 0; i < object[".google.api.methodSignature"].length; ++i) + message[".google.api.methodSignature"][i] = String(object[".google.api.methodSignature"][i]); + } + return message; + }; + + /** + * Creates a plain object from a MethodOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.MethodOptions + * @static + * @param {google.protobuf.MethodOptions} message MethodOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + MethodOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.uninterpretedOption = []; + object[".google.api.methodSignature"] = []; + } + if (options.defaults) { + object.deprecated = false; + object.idempotencyLevel = options.enums === String ? "IDEMPOTENCY_UNKNOWN" : 0; + object[".google.api.http"] = null; + } + if (message.deprecated != null && message.hasOwnProperty("deprecated")) + object.deprecated = message.deprecated; + if (message.idempotencyLevel != null && message.hasOwnProperty("idempotencyLevel")) + object.idempotencyLevel = options.enums === String ? $root.google.protobuf.MethodOptions.IdempotencyLevel[message.idempotencyLevel] === undefined ? message.idempotencyLevel : $root.google.protobuf.MethodOptions.IdempotencyLevel[message.idempotencyLevel] : message.idempotencyLevel; + if (message.uninterpretedOption && message.uninterpretedOption.length) { + object.uninterpretedOption = []; + for (var j = 0; j < message.uninterpretedOption.length; ++j) + object.uninterpretedOption[j] = $root.google.protobuf.UninterpretedOption.toObject(message.uninterpretedOption[j], options); + } + if (message[".google.api.methodSignature"] && message[".google.api.methodSignature"].length) { + object[".google.api.methodSignature"] = []; + for (var j = 0; j < message[".google.api.methodSignature"].length; ++j) + object[".google.api.methodSignature"][j] = message[".google.api.methodSignature"][j]; + } + if (message[".google.api.http"] != null && message.hasOwnProperty(".google.api.http")) + object[".google.api.http"] = $root.google.api.HttpRule.toObject(message[".google.api.http"], options); + return object; + }; + + /** + * Converts this MethodOptions to JSON. + * @function toJSON + * @memberof google.protobuf.MethodOptions + * @instance + * @returns {Object.} JSON object + */ + MethodOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for MethodOptions + * @function getTypeUrl + * @memberof google.protobuf.MethodOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + MethodOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.MethodOptions"; + }; + + /** + * IdempotencyLevel enum. + * @name google.protobuf.MethodOptions.IdempotencyLevel + * @enum {number} + * @property {number} IDEMPOTENCY_UNKNOWN=0 IDEMPOTENCY_UNKNOWN value + * @property {number} NO_SIDE_EFFECTS=1 NO_SIDE_EFFECTS value + * @property {number} IDEMPOTENT=2 IDEMPOTENT value + */ + MethodOptions.IdempotencyLevel = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "IDEMPOTENCY_UNKNOWN"] = 0; + values[valuesById[1] = "NO_SIDE_EFFECTS"] = 1; + values[valuesById[2] = "IDEMPOTENT"] = 2; + return values; + })(); + + return MethodOptions; + })(); + + protobuf.UninterpretedOption = (function() { + + /** + * Properties of an UninterpretedOption. + * @memberof google.protobuf + * @interface IUninterpretedOption + * @property {Array.|null} [name] UninterpretedOption name + * @property {string|null} [identifierValue] UninterpretedOption identifierValue + * @property {number|Long|null} [positiveIntValue] UninterpretedOption positiveIntValue + * @property {number|Long|null} [negativeIntValue] UninterpretedOption negativeIntValue + * @property {number|null} [doubleValue] UninterpretedOption doubleValue + * @property {Uint8Array|null} [stringValue] UninterpretedOption stringValue + * @property {string|null} [aggregateValue] UninterpretedOption aggregateValue + */ + + /** + * Constructs a new UninterpretedOption. + * @memberof google.protobuf + * @classdesc Represents an UninterpretedOption. + * @implements IUninterpretedOption + * @constructor + * @param {google.protobuf.IUninterpretedOption=} [properties] Properties to set + */ + function UninterpretedOption(properties) { + this.name = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * UninterpretedOption name. + * @member {Array.} name + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.name = $util.emptyArray; + + /** + * UninterpretedOption identifierValue. + * @member {string} identifierValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.identifierValue = ""; + + /** + * UninterpretedOption positiveIntValue. + * @member {number|Long} positiveIntValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.positiveIntValue = $util.Long ? $util.Long.fromBits(0,0,true) : 0; + + /** + * UninterpretedOption negativeIntValue. + * @member {number|Long} negativeIntValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.negativeIntValue = $util.Long ? $util.Long.fromBits(0,0,false) : 0; + + /** + * UninterpretedOption doubleValue. + * @member {number} doubleValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.doubleValue = 0; + + /** + * UninterpretedOption stringValue. + * @member {Uint8Array} stringValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.stringValue = $util.newBuffer([]); + + /** + * UninterpretedOption aggregateValue. + * @member {string} aggregateValue + * @memberof google.protobuf.UninterpretedOption + * @instance + */ + UninterpretedOption.prototype.aggregateValue = ""; + + /** + * Creates a new UninterpretedOption instance using the specified properties. + * @function create + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {google.protobuf.IUninterpretedOption=} [properties] Properties to set + * @returns {google.protobuf.UninterpretedOption} UninterpretedOption instance + */ + UninterpretedOption.create = function create(properties) { + return new UninterpretedOption(properties); + }; + + /** + * Encodes the specified UninterpretedOption message. Does not implicitly {@link google.protobuf.UninterpretedOption.verify|verify} messages. + * @function encode + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {google.protobuf.IUninterpretedOption} message UninterpretedOption message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + UninterpretedOption.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.name != null && message.name.length) + for (var i = 0; i < message.name.length; ++i) + $root.google.protobuf.UninterpretedOption.NamePart.encode(message.name[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.identifierValue != null && Object.hasOwnProperty.call(message, "identifierValue")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.identifierValue); + if (message.positiveIntValue != null && Object.hasOwnProperty.call(message, "positiveIntValue")) + writer.uint32(/* id 4, wireType 0 =*/32).uint64(message.positiveIntValue); + if (message.negativeIntValue != null && Object.hasOwnProperty.call(message, "negativeIntValue")) + writer.uint32(/* id 5, wireType 0 =*/40).int64(message.negativeIntValue); + if (message.doubleValue != null && Object.hasOwnProperty.call(message, "doubleValue")) + writer.uint32(/* id 6, wireType 1 =*/49).double(message.doubleValue); + if (message.stringValue != null && Object.hasOwnProperty.call(message, "stringValue")) + writer.uint32(/* id 7, wireType 2 =*/58).bytes(message.stringValue); + if (message.aggregateValue != null && Object.hasOwnProperty.call(message, "aggregateValue")) + writer.uint32(/* id 8, wireType 2 =*/66).string(message.aggregateValue); + return writer; + }; + + /** + * Encodes the specified UninterpretedOption message, length delimited. Does not implicitly {@link google.protobuf.UninterpretedOption.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {google.protobuf.IUninterpretedOption} message UninterpretedOption message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + UninterpretedOption.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an UninterpretedOption message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.UninterpretedOption} UninterpretedOption + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + UninterpretedOption.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.UninterpretedOption(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 2: { + if (!(message.name && message.name.length)) + message.name = []; + message.name.push($root.google.protobuf.UninterpretedOption.NamePart.decode(reader, reader.uint32())); + break; + } + case 3: { + message.identifierValue = reader.string(); + break; + } + case 4: { + message.positiveIntValue = reader.uint64(); + break; + } + case 5: { + message.negativeIntValue = reader.int64(); + break; + } + case 6: { + message.doubleValue = reader.double(); + break; + } + case 7: { + message.stringValue = reader.bytes(); + break; + } + case 8: { + message.aggregateValue = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an UninterpretedOption message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.UninterpretedOption} UninterpretedOption + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + UninterpretedOption.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an UninterpretedOption message. + * @function verify + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + UninterpretedOption.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.name != null && message.hasOwnProperty("name")) { + if (!Array.isArray(message.name)) + return "name: array expected"; + for (var i = 0; i < message.name.length; ++i) { + var error = $root.google.protobuf.UninterpretedOption.NamePart.verify(message.name[i]); + if (error) + return "name." + error; + } + } + if (message.identifierValue != null && message.hasOwnProperty("identifierValue")) + if (!$util.isString(message.identifierValue)) + return "identifierValue: string expected"; + if (message.positiveIntValue != null && message.hasOwnProperty("positiveIntValue")) + if (!$util.isInteger(message.positiveIntValue) && !(message.positiveIntValue && $util.isInteger(message.positiveIntValue.low) && $util.isInteger(message.positiveIntValue.high))) + return "positiveIntValue: integer|Long expected"; + if (message.negativeIntValue != null && message.hasOwnProperty("negativeIntValue")) + if (!$util.isInteger(message.negativeIntValue) && !(message.negativeIntValue && $util.isInteger(message.negativeIntValue.low) && $util.isInteger(message.negativeIntValue.high))) + return "negativeIntValue: integer|Long expected"; + if (message.doubleValue != null && message.hasOwnProperty("doubleValue")) + if (typeof message.doubleValue !== "number") + return "doubleValue: number expected"; + if (message.stringValue != null && message.hasOwnProperty("stringValue")) + if (!(message.stringValue && typeof message.stringValue.length === "number" || $util.isString(message.stringValue))) + return "stringValue: buffer expected"; + if (message.aggregateValue != null && message.hasOwnProperty("aggregateValue")) + if (!$util.isString(message.aggregateValue)) + return "aggregateValue: string expected"; + return null; + }; + + /** + * Creates an UninterpretedOption message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.UninterpretedOption} UninterpretedOption + */ + UninterpretedOption.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.UninterpretedOption) + return object; + var message = new $root.google.protobuf.UninterpretedOption(); + if (object.name) { + if (!Array.isArray(object.name)) + throw TypeError(".google.protobuf.UninterpretedOption.name: array expected"); + message.name = []; + for (var i = 0; i < object.name.length; ++i) { + if (typeof object.name[i] !== "object") + throw TypeError(".google.protobuf.UninterpretedOption.name: object expected"); + message.name[i] = $root.google.protobuf.UninterpretedOption.NamePart.fromObject(object.name[i]); + } + } + if (object.identifierValue != null) + message.identifierValue = String(object.identifierValue); + if (object.positiveIntValue != null) + if ($util.Long) + (message.positiveIntValue = $util.Long.fromValue(object.positiveIntValue)).unsigned = true; + else if (typeof object.positiveIntValue === "string") + message.positiveIntValue = parseInt(object.positiveIntValue, 10); + else if (typeof object.positiveIntValue === "number") + message.positiveIntValue = object.positiveIntValue; + else if (typeof object.positiveIntValue === "object") + message.positiveIntValue = new $util.LongBits(object.positiveIntValue.low >>> 0, object.positiveIntValue.high >>> 0).toNumber(true); + if (object.negativeIntValue != null) + if ($util.Long) + (message.negativeIntValue = $util.Long.fromValue(object.negativeIntValue)).unsigned = false; + else if (typeof object.negativeIntValue === "string") + message.negativeIntValue = parseInt(object.negativeIntValue, 10); + else if (typeof object.negativeIntValue === "number") + message.negativeIntValue = object.negativeIntValue; + else if (typeof object.negativeIntValue === "object") + message.negativeIntValue = new $util.LongBits(object.negativeIntValue.low >>> 0, object.negativeIntValue.high >>> 0).toNumber(); + if (object.doubleValue != null) + message.doubleValue = Number(object.doubleValue); + if (object.stringValue != null) + if (typeof object.stringValue === "string") + $util.base64.decode(object.stringValue, message.stringValue = $util.newBuffer($util.base64.length(object.stringValue)), 0); + else if (object.stringValue.length >= 0) + message.stringValue = object.stringValue; + if (object.aggregateValue != null) + message.aggregateValue = String(object.aggregateValue); + return message; + }; + + /** + * Creates a plain object from an UninterpretedOption message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {google.protobuf.UninterpretedOption} message UninterpretedOption + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + UninterpretedOption.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.name = []; + if (options.defaults) { + object.identifierValue = ""; + if ($util.Long) { + var long = new $util.Long(0, 0, true); + object.positiveIntValue = options.longs === String ? long.toString() : options.longs === Number ? long.toNumber() : long; + } else + object.positiveIntValue = options.longs === String ? "0" : 0; + if ($util.Long) { + var long = new $util.Long(0, 0, false); + object.negativeIntValue = options.longs === String ? long.toString() : options.longs === Number ? long.toNumber() : long; + } else + object.negativeIntValue = options.longs === String ? "0" : 0; + object.doubleValue = 0; + if (options.bytes === String) + object.stringValue = ""; + else { + object.stringValue = []; + if (options.bytes !== Array) + object.stringValue = $util.newBuffer(object.stringValue); + } + object.aggregateValue = ""; + } + if (message.name && message.name.length) { + object.name = []; + for (var j = 0; j < message.name.length; ++j) + object.name[j] = $root.google.protobuf.UninterpretedOption.NamePart.toObject(message.name[j], options); + } + if (message.identifierValue != null && message.hasOwnProperty("identifierValue")) + object.identifierValue = message.identifierValue; + if (message.positiveIntValue != null && message.hasOwnProperty("positiveIntValue")) + if (typeof message.positiveIntValue === "number") + object.positiveIntValue = options.longs === String ? String(message.positiveIntValue) : message.positiveIntValue; + else + object.positiveIntValue = options.longs === String ? $util.Long.prototype.toString.call(message.positiveIntValue) : options.longs === Number ? new $util.LongBits(message.positiveIntValue.low >>> 0, message.positiveIntValue.high >>> 0).toNumber(true) : message.positiveIntValue; + if (message.negativeIntValue != null && message.hasOwnProperty("negativeIntValue")) + if (typeof message.negativeIntValue === "number") + object.negativeIntValue = options.longs === String ? String(message.negativeIntValue) : message.negativeIntValue; + else + object.negativeIntValue = options.longs === String ? $util.Long.prototype.toString.call(message.negativeIntValue) : options.longs === Number ? new $util.LongBits(message.negativeIntValue.low >>> 0, message.negativeIntValue.high >>> 0).toNumber() : message.negativeIntValue; + if (message.doubleValue != null && message.hasOwnProperty("doubleValue")) + object.doubleValue = options.json && !isFinite(message.doubleValue) ? String(message.doubleValue) : message.doubleValue; + if (message.stringValue != null && message.hasOwnProperty("stringValue")) + object.stringValue = options.bytes === String ? $util.base64.encode(message.stringValue, 0, message.stringValue.length) : options.bytes === Array ? Array.prototype.slice.call(message.stringValue) : message.stringValue; + if (message.aggregateValue != null && message.hasOwnProperty("aggregateValue")) + object.aggregateValue = message.aggregateValue; + return object; + }; + + /** + * Converts this UninterpretedOption to JSON. + * @function toJSON + * @memberof google.protobuf.UninterpretedOption + * @instance + * @returns {Object.} JSON object + */ + UninterpretedOption.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for UninterpretedOption + * @function getTypeUrl + * @memberof google.protobuf.UninterpretedOption + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + UninterpretedOption.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.UninterpretedOption"; + }; + + UninterpretedOption.NamePart = (function() { + + /** + * Properties of a NamePart. + * @memberof google.protobuf.UninterpretedOption + * @interface INamePart + * @property {string} namePart NamePart namePart + * @property {boolean} isExtension NamePart isExtension + */ + + /** + * Constructs a new NamePart. + * @memberof google.protobuf.UninterpretedOption + * @classdesc Represents a NamePart. + * @implements INamePart + * @constructor + * @param {google.protobuf.UninterpretedOption.INamePart=} [properties] Properties to set + */ + function NamePart(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * NamePart namePart. + * @member {string} namePart + * @memberof google.protobuf.UninterpretedOption.NamePart + * @instance + */ + NamePart.prototype.namePart = ""; + + /** + * NamePart isExtension. + * @member {boolean} isExtension + * @memberof google.protobuf.UninterpretedOption.NamePart + * @instance + */ + NamePart.prototype.isExtension = false; + + /** + * Creates a new NamePart instance using the specified properties. + * @function create + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {google.protobuf.UninterpretedOption.INamePart=} [properties] Properties to set + * @returns {google.protobuf.UninterpretedOption.NamePart} NamePart instance + */ + NamePart.create = function create(properties) { + return new NamePart(properties); + }; + + /** + * Encodes the specified NamePart message. Does not implicitly {@link google.protobuf.UninterpretedOption.NamePart.verify|verify} messages. + * @function encode + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {google.protobuf.UninterpretedOption.INamePart} message NamePart message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + NamePart.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + writer.uint32(/* id 1, wireType 2 =*/10).string(message.namePart); + writer.uint32(/* id 2, wireType 0 =*/16).bool(message.isExtension); + return writer; + }; + + /** + * Encodes the specified NamePart message, length delimited. Does not implicitly {@link google.protobuf.UninterpretedOption.NamePart.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {google.protobuf.UninterpretedOption.INamePart} message NamePart message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + NamePart.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a NamePart message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.UninterpretedOption.NamePart} NamePart + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + NamePart.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.UninterpretedOption.NamePart(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.namePart = reader.string(); + break; + } + case 2: { + message.isExtension = reader.bool(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + if (!message.hasOwnProperty("namePart")) + throw $util.ProtocolError("missing required 'namePart'", { instance: message }); + if (!message.hasOwnProperty("isExtension")) + throw $util.ProtocolError("missing required 'isExtension'", { instance: message }); + return message; + }; + + /** + * Decodes a NamePart message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.UninterpretedOption.NamePart} NamePart + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + NamePart.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a NamePart message. + * @function verify + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + NamePart.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (!$util.isString(message.namePart)) + return "namePart: string expected"; + if (typeof message.isExtension !== "boolean") + return "isExtension: boolean expected"; + return null; + }; + + /** + * Creates a NamePart message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.UninterpretedOption.NamePart} NamePart + */ + NamePart.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.UninterpretedOption.NamePart) + return object; + var message = new $root.google.protobuf.UninterpretedOption.NamePart(); + if (object.namePart != null) + message.namePart = String(object.namePart); + if (object.isExtension != null) + message.isExtension = Boolean(object.isExtension); + return message; + }; + + /** + * Creates a plain object from a NamePart message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {google.protobuf.UninterpretedOption.NamePart} message NamePart + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + NamePart.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.namePart = ""; + object.isExtension = false; + } + if (message.namePart != null && message.hasOwnProperty("namePart")) + object.namePart = message.namePart; + if (message.isExtension != null && message.hasOwnProperty("isExtension")) + object.isExtension = message.isExtension; + return object; + }; + + /** + * Converts this NamePart to JSON. + * @function toJSON + * @memberof google.protobuf.UninterpretedOption.NamePart + * @instance + * @returns {Object.} JSON object + */ + NamePart.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for NamePart + * @function getTypeUrl + * @memberof google.protobuf.UninterpretedOption.NamePart + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + NamePart.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.UninterpretedOption.NamePart"; + }; + + return NamePart; + })(); + + return UninterpretedOption; + })(); + + protobuf.SourceCodeInfo = (function() { + + /** + * Properties of a SourceCodeInfo. + * @memberof google.protobuf + * @interface ISourceCodeInfo + * @property {Array.|null} [location] SourceCodeInfo location + */ + + /** + * Constructs a new SourceCodeInfo. + * @memberof google.protobuf + * @classdesc Represents a SourceCodeInfo. + * @implements ISourceCodeInfo + * @constructor + * @param {google.protobuf.ISourceCodeInfo=} [properties] Properties to set + */ + function SourceCodeInfo(properties) { + this.location = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * SourceCodeInfo location. + * @member {Array.} location + * @memberof google.protobuf.SourceCodeInfo + * @instance + */ + SourceCodeInfo.prototype.location = $util.emptyArray; + + /** + * Creates a new SourceCodeInfo instance using the specified properties. + * @function create + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {google.protobuf.ISourceCodeInfo=} [properties] Properties to set + * @returns {google.protobuf.SourceCodeInfo} SourceCodeInfo instance + */ + SourceCodeInfo.create = function create(properties) { + return new SourceCodeInfo(properties); + }; + + /** + * Encodes the specified SourceCodeInfo message. Does not implicitly {@link google.protobuf.SourceCodeInfo.verify|verify} messages. + * @function encode + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {google.protobuf.ISourceCodeInfo} message SourceCodeInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + SourceCodeInfo.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.location != null && message.location.length) + for (var i = 0; i < message.location.length; ++i) + $root.google.protobuf.SourceCodeInfo.Location.encode(message.location[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified SourceCodeInfo message, length delimited. Does not implicitly {@link google.protobuf.SourceCodeInfo.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {google.protobuf.ISourceCodeInfo} message SourceCodeInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + SourceCodeInfo.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a SourceCodeInfo message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.SourceCodeInfo} SourceCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + SourceCodeInfo.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.SourceCodeInfo(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + if (!(message.location && message.location.length)) + message.location = []; + message.location.push($root.google.protobuf.SourceCodeInfo.Location.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a SourceCodeInfo message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.SourceCodeInfo} SourceCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + SourceCodeInfo.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a SourceCodeInfo message. + * @function verify + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + SourceCodeInfo.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.location != null && message.hasOwnProperty("location")) { + if (!Array.isArray(message.location)) + return "location: array expected"; + for (var i = 0; i < message.location.length; ++i) { + var error = $root.google.protobuf.SourceCodeInfo.Location.verify(message.location[i]); + if (error) + return "location." + error; + } + } + return null; + }; + + /** + * Creates a SourceCodeInfo message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.SourceCodeInfo} SourceCodeInfo + */ + SourceCodeInfo.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.SourceCodeInfo) + return object; + var message = new $root.google.protobuf.SourceCodeInfo(); + if (object.location) { + if (!Array.isArray(object.location)) + throw TypeError(".google.protobuf.SourceCodeInfo.location: array expected"); + message.location = []; + for (var i = 0; i < object.location.length; ++i) { + if (typeof object.location[i] !== "object") + throw TypeError(".google.protobuf.SourceCodeInfo.location: object expected"); + message.location[i] = $root.google.protobuf.SourceCodeInfo.Location.fromObject(object.location[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a SourceCodeInfo message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {google.protobuf.SourceCodeInfo} message SourceCodeInfo + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + SourceCodeInfo.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.location = []; + if (message.location && message.location.length) { + object.location = []; + for (var j = 0; j < message.location.length; ++j) + object.location[j] = $root.google.protobuf.SourceCodeInfo.Location.toObject(message.location[j], options); + } + return object; + }; + + /** + * Converts this SourceCodeInfo to JSON. + * @function toJSON + * @memberof google.protobuf.SourceCodeInfo + * @instance + * @returns {Object.} JSON object + */ + SourceCodeInfo.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for SourceCodeInfo + * @function getTypeUrl + * @memberof google.protobuf.SourceCodeInfo + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + SourceCodeInfo.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.SourceCodeInfo"; + }; + + SourceCodeInfo.Location = (function() { + + /** + * Properties of a Location. + * @memberof google.protobuf.SourceCodeInfo + * @interface ILocation + * @property {Array.|null} [path] Location path + * @property {Array.|null} [span] Location span + * @property {string|null} [leadingComments] Location leadingComments + * @property {string|null} [trailingComments] Location trailingComments + * @property {Array.|null} [leadingDetachedComments] Location leadingDetachedComments + */ + + /** + * Constructs a new Location. + * @memberof google.protobuf.SourceCodeInfo + * @classdesc Represents a Location. + * @implements ILocation + * @constructor + * @param {google.protobuf.SourceCodeInfo.ILocation=} [properties] Properties to set + */ + function Location(properties) { + this.path = []; + this.span = []; + this.leadingDetachedComments = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Location path. + * @member {Array.} path + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.path = $util.emptyArray; + + /** + * Location span. + * @member {Array.} span + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.span = $util.emptyArray; + + /** + * Location leadingComments. + * @member {string} leadingComments + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.leadingComments = ""; + + /** + * Location trailingComments. + * @member {string} trailingComments + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.trailingComments = ""; + + /** + * Location leadingDetachedComments. + * @member {Array.} leadingDetachedComments + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + */ + Location.prototype.leadingDetachedComments = $util.emptyArray; + + /** + * Creates a new Location instance using the specified properties. + * @function create + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {google.protobuf.SourceCodeInfo.ILocation=} [properties] Properties to set + * @returns {google.protobuf.SourceCodeInfo.Location} Location instance + */ + Location.create = function create(properties) { + return new Location(properties); + }; + + /** + * Encodes the specified Location message. Does not implicitly {@link google.protobuf.SourceCodeInfo.Location.verify|verify} messages. + * @function encode + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {google.protobuf.SourceCodeInfo.ILocation} message Location message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Location.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.path != null && message.path.length) { + writer.uint32(/* id 1, wireType 2 =*/10).fork(); + for (var i = 0; i < message.path.length; ++i) + writer.int32(message.path[i]); + writer.ldelim(); + } + if (message.span != null && message.span.length) { + writer.uint32(/* id 2, wireType 2 =*/18).fork(); + for (var i = 0; i < message.span.length; ++i) + writer.int32(message.span[i]); + writer.ldelim(); + } + if (message.leadingComments != null && Object.hasOwnProperty.call(message, "leadingComments")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.leadingComments); + if (message.trailingComments != null && Object.hasOwnProperty.call(message, "trailingComments")) + writer.uint32(/* id 4, wireType 2 =*/34).string(message.trailingComments); + if (message.leadingDetachedComments != null && message.leadingDetachedComments.length) + for (var i = 0; i < message.leadingDetachedComments.length; ++i) + writer.uint32(/* id 6, wireType 2 =*/50).string(message.leadingDetachedComments[i]); + return writer; + }; + + /** + * Encodes the specified Location message, length delimited. Does not implicitly {@link google.protobuf.SourceCodeInfo.Location.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {google.protobuf.SourceCodeInfo.ILocation} message Location message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Location.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Location message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.SourceCodeInfo.Location} Location + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Location.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.SourceCodeInfo.Location(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + if (!(message.path && message.path.length)) + message.path = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.path.push(reader.int32()); + } else + message.path.push(reader.int32()); + break; + } + case 2: { + if (!(message.span && message.span.length)) + message.span = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.span.push(reader.int32()); + } else + message.span.push(reader.int32()); + break; + } + case 3: { + message.leadingComments = reader.string(); + break; + } + case 4: { + message.trailingComments = reader.string(); + break; + } + case 6: { + if (!(message.leadingDetachedComments && message.leadingDetachedComments.length)) + message.leadingDetachedComments = []; + message.leadingDetachedComments.push(reader.string()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Location message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.SourceCodeInfo.Location} Location + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Location.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Location message. + * @function verify + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Location.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.path != null && message.hasOwnProperty("path")) { + if (!Array.isArray(message.path)) + return "path: array expected"; + for (var i = 0; i < message.path.length; ++i) + if (!$util.isInteger(message.path[i])) + return "path: integer[] expected"; + } + if (message.span != null && message.hasOwnProperty("span")) { + if (!Array.isArray(message.span)) + return "span: array expected"; + for (var i = 0; i < message.span.length; ++i) + if (!$util.isInteger(message.span[i])) + return "span: integer[] expected"; + } + if (message.leadingComments != null && message.hasOwnProperty("leadingComments")) + if (!$util.isString(message.leadingComments)) + return "leadingComments: string expected"; + if (message.trailingComments != null && message.hasOwnProperty("trailingComments")) + if (!$util.isString(message.trailingComments)) + return "trailingComments: string expected"; + if (message.leadingDetachedComments != null && message.hasOwnProperty("leadingDetachedComments")) { + if (!Array.isArray(message.leadingDetachedComments)) + return "leadingDetachedComments: array expected"; + for (var i = 0; i < message.leadingDetachedComments.length; ++i) + if (!$util.isString(message.leadingDetachedComments[i])) + return "leadingDetachedComments: string[] expected"; + } + return null; + }; + + /** + * Creates a Location message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.SourceCodeInfo.Location} Location + */ + Location.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.SourceCodeInfo.Location) + return object; + var message = new $root.google.protobuf.SourceCodeInfo.Location(); + if (object.path) { + if (!Array.isArray(object.path)) + throw TypeError(".google.protobuf.SourceCodeInfo.Location.path: array expected"); + message.path = []; + for (var i = 0; i < object.path.length; ++i) + message.path[i] = object.path[i] | 0; + } + if (object.span) { + if (!Array.isArray(object.span)) + throw TypeError(".google.protobuf.SourceCodeInfo.Location.span: array expected"); + message.span = []; + for (var i = 0; i < object.span.length; ++i) + message.span[i] = object.span[i] | 0; + } + if (object.leadingComments != null) + message.leadingComments = String(object.leadingComments); + if (object.trailingComments != null) + message.trailingComments = String(object.trailingComments); + if (object.leadingDetachedComments) { + if (!Array.isArray(object.leadingDetachedComments)) + throw TypeError(".google.protobuf.SourceCodeInfo.Location.leadingDetachedComments: array expected"); + message.leadingDetachedComments = []; + for (var i = 0; i < object.leadingDetachedComments.length; ++i) + message.leadingDetachedComments[i] = String(object.leadingDetachedComments[i]); + } + return message; + }; + + /** + * Creates a plain object from a Location message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {google.protobuf.SourceCodeInfo.Location} message Location + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Location.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.path = []; + object.span = []; + object.leadingDetachedComments = []; + } + if (options.defaults) { + object.leadingComments = ""; + object.trailingComments = ""; + } + if (message.path && message.path.length) { + object.path = []; + for (var j = 0; j < message.path.length; ++j) + object.path[j] = message.path[j]; + } + if (message.span && message.span.length) { + object.span = []; + for (var j = 0; j < message.span.length; ++j) + object.span[j] = message.span[j]; + } + if (message.leadingComments != null && message.hasOwnProperty("leadingComments")) + object.leadingComments = message.leadingComments; + if (message.trailingComments != null && message.hasOwnProperty("trailingComments")) + object.trailingComments = message.trailingComments; + if (message.leadingDetachedComments && message.leadingDetachedComments.length) { + object.leadingDetachedComments = []; + for (var j = 0; j < message.leadingDetachedComments.length; ++j) + object.leadingDetachedComments[j] = message.leadingDetachedComments[j]; + } + return object; + }; + + /** + * Converts this Location to JSON. + * @function toJSON + * @memberof google.protobuf.SourceCodeInfo.Location + * @instance + * @returns {Object.} JSON object + */ + Location.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for Location + * @function getTypeUrl + * @memberof google.protobuf.SourceCodeInfo.Location + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Location.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.SourceCodeInfo.Location"; + }; + + return Location; + })(); + + return SourceCodeInfo; + })(); + + protobuf.GeneratedCodeInfo = (function() { + + /** + * Properties of a GeneratedCodeInfo. + * @memberof google.protobuf + * @interface IGeneratedCodeInfo + * @property {Array.|null} [annotation] GeneratedCodeInfo annotation + */ + + /** + * Constructs a new GeneratedCodeInfo. + * @memberof google.protobuf + * @classdesc Represents a GeneratedCodeInfo. + * @implements IGeneratedCodeInfo + * @constructor + * @param {google.protobuf.IGeneratedCodeInfo=} [properties] Properties to set + */ + function GeneratedCodeInfo(properties) { + this.annotation = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * GeneratedCodeInfo annotation. + * @member {Array.} annotation + * @memberof google.protobuf.GeneratedCodeInfo + * @instance + */ + GeneratedCodeInfo.prototype.annotation = $util.emptyArray; + + /** + * Creates a new GeneratedCodeInfo instance using the specified properties. + * @function create + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {google.protobuf.IGeneratedCodeInfo=} [properties] Properties to set + * @returns {google.protobuf.GeneratedCodeInfo} GeneratedCodeInfo instance + */ + GeneratedCodeInfo.create = function create(properties) { + return new GeneratedCodeInfo(properties); + }; + + /** + * Encodes the specified GeneratedCodeInfo message. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.verify|verify} messages. + * @function encode + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {google.protobuf.IGeneratedCodeInfo} message GeneratedCodeInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GeneratedCodeInfo.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.annotation != null && message.annotation.length) + for (var i = 0; i < message.annotation.length; ++i) + $root.google.protobuf.GeneratedCodeInfo.Annotation.encode(message.annotation[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified GeneratedCodeInfo message, length delimited. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {google.protobuf.IGeneratedCodeInfo} message GeneratedCodeInfo message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GeneratedCodeInfo.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a GeneratedCodeInfo message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.GeneratedCodeInfo} GeneratedCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GeneratedCodeInfo.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.GeneratedCodeInfo(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + if (!(message.annotation && message.annotation.length)) + message.annotation = []; + message.annotation.push($root.google.protobuf.GeneratedCodeInfo.Annotation.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a GeneratedCodeInfo message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.GeneratedCodeInfo} GeneratedCodeInfo + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GeneratedCodeInfo.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a GeneratedCodeInfo message. + * @function verify + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + GeneratedCodeInfo.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.annotation != null && message.hasOwnProperty("annotation")) { + if (!Array.isArray(message.annotation)) + return "annotation: array expected"; + for (var i = 0; i < message.annotation.length; ++i) { + var error = $root.google.protobuf.GeneratedCodeInfo.Annotation.verify(message.annotation[i]); + if (error) + return "annotation." + error; + } + } + return null; + }; + + /** + * Creates a GeneratedCodeInfo message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.GeneratedCodeInfo} GeneratedCodeInfo + */ + GeneratedCodeInfo.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.GeneratedCodeInfo) + return object; + var message = new $root.google.protobuf.GeneratedCodeInfo(); + if (object.annotation) { + if (!Array.isArray(object.annotation)) + throw TypeError(".google.protobuf.GeneratedCodeInfo.annotation: array expected"); + message.annotation = []; + for (var i = 0; i < object.annotation.length; ++i) { + if (typeof object.annotation[i] !== "object") + throw TypeError(".google.protobuf.GeneratedCodeInfo.annotation: object expected"); + message.annotation[i] = $root.google.protobuf.GeneratedCodeInfo.Annotation.fromObject(object.annotation[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a GeneratedCodeInfo message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {google.protobuf.GeneratedCodeInfo} message GeneratedCodeInfo + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + GeneratedCodeInfo.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.annotation = []; + if (message.annotation && message.annotation.length) { + object.annotation = []; + for (var j = 0; j < message.annotation.length; ++j) + object.annotation[j] = $root.google.protobuf.GeneratedCodeInfo.Annotation.toObject(message.annotation[j], options); + } + return object; + }; + + /** + * Converts this GeneratedCodeInfo to JSON. + * @function toJSON + * @memberof google.protobuf.GeneratedCodeInfo + * @instance + * @returns {Object.} JSON object + */ + GeneratedCodeInfo.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for GeneratedCodeInfo + * @function getTypeUrl + * @memberof google.protobuf.GeneratedCodeInfo + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + GeneratedCodeInfo.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.GeneratedCodeInfo"; + }; + + GeneratedCodeInfo.Annotation = (function() { + + /** + * Properties of an Annotation. + * @memberof google.protobuf.GeneratedCodeInfo + * @interface IAnnotation + * @property {Array.|null} [path] Annotation path + * @property {string|null} [sourceFile] Annotation sourceFile + * @property {number|null} [begin] Annotation begin + * @property {number|null} [end] Annotation end + * @property {google.protobuf.GeneratedCodeInfo.Annotation.Semantic|null} [semantic] Annotation semantic + */ + + /** + * Constructs a new Annotation. + * @memberof google.protobuf.GeneratedCodeInfo + * @classdesc Represents an Annotation. + * @implements IAnnotation + * @constructor + * @param {google.protobuf.GeneratedCodeInfo.IAnnotation=} [properties] Properties to set + */ + function Annotation(properties) { + this.path = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Annotation path. + * @member {Array.} path + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.path = $util.emptyArray; + + /** + * Annotation sourceFile. + * @member {string} sourceFile + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.sourceFile = ""; + + /** + * Annotation begin. + * @member {number} begin + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.begin = 0; + + /** + * Annotation end. + * @member {number} end + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.end = 0; + + /** + * Annotation semantic. + * @member {google.protobuf.GeneratedCodeInfo.Annotation.Semantic} semantic + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + */ + Annotation.prototype.semantic = 0; + + /** + * Creates a new Annotation instance using the specified properties. + * @function create + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {google.protobuf.GeneratedCodeInfo.IAnnotation=} [properties] Properties to set + * @returns {google.protobuf.GeneratedCodeInfo.Annotation} Annotation instance + */ + Annotation.create = function create(properties) { + return new Annotation(properties); + }; + + /** + * Encodes the specified Annotation message. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.Annotation.verify|verify} messages. + * @function encode + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {google.protobuf.GeneratedCodeInfo.IAnnotation} message Annotation message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Annotation.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.path != null && message.path.length) { + writer.uint32(/* id 1, wireType 2 =*/10).fork(); + for (var i = 0; i < message.path.length; ++i) + writer.int32(message.path[i]); + writer.ldelim(); + } + if (message.sourceFile != null && Object.hasOwnProperty.call(message, "sourceFile")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.sourceFile); + if (message.begin != null && Object.hasOwnProperty.call(message, "begin")) + writer.uint32(/* id 3, wireType 0 =*/24).int32(message.begin); + if (message.end != null && Object.hasOwnProperty.call(message, "end")) + writer.uint32(/* id 4, wireType 0 =*/32).int32(message.end); + if (message.semantic != null && Object.hasOwnProperty.call(message, "semantic")) + writer.uint32(/* id 5, wireType 0 =*/40).int32(message.semantic); + return writer; + }; + + /** + * Encodes the specified Annotation message, length delimited. Does not implicitly {@link google.protobuf.GeneratedCodeInfo.Annotation.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {google.protobuf.GeneratedCodeInfo.IAnnotation} message Annotation message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Annotation.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an Annotation message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.GeneratedCodeInfo.Annotation} Annotation + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Annotation.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.GeneratedCodeInfo.Annotation(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + if (!(message.path && message.path.length)) + message.path = []; + if ((tag & 7) === 2) { + var end2 = reader.uint32() + reader.pos; + while (reader.pos < end2) + message.path.push(reader.int32()); + } else + message.path.push(reader.int32()); + break; + } + case 2: { + message.sourceFile = reader.string(); + break; + } + case 3: { + message.begin = reader.int32(); + break; + } + case 4: { + message.end = reader.int32(); + break; + } + case 5: { + message.semantic = reader.int32(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an Annotation message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.GeneratedCodeInfo.Annotation} Annotation + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Annotation.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an Annotation message. + * @function verify + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Annotation.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.path != null && message.hasOwnProperty("path")) { + if (!Array.isArray(message.path)) + return "path: array expected"; + for (var i = 0; i < message.path.length; ++i) + if (!$util.isInteger(message.path[i])) + return "path: integer[] expected"; + } + if (message.sourceFile != null && message.hasOwnProperty("sourceFile")) + if (!$util.isString(message.sourceFile)) + return "sourceFile: string expected"; + if (message.begin != null && message.hasOwnProperty("begin")) + if (!$util.isInteger(message.begin)) + return "begin: integer expected"; + if (message.end != null && message.hasOwnProperty("end")) + if (!$util.isInteger(message.end)) + return "end: integer expected"; + if (message.semantic != null && message.hasOwnProperty("semantic")) + switch (message.semantic) { + default: + return "semantic: enum value expected"; + case 0: + case 1: + case 2: + break; + } + return null; + }; + + /** + * Creates an Annotation message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.GeneratedCodeInfo.Annotation} Annotation + */ + Annotation.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.GeneratedCodeInfo.Annotation) + return object; + var message = new $root.google.protobuf.GeneratedCodeInfo.Annotation(); + if (object.path) { + if (!Array.isArray(object.path)) + throw TypeError(".google.protobuf.GeneratedCodeInfo.Annotation.path: array expected"); + message.path = []; + for (var i = 0; i < object.path.length; ++i) + message.path[i] = object.path[i] | 0; + } + if (object.sourceFile != null) + message.sourceFile = String(object.sourceFile); + if (object.begin != null) + message.begin = object.begin | 0; + if (object.end != null) + message.end = object.end | 0; + switch (object.semantic) { + default: + if (typeof object.semantic === "number") { + message.semantic = object.semantic; + break; + } + break; + case "NONE": + case 0: + message.semantic = 0; + break; + case "SET": + case 1: + message.semantic = 1; + break; + case "ALIAS": + case 2: + message.semantic = 2; + break; + } + return message; + }; + + /** + * Creates a plain object from an Annotation message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {google.protobuf.GeneratedCodeInfo.Annotation} message Annotation + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Annotation.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.path = []; + if (options.defaults) { + object.sourceFile = ""; + object.begin = 0; + object.end = 0; + object.semantic = options.enums === String ? "NONE" : 0; + } + if (message.path && message.path.length) { + object.path = []; + for (var j = 0; j < message.path.length; ++j) + object.path[j] = message.path[j]; + } + if (message.sourceFile != null && message.hasOwnProperty("sourceFile")) + object.sourceFile = message.sourceFile; + if (message.begin != null && message.hasOwnProperty("begin")) + object.begin = message.begin; + if (message.end != null && message.hasOwnProperty("end")) + object.end = message.end; + if (message.semantic != null && message.hasOwnProperty("semantic")) + object.semantic = options.enums === String ? $root.google.protobuf.GeneratedCodeInfo.Annotation.Semantic[message.semantic] === undefined ? message.semantic : $root.google.protobuf.GeneratedCodeInfo.Annotation.Semantic[message.semantic] : message.semantic; + return object; + }; + + /** + * Converts this Annotation to JSON. + * @function toJSON + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @instance + * @returns {Object.} JSON object + */ + Annotation.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for Annotation + * @function getTypeUrl + * @memberof google.protobuf.GeneratedCodeInfo.Annotation + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Annotation.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.GeneratedCodeInfo.Annotation"; + }; + + /** + * Semantic enum. + * @name google.protobuf.GeneratedCodeInfo.Annotation.Semantic + * @enum {number} + * @property {number} NONE=0 NONE value + * @property {number} SET=1 SET value + * @property {number} ALIAS=2 ALIAS value + */ + Annotation.Semantic = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "NONE"] = 0; + values[valuesById[1] = "SET"] = 1; + values[valuesById[2] = "ALIAS"] = 2; + return values; + })(); + + return Annotation; + })(); + + return GeneratedCodeInfo; + })(); + + protobuf.FieldMask = (function() { + + /** + * Properties of a FieldMask. + * @memberof google.protobuf + * @interface IFieldMask + * @property {Array.|null} [paths] FieldMask paths + */ + + /** + * Constructs a new FieldMask. + * @memberof google.protobuf + * @classdesc Represents a FieldMask. + * @implements IFieldMask + * @constructor + * @param {google.protobuf.IFieldMask=} [properties] Properties to set + */ + function FieldMask(properties) { + this.paths = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * FieldMask paths. + * @member {Array.} paths + * @memberof google.protobuf.FieldMask + * @instance + */ + FieldMask.prototype.paths = $util.emptyArray; + + /** + * Creates a new FieldMask instance using the specified properties. + * @function create + * @memberof google.protobuf.FieldMask + * @static + * @param {google.protobuf.IFieldMask=} [properties] Properties to set + * @returns {google.protobuf.FieldMask} FieldMask instance + */ + FieldMask.create = function create(properties) { + return new FieldMask(properties); + }; + + /** + * Encodes the specified FieldMask message. Does not implicitly {@link google.protobuf.FieldMask.verify|verify} messages. + * @function encode + * @memberof google.protobuf.FieldMask + * @static + * @param {google.protobuf.IFieldMask} message FieldMask message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldMask.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.paths != null && message.paths.length) + for (var i = 0; i < message.paths.length; ++i) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.paths[i]); + return writer; + }; + + /** + * Encodes the specified FieldMask message, length delimited. Does not implicitly {@link google.protobuf.FieldMask.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.FieldMask + * @static + * @param {google.protobuf.IFieldMask} message FieldMask message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + FieldMask.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a FieldMask message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.FieldMask + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.FieldMask} FieldMask + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldMask.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.FieldMask(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + if (!(message.paths && message.paths.length)) + message.paths = []; + message.paths.push(reader.string()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a FieldMask message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.FieldMask + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.FieldMask} FieldMask + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + FieldMask.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a FieldMask message. + * @function verify + * @memberof google.protobuf.FieldMask + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + FieldMask.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.paths != null && message.hasOwnProperty("paths")) { + if (!Array.isArray(message.paths)) + return "paths: array expected"; + for (var i = 0; i < message.paths.length; ++i) + if (!$util.isString(message.paths[i])) + return "paths: string[] expected"; + } + return null; + }; + + /** + * Creates a FieldMask message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.FieldMask + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.FieldMask} FieldMask + */ + FieldMask.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.FieldMask) + return object; + var message = new $root.google.protobuf.FieldMask(); + if (object.paths) { + if (!Array.isArray(object.paths)) + throw TypeError(".google.protobuf.FieldMask.paths: array expected"); + message.paths = []; + for (var i = 0; i < object.paths.length; ++i) + message.paths[i] = String(object.paths[i]); + } + return message; + }; + + /** + * Creates a plain object from a FieldMask message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.FieldMask + * @static + * @param {google.protobuf.FieldMask} message FieldMask + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + FieldMask.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.paths = []; + if (message.paths && message.paths.length) { + object.paths = []; + for (var j = 0; j < message.paths.length; ++j) + object.paths[j] = message.paths[j]; + } + return object; + }; + + /** + * Converts this FieldMask to JSON. + * @function toJSON + * @memberof google.protobuf.FieldMask + * @instance + * @returns {Object.} JSON object + */ + FieldMask.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for FieldMask + * @function getTypeUrl + * @memberof google.protobuf.FieldMask + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + FieldMask.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.FieldMask"; + }; + + return FieldMask; + })(); + + protobuf.Empty = (function() { + + /** + * Properties of an Empty. + * @memberof google.protobuf + * @interface IEmpty + */ + + /** + * Constructs a new Empty. + * @memberof google.protobuf + * @classdesc Represents an Empty. + * @implements IEmpty + * @constructor + * @param {google.protobuf.IEmpty=} [properties] Properties to set + */ + function Empty(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Creates a new Empty instance using the specified properties. + * @function create + * @memberof google.protobuf.Empty + * @static + * @param {google.protobuf.IEmpty=} [properties] Properties to set + * @returns {google.protobuf.Empty} Empty instance + */ + Empty.create = function create(properties) { + return new Empty(properties); + }; + + /** + * Encodes the specified Empty message. Does not implicitly {@link google.protobuf.Empty.verify|verify} messages. + * @function encode + * @memberof google.protobuf.Empty + * @static + * @param {google.protobuf.IEmpty} message Empty message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Empty.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + return writer; + }; + + /** + * Encodes the specified Empty message, length delimited. Does not implicitly {@link google.protobuf.Empty.verify|verify} messages. + * @function encodeDelimited + * @memberof google.protobuf.Empty + * @static + * @param {google.protobuf.IEmpty} message Empty message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Empty.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an Empty message from the specified reader or buffer. + * @function decode + * @memberof google.protobuf.Empty + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.protobuf.Empty} Empty + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Empty.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.protobuf.Empty(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an Empty message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.protobuf.Empty + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.protobuf.Empty} Empty + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Empty.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an Empty message. + * @function verify + * @memberof google.protobuf.Empty + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Empty.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + return null; + }; + + /** + * Creates an Empty message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.protobuf.Empty + * @static + * @param {Object.} object Plain object + * @returns {google.protobuf.Empty} Empty + */ + Empty.fromObject = function fromObject(object) { + if (object instanceof $root.google.protobuf.Empty) + return object; + return new $root.google.protobuf.Empty(); + }; + + /** + * Creates a plain object from an Empty message. Also converts values to other types if specified. + * @function toObject + * @memberof google.protobuf.Empty + * @static + * @param {google.protobuf.Empty} message Empty + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Empty.toObject = function toObject() { + return {}; + }; + + /** + * Converts this Empty to JSON. + * @function toJSON + * @memberof google.protobuf.Empty + * @instance + * @returns {Object.} JSON object + */ + Empty.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for Empty + * @function getTypeUrl + * @memberof google.protobuf.Empty + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Empty.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.protobuf.Empty"; + }; + + return Empty; + })(); + + return protobuf; + })(); + + google.iam = (function() { + + /** + * Namespace iam. + * @memberof google + * @namespace + */ + var iam = {}; + + iam.v1 = (function() { + + /** + * Namespace v1. + * @memberof google.iam + * @namespace + */ + var v1 = {}; + + v1.IAMPolicy = (function() { + + /** + * Constructs a new IAMPolicy service. + * @memberof google.iam.v1 + * @classdesc Represents a IAMPolicy + * @extends $protobuf.rpc.Service + * @constructor + * @param {$protobuf.RPCImpl} rpcImpl RPC implementation + * @param {boolean} [requestDelimited=false] Whether requests are length-delimited + * @param {boolean} [responseDelimited=false] Whether responses are length-delimited + */ + function IAMPolicy(rpcImpl, requestDelimited, responseDelimited) { + $protobuf.rpc.Service.call(this, rpcImpl, requestDelimited, responseDelimited); + } + + (IAMPolicy.prototype = Object.create($protobuf.rpc.Service.prototype)).constructor = IAMPolicy; + + /** + * Creates new IAMPolicy service using the specified rpc implementation. + * @function create + * @memberof google.iam.v1.IAMPolicy + * @static + * @param {$protobuf.RPCImpl} rpcImpl RPC implementation + * @param {boolean} [requestDelimited=false] Whether requests are length-delimited + * @param {boolean} [responseDelimited=false] Whether responses are length-delimited + * @returns {IAMPolicy} RPC service. Useful where requests and/or responses are streamed. + */ + IAMPolicy.create = function create(rpcImpl, requestDelimited, responseDelimited) { + return new this(rpcImpl, requestDelimited, responseDelimited); + }; + + /** + * Callback as used by {@link google.iam.v1.IAMPolicy|setIamPolicy}. + * @memberof google.iam.v1.IAMPolicy + * @typedef SetIamPolicyCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.iam.v1.Policy} [response] Policy + */ + + /** + * Calls SetIamPolicy. + * @function setIamPolicy + * @memberof google.iam.v1.IAMPolicy + * @instance + * @param {google.iam.v1.ISetIamPolicyRequest} request SetIamPolicyRequest message or plain object + * @param {google.iam.v1.IAMPolicy.SetIamPolicyCallback} callback Node-style callback called with the error, if any, and Policy + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(IAMPolicy.prototype.setIamPolicy = function setIamPolicy(request, callback) { + return this.rpcCall(setIamPolicy, $root.google.iam.v1.SetIamPolicyRequest, $root.google.iam.v1.Policy, request, callback); + }, "name", { value: "SetIamPolicy" }); + + /** + * Calls SetIamPolicy. + * @function setIamPolicy + * @memberof google.iam.v1.IAMPolicy + * @instance + * @param {google.iam.v1.ISetIamPolicyRequest} request SetIamPolicyRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + /** + * Callback as used by {@link google.iam.v1.IAMPolicy|getIamPolicy}. + * @memberof google.iam.v1.IAMPolicy + * @typedef GetIamPolicyCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.iam.v1.Policy} [response] Policy + */ + + /** + * Calls GetIamPolicy. + * @function getIamPolicy + * @memberof google.iam.v1.IAMPolicy + * @instance + * @param {google.iam.v1.IGetIamPolicyRequest} request GetIamPolicyRequest message or plain object + * @param {google.iam.v1.IAMPolicy.GetIamPolicyCallback} callback Node-style callback called with the error, if any, and Policy + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(IAMPolicy.prototype.getIamPolicy = function getIamPolicy(request, callback) { + return this.rpcCall(getIamPolicy, $root.google.iam.v1.GetIamPolicyRequest, $root.google.iam.v1.Policy, request, callback); + }, "name", { value: "GetIamPolicy" }); + + /** + * Calls GetIamPolicy. + * @function getIamPolicy + * @memberof google.iam.v1.IAMPolicy + * @instance + * @param {google.iam.v1.IGetIamPolicyRequest} request GetIamPolicyRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + /** + * Callback as used by {@link google.iam.v1.IAMPolicy|testIamPermissions}. + * @memberof google.iam.v1.IAMPolicy + * @typedef TestIamPermissionsCallback + * @type {function} + * @param {Error|null} error Error, if any + * @param {google.iam.v1.TestIamPermissionsResponse} [response] TestIamPermissionsResponse + */ + + /** + * Calls TestIamPermissions. + * @function testIamPermissions + * @memberof google.iam.v1.IAMPolicy + * @instance + * @param {google.iam.v1.ITestIamPermissionsRequest} request TestIamPermissionsRequest message or plain object + * @param {google.iam.v1.IAMPolicy.TestIamPermissionsCallback} callback Node-style callback called with the error, if any, and TestIamPermissionsResponse + * @returns {undefined} + * @variation 1 + */ + Object.defineProperty(IAMPolicy.prototype.testIamPermissions = function testIamPermissions(request, callback) { + return this.rpcCall(testIamPermissions, $root.google.iam.v1.TestIamPermissionsRequest, $root.google.iam.v1.TestIamPermissionsResponse, request, callback); + }, "name", { value: "TestIamPermissions" }); + + /** + * Calls TestIamPermissions. + * @function testIamPermissions + * @memberof google.iam.v1.IAMPolicy + * @instance + * @param {google.iam.v1.ITestIamPermissionsRequest} request TestIamPermissionsRequest message or plain object + * @returns {Promise} Promise + * @variation 2 + */ + + return IAMPolicy; + })(); + + v1.SetIamPolicyRequest = (function() { + + /** + * Properties of a SetIamPolicyRequest. + * @memberof google.iam.v1 + * @interface ISetIamPolicyRequest + * @property {string|null} [resource] SetIamPolicyRequest resource + * @property {google.iam.v1.IPolicy|null} [policy] SetIamPolicyRequest policy + * @property {google.protobuf.IFieldMask|null} [updateMask] SetIamPolicyRequest updateMask + */ + + /** + * Constructs a new SetIamPolicyRequest. + * @memberof google.iam.v1 + * @classdesc Represents a SetIamPolicyRequest. + * @implements ISetIamPolicyRequest + * @constructor + * @param {google.iam.v1.ISetIamPolicyRequest=} [properties] Properties to set + */ + function SetIamPolicyRequest(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * SetIamPolicyRequest resource. + * @member {string} resource + * @memberof google.iam.v1.SetIamPolicyRequest + * @instance + */ + SetIamPolicyRequest.prototype.resource = ""; + + /** + * SetIamPolicyRequest policy. + * @member {google.iam.v1.IPolicy|null|undefined} policy + * @memberof google.iam.v1.SetIamPolicyRequest + * @instance + */ + SetIamPolicyRequest.prototype.policy = null; + + /** + * SetIamPolicyRequest updateMask. + * @member {google.protobuf.IFieldMask|null|undefined} updateMask + * @memberof google.iam.v1.SetIamPolicyRequest + * @instance + */ + SetIamPolicyRequest.prototype.updateMask = null; + + /** + * Creates a new SetIamPolicyRequest instance using the specified properties. + * @function create + * @memberof google.iam.v1.SetIamPolicyRequest + * @static + * @param {google.iam.v1.ISetIamPolicyRequest=} [properties] Properties to set + * @returns {google.iam.v1.SetIamPolicyRequest} SetIamPolicyRequest instance + */ + SetIamPolicyRequest.create = function create(properties) { + return new SetIamPolicyRequest(properties); + }; + + /** + * Encodes the specified SetIamPolicyRequest message. Does not implicitly {@link google.iam.v1.SetIamPolicyRequest.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.SetIamPolicyRequest + * @static + * @param {google.iam.v1.ISetIamPolicyRequest} message SetIamPolicyRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + SetIamPolicyRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.resource != null && Object.hasOwnProperty.call(message, "resource")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.resource); + if (message.policy != null && Object.hasOwnProperty.call(message, "policy")) + $root.google.iam.v1.Policy.encode(message.policy, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + if (message.updateMask != null && Object.hasOwnProperty.call(message, "updateMask")) + $root.google.protobuf.FieldMask.encode(message.updateMask, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified SetIamPolicyRequest message, length delimited. Does not implicitly {@link google.iam.v1.SetIamPolicyRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.SetIamPolicyRequest + * @static + * @param {google.iam.v1.ISetIamPolicyRequest} message SetIamPolicyRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + SetIamPolicyRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a SetIamPolicyRequest message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.SetIamPolicyRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.SetIamPolicyRequest} SetIamPolicyRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + SetIamPolicyRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.SetIamPolicyRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.resource = reader.string(); + break; + } + case 2: { + message.policy = $root.google.iam.v1.Policy.decode(reader, reader.uint32()); + break; + } + case 3: { + message.updateMask = $root.google.protobuf.FieldMask.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a SetIamPolicyRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.SetIamPolicyRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.SetIamPolicyRequest} SetIamPolicyRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + SetIamPolicyRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a SetIamPolicyRequest message. + * @function verify + * @memberof google.iam.v1.SetIamPolicyRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + SetIamPolicyRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.resource != null && message.hasOwnProperty("resource")) + if (!$util.isString(message.resource)) + return "resource: string expected"; + if (message.policy != null && message.hasOwnProperty("policy")) { + var error = $root.google.iam.v1.Policy.verify(message.policy); + if (error) + return "policy." + error; + } + if (message.updateMask != null && message.hasOwnProperty("updateMask")) { + var error = $root.google.protobuf.FieldMask.verify(message.updateMask); + if (error) + return "updateMask." + error; + } + return null; + }; + + /** + * Creates a SetIamPolicyRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.SetIamPolicyRequest + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.SetIamPolicyRequest} SetIamPolicyRequest + */ + SetIamPolicyRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.SetIamPolicyRequest) + return object; + var message = new $root.google.iam.v1.SetIamPolicyRequest(); + if (object.resource != null) + message.resource = String(object.resource); + if (object.policy != null) { + if (typeof object.policy !== "object") + throw TypeError(".google.iam.v1.SetIamPolicyRequest.policy: object expected"); + message.policy = $root.google.iam.v1.Policy.fromObject(object.policy); + } + if (object.updateMask != null) { + if (typeof object.updateMask !== "object") + throw TypeError(".google.iam.v1.SetIamPolicyRequest.updateMask: object expected"); + message.updateMask = $root.google.protobuf.FieldMask.fromObject(object.updateMask); + } + return message; + }; + + /** + * Creates a plain object from a SetIamPolicyRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.SetIamPolicyRequest + * @static + * @param {google.iam.v1.SetIamPolicyRequest} message SetIamPolicyRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + SetIamPolicyRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.resource = ""; + object.policy = null; + object.updateMask = null; + } + if (message.resource != null && message.hasOwnProperty("resource")) + object.resource = message.resource; + if (message.policy != null && message.hasOwnProperty("policy")) + object.policy = $root.google.iam.v1.Policy.toObject(message.policy, options); + if (message.updateMask != null && message.hasOwnProperty("updateMask")) + object.updateMask = $root.google.protobuf.FieldMask.toObject(message.updateMask, options); + return object; + }; + + /** + * Converts this SetIamPolicyRequest to JSON. + * @function toJSON + * @memberof google.iam.v1.SetIamPolicyRequest + * @instance + * @returns {Object.} JSON object + */ + SetIamPolicyRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for SetIamPolicyRequest + * @function getTypeUrl + * @memberof google.iam.v1.SetIamPolicyRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + SetIamPolicyRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.SetIamPolicyRequest"; + }; + + return SetIamPolicyRequest; + })(); + + v1.GetIamPolicyRequest = (function() { + + /** + * Properties of a GetIamPolicyRequest. + * @memberof google.iam.v1 + * @interface IGetIamPolicyRequest + * @property {string|null} [resource] GetIamPolicyRequest resource + * @property {google.iam.v1.IGetPolicyOptions|null} [options] GetIamPolicyRequest options + */ + + /** + * Constructs a new GetIamPolicyRequest. + * @memberof google.iam.v1 + * @classdesc Represents a GetIamPolicyRequest. + * @implements IGetIamPolicyRequest + * @constructor + * @param {google.iam.v1.IGetIamPolicyRequest=} [properties] Properties to set + */ + function GetIamPolicyRequest(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * GetIamPolicyRequest resource. + * @member {string} resource + * @memberof google.iam.v1.GetIamPolicyRequest + * @instance + */ + GetIamPolicyRequest.prototype.resource = ""; + + /** + * GetIamPolicyRequest options. + * @member {google.iam.v1.IGetPolicyOptions|null|undefined} options + * @memberof google.iam.v1.GetIamPolicyRequest + * @instance + */ + GetIamPolicyRequest.prototype.options = null; + + /** + * Creates a new GetIamPolicyRequest instance using the specified properties. + * @function create + * @memberof google.iam.v1.GetIamPolicyRequest + * @static + * @param {google.iam.v1.IGetIamPolicyRequest=} [properties] Properties to set + * @returns {google.iam.v1.GetIamPolicyRequest} GetIamPolicyRequest instance + */ + GetIamPolicyRequest.create = function create(properties) { + return new GetIamPolicyRequest(properties); + }; + + /** + * Encodes the specified GetIamPolicyRequest message. Does not implicitly {@link google.iam.v1.GetIamPolicyRequest.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.GetIamPolicyRequest + * @static + * @param {google.iam.v1.IGetIamPolicyRequest} message GetIamPolicyRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GetIamPolicyRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.resource != null && Object.hasOwnProperty.call(message, "resource")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.resource); + if (message.options != null && Object.hasOwnProperty.call(message, "options")) + $root.google.iam.v1.GetPolicyOptions.encode(message.options, writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified GetIamPolicyRequest message, length delimited. Does not implicitly {@link google.iam.v1.GetIamPolicyRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.GetIamPolicyRequest + * @static + * @param {google.iam.v1.IGetIamPolicyRequest} message GetIamPolicyRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GetIamPolicyRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a GetIamPolicyRequest message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.GetIamPolicyRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.GetIamPolicyRequest} GetIamPolicyRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GetIamPolicyRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.GetIamPolicyRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.resource = reader.string(); + break; + } + case 2: { + message.options = $root.google.iam.v1.GetPolicyOptions.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a GetIamPolicyRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.GetIamPolicyRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.GetIamPolicyRequest} GetIamPolicyRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GetIamPolicyRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a GetIamPolicyRequest message. + * @function verify + * @memberof google.iam.v1.GetIamPolicyRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + GetIamPolicyRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.resource != null && message.hasOwnProperty("resource")) + if (!$util.isString(message.resource)) + return "resource: string expected"; + if (message.options != null && message.hasOwnProperty("options")) { + var error = $root.google.iam.v1.GetPolicyOptions.verify(message.options); + if (error) + return "options." + error; + } + return null; + }; + + /** + * Creates a GetIamPolicyRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.GetIamPolicyRequest + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.GetIamPolicyRequest} GetIamPolicyRequest + */ + GetIamPolicyRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.GetIamPolicyRequest) + return object; + var message = new $root.google.iam.v1.GetIamPolicyRequest(); + if (object.resource != null) + message.resource = String(object.resource); + if (object.options != null) { + if (typeof object.options !== "object") + throw TypeError(".google.iam.v1.GetIamPolicyRequest.options: object expected"); + message.options = $root.google.iam.v1.GetPolicyOptions.fromObject(object.options); + } + return message; + }; + + /** + * Creates a plain object from a GetIamPolicyRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.GetIamPolicyRequest + * @static + * @param {google.iam.v1.GetIamPolicyRequest} message GetIamPolicyRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + GetIamPolicyRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.resource = ""; + object.options = null; + } + if (message.resource != null && message.hasOwnProperty("resource")) + object.resource = message.resource; + if (message.options != null && message.hasOwnProperty("options")) + object.options = $root.google.iam.v1.GetPolicyOptions.toObject(message.options, options); + return object; + }; + + /** + * Converts this GetIamPolicyRequest to JSON. + * @function toJSON + * @memberof google.iam.v1.GetIamPolicyRequest + * @instance + * @returns {Object.} JSON object + */ + GetIamPolicyRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for GetIamPolicyRequest + * @function getTypeUrl + * @memberof google.iam.v1.GetIamPolicyRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + GetIamPolicyRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.GetIamPolicyRequest"; + }; + + return GetIamPolicyRequest; + })(); + + v1.TestIamPermissionsRequest = (function() { + + /** + * Properties of a TestIamPermissionsRequest. + * @memberof google.iam.v1 + * @interface ITestIamPermissionsRequest + * @property {string|null} [resource] TestIamPermissionsRequest resource + * @property {Array.|null} [permissions] TestIamPermissionsRequest permissions + */ + + /** + * Constructs a new TestIamPermissionsRequest. + * @memberof google.iam.v1 + * @classdesc Represents a TestIamPermissionsRequest. + * @implements ITestIamPermissionsRequest + * @constructor + * @param {google.iam.v1.ITestIamPermissionsRequest=} [properties] Properties to set + */ + function TestIamPermissionsRequest(properties) { + this.permissions = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * TestIamPermissionsRequest resource. + * @member {string} resource + * @memberof google.iam.v1.TestIamPermissionsRequest + * @instance + */ + TestIamPermissionsRequest.prototype.resource = ""; + + /** + * TestIamPermissionsRequest permissions. + * @member {Array.} permissions + * @memberof google.iam.v1.TestIamPermissionsRequest + * @instance + */ + TestIamPermissionsRequest.prototype.permissions = $util.emptyArray; + + /** + * Creates a new TestIamPermissionsRequest instance using the specified properties. + * @function create + * @memberof google.iam.v1.TestIamPermissionsRequest + * @static + * @param {google.iam.v1.ITestIamPermissionsRequest=} [properties] Properties to set + * @returns {google.iam.v1.TestIamPermissionsRequest} TestIamPermissionsRequest instance + */ + TestIamPermissionsRequest.create = function create(properties) { + return new TestIamPermissionsRequest(properties); + }; + + /** + * Encodes the specified TestIamPermissionsRequest message. Does not implicitly {@link google.iam.v1.TestIamPermissionsRequest.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.TestIamPermissionsRequest + * @static + * @param {google.iam.v1.ITestIamPermissionsRequest} message TestIamPermissionsRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + TestIamPermissionsRequest.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.resource != null && Object.hasOwnProperty.call(message, "resource")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.resource); + if (message.permissions != null && message.permissions.length) + for (var i = 0; i < message.permissions.length; ++i) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.permissions[i]); + return writer; + }; + + /** + * Encodes the specified TestIamPermissionsRequest message, length delimited. Does not implicitly {@link google.iam.v1.TestIamPermissionsRequest.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.TestIamPermissionsRequest + * @static + * @param {google.iam.v1.ITestIamPermissionsRequest} message TestIamPermissionsRequest message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + TestIamPermissionsRequest.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a TestIamPermissionsRequest message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.TestIamPermissionsRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.TestIamPermissionsRequest} TestIamPermissionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + TestIamPermissionsRequest.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.TestIamPermissionsRequest(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.resource = reader.string(); + break; + } + case 2: { + if (!(message.permissions && message.permissions.length)) + message.permissions = []; + message.permissions.push(reader.string()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a TestIamPermissionsRequest message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.TestIamPermissionsRequest + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.TestIamPermissionsRequest} TestIamPermissionsRequest + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + TestIamPermissionsRequest.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a TestIamPermissionsRequest message. + * @function verify + * @memberof google.iam.v1.TestIamPermissionsRequest + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + TestIamPermissionsRequest.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.resource != null && message.hasOwnProperty("resource")) + if (!$util.isString(message.resource)) + return "resource: string expected"; + if (message.permissions != null && message.hasOwnProperty("permissions")) { + if (!Array.isArray(message.permissions)) + return "permissions: array expected"; + for (var i = 0; i < message.permissions.length; ++i) + if (!$util.isString(message.permissions[i])) + return "permissions: string[] expected"; + } + return null; + }; + + /** + * Creates a TestIamPermissionsRequest message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.TestIamPermissionsRequest + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.TestIamPermissionsRequest} TestIamPermissionsRequest + */ + TestIamPermissionsRequest.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.TestIamPermissionsRequest) + return object; + var message = new $root.google.iam.v1.TestIamPermissionsRequest(); + if (object.resource != null) + message.resource = String(object.resource); + if (object.permissions) { + if (!Array.isArray(object.permissions)) + throw TypeError(".google.iam.v1.TestIamPermissionsRequest.permissions: array expected"); + message.permissions = []; + for (var i = 0; i < object.permissions.length; ++i) + message.permissions[i] = String(object.permissions[i]); + } + return message; + }; + + /** + * Creates a plain object from a TestIamPermissionsRequest message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.TestIamPermissionsRequest + * @static + * @param {google.iam.v1.TestIamPermissionsRequest} message TestIamPermissionsRequest + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + TestIamPermissionsRequest.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.permissions = []; + if (options.defaults) + object.resource = ""; + if (message.resource != null && message.hasOwnProperty("resource")) + object.resource = message.resource; + if (message.permissions && message.permissions.length) { + object.permissions = []; + for (var j = 0; j < message.permissions.length; ++j) + object.permissions[j] = message.permissions[j]; + } + return object; + }; + + /** + * Converts this TestIamPermissionsRequest to JSON. + * @function toJSON + * @memberof google.iam.v1.TestIamPermissionsRequest + * @instance + * @returns {Object.} JSON object + */ + TestIamPermissionsRequest.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for TestIamPermissionsRequest + * @function getTypeUrl + * @memberof google.iam.v1.TestIamPermissionsRequest + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + TestIamPermissionsRequest.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.TestIamPermissionsRequest"; + }; + + return TestIamPermissionsRequest; + })(); + + v1.TestIamPermissionsResponse = (function() { + + /** + * Properties of a TestIamPermissionsResponse. + * @memberof google.iam.v1 + * @interface ITestIamPermissionsResponse + * @property {Array.|null} [permissions] TestIamPermissionsResponse permissions + */ + + /** + * Constructs a new TestIamPermissionsResponse. + * @memberof google.iam.v1 + * @classdesc Represents a TestIamPermissionsResponse. + * @implements ITestIamPermissionsResponse + * @constructor + * @param {google.iam.v1.ITestIamPermissionsResponse=} [properties] Properties to set + */ + function TestIamPermissionsResponse(properties) { + this.permissions = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * TestIamPermissionsResponse permissions. + * @member {Array.} permissions + * @memberof google.iam.v1.TestIamPermissionsResponse + * @instance + */ + TestIamPermissionsResponse.prototype.permissions = $util.emptyArray; + + /** + * Creates a new TestIamPermissionsResponse instance using the specified properties. + * @function create + * @memberof google.iam.v1.TestIamPermissionsResponse + * @static + * @param {google.iam.v1.ITestIamPermissionsResponse=} [properties] Properties to set + * @returns {google.iam.v1.TestIamPermissionsResponse} TestIamPermissionsResponse instance + */ + TestIamPermissionsResponse.create = function create(properties) { + return new TestIamPermissionsResponse(properties); + }; + + /** + * Encodes the specified TestIamPermissionsResponse message. Does not implicitly {@link google.iam.v1.TestIamPermissionsResponse.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.TestIamPermissionsResponse + * @static + * @param {google.iam.v1.ITestIamPermissionsResponse} message TestIamPermissionsResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + TestIamPermissionsResponse.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.permissions != null && message.permissions.length) + for (var i = 0; i < message.permissions.length; ++i) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.permissions[i]); + return writer; + }; + + /** + * Encodes the specified TestIamPermissionsResponse message, length delimited. Does not implicitly {@link google.iam.v1.TestIamPermissionsResponse.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.TestIamPermissionsResponse + * @static + * @param {google.iam.v1.ITestIamPermissionsResponse} message TestIamPermissionsResponse message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + TestIamPermissionsResponse.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a TestIamPermissionsResponse message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.TestIamPermissionsResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.TestIamPermissionsResponse} TestIamPermissionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + TestIamPermissionsResponse.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.TestIamPermissionsResponse(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + if (!(message.permissions && message.permissions.length)) + message.permissions = []; + message.permissions.push(reader.string()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a TestIamPermissionsResponse message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.TestIamPermissionsResponse + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.TestIamPermissionsResponse} TestIamPermissionsResponse + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + TestIamPermissionsResponse.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a TestIamPermissionsResponse message. + * @function verify + * @memberof google.iam.v1.TestIamPermissionsResponse + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + TestIamPermissionsResponse.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.permissions != null && message.hasOwnProperty("permissions")) { + if (!Array.isArray(message.permissions)) + return "permissions: array expected"; + for (var i = 0; i < message.permissions.length; ++i) + if (!$util.isString(message.permissions[i])) + return "permissions: string[] expected"; + } + return null; + }; + + /** + * Creates a TestIamPermissionsResponse message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.TestIamPermissionsResponse + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.TestIamPermissionsResponse} TestIamPermissionsResponse + */ + TestIamPermissionsResponse.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.TestIamPermissionsResponse) + return object; + var message = new $root.google.iam.v1.TestIamPermissionsResponse(); + if (object.permissions) { + if (!Array.isArray(object.permissions)) + throw TypeError(".google.iam.v1.TestIamPermissionsResponse.permissions: array expected"); + message.permissions = []; + for (var i = 0; i < object.permissions.length; ++i) + message.permissions[i] = String(object.permissions[i]); + } + return message; + }; + + /** + * Creates a plain object from a TestIamPermissionsResponse message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.TestIamPermissionsResponse + * @static + * @param {google.iam.v1.TestIamPermissionsResponse} message TestIamPermissionsResponse + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + TestIamPermissionsResponse.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.permissions = []; + if (message.permissions && message.permissions.length) { + object.permissions = []; + for (var j = 0; j < message.permissions.length; ++j) + object.permissions[j] = message.permissions[j]; + } + return object; + }; + + /** + * Converts this TestIamPermissionsResponse to JSON. + * @function toJSON + * @memberof google.iam.v1.TestIamPermissionsResponse + * @instance + * @returns {Object.} JSON object + */ + TestIamPermissionsResponse.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for TestIamPermissionsResponse + * @function getTypeUrl + * @memberof google.iam.v1.TestIamPermissionsResponse + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + TestIamPermissionsResponse.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.TestIamPermissionsResponse"; + }; + + return TestIamPermissionsResponse; + })(); + + v1.GetPolicyOptions = (function() { + + /** + * Properties of a GetPolicyOptions. + * @memberof google.iam.v1 + * @interface IGetPolicyOptions + * @property {number|null} [requestedPolicyVersion] GetPolicyOptions requestedPolicyVersion + */ + + /** + * Constructs a new GetPolicyOptions. + * @memberof google.iam.v1 + * @classdesc Represents a GetPolicyOptions. + * @implements IGetPolicyOptions + * @constructor + * @param {google.iam.v1.IGetPolicyOptions=} [properties] Properties to set + */ + function GetPolicyOptions(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * GetPolicyOptions requestedPolicyVersion. + * @member {number} requestedPolicyVersion + * @memberof google.iam.v1.GetPolicyOptions + * @instance + */ + GetPolicyOptions.prototype.requestedPolicyVersion = 0; + + /** + * Creates a new GetPolicyOptions instance using the specified properties. + * @function create + * @memberof google.iam.v1.GetPolicyOptions + * @static + * @param {google.iam.v1.IGetPolicyOptions=} [properties] Properties to set + * @returns {google.iam.v1.GetPolicyOptions} GetPolicyOptions instance + */ + GetPolicyOptions.create = function create(properties) { + return new GetPolicyOptions(properties); + }; + + /** + * Encodes the specified GetPolicyOptions message. Does not implicitly {@link google.iam.v1.GetPolicyOptions.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.GetPolicyOptions + * @static + * @param {google.iam.v1.IGetPolicyOptions} message GetPolicyOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GetPolicyOptions.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.requestedPolicyVersion != null && Object.hasOwnProperty.call(message, "requestedPolicyVersion")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.requestedPolicyVersion); + return writer; + }; + + /** + * Encodes the specified GetPolicyOptions message, length delimited. Does not implicitly {@link google.iam.v1.GetPolicyOptions.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.GetPolicyOptions + * @static + * @param {google.iam.v1.IGetPolicyOptions} message GetPolicyOptions message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + GetPolicyOptions.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a GetPolicyOptions message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.GetPolicyOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.GetPolicyOptions} GetPolicyOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GetPolicyOptions.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.GetPolicyOptions(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.requestedPolicyVersion = reader.int32(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a GetPolicyOptions message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.GetPolicyOptions + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.GetPolicyOptions} GetPolicyOptions + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + GetPolicyOptions.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a GetPolicyOptions message. + * @function verify + * @memberof google.iam.v1.GetPolicyOptions + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + GetPolicyOptions.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.requestedPolicyVersion != null && message.hasOwnProperty("requestedPolicyVersion")) + if (!$util.isInteger(message.requestedPolicyVersion)) + return "requestedPolicyVersion: integer expected"; + return null; + }; + + /** + * Creates a GetPolicyOptions message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.GetPolicyOptions + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.GetPolicyOptions} GetPolicyOptions + */ + GetPolicyOptions.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.GetPolicyOptions) + return object; + var message = new $root.google.iam.v1.GetPolicyOptions(); + if (object.requestedPolicyVersion != null) + message.requestedPolicyVersion = object.requestedPolicyVersion | 0; + return message; + }; + + /** + * Creates a plain object from a GetPolicyOptions message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.GetPolicyOptions + * @static + * @param {google.iam.v1.GetPolicyOptions} message GetPolicyOptions + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + GetPolicyOptions.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) + object.requestedPolicyVersion = 0; + if (message.requestedPolicyVersion != null && message.hasOwnProperty("requestedPolicyVersion")) + object.requestedPolicyVersion = message.requestedPolicyVersion; + return object; + }; + + /** + * Converts this GetPolicyOptions to JSON. + * @function toJSON + * @memberof google.iam.v1.GetPolicyOptions + * @instance + * @returns {Object.} JSON object + */ + GetPolicyOptions.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for GetPolicyOptions + * @function getTypeUrl + * @memberof google.iam.v1.GetPolicyOptions + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + GetPolicyOptions.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.GetPolicyOptions"; + }; + + return GetPolicyOptions; + })(); + + v1.Policy = (function() { + + /** + * Properties of a Policy. + * @memberof google.iam.v1 + * @interface IPolicy + * @property {number|null} [version] Policy version + * @property {Array.|null} [bindings] Policy bindings + * @property {Array.|null} [auditConfigs] Policy auditConfigs + * @property {Uint8Array|null} [etag] Policy etag + */ + + /** + * Constructs a new Policy. + * @memberof google.iam.v1 + * @classdesc Represents a Policy. + * @implements IPolicy + * @constructor + * @param {google.iam.v1.IPolicy=} [properties] Properties to set + */ + function Policy(properties) { + this.bindings = []; + this.auditConfigs = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Policy version. + * @member {number} version + * @memberof google.iam.v1.Policy + * @instance + */ + Policy.prototype.version = 0; + + /** + * Policy bindings. + * @member {Array.} bindings + * @memberof google.iam.v1.Policy + * @instance + */ + Policy.prototype.bindings = $util.emptyArray; + + /** + * Policy auditConfigs. + * @member {Array.} auditConfigs + * @memberof google.iam.v1.Policy + * @instance + */ + Policy.prototype.auditConfigs = $util.emptyArray; + + /** + * Policy etag. + * @member {Uint8Array} etag + * @memberof google.iam.v1.Policy + * @instance + */ + Policy.prototype.etag = $util.newBuffer([]); + + /** + * Creates a new Policy instance using the specified properties. + * @function create + * @memberof google.iam.v1.Policy + * @static + * @param {google.iam.v1.IPolicy=} [properties] Properties to set + * @returns {google.iam.v1.Policy} Policy instance + */ + Policy.create = function create(properties) { + return new Policy(properties); + }; + + /** + * Encodes the specified Policy message. Does not implicitly {@link google.iam.v1.Policy.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.Policy + * @static + * @param {google.iam.v1.IPolicy} message Policy message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Policy.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.version != null && Object.hasOwnProperty.call(message, "version")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.version); + if (message.etag != null && Object.hasOwnProperty.call(message, "etag")) + writer.uint32(/* id 3, wireType 2 =*/26).bytes(message.etag); + if (message.bindings != null && message.bindings.length) + for (var i = 0; i < message.bindings.length; ++i) + $root.google.iam.v1.Binding.encode(message.bindings[i], writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + if (message.auditConfigs != null && message.auditConfigs.length) + for (var i = 0; i < message.auditConfigs.length; ++i) + $root.google.iam.v1.AuditConfig.encode(message.auditConfigs[i], writer.uint32(/* id 6, wireType 2 =*/50).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified Policy message, length delimited. Does not implicitly {@link google.iam.v1.Policy.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.Policy + * @static + * @param {google.iam.v1.IPolicy} message Policy message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Policy.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Policy message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.Policy + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.Policy} Policy + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Policy.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.Policy(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.version = reader.int32(); + break; + } + case 4: { + if (!(message.bindings && message.bindings.length)) + message.bindings = []; + message.bindings.push($root.google.iam.v1.Binding.decode(reader, reader.uint32())); + break; + } + case 6: { + if (!(message.auditConfigs && message.auditConfigs.length)) + message.auditConfigs = []; + message.auditConfigs.push($root.google.iam.v1.AuditConfig.decode(reader, reader.uint32())); + break; + } + case 3: { + message.etag = reader.bytes(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Policy message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.Policy + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.Policy} Policy + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Policy.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Policy message. + * @function verify + * @memberof google.iam.v1.Policy + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Policy.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.version != null && message.hasOwnProperty("version")) + if (!$util.isInteger(message.version)) + return "version: integer expected"; + if (message.bindings != null && message.hasOwnProperty("bindings")) { + if (!Array.isArray(message.bindings)) + return "bindings: array expected"; + for (var i = 0; i < message.bindings.length; ++i) { + var error = $root.google.iam.v1.Binding.verify(message.bindings[i]); + if (error) + return "bindings." + error; + } + } + if (message.auditConfigs != null && message.hasOwnProperty("auditConfigs")) { + if (!Array.isArray(message.auditConfigs)) + return "auditConfigs: array expected"; + for (var i = 0; i < message.auditConfigs.length; ++i) { + var error = $root.google.iam.v1.AuditConfig.verify(message.auditConfigs[i]); + if (error) + return "auditConfigs." + error; + } + } + if (message.etag != null && message.hasOwnProperty("etag")) + if (!(message.etag && typeof message.etag.length === "number" || $util.isString(message.etag))) + return "etag: buffer expected"; + return null; + }; + + /** + * Creates a Policy message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.Policy + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.Policy} Policy + */ + Policy.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.Policy) + return object; + var message = new $root.google.iam.v1.Policy(); + if (object.version != null) + message.version = object.version | 0; + if (object.bindings) { + if (!Array.isArray(object.bindings)) + throw TypeError(".google.iam.v1.Policy.bindings: array expected"); + message.bindings = []; + for (var i = 0; i < object.bindings.length; ++i) { + if (typeof object.bindings[i] !== "object") + throw TypeError(".google.iam.v1.Policy.bindings: object expected"); + message.bindings[i] = $root.google.iam.v1.Binding.fromObject(object.bindings[i]); + } + } + if (object.auditConfigs) { + if (!Array.isArray(object.auditConfigs)) + throw TypeError(".google.iam.v1.Policy.auditConfigs: array expected"); + message.auditConfigs = []; + for (var i = 0; i < object.auditConfigs.length; ++i) { + if (typeof object.auditConfigs[i] !== "object") + throw TypeError(".google.iam.v1.Policy.auditConfigs: object expected"); + message.auditConfigs[i] = $root.google.iam.v1.AuditConfig.fromObject(object.auditConfigs[i]); + } + } + if (object.etag != null) + if (typeof object.etag === "string") + $util.base64.decode(object.etag, message.etag = $util.newBuffer($util.base64.length(object.etag)), 0); + else if (object.etag.length >= 0) + message.etag = object.etag; + return message; + }; + + /** + * Creates a plain object from a Policy message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.Policy + * @static + * @param {google.iam.v1.Policy} message Policy + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Policy.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.bindings = []; + object.auditConfigs = []; + } + if (options.defaults) { + object.version = 0; + if (options.bytes === String) + object.etag = ""; + else { + object.etag = []; + if (options.bytes !== Array) + object.etag = $util.newBuffer(object.etag); + } + } + if (message.version != null && message.hasOwnProperty("version")) + object.version = message.version; + if (message.etag != null && message.hasOwnProperty("etag")) + object.etag = options.bytes === String ? $util.base64.encode(message.etag, 0, message.etag.length) : options.bytes === Array ? Array.prototype.slice.call(message.etag) : message.etag; + if (message.bindings && message.bindings.length) { + object.bindings = []; + for (var j = 0; j < message.bindings.length; ++j) + object.bindings[j] = $root.google.iam.v1.Binding.toObject(message.bindings[j], options); + } + if (message.auditConfigs && message.auditConfigs.length) { + object.auditConfigs = []; + for (var j = 0; j < message.auditConfigs.length; ++j) + object.auditConfigs[j] = $root.google.iam.v1.AuditConfig.toObject(message.auditConfigs[j], options); + } + return object; + }; + + /** + * Converts this Policy to JSON. + * @function toJSON + * @memberof google.iam.v1.Policy + * @instance + * @returns {Object.} JSON object + */ + Policy.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for Policy + * @function getTypeUrl + * @memberof google.iam.v1.Policy + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Policy.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.Policy"; + }; + + return Policy; + })(); + + v1.Binding = (function() { + + /** + * Properties of a Binding. + * @memberof google.iam.v1 + * @interface IBinding + * @property {string|null} [role] Binding role + * @property {Array.|null} [members] Binding members + * @property {google.type.IExpr|null} [condition] Binding condition + */ + + /** + * Constructs a new Binding. + * @memberof google.iam.v1 + * @classdesc Represents a Binding. + * @implements IBinding + * @constructor + * @param {google.iam.v1.IBinding=} [properties] Properties to set + */ + function Binding(properties) { + this.members = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Binding role. + * @member {string} role + * @memberof google.iam.v1.Binding + * @instance + */ + Binding.prototype.role = ""; + + /** + * Binding members. + * @member {Array.} members + * @memberof google.iam.v1.Binding + * @instance + */ + Binding.prototype.members = $util.emptyArray; + + /** + * Binding condition. + * @member {google.type.IExpr|null|undefined} condition + * @memberof google.iam.v1.Binding + * @instance + */ + Binding.prototype.condition = null; + + /** + * Creates a new Binding instance using the specified properties. + * @function create + * @memberof google.iam.v1.Binding + * @static + * @param {google.iam.v1.IBinding=} [properties] Properties to set + * @returns {google.iam.v1.Binding} Binding instance + */ + Binding.create = function create(properties) { + return new Binding(properties); + }; + + /** + * Encodes the specified Binding message. Does not implicitly {@link google.iam.v1.Binding.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.Binding + * @static + * @param {google.iam.v1.IBinding} message Binding message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Binding.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.role != null && Object.hasOwnProperty.call(message, "role")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.role); + if (message.members != null && message.members.length) + for (var i = 0; i < message.members.length; ++i) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.members[i]); + if (message.condition != null && Object.hasOwnProperty.call(message, "condition")) + $root.google.type.Expr.encode(message.condition, writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified Binding message, length delimited. Does not implicitly {@link google.iam.v1.Binding.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.Binding + * @static + * @param {google.iam.v1.IBinding} message Binding message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Binding.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a Binding message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.Binding + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.Binding} Binding + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Binding.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.Binding(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.role = reader.string(); + break; + } + case 2: { + if (!(message.members && message.members.length)) + message.members = []; + message.members.push(reader.string()); + break; + } + case 3: { + message.condition = $root.google.type.Expr.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a Binding message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.Binding + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.Binding} Binding + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Binding.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a Binding message. + * @function verify + * @memberof google.iam.v1.Binding + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Binding.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.role != null && message.hasOwnProperty("role")) + if (!$util.isString(message.role)) + return "role: string expected"; + if (message.members != null && message.hasOwnProperty("members")) { + if (!Array.isArray(message.members)) + return "members: array expected"; + for (var i = 0; i < message.members.length; ++i) + if (!$util.isString(message.members[i])) + return "members: string[] expected"; + } + if (message.condition != null && message.hasOwnProperty("condition")) { + var error = $root.google.type.Expr.verify(message.condition); + if (error) + return "condition." + error; + } + return null; + }; + + /** + * Creates a Binding message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.Binding + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.Binding} Binding + */ + Binding.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.Binding) + return object; + var message = new $root.google.iam.v1.Binding(); + if (object.role != null) + message.role = String(object.role); + if (object.members) { + if (!Array.isArray(object.members)) + throw TypeError(".google.iam.v1.Binding.members: array expected"); + message.members = []; + for (var i = 0; i < object.members.length; ++i) + message.members[i] = String(object.members[i]); + } + if (object.condition != null) { + if (typeof object.condition !== "object") + throw TypeError(".google.iam.v1.Binding.condition: object expected"); + message.condition = $root.google.type.Expr.fromObject(object.condition); + } + return message; + }; + + /** + * Creates a plain object from a Binding message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.Binding + * @static + * @param {google.iam.v1.Binding} message Binding + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Binding.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.members = []; + if (options.defaults) { + object.role = ""; + object.condition = null; + } + if (message.role != null && message.hasOwnProperty("role")) + object.role = message.role; + if (message.members && message.members.length) { + object.members = []; + for (var j = 0; j < message.members.length; ++j) + object.members[j] = message.members[j]; + } + if (message.condition != null && message.hasOwnProperty("condition")) + object.condition = $root.google.type.Expr.toObject(message.condition, options); + return object; + }; + + /** + * Converts this Binding to JSON. + * @function toJSON + * @memberof google.iam.v1.Binding + * @instance + * @returns {Object.} JSON object + */ + Binding.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for Binding + * @function getTypeUrl + * @memberof google.iam.v1.Binding + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Binding.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.Binding"; + }; + + return Binding; + })(); + + v1.AuditConfig = (function() { + + /** + * Properties of an AuditConfig. + * @memberof google.iam.v1 + * @interface IAuditConfig + * @property {string|null} [service] AuditConfig service + * @property {Array.|null} [auditLogConfigs] AuditConfig auditLogConfigs + */ + + /** + * Constructs a new AuditConfig. + * @memberof google.iam.v1 + * @classdesc Represents an AuditConfig. + * @implements IAuditConfig + * @constructor + * @param {google.iam.v1.IAuditConfig=} [properties] Properties to set + */ + function AuditConfig(properties) { + this.auditLogConfigs = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * AuditConfig service. + * @member {string} service + * @memberof google.iam.v1.AuditConfig + * @instance + */ + AuditConfig.prototype.service = ""; + + /** + * AuditConfig auditLogConfigs. + * @member {Array.} auditLogConfigs + * @memberof google.iam.v1.AuditConfig + * @instance + */ + AuditConfig.prototype.auditLogConfigs = $util.emptyArray; + + /** + * Creates a new AuditConfig instance using the specified properties. + * @function create + * @memberof google.iam.v1.AuditConfig + * @static + * @param {google.iam.v1.IAuditConfig=} [properties] Properties to set + * @returns {google.iam.v1.AuditConfig} AuditConfig instance + */ + AuditConfig.create = function create(properties) { + return new AuditConfig(properties); + }; + + /** + * Encodes the specified AuditConfig message. Does not implicitly {@link google.iam.v1.AuditConfig.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.AuditConfig + * @static + * @param {google.iam.v1.IAuditConfig} message AuditConfig message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AuditConfig.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.service != null && Object.hasOwnProperty.call(message, "service")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.service); + if (message.auditLogConfigs != null && message.auditLogConfigs.length) + for (var i = 0; i < message.auditLogConfigs.length; ++i) + $root.google.iam.v1.AuditLogConfig.encode(message.auditLogConfigs[i], writer.uint32(/* id 3, wireType 2 =*/26).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified AuditConfig message, length delimited. Does not implicitly {@link google.iam.v1.AuditConfig.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.AuditConfig + * @static + * @param {google.iam.v1.IAuditConfig} message AuditConfig message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AuditConfig.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an AuditConfig message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.AuditConfig + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.AuditConfig} AuditConfig + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AuditConfig.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.AuditConfig(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.service = reader.string(); + break; + } + case 3: { + if (!(message.auditLogConfigs && message.auditLogConfigs.length)) + message.auditLogConfigs = []; + message.auditLogConfigs.push($root.google.iam.v1.AuditLogConfig.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an AuditConfig message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.AuditConfig + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.AuditConfig} AuditConfig + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AuditConfig.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an AuditConfig message. + * @function verify + * @memberof google.iam.v1.AuditConfig + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + AuditConfig.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.service != null && message.hasOwnProperty("service")) + if (!$util.isString(message.service)) + return "service: string expected"; + if (message.auditLogConfigs != null && message.hasOwnProperty("auditLogConfigs")) { + if (!Array.isArray(message.auditLogConfigs)) + return "auditLogConfigs: array expected"; + for (var i = 0; i < message.auditLogConfigs.length; ++i) { + var error = $root.google.iam.v1.AuditLogConfig.verify(message.auditLogConfigs[i]); + if (error) + return "auditLogConfigs." + error; + } + } + return null; + }; + + /** + * Creates an AuditConfig message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.AuditConfig + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.AuditConfig} AuditConfig + */ + AuditConfig.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.AuditConfig) + return object; + var message = new $root.google.iam.v1.AuditConfig(); + if (object.service != null) + message.service = String(object.service); + if (object.auditLogConfigs) { + if (!Array.isArray(object.auditLogConfigs)) + throw TypeError(".google.iam.v1.AuditConfig.auditLogConfigs: array expected"); + message.auditLogConfigs = []; + for (var i = 0; i < object.auditLogConfigs.length; ++i) { + if (typeof object.auditLogConfigs[i] !== "object") + throw TypeError(".google.iam.v1.AuditConfig.auditLogConfigs: object expected"); + message.auditLogConfigs[i] = $root.google.iam.v1.AuditLogConfig.fromObject(object.auditLogConfigs[i]); + } + } + return message; + }; + + /** + * Creates a plain object from an AuditConfig message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.AuditConfig + * @static + * @param {google.iam.v1.AuditConfig} message AuditConfig + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + AuditConfig.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.auditLogConfigs = []; + if (options.defaults) + object.service = ""; + if (message.service != null && message.hasOwnProperty("service")) + object.service = message.service; + if (message.auditLogConfigs && message.auditLogConfigs.length) { + object.auditLogConfigs = []; + for (var j = 0; j < message.auditLogConfigs.length; ++j) + object.auditLogConfigs[j] = $root.google.iam.v1.AuditLogConfig.toObject(message.auditLogConfigs[j], options); + } + return object; + }; + + /** + * Converts this AuditConfig to JSON. + * @function toJSON + * @memberof google.iam.v1.AuditConfig + * @instance + * @returns {Object.} JSON object + */ + AuditConfig.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for AuditConfig + * @function getTypeUrl + * @memberof google.iam.v1.AuditConfig + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + AuditConfig.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.AuditConfig"; + }; + + return AuditConfig; + })(); + + v1.AuditLogConfig = (function() { + + /** + * Properties of an AuditLogConfig. + * @memberof google.iam.v1 + * @interface IAuditLogConfig + * @property {google.iam.v1.AuditLogConfig.LogType|null} [logType] AuditLogConfig logType + * @property {Array.|null} [exemptedMembers] AuditLogConfig exemptedMembers + */ + + /** + * Constructs a new AuditLogConfig. + * @memberof google.iam.v1 + * @classdesc Represents an AuditLogConfig. + * @implements IAuditLogConfig + * @constructor + * @param {google.iam.v1.IAuditLogConfig=} [properties] Properties to set + */ + function AuditLogConfig(properties) { + this.exemptedMembers = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * AuditLogConfig logType. + * @member {google.iam.v1.AuditLogConfig.LogType} logType + * @memberof google.iam.v1.AuditLogConfig + * @instance + */ + AuditLogConfig.prototype.logType = 0; + + /** + * AuditLogConfig exemptedMembers. + * @member {Array.} exemptedMembers + * @memberof google.iam.v1.AuditLogConfig + * @instance + */ + AuditLogConfig.prototype.exemptedMembers = $util.emptyArray; + + /** + * Creates a new AuditLogConfig instance using the specified properties. + * @function create + * @memberof google.iam.v1.AuditLogConfig + * @static + * @param {google.iam.v1.IAuditLogConfig=} [properties] Properties to set + * @returns {google.iam.v1.AuditLogConfig} AuditLogConfig instance + */ + AuditLogConfig.create = function create(properties) { + return new AuditLogConfig(properties); + }; + + /** + * Encodes the specified AuditLogConfig message. Does not implicitly {@link google.iam.v1.AuditLogConfig.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.AuditLogConfig + * @static + * @param {google.iam.v1.IAuditLogConfig} message AuditLogConfig message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AuditLogConfig.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.logType != null && Object.hasOwnProperty.call(message, "logType")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.logType); + if (message.exemptedMembers != null && message.exemptedMembers.length) + for (var i = 0; i < message.exemptedMembers.length; ++i) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.exemptedMembers[i]); + return writer; + }; + + /** + * Encodes the specified AuditLogConfig message, length delimited. Does not implicitly {@link google.iam.v1.AuditLogConfig.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.AuditLogConfig + * @static + * @param {google.iam.v1.IAuditLogConfig} message AuditLogConfig message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AuditLogConfig.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an AuditLogConfig message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.AuditLogConfig + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.AuditLogConfig} AuditLogConfig + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AuditLogConfig.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.AuditLogConfig(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.logType = reader.int32(); + break; + } + case 2: { + if (!(message.exemptedMembers && message.exemptedMembers.length)) + message.exemptedMembers = []; + message.exemptedMembers.push(reader.string()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an AuditLogConfig message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.AuditLogConfig + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.AuditLogConfig} AuditLogConfig + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AuditLogConfig.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an AuditLogConfig message. + * @function verify + * @memberof google.iam.v1.AuditLogConfig + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + AuditLogConfig.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.logType != null && message.hasOwnProperty("logType")) + switch (message.logType) { + default: + return "logType: enum value expected"; + case 0: + case 1: + case 2: + case 3: + break; + } + if (message.exemptedMembers != null && message.hasOwnProperty("exemptedMembers")) { + if (!Array.isArray(message.exemptedMembers)) + return "exemptedMembers: array expected"; + for (var i = 0; i < message.exemptedMembers.length; ++i) + if (!$util.isString(message.exemptedMembers[i])) + return "exemptedMembers: string[] expected"; + } + return null; + }; + + /** + * Creates an AuditLogConfig message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.AuditLogConfig + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.AuditLogConfig} AuditLogConfig + */ + AuditLogConfig.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.AuditLogConfig) + return object; + var message = new $root.google.iam.v1.AuditLogConfig(); + switch (object.logType) { + default: + if (typeof object.logType === "number") { + message.logType = object.logType; + break; + } + break; + case "LOG_TYPE_UNSPECIFIED": + case 0: + message.logType = 0; + break; + case "ADMIN_READ": + case 1: + message.logType = 1; + break; + case "DATA_WRITE": + case 2: + message.logType = 2; + break; + case "DATA_READ": + case 3: + message.logType = 3; + break; + } + if (object.exemptedMembers) { + if (!Array.isArray(object.exemptedMembers)) + throw TypeError(".google.iam.v1.AuditLogConfig.exemptedMembers: array expected"); + message.exemptedMembers = []; + for (var i = 0; i < object.exemptedMembers.length; ++i) + message.exemptedMembers[i] = String(object.exemptedMembers[i]); + } + return message; + }; + + /** + * Creates a plain object from an AuditLogConfig message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.AuditLogConfig + * @static + * @param {google.iam.v1.AuditLogConfig} message AuditLogConfig + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + AuditLogConfig.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) + object.exemptedMembers = []; + if (options.defaults) + object.logType = options.enums === String ? "LOG_TYPE_UNSPECIFIED" : 0; + if (message.logType != null && message.hasOwnProperty("logType")) + object.logType = options.enums === String ? $root.google.iam.v1.AuditLogConfig.LogType[message.logType] === undefined ? message.logType : $root.google.iam.v1.AuditLogConfig.LogType[message.logType] : message.logType; + if (message.exemptedMembers && message.exemptedMembers.length) { + object.exemptedMembers = []; + for (var j = 0; j < message.exemptedMembers.length; ++j) + object.exemptedMembers[j] = message.exemptedMembers[j]; + } + return object; + }; + + /** + * Converts this AuditLogConfig to JSON. + * @function toJSON + * @memberof google.iam.v1.AuditLogConfig + * @instance + * @returns {Object.} JSON object + */ + AuditLogConfig.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for AuditLogConfig + * @function getTypeUrl + * @memberof google.iam.v1.AuditLogConfig + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + AuditLogConfig.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.AuditLogConfig"; + }; + + /** + * LogType enum. + * @name google.iam.v1.AuditLogConfig.LogType + * @enum {number} + * @property {number} LOG_TYPE_UNSPECIFIED=0 LOG_TYPE_UNSPECIFIED value + * @property {number} ADMIN_READ=1 ADMIN_READ value + * @property {number} DATA_WRITE=2 DATA_WRITE value + * @property {number} DATA_READ=3 DATA_READ value + */ + AuditLogConfig.LogType = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "LOG_TYPE_UNSPECIFIED"] = 0; + values[valuesById[1] = "ADMIN_READ"] = 1; + values[valuesById[2] = "DATA_WRITE"] = 2; + values[valuesById[3] = "DATA_READ"] = 3; + return values; + })(); + + return AuditLogConfig; + })(); + + v1.PolicyDelta = (function() { + + /** + * Properties of a PolicyDelta. + * @memberof google.iam.v1 + * @interface IPolicyDelta + * @property {Array.|null} [bindingDeltas] PolicyDelta bindingDeltas + * @property {Array.|null} [auditConfigDeltas] PolicyDelta auditConfigDeltas + */ + + /** + * Constructs a new PolicyDelta. + * @memberof google.iam.v1 + * @classdesc Represents a PolicyDelta. + * @implements IPolicyDelta + * @constructor + * @param {google.iam.v1.IPolicyDelta=} [properties] Properties to set + */ + function PolicyDelta(properties) { + this.bindingDeltas = []; + this.auditConfigDeltas = []; + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * PolicyDelta bindingDeltas. + * @member {Array.} bindingDeltas + * @memberof google.iam.v1.PolicyDelta + * @instance + */ + PolicyDelta.prototype.bindingDeltas = $util.emptyArray; + + /** + * PolicyDelta auditConfigDeltas. + * @member {Array.} auditConfigDeltas + * @memberof google.iam.v1.PolicyDelta + * @instance + */ + PolicyDelta.prototype.auditConfigDeltas = $util.emptyArray; + + /** + * Creates a new PolicyDelta instance using the specified properties. + * @function create + * @memberof google.iam.v1.PolicyDelta + * @static + * @param {google.iam.v1.IPolicyDelta=} [properties] Properties to set + * @returns {google.iam.v1.PolicyDelta} PolicyDelta instance + */ + PolicyDelta.create = function create(properties) { + return new PolicyDelta(properties); + }; + + /** + * Encodes the specified PolicyDelta message. Does not implicitly {@link google.iam.v1.PolicyDelta.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.PolicyDelta + * @static + * @param {google.iam.v1.IPolicyDelta} message PolicyDelta message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + PolicyDelta.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.bindingDeltas != null && message.bindingDeltas.length) + for (var i = 0; i < message.bindingDeltas.length; ++i) + $root.google.iam.v1.BindingDelta.encode(message.bindingDeltas[i], writer.uint32(/* id 1, wireType 2 =*/10).fork()).ldelim(); + if (message.auditConfigDeltas != null && message.auditConfigDeltas.length) + for (var i = 0; i < message.auditConfigDeltas.length; ++i) + $root.google.iam.v1.AuditConfigDelta.encode(message.auditConfigDeltas[i], writer.uint32(/* id 2, wireType 2 =*/18).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified PolicyDelta message, length delimited. Does not implicitly {@link google.iam.v1.PolicyDelta.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.PolicyDelta + * @static + * @param {google.iam.v1.IPolicyDelta} message PolicyDelta message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + PolicyDelta.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a PolicyDelta message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.PolicyDelta + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.PolicyDelta} PolicyDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + PolicyDelta.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.PolicyDelta(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + if (!(message.bindingDeltas && message.bindingDeltas.length)) + message.bindingDeltas = []; + message.bindingDeltas.push($root.google.iam.v1.BindingDelta.decode(reader, reader.uint32())); + break; + } + case 2: { + if (!(message.auditConfigDeltas && message.auditConfigDeltas.length)) + message.auditConfigDeltas = []; + message.auditConfigDeltas.push($root.google.iam.v1.AuditConfigDelta.decode(reader, reader.uint32())); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a PolicyDelta message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.PolicyDelta + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.PolicyDelta} PolicyDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + PolicyDelta.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a PolicyDelta message. + * @function verify + * @memberof google.iam.v1.PolicyDelta + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + PolicyDelta.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.bindingDeltas != null && message.hasOwnProperty("bindingDeltas")) { + if (!Array.isArray(message.bindingDeltas)) + return "bindingDeltas: array expected"; + for (var i = 0; i < message.bindingDeltas.length; ++i) { + var error = $root.google.iam.v1.BindingDelta.verify(message.bindingDeltas[i]); + if (error) + return "bindingDeltas." + error; + } + } + if (message.auditConfigDeltas != null && message.hasOwnProperty("auditConfigDeltas")) { + if (!Array.isArray(message.auditConfigDeltas)) + return "auditConfigDeltas: array expected"; + for (var i = 0; i < message.auditConfigDeltas.length; ++i) { + var error = $root.google.iam.v1.AuditConfigDelta.verify(message.auditConfigDeltas[i]); + if (error) + return "auditConfigDeltas." + error; + } + } + return null; + }; + + /** + * Creates a PolicyDelta message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.PolicyDelta + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.PolicyDelta} PolicyDelta + */ + PolicyDelta.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.PolicyDelta) + return object; + var message = new $root.google.iam.v1.PolicyDelta(); + if (object.bindingDeltas) { + if (!Array.isArray(object.bindingDeltas)) + throw TypeError(".google.iam.v1.PolicyDelta.bindingDeltas: array expected"); + message.bindingDeltas = []; + for (var i = 0; i < object.bindingDeltas.length; ++i) { + if (typeof object.bindingDeltas[i] !== "object") + throw TypeError(".google.iam.v1.PolicyDelta.bindingDeltas: object expected"); + message.bindingDeltas[i] = $root.google.iam.v1.BindingDelta.fromObject(object.bindingDeltas[i]); + } + } + if (object.auditConfigDeltas) { + if (!Array.isArray(object.auditConfigDeltas)) + throw TypeError(".google.iam.v1.PolicyDelta.auditConfigDeltas: array expected"); + message.auditConfigDeltas = []; + for (var i = 0; i < object.auditConfigDeltas.length; ++i) { + if (typeof object.auditConfigDeltas[i] !== "object") + throw TypeError(".google.iam.v1.PolicyDelta.auditConfigDeltas: object expected"); + message.auditConfigDeltas[i] = $root.google.iam.v1.AuditConfigDelta.fromObject(object.auditConfigDeltas[i]); + } + } + return message; + }; + + /** + * Creates a plain object from a PolicyDelta message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.PolicyDelta + * @static + * @param {google.iam.v1.PolicyDelta} message PolicyDelta + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + PolicyDelta.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.arrays || options.defaults) { + object.bindingDeltas = []; + object.auditConfigDeltas = []; + } + if (message.bindingDeltas && message.bindingDeltas.length) { + object.bindingDeltas = []; + for (var j = 0; j < message.bindingDeltas.length; ++j) + object.bindingDeltas[j] = $root.google.iam.v1.BindingDelta.toObject(message.bindingDeltas[j], options); + } + if (message.auditConfigDeltas && message.auditConfigDeltas.length) { + object.auditConfigDeltas = []; + for (var j = 0; j < message.auditConfigDeltas.length; ++j) + object.auditConfigDeltas[j] = $root.google.iam.v1.AuditConfigDelta.toObject(message.auditConfigDeltas[j], options); + } + return object; + }; + + /** + * Converts this PolicyDelta to JSON. + * @function toJSON + * @memberof google.iam.v1.PolicyDelta + * @instance + * @returns {Object.} JSON object + */ + PolicyDelta.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for PolicyDelta + * @function getTypeUrl + * @memberof google.iam.v1.PolicyDelta + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + PolicyDelta.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.PolicyDelta"; + }; + + return PolicyDelta; + })(); + + v1.BindingDelta = (function() { + + /** + * Properties of a BindingDelta. + * @memberof google.iam.v1 + * @interface IBindingDelta + * @property {google.iam.v1.BindingDelta.Action|null} [action] BindingDelta action + * @property {string|null} [role] BindingDelta role + * @property {string|null} [member] BindingDelta member + * @property {google.type.IExpr|null} [condition] BindingDelta condition + */ + + /** + * Constructs a new BindingDelta. + * @memberof google.iam.v1 + * @classdesc Represents a BindingDelta. + * @implements IBindingDelta + * @constructor + * @param {google.iam.v1.IBindingDelta=} [properties] Properties to set + */ + function BindingDelta(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * BindingDelta action. + * @member {google.iam.v1.BindingDelta.Action} action + * @memberof google.iam.v1.BindingDelta + * @instance + */ + BindingDelta.prototype.action = 0; + + /** + * BindingDelta role. + * @member {string} role + * @memberof google.iam.v1.BindingDelta + * @instance + */ + BindingDelta.prototype.role = ""; + + /** + * BindingDelta member. + * @member {string} member + * @memberof google.iam.v1.BindingDelta + * @instance + */ + BindingDelta.prototype.member = ""; + + /** + * BindingDelta condition. + * @member {google.type.IExpr|null|undefined} condition + * @memberof google.iam.v1.BindingDelta + * @instance + */ + BindingDelta.prototype.condition = null; + + /** + * Creates a new BindingDelta instance using the specified properties. + * @function create + * @memberof google.iam.v1.BindingDelta + * @static + * @param {google.iam.v1.IBindingDelta=} [properties] Properties to set + * @returns {google.iam.v1.BindingDelta} BindingDelta instance + */ + BindingDelta.create = function create(properties) { + return new BindingDelta(properties); + }; + + /** + * Encodes the specified BindingDelta message. Does not implicitly {@link google.iam.v1.BindingDelta.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.BindingDelta + * @static + * @param {google.iam.v1.IBindingDelta} message BindingDelta message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + BindingDelta.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.action != null && Object.hasOwnProperty.call(message, "action")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.action); + if (message.role != null && Object.hasOwnProperty.call(message, "role")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.role); + if (message.member != null && Object.hasOwnProperty.call(message, "member")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.member); + if (message.condition != null && Object.hasOwnProperty.call(message, "condition")) + $root.google.type.Expr.encode(message.condition, writer.uint32(/* id 4, wireType 2 =*/34).fork()).ldelim(); + return writer; + }; + + /** + * Encodes the specified BindingDelta message, length delimited. Does not implicitly {@link google.iam.v1.BindingDelta.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.BindingDelta + * @static + * @param {google.iam.v1.IBindingDelta} message BindingDelta message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + BindingDelta.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes a BindingDelta message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.BindingDelta + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.BindingDelta} BindingDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + BindingDelta.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.BindingDelta(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.action = reader.int32(); + break; + } + case 2: { + message.role = reader.string(); + break; + } + case 3: { + message.member = reader.string(); + break; + } + case 4: { + message.condition = $root.google.type.Expr.decode(reader, reader.uint32()); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes a BindingDelta message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.BindingDelta + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.BindingDelta} BindingDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + BindingDelta.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies a BindingDelta message. + * @function verify + * @memberof google.iam.v1.BindingDelta + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + BindingDelta.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.action != null && message.hasOwnProperty("action")) + switch (message.action) { + default: + return "action: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.role != null && message.hasOwnProperty("role")) + if (!$util.isString(message.role)) + return "role: string expected"; + if (message.member != null && message.hasOwnProperty("member")) + if (!$util.isString(message.member)) + return "member: string expected"; + if (message.condition != null && message.hasOwnProperty("condition")) { + var error = $root.google.type.Expr.verify(message.condition); + if (error) + return "condition." + error; + } + return null; + }; + + /** + * Creates a BindingDelta message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.BindingDelta + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.BindingDelta} BindingDelta + */ + BindingDelta.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.BindingDelta) + return object; + var message = new $root.google.iam.v1.BindingDelta(); + switch (object.action) { + default: + if (typeof object.action === "number") { + message.action = object.action; + break; + } + break; + case "ACTION_UNSPECIFIED": + case 0: + message.action = 0; + break; + case "ADD": + case 1: + message.action = 1; + break; + case "REMOVE": + case 2: + message.action = 2; + break; + } + if (object.role != null) + message.role = String(object.role); + if (object.member != null) + message.member = String(object.member); + if (object.condition != null) { + if (typeof object.condition !== "object") + throw TypeError(".google.iam.v1.BindingDelta.condition: object expected"); + message.condition = $root.google.type.Expr.fromObject(object.condition); + } + return message; + }; + + /** + * Creates a plain object from a BindingDelta message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.BindingDelta + * @static + * @param {google.iam.v1.BindingDelta} message BindingDelta + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + BindingDelta.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.action = options.enums === String ? "ACTION_UNSPECIFIED" : 0; + object.role = ""; + object.member = ""; + object.condition = null; + } + if (message.action != null && message.hasOwnProperty("action")) + object.action = options.enums === String ? $root.google.iam.v1.BindingDelta.Action[message.action] === undefined ? message.action : $root.google.iam.v1.BindingDelta.Action[message.action] : message.action; + if (message.role != null && message.hasOwnProperty("role")) + object.role = message.role; + if (message.member != null && message.hasOwnProperty("member")) + object.member = message.member; + if (message.condition != null && message.hasOwnProperty("condition")) + object.condition = $root.google.type.Expr.toObject(message.condition, options); + return object; + }; + + /** + * Converts this BindingDelta to JSON. + * @function toJSON + * @memberof google.iam.v1.BindingDelta + * @instance + * @returns {Object.} JSON object + */ + BindingDelta.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for BindingDelta + * @function getTypeUrl + * @memberof google.iam.v1.BindingDelta + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + BindingDelta.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.BindingDelta"; + }; + + /** + * Action enum. + * @name google.iam.v1.BindingDelta.Action + * @enum {number} + * @property {number} ACTION_UNSPECIFIED=0 ACTION_UNSPECIFIED value + * @property {number} ADD=1 ADD value + * @property {number} REMOVE=2 REMOVE value + */ + BindingDelta.Action = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "ACTION_UNSPECIFIED"] = 0; + values[valuesById[1] = "ADD"] = 1; + values[valuesById[2] = "REMOVE"] = 2; + return values; + })(); + + return BindingDelta; + })(); + + v1.AuditConfigDelta = (function() { + + /** + * Properties of an AuditConfigDelta. + * @memberof google.iam.v1 + * @interface IAuditConfigDelta + * @property {google.iam.v1.AuditConfigDelta.Action|null} [action] AuditConfigDelta action + * @property {string|null} [service] AuditConfigDelta service + * @property {string|null} [exemptedMember] AuditConfigDelta exemptedMember + * @property {string|null} [logType] AuditConfigDelta logType + */ + + /** + * Constructs a new AuditConfigDelta. + * @memberof google.iam.v1 + * @classdesc Represents an AuditConfigDelta. + * @implements IAuditConfigDelta + * @constructor + * @param {google.iam.v1.IAuditConfigDelta=} [properties] Properties to set + */ + function AuditConfigDelta(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * AuditConfigDelta action. + * @member {google.iam.v1.AuditConfigDelta.Action} action + * @memberof google.iam.v1.AuditConfigDelta + * @instance + */ + AuditConfigDelta.prototype.action = 0; + + /** + * AuditConfigDelta service. + * @member {string} service + * @memberof google.iam.v1.AuditConfigDelta + * @instance + */ + AuditConfigDelta.prototype.service = ""; + + /** + * AuditConfigDelta exemptedMember. + * @member {string} exemptedMember + * @memberof google.iam.v1.AuditConfigDelta + * @instance + */ + AuditConfigDelta.prototype.exemptedMember = ""; + + /** + * AuditConfigDelta logType. + * @member {string} logType + * @memberof google.iam.v1.AuditConfigDelta + * @instance + */ + AuditConfigDelta.prototype.logType = ""; + + /** + * Creates a new AuditConfigDelta instance using the specified properties. + * @function create + * @memberof google.iam.v1.AuditConfigDelta + * @static + * @param {google.iam.v1.IAuditConfigDelta=} [properties] Properties to set + * @returns {google.iam.v1.AuditConfigDelta} AuditConfigDelta instance + */ + AuditConfigDelta.create = function create(properties) { + return new AuditConfigDelta(properties); + }; + + /** + * Encodes the specified AuditConfigDelta message. Does not implicitly {@link google.iam.v1.AuditConfigDelta.verify|verify} messages. + * @function encode + * @memberof google.iam.v1.AuditConfigDelta + * @static + * @param {google.iam.v1.IAuditConfigDelta} message AuditConfigDelta message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AuditConfigDelta.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.action != null && Object.hasOwnProperty.call(message, "action")) + writer.uint32(/* id 1, wireType 0 =*/8).int32(message.action); + if (message.service != null && Object.hasOwnProperty.call(message, "service")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.service); + if (message.exemptedMember != null && Object.hasOwnProperty.call(message, "exemptedMember")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.exemptedMember); + if (message.logType != null && Object.hasOwnProperty.call(message, "logType")) + writer.uint32(/* id 4, wireType 2 =*/34).string(message.logType); + return writer; + }; + + /** + * Encodes the specified AuditConfigDelta message, length delimited. Does not implicitly {@link google.iam.v1.AuditConfigDelta.verify|verify} messages. + * @function encodeDelimited + * @memberof google.iam.v1.AuditConfigDelta + * @static + * @param {google.iam.v1.IAuditConfigDelta} message AuditConfigDelta message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + AuditConfigDelta.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an AuditConfigDelta message from the specified reader or buffer. + * @function decode + * @memberof google.iam.v1.AuditConfigDelta + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.iam.v1.AuditConfigDelta} AuditConfigDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AuditConfigDelta.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.iam.v1.AuditConfigDelta(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.action = reader.int32(); + break; + } + case 2: { + message.service = reader.string(); + break; + } + case 3: { + message.exemptedMember = reader.string(); + break; + } + case 4: { + message.logType = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an AuditConfigDelta message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.iam.v1.AuditConfigDelta + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.iam.v1.AuditConfigDelta} AuditConfigDelta + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + AuditConfigDelta.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an AuditConfigDelta message. + * @function verify + * @memberof google.iam.v1.AuditConfigDelta + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + AuditConfigDelta.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.action != null && message.hasOwnProperty("action")) + switch (message.action) { + default: + return "action: enum value expected"; + case 0: + case 1: + case 2: + break; + } + if (message.service != null && message.hasOwnProperty("service")) + if (!$util.isString(message.service)) + return "service: string expected"; + if (message.exemptedMember != null && message.hasOwnProperty("exemptedMember")) + if (!$util.isString(message.exemptedMember)) + return "exemptedMember: string expected"; + if (message.logType != null && message.hasOwnProperty("logType")) + if (!$util.isString(message.logType)) + return "logType: string expected"; + return null; + }; + + /** + * Creates an AuditConfigDelta message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.iam.v1.AuditConfigDelta + * @static + * @param {Object.} object Plain object + * @returns {google.iam.v1.AuditConfigDelta} AuditConfigDelta + */ + AuditConfigDelta.fromObject = function fromObject(object) { + if (object instanceof $root.google.iam.v1.AuditConfigDelta) + return object; + var message = new $root.google.iam.v1.AuditConfigDelta(); + switch (object.action) { + default: + if (typeof object.action === "number") { + message.action = object.action; + break; + } + break; + case "ACTION_UNSPECIFIED": + case 0: + message.action = 0; + break; + case "ADD": + case 1: + message.action = 1; + break; + case "REMOVE": + case 2: + message.action = 2; + break; + } + if (object.service != null) + message.service = String(object.service); + if (object.exemptedMember != null) + message.exemptedMember = String(object.exemptedMember); + if (object.logType != null) + message.logType = String(object.logType); + return message; + }; + + /** + * Creates a plain object from an AuditConfigDelta message. Also converts values to other types if specified. + * @function toObject + * @memberof google.iam.v1.AuditConfigDelta + * @static + * @param {google.iam.v1.AuditConfigDelta} message AuditConfigDelta + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + AuditConfigDelta.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.action = options.enums === String ? "ACTION_UNSPECIFIED" : 0; + object.service = ""; + object.exemptedMember = ""; + object.logType = ""; + } + if (message.action != null && message.hasOwnProperty("action")) + object.action = options.enums === String ? $root.google.iam.v1.AuditConfigDelta.Action[message.action] === undefined ? message.action : $root.google.iam.v1.AuditConfigDelta.Action[message.action] : message.action; + if (message.service != null && message.hasOwnProperty("service")) + object.service = message.service; + if (message.exemptedMember != null && message.hasOwnProperty("exemptedMember")) + object.exemptedMember = message.exemptedMember; + if (message.logType != null && message.hasOwnProperty("logType")) + object.logType = message.logType; + return object; + }; + + /** + * Converts this AuditConfigDelta to JSON. + * @function toJSON + * @memberof google.iam.v1.AuditConfigDelta + * @instance + * @returns {Object.} JSON object + */ + AuditConfigDelta.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for AuditConfigDelta + * @function getTypeUrl + * @memberof google.iam.v1.AuditConfigDelta + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + AuditConfigDelta.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.iam.v1.AuditConfigDelta"; + }; + + /** + * Action enum. + * @name google.iam.v1.AuditConfigDelta.Action + * @enum {number} + * @property {number} ACTION_UNSPECIFIED=0 ACTION_UNSPECIFIED value + * @property {number} ADD=1 ADD value + * @property {number} REMOVE=2 REMOVE value + */ + AuditConfigDelta.Action = (function() { + var valuesById = {}, values = Object.create(valuesById); + values[valuesById[0] = "ACTION_UNSPECIFIED"] = 0; + values[valuesById[1] = "ADD"] = 1; + values[valuesById[2] = "REMOVE"] = 2; + return values; + })(); + + return AuditConfigDelta; + })(); + + return v1; + })(); + + return iam; + })(); + + google.type = (function() { + + /** + * Namespace type. + * @memberof google + * @namespace + */ + var type = {}; + + type.Expr = (function() { + + /** + * Properties of an Expr. + * @memberof google.type + * @interface IExpr + * @property {string|null} [expression] Expr expression + * @property {string|null} [title] Expr title + * @property {string|null} [description] Expr description + * @property {string|null} [location] Expr location + */ + + /** + * Constructs a new Expr. + * @memberof google.type + * @classdesc Represents an Expr. + * @implements IExpr + * @constructor + * @param {google.type.IExpr=} [properties] Properties to set + */ + function Expr(properties) { + if (properties) + for (var keys = Object.keys(properties), i = 0; i < keys.length; ++i) + if (properties[keys[i]] != null) + this[keys[i]] = properties[keys[i]]; + } + + /** + * Expr expression. + * @member {string} expression + * @memberof google.type.Expr + * @instance + */ + Expr.prototype.expression = ""; + + /** + * Expr title. + * @member {string} title + * @memberof google.type.Expr + * @instance + */ + Expr.prototype.title = ""; + + /** + * Expr description. + * @member {string} description + * @memberof google.type.Expr + * @instance + */ + Expr.prototype.description = ""; + + /** + * Expr location. + * @member {string} location + * @memberof google.type.Expr + * @instance + */ + Expr.prototype.location = ""; + + /** + * Creates a new Expr instance using the specified properties. + * @function create + * @memberof google.type.Expr + * @static + * @param {google.type.IExpr=} [properties] Properties to set + * @returns {google.type.Expr} Expr instance + */ + Expr.create = function create(properties) { + return new Expr(properties); + }; + + /** + * Encodes the specified Expr message. Does not implicitly {@link google.type.Expr.verify|verify} messages. + * @function encode + * @memberof google.type.Expr + * @static + * @param {google.type.IExpr} message Expr message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Expr.encode = function encode(message, writer) { + if (!writer) + writer = $Writer.create(); + if (message.expression != null && Object.hasOwnProperty.call(message, "expression")) + writer.uint32(/* id 1, wireType 2 =*/10).string(message.expression); + if (message.title != null && Object.hasOwnProperty.call(message, "title")) + writer.uint32(/* id 2, wireType 2 =*/18).string(message.title); + if (message.description != null && Object.hasOwnProperty.call(message, "description")) + writer.uint32(/* id 3, wireType 2 =*/26).string(message.description); + if (message.location != null && Object.hasOwnProperty.call(message, "location")) + writer.uint32(/* id 4, wireType 2 =*/34).string(message.location); + return writer; + }; + + /** + * Encodes the specified Expr message, length delimited. Does not implicitly {@link google.type.Expr.verify|verify} messages. + * @function encodeDelimited + * @memberof google.type.Expr + * @static + * @param {google.type.IExpr} message Expr message or plain object to encode + * @param {$protobuf.Writer} [writer] Writer to encode to + * @returns {$protobuf.Writer} Writer + */ + Expr.encodeDelimited = function encodeDelimited(message, writer) { + return this.encode(message, writer).ldelim(); + }; + + /** + * Decodes an Expr message from the specified reader or buffer. + * @function decode + * @memberof google.type.Expr + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @param {number} [length] Message length if known beforehand + * @returns {google.type.Expr} Expr + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Expr.decode = function decode(reader, length) { + if (!(reader instanceof $Reader)) + reader = $Reader.create(reader); + var end = length === undefined ? reader.len : reader.pos + length, message = new $root.google.type.Expr(); + while (reader.pos < end) { + var tag = reader.uint32(); + switch (tag >>> 3) { + case 1: { + message.expression = reader.string(); + break; + } + case 2: { + message.title = reader.string(); + break; + } + case 3: { + message.description = reader.string(); + break; + } + case 4: { + message.location = reader.string(); + break; + } + default: + reader.skipType(tag & 7); + break; + } + } + return message; + }; + + /** + * Decodes an Expr message from the specified reader or buffer, length delimited. + * @function decodeDelimited + * @memberof google.type.Expr + * @static + * @param {$protobuf.Reader|Uint8Array} reader Reader or buffer to decode from + * @returns {google.type.Expr} Expr + * @throws {Error} If the payload is not a reader or valid buffer + * @throws {$protobuf.util.ProtocolError} If required fields are missing + */ + Expr.decodeDelimited = function decodeDelimited(reader) { + if (!(reader instanceof $Reader)) + reader = new $Reader(reader); + return this.decode(reader, reader.uint32()); + }; + + /** + * Verifies an Expr message. + * @function verify + * @memberof google.type.Expr + * @static + * @param {Object.} message Plain object to verify + * @returns {string|null} `null` if valid, otherwise the reason why it is not + */ + Expr.verify = function verify(message) { + if (typeof message !== "object" || message === null) + return "object expected"; + if (message.expression != null && message.hasOwnProperty("expression")) + if (!$util.isString(message.expression)) + return "expression: string expected"; + if (message.title != null && message.hasOwnProperty("title")) + if (!$util.isString(message.title)) + return "title: string expected"; + if (message.description != null && message.hasOwnProperty("description")) + if (!$util.isString(message.description)) + return "description: string expected"; + if (message.location != null && message.hasOwnProperty("location")) + if (!$util.isString(message.location)) + return "location: string expected"; + return null; + }; + + /** + * Creates an Expr message from a plain object. Also converts values to their respective internal types. + * @function fromObject + * @memberof google.type.Expr + * @static + * @param {Object.} object Plain object + * @returns {google.type.Expr} Expr + */ + Expr.fromObject = function fromObject(object) { + if (object instanceof $root.google.type.Expr) + return object; + var message = new $root.google.type.Expr(); + if (object.expression != null) + message.expression = String(object.expression); + if (object.title != null) + message.title = String(object.title); + if (object.description != null) + message.description = String(object.description); + if (object.location != null) + message.location = String(object.location); + return message; + }; + + /** + * Creates a plain object from an Expr message. Also converts values to other types if specified. + * @function toObject + * @memberof google.type.Expr + * @static + * @param {google.type.Expr} message Expr + * @param {$protobuf.IConversionOptions} [options] Conversion options + * @returns {Object.} Plain object + */ + Expr.toObject = function toObject(message, options) { + if (!options) + options = {}; + var object = {}; + if (options.defaults) { + object.expression = ""; + object.title = ""; + object.description = ""; + object.location = ""; + } + if (message.expression != null && message.hasOwnProperty("expression")) + object.expression = message.expression; + if (message.title != null && message.hasOwnProperty("title")) + object.title = message.title; + if (message.description != null && message.hasOwnProperty("description")) + object.description = message.description; + if (message.location != null && message.hasOwnProperty("location")) + object.location = message.location; + return object; + }; + + /** + * Converts this Expr to JSON. + * @function toJSON + * @memberof google.type.Expr + * @instance + * @returns {Object.} JSON object + */ + Expr.prototype.toJSON = function toJSON() { + return this.constructor.toObject(this, $protobuf.util.toJSONOptions); + }; + + /** + * Gets the default type url for Expr + * @function getTypeUrl + * @memberof google.type.Expr + * @static + * @param {string} [typeUrlPrefix] your custom typeUrlPrefix(default "type.googleapis.com") + * @returns {string} The default type url + */ + Expr.getTypeUrl = function getTypeUrl(typeUrlPrefix) { + if (typeUrlPrefix === undefined) { + typeUrlPrefix = "type.googleapis.com"; + } + return typeUrlPrefix + "/google.type.Expr"; + }; + + return Expr; + })(); + + return type; + })(); + + return google; + })(); + + return $root; +}); diff --git a/packages/google-cloud-bigquery-connection/protos/protos.json b/packages/google-cloud-bigquery-connection/protos/protos.json new file mode 100644 index 00000000000..bb0483a1648 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/protos/protos.json @@ -0,0 +1,2033 @@ +{ + "nested": { + "google": { + "nested": { + "cloud": { + "nested": { + "bigquery": { + "nested": { + "connection": { + "nested": { + "v1": { + "options": { + "csharp_namespace": "Google.Cloud.BigQuery.Connection.V1", + "go_package": "google.golang.org/genproto/googleapis/cloud/bigquery/connection/v1;connection", + "java_multiple_files": true, + "java_package": "com.google.cloud.bigquery.connection.v1", + "php_namespace": "Google\\Cloud\\BigQuery\\Connection\\V1" + }, + "nested": { + "ConnectionService": { + "options": { + "(google.api.default_host)": "bigqueryconnection.googleapis.com", + "(google.api.oauth_scopes)": "https://www.googleapis.com/auth/bigquery,https://www.googleapis.com/auth/cloud-platform" + }, + "methods": { + "CreateConnection": { + "requestType": "CreateConnectionRequest", + "responseType": "Connection", + "options": { + "(google.api.http).post": "/v1/{parent=projects/*/locations/*}/connections", + "(google.api.http).body": "connection", + "(google.api.method_signature)": "parent,connection,connection_id" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "post": "/v1/{parent=projects/*/locations/*}/connections", + "body": "connection" + } + }, + { + "(google.api.method_signature)": "parent,connection,connection_id" + } + ] + }, + "GetConnection": { + "requestType": "GetConnectionRequest", + "responseType": "Connection", + "options": { + "(google.api.http).get": "/v1/{name=projects/*/locations/*/connections/*}", + "(google.api.method_signature)": "name" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "get": "/v1/{name=projects/*/locations/*/connections/*}" + } + }, + { + "(google.api.method_signature)": "name" + } + ] + }, + "ListConnections": { + "requestType": "ListConnectionsRequest", + "responseType": "ListConnectionsResponse", + "options": { + "(google.api.http).get": "/v1/{parent=projects/*/locations/*}/connections", + "(google.api.method_signature)": "parent" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "get": "/v1/{parent=projects/*/locations/*}/connections" + } + }, + { + "(google.api.method_signature)": "parent" + } + ] + }, + "UpdateConnection": { + "requestType": "UpdateConnectionRequest", + "responseType": "Connection", + "options": { + "(google.api.http).patch": "/v1/{name=projects/*/locations/*/connections/*}", + "(google.api.http).body": "connection", + "(google.api.method_signature)": "name,connection,update_mask" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "patch": "/v1/{name=projects/*/locations/*/connections/*}", + "body": "connection" + } + }, + { + "(google.api.method_signature)": "name,connection,update_mask" + } + ] + }, + "DeleteConnection": { + "requestType": "DeleteConnectionRequest", + "responseType": "google.protobuf.Empty", + "options": { + "(google.api.http).delete": "/v1/{name=projects/*/locations/*/connections/*}", + "(google.api.method_signature)": "name" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "delete": "/v1/{name=projects/*/locations/*/connections/*}" + } + }, + { + "(google.api.method_signature)": "name" + } + ] + }, + "GetIamPolicy": { + "requestType": "google.iam.v1.GetIamPolicyRequest", + "responseType": "google.iam.v1.Policy", + "options": { + "(google.api.http).post": "/v1/{resource=projects/*/locations/*/connections/*}:getIamPolicy", + "(google.api.http).body": "*", + "(google.api.method_signature)": "resource,options" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "post": "/v1/{resource=projects/*/locations/*/connections/*}:getIamPolicy", + "body": "*" + } + }, + { + "(google.api.method_signature)": "resource,options" + } + ] + }, + "SetIamPolicy": { + "requestType": "google.iam.v1.SetIamPolicyRequest", + "responseType": "google.iam.v1.Policy", + "options": { + "(google.api.http).post": "/v1/{resource=projects/*/locations/*/connections/*}:setIamPolicy", + "(google.api.http).body": "*", + "(google.api.method_signature)": "resource,policy" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "post": "/v1/{resource=projects/*/locations/*/connections/*}:setIamPolicy", + "body": "*" + } + }, + { + "(google.api.method_signature)": "resource,policy" + } + ] + }, + "TestIamPermissions": { + "requestType": "google.iam.v1.TestIamPermissionsRequest", + "responseType": "google.iam.v1.TestIamPermissionsResponse", + "options": { + "(google.api.http).post": "/v1/{resource=projects/*/locations/*/connections/*}:testIamPermissions", + "(google.api.http).body": "*", + "(google.api.method_signature)": "resource,permissions" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "post": "/v1/{resource=projects/*/locations/*/connections/*}:testIamPermissions", + "body": "*" + } + }, + { + "(google.api.method_signature)": "resource,permissions" + } + ] + } + } + }, + "CreateConnectionRequest": { + "fields": { + "parent": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "REQUIRED", + "(google.api.resource_reference).type": "locations.googleapis.com/Location" + } + }, + "connectionId": { + "type": "string", + "id": 2, + "options": { + "(google.api.field_behavior)": "OPTIONAL" + } + }, + "connection": { + "type": "Connection", + "id": 3, + "options": { + "(google.api.field_behavior)": "REQUIRED" + } + } + } + }, + "GetConnectionRequest": { + "fields": { + "name": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "REQUIRED", + "(google.api.resource_reference).type": "bigqueryconnection.googleapis.com/Connection" + } + } + } + }, + "ListConnectionsRequest": { + "fields": { + "parent": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "REQUIRED", + "(google.api.resource_reference).type": "locations.googleapis.com/Location" + } + }, + "pageSize": { + "type": "int32", + "id": 4, + "options": { + "(google.api.field_behavior)": "REQUIRED" + } + }, + "pageToken": { + "type": "string", + "id": 3 + } + } + }, + "ListConnectionsResponse": { + "fields": { + "nextPageToken": { + "type": "string", + "id": 1 + }, + "connections": { + "rule": "repeated", + "type": "Connection", + "id": 2 + } + } + }, + "UpdateConnectionRequest": { + "fields": { + "name": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "REQUIRED", + "(google.api.resource_reference).type": "bigqueryconnection.googleapis.com/Connection" + } + }, + "connection": { + "type": "Connection", + "id": 2, + "options": { + "(google.api.field_behavior)": "REQUIRED" + } + }, + "updateMask": { + "type": "google.protobuf.FieldMask", + "id": 3, + "options": { + "(google.api.field_behavior)": "REQUIRED" + } + } + } + }, + "DeleteConnectionRequest": { + "fields": { + "name": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "REQUIRED", + "(google.api.resource_reference).type": "bigqueryconnection.googleapis.com/Connection" + } + } + } + }, + "Connection": { + "options": { + "(google.api.resource).type": "bigqueryconnection.googleapis.com/Connection", + "(google.api.resource).pattern": "projects/{project}/locations/{location}/connections/{connection}" + }, + "oneofs": { + "properties": { + "oneof": [ + "cloudSql", + "aws", + "azure", + "cloudSpanner", + "cloudResource" + ] + } + }, + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "friendlyName": { + "type": "string", + "id": 2 + }, + "description": { + "type": "string", + "id": 3 + }, + "cloudSql": { + "type": "CloudSqlProperties", + "id": 4 + }, + "aws": { + "type": "AwsProperties", + "id": 8 + }, + "azure": { + "type": "AzureProperties", + "id": 11 + }, + "cloudSpanner": { + "type": "CloudSpannerProperties", + "id": 21 + }, + "cloudResource": { + "type": "CloudResourceProperties", + "id": 22 + }, + "creationTime": { + "type": "int64", + "id": 5, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + }, + "lastModifiedTime": { + "type": "int64", + "id": 6, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + }, + "hasCredential": { + "type": "bool", + "id": 7, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + } + } + }, + "CloudSqlProperties": { + "fields": { + "instanceId": { + "type": "string", + "id": 1 + }, + "database": { + "type": "string", + "id": 2 + }, + "type": { + "type": "DatabaseType", + "id": 3 + }, + "credential": { + "type": "CloudSqlCredential", + "id": 4, + "options": { + "(google.api.field_behavior)": "INPUT_ONLY" + } + }, + "serviceAccountId": { + "type": "string", + "id": 5, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + } + }, + "nested": { + "DatabaseType": { + "values": { + "DATABASE_TYPE_UNSPECIFIED": 0, + "POSTGRES": 1, + "MYSQL": 2 + } + } + } + }, + "CloudSqlCredential": { + "fields": { + "username": { + "type": "string", + "id": 1 + }, + "password": { + "type": "string", + "id": 2 + } + } + }, + "CloudSpannerProperties": { + "fields": { + "database": { + "type": "string", + "id": 1 + }, + "useParallelism": { + "type": "bool", + "id": 2 + } + } + }, + "AwsProperties": { + "oneofs": { + "authenticationMethod": { + "oneof": [ + "crossAccountRole", + "accessRole" + ] + } + }, + "fields": { + "crossAccountRole": { + "type": "AwsCrossAccountRole", + "id": 2, + "options": { + "deprecated": true + } + }, + "accessRole": { + "type": "AwsAccessRole", + "id": 3 + } + } + }, + "AwsCrossAccountRole": { + "fields": { + "iamRoleId": { + "type": "string", + "id": 1 + }, + "iamUserId": { + "type": "string", + "id": 2, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + }, + "externalId": { + "type": "string", + "id": 3, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + } + } + }, + "AwsAccessRole": { + "fields": { + "iamRoleId": { + "type": "string", + "id": 1 + }, + "identity": { + "type": "string", + "id": 2 + } + } + }, + "AzureProperties": { + "fields": { + "application": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + }, + "clientId": { + "type": "string", + "id": 2, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + }, + "objectId": { + "type": "string", + "id": 3, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + }, + "customerTenantId": { + "type": "string", + "id": 4 + }, + "redirectUri": { + "type": "string", + "id": 5 + }, + "federatedApplicationClientId": { + "type": "string", + "id": 6 + }, + "identity": { + "type": "string", + "id": 7, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + } + } + }, + "CloudResourceProperties": { + "fields": { + "serviceAccountId": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "OUTPUT_ONLY" + } + } + } + } + } + } + } + } + } + } + } + }, + "api": { + "options": { + "go_package": "google.golang.org/genproto/googleapis/api/annotations;annotations", + "java_multiple_files": true, + "java_outer_classname": "ResourceProto", + "java_package": "com.google.api", + "objc_class_prefix": "GAPI", + "cc_enable_arenas": true + }, + "nested": { + "http": { + "type": "HttpRule", + "id": 72295728, + "extend": "google.protobuf.MethodOptions" + }, + "Http": { + "fields": { + "rules": { + "rule": "repeated", + "type": "HttpRule", + "id": 1 + }, + "fullyDecodeReservedExpansion": { + "type": "bool", + "id": 2 + } + } + }, + "HttpRule": { + "oneofs": { + "pattern": { + "oneof": [ + "get", + "put", + "post", + "delete", + "patch", + "custom" + ] + } + }, + "fields": { + "selector": { + "type": "string", + "id": 1 + }, + "get": { + "type": "string", + "id": 2 + }, + "put": { + "type": "string", + "id": 3 + }, + "post": { + "type": "string", + "id": 4 + }, + "delete": { + "type": "string", + "id": 5 + }, + "patch": { + "type": "string", + "id": 6 + }, + "custom": { + "type": "CustomHttpPattern", + "id": 8 + }, + "body": { + "type": "string", + "id": 7 + }, + "responseBody": { + "type": "string", + "id": 12 + }, + "additionalBindings": { + "rule": "repeated", + "type": "HttpRule", + "id": 11 + } + } + }, + "CustomHttpPattern": { + "fields": { + "kind": { + "type": "string", + "id": 1 + }, + "path": { + "type": "string", + "id": 2 + } + } + }, + "methodSignature": { + "rule": "repeated", + "type": "string", + "id": 1051, + "extend": "google.protobuf.MethodOptions" + }, + "defaultHost": { + "type": "string", + "id": 1049, + "extend": "google.protobuf.ServiceOptions" + }, + "oauthScopes": { + "type": "string", + "id": 1050, + "extend": "google.protobuf.ServiceOptions" + }, + "fieldBehavior": { + "rule": "repeated", + "type": "google.api.FieldBehavior", + "id": 1052, + "extend": "google.protobuf.FieldOptions" + }, + "FieldBehavior": { + "values": { + "FIELD_BEHAVIOR_UNSPECIFIED": 0, + "OPTIONAL": 1, + "REQUIRED": 2, + "OUTPUT_ONLY": 3, + "INPUT_ONLY": 4, + "IMMUTABLE": 5, + "UNORDERED_LIST": 6, + "NON_EMPTY_DEFAULT": 7 + } + }, + "resourceReference": { + "type": "google.api.ResourceReference", + "id": 1055, + "extend": "google.protobuf.FieldOptions" + }, + "resourceDefinition": { + "rule": "repeated", + "type": "google.api.ResourceDescriptor", + "id": 1053, + "extend": "google.protobuf.FileOptions" + }, + "resource": { + "type": "google.api.ResourceDescriptor", + "id": 1053, + "extend": "google.protobuf.MessageOptions" + }, + "ResourceDescriptor": { + "fields": { + "type": { + "type": "string", + "id": 1 + }, + "pattern": { + "rule": "repeated", + "type": "string", + "id": 2 + }, + "nameField": { + "type": "string", + "id": 3 + }, + "history": { + "type": "History", + "id": 4 + }, + "plural": { + "type": "string", + "id": 5 + }, + "singular": { + "type": "string", + "id": 6 + }, + "style": { + "rule": "repeated", + "type": "Style", + "id": 10 + } + }, + "nested": { + "History": { + "values": { + "HISTORY_UNSPECIFIED": 0, + "ORIGINALLY_SINGLE_PATTERN": 1, + "FUTURE_MULTI_PATTERN": 2 + } + }, + "Style": { + "values": { + "STYLE_UNSPECIFIED": 0, + "DECLARATIVE_FRIENDLY": 1 + } + } + } + }, + "ResourceReference": { + "fields": { + "type": { + "type": "string", + "id": 1 + }, + "childType": { + "type": "string", + "id": 2 + } + } + } + } + }, + "protobuf": { + "options": { + "go_package": "google.golang.org/protobuf/types/descriptorpb", + "java_package": "com.google.protobuf", + "java_outer_classname": "DescriptorProtos", + "csharp_namespace": "Google.Protobuf.Reflection", + "objc_class_prefix": "GPB", + "cc_enable_arenas": true, + "optimize_for": "SPEED" + }, + "nested": { + "FileDescriptorSet": { + "fields": { + "file": { + "rule": "repeated", + "type": "FileDescriptorProto", + "id": 1 + } + } + }, + "FileDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "package": { + "type": "string", + "id": 2 + }, + "dependency": { + "rule": "repeated", + "type": "string", + "id": 3 + }, + "publicDependency": { + "rule": "repeated", + "type": "int32", + "id": 10, + "options": { + "packed": false + } + }, + "weakDependency": { + "rule": "repeated", + "type": "int32", + "id": 11, + "options": { + "packed": false + } + }, + "messageType": { + "rule": "repeated", + "type": "DescriptorProto", + "id": 4 + }, + "enumType": { + "rule": "repeated", + "type": "EnumDescriptorProto", + "id": 5 + }, + "service": { + "rule": "repeated", + "type": "ServiceDescriptorProto", + "id": 6 + }, + "extension": { + "rule": "repeated", + "type": "FieldDescriptorProto", + "id": 7 + }, + "options": { + "type": "FileOptions", + "id": 8 + }, + "sourceCodeInfo": { + "type": "SourceCodeInfo", + "id": 9 + }, + "syntax": { + "type": "string", + "id": 12 + }, + "edition": { + "type": "string", + "id": 13 + } + } + }, + "DescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "field": { + "rule": "repeated", + "type": "FieldDescriptorProto", + "id": 2 + }, + "extension": { + "rule": "repeated", + "type": "FieldDescriptorProto", + "id": 6 + }, + "nestedType": { + "rule": "repeated", + "type": "DescriptorProto", + "id": 3 + }, + "enumType": { + "rule": "repeated", + "type": "EnumDescriptorProto", + "id": 4 + }, + "extensionRange": { + "rule": "repeated", + "type": "ExtensionRange", + "id": 5 + }, + "oneofDecl": { + "rule": "repeated", + "type": "OneofDescriptorProto", + "id": 8 + }, + "options": { + "type": "MessageOptions", + "id": 7 + }, + "reservedRange": { + "rule": "repeated", + "type": "ReservedRange", + "id": 9 + }, + "reservedName": { + "rule": "repeated", + "type": "string", + "id": 10 + } + }, + "nested": { + "ExtensionRange": { + "fields": { + "start": { + "type": "int32", + "id": 1 + }, + "end": { + "type": "int32", + "id": 2 + }, + "options": { + "type": "ExtensionRangeOptions", + "id": 3 + } + } + }, + "ReservedRange": { + "fields": { + "start": { + "type": "int32", + "id": 1 + }, + "end": { + "type": "int32", + "id": 2 + } + } + } + } + }, + "ExtensionRangeOptions": { + "fields": { + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ] + }, + "FieldDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "number": { + "type": "int32", + "id": 3 + }, + "label": { + "type": "Label", + "id": 4 + }, + "type": { + "type": "Type", + "id": 5 + }, + "typeName": { + "type": "string", + "id": 6 + }, + "extendee": { + "type": "string", + "id": 2 + }, + "defaultValue": { + "type": "string", + "id": 7 + }, + "oneofIndex": { + "type": "int32", + "id": 9 + }, + "jsonName": { + "type": "string", + "id": 10 + }, + "options": { + "type": "FieldOptions", + "id": 8 + }, + "proto3Optional": { + "type": "bool", + "id": 17 + } + }, + "nested": { + "Type": { + "values": { + "TYPE_DOUBLE": 1, + "TYPE_FLOAT": 2, + "TYPE_INT64": 3, + "TYPE_UINT64": 4, + "TYPE_INT32": 5, + "TYPE_FIXED64": 6, + "TYPE_FIXED32": 7, + "TYPE_BOOL": 8, + "TYPE_STRING": 9, + "TYPE_GROUP": 10, + "TYPE_MESSAGE": 11, + "TYPE_BYTES": 12, + "TYPE_UINT32": 13, + "TYPE_ENUM": 14, + "TYPE_SFIXED32": 15, + "TYPE_SFIXED64": 16, + "TYPE_SINT32": 17, + "TYPE_SINT64": 18 + } + }, + "Label": { + "values": { + "LABEL_OPTIONAL": 1, + "LABEL_REQUIRED": 2, + "LABEL_REPEATED": 3 + } + } + } + }, + "OneofDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "options": { + "type": "OneofOptions", + "id": 2 + } + } + }, + "EnumDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "value": { + "rule": "repeated", + "type": "EnumValueDescriptorProto", + "id": 2 + }, + "options": { + "type": "EnumOptions", + "id": 3 + }, + "reservedRange": { + "rule": "repeated", + "type": "EnumReservedRange", + "id": 4 + }, + "reservedName": { + "rule": "repeated", + "type": "string", + "id": 5 + } + }, + "nested": { + "EnumReservedRange": { + "fields": { + "start": { + "type": "int32", + "id": 1 + }, + "end": { + "type": "int32", + "id": 2 + } + } + } + } + }, + "EnumValueDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "number": { + "type": "int32", + "id": 2 + }, + "options": { + "type": "EnumValueOptions", + "id": 3 + } + } + }, + "ServiceDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "method": { + "rule": "repeated", + "type": "MethodDescriptorProto", + "id": 2 + }, + "options": { + "type": "ServiceOptions", + "id": 3 + } + } + }, + "MethodDescriptorProto": { + "fields": { + "name": { + "type": "string", + "id": 1 + }, + "inputType": { + "type": "string", + "id": 2 + }, + "outputType": { + "type": "string", + "id": 3 + }, + "options": { + "type": "MethodOptions", + "id": 4 + }, + "clientStreaming": { + "type": "bool", + "id": 5, + "options": { + "default": false + } + }, + "serverStreaming": { + "type": "bool", + "id": 6, + "options": { + "default": false + } + } + } + }, + "FileOptions": { + "fields": { + "javaPackage": { + "type": "string", + "id": 1 + }, + "javaOuterClassname": { + "type": "string", + "id": 8 + }, + "javaMultipleFiles": { + "type": "bool", + "id": 10, + "options": { + "default": false + } + }, + "javaGenerateEqualsAndHash": { + "type": "bool", + "id": 20, + "options": { + "deprecated": true + } + }, + "javaStringCheckUtf8": { + "type": "bool", + "id": 27, + "options": { + "default": false + } + }, + "optimizeFor": { + "type": "OptimizeMode", + "id": 9, + "options": { + "default": "SPEED" + } + }, + "goPackage": { + "type": "string", + "id": 11 + }, + "ccGenericServices": { + "type": "bool", + "id": 16, + "options": { + "default": false + } + }, + "javaGenericServices": { + "type": "bool", + "id": 17, + "options": { + "default": false + } + }, + "pyGenericServices": { + "type": "bool", + "id": 18, + "options": { + "default": false + } + }, + "phpGenericServices": { + "type": "bool", + "id": 42, + "options": { + "default": false + } + }, + "deprecated": { + "type": "bool", + "id": 23, + "options": { + "default": false + } + }, + "ccEnableArenas": { + "type": "bool", + "id": 31, + "options": { + "default": true + } + }, + "objcClassPrefix": { + "type": "string", + "id": 36 + }, + "csharpNamespace": { + "type": "string", + "id": 37 + }, + "swiftPrefix": { + "type": "string", + "id": 39 + }, + "phpClassPrefix": { + "type": "string", + "id": 40 + }, + "phpNamespace": { + "type": "string", + "id": 41 + }, + "phpMetadataNamespace": { + "type": "string", + "id": 44 + }, + "rubyPackage": { + "type": "string", + "id": 45 + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "reserved": [ + [ + 38, + 38 + ] + ], + "nested": { + "OptimizeMode": { + "values": { + "SPEED": 1, + "CODE_SIZE": 2, + "LITE_RUNTIME": 3 + } + } + } + }, + "MessageOptions": { + "fields": { + "messageSetWireFormat": { + "type": "bool", + "id": 1, + "options": { + "default": false + } + }, + "noStandardDescriptorAccessor": { + "type": "bool", + "id": 2, + "options": { + "default": false + } + }, + "deprecated": { + "type": "bool", + "id": 3, + "options": { + "default": false + } + }, + "mapEntry": { + "type": "bool", + "id": 7 + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "reserved": [ + [ + 4, + 4 + ], + [ + 5, + 5 + ], + [ + 6, + 6 + ], + [ + 8, + 8 + ], + [ + 9, + 9 + ] + ] + }, + "FieldOptions": { + "fields": { + "ctype": { + "type": "CType", + "id": 1, + "options": { + "default": "STRING" + } + }, + "packed": { + "type": "bool", + "id": 2 + }, + "jstype": { + "type": "JSType", + "id": 6, + "options": { + "default": "JS_NORMAL" + } + }, + "lazy": { + "type": "bool", + "id": 5, + "options": { + "default": false + } + }, + "unverifiedLazy": { + "type": "bool", + "id": 15, + "options": { + "default": false + } + }, + "deprecated": { + "type": "bool", + "id": 3, + "options": { + "default": false + } + }, + "weak": { + "type": "bool", + "id": 10, + "options": { + "default": false + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "reserved": [ + [ + 4, + 4 + ] + ], + "nested": { + "CType": { + "values": { + "STRING": 0, + "CORD": 1, + "STRING_PIECE": 2 + } + }, + "JSType": { + "values": { + "JS_NORMAL": 0, + "JS_STRING": 1, + "JS_NUMBER": 2 + } + } + } + }, + "OneofOptions": { + "fields": { + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ] + }, + "EnumOptions": { + "fields": { + "allowAlias": { + "type": "bool", + "id": 2 + }, + "deprecated": { + "type": "bool", + "id": 3, + "options": { + "default": false + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "reserved": [ + [ + 5, + 5 + ] + ] + }, + "EnumValueOptions": { + "fields": { + "deprecated": { + "type": "bool", + "id": 1, + "options": { + "default": false + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ] + }, + "ServiceOptions": { + "fields": { + "deprecated": { + "type": "bool", + "id": 33, + "options": { + "default": false + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ] + }, + "MethodOptions": { + "fields": { + "deprecated": { + "type": "bool", + "id": 33, + "options": { + "default": false + } + }, + "idempotencyLevel": { + "type": "IdempotencyLevel", + "id": 34, + "options": { + "default": "IDEMPOTENCY_UNKNOWN" + } + }, + "uninterpretedOption": { + "rule": "repeated", + "type": "UninterpretedOption", + "id": 999 + } + }, + "extensions": [ + [ + 1000, + 536870911 + ] + ], + "nested": { + "IdempotencyLevel": { + "values": { + "IDEMPOTENCY_UNKNOWN": 0, + "NO_SIDE_EFFECTS": 1, + "IDEMPOTENT": 2 + } + } + } + }, + "UninterpretedOption": { + "fields": { + "name": { + "rule": "repeated", + "type": "NamePart", + "id": 2 + }, + "identifierValue": { + "type": "string", + "id": 3 + }, + "positiveIntValue": { + "type": "uint64", + "id": 4 + }, + "negativeIntValue": { + "type": "int64", + "id": 5 + }, + "doubleValue": { + "type": "double", + "id": 6 + }, + "stringValue": { + "type": "bytes", + "id": 7 + }, + "aggregateValue": { + "type": "string", + "id": 8 + } + }, + "nested": { + "NamePart": { + "fields": { + "namePart": { + "rule": "required", + "type": "string", + "id": 1 + }, + "isExtension": { + "rule": "required", + "type": "bool", + "id": 2 + } + } + } + } + }, + "SourceCodeInfo": { + "fields": { + "location": { + "rule": "repeated", + "type": "Location", + "id": 1 + } + }, + "nested": { + "Location": { + "fields": { + "path": { + "rule": "repeated", + "type": "int32", + "id": 1 + }, + "span": { + "rule": "repeated", + "type": "int32", + "id": 2 + }, + "leadingComments": { + "type": "string", + "id": 3 + }, + "trailingComments": { + "type": "string", + "id": 4 + }, + "leadingDetachedComments": { + "rule": "repeated", + "type": "string", + "id": 6 + } + } + } + } + }, + "GeneratedCodeInfo": { + "fields": { + "annotation": { + "rule": "repeated", + "type": "Annotation", + "id": 1 + } + }, + "nested": { + "Annotation": { + "fields": { + "path": { + "rule": "repeated", + "type": "int32", + "id": 1 + }, + "sourceFile": { + "type": "string", + "id": 2 + }, + "begin": { + "type": "int32", + "id": 3 + }, + "end": { + "type": "int32", + "id": 4 + }, + "semantic": { + "type": "Semantic", + "id": 5 + } + }, + "nested": { + "Semantic": { + "values": { + "NONE": 0, + "SET": 1, + "ALIAS": 2 + } + } + } + } + } + }, + "FieldMask": { + "fields": { + "paths": { + "rule": "repeated", + "type": "string", + "id": 1 + } + } + }, + "Empty": { + "fields": {} + } + } + }, + "iam": { + "nested": { + "v1": { + "options": { + "cc_enable_arenas": true, + "csharp_namespace": "Google.Cloud.Iam.V1", + "go_package": "google.golang.org/genproto/googleapis/iam/v1;iam", + "java_multiple_files": true, + "java_outer_classname": "PolicyProto", + "java_package": "com.google.iam.v1", + "php_namespace": "Google\\Cloud\\Iam\\V1" + }, + "nested": { + "IAMPolicy": { + "options": { + "(google.api.default_host)": "iam-meta-api.googleapis.com" + }, + "methods": { + "SetIamPolicy": { + "requestType": "SetIamPolicyRequest", + "responseType": "Policy", + "options": { + "(google.api.http).post": "/v1/{resource=**}:setIamPolicy", + "(google.api.http).body": "*" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "post": "/v1/{resource=**}:setIamPolicy", + "body": "*" + } + } + ] + }, + "GetIamPolicy": { + "requestType": "GetIamPolicyRequest", + "responseType": "Policy", + "options": { + "(google.api.http).post": "/v1/{resource=**}:getIamPolicy", + "(google.api.http).body": "*" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "post": "/v1/{resource=**}:getIamPolicy", + "body": "*" + } + } + ] + }, + "TestIamPermissions": { + "requestType": "TestIamPermissionsRequest", + "responseType": "TestIamPermissionsResponse", + "options": { + "(google.api.http).post": "/v1/{resource=**}:testIamPermissions", + "(google.api.http).body": "*" + }, + "parsedOptions": [ + { + "(google.api.http)": { + "post": "/v1/{resource=**}:testIamPermissions", + "body": "*" + } + } + ] + } + } + }, + "SetIamPolicyRequest": { + "fields": { + "resource": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "REQUIRED", + "(google.api.resource_reference).type": "*" + } + }, + "policy": { + "type": "Policy", + "id": 2, + "options": { + "(google.api.field_behavior)": "REQUIRED" + } + }, + "updateMask": { + "type": "google.protobuf.FieldMask", + "id": 3 + } + } + }, + "GetIamPolicyRequest": { + "fields": { + "resource": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "REQUIRED", + "(google.api.resource_reference).type": "*" + } + }, + "options": { + "type": "GetPolicyOptions", + "id": 2 + } + } + }, + "TestIamPermissionsRequest": { + "fields": { + "resource": { + "type": "string", + "id": 1, + "options": { + "(google.api.field_behavior)": "REQUIRED", + "(google.api.resource_reference).type": "*" + } + }, + "permissions": { + "rule": "repeated", + "type": "string", + "id": 2, + "options": { + "(google.api.field_behavior)": "REQUIRED" + } + } + } + }, + "TestIamPermissionsResponse": { + "fields": { + "permissions": { + "rule": "repeated", + "type": "string", + "id": 1 + } + } + }, + "GetPolicyOptions": { + "fields": { + "requestedPolicyVersion": { + "type": "int32", + "id": 1 + } + } + }, + "Policy": { + "fields": { + "version": { + "type": "int32", + "id": 1 + }, + "bindings": { + "rule": "repeated", + "type": "Binding", + "id": 4 + }, + "auditConfigs": { + "rule": "repeated", + "type": "AuditConfig", + "id": 6 + }, + "etag": { + "type": "bytes", + "id": 3 + } + } + }, + "Binding": { + "fields": { + "role": { + "type": "string", + "id": 1 + }, + "members": { + "rule": "repeated", + "type": "string", + "id": 2 + }, + "condition": { + "type": "google.type.Expr", + "id": 3 + } + } + }, + "AuditConfig": { + "fields": { + "service": { + "type": "string", + "id": 1 + }, + "auditLogConfigs": { + "rule": "repeated", + "type": "AuditLogConfig", + "id": 3 + } + } + }, + "AuditLogConfig": { + "fields": { + "logType": { + "type": "LogType", + "id": 1 + }, + "exemptedMembers": { + "rule": "repeated", + "type": "string", + "id": 2 + } + }, + "nested": { + "LogType": { + "values": { + "LOG_TYPE_UNSPECIFIED": 0, + "ADMIN_READ": 1, + "DATA_WRITE": 2, + "DATA_READ": 3 + } + } + } + }, + "PolicyDelta": { + "fields": { + "bindingDeltas": { + "rule": "repeated", + "type": "BindingDelta", + "id": 1 + }, + "auditConfigDeltas": { + "rule": "repeated", + "type": "AuditConfigDelta", + "id": 2 + } + } + }, + "BindingDelta": { + "fields": { + "action": { + "type": "Action", + "id": 1 + }, + "role": { + "type": "string", + "id": 2 + }, + "member": { + "type": "string", + "id": 3 + }, + "condition": { + "type": "google.type.Expr", + "id": 4 + } + }, + "nested": { + "Action": { + "values": { + "ACTION_UNSPECIFIED": 0, + "ADD": 1, + "REMOVE": 2 + } + } + } + }, + "AuditConfigDelta": { + "fields": { + "action": { + "type": "Action", + "id": 1 + }, + "service": { + "type": "string", + "id": 2 + }, + "exemptedMember": { + "type": "string", + "id": 3 + }, + "logType": { + "type": "string", + "id": 4 + } + }, + "nested": { + "Action": { + "values": { + "ACTION_UNSPECIFIED": 0, + "ADD": 1, + "REMOVE": 2 + } + } + } + } + } + } + } + }, + "type": { + "options": { + "go_package": "google.golang.org/genproto/googleapis/type/expr;expr", + "java_multiple_files": true, + "java_outer_classname": "ExprProto", + "java_package": "com.google.type", + "objc_class_prefix": "GTP" + }, + "nested": { + "Expr": { + "fields": { + "expression": { + "type": "string", + "id": 1 + }, + "title": { + "type": "string", + "id": 2 + }, + "description": { + "type": "string", + "id": 3 + }, + "location": { + "type": "string", + "id": 4 + } + } + } + } + } + } + } + } +} \ No newline at end of file diff --git a/packages/google-cloud-bigquery-connection/samples/README.md b/packages/google-cloud-bigquery-connection/samples/README.md new file mode 100644 index 00000000000..5c38f8484b7 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/README.md @@ -0,0 +1,212 @@ +[//]: # "This README.md file is auto-generated, all changes to this file will be lost." +[//]: # "To regenerate it, use `python -m synthtool`." +Google Cloud Platform logo + +# [Google BigQuery Connection: Node.js Samples](https://github.com/googleapis/google-cloud-node) + +[![Open in Cloud Shell][shell_img]][shell_link] + + + +## Table of Contents + +* [Before you begin](#before-you-begin) +* [Samples](#samples) + * [Connection_service.create_connection](#connection_service.create_connection) + * [Connection_service.delete_connection](#connection_service.delete_connection) + * [Connection_service.get_connection](#connection_service.get_connection) + * [Connection_service.get_iam_policy](#connection_service.get_iam_policy) + * [Connection_service.list_connections](#connection_service.list_connections) + * [Connection_service.set_iam_policy](#connection_service.set_iam_policy) + * [Connection_service.test_iam_permissions](#connection_service.test_iam_permissions) + * [Connection_service.update_connection](#connection_service.update_connection) + * [Quickstart](#quickstart) + * [Quickstart](#quickstart) + +## Before you begin + +Before running the samples, make sure you've followed the steps outlined in +[Using the client library](https://github.com/googleapis/google-cloud-node#using-the-client-library). + +`cd samples` + +`npm install` + +`cd ..` + +## Samples + + + +### Connection_service.create_connection + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.create_connection.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.create_connection.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.create_connection.js` + + +----- + + + + +### Connection_service.delete_connection + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.delete_connection.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.delete_connection.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.delete_connection.js` + + +----- + + + + +### Connection_service.get_connection + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_connection.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_connection.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_connection.js` + + +----- + + + + +### Connection_service.get_iam_policy + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_iam_policy.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_iam_policy.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_iam_policy.js` + + +----- + + + + +### Connection_service.list_connections + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.list_connections.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.list_connections.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.list_connections.js` + + +----- + + + + +### Connection_service.set_iam_policy + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.set_iam_policy.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.set_iam_policy.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.set_iam_policy.js` + + +----- + + + + +### Connection_service.test_iam_permissions + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.test_iam_permissions.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.test_iam_permissions.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.test_iam_permissions.js` + + +----- + + + + +### Connection_service.update_connection + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.update_connection.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.update_connection.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.update_connection.js` + + +----- + + + + +### Quickstart + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/quickstart.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/quickstart.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/quickstart.js` + + +----- + + + + +### Quickstart + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-bigquery-connection/samples/test/quickstart.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-bigquery-connection/samples/test/quickstart.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-bigquery-connection/samples/test/quickstart.js` + + + + + + +[shell_img]: https://gstatic.com/cloudssh/images/open-btn.png +[shell_link]: https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=samples/README.md +[product-docs]: https://cloud.google.com/bigquery/docs/reference/bigqueryconnection diff --git a/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.create_connection.js b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.create_connection.js new file mode 100644 index 00000000000..8ac35d5fb73 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.create_connection.js @@ -0,0 +1,71 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + + + +'use strict'; + +function main(parent, connection) { + // [START bigqueryconnection_v1_generated_ConnectionService_CreateConnection_async] + /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * Required. Parent resource name. + * Must be in the format `projects/{project_id}/locations/{location_id}` + */ + // const parent = 'abc123' + /** + * Optional. Connection id that should be assigned to the created connection. + */ + // const connectionId = 'abc123' + /** + * Required. Connection to create. + */ + // const connection = {} + + // Imports the Connection library + const {ConnectionServiceClient} = require('@google-cloud/bigquery-connection').v1; + + // Instantiates a client + const connectionClient = new ConnectionServiceClient(); + + async function callCreateConnection() { + // Construct request + const request = { + parent, + connection, + }; + + // Run request + const response = await connectionClient.createConnection(request); + console.log(response); + } + + callCreateConnection(); + // [END bigqueryconnection_v1_generated_ConnectionService_CreateConnection_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.delete_connection.js b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.delete_connection.js new file mode 100644 index 00000000000..43360021887 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.delete_connection.js @@ -0,0 +1,62 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + + + +'use strict'; + +function main(name) { + // [START bigqueryconnection_v1_generated_ConnectionService_DeleteConnection_async] + /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * Required. Name of the deleted connection, for example: + * `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + */ + // const name = 'abc123' + + // Imports the Connection library + const {ConnectionServiceClient} = require('@google-cloud/bigquery-connection').v1; + + // Instantiates a client + const connectionClient = new ConnectionServiceClient(); + + async function callDeleteConnection() { + // Construct request + const request = { + name, + }; + + // Run request + const response = await connectionClient.deleteConnection(request); + console.log(response); + } + + callDeleteConnection(); + // [END bigqueryconnection_v1_generated_ConnectionService_DeleteConnection_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_connection.js b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_connection.js new file mode 100644 index 00000000000..406f86f5245 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_connection.js @@ -0,0 +1,62 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + + + +'use strict'; + +function main(name) { + // [START bigqueryconnection_v1_generated_ConnectionService_GetConnection_async] + /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * Required. Name of the requested connection, for example: + * `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + */ + // const name = 'abc123' + + // Imports the Connection library + const {ConnectionServiceClient} = require('@google-cloud/bigquery-connection').v1; + + // Instantiates a client + const connectionClient = new ConnectionServiceClient(); + + async function callGetConnection() { + // Construct request + const request = { + name, + }; + + // Run request + const response = await connectionClient.getConnection(request); + console.log(response); + } + + callGetConnection(); + // [END bigqueryconnection_v1_generated_ConnectionService_GetConnection_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_iam_policy.js b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_iam_policy.js new file mode 100644 index 00000000000..cab48cb4d5f --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.get_iam_policy.js @@ -0,0 +1,67 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + + + +'use strict'; + +function main(resource) { + // [START bigqueryconnection_v1_generated_ConnectionService_GetIamPolicy_async] + /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * REQUIRED: The resource for which the policy is being requested. + * See the operation documentation for the appropriate value for this field. + */ + // const resource = 'abc123' + /** + * OPTIONAL: A `GetPolicyOptions` object for specifying options to + * `GetIamPolicy`. + */ + // const options = {} + + // Imports the Connection library + const {ConnectionServiceClient} = require('@google-cloud/bigquery-connection').v1; + + // Instantiates a client + const connectionClient = new ConnectionServiceClient(); + + async function callGetIamPolicy() { + // Construct request + const request = { + resource, + }; + + // Run request + const response = await connectionClient.getIamPolicy(request); + console.log(response); + } + + callGetIamPolicy(); + // [END bigqueryconnection_v1_generated_ConnectionService_GetIamPolicy_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.list_connections.js b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.list_connections.js new file mode 100644 index 00000000000..56f097f062c --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.list_connections.js @@ -0,0 +1,73 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + + + +'use strict'; + +function main(parent, pageSize) { + // [START bigqueryconnection_v1_generated_ConnectionService_ListConnections_async] + /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * Required. Parent resource name. + * Must be in the form: `projects/{project_id}/locations/{location_id}` + */ + // const parent = 'abc123' + /** + * Required. Page size. + */ + // const pageSize = 1234 + /** + * Page token. + */ + // const pageToken = 'abc123' + + // Imports the Connection library + const {ConnectionServiceClient} = require('@google-cloud/bigquery-connection').v1; + + // Instantiates a client + const connectionClient = new ConnectionServiceClient(); + + async function callListConnections() { + // Construct request + const request = { + parent, + pageSize, + }; + + // Run request + const iterable = await connectionClient.listConnectionsAsync(request); + for await (const response of iterable) { + console.log(response); + } + } + + callListConnections(); + // [END bigqueryconnection_v1_generated_ConnectionService_ListConnections_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.set_iam_policy.js b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.set_iam_policy.js new file mode 100644 index 00000000000..6754edc5d4d --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.set_iam_policy.js @@ -0,0 +1,77 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + + + +'use strict'; + +function main(resource, policy) { + // [START bigqueryconnection_v1_generated_ConnectionService_SetIamPolicy_async] + /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * REQUIRED: The resource for which the policy is being specified. + * See the operation documentation for the appropriate value for this field. + */ + // const resource = 'abc123' + /** + * REQUIRED: The complete policy to be applied to the `resource`. The size of + * the policy is limited to a few 10s of KB. An empty policy is a + * valid policy but certain Cloud Platform services (such as Projects) + * might reject them. + */ + // const policy = {} + /** + * OPTIONAL: A FieldMask specifying which fields of the policy to modify. Only + * the fields in the mask will be modified. If no mask is provided, the + * following default mask is used: + * `paths: "bindings, etag"` + */ + // const updateMask = {} + + // Imports the Connection library + const {ConnectionServiceClient} = require('@google-cloud/bigquery-connection').v1; + + // Instantiates a client + const connectionClient = new ConnectionServiceClient(); + + async function callSetIamPolicy() { + // Construct request + const request = { + resource, + policy, + }; + + // Run request + const response = await connectionClient.setIamPolicy(request); + console.log(response); + } + + callSetIamPolicy(); + // [END bigqueryconnection_v1_generated_ConnectionService_SetIamPolicy_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.test_iam_permissions.js b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.test_iam_permissions.js new file mode 100644 index 00000000000..985ddc86c48 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.test_iam_permissions.js @@ -0,0 +1,70 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + + + +'use strict'; + +function main(resource, permissions) { + // [START bigqueryconnection_v1_generated_ConnectionService_TestIamPermissions_async] + /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * REQUIRED: The resource for which the policy detail is being requested. + * See the operation documentation for the appropriate value for this field. + */ + // const resource = 'abc123' + /** + * The set of permissions to check for the `resource`. Permissions with + * wildcards (such as '*' or 'storage.*') are not allowed. For more + * information see + * IAM Overview (https://cloud.google.com/iam/docs/overview#permissions). + */ + // const permissions = 'abc123' + + // Imports the Connection library + const {ConnectionServiceClient} = require('@google-cloud/bigquery-connection').v1; + + // Instantiates a client + const connectionClient = new ConnectionServiceClient(); + + async function callTestIamPermissions() { + // Construct request + const request = { + resource, + permissions, + }; + + // Run request + const response = await connectionClient.testIamPermissions(request); + console.log(response); + } + + callTestIamPermissions(); + // [END bigqueryconnection_v1_generated_ConnectionService_TestIamPermissions_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.update_connection.js b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.update_connection.js new file mode 100644 index 00000000000..59630d9b3c0 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/generated/v1/connection_service.update_connection.js @@ -0,0 +1,72 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + + + +'use strict'; + +function main(name, connection, updateMask) { + // [START bigqueryconnection_v1_generated_ConnectionService_UpdateConnection_async] + /** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. + * TODO(developer): Uncomment these variables before running the sample. + */ + /** + * Required. Name of the connection to update, for example: + * `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + */ + // const name = 'abc123' + /** + * Required. Connection containing the updated fields. + */ + // const connection = {} + /** + * Required. Update mask for the connection fields to be updated. + */ + // const updateMask = {} + + // Imports the Connection library + const {ConnectionServiceClient} = require('@google-cloud/bigquery-connection').v1; + + // Instantiates a client + const connectionClient = new ConnectionServiceClient(); + + async function callUpdateConnection() { + // Construct request + const request = { + name, + connection, + updateMask, + }; + + // Run request + const response = await connectionClient.updateConnection(request); + console.log(response); + } + + callUpdateConnection(); + // [END bigqueryconnection_v1_generated_ConnectionService_UpdateConnection_async] +} + +process.on('unhandledRejection', err => { + console.error(err.message); + process.exitCode = 1; +}); +main(...process.argv.slice(2)); diff --git a/packages/google-cloud-bigquery-connection/samples/generated/v1/snippet_metadata.google.cloud.bigquery.connection.v1.json b/packages/google-cloud-bigquery-connection/samples/generated/v1/snippet_metadata.google.cloud.bigquery.connection.v1.json new file mode 100644 index 00000000000..93e82b90702 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/generated/v1/snippet_metadata.google.cloud.bigquery.connection.v1.json @@ -0,0 +1,375 @@ +{ + "clientLibrary": { + "name": "nodejs-connection", + "version": "2.0.2", + "language": "TYPESCRIPT", + "apis": [ + { + "id": "google.cloud.bigquery.connection.v1", + "version": "v1" + } + ] + }, + "snippets": [ + { + "regionTag": "bigqueryconnection_v1_generated_ConnectionService_CreateConnection_async", + "title": "ConnectionService createConnection Sample", + "origin": "API_DEFINITION", + "description": " Creates a new connection.", + "canonical": true, + "file": "connection_service.create_connection.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 63, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "CreateConnection", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.CreateConnection", + "async": true, + "parameters": [ + { + "name": "parent", + "type": "TYPE_STRING" + }, + { + "name": "connection_id", + "type": "TYPE_STRING" + }, + { + "name": "connection", + "type": ".google.cloud.bigquery.connection.v1.Connection" + } + ], + "resultType": ".google.cloud.bigquery.connection.v1.Connection", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "CreateConnection", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.CreateConnection", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService" + } + } + } + }, + { + "regionTag": "bigqueryconnection_v1_generated_ConnectionService_GetConnection_async", + "title": "ConnectionService getConnection Sample", + "origin": "API_DEFINITION", + "description": " Returns specified connection.", + "canonical": true, + "file": "connection_service.get_connection.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 54, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "GetConnection", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.GetConnection", + "async": true, + "parameters": [ + { + "name": "name", + "type": "TYPE_STRING" + } + ], + "resultType": ".google.cloud.bigquery.connection.v1.Connection", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "GetConnection", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.GetConnection", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService" + } + } + } + }, + { + "regionTag": "bigqueryconnection_v1_generated_ConnectionService_ListConnections_async", + "title": "ConnectionService listConnections Sample", + "origin": "API_DEFINITION", + "description": " Returns a list of connections in the given project.", + "canonical": true, + "file": "connection_service.list_connections.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 65, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "ListConnections", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.ListConnections", + "async": true, + "parameters": [ + { + "name": "parent", + "type": "TYPE_STRING" + }, + { + "name": "page_size", + "type": "TYPE_INT32" + }, + { + "name": "page_token", + "type": "TYPE_STRING" + } + ], + "resultType": ".google.cloud.bigquery.connection.v1.ListConnectionsResponse", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "ListConnections", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.ListConnections", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService" + } + } + } + }, + { + "regionTag": "bigqueryconnection_v1_generated_ConnectionService_UpdateConnection_async", + "title": "ConnectionService updateConnection Sample", + "origin": "API_DEFINITION", + "description": " Updates the specified connection. For security reasons, also resets credential if connection properties are in the update field mask.", + "canonical": true, + "file": "connection_service.update_connection.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 64, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "UpdateConnection", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.UpdateConnection", + "async": true, + "parameters": [ + { + "name": "name", + "type": "TYPE_STRING" + }, + { + "name": "connection", + "type": ".google.cloud.bigquery.connection.v1.Connection" + }, + { + "name": "update_mask", + "type": ".google.protobuf.FieldMask" + } + ], + "resultType": ".google.cloud.bigquery.connection.v1.Connection", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "UpdateConnection", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.UpdateConnection", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService" + } + } + } + }, + { + "regionTag": "bigqueryconnection_v1_generated_ConnectionService_DeleteConnection_async", + "title": "ConnectionService deleteConnection Sample", + "origin": "API_DEFINITION", + "description": " Deletes connection and associated credential.", + "canonical": true, + "file": "connection_service.delete_connection.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 54, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "DeleteConnection", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.DeleteConnection", + "async": true, + "parameters": [ + { + "name": "name", + "type": "TYPE_STRING" + } + ], + "resultType": ".google.protobuf.Empty", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "DeleteConnection", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.DeleteConnection", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService" + } + } + } + }, + { + "regionTag": "bigqueryconnection_v1_generated_ConnectionService_GetIamPolicy_async", + "title": "ConnectionService getIamPolicy Sample", + "origin": "API_DEFINITION", + "description": " Gets the access control policy for a resource. Returns an empty policy if the resource exists and does not have a policy set.", + "canonical": true, + "file": "connection_service.get_iam_policy.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 59, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "GetIamPolicy", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.GetIamPolicy", + "async": true, + "parameters": [ + { + "name": "resource", + "type": "TYPE_STRING" + }, + { + "name": "options", + "type": ".google.iam.v1.GetPolicyOptions" + } + ], + "resultType": ".google.iam.v1.Policy", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "GetIamPolicy", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.GetIamPolicy", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService" + } + } + } + }, + { + "regionTag": "bigqueryconnection_v1_generated_ConnectionService_SetIamPolicy_async", + "title": "ConnectionService setIamPolicy Sample", + "origin": "API_DEFINITION", + "description": " Sets the access control policy on the specified resource. Replaces any existing policy. Can return `NOT_FOUND`, `INVALID_ARGUMENT`, and `PERMISSION_DENIED` errors.", + "canonical": true, + "file": "connection_service.set_iam_policy.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 69, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "SetIamPolicy", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.SetIamPolicy", + "async": true, + "parameters": [ + { + "name": "resource", + "type": "TYPE_STRING" + }, + { + "name": "policy", + "type": ".google.iam.v1.Policy" + }, + { + "name": "update_mask", + "type": ".google.protobuf.FieldMask" + } + ], + "resultType": ".google.iam.v1.Policy", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "SetIamPolicy", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.SetIamPolicy", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService" + } + } + } + }, + { + "regionTag": "bigqueryconnection_v1_generated_ConnectionService_TestIamPermissions_async", + "title": "ConnectionService testIamPermissions Sample", + "origin": "API_DEFINITION", + "description": " Returns permissions that a caller has on the specified resource. If the resource does not exist, this will return an empty set of permissions, not a `NOT_FOUND` error. Note: This operation is designed to be used for building permission-aware UIs and command-line tools, not for authorization checking. This operation may \"fail open\" without warning.", + "canonical": true, + "file": "connection_service.test_iam_permissions.js", + "language": "JAVASCRIPT", + "segments": [ + { + "start": 25, + "end": 62, + "type": "FULL" + } + ], + "clientMethod": { + "shortName": "TestIamPermissions", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.TestIamPermissions", + "async": true, + "parameters": [ + { + "name": "resource", + "type": "TYPE_STRING" + }, + { + "name": "permissions", + "type": "TYPE_STRING[]" + } + ], + "resultType": ".google.iam.v1.TestIamPermissionsResponse", + "client": { + "shortName": "ConnectionServiceClient", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionServiceClient" + }, + "method": { + "shortName": "TestIamPermissions", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService.TestIamPermissions", + "service": { + "shortName": "ConnectionService", + "fullName": "google.cloud.bigquery.connection.v1.ConnectionService" + } + } + } + } + ] +} \ No newline at end of file diff --git a/packages/google-cloud-bigquery-connection/samples/package.json b/packages/google-cloud-bigquery-connection/samples/package.json new file mode 100644 index 00000000000..986305da535 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/package.json @@ -0,0 +1,23 @@ +{ + "name": "nodejs-bigquery-connection-samples", + "private": true, + "license": "Apache-2.0", + "author": "Google LLC", + "engines": { + "node": ">=12.0.0" + }, + "files": [ + "*.js" + ], + "scripts": { + "test": "c8 mocha --timeout 600000 test/*.js" + }, + "dependencies": { + "@google-cloud/bigquery-connection": "^2.0.2" + }, + "devDependencies": { + "c8": "^7.1.0", + "chai": "^4.2.0", + "mocha": "^8.0.0" + } +} diff --git a/packages/google-cloud-bigquery-connection/samples/quickstart.js b/packages/google-cloud-bigquery-connection/samples/quickstart.js new file mode 100644 index 00000000000..a7c9fbeb4e4 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/quickstart.js @@ -0,0 +1,51 @@ +// Copyright 2020 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +'use strict'; + +async function quickstart( + project = 'my-project' // Project to list connections for. +) { + // [START bigqueryconnection_quickstart] + // Imports the Google Cloud client library + const { + ConnectionServiceClient, + } = require('@google-cloud/bigquery-connection'); + + // Creates a client + const client = new ConnectionServiceClient(); + + // project = 'my-project' // Project to list connections for. + + const parent = `projects/${project}/locations/US`; + + async function listConnections() { + const [connections] = await client.listConnections({ + parent: parent, + }); + + console.info(`found ${connections.length} connections:`); + console.info(connections); + } + const listConnectionsResponse = listConnections(); + // [END bigqueryconnection_quickstart] + return listConnectionsResponse; +} + +const args = process.argv.slice(2); +quickstart(...args).catch(err => { + console.error(err); + process.exitCode = 1; +}); diff --git a/packages/google-cloud-bigquery-connection/samples/test/quickstart.js b/packages/google-cloud-bigquery-connection/samples/test/quickstart.js new file mode 100644 index 00000000000..bf053fa677d --- /dev/null +++ b/packages/google-cloud-bigquery-connection/samples/test/quickstart.js @@ -0,0 +1,38 @@ +// Copyright 2020 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +'use strict'; + +const {assert} = require('chai'); +const cp = require('child_process'); +const {before, describe, it} = require('mocha'); +const {ConnectionServiceClient} = require('@google-cloud/bigquery-connection'); +const client = new ConnectionServiceClient(); +const execSync = cmd => cp.execSync(cmd, {encoding: 'utf-8'}); + +describe('Quickstart', () => { + let project; + before(async () => { + project = await client.getProjectId(); + }); + + it('should run quickstart', async () => { + const stdout = execSync(`node ./quickstart.js ${project}`); + assert.match(stdout, /found [0-9]+ connections/); + }); +}); diff --git a/packages/google-cloud-bigquery-connection/src/index.ts b/packages/google-cloud-bigquery-connection/src/index.ts new file mode 100644 index 00000000000..f21a4480c37 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/src/index.ts @@ -0,0 +1,27 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by synthtool. ** +// ** https://github.com/googleapis/synthtool ** +// ** All changes to this file may be overwritten. ** + +import * as v1 from './v1'; + +const ConnectionServiceClient = v1.ConnectionServiceClient; +type ConnectionServiceClient = v1.ConnectionServiceClient; + +export {v1, ConnectionServiceClient}; +export default {v1, ConnectionServiceClient}; +import * as protos from '../protos/protos'; +export {protos}; diff --git a/packages/google-cloud-bigquery-connection/src/v1/connection_service_client.ts b/packages/google-cloud-bigquery-connection/src/v1/connection_service_client.ts new file mode 100644 index 00000000000..66993ea11d1 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/src/v1/connection_service_client.ts @@ -0,0 +1,1325 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +/* global window */ +import type * as gax from 'google-gax'; +import type { + Callback, + CallOptions, + Descriptors, + ClientOptions, + PaginationCallback, + GaxCall, +} from 'google-gax'; +import {Transform} from 'stream'; +import * as protos from '../../protos/protos'; +import jsonProtos = require('../../protos/protos.json'); +/** + * Client JSON configuration object, loaded from + * `src/v1/connection_service_client_config.json`. + * This file defines retry strategy and timeouts for all API methods in this library. + */ +import * as gapicConfig from './connection_service_client_config.json'; +const version = require('../../../package.json').version; + +/** + * Manages external data source connections and credentials. + * @class + * @memberof v1 + */ +export class ConnectionServiceClient { + private _terminated = false; + private _opts: ClientOptions; + private _providedCustomServicePath: boolean; + private _gaxModule: typeof gax | typeof gax.fallback; + private _gaxGrpc: gax.GrpcClient | gax.fallback.GrpcClient; + private _protos: {}; + private _defaults: {[method: string]: gax.CallSettings}; + auth: gax.GoogleAuth; + descriptors: Descriptors = { + page: {}, + stream: {}, + longrunning: {}, + batching: {}, + }; + warn: (code: string, message: string, warnType?: string) => void; + innerApiCalls: {[name: string]: Function}; + pathTemplates: {[name: string]: gax.PathTemplate}; + connectionServiceStub?: Promise<{[name: string]: Function}>; + + /** + * Construct an instance of ConnectionServiceClient. + * + * @param {object} [options] - The configuration object. + * The options accepted by the constructor are described in detail + * in [this document](https://github.com/googleapis/gax-nodejs/blob/main/client-libraries.md#creating-the-client-instance). + * The common options are: + * @param {object} [options.credentials] - Credentials object. + * @param {string} [options.credentials.client_email] + * @param {string} [options.credentials.private_key] + * @param {string} [options.email] - Account email address. Required when + * using a .pem or .p12 keyFilename. + * @param {string} [options.keyFilename] - Full path to the a .json, .pem, or + * .p12 key downloaded from the Google Developers Console. If you provide + * a path to a JSON file, the projectId option below is not necessary. + * NOTE: .pem and .p12 require you to specify options.email as well. + * @param {number} [options.port] - The port on which to connect to + * the remote host. + * @param {string} [options.projectId] - The project ID from the Google + * Developer's Console, e.g. 'grape-spaceship-123'. We will also check + * the environment variable GCLOUD_PROJECT for your project ID. If your + * app is running in an environment which supports + * {@link https://developers.google.com/identity/protocols/application-default-credentials Application Default Credentials}, + * your project ID will be detected automatically. + * @param {string} [options.apiEndpoint] - The domain name of the + * API remote host. + * @param {gax.ClientConfig} [options.clientConfig] - Client configuration override. + * Follows the structure of {@link gapicConfig}. + * @param {boolean | "rest"} [options.fallback] - Use HTTP fallback mode. + * Pass "rest" to use HTTP/1.1 REST API instead of gRPC. + * For more information, please check the + * {@link https://github.com/googleapis/gax-nodejs/blob/main/client-libraries.md#http11-rest-api-mode documentation}. + * @param {gax} [gaxInstance]: loaded instance of `google-gax`. Useful if you + * need to avoid loading the default gRPC version and want to use the fallback + * HTTP implementation. Load only fallback version and pass it to the constructor: + * ``` + * const gax = require('google-gax/build/src/fallback'); // avoids loading google-gax with gRPC + * const client = new ConnectionServiceClient({fallback: 'rest'}, gax); + * ``` + */ + constructor( + opts?: ClientOptions, + gaxInstance?: typeof gax | typeof gax.fallback + ) { + // Ensure that options include all the required fields. + const staticMembers = this.constructor as typeof ConnectionServiceClient; + const servicePath = + opts?.servicePath || opts?.apiEndpoint || staticMembers.servicePath; + this._providedCustomServicePath = !!( + opts?.servicePath || opts?.apiEndpoint + ); + const port = opts?.port || staticMembers.port; + const clientConfig = opts?.clientConfig ?? {}; + const fallback = + opts?.fallback ?? + (typeof window !== 'undefined' && typeof window?.fetch === 'function'); + opts = Object.assign({servicePath, port, clientConfig, fallback}, opts); + + // If scopes are unset in options and we're connecting to a non-default endpoint, set scopes just in case. + if (servicePath !== staticMembers.servicePath && !('scopes' in opts)) { + opts['scopes'] = staticMembers.scopes; + } + + // Load google-gax module synchronously if needed + if (!gaxInstance) { + gaxInstance = require('google-gax') as typeof gax; + } + + // Choose either gRPC or proto-over-HTTP implementation of google-gax. + this._gaxModule = opts.fallback ? gaxInstance.fallback : gaxInstance; + + // Create a `gaxGrpc` object, with any grpc-specific options sent to the client. + this._gaxGrpc = new this._gaxModule.GrpcClient(opts); + + // Save options to use in initialize() method. + this._opts = opts; + + // Save the auth object to the client, for use by other methods. + this.auth = this._gaxGrpc.auth as gax.GoogleAuth; + + // Set useJWTAccessWithScope on the auth object. + this.auth.useJWTAccessWithScope = true; + + // Set defaultServicePath on the auth object. + this.auth.defaultServicePath = staticMembers.servicePath; + + // Set the default scopes in auth client if needed. + if (servicePath === staticMembers.servicePath) { + this.auth.defaultScopes = staticMembers.scopes; + } + + // Determine the client header string. + const clientHeader = [`gax/${this._gaxModule.version}`, `gapic/${version}`]; + if (typeof process !== 'undefined' && 'versions' in process) { + clientHeader.push(`gl-node/${process.versions.node}`); + } else { + clientHeader.push(`gl-web/${this._gaxModule.version}`); + } + if (!opts.fallback) { + clientHeader.push(`grpc/${this._gaxGrpc.grpcVersion}`); + } else if (opts.fallback === 'rest') { + clientHeader.push(`rest/${this._gaxGrpc.grpcVersion}`); + } + if (opts.libName && opts.libVersion) { + clientHeader.push(`${opts.libName}/${opts.libVersion}`); + } + // Load the applicable protos. + this._protos = this._gaxGrpc.loadProtoJSON(jsonProtos); + + // This API contains "path templates"; forward-slash-separated + // identifiers to uniquely identify resources within the API. + // Create useful helper objects for these. + this.pathTemplates = { + connectionPathTemplate: new this._gaxModule.PathTemplate( + 'projects/{project}/locations/{location}/connections/{connection}' + ), + locationPathTemplate: new this._gaxModule.PathTemplate( + 'projects/{project}/locations/{location}' + ), + }; + + // Some of the methods on this service return "paged" results, + // (e.g. 50 results at a time, with tokens to get subsequent + // pages). Denote the keys used for pagination and results. + this.descriptors.page = { + listConnections: new this._gaxModule.PageDescriptor( + 'pageToken', + 'nextPageToken', + 'connections' + ), + }; + + // Put together the default options sent with requests. + this._defaults = this._gaxGrpc.constructSettings( + 'google.cloud.bigquery.connection.v1.ConnectionService', + gapicConfig as gax.ClientConfig, + opts.clientConfig || {}, + {'x-goog-api-client': clientHeader.join(' ')} + ); + + // Set up a dictionary of "inner API calls"; the core implementation + // of calling the API is handled in `google-gax`, with this code + // merely providing the destination and request information. + this.innerApiCalls = {}; + + // Add a warn function to the client constructor so it can be easily tested. + this.warn = this._gaxModule.warn; + } + + /** + * Initialize the client. + * Performs asynchronous operations (such as authentication) and prepares the client. + * This function will be called automatically when any class method is called for the + * first time, but if you need to initialize it before calling an actual method, + * feel free to call initialize() directly. + * + * You can await on this method if you want to make sure the client is initialized. + * + * @returns {Promise} A promise that resolves to an authenticated service stub. + */ + initialize() { + // If the client stub promise is already initialized, return immediately. + if (this.connectionServiceStub) { + return this.connectionServiceStub; + } + + // Put together the "service stub" for + // google.cloud.bigquery.connection.v1.ConnectionService. + this.connectionServiceStub = this._gaxGrpc.createStub( + this._opts.fallback + ? (this._protos as protobuf.Root).lookupService( + 'google.cloud.bigquery.connection.v1.ConnectionService' + ) + : // eslint-disable-next-line @typescript-eslint/no-explicit-any + (this._protos as any).google.cloud.bigquery.connection.v1 + .ConnectionService, + this._opts, + this._providedCustomServicePath + ) as Promise<{[method: string]: Function}>; + + // Iterate over each of the methods that the service provides + // and create an API call method for each. + const connectionServiceStubMethods = [ + 'createConnection', + 'getConnection', + 'listConnections', + 'updateConnection', + 'deleteConnection', + 'getIamPolicy', + 'setIamPolicy', + 'testIamPermissions', + ]; + for (const methodName of connectionServiceStubMethods) { + const callPromise = this.connectionServiceStub.then( + stub => + (...args: Array<{}>) => { + if (this._terminated) { + return Promise.reject('The client has already been closed.'); + } + const func = stub[methodName]; + return func.apply(stub, args); + }, + (err: Error | null | undefined) => () => { + throw err; + } + ); + + const descriptor = this.descriptors.page[methodName] || undefined; + const apiCall = this._gaxModule.createApiCall( + callPromise, + this._defaults[methodName], + descriptor, + this._opts.fallback + ); + + this.innerApiCalls[methodName] = apiCall; + } + + return this.connectionServiceStub; + } + + /** + * The DNS address for this API service. + * @returns {string} The DNS address for this service. + */ + static get servicePath() { + return 'bigqueryconnection.googleapis.com'; + } + + /** + * The DNS address for this API service - same as servicePath(), + * exists for compatibility reasons. + * @returns {string} The DNS address for this service. + */ + static get apiEndpoint() { + return 'bigqueryconnection.googleapis.com'; + } + + /** + * The port for this API service. + * @returns {number} The default port for this service. + */ + static get port() { + return 443; + } + + /** + * The scopes needed to make gRPC calls for every method defined + * in this service. + * @returns {string[]} List of default scopes. + */ + static get scopes() { + return [ + 'https://www.googleapis.com/auth/bigquery', + 'https://www.googleapis.com/auth/cloud-platform', + ]; + } + + getProjectId(): Promise; + getProjectId(callback: Callback): void; + /** + * Return the project ID used by this class. + * @returns {Promise} A promise that resolves to string containing the project ID. + */ + getProjectId( + callback?: Callback + ): Promise | void { + if (callback) { + this.auth.getProjectId(callback); + return; + } + return this.auth.getProjectId(); + } + + // ------------------- + // -- Service calls -- + // ------------------- + /** + * Creates a new connection. + * + * @param {Object} request + * The request object that will be sent. + * @param {string} request.parent + * Required. Parent resource name. + * Must be in the format `projects/{project_id}/locations/{location_id}` + * @param {string} [request.connectionId] + * Optional. Connection id that should be assigned to the created connection. + * @param {google.cloud.bigquery.connection.v1.Connection} request.connection + * Required. Connection to create. + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Promise} - The promise which resolves to an array. + * The first element of the array is an object representing [Connection]{@link google.cloud.bigquery.connection.v1.Connection}. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#regular-methods) + * for more details and examples. + * @example include:samples/generated/v1/connection_service.create_connection.js + * region_tag:bigqueryconnection_v1_generated_ConnectionService_CreateConnection_async + */ + createConnection( + request?: protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest, + options?: CallOptions + ): Promise< + [ + protos.google.cloud.bigquery.connection.v1.IConnection, + ( + | protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest + | undefined + ), + {} | undefined + ] + >; + createConnection( + request: protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest, + options: CallOptions, + callback: Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): void; + createConnection( + request: protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest, + callback: Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): void; + createConnection( + request?: protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest, + optionsOrCallback?: + | CallOptions + | Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest + | null + | undefined, + {} | null | undefined + >, + callback?: Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): Promise< + [ + protos.google.cloud.bigquery.connection.v1.IConnection, + ( + | protos.google.cloud.bigquery.connection.v1.ICreateConnectionRequest + | undefined + ), + {} | undefined + ] + > | void { + request = request || {}; + let options: CallOptions; + if (typeof optionsOrCallback === 'function' && callback === undefined) { + callback = optionsOrCallback; + options = {}; + } else { + options = optionsOrCallback as CallOptions; + } + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + parent: request.parent ?? '', + }); + this.initialize(); + return this.innerApiCalls.createConnection(request, options, callback); + } + /** + * Returns specified connection. + * + * @param {Object} request + * The request object that will be sent. + * @param {string} request.name + * Required. Name of the requested connection, for example: + * `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Promise} - The promise which resolves to an array. + * The first element of the array is an object representing [Connection]{@link google.cloud.bigquery.connection.v1.Connection}. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#regular-methods) + * for more details and examples. + * @example include:samples/generated/v1/connection_service.get_connection.js + * region_tag:bigqueryconnection_v1_generated_ConnectionService_GetConnection_async + */ + getConnection( + request?: protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest, + options?: CallOptions + ): Promise< + [ + protos.google.cloud.bigquery.connection.v1.IConnection, + ( + | protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest + | undefined + ), + {} | undefined + ] + >; + getConnection( + request: protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest, + options: CallOptions, + callback: Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): void; + getConnection( + request: protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest, + callback: Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): void; + getConnection( + request?: protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest, + optionsOrCallback?: + | CallOptions + | Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest + | null + | undefined, + {} | null | undefined + >, + callback?: Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): Promise< + [ + protos.google.cloud.bigquery.connection.v1.IConnection, + ( + | protos.google.cloud.bigquery.connection.v1.IGetConnectionRequest + | undefined + ), + {} | undefined + ] + > | void { + request = request || {}; + let options: CallOptions; + if (typeof optionsOrCallback === 'function' && callback === undefined) { + callback = optionsOrCallback; + options = {}; + } else { + options = optionsOrCallback as CallOptions; + } + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + name: request.name ?? '', + }); + this.initialize(); + return this.innerApiCalls.getConnection(request, options, callback); + } + /** + * Updates the specified connection. For security reasons, also resets + * credential if connection properties are in the update field mask. + * + * @param {Object} request + * The request object that will be sent. + * @param {string} request.name + * Required. Name of the connection to update, for example: + * `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + * @param {google.cloud.bigquery.connection.v1.Connection} request.connection + * Required. Connection containing the updated fields. + * @param {google.protobuf.FieldMask} request.updateMask + * Required. Update mask for the connection fields to be updated. + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Promise} - The promise which resolves to an array. + * The first element of the array is an object representing [Connection]{@link google.cloud.bigquery.connection.v1.Connection}. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#regular-methods) + * for more details and examples. + * @example include:samples/generated/v1/connection_service.update_connection.js + * region_tag:bigqueryconnection_v1_generated_ConnectionService_UpdateConnection_async + */ + updateConnection( + request?: protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest, + options?: CallOptions + ): Promise< + [ + protos.google.cloud.bigquery.connection.v1.IConnection, + ( + | protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest + | undefined + ), + {} | undefined + ] + >; + updateConnection( + request: protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest, + options: CallOptions, + callback: Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): void; + updateConnection( + request: protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest, + callback: Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): void; + updateConnection( + request?: protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest, + optionsOrCallback?: + | CallOptions + | Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest + | null + | undefined, + {} | null | undefined + >, + callback?: Callback< + protos.google.cloud.bigquery.connection.v1.IConnection, + | protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): Promise< + [ + protos.google.cloud.bigquery.connection.v1.IConnection, + ( + | protos.google.cloud.bigquery.connection.v1.IUpdateConnectionRequest + | undefined + ), + {} | undefined + ] + > | void { + request = request || {}; + let options: CallOptions; + if (typeof optionsOrCallback === 'function' && callback === undefined) { + callback = optionsOrCallback; + options = {}; + } else { + options = optionsOrCallback as CallOptions; + } + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + name: request.name ?? '', + }); + this.initialize(); + return this.innerApiCalls.updateConnection(request, options, callback); + } + /** + * Deletes connection and associated credential. + * + * @param {Object} request + * The request object that will be sent. + * @param {string} request.name + * Required. Name of the deleted connection, for example: + * `projects/{project_id}/locations/{location_id}/connections/{connection_id}` + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Promise} - The promise which resolves to an array. + * The first element of the array is an object representing [Empty]{@link google.protobuf.Empty}. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#regular-methods) + * for more details and examples. + * @example include:samples/generated/v1/connection_service.delete_connection.js + * region_tag:bigqueryconnection_v1_generated_ConnectionService_DeleteConnection_async + */ + deleteConnection( + request?: protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest, + options?: CallOptions + ): Promise< + [ + protos.google.protobuf.IEmpty, + ( + | protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest + | undefined + ), + {} | undefined + ] + >; + deleteConnection( + request: protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest, + options: CallOptions, + callback: Callback< + protos.google.protobuf.IEmpty, + | protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): void; + deleteConnection( + request: protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest, + callback: Callback< + protos.google.protobuf.IEmpty, + | protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): void; + deleteConnection( + request?: protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest, + optionsOrCallback?: + | CallOptions + | Callback< + protos.google.protobuf.IEmpty, + | protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest + | null + | undefined, + {} | null | undefined + >, + callback?: Callback< + protos.google.protobuf.IEmpty, + | protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest + | null + | undefined, + {} | null | undefined + > + ): Promise< + [ + protos.google.protobuf.IEmpty, + ( + | protos.google.cloud.bigquery.connection.v1.IDeleteConnectionRequest + | undefined + ), + {} | undefined + ] + > | void { + request = request || {}; + let options: CallOptions; + if (typeof optionsOrCallback === 'function' && callback === undefined) { + callback = optionsOrCallback; + options = {}; + } else { + options = optionsOrCallback as CallOptions; + } + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + name: request.name ?? '', + }); + this.initialize(); + return this.innerApiCalls.deleteConnection(request, options, callback); + } + /** + * Gets the access control policy for a resource. + * Returns an empty policy if the resource exists and does not have a policy + * set. + * + * @param {Object} request + * The request object that will be sent. + * @param {string} request.resource + * REQUIRED: The resource for which the policy is being requested. + * See the operation documentation for the appropriate value for this field. + * @param {google.iam.v1.GetPolicyOptions} request.options + * OPTIONAL: A `GetPolicyOptions` object for specifying options to + * `GetIamPolicy`. + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Promise} - The promise which resolves to an array. + * The first element of the array is an object representing [Policy]{@link google.iam.v1.Policy}. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#regular-methods) + * for more details and examples. + * @example include:samples/generated/v1/connection_service.get_iam_policy.js + * region_tag:bigqueryconnection_v1_generated_ConnectionService_GetIamPolicy_async + */ + getIamPolicy( + request?: protos.google.iam.v1.IGetIamPolicyRequest, + options?: CallOptions + ): Promise< + [ + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.IGetIamPolicyRequest | undefined, + {} | undefined + ] + >; + getIamPolicy( + request: protos.google.iam.v1.IGetIamPolicyRequest, + options: CallOptions, + callback: Callback< + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.IGetIamPolicyRequest | null | undefined, + {} | null | undefined + > + ): void; + getIamPolicy( + request: protos.google.iam.v1.IGetIamPolicyRequest, + callback: Callback< + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.IGetIamPolicyRequest | null | undefined, + {} | null | undefined + > + ): void; + getIamPolicy( + request?: protos.google.iam.v1.IGetIamPolicyRequest, + optionsOrCallback?: + | CallOptions + | Callback< + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.IGetIamPolicyRequest | null | undefined, + {} | null | undefined + >, + callback?: Callback< + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.IGetIamPolicyRequest | null | undefined, + {} | null | undefined + > + ): Promise< + [ + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.IGetIamPolicyRequest | undefined, + {} | undefined + ] + > | void { + request = request || {}; + let options: CallOptions; + if (typeof optionsOrCallback === 'function' && callback === undefined) { + callback = optionsOrCallback; + options = {}; + } else { + options = optionsOrCallback as CallOptions; + } + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + resource: request.resource ?? '', + }); + this.initialize(); + return this.innerApiCalls.getIamPolicy(request, options, callback); + } + /** + * Sets the access control policy on the specified resource. Replaces any + * existing policy. + * + * Can return `NOT_FOUND`, `INVALID_ARGUMENT`, and `PERMISSION_DENIED` errors. + * + * @param {Object} request + * The request object that will be sent. + * @param {string} request.resource + * REQUIRED: The resource for which the policy is being specified. + * See the operation documentation for the appropriate value for this field. + * @param {google.iam.v1.Policy} request.policy + * REQUIRED: The complete policy to be applied to the `resource`. The size of + * the policy is limited to a few 10s of KB. An empty policy is a + * valid policy but certain Cloud Platform services (such as Projects) + * might reject them. + * @param {google.protobuf.FieldMask} request.updateMask + * OPTIONAL: A FieldMask specifying which fields of the policy to modify. Only + * the fields in the mask will be modified. If no mask is provided, the + * following default mask is used: + * + * `paths: "bindings, etag"` + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Promise} - The promise which resolves to an array. + * The first element of the array is an object representing [Policy]{@link google.iam.v1.Policy}. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#regular-methods) + * for more details and examples. + * @example include:samples/generated/v1/connection_service.set_iam_policy.js + * region_tag:bigqueryconnection_v1_generated_ConnectionService_SetIamPolicy_async + */ + setIamPolicy( + request?: protos.google.iam.v1.ISetIamPolicyRequest, + options?: CallOptions + ): Promise< + [ + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.ISetIamPolicyRequest | undefined, + {} | undefined + ] + >; + setIamPolicy( + request: protos.google.iam.v1.ISetIamPolicyRequest, + options: CallOptions, + callback: Callback< + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.ISetIamPolicyRequest | null | undefined, + {} | null | undefined + > + ): void; + setIamPolicy( + request: protos.google.iam.v1.ISetIamPolicyRequest, + callback: Callback< + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.ISetIamPolicyRequest | null | undefined, + {} | null | undefined + > + ): void; + setIamPolicy( + request?: protos.google.iam.v1.ISetIamPolicyRequest, + optionsOrCallback?: + | CallOptions + | Callback< + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.ISetIamPolicyRequest | null | undefined, + {} | null | undefined + >, + callback?: Callback< + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.ISetIamPolicyRequest | null | undefined, + {} | null | undefined + > + ): Promise< + [ + protos.google.iam.v1.IPolicy, + protos.google.iam.v1.ISetIamPolicyRequest | undefined, + {} | undefined + ] + > | void { + request = request || {}; + let options: CallOptions; + if (typeof optionsOrCallback === 'function' && callback === undefined) { + callback = optionsOrCallback; + options = {}; + } else { + options = optionsOrCallback as CallOptions; + } + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + resource: request.resource ?? '', + }); + this.initialize(); + return this.innerApiCalls.setIamPolicy(request, options, callback); + } + /** + * Returns permissions that a caller has on the specified resource. + * If the resource does not exist, this will return an empty set of + * permissions, not a `NOT_FOUND` error. + * + * Note: This operation is designed to be used for building permission-aware + * UIs and command-line tools, not for authorization checking. This operation + * may "fail open" without warning. + * + * @param {Object} request + * The request object that will be sent. + * @param {string} request.resource + * REQUIRED: The resource for which the policy detail is being requested. + * See the operation documentation for the appropriate value for this field. + * @param {string[]} request.permissions + * The set of permissions to check for the `resource`. Permissions with + * wildcards (such as '*' or 'storage.*') are not allowed. For more + * information see + * [IAM Overview](https://cloud.google.com/iam/docs/overview#permissions). + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Promise} - The promise which resolves to an array. + * The first element of the array is an object representing [TestIamPermissionsResponse]{@link google.iam.v1.TestIamPermissionsResponse}. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#regular-methods) + * for more details and examples. + * @example include:samples/generated/v1/connection_service.test_iam_permissions.js + * region_tag:bigqueryconnection_v1_generated_ConnectionService_TestIamPermissions_async + */ + testIamPermissions( + request?: protos.google.iam.v1.ITestIamPermissionsRequest, + options?: CallOptions + ): Promise< + [ + protos.google.iam.v1.ITestIamPermissionsResponse, + protos.google.iam.v1.ITestIamPermissionsRequest | undefined, + {} | undefined + ] + >; + testIamPermissions( + request: protos.google.iam.v1.ITestIamPermissionsRequest, + options: CallOptions, + callback: Callback< + protos.google.iam.v1.ITestIamPermissionsResponse, + protos.google.iam.v1.ITestIamPermissionsRequest | null | undefined, + {} | null | undefined + > + ): void; + testIamPermissions( + request: protos.google.iam.v1.ITestIamPermissionsRequest, + callback: Callback< + protos.google.iam.v1.ITestIamPermissionsResponse, + protos.google.iam.v1.ITestIamPermissionsRequest | null | undefined, + {} | null | undefined + > + ): void; + testIamPermissions( + request?: protos.google.iam.v1.ITestIamPermissionsRequest, + optionsOrCallback?: + | CallOptions + | Callback< + protos.google.iam.v1.ITestIamPermissionsResponse, + protos.google.iam.v1.ITestIamPermissionsRequest | null | undefined, + {} | null | undefined + >, + callback?: Callback< + protos.google.iam.v1.ITestIamPermissionsResponse, + protos.google.iam.v1.ITestIamPermissionsRequest | null | undefined, + {} | null | undefined + > + ): Promise< + [ + protos.google.iam.v1.ITestIamPermissionsResponse, + protos.google.iam.v1.ITestIamPermissionsRequest | undefined, + {} | undefined + ] + > | void { + request = request || {}; + let options: CallOptions; + if (typeof optionsOrCallback === 'function' && callback === undefined) { + callback = optionsOrCallback; + options = {}; + } else { + options = optionsOrCallback as CallOptions; + } + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + resource: request.resource ?? '', + }); + this.initialize(); + return this.innerApiCalls.testIamPermissions(request, options, callback); + } + + /** + * Returns a list of connections in the given project. + * + * @param {Object} request + * The request object that will be sent. + * @param {string} request.parent + * Required. Parent resource name. + * Must be in the form: `projects/{project_id}/locations/{location_id}` + * @param {number} request.pageSize + * Required. Page size. + * @param {string} request.pageToken + * Page token. + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Promise} - The promise which resolves to an array. + * The first element of the array is Array of [Connection]{@link google.cloud.bigquery.connection.v1.Connection}. + * The client library will perform auto-pagination by default: it will call the API as many + * times as needed and will merge results from all the pages into this array. + * Note that it can affect your quota. + * We recommend using `listConnectionsAsync()` + * method described below for async iteration which you can stop as needed. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#auto-pagination) + * for more details and examples. + */ + listConnections( + request?: protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + options?: CallOptions + ): Promise< + [ + protos.google.cloud.bigquery.connection.v1.IConnection[], + protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest | null, + protos.google.cloud.bigquery.connection.v1.IListConnectionsResponse + ] + >; + listConnections( + request: protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + options: CallOptions, + callback: PaginationCallback< + protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + | protos.google.cloud.bigquery.connection.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.bigquery.connection.v1.IConnection + > + ): void; + listConnections( + request: protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + callback: PaginationCallback< + protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + | protos.google.cloud.bigquery.connection.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.bigquery.connection.v1.IConnection + > + ): void; + listConnections( + request?: protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + optionsOrCallback?: + | CallOptions + | PaginationCallback< + protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + | protos.google.cloud.bigquery.connection.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.bigquery.connection.v1.IConnection + >, + callback?: PaginationCallback< + protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + | protos.google.cloud.bigquery.connection.v1.IListConnectionsResponse + | null + | undefined, + protos.google.cloud.bigquery.connection.v1.IConnection + > + ): Promise< + [ + protos.google.cloud.bigquery.connection.v1.IConnection[], + protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest | null, + protos.google.cloud.bigquery.connection.v1.IListConnectionsResponse + ] + > | void { + request = request || {}; + let options: CallOptions; + if (typeof optionsOrCallback === 'function' && callback === undefined) { + callback = optionsOrCallback; + options = {}; + } else { + options = optionsOrCallback as CallOptions; + } + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + parent: request.parent ?? '', + }); + this.initialize(); + return this.innerApiCalls.listConnections(request, options, callback); + } + + /** + * Equivalent to `method.name.toCamelCase()`, but returns a NodeJS Stream object. + * @param {Object} request + * The request object that will be sent. + * @param {string} request.parent + * Required. Parent resource name. + * Must be in the form: `projects/{project_id}/locations/{location_id}` + * @param {number} request.pageSize + * Required. Page size. + * @param {string} request.pageToken + * Page token. + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Stream} + * An object stream which emits an object representing [Connection]{@link google.cloud.bigquery.connection.v1.Connection} on 'data' event. + * The client library will perform auto-pagination by default: it will call the API as many + * times as needed. Note that it can affect your quota. + * We recommend using `listConnectionsAsync()` + * method described below for async iteration which you can stop as needed. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#auto-pagination) + * for more details and examples. + */ + listConnectionsStream( + request?: protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + options?: CallOptions + ): Transform { + request = request || {}; + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + parent: request.parent ?? '', + }); + const defaultCallSettings = this._defaults['listConnections']; + const callSettings = defaultCallSettings.merge(options); + this.initialize(); + return this.descriptors.page.listConnections.createStream( + this.innerApiCalls.listConnections as GaxCall, + request, + callSettings + ); + } + + /** + * Equivalent to `listConnections`, but returns an iterable object. + * + * `for`-`await`-`of` syntax is used with the iterable to get response elements on-demand. + * @param {Object} request + * The request object that will be sent. + * @param {string} request.parent + * Required. Parent resource name. + * Must be in the form: `projects/{project_id}/locations/{location_id}` + * @param {number} request.pageSize + * Required. Page size. + * @param {string} request.pageToken + * Page token. + * @param {object} [options] + * Call options. See {@link https://googleapis.dev/nodejs/google-gax/latest/interfaces/CallOptions.html|CallOptions} for more details. + * @returns {Object} + * An iterable Object that allows [async iteration](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Iteration_protocols). + * When you iterate the returned iterable, each element will be an object representing + * [Connection]{@link google.cloud.bigquery.connection.v1.Connection}. The API will be called under the hood as needed, once per the page, + * so you can stop the iteration when you don't need more results. + * Please see the + * [documentation](https://github.com/googleapis/gax-nodejs/blob/master/client-libraries.md#auto-pagination) + * for more details and examples. + * @example include:samples/generated/v1/connection_service.list_connections.js + * region_tag:bigqueryconnection_v1_generated_ConnectionService_ListConnections_async + */ + listConnectionsAsync( + request?: protos.google.cloud.bigquery.connection.v1.IListConnectionsRequest, + options?: CallOptions + ): AsyncIterable { + request = request || {}; + options = options || {}; + options.otherArgs = options.otherArgs || {}; + options.otherArgs.headers = options.otherArgs.headers || {}; + options.otherArgs.headers['x-goog-request-params'] = + this._gaxModule.routingHeader.fromParams({ + parent: request.parent ?? '', + }); + const defaultCallSettings = this._defaults['listConnections']; + const callSettings = defaultCallSettings.merge(options); + this.initialize(); + return this.descriptors.page.listConnections.asyncIterate( + this.innerApiCalls['listConnections'] as GaxCall, + request as {}, + callSettings + ) as AsyncIterable; + } + // -------------------- + // -- Path templates -- + // -------------------- + + /** + * Return a fully-qualified connection resource name string. + * + * @param {string} project + * @param {string} location + * @param {string} connection + * @returns {string} Resource name string. + */ + connectionPath(project: string, location: string, connection: string) { + return this.pathTemplates.connectionPathTemplate.render({ + project: project, + location: location, + connection: connection, + }); + } + + /** + * Parse the project from Connection resource. + * + * @param {string} connectionName + * A fully-qualified path representing Connection resource. + * @returns {string} A string representing the project. + */ + matchProjectFromConnectionName(connectionName: string) { + return this.pathTemplates.connectionPathTemplate.match(connectionName) + .project; + } + + /** + * Parse the location from Connection resource. + * + * @param {string} connectionName + * A fully-qualified path representing Connection resource. + * @returns {string} A string representing the location. + */ + matchLocationFromConnectionName(connectionName: string) { + return this.pathTemplates.connectionPathTemplate.match(connectionName) + .location; + } + + /** + * Parse the connection from Connection resource. + * + * @param {string} connectionName + * A fully-qualified path representing Connection resource. + * @returns {string} A string representing the connection. + */ + matchConnectionFromConnectionName(connectionName: string) { + return this.pathTemplates.connectionPathTemplate.match(connectionName) + .connection; + } + + /** + * Return a fully-qualified location resource name string. + * + * @param {string} project + * @param {string} location + * @returns {string} Resource name string. + */ + locationPath(project: string, location: string) { + return this.pathTemplates.locationPathTemplate.render({ + project: project, + location: location, + }); + } + + /** + * Parse the project from Location resource. + * + * @param {string} locationName + * A fully-qualified path representing Location resource. + * @returns {string} A string representing the project. + */ + matchProjectFromLocationName(locationName: string) { + return this.pathTemplates.locationPathTemplate.match(locationName).project; + } + + /** + * Parse the location from Location resource. + * + * @param {string} locationName + * A fully-qualified path representing Location resource. + * @returns {string} A string representing the location. + */ + matchLocationFromLocationName(locationName: string) { + return this.pathTemplates.locationPathTemplate.match(locationName).location; + } + + /** + * Terminate the gRPC channel and close the client. + * + * The client will no longer be usable and all future behavior is undefined. + * @returns {Promise} A promise that resolves when the client is closed. + */ + close(): Promise { + if (this.connectionServiceStub && !this._terminated) { + return this.connectionServiceStub.then(stub => { + this._terminated = true; + stub.close(); + }); + } + return Promise.resolve(); + } +} diff --git a/packages/google-cloud-bigquery-connection/src/v1/connection_service_client_config.json b/packages/google-cloud-bigquery-connection/src/v1/connection_service_client_config.json new file mode 100644 index 00000000000..14ceae166e2 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/src/v1/connection_service_client_config.json @@ -0,0 +1,66 @@ +{ + "interfaces": { + "google.cloud.bigquery.connection.v1.ConnectionService": { + "retry_codes": { + "non_idempotent": [], + "idempotent": [ + "DEADLINE_EXCEEDED", + "UNAVAILABLE" + ] + }, + "retry_params": { + "default": { + "initial_retry_delay_millis": 100, + "retry_delay_multiplier": 1.3, + "max_retry_delay_millis": 60000, + "initial_rpc_timeout_millis": 60000, + "rpc_timeout_multiplier": 1, + "max_rpc_timeout_millis": 60000, + "total_timeout_millis": 600000 + } + }, + "methods": { + "CreateConnection": { + "timeout_millis": 60000, + "retry_codes_name": "non_idempotent", + "retry_params_name": "default" + }, + "GetConnection": { + "timeout_millis": 60000, + "retry_codes_name": "idempotent", + "retry_params_name": "default" + }, + "ListConnections": { + "timeout_millis": 60000, + "retry_codes_name": "idempotent", + "retry_params_name": "default" + }, + "UpdateConnection": { + "timeout_millis": 60000, + "retry_codes_name": "non_idempotent", + "retry_params_name": "default" + }, + "DeleteConnection": { + "timeout_millis": 60000, + "retry_codes_name": "idempotent", + "retry_params_name": "default" + }, + "GetIamPolicy": { + "timeout_millis": 60000, + "retry_codes_name": "non_idempotent", + "retry_params_name": "default" + }, + "SetIamPolicy": { + "timeout_millis": 60000, + "retry_codes_name": "non_idempotent", + "retry_params_name": "default" + }, + "TestIamPermissions": { + "timeout_millis": 60000, + "retry_codes_name": "non_idempotent", + "retry_params_name": "default" + } + } + } + } +} diff --git a/packages/google-cloud-bigquery-connection/src/v1/connection_service_proto_list.json b/packages/google-cloud-bigquery-connection/src/v1/connection_service_proto_list.json new file mode 100644 index 00000000000..4ab50b0f47b --- /dev/null +++ b/packages/google-cloud-bigquery-connection/src/v1/connection_service_proto_list.json @@ -0,0 +1,3 @@ +[ + "../../protos/google/cloud/bigquery/connection/v1/connection.proto" +] diff --git a/packages/google-cloud-bigquery-connection/src/v1/gapic_metadata.json b/packages/google-cloud-bigquery-connection/src/v1/gapic_metadata.json new file mode 100644 index 00000000000..7096301cfca --- /dev/null +++ b/packages/google-cloud-bigquery-connection/src/v1/gapic_metadata.json @@ -0,0 +1,107 @@ +{ + "schema": "1.0", + "comment": "This file maps proto services/RPCs to the corresponding library clients/methods", + "language": "typescript", + "protoPackage": "google.cloud.bigquery.connection.v1", + "libraryPackage": "@google-cloud/bigquery-connection", + "services": { + "ConnectionService": { + "clients": { + "grpc": { + "libraryClient": "ConnectionServiceClient", + "rpcs": { + "CreateConnection": { + "methods": [ + "createConnection" + ] + }, + "GetConnection": { + "methods": [ + "getConnection" + ] + }, + "UpdateConnection": { + "methods": [ + "updateConnection" + ] + }, + "DeleteConnection": { + "methods": [ + "deleteConnection" + ] + }, + "GetIamPolicy": { + "methods": [ + "getIamPolicy" + ] + }, + "SetIamPolicy": { + "methods": [ + "setIamPolicy" + ] + }, + "TestIamPermissions": { + "methods": [ + "testIamPermissions" + ] + }, + "ListConnections": { + "methods": [ + "listConnections", + "listConnectionsStream", + "listConnectionsAsync" + ] + } + } + }, + "grpc-fallback": { + "libraryClient": "ConnectionServiceClient", + "rpcs": { + "CreateConnection": { + "methods": [ + "createConnection" + ] + }, + "GetConnection": { + "methods": [ + "getConnection" + ] + }, + "UpdateConnection": { + "methods": [ + "updateConnection" + ] + }, + "DeleteConnection": { + "methods": [ + "deleteConnection" + ] + }, + "GetIamPolicy": { + "methods": [ + "getIamPolicy" + ] + }, + "SetIamPolicy": { + "methods": [ + "setIamPolicy" + ] + }, + "TestIamPermissions": { + "methods": [ + "testIamPermissions" + ] + }, + "ListConnections": { + "methods": [ + "listConnections", + "listConnectionsStream", + "listConnectionsAsync" + ] + } + } + } + } + } + } +} diff --git a/packages/google-cloud-bigquery-connection/src/v1/index.ts b/packages/google-cloud-bigquery-connection/src/v1/index.ts new file mode 100644 index 00000000000..96ac493e47f --- /dev/null +++ b/packages/google-cloud-bigquery-connection/src/v1/index.ts @@ -0,0 +1,19 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +export {ConnectionServiceClient} from './connection_service_client'; diff --git a/packages/google-cloud-bigquery-connection/system-test/fixtures/sample/src/index.js b/packages/google-cloud-bigquery-connection/system-test/fixtures/sample/src/index.js new file mode 100644 index 00000000000..5fc76824528 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/system-test/fixtures/sample/src/index.js @@ -0,0 +1,26 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +/* eslint-disable node/no-missing-require, no-unused-vars */ +const connection = require('@google-cloud/bigquery-connection'); + +function main() { + const connectionServiceClient = new connection.ConnectionServiceClient(); +} + +main(); diff --git a/packages/google-cloud-bigquery-connection/system-test/fixtures/sample/src/index.ts b/packages/google-cloud-bigquery-connection/system-test/fixtures/sample/src/index.ts new file mode 100644 index 00000000000..8ec60e65384 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/system-test/fixtures/sample/src/index.ts @@ -0,0 +1,32 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +import {ConnectionServiceClient} from '@google-cloud/bigquery-connection'; + +// check that the client class type name can be used +function doStuffWithConnectionServiceClient(client: ConnectionServiceClient) { + client.close(); +} + +function main() { + // check that the client instance can be created + const connectionServiceClient = new ConnectionServiceClient(); + doStuffWithConnectionServiceClient(connectionServiceClient); +} + +main(); diff --git a/packages/google-cloud-bigquery-connection/system-test/install.ts b/packages/google-cloud-bigquery-connection/system-test/install.ts new file mode 100644 index 00000000000..6dd1eaadafa --- /dev/null +++ b/packages/google-cloud-bigquery-connection/system-test/install.ts @@ -0,0 +1,51 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +import {packNTest} from 'pack-n-play'; +import {readFileSync} from 'fs'; +import {describe, it} from 'mocha'; + +describe('📦 pack-n-play test', () => { + it('TypeScript code', async function () { + this.timeout(300000); + const options = { + packageDir: process.cwd(), + sample: { + description: 'TypeScript user can use the type definitions', + ts: readFileSync( + './system-test/fixtures/sample/src/index.ts' + ).toString(), + }, + }; + await packNTest(options); + }); + + it('JavaScript code', async function () { + this.timeout(300000); + const options = { + packageDir: process.cwd(), + sample: { + description: 'JavaScript user can use the library', + ts: readFileSync( + './system-test/fixtures/sample/src/index.js' + ).toString(), + }, + }; + await packNTest(options); + }); +}); diff --git a/packages/google-cloud-bigquery-connection/test/gapic_connection_service_v1.ts b/packages/google-cloud-bigquery-connection/test/gapic_connection_service_v1.ts new file mode 100644 index 00000000000..de4d08ed4a9 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/test/gapic_connection_service_v1.ts @@ -0,0 +1,1586 @@ +// Copyright 2022 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// +// ** This file is automatically generated by gapic-generator-typescript. ** +// ** https://github.com/googleapis/gapic-generator-typescript ** +// ** All changes to this file may be overwritten. ** + +import * as protos from '../protos/protos'; +import * as assert from 'assert'; +import * as sinon from 'sinon'; +import {SinonStub} from 'sinon'; +import {describe, it} from 'mocha'; +import * as connectionserviceModule from '../src'; + +import {PassThrough} from 'stream'; + +import {protobuf} from 'google-gax'; + +// Dynamically loaded proto JSON is needed to get the type information +// to fill in default values for request objects +const root = protobuf.Root.fromJSON( + require('../protos/protos.json') +).resolveAll(); + +// eslint-disable-next-line @typescript-eslint/no-unused-vars +function getTypeDefaultValue(typeName: string, fields: string[]) { + let type = root.lookupType(typeName) as protobuf.Type; + for (const field of fields.slice(0, -1)) { + type = type.fields[field]?.resolvedType as protobuf.Type; + } + return type.fields[fields[fields.length - 1]]?.defaultValue; +} + +function generateSampleMessage(instance: T) { + const filledObject = ( + instance.constructor as typeof protobuf.Message + ).toObject(instance as protobuf.Message, {defaults: true}); + return (instance.constructor as typeof protobuf.Message).fromObject( + filledObject + ) as T; +} + +function stubSimpleCall(response?: ResponseType, error?: Error) { + return error + ? sinon.stub().rejects(error) + : sinon.stub().resolves([response]); +} + +function stubSimpleCallWithCallback( + response?: ResponseType, + error?: Error +) { + return error + ? sinon.stub().callsArgWith(2, error) + : sinon.stub().callsArgWith(2, null, response); +} + +function stubPageStreamingCall( + responses?: ResponseType[], + error?: Error +) { + const pagingStub = sinon.stub(); + if (responses) { + for (let i = 0; i < responses.length; ++i) { + pagingStub.onCall(i).callsArgWith(2, null, responses[i]); + } + } + const transformStub = error + ? sinon.stub().callsArgWith(2, error) + : pagingStub; + const mockStream = new PassThrough({ + objectMode: true, + transform: transformStub, + }); + // trigger as many responses as needed + if (responses) { + for (let i = 0; i < responses.length; ++i) { + setImmediate(() => { + mockStream.write({}); + }); + } + setImmediate(() => { + mockStream.end(); + }); + } else { + setImmediate(() => { + mockStream.write({}); + }); + setImmediate(() => { + mockStream.end(); + }); + } + return sinon.stub().returns(mockStream); +} + +function stubAsyncIterationCall( + responses?: ResponseType[], + error?: Error +) { + let counter = 0; + const asyncIterable = { + [Symbol.asyncIterator]() { + return { + async next() { + if (error) { + return Promise.reject(error); + } + if (counter >= responses!.length) { + return Promise.resolve({done: true, value: undefined}); + } + return Promise.resolve({done: false, value: responses![counter++]}); + }, + }; + }, + }; + return sinon.stub().returns(asyncIterable); +} + +describe('v1.ConnectionServiceClient', () => { + describe('Common methods', () => { + it('has servicePath', () => { + const servicePath = + connectionserviceModule.v1.ConnectionServiceClient.servicePath; + assert(servicePath); + }); + + it('has apiEndpoint', () => { + const apiEndpoint = + connectionserviceModule.v1.ConnectionServiceClient.apiEndpoint; + assert(apiEndpoint); + }); + + it('has port', () => { + const port = connectionserviceModule.v1.ConnectionServiceClient.port; + assert(port); + assert(typeof port === 'number'); + }); + + it('should create a client with no option', () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient(); + assert(client); + }); + + it('should create a client with gRPC fallback', () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + fallback: true, + }); + assert(client); + }); + + it('has initialize method and supports deferred initialization', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.connectionServiceStub, undefined); + await client.initialize(); + assert(client.connectionServiceStub); + }); + + it('has close method for the initialized client', done => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + assert(client.connectionServiceStub); + client.close().then(() => { + done(); + }); + }); + + it('has close method for the non-initialized client', done => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + assert.strictEqual(client.connectionServiceStub, undefined); + client.close().then(() => { + done(); + }); + }); + + it('has getProjectId method', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon.stub().resolves(fakeProjectId); + const result = await client.getProjectId(); + assert.strictEqual(result, fakeProjectId); + assert((client.auth.getProjectId as SinonStub).calledWithExactly()); + }); + + it('has getProjectId method with callback', async () => { + const fakeProjectId = 'fake-project-id'; + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.auth.getProjectId = sinon + .stub() + .callsArgWith(0, null, fakeProjectId); + const promise = new Promise((resolve, reject) => { + client.getProjectId((err?: Error | null, projectId?: string | null) => { + if (err) { + reject(err); + } else { + resolve(projectId); + } + }); + }); + const result = await promise; + assert.strictEqual(result, fakeProjectId); + }); + }); + + describe('createConnection', () => { + it('invokes createConnection without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.CreateConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.CreateConnectionRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ); + client.innerApiCalls.createConnection = stubSimpleCall(expectedResponse); + const [response] = await client.createConnection(request); + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.createConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.createConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes createConnection without error using callback', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.CreateConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.CreateConnectionRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ); + client.innerApiCalls.createConnection = + stubSimpleCallWithCallback(expectedResponse); + const promise = new Promise((resolve, reject) => { + client.createConnection( + request, + ( + err?: Error | null, + result?: protos.google.cloud.bigquery.connection.v1.IConnection | null + ) => { + if (err) { + reject(err); + } else { + resolve(result); + } + } + ); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.createConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.createConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes createConnection with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.CreateConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.CreateConnectionRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedError = new Error('expected'); + client.innerApiCalls.createConnection = stubSimpleCall( + undefined, + expectedError + ); + await assert.rejects(client.createConnection(request), expectedError); + const actualRequest = ( + client.innerApiCalls.createConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.createConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes createConnection with closed client', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.CreateConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.CreateConnectionRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedError = new Error('The client has already been closed.'); + client.close(); + await assert.rejects(client.createConnection(request), expectedError); + }); + }); + + describe('getConnection', () => { + it('invokes getConnection without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.GetConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.GetConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedHeaderRequestParams = `name=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ); + client.innerApiCalls.getConnection = stubSimpleCall(expectedResponse); + const [response] = await client.getConnection(request); + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.getConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.getConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes getConnection without error using callback', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.GetConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.GetConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedHeaderRequestParams = `name=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ); + client.innerApiCalls.getConnection = + stubSimpleCallWithCallback(expectedResponse); + const promise = new Promise((resolve, reject) => { + client.getConnection( + request, + ( + err?: Error | null, + result?: protos.google.cloud.bigquery.connection.v1.IConnection | null + ) => { + if (err) { + reject(err); + } else { + resolve(result); + } + } + ); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.getConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.getConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes getConnection with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.GetConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.GetConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedHeaderRequestParams = `name=${defaultValue1}`; + const expectedError = new Error('expected'); + client.innerApiCalls.getConnection = stubSimpleCall( + undefined, + expectedError + ); + await assert.rejects(client.getConnection(request), expectedError); + const actualRequest = ( + client.innerApiCalls.getConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.getConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes getConnection with closed client', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.GetConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.GetConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedError = new Error('The client has already been closed.'); + client.close(); + await assert.rejects(client.getConnection(request), expectedError); + }); + }); + + describe('updateConnection', () => { + it('invokes updateConnection without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.UpdateConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.UpdateConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedHeaderRequestParams = `name=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ); + client.innerApiCalls.updateConnection = stubSimpleCall(expectedResponse); + const [response] = await client.updateConnection(request); + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.updateConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.updateConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes updateConnection without error using callback', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.UpdateConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.UpdateConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedHeaderRequestParams = `name=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ); + client.innerApiCalls.updateConnection = + stubSimpleCallWithCallback(expectedResponse); + const promise = new Promise((resolve, reject) => { + client.updateConnection( + request, + ( + err?: Error | null, + result?: protos.google.cloud.bigquery.connection.v1.IConnection | null + ) => { + if (err) { + reject(err); + } else { + resolve(result); + } + } + ); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.updateConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.updateConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes updateConnection with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.UpdateConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.UpdateConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedHeaderRequestParams = `name=${defaultValue1}`; + const expectedError = new Error('expected'); + client.innerApiCalls.updateConnection = stubSimpleCall( + undefined, + expectedError + ); + await assert.rejects(client.updateConnection(request), expectedError); + const actualRequest = ( + client.innerApiCalls.updateConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.updateConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes updateConnection with closed client', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.UpdateConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.UpdateConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedError = new Error('The client has already been closed.'); + client.close(); + await assert.rejects(client.updateConnection(request), expectedError); + }); + }); + + describe('deleteConnection', () => { + it('invokes deleteConnection without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.DeleteConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.DeleteConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedHeaderRequestParams = `name=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.protobuf.Empty() + ); + client.innerApiCalls.deleteConnection = stubSimpleCall(expectedResponse); + const [response] = await client.deleteConnection(request); + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.deleteConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.deleteConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes deleteConnection without error using callback', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.DeleteConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.DeleteConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedHeaderRequestParams = `name=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.protobuf.Empty() + ); + client.innerApiCalls.deleteConnection = + stubSimpleCallWithCallback(expectedResponse); + const promise = new Promise((resolve, reject) => { + client.deleteConnection( + request, + ( + err?: Error | null, + result?: protos.google.protobuf.IEmpty | null + ) => { + if (err) { + reject(err); + } else { + resolve(result); + } + } + ); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.deleteConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.deleteConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes deleteConnection with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.DeleteConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.DeleteConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedHeaderRequestParams = `name=${defaultValue1}`; + const expectedError = new Error('expected'); + client.innerApiCalls.deleteConnection = stubSimpleCall( + undefined, + expectedError + ); + await assert.rejects(client.deleteConnection(request), expectedError); + const actualRequest = ( + client.innerApiCalls.deleteConnection as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.deleteConnection as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes deleteConnection with closed client', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.DeleteConnectionRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.DeleteConnectionRequest', + ['name'] + ); + request.name = defaultValue1; + const expectedError = new Error('The client has already been closed.'); + client.close(); + await assert.rejects(client.deleteConnection(request), expectedError); + }); + }); + + describe('getIamPolicy', () => { + it('invokes getIamPolicy without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.GetIamPolicyRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.GetIamPolicyRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedHeaderRequestParams = `resource=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.iam.v1.Policy() + ); + client.innerApiCalls.getIamPolicy = stubSimpleCall(expectedResponse); + const [response] = await client.getIamPolicy(request); + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.getIamPolicy as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.getIamPolicy as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes getIamPolicy without error using callback', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.GetIamPolicyRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.GetIamPolicyRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedHeaderRequestParams = `resource=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.iam.v1.Policy() + ); + client.innerApiCalls.getIamPolicy = + stubSimpleCallWithCallback(expectedResponse); + const promise = new Promise((resolve, reject) => { + client.getIamPolicy( + request, + ( + err?: Error | null, + result?: protos.google.iam.v1.IPolicy | null + ) => { + if (err) { + reject(err); + } else { + resolve(result); + } + } + ); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.getIamPolicy as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.getIamPolicy as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes getIamPolicy with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.GetIamPolicyRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.GetIamPolicyRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedHeaderRequestParams = `resource=${defaultValue1}`; + const expectedError = new Error('expected'); + client.innerApiCalls.getIamPolicy = stubSimpleCall( + undefined, + expectedError + ); + await assert.rejects(client.getIamPolicy(request), expectedError); + const actualRequest = ( + client.innerApiCalls.getIamPolicy as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.getIamPolicy as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes getIamPolicy with closed client', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.GetIamPolicyRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.GetIamPolicyRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedError = new Error('The client has already been closed.'); + client.close(); + await assert.rejects(client.getIamPolicy(request), expectedError); + }); + }); + + describe('setIamPolicy', () => { + it('invokes setIamPolicy without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.SetIamPolicyRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.SetIamPolicyRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedHeaderRequestParams = `resource=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.iam.v1.Policy() + ); + client.innerApiCalls.setIamPolicy = stubSimpleCall(expectedResponse); + const [response] = await client.setIamPolicy(request); + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.setIamPolicy as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.setIamPolicy as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes setIamPolicy without error using callback', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.SetIamPolicyRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.SetIamPolicyRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedHeaderRequestParams = `resource=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.iam.v1.Policy() + ); + client.innerApiCalls.setIamPolicy = + stubSimpleCallWithCallback(expectedResponse); + const promise = new Promise((resolve, reject) => { + client.setIamPolicy( + request, + ( + err?: Error | null, + result?: protos.google.iam.v1.IPolicy | null + ) => { + if (err) { + reject(err); + } else { + resolve(result); + } + } + ); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.setIamPolicy as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.setIamPolicy as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes setIamPolicy with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.SetIamPolicyRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.SetIamPolicyRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedHeaderRequestParams = `resource=${defaultValue1}`; + const expectedError = new Error('expected'); + client.innerApiCalls.setIamPolicy = stubSimpleCall( + undefined, + expectedError + ); + await assert.rejects(client.setIamPolicy(request), expectedError); + const actualRequest = ( + client.innerApiCalls.setIamPolicy as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.setIamPolicy as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes setIamPolicy with closed client', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.SetIamPolicyRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.SetIamPolicyRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedError = new Error('The client has already been closed.'); + client.close(); + await assert.rejects(client.setIamPolicy(request), expectedError); + }); + }); + + describe('testIamPermissions', () => { + it('invokes testIamPermissions without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.TestIamPermissionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.TestIamPermissionsRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedHeaderRequestParams = `resource=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.iam.v1.TestIamPermissionsResponse() + ); + client.innerApiCalls.testIamPermissions = + stubSimpleCall(expectedResponse); + const [response] = await client.testIamPermissions(request); + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.testIamPermissions as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.testIamPermissions as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes testIamPermissions without error using callback', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.TestIamPermissionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.TestIamPermissionsRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedHeaderRequestParams = `resource=${defaultValue1}`; + const expectedResponse = generateSampleMessage( + new protos.google.iam.v1.TestIamPermissionsResponse() + ); + client.innerApiCalls.testIamPermissions = + stubSimpleCallWithCallback(expectedResponse); + const promise = new Promise((resolve, reject) => { + client.testIamPermissions( + request, + ( + err?: Error | null, + result?: protos.google.iam.v1.ITestIamPermissionsResponse | null + ) => { + if (err) { + reject(err); + } else { + resolve(result); + } + } + ); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.testIamPermissions as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.testIamPermissions as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes testIamPermissions with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.TestIamPermissionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.TestIamPermissionsRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedHeaderRequestParams = `resource=${defaultValue1}`; + const expectedError = new Error('expected'); + client.innerApiCalls.testIamPermissions = stubSimpleCall( + undefined, + expectedError + ); + await assert.rejects(client.testIamPermissions(request), expectedError); + const actualRequest = ( + client.innerApiCalls.testIamPermissions as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.testIamPermissions as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes testIamPermissions with closed client', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.iam.v1.TestIamPermissionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.iam.v1.TestIamPermissionsRequest', + ['resource'] + ); + request.resource = defaultValue1; + const expectedError = new Error('The client has already been closed.'); + client.close(); + await assert.rejects(client.testIamPermissions(request), expectedError); + }); + }); + + describe('listConnections', () => { + it('invokes listConnections without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.ListConnectionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.ListConnectionsRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedResponse = [ + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + ]; + client.innerApiCalls.listConnections = stubSimpleCall(expectedResponse); + const [response] = await client.listConnections(request); + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes listConnections without error using callback', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.ListConnectionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.ListConnectionsRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedResponse = [ + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + ]; + client.innerApiCalls.listConnections = + stubSimpleCallWithCallback(expectedResponse); + const promise = new Promise((resolve, reject) => { + client.listConnections( + request, + ( + err?: Error | null, + result?: + | protos.google.cloud.bigquery.connection.v1.IConnection[] + | null + ) => { + if (err) { + reject(err); + } else { + resolve(result); + } + } + ); + }); + const response = await promise; + assert.deepStrictEqual(response, expectedResponse); + const actualRequest = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes listConnections with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.ListConnectionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.ListConnectionsRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedError = new Error('expected'); + client.innerApiCalls.listConnections = stubSimpleCall( + undefined, + expectedError + ); + await assert.rejects(client.listConnections(request), expectedError); + const actualRequest = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[0]; + assert.deepStrictEqual(actualRequest, request); + const actualHeaderRequestParams = ( + client.innerApiCalls.listConnections as SinonStub + ).getCall(0).args[1].otherArgs.headers['x-goog-request-params']; + assert(actualHeaderRequestParams.includes(expectedHeaderRequestParams)); + }); + + it('invokes listConnectionsStream without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.ListConnectionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.ListConnectionsRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedResponse = [ + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + ]; + client.descriptors.page.listConnections.createStream = + stubPageStreamingCall(expectedResponse); + const stream = client.listConnectionsStream(request); + const promise = new Promise((resolve, reject) => { + const responses: protos.google.cloud.bigquery.connection.v1.Connection[] = + []; + stream.on( + 'data', + (response: protos.google.cloud.bigquery.connection.v1.Connection) => { + responses.push(response); + } + ); + stream.on('end', () => { + resolve(responses); + }); + stream.on('error', (err: Error) => { + reject(err); + }); + }); + const responses = await promise; + assert.deepStrictEqual(responses, expectedResponse); + assert( + (client.descriptors.page.listConnections.createStream as SinonStub) + .getCall(0) + .calledWith(client.innerApiCalls.listConnections, request) + ); + assert( + (client.descriptors.page.listConnections.createStream as SinonStub) + .getCall(0) + .args[2].otherArgs.headers['x-goog-request-params'].includes( + expectedHeaderRequestParams + ) + ); + }); + + it('invokes listConnectionsStream with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.ListConnectionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.ListConnectionsRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedError = new Error('expected'); + client.descriptors.page.listConnections.createStream = + stubPageStreamingCall(undefined, expectedError); + const stream = client.listConnectionsStream(request); + const promise = new Promise((resolve, reject) => { + const responses: protos.google.cloud.bigquery.connection.v1.Connection[] = + []; + stream.on( + 'data', + (response: protos.google.cloud.bigquery.connection.v1.Connection) => { + responses.push(response); + } + ); + stream.on('end', () => { + resolve(responses); + }); + stream.on('error', (err: Error) => { + reject(err); + }); + }); + await assert.rejects(promise, expectedError); + assert( + (client.descriptors.page.listConnections.createStream as SinonStub) + .getCall(0) + .calledWith(client.innerApiCalls.listConnections, request) + ); + assert( + (client.descriptors.page.listConnections.createStream as SinonStub) + .getCall(0) + .args[2].otherArgs.headers['x-goog-request-params'].includes( + expectedHeaderRequestParams + ) + ); + }); + + it('uses async iteration with listConnections without error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.ListConnectionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.ListConnectionsRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedResponse = [ + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.Connection() + ), + ]; + client.descriptors.page.listConnections.asyncIterate = + stubAsyncIterationCall(expectedResponse); + const responses: protos.google.cloud.bigquery.connection.v1.IConnection[] = + []; + const iterable = client.listConnectionsAsync(request); + for await (const resource of iterable) { + responses.push(resource!); + } + assert.deepStrictEqual(responses, expectedResponse); + assert.deepStrictEqual( + ( + client.descriptors.page.listConnections.asyncIterate as SinonStub + ).getCall(0).args[1], + request + ); + assert( + (client.descriptors.page.listConnections.asyncIterate as SinonStub) + .getCall(0) + .args[2].otherArgs.headers['x-goog-request-params'].includes( + expectedHeaderRequestParams + ) + ); + }); + + it('uses async iteration with listConnections with error', async () => { + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + const request = generateSampleMessage( + new protos.google.cloud.bigquery.connection.v1.ListConnectionsRequest() + ); + const defaultValue1 = getTypeDefaultValue( + '.google.cloud.bigquery.connection.v1.ListConnectionsRequest', + ['parent'] + ); + request.parent = defaultValue1; + const expectedHeaderRequestParams = `parent=${defaultValue1}`; + const expectedError = new Error('expected'); + client.descriptors.page.listConnections.asyncIterate = + stubAsyncIterationCall(undefined, expectedError); + const iterable = client.listConnectionsAsync(request); + await assert.rejects(async () => { + const responses: protos.google.cloud.bigquery.connection.v1.IConnection[] = + []; + for await (const resource of iterable) { + responses.push(resource!); + } + }); + assert.deepStrictEqual( + ( + client.descriptors.page.listConnections.asyncIterate as SinonStub + ).getCall(0).args[1], + request + ); + assert( + (client.descriptors.page.listConnections.asyncIterate as SinonStub) + .getCall(0) + .args[2].otherArgs.headers['x-goog-request-params'].includes( + expectedHeaderRequestParams + ) + ); + }); + }); + + describe('Path templates', () => { + describe('connection', () => { + const fakePath = '/rendered/path/connection'; + const expectedParameters = { + project: 'projectValue', + location: 'locationValue', + connection: 'connectionValue', + }; + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + client.pathTemplates.connectionPathTemplate.render = sinon + .stub() + .returns(fakePath); + client.pathTemplates.connectionPathTemplate.match = sinon + .stub() + .returns(expectedParameters); + + it('connectionPath', () => { + const result = client.connectionPath( + 'projectValue', + 'locationValue', + 'connectionValue' + ); + assert.strictEqual(result, fakePath); + assert( + (client.pathTemplates.connectionPathTemplate.render as SinonStub) + .getCall(-1) + .calledWith(expectedParameters) + ); + }); + + it('matchProjectFromConnectionName', () => { + const result = client.matchProjectFromConnectionName(fakePath); + assert.strictEqual(result, 'projectValue'); + assert( + (client.pathTemplates.connectionPathTemplate.match as SinonStub) + .getCall(-1) + .calledWith(fakePath) + ); + }); + + it('matchLocationFromConnectionName', () => { + const result = client.matchLocationFromConnectionName(fakePath); + assert.strictEqual(result, 'locationValue'); + assert( + (client.pathTemplates.connectionPathTemplate.match as SinonStub) + .getCall(-1) + .calledWith(fakePath) + ); + }); + + it('matchConnectionFromConnectionName', () => { + const result = client.matchConnectionFromConnectionName(fakePath); + assert.strictEqual(result, 'connectionValue'); + assert( + (client.pathTemplates.connectionPathTemplate.match as SinonStub) + .getCall(-1) + .calledWith(fakePath) + ); + }); + }); + + describe('location', () => { + const fakePath = '/rendered/path/location'; + const expectedParameters = { + project: 'projectValue', + location: 'locationValue', + }; + const client = new connectionserviceModule.v1.ConnectionServiceClient({ + credentials: {client_email: 'bogus', private_key: 'bogus'}, + projectId: 'bogus', + }); + client.initialize(); + client.pathTemplates.locationPathTemplate.render = sinon + .stub() + .returns(fakePath); + client.pathTemplates.locationPathTemplate.match = sinon + .stub() + .returns(expectedParameters); + + it('locationPath', () => { + const result = client.locationPath('projectValue', 'locationValue'); + assert.strictEqual(result, fakePath); + assert( + (client.pathTemplates.locationPathTemplate.render as SinonStub) + .getCall(-1) + .calledWith(expectedParameters) + ); + }); + + it('matchProjectFromLocationName', () => { + const result = client.matchProjectFromLocationName(fakePath); + assert.strictEqual(result, 'projectValue'); + assert( + (client.pathTemplates.locationPathTemplate.match as SinonStub) + .getCall(-1) + .calledWith(fakePath) + ); + }); + + it('matchLocationFromLocationName', () => { + const result = client.matchLocationFromLocationName(fakePath); + assert.strictEqual(result, 'locationValue'); + assert( + (client.pathTemplates.locationPathTemplate.match as SinonStub) + .getCall(-1) + .calledWith(fakePath) + ); + }); + }); + }); +}); diff --git a/packages/google-cloud-bigquery-connection/tsconfig.json b/packages/google-cloud-bigquery-connection/tsconfig.json new file mode 100644 index 00000000000..c78f1c884ef --- /dev/null +++ b/packages/google-cloud-bigquery-connection/tsconfig.json @@ -0,0 +1,19 @@ +{ + "extends": "./node_modules/gts/tsconfig-google.json", + "compilerOptions": { + "rootDir": ".", + "outDir": "build", + "resolveJsonModule": true, + "lib": [ + "es2018", + "dom" + ] + }, + "include": [ + "src/*.ts", + "src/**/*.ts", + "test/*.ts", + "test/**/*.ts", + "system-test/*.ts" + ] +} diff --git a/packages/google-cloud-bigquery-connection/webpack.config.js b/packages/google-cloud-bigquery-connection/webpack.config.js new file mode 100644 index 00000000000..96ac8cbfca7 --- /dev/null +++ b/packages/google-cloud-bigquery-connection/webpack.config.js @@ -0,0 +1,64 @@ +// Copyright 2021 Google LLC +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// https://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. + +const path = require('path'); + +module.exports = { + entry: './src/index.ts', + output: { + library: 'ConnectionService', + filename: './connection-service.js', + }, + node: { + child_process: 'empty', + fs: 'empty', + crypto: 'empty', + }, + resolve: { + alias: { + '../../../package.json': path.resolve(__dirname, 'package.json'), + }, + extensions: ['.js', '.json', '.ts'], + }, + module: { + rules: [ + { + test: /\.tsx?$/, + use: 'ts-loader', + exclude: /node_modules/, + }, + { + test: /node_modules[\\/]@grpc[\\/]grpc-js/, + use: 'null-loader', + }, + { + test: /node_modules[\\/]grpc/, + use: 'null-loader', + }, + { + test: /node_modules[\\/]retry-request/, + use: 'null-loader', + }, + { + test: /node_modules[\\/]https?-proxy-agent/, + use: 'null-loader', + }, + { + test: /node_modules[\\/]gtoken/, + use: 'null-loader', + }, + ], + }, + mode: 'production', +}; diff --git a/packages/google-cloud-networkconnectivity/README.md b/packages/google-cloud-networkconnectivity/README.md index 2b47464e64f..38c9b9d5df3 100644 --- a/packages/google-cloud-networkconnectivity/README.md +++ b/packages/google-cloud-networkconnectivity/README.md @@ -88,32 +88,32 @@ Samples are in the [`samples/`](https://github.com/googleapis/google-cloud-node/ | Sample | Source Code | Try it | | --------------------------- | --------------------------------- | ------ | -| Hub_service.create_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.create_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.create_hub.js,samples/README.md) | -| Hub_service.create_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.create_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.create_spoke.js,samples/README.md) | -| Hub_service.delete_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.delete_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.delete_hub.js,samples/README.md) | -| Hub_service.delete_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.delete_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.delete_spoke.js,samples/README.md) | -| Hub_service.get_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.get_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.get_hub.js,samples/README.md) | -| Hub_service.get_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.get_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.get_spoke.js,samples/README.md) | -| Hub_service.list_hubs | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.list_hubs.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.list_hubs.js,samples/README.md) | -| Hub_service.list_spokes | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.list_spokes.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.list_spokes.js,samples/README.md) | -| Hub_service.update_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.update_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.update_hub.js,samples/README.md) | -| Hub_service.update_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.update_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.update_spoke.js,samples/README.md) | -| Policy_based_routing_service.create_policy_based_route | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js,samples/README.md) | -| Policy_based_routing_service.delete_policy_based_route | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js,samples/README.md) | -| Policy_based_routing_service.get_policy_based_route | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js,samples/README.md) | -| Policy_based_routing_service.list_policy_based_routes | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js,samples/README.md) | -| Hub_service.create_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_hub.js,samples/README.md) | -| Hub_service.create_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_spoke.js,samples/README.md) | -| Hub_service.delete_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_hub.js,samples/README.md) | -| Hub_service.delete_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_spoke.js,samples/README.md) | -| Hub_service.get_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_hub.js,samples/README.md) | -| Hub_service.get_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_spoke.js,samples/README.md) | -| Hub_service.list_hubs | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_hubs.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_hubs.js,samples/README.md) | -| Hub_service.list_spokes | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_spokes.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_spokes.js,samples/README.md) | -| Hub_service.update_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_hub.js,samples/README.md) | -| Hub_service.update_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_spoke.js,samples/README.md) | -| Quickstart | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/quickstart.js,samples/README.md) | -| Quickstart | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/test/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/test/quickstart.js,samples/README.md) | +| Hub_service.create_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_hub.js,samples/README.md) | +| Hub_service.create_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_spoke.js,samples/README.md) | +| Hub_service.delete_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_hub.js,samples/README.md) | +| Hub_service.delete_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_spoke.js,samples/README.md) | +| Hub_service.get_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_hub.js,samples/README.md) | +| Hub_service.get_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_spoke.js,samples/README.md) | +| Hub_service.list_hubs | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_hubs.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_hubs.js,samples/README.md) | +| Hub_service.list_spokes | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_spokes.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_spokes.js,samples/README.md) | +| Hub_service.update_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_hub.js,samples/README.md) | +| Hub_service.update_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_spoke.js,samples/README.md) | +| Policy_based_routing_service.create_policy_based_route | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js,samples/README.md) | +| Policy_based_routing_service.delete_policy_based_route | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js,samples/README.md) | +| Policy_based_routing_service.get_policy_based_route | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js,samples/README.md) | +| Policy_based_routing_service.list_policy_based_routes | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js,samples/README.md) | +| Hub_service.create_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_hub.js,samples/README.md) | +| Hub_service.create_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_spoke.js,samples/README.md) | +| Hub_service.delete_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_hub.js,samples/README.md) | +| Hub_service.delete_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_spoke.js,samples/README.md) | +| Hub_service.get_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_hub.js,samples/README.md) | +| Hub_service.get_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_spoke.js,samples/README.md) | +| Hub_service.list_hubs | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_hubs.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_hubs.js,samples/README.md) | +| Hub_service.list_spokes | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_spokes.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_spokes.js,samples/README.md) | +| Hub_service.update_hub | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_hub.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_hub.js,samples/README.md) | +| Hub_service.update_spoke | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_spoke.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_spoke.js,samples/README.md) | +| Quickstart | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/quickstart.js,samples/README.md) | +| Quickstart | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/test/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/test/quickstart.js,samples/README.md) | diff --git a/packages/google-cloud-networkconnectivity/samples/README.md b/packages/google-cloud-networkconnectivity/samples/README.md index 571004cec6b..3dcb5257fcf 100644 --- a/packages/google-cloud-networkconnectivity/samples/README.md +++ b/packages/google-cloud-networkconnectivity/samples/README.md @@ -56,14 +56,14 @@ Before running the samples, make sure you've followed the steps outlined in ### Hub_service.create_hub -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.create_hub.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_hub.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.create_hub.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_hub.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.create_hub.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_hub.js` ----- @@ -73,14 +73,14 @@ __Usage:__ ### Hub_service.create_spoke -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.create_spoke.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_spoke.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.create_spoke.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_spoke.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.create_spoke.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.create_spoke.js` ----- @@ -90,14 +90,14 @@ __Usage:__ ### Hub_service.delete_hub -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.delete_hub.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_hub.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.delete_hub.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_hub.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.delete_hub.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_hub.js` ----- @@ -107,14 +107,14 @@ __Usage:__ ### Hub_service.delete_spoke -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.delete_spoke.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_spoke.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.delete_spoke.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_spoke.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.delete_spoke.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.delete_spoke.js` ----- @@ -124,14 +124,14 @@ __Usage:__ ### Hub_service.get_hub -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.get_hub.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_hub.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.get_hub.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_hub.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.get_hub.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_hub.js` ----- @@ -141,14 +141,14 @@ __Usage:__ ### Hub_service.get_spoke -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.get_spoke.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_spoke.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.get_spoke.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_spoke.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.get_spoke.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.get_spoke.js` ----- @@ -158,14 +158,14 @@ __Usage:__ ### Hub_service.list_hubs -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.list_hubs.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_hubs.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.list_hubs.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_hubs.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.list_hubs.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_hubs.js` ----- @@ -175,14 +175,14 @@ __Usage:__ ### Hub_service.list_spokes -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.list_spokes.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_spokes.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.list_spokes.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_spokes.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.list_spokes.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.list_spokes.js` ----- @@ -192,14 +192,14 @@ __Usage:__ ### Hub_service.update_hub -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.update_hub.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_hub.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.update_hub.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_hub.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.update_hub.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_hub.js` ----- @@ -209,14 +209,14 @@ __Usage:__ ### Hub_service.update_spoke -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/hub_service.update_spoke.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_spoke.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/hub_service.update_spoke.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_spoke.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/hub_service.update_spoke.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/hub_service.update_spoke.js` ----- @@ -226,14 +226,14 @@ __Usage:__ ### Policy_based_routing_service.create_policy_based_route -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.create_policy_based_route.js` ----- @@ -243,14 +243,14 @@ __Usage:__ ### Policy_based_routing_service.delete_policy_based_route -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.delete_policy_based_route.js` ----- @@ -260,14 +260,14 @@ __Usage:__ ### Policy_based_routing_service.get_policy_based_route -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.get_policy_based_route.js` ----- @@ -277,14 +277,14 @@ __Usage:__ ### Policy_based_routing_service.list_policy_based_routes -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1/policy_based_routing_service.list_policy_based_routes.js` ----- @@ -294,14 +294,14 @@ __Usage:__ ### Hub_service.create_hub -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_hub.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_hub.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_hub.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_hub.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_hub.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_hub.js` ----- @@ -311,14 +311,14 @@ __Usage:__ ### Hub_service.create_spoke -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_spoke.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_spoke.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_spoke.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_spoke.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.create_spoke.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.create_spoke.js` ----- @@ -328,14 +328,14 @@ __Usage:__ ### Hub_service.delete_hub -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_hub.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_hub.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_hub.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_hub.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_hub.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_hub.js` ----- @@ -345,14 +345,14 @@ __Usage:__ ### Hub_service.delete_spoke -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_spoke.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_spoke.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_spoke.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_spoke.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.delete_spoke.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.delete_spoke.js` ----- @@ -362,14 +362,14 @@ __Usage:__ ### Hub_service.get_hub -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_hub.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_hub.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_hub.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_hub.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_hub.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_hub.js` ----- @@ -379,14 +379,14 @@ __Usage:__ ### Hub_service.get_spoke -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_spoke.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_spoke.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_spoke.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_spoke.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.get_spoke.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.get_spoke.js` ----- @@ -396,14 +396,14 @@ __Usage:__ ### Hub_service.list_hubs -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_hubs.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_hubs.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_hubs.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_hubs.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_hubs.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_hubs.js` ----- @@ -413,14 +413,14 @@ __Usage:__ ### Hub_service.list_spokes -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_spokes.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_spokes.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_spokes.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_spokes.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.list_spokes.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.list_spokes.js` ----- @@ -430,14 +430,14 @@ __Usage:__ ### Hub_service.update_hub -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_hub.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_hub.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_hub.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_hub.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_hub.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_hub.js` ----- @@ -447,14 +447,14 @@ __Usage:__ ### Hub_service.update_spoke -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_spoke.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_spoke.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_spoke.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_spoke.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1alpha1/hub_service.update_spoke.js` +`node packages/google-cloud-networkconnectivity/samples/generated/v1alpha1/hub_service.update_spoke.js` ----- @@ -464,14 +464,14 @@ __Usage:__ ### Quickstart -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/quickstart.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/quickstart.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/quickstart.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/quickstart.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/quickstart.js` +`node packages/google-cloud-networkconnectivity/samples/quickstart.js` ----- @@ -481,14 +481,14 @@ __Usage:__ ### Quickstart -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/test/quickstart.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-networkconnectivity/samples/test/quickstart.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/test/quickstart.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-networkconnectivity/samples/test/quickstart.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/test/quickstart.js` +`node packages/google-cloud-networkconnectivity/samples/test/quickstart.js` diff --git a/packages/google-cloud-recaptchaenterprise/README.md b/packages/google-cloud-recaptchaenterprise/README.md index e4866ae5969..af22feb12e0 100644 --- a/packages/google-cloud-recaptchaenterprise/README.md +++ b/packages/google-cloud-recaptchaenterprise/README.md @@ -31,7 +31,7 @@ Google APIs Client Libraries, in [Client Libraries Explained][explained]. * [Quickstart](#quickstart) * [Before you begin](#before-you-begin) * [Installing the client library](#installing-the-client-library) - + * [Using the client library](#using-the-client-library) * [Samples](#samples) * [Versioning](#versioning) * [Contributing](#contributing) @@ -54,6 +54,56 @@ npm install @google-cloud/recaptcha-enterprise ``` +### Using the client library + +```javascript +/** + * This snippet has been automatically generated and should be regarded as a code template only. + * It will require modifications to work. + * It may require correct/in-range values for request initialization. + * TODO(developer): Uncomment these variables before running the sample. + */ +/** + * Required. The name of the project that contains the keys that will be + * listed, in the format "projects/{project}". + */ +// const parent = 'abc123' +/** + * Optional. The maximum number of keys to return. Default is 10. Max limit is + * 1000. + */ +// const pageSize = 1234 +/** + * Optional. The next_page_token value returned from a previous. + * ListKeysRequest, if any. + */ +// const pageToken = 'abc123' + +// Imports the Recaptchaenterprise library +const {RecaptchaEnterpriseServiceClient} = + // eslint-disable-next-line node/no-missing-require + require('@google-cloud/recaptcha-enterprise').v1; + +// Instantiates a client +const recaptchaenterpriseClient = new RecaptchaEnterpriseServiceClient(); + +async function callListKeys() { + // Construct request + const request = { + parent, + }; + + // Run request + const iterable = await recaptchaenterpriseClient.listKeysAsync(request); + for await (const response of iterable) { + console.log(response); + } +} + +callListKeys(); + +``` + ## Samples @@ -62,26 +112,27 @@ Samples are in the [`samples/`](https://github.com/googleapis/google-cloud-node/ | Sample | Source Code | Try it | | --------------------------- | --------------------------------- | ------ | -| Recaptcha_enterprise_service.annotate_assessment | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js,samples/README.md) | -| Recaptcha_enterprise_service.create_assessment | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js,samples/README.md) | -| Recaptcha_enterprise_service.create_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_key.js,samples/README.md) | -| Recaptcha_enterprise_service.delete_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.delete_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.delete_key.js,samples/README.md) | -| Recaptcha_enterprise_service.get_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_key.js,samples/README.md) | -| Recaptcha_enterprise_service.get_metrics | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js,samples/README.md) | -| Recaptcha_enterprise_service.list_keys | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_keys.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_keys.js,samples/README.md) | -| Recaptcha_enterprise_service.list_related_account_group_memberships | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js,samples/README.md) | -| Recaptcha_enterprise_service.list_related_account_groups | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js,samples/README.md) | -| Recaptcha_enterprise_service.migrate_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js,samples/README.md) | -| Recaptcha_enterprise_service.retrieve_legacy_secret_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js,samples/README.md) | -| Recaptcha_enterprise_service.search_related_account_group_memberships | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js,samples/README.md) | -| Recaptcha_enterprise_service.update_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.update_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.update_key.js,samples/README.md) | -| Recaptcha_enterprise_service_v1_beta1.annotate_assessment | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js,samples/README.md) | -| Recaptcha_enterprise_service_v1_beta1.create_assessment | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js,samples/README.md) | -| Recaptcha_enterprise_service_v1_beta1.create_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js,samples/README.md) | -| Recaptcha_enterprise_service_v1_beta1.delete_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js,samples/README.md) | -| Recaptcha_enterprise_service_v1_beta1.get_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js,samples/README.md) | -| Recaptcha_enterprise_service_v1_beta1.list_keys | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js,samples/README.md) | -| Recaptcha_enterprise_service_v1_beta1.update_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js,samples/README.md) | +| Recaptcha_enterprise_service.annotate_assessment | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js,samples/README.md) | +| Recaptcha_enterprise_service.create_assessment | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js,samples/README.md) | +| Recaptcha_enterprise_service.create_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_key.js,samples/README.md) | +| Recaptcha_enterprise_service.delete_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.delete_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.delete_key.js,samples/README.md) | +| Recaptcha_enterprise_service.get_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_key.js,samples/README.md) | +| Recaptcha_enterprise_service.get_metrics | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js,samples/README.md) | +| Recaptcha_enterprise_service.list_keys | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_keys.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_keys.js,samples/README.md) | +| Recaptcha_enterprise_service.list_related_account_group_memberships | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js,samples/README.md) | +| Recaptcha_enterprise_service.list_related_account_groups | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js,samples/README.md) | +| Recaptcha_enterprise_service.migrate_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js,samples/README.md) | +| Recaptcha_enterprise_service.retrieve_legacy_secret_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js,samples/README.md) | +| Recaptcha_enterprise_service.search_related_account_group_memberships | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js,samples/README.md) | +| Recaptcha_enterprise_service.update_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.update_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.update_key.js,samples/README.md) | +| Recaptcha_enterprise_service_v1_beta1.annotate_assessment | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js,samples/README.md) | +| Recaptcha_enterprise_service_v1_beta1.create_assessment | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js,samples/README.md) | +| Recaptcha_enterprise_service_v1_beta1.create_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js,samples/README.md) | +| Recaptcha_enterprise_service_v1_beta1.delete_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js,samples/README.md) | +| Recaptcha_enterprise_service_v1_beta1.get_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js,samples/README.md) | +| Recaptcha_enterprise_service_v1_beta1.list_keys | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js,samples/README.md) | +| Recaptcha_enterprise_service_v1_beta1.update_key | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js,samples/README.md) | +| Quickstart | [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/quickstart.js) | [![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/quickstart.js,samples/README.md) | diff --git a/packages/google-cloud-recaptchaenterprise/samples/README.md b/packages/google-cloud-recaptchaenterprise/samples/README.md index ea4f029b55f..3360fa7b951 100644 --- a/packages/google-cloud-recaptchaenterprise/samples/README.md +++ b/packages/google-cloud-recaptchaenterprise/samples/README.md @@ -32,6 +32,7 @@ * [Recaptcha_enterprise_service_v1_beta1.get_key](#recaptcha_enterprise_service_v1_beta1.get_key) * [Recaptcha_enterprise_service_v1_beta1.list_keys](#recaptcha_enterprise_service_v1_beta1.list_keys) * [Recaptcha_enterprise_service_v1_beta1.update_key](#recaptcha_enterprise_service_v1_beta1.update_key) + * [Quickstart](#quickstart) ## Before you begin @@ -50,14 +51,14 @@ Before running the samples, make sure you've followed the steps outlined in ### Recaptcha_enterprise_service.annotate_assessment -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.annotate_assessment.js` ----- @@ -67,14 +68,14 @@ __Usage:__ ### Recaptcha_enterprise_service.create_assessment -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_assessment.js` ----- @@ -84,14 +85,14 @@ __Usage:__ ### Recaptcha_enterprise_service.create_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.create_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.create_key.js` ----- @@ -101,14 +102,14 @@ __Usage:__ ### Recaptcha_enterprise_service.delete_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.delete_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.delete_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.delete_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.delete_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.delete_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.delete_key.js` ----- @@ -118,14 +119,14 @@ __Usage:__ ### Recaptcha_enterprise_service.get_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_key.js` ----- @@ -135,14 +136,14 @@ __Usage:__ ### Recaptcha_enterprise_service.get_metrics -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.get_metrics.js` ----- @@ -152,14 +153,14 @@ __Usage:__ ### Recaptcha_enterprise_service.list_keys -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_keys.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_keys.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_keys.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_keys.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_keys.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_keys.js` ----- @@ -169,14 +170,14 @@ __Usage:__ ### Recaptcha_enterprise_service.list_related_account_group_memberships -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_group_memberships.js` ----- @@ -186,14 +187,14 @@ __Usage:__ ### Recaptcha_enterprise_service.list_related_account_groups -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.list_related_account_groups.js` ----- @@ -203,14 +204,14 @@ __Usage:__ ### Recaptcha_enterprise_service.migrate_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.migrate_key.js` ----- @@ -220,14 +221,14 @@ __Usage:__ ### Recaptcha_enterprise_service.retrieve_legacy_secret_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.retrieve_legacy_secret_key.js` ----- @@ -237,14 +238,14 @@ __Usage:__ ### Recaptcha_enterprise_service.search_related_account_group_memberships -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.search_related_account_group_memberships.js` ----- @@ -254,14 +255,14 @@ __Usage:__ ### Recaptcha_enterprise_service.update_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.update_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.update_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.update_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.update_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1/recaptcha_enterprise_service.update_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1/recaptcha_enterprise_service.update_key.js` ----- @@ -271,14 +272,14 @@ __Usage:__ ### Recaptcha_enterprise_service_v1_beta1.annotate_assessment -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.annotate_assessment.js` ----- @@ -288,14 +289,14 @@ __Usage:__ ### Recaptcha_enterprise_service_v1_beta1.create_assessment -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_assessment.js` ----- @@ -305,14 +306,14 @@ __Usage:__ ### Recaptcha_enterprise_service_v1_beta1.create_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.create_key.js` ----- @@ -322,14 +323,14 @@ __Usage:__ ### Recaptcha_enterprise_service_v1_beta1.delete_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.delete_key.js` ----- @@ -339,14 +340,14 @@ __Usage:__ ### Recaptcha_enterprise_service_v1_beta1.get_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.get_key.js` ----- @@ -356,14 +357,14 @@ __Usage:__ ### Recaptcha_enterprise_service_v1_beta1.list_keys -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.list_keys.js` ----- @@ -373,14 +374,31 @@ __Usage:__ ### Recaptcha_enterprise_service_v1_beta1.update_key -View the [source code](https://github.com/googleapis/google-cloud-node/blob/main//workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js). +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js). -[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=/workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js,samples/README.md) +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js,samples/README.md) __Usage:__ -`node /workspace/google-cloud-node/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js` +`node packages/google-cloud-recaptchaenterprise/samples/generated/v1beta1/recaptcha_enterprise_service_v1_beta1.update_key.js` + + +----- + + + + +### Quickstart + +View the [source code](https://github.com/googleapis/google-cloud-node/blob/main/packages/google-cloud-recaptchaenterprise/samples/quickstart.js). + +[![Open in Cloud Shell][shell_img]](https://console.cloud.google.com/cloudshell/open?git_repo=https://github.com/googleapis/google-cloud-node&page=editor&open_in_editor=packages/google-cloud-recaptchaenterprise/samples/quickstart.js,samples/README.md) + +__Usage:__ + + +`node packages/google-cloud-recaptchaenterprise/samples/quickstart.js` diff --git a/release-please-config.json b/release-please-config.json index 2f12797a350..1cea325e26b 100644 --- a/release-please-config.json +++ b/release-please-config.json @@ -19,6 +19,7 @@ "packages/google-cloud-beyondcorp-clientconnectorservices": {}, "packages/google-cloud-beyondcorp-clientgateways": {}, "packages/google-cloud-bigquery-analyticshub": {}, + "packages/google-cloud-bigquery-connection": {}, "packages/google-cloud-bigquery-dataexchange": {}, "packages/google-cloud-bigquery-datapolicies": {}, "packages/google-cloud-bigquery-datatransfer": {}, @@ -53,11 +54,7 @@ "packages/google-cloud-gkeconnect-gateway": {}, "packages/google-cloud-gkehub": {}, "packages/google-cloud-gkemulticloud": {}, - "packages/google-cloud-documentai": {}, "packages/google-cloud-filestore": {}, - "packages/google-cloud-gkeconnect-gateway": {}, - "packages/google-cloud-gkehub": {}, - "packages/google-cloud-gkemulticloud": {}, "packages/google-cloud-iap": {}, "packages/google-cloud-ids": {}, "packages/google-cloud-iot": {}, @@ -125,4 +122,4 @@ } ], "release-type": "node" -} +} \ No newline at end of file