From a2c5bf82732f10263ceed9eedd4efe3fe5cdfb9b Mon Sep 17 00:00:00 2001 From: Matthew Kime Date: Tue, 7 Feb 2023 21:05:59 -0600 Subject: [PATCH 01/60] [data view mgmt] fix field refresh when index pattern is changed. (#150403) Data view management now updates the field list of an edited data view upon save. Closes: https://github.com/elastic/kibana/issues/150248 --- .../edit_index_pattern/edit_index_pattern.tsx | 5 ++- .../table/__snapshots__/table.test.tsx.snap | 16 +++++++--- .../components/table/table.tsx | 2 +- .../_index_pattern_create_delete.ts | 31 +++++++++++++++++++ 4 files changed, 48 insertions(+), 6 deletions(-) diff --git a/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx b/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx index 811222ef71e88..de421c0b8945e 100644 --- a/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx +++ b/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx @@ -128,7 +128,10 @@ export const EditIndexPattern = withRouter( const isRollup = new URLSearchParams(useLocation().search).get('type') === 'rollup'; const displayIndexPatternEditor = showEditDialog ? ( setShowEditDialog(false)} + onSave={() => { + setFields(indexPattern.getNonScriptedFields()); + setShowEditDialog(false); + }} onCancel={() => setShowEditDialog(false)} defaultTypeIsRollup={isRollup} editData={indexPattern} diff --git a/src/plugins/data_view_management/public/components/edit_index_pattern/indexed_fields_table/components/table/__snapshots__/table.test.tsx.snap b/src/plugins/data_view_management/public/components/edit_index_pattern/indexed_fields_table/components/table/__snapshots__/table.test.tsx.snap index ac6ab1172a535..65c124c6676fa 100644 --- a/src/plugins/data_view_management/public/components/edit_index_pattern/indexed_fields_table/components/table/__snapshots__/table.test.tsx.snap +++ b/src/plugins/data_view_management/public/components/edit_index_pattern/indexed_fields_table/components/table/__snapshots__/table.test.tsx.snap @@ -82,13 +82,17 @@ exports[`Table render conflict summary modal 1`] = ` `; exports[`Table render name 1`] = ` - + customer `; exports[`Table render name 2`] = ` - + customer   @@ -126,7 +130,9 @@ exports[`Table should render mixed, non-conflicting type 1`] = ` `; exports[`Table should render normal field name 1`] = ` - + Elastic `; @@ -324,7 +330,9 @@ exports[`Table should render the boolean template (true) 1`] = ` `; exports[`Table should render timestamp field name 1`] = ` - + timestamp   diff --git a/src/plugins/data_view_management/public/components/edit_index_pattern/indexed_fields_table/components/table/table.tsx b/src/plugins/data_view_management/public/components/edit_index_pattern/indexed_fields_table/components/table/table.tsx index a7b6cf621bb64..b7ed701b31c68 100644 --- a/src/plugins/data_view_management/public/components/edit_index_pattern/indexed_fields_table/components/table/table.tsx +++ b/src/plugins/data_view_management/public/components/edit_index_pattern/indexed_fields_table/components/table/table.tsx @@ -220,7 +220,7 @@ const getItems = (conflictDescriptions: IndexedFieldItem['conflictDescriptions'] }; export const renderFieldName = (field: IndexedFieldItem, timeFieldName?: string) => ( - + {field.name} {field.info && field.info.length ? ( diff --git a/test/functional/apps/management/_index_pattern_create_delete.ts b/test/functional/apps/management/_index_pattern_create_delete.ts index 8447610d60aa8..f89013eac43fa 100644 --- a/test/functional/apps/management/_index_pattern_create_delete.ts +++ b/test/functional/apps/management/_index_pattern_create_delete.ts @@ -22,11 +22,20 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { describe('creating and deleting default index', function describeIndexTests() { before(async function () { await esArchiver.emptyKibanaIndex(); + await esArchiver.loadIfNeeded( + 'test/functional/fixtures/es_archiver/kibana_sample_data_flights_index_pattern' + ); await kibanaServer.uiSettings.replace({}); await PageObjects.settings.navigateTo(); await PageObjects.settings.clickKibanaIndexPatterns(); }); + after(async function () { + await esArchiver.unload( + 'test/functional/fixtures/es_archiver/kibana_sample_data_flights_index_pattern' + ); + }); + describe('can open and close editor', function () { it('without creating index pattern', async function () { await PageObjects.settings.clickKibanaIndexPatterns(); @@ -157,6 +166,28 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { }); }); + describe('index pattern edit', function () { + it('should update field list', async function () { + await PageObjects.settings.editIndexPattern( + 'kibana_sample_data_flights', + 'timestamp', + undefined, + true + ); + + await retry.try(async () => { + // verify initial field list + expect(await testSubjects.exists('field-name-AvgTicketPrice')).to.be(true); + }); + + await PageObjects.settings.editIndexPattern('logstash-*', '@timestamp', undefined, true); + await retry.try(async () => { + // verify updated field list + expect(await testSubjects.exists('field-name-agent')).to.be(true); + }); + }); + }); + describe('index pattern deletion', function indexDelete() { before(function () { const expectedAlertText = 'Delete data view'; From 01f07bccf1c2e68663c157b31f70ff11605bd6e4 Mon Sep 17 00:00:00 2001 From: Xavier Mouligneau Date: Tue, 7 Feb 2023 22:52:26 -0500 Subject: [PATCH 02/60] [RAM] Bring flapping status and settings in o11y (#150483) ## Summary Bring shareable components to set the flapping configuration on rule management in o11y and update the status alert around flapping. image Screenshot 2023-02-07 at 3 15 01 PM ### Checklist - [x] [Unit or functional tests](https://www.elastic.co/guide/en/kibana/master/development-tests.html) were updated or added to match the most common scenarios --------- Co-authored-by: kibanamachine <42973632+kibanamachine@users.noreply.github.com> --- .github/CODEOWNERS | 1 + .i18nrc.json | 1 + package.json | 1 + packages/kbn-alerts-ui-shared/README.mdx | 14 +++ packages/kbn-alerts-ui-shared/index.ts | 10 ++ packages/kbn-alerts-ui-shared/jest.config.js | 13 +++ packages/kbn-alerts-ui-shared/kibana.jsonc | 5 + packages/kbn-alerts-ui-shared/package.json | 6 ++ .../index.test.tsx | 7 +- .../alert_lifecycle_status_badge/index.tsx | 92 +++++++++++++++++++ packages/kbn-alerts-ui-shared/tsconfig.json | 22 +++++ tsconfig.base.json | 2 + ...bservability_public_plugins_start.mock.tsx | 3 + .../alerts_flyout/alerts_flyout_body.tsx | 6 +- .../public/pages/rules/index.tsx | 7 +- x-pack/plugins/observability/tsconfig.json | 1 + .../alert_lifecycle_status_badge.tsx | 90 +----------------- .../plugins/triggers_actions_ui/tsconfig.json | 1 + yarn.lock | 4 + 19 files changed, 193 insertions(+), 93 deletions(-) create mode 100644 packages/kbn-alerts-ui-shared/README.mdx create mode 100644 packages/kbn-alerts-ui-shared/index.ts create mode 100644 packages/kbn-alerts-ui-shared/jest.config.js create mode 100644 packages/kbn-alerts-ui-shared/kibana.jsonc create mode 100644 packages/kbn-alerts-ui-shared/package.json rename x-pack/plugins/triggers_actions_ui/public/application/components/alert_lifecycle_status_badge.test.tsx => packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.test.tsx (88%) create mode 100644 packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.tsx create mode 100644 packages/kbn-alerts-ui-shared/tsconfig.json diff --git a/.github/CODEOWNERS b/.github/CODEOWNERS index c6e2a9202f804..547c8f5d33edd 100644 --- a/.github/CODEOWNERS +++ b/.github/CODEOWNERS @@ -882,6 +882,7 @@ packages/home/sample_data_tab @elastic/appex-sharedux packages/home/sample_data_types @elastic/appex-sharedux packages/kbn-ace @elastic/platform-deployment-management packages/kbn-alerts @elastic/security-solution +packages/kbn-alerts-ui-shared @elastic/response-ops packages/kbn-ambient-common-types @elastic/kibana-operations packages/kbn-ambient-ftr-types @elastic/kibana-operations packages/kbn-ambient-storybook-types @elastic/kibana-operations diff --git a/.i18nrc.json b/.i18nrc.json index a4bb5c900fa57..d8a6b4689f78e 100644 --- a/.i18nrc.json +++ b/.i18nrc.json @@ -2,6 +2,7 @@ "paths": { "advancedSettings": "src/plugins/advanced_settings", "alerts": "packages/kbn-alerts/src", + "alertsUIShared": "packages/kbn-alerts-ui-shared/src", "apmOss": "src/plugins/apm_oss", "autocomplete": "packages/kbn-securitysolution-autocomplete/src", "bfetch": "src/plugins/bfetch", diff --git a/package.json b/package.json index 04f0e1035325b..e10addc6cec12 100644 --- a/package.json +++ b/package.json @@ -133,6 +133,7 @@ "@kbn/aiops-components": "link:x-pack/packages/ml/aiops_components", "@kbn/aiops-utils": "link:x-pack/packages/ml/aiops_utils", "@kbn/alerts": "link:packages/kbn-alerts", + "@kbn/alerts-ui-shared": "link:packages/kbn-alerts-ui-shared", "@kbn/analytics": "link:packages/kbn-analytics", "@kbn/analytics-client": "link:packages/analytics/client", "@kbn/analytics-shippers-elastic-v3-browser": "link:packages/analytics/shippers/elastic_v3/browser", diff --git a/packages/kbn-alerts-ui-shared/README.mdx b/packages/kbn-alerts-ui-shared/README.mdx new file mode 100644 index 0000000000000..8903565a90751 --- /dev/null +++ b/packages/kbn-alerts-ui-shared/README.mdx @@ -0,0 +1,14 @@ +# @kbn/alerts-ui-shared + +--- +id: AlertsUIShared/Components/AlertLifecycleStatusBadge +slug: /kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.tsx +title: Alert Lifecycle Status +description: A component to show the status of an alert +tags: ['kbn-alerts-ui-shared', 'component'] +date: 2023-02-07 +--- + +## Description + +A component to show the status of an alert \ No newline at end of file diff --git a/packages/kbn-alerts-ui-shared/index.ts b/packages/kbn-alerts-ui-shared/index.ts new file mode 100644 index 0000000000000..431c6803c36d4 --- /dev/null +++ b/packages/kbn-alerts-ui-shared/index.ts @@ -0,0 +1,10 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +export { AlertLifecycleStatusBadge } from './src/alert_lifecycle_status_badge'; +export type { AlertLifecycleStatusBadgeProps } from './src/alert_lifecycle_status_badge'; diff --git a/packages/kbn-alerts-ui-shared/jest.config.js b/packages/kbn-alerts-ui-shared/jest.config.js new file mode 100644 index 0000000000000..31062b3280e41 --- /dev/null +++ b/packages/kbn-alerts-ui-shared/jest.config.js @@ -0,0 +1,13 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +module.exports = { + preset: '@kbn/test', + rootDir: '../..', + roots: ['/packages/kbn-alerts-ui-shared'], +}; diff --git a/packages/kbn-alerts-ui-shared/kibana.jsonc b/packages/kbn-alerts-ui-shared/kibana.jsonc new file mode 100644 index 0000000000000..da035e4fbb8f8 --- /dev/null +++ b/packages/kbn-alerts-ui-shared/kibana.jsonc @@ -0,0 +1,5 @@ +{ + "type": "shared-common", + "id": "@kbn/alerts-ui-shared", + "owner": "@elastic/response-ops" +} diff --git a/packages/kbn-alerts-ui-shared/package.json b/packages/kbn-alerts-ui-shared/package.json new file mode 100644 index 0000000000000..cddedc28c624f --- /dev/null +++ b/packages/kbn-alerts-ui-shared/package.json @@ -0,0 +1,6 @@ +{ + "name": "@kbn/alerts-ui-shared", + "private": true, + "version": "1.0.0", + "license": "SSPL-1.0 OR Elastic License 2.0" +} \ No newline at end of file diff --git a/x-pack/plugins/triggers_actions_ui/public/application/components/alert_lifecycle_status_badge.test.tsx b/packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.test.tsx similarity index 88% rename from x-pack/plugins/triggers_actions_ui/public/application/components/alert_lifecycle_status_badge.test.tsx rename to packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.test.tsx index 0b959e6b8a2d7..1fe498fb5a660 100644 --- a/x-pack/plugins/triggers_actions_ui/public/application/components/alert_lifecycle_status_badge.test.tsx +++ b/packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.test.tsx @@ -1,13 +1,14 @@ /* * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one * or more contributor license agreements. Licensed under the Elastic License - * 2.0; you may not use this file except in compliance with the Elastic License - * 2.0. + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. */ import React from 'react'; import { render } from '@testing-library/react'; -import { AlertLifecycleStatusBadge } from './alert_lifecycle_status_badge'; +import { AlertLifecycleStatusBadge } from '.'; describe('alertLifecycleStatusBadge', () => { it('should display the alert status correctly when active and not flapping', () => { diff --git a/packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.tsx b/packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.tsx new file mode 100644 index 0000000000000..35519fba7dd1e --- /dev/null +++ b/packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.tsx @@ -0,0 +1,92 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +import React, { memo } from 'react'; +import { i18n } from '@kbn/i18n'; +import { EuiBadge, EuiBadgeProps } from '@elastic/eui'; +import { AlertStatus, ALERT_STATUS_RECOVERED } from '@kbn/rule-data-utils'; + +export interface AlertLifecycleStatusBadgeProps { + alertStatus: AlertStatus; + flapping?: boolean | string; +} + +const ACTIVE_LABEL = i18n.translate( + 'alertsUIShared.components.alertLifecycleStatusBadge.activeLabel', + { + defaultMessage: 'Active', + } +); + +const RECOVERED_LABEL = i18n.translate( + 'alertsUIShared.components.alertLifecycleStatusBadge.recoveredLabel', + { + defaultMessage: 'Recovered', + } +); + +const FLAPPING_LABEL = i18n.translate( + 'alertsUIShared.components.alertLifecycleStatusBadge.flappingLabel', + { + defaultMessage: 'Flapping', + } +); + +interface BadgeProps { + label: string; + color: string; + iconProps?: { + iconType: EuiBadgeProps['iconType']; + }; +} + +const getBadgeProps = (alertStatus: AlertStatus, flapping: boolean | undefined): BadgeProps => { + // Prefer recovered over flapping + if (alertStatus === ALERT_STATUS_RECOVERED) { + return { + label: RECOVERED_LABEL, + color: 'success', + }; + } + + if (flapping) { + return { + label: FLAPPING_LABEL, + color: 'danger', + iconProps: { + iconType: 'visGauge', + }, + }; + } + + return { + label: ACTIVE_LABEL, + color: 'danger', + }; +}; + +const castFlapping = (flapping: boolean | string | undefined) => { + if (typeof flapping === 'string') { + return flapping === 'true'; + } + return flapping; +}; + +export const AlertLifecycleStatusBadge = memo((props: AlertLifecycleStatusBadgeProps) => { + const { alertStatus, flapping } = props; + + const castedFlapping = castFlapping(flapping); + + const { label, color, iconProps } = getBadgeProps(alertStatus, castedFlapping); + + return ( + + {label} + + ); +}); diff --git a/packages/kbn-alerts-ui-shared/tsconfig.json b/packages/kbn-alerts-ui-shared/tsconfig.json new file mode 100644 index 0000000000000..045e79467b3b7 --- /dev/null +++ b/packages/kbn-alerts-ui-shared/tsconfig.json @@ -0,0 +1,22 @@ +{ + "extends": "../../tsconfig.base.json", + "compilerOptions": { + "outDir": "target/types", + "types": [ + "jest", + "node", + "react" + ] + }, + "include": [ + "**/*.ts", + "**/*.tsx" + ], + "exclude": [ + "target/**/*" + ], + "kbn_references": [ + "@kbn/i18n", + "@kbn/rule-data-utils" + ] +} diff --git a/tsconfig.base.json b/tsconfig.base.json index 98d79a813b6c8..63e43cf855daf 100644 --- a/tsconfig.base.json +++ b/tsconfig.base.json @@ -26,6 +26,8 @@ "@kbn/alerting-plugin/*": ["x-pack/plugins/alerting/*"], "@kbn/alerts": ["packages/kbn-alerts"], "@kbn/alerts/*": ["packages/kbn-alerts/*"], + "@kbn/alerts-ui-shared": ["packages/kbn-alerts-ui-shared"], + "@kbn/alerts-ui-shared/*": ["packages/kbn-alerts-ui-shared/*"], "@kbn/ambient-common-types": ["packages/kbn-ambient-common-types"], "@kbn/ambient-common-types/*": ["packages/kbn-ambient-common-types/*"], "@kbn/ambient-ftr-types": ["packages/kbn-ambient-ftr-types"], diff --git a/x-pack/plugins/observability/public/observability_public_plugins_start.mock.tsx b/x-pack/plugins/observability/public/observability_public_plugins_start.mock.tsx index 6ccca21b37907..f31f41c6a6357 100644 --- a/x-pack/plugins/observability/public/observability_public_plugins_start.mock.tsx +++ b/x-pack/plugins/observability/public/observability_public_plugins_start.mock.tsx @@ -59,6 +59,9 @@ const triggersActionsUiStartMock = { )), getRuleTagFilter: jest.fn(() =>
mocked component
), getRulesList: jest.fn(() =>
mocked component
), + getRulesSettingsLink: jest.fn(() => ( +
mocked component
+ )), ruleTypeRegistry: { has: jest.fn(), register: jest.fn(), diff --git a/x-pack/plugins/observability/public/pages/alerts/components/alerts_flyout/alerts_flyout_body.tsx b/x-pack/plugins/observability/public/pages/alerts/components/alerts_flyout/alerts_flyout_body.tsx index 56daa3a4f8f9b..ead2b83388f87 100644 --- a/x-pack/plugins/observability/public/pages/alerts/components/alerts_flyout/alerts_flyout_body.tsx +++ b/x-pack/plugins/observability/public/pages/alerts/components/alerts_flyout/alerts_flyout_body.tsx @@ -19,17 +19,18 @@ import { ALERT_DURATION, ALERT_EVALUATION_THRESHOLD, ALERT_EVALUATION_VALUE, + ALERT_FLAPPING, ALERT_RULE_CATEGORY, ALERT_RULE_UUID, ALERT_STATUS_ACTIVE, ALERT_STATUS_RECOVERED, } from '@kbn/rule-data-utils'; +import { AlertLifecycleStatusBadge } from '@kbn/alerts-ui-shared'; import moment from 'moment-timezone'; import { useKibana, useUiSetting } from '@kbn/kibana-react-plugin/public'; import { RULE_DETAILS_PAGE_ID } from '../../../rule_details/constants'; import { asDuration } from '../../../../../common/utils/formatters'; import { translations, paths } from '../../../../config'; -import { AlertStatusIndicator } from '../../../../components/shared/alert_status_indicator'; import { FlyoutProps } from './types'; // eslint-disable-next-line import/no-default-export @@ -47,8 +48,9 @@ export default function AlertsFlyoutBody({ alert, id: pageId }: FlyoutProps) { { title: translations.alertsFlyout.statusLabel, description: ( - ), }, diff --git a/x-pack/plugins/observability/public/pages/rules/index.tsx b/x-pack/plugins/observability/public/pages/rules/index.tsx index 36968f5fc1b2b..28c37ad7c454d 100644 --- a/x-pack/plugins/observability/public/pages/rules/index.tsx +++ b/x-pack/plugins/observability/public/pages/rules/index.tsx @@ -34,7 +34,11 @@ function RulesPage() { const { http, docLinks, - triggersActionsUi: { getAddAlertFlyout: AddAlertFlyout, getRulesList: RuleList }, + triggersActionsUi: { + getAddAlertFlyout: AddAlertFlyout, + getRulesList: RuleList, + getRulesSettingsLink: RulesSettingsLink, + }, } = useKibana().services; const { status, setStatus, lastResponse, setLastResponse } = useRulesPageStateContainer(); @@ -83,6 +87,7 @@ function RulesPage() { defaultMessage="Create rule" /> , + , { - // Prefer recovered over flapping - if (alertStatus === ALERT_STATUS_RECOVERED) { - return { - label: RECOVERED_LABEL, - color: 'success', - }; - } - - if (flapping) { - return { - label: FLAPPING_LABEL, - color: 'danger', - iconProps: { - iconType: 'visGauge', - }, - }; - } - - return { - label: ACTIVE_LABEL, - color: 'danger', - }; -}; - -const castFlapping = (flapping: boolean | string | undefined) => { - if (typeof flapping === 'string') { - return flapping === 'true'; - } - return flapping; -}; - -export const AlertLifecycleStatusBadge = memo((props: AlertLifecycleStatusBadgeProps) => { - const { alertStatus, flapping } = props; - - const castedFlapping = castFlapping(flapping); - - const { label, color, iconProps } = getBadgeProps(alertStatus, castedFlapping); - - return ( - - {label} - - ); -}); - -// eslint-disable-next-line import/no-default-export -export { AlertLifecycleStatusBadge as default }; +export { AlertLifecycleStatusBadge }; +export type { AlertLifecycleStatusBadgeProps }; diff --git a/x-pack/plugins/triggers_actions_ui/tsconfig.json b/x-pack/plugins/triggers_actions_ui/tsconfig.json index 96024fb676b14..e6f7ac42c3cc4 100644 --- a/x-pack/plugins/triggers_actions_ui/tsconfig.json +++ b/x-pack/plugins/triggers_actions_ui/tsconfig.json @@ -44,6 +44,7 @@ "@kbn/ui-theme", "@kbn/datemath", "@kbn/core-capabilities-common", + "@kbn/alerts-ui-shared", ], "exclude": [ "target/**/*", diff --git a/yarn.lock b/yarn.lock index 4613bc8853a69..ddef865f3ea99 100644 --- a/yarn.lock +++ b/yarn.lock @@ -2749,6 +2749,10 @@ version "0.0.0" uid "" +"@kbn/alerts-ui-shared@link:packages/kbn-alerts-ui-shared": + version "0.0.0" + uid "" + "@kbn/alerts@link:packages/kbn-alerts": version "0.0.0" uid "" From f4c733099f1d5f5a4dd39bfb07c54b11d7f1efa0 Mon Sep 17 00:00:00 2001 From: Thomas Watson Date: Wed, 8 Feb 2023 06:41:12 +0100 Subject: [PATCH 03/60] [canvas] Run tests against @kbn/handlebars compileAST function (#150439) The `Handlebars` object exposed by the tested file (`x-pack/plugins/canvas/common/lib/handlebars.js`) is primarily meant to have its `compileAST` function called and not the `compile` function. This PR just updates the tests to reflect that. --- x-pack/plugins/canvas/common/lib/handlebars.test.js | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/x-pack/plugins/canvas/common/lib/handlebars.test.js b/x-pack/plugins/canvas/common/lib/handlebars.test.js index 5a0ee7f2746e6..1670a9f70067c 100644 --- a/x-pack/plugins/canvas/common/lib/handlebars.test.js +++ b/x-pack/plugins/canvas/common/lib/handlebars.test.js @@ -10,11 +10,11 @@ import { Handlebars } from './handlebars'; describe('handlebars', () => { it('registers math function and returns argument error', () => { - const template = Handlebars.compile("test math: {{math rows 'mean(price * quantity)' 2}}"); + const template = Handlebars.compileAST("test math: {{math rows 'mean(price * quantity)' 2}}"); expect(template()).toBe('test math: MATH ERROR: first argument must be an array'); }); it('evaluates math function successfully', () => { - const template = Handlebars.compile("test math: {{math rows 'mean(price * quantity)' 2}}"); + const template = Handlebars.compileAST("test math: {{math rows 'mean(price * quantity)' 2}}"); expect(template(testTable)).toBe('test math: 82164.33'); }); }); From 1e133e39cdbfce99acbdba17df9f5cc9560f075d Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 00:48:07 -0500 Subject: [PATCH 04/60] [api-docs] 2023-02-08 Daily api_docs build (#150518) Generated by https://buildkite.com/elastic/kibana-api-docs-daily/builds/242 --- api_docs/actions.mdx | 2 +- api_docs/advanced_settings.mdx | 2 +- api_docs/aiops.mdx | 2 +- api_docs/alerting.devdocs.json | 65 +- api_docs/alerting.mdx | 4 +- api_docs/apm.devdocs.json | 6 + api_docs/apm.mdx | 2 +- api_docs/banners.mdx | 2 +- api_docs/bfetch.mdx | 2 +- api_docs/canvas.mdx | 2 +- api_docs/cases.mdx | 2 +- api_docs/charts.mdx | 2 +- api_docs/cloud.mdx | 2 +- api_docs/cloud_chat.mdx | 2 +- api_docs/cloud_data_migration.mdx | 2 +- api_docs/cloud_defend.mdx | 2 +- api_docs/cloud_experiments.mdx | 2 +- api_docs/cloud_security_posture.mdx | 2 +- api_docs/console.mdx | 2 +- api_docs/content_management.devdocs.json | 291 ++- api_docs/content_management.mdx | 10 +- api_docs/controls.mdx | 2 +- api_docs/core.devdocs.json | 60 + api_docs/core.mdx | 4 +- api_docs/custom_integrations.mdx | 2 +- api_docs/dashboard.devdocs.json | 4 +- api_docs/dashboard.mdx | 2 +- api_docs/dashboard_enhanced.mdx | 2 +- api_docs/data.devdocs.json | 8 + api_docs/data.mdx | 2 +- api_docs/data_query.mdx | 2 +- api_docs/data_search.mdx | 2 +- api_docs/data_view_editor.mdx | 2 +- api_docs/data_view_field_editor.mdx | 2 +- api_docs/data_view_management.mdx | 2 +- api_docs/data_views.devdocs.json | 12 + api_docs/data_views.mdx | 2 +- api_docs/data_visualizer.mdx | 2 +- api_docs/deprecations_by_api.mdx | 2 +- api_docs/deprecations_by_plugin.mdx | 8 +- api_docs/deprecations_by_team.mdx | 2 +- api_docs/dev_tools.mdx | 2 +- api_docs/discover.mdx | 2 +- api_docs/discover_enhanced.mdx | 2 +- api_docs/ecs_data_quality_dashboard.mdx | 2 +- api_docs/embeddable.mdx | 2 +- api_docs/embeddable_enhanced.mdx | 2 +- api_docs/encrypted_saved_objects.mdx | 2 +- api_docs/enterprise_search.mdx | 2 +- api_docs/es_ui_shared.mdx | 2 +- api_docs/event_annotation.mdx | 2 +- api_docs/event_log.mdx | 2 +- api_docs/expression_error.mdx | 2 +- api_docs/expression_gauge.mdx | 2 +- api_docs/expression_heatmap.mdx | 2 +- api_docs/expression_image.mdx | 2 +- api_docs/expression_legacy_metric_vis.mdx | 2 +- api_docs/expression_metric.mdx | 2 +- api_docs/expression_metric_vis.mdx | 2 +- api_docs/expression_partition_vis.mdx | 2 +- api_docs/expression_repeat_image.mdx | 2 +- api_docs/expression_reveal_image.mdx | 2 +- api_docs/expression_shape.mdx | 2 +- api_docs/expression_tagcloud.mdx | 2 +- api_docs/expression_x_y.mdx | 2 +- api_docs/expressions.mdx | 2 +- api_docs/features.mdx | 2 +- api_docs/field_formats.mdx | 2 +- api_docs/file_upload.mdx | 2 +- api_docs/files.mdx | 2 +- api_docs/files_management.mdx | 2 +- api_docs/fleet.devdocs.json | 16 +- api_docs/fleet.mdx | 4 +- api_docs/global_search.mdx | 2 +- api_docs/guided_onboarding.mdx | 2 +- api_docs/home.mdx | 2 +- api_docs/image_embeddable.mdx | 2 +- api_docs/index_lifecycle_management.mdx | 2 +- api_docs/index_management.mdx | 2 +- api_docs/infra.mdx | 2 +- api_docs/inspector.mdx | 2 +- api_docs/interactive_setup.mdx | 2 +- api_docs/kbn_ace.mdx | 2 +- api_docs/kbn_aiops_components.mdx | 2 +- api_docs/kbn_aiops_utils.mdx | 2 +- api_docs/kbn_alerts.mdx | 2 +- api_docs/kbn_alerts_ui_shared.devdocs.json | 119 ++ api_docs/kbn_alerts_ui_shared.mdx | 33 + api_docs/kbn_analytics.mdx | 2 +- api_docs/kbn_analytics_client.mdx | 2 +- ..._analytics_shippers_elastic_v3_browser.mdx | 2 +- ...n_analytics_shippers_elastic_v3_common.mdx | 2 +- ...n_analytics_shippers_elastic_v3_server.mdx | 2 +- api_docs/kbn_analytics_shippers_fullstory.mdx | 2 +- api_docs/kbn_analytics_shippers_gainsight.mdx | 2 +- api_docs/kbn_apm_config_loader.mdx | 2 +- api_docs/kbn_apm_synthtrace.mdx | 2 +- .../kbn_apm_synthtrace_client.devdocs.json | 8 +- api_docs/kbn_apm_synthtrace_client.mdx | 2 +- api_docs/kbn_apm_utils.mdx | 2 +- api_docs/kbn_axe_config.mdx | 2 +- api_docs/kbn_cases_components.mdx | 2 +- api_docs/kbn_cell_actions.mdx | 2 +- api_docs/kbn_chart_icons.mdx | 2 +- api_docs/kbn_ci_stats_core.mdx | 2 +- api_docs/kbn_ci_stats_performance_metrics.mdx | 2 +- api_docs/kbn_ci_stats_reporter.mdx | 2 +- api_docs/kbn_cli_dev_mode.mdx | 2 +- api_docs/kbn_code_editor.mdx | 2 +- api_docs/kbn_code_editor_mocks.mdx | 2 +- api_docs/kbn_coloring.mdx | 2 +- api_docs/kbn_config.mdx | 2 +- api_docs/kbn_config_mocks.mdx | 2 +- api_docs/kbn_config_schema.mdx | 2 +- .../kbn_content_management_content_editor.mdx | 2 +- .../kbn_content_management_table_list.mdx | 2 +- api_docs/kbn_core_analytics_browser.mdx | 2 +- .../kbn_core_analytics_browser_internal.mdx | 2 +- api_docs/kbn_core_analytics_browser_mocks.mdx | 2 +- api_docs/kbn_core_analytics_server.mdx | 2 +- .../kbn_core_analytics_server_internal.mdx | 2 +- api_docs/kbn_core_analytics_server_mocks.mdx | 2 +- api_docs/kbn_core_application_browser.mdx | 2 +- .../kbn_core_application_browser_internal.mdx | 2 +- .../kbn_core_application_browser_mocks.mdx | 2 +- api_docs/kbn_core_application_common.mdx | 2 +- api_docs/kbn_core_apps_browser_internal.mdx | 2 +- api_docs/kbn_core_apps_browser_mocks.mdx | 2 +- api_docs/kbn_core_apps_server_internal.mdx | 2 +- api_docs/kbn_core_base_browser_mocks.mdx | 2 +- api_docs/kbn_core_base_common.mdx | 2 +- api_docs/kbn_core_base_server_internal.mdx | 2 +- api_docs/kbn_core_base_server_mocks.mdx | 2 +- .../kbn_core_capabilities_browser_mocks.mdx | 2 +- api_docs/kbn_core_capabilities_common.mdx | 2 +- api_docs/kbn_core_capabilities_server.mdx | 2 +- .../kbn_core_capabilities_server_mocks.mdx | 2 +- api_docs/kbn_core_chrome_browser.mdx | 2 +- api_docs/kbn_core_chrome_browser_mocks.mdx | 2 +- api_docs/kbn_core_config_server_internal.mdx | 2 +- api_docs/kbn_core_custom_branding_browser.mdx | 2 +- ..._core_custom_branding_browser_internal.mdx | 2 +- ...kbn_core_custom_branding_browser_mocks.mdx | 2 +- api_docs/kbn_core_custom_branding_common.mdx | 2 +- api_docs/kbn_core_custom_branding_server.mdx | 2 +- ...n_core_custom_branding_server_internal.mdx | 2 +- .../kbn_core_custom_branding_server_mocks.mdx | 2 +- api_docs/kbn_core_deprecations_browser.mdx | 2 +- ...kbn_core_deprecations_browser_internal.mdx | 2 +- .../kbn_core_deprecations_browser_mocks.mdx | 2 +- api_docs/kbn_core_deprecations_common.mdx | 2 +- api_docs/kbn_core_deprecations_server.mdx | 2 +- .../kbn_core_deprecations_server_internal.mdx | 2 +- .../kbn_core_deprecations_server_mocks.mdx | 2 +- api_docs/kbn_core_doc_links_browser.mdx | 2 +- api_docs/kbn_core_doc_links_browser_mocks.mdx | 2 +- api_docs/kbn_core_doc_links_server.mdx | 2 +- api_docs/kbn_core_doc_links_server_mocks.mdx | 2 +- ...e_elasticsearch_client_server_internal.mdx | 2 +- ...core_elasticsearch_client_server_mocks.mdx | 2 +- api_docs/kbn_core_elasticsearch_server.mdx | 2 +- ...kbn_core_elasticsearch_server_internal.mdx | 2 +- .../kbn_core_elasticsearch_server_mocks.mdx | 2 +- .../kbn_core_environment_server_internal.mdx | 2 +- .../kbn_core_environment_server_mocks.mdx | 2 +- .../kbn_core_execution_context_browser.mdx | 2 +- ...ore_execution_context_browser_internal.mdx | 2 +- ...n_core_execution_context_browser_mocks.mdx | 2 +- .../kbn_core_execution_context_common.mdx | 2 +- .../kbn_core_execution_context_server.mdx | 2 +- ...core_execution_context_server_internal.mdx | 2 +- ...bn_core_execution_context_server_mocks.mdx | 2 +- api_docs/kbn_core_fatal_errors_browser.mdx | 2 +- .../kbn_core_fatal_errors_browser_mocks.mdx | 2 +- api_docs/kbn_core_http_browser.mdx | 2 +- api_docs/kbn_core_http_browser_internal.mdx | 2 +- api_docs/kbn_core_http_browser_mocks.mdx | 2 +- api_docs/kbn_core_http_common.mdx | 2 +- .../kbn_core_http_context_server_mocks.mdx | 2 +- ...re_http_request_handler_context_server.mdx | 2 +- api_docs/kbn_core_http_resources_server.mdx | 2 +- ...bn_core_http_resources_server_internal.mdx | 2 +- .../kbn_core_http_resources_server_mocks.mdx | 2 +- .../kbn_core_http_router_server_internal.mdx | 2 +- .../kbn_core_http_router_server_mocks.mdx | 2 +- api_docs/kbn_core_http_server.mdx | 2 +- ...kbn_core_http_server_internal.devdocs.json | 17 +- api_docs/kbn_core_http_server_internal.mdx | 4 +- api_docs/kbn_core_http_server_mocks.mdx | 2 +- api_docs/kbn_core_i18n_browser.mdx | 2 +- api_docs/kbn_core_i18n_browser_mocks.mdx | 2 +- api_docs/kbn_core_i18n_server.mdx | 2 +- api_docs/kbn_core_i18n_server_internal.mdx | 2 +- api_docs/kbn_core_i18n_server_mocks.mdx | 2 +- ...n_core_injected_metadata_browser_mocks.mdx | 2 +- ...kbn_core_integrations_browser_internal.mdx | 2 +- .../kbn_core_integrations_browser_mocks.mdx | 2 +- api_docs/kbn_core_lifecycle_browser.mdx | 2 +- api_docs/kbn_core_lifecycle_browser_mocks.mdx | 2 +- api_docs/kbn_core_lifecycle_server.mdx | 2 +- api_docs/kbn_core_lifecycle_server_mocks.mdx | 2 +- api_docs/kbn_core_logging_browser_mocks.mdx | 2 +- api_docs/kbn_core_logging_common_internal.mdx | 2 +- api_docs/kbn_core_logging_server.mdx | 2 +- api_docs/kbn_core_logging_server_internal.mdx | 2 +- api_docs/kbn_core_logging_server_mocks.mdx | 2 +- ...ore_metrics_collectors_server_internal.mdx | 2 +- ...n_core_metrics_collectors_server_mocks.mdx | 2 +- api_docs/kbn_core_metrics_server.mdx | 2 +- api_docs/kbn_core_metrics_server_internal.mdx | 2 +- api_docs/kbn_core_metrics_server_mocks.mdx | 2 +- api_docs/kbn_core_mount_utils_browser.mdx | 2 +- api_docs/kbn_core_node_server.mdx | 2 +- api_docs/kbn_core_node_server_internal.mdx | 2 +- api_docs/kbn_core_node_server_mocks.mdx | 2 +- api_docs/kbn_core_notifications_browser.mdx | 2 +- ...bn_core_notifications_browser_internal.mdx | 2 +- .../kbn_core_notifications_browser_mocks.mdx | 2 +- api_docs/kbn_core_overlays_browser.mdx | 2 +- .../kbn_core_overlays_browser_internal.mdx | 2 +- api_docs/kbn_core_overlays_browser_mocks.mdx | 2 +- api_docs/kbn_core_plugins_browser.mdx | 2 +- api_docs/kbn_core_plugins_browser_mocks.mdx | 2 +- api_docs/kbn_core_plugins_server.mdx | 2 +- api_docs/kbn_core_plugins_server_mocks.mdx | 2 +- api_docs/kbn_core_preboot_server.mdx | 2 +- api_docs/kbn_core_preboot_server_mocks.mdx | 2 +- api_docs/kbn_core_rendering_browser_mocks.mdx | 2 +- .../kbn_core_rendering_server_internal.mdx | 2 +- api_docs/kbn_core_rendering_server_mocks.mdx | 2 +- api_docs/kbn_core_root_server_internal.mdx | 2 +- .../kbn_core_saved_objects_api_browser.mdx | 2 +- .../kbn_core_saved_objects_api_server.mdx | 2 +- ...core_saved_objects_api_server_internal.mdx | 2 +- ...bn_core_saved_objects_api_server_mocks.mdx | 2 +- ...ore_saved_objects_base_server_internal.mdx | 2 +- ...n_core_saved_objects_base_server_mocks.mdx | 2 +- api_docs/kbn_core_saved_objects_browser.mdx | 2 +- ...bn_core_saved_objects_browser_internal.mdx | 2 +- .../kbn_core_saved_objects_browser_mocks.mdx | 2 +- api_docs/kbn_core_saved_objects_common.mdx | 2 +- ..._objects_import_export_server_internal.mdx | 2 +- ...ved_objects_import_export_server_mocks.mdx | 2 +- ...aved_objects_migration_server_internal.mdx | 2 +- ...e_saved_objects_migration_server_mocks.mdx | 2 +- ...kbn_core_saved_objects_server.devdocs.json | 685 +++++++ api_docs/kbn_core_saved_objects_server.mdx | 4 +- ...kbn_core_saved_objects_server_internal.mdx | 2 +- .../kbn_core_saved_objects_server_mocks.mdx | 2 +- .../kbn_core_saved_objects_utils_server.mdx | 2 +- api_docs/kbn_core_status_common.mdx | 2 +- api_docs/kbn_core_status_common_internal.mdx | 2 +- api_docs/kbn_core_status_server.mdx | 2 +- api_docs/kbn_core_status_server_internal.mdx | 2 +- api_docs/kbn_core_status_server_mocks.mdx | 2 +- ...core_test_helpers_deprecations_getters.mdx | 2 +- ...n_core_test_helpers_http_setup_browser.mdx | 2 +- api_docs/kbn_core_test_helpers_kbn_server.mdx | 2 +- ...st_helpers_so_type_serializer.devdocs.json | 29 + ...n_core_test_helpers_so_type_serializer.mdx | 4 +- api_docs/kbn_core_test_helpers_test_utils.mdx | 2 +- api_docs/kbn_core_theme_browser.mdx | 2 +- api_docs/kbn_core_theme_browser_internal.mdx | 2 +- api_docs/kbn_core_theme_browser_mocks.mdx | 2 +- api_docs/kbn_core_ui_settings_browser.mdx | 2 +- .../kbn_core_ui_settings_browser_internal.mdx | 2 +- .../kbn_core_ui_settings_browser_mocks.mdx | 2 +- api_docs/kbn_core_ui_settings_common.mdx | 2 +- api_docs/kbn_core_ui_settings_server.mdx | 2 +- .../kbn_core_ui_settings_server_internal.mdx | 2 +- .../kbn_core_ui_settings_server_mocks.mdx | 2 +- api_docs/kbn_core_usage_data_server.mdx | 2 +- .../kbn_core_usage_data_server_internal.mdx | 2 +- api_docs/kbn_core_usage_data_server_mocks.mdx | 2 +- api_docs/kbn_crypto.mdx | 2 +- api_docs/kbn_crypto_browser.mdx | 2 +- api_docs/kbn_cypress_config.mdx | 2 +- api_docs/kbn_datemath.mdx | 2 +- api_docs/kbn_dev_cli_errors.mdx | 2 +- api_docs/kbn_dev_cli_runner.mdx | 2 +- api_docs/kbn_dev_proc_runner.mdx | 2 +- api_docs/kbn_dev_utils.mdx | 2 +- api_docs/kbn_doc_links.devdocs.json | 2 +- api_docs/kbn_doc_links.mdx | 2 +- api_docs/kbn_docs_utils.mdx | 2 +- api_docs/kbn_ebt_tools.mdx | 2 +- api_docs/kbn_ecs.mdx | 2 +- api_docs/kbn_ecs_data_quality_dashboard.mdx | 2 +- api_docs/kbn_es.mdx | 2 +- api_docs/kbn_es_archiver.mdx | 2 +- api_docs/kbn_es_errors.mdx | 2 +- api_docs/kbn_es_query.mdx | 2 +- api_docs/kbn_es_types.mdx | 2 +- api_docs/kbn_eslint_plugin_imports.mdx | 2 +- api_docs/kbn_field_types.mdx | 2 +- api_docs/kbn_find_used_node_modules.mdx | 2 +- .../kbn_ftr_common_functional_services.mdx | 2 +- api_docs/kbn_generate.mdx | 2 +- api_docs/kbn_get_repo_files.mdx | 2 +- api_docs/kbn_guided_onboarding.mdx | 2 +- api_docs/kbn_handlebars.devdocs.json | 218 +-- api_docs/kbn_handlebars.mdx | 10 +- api_docs/kbn_hapi_mocks.mdx | 2 +- api_docs/kbn_health_gateway_server.mdx | 2 +- api_docs/kbn_home_sample_data_card.mdx | 2 +- api_docs/kbn_home_sample_data_tab.mdx | 2 +- api_docs/kbn_i18n.mdx | 2 +- api_docs/kbn_i18n_react.mdx | 2 +- api_docs/kbn_import_resolver.mdx | 2 +- api_docs/kbn_interpreter.mdx | 2 +- api_docs/kbn_io_ts_utils.mdx | 2 +- api_docs/kbn_jest_serializers.mdx | 2 +- api_docs/kbn_journeys.mdx | 2 +- api_docs/kbn_json_ast.mdx | 2 +- api_docs/kbn_kibana_manifest_schema.mdx | 2 +- .../kbn_language_documentation_popover.mdx | 2 +- api_docs/kbn_logging.mdx | 2 +- api_docs/kbn_logging_mocks.mdx | 2 +- api_docs/kbn_managed_vscode_config.mdx | 2 +- api_docs/kbn_mapbox_gl.mdx | 2 +- api_docs/kbn_ml_agg_utils.mdx | 2 +- api_docs/kbn_ml_date_picker.devdocs.json | 27 + api_docs/kbn_ml_date_picker.mdx | 4 +- api_docs/kbn_ml_is_defined.mdx | 2 +- api_docs/kbn_ml_is_populated_object.mdx | 2 +- api_docs/kbn_ml_local_storage.mdx | 2 +- api_docs/kbn_ml_nested_property.mdx | 2 +- api_docs/kbn_ml_query_utils.mdx | 2 +- api_docs/kbn_ml_string_hash.mdx | 2 +- api_docs/kbn_ml_url_state.mdx | 2 +- api_docs/kbn_monaco.mdx | 2 +- api_docs/kbn_optimizer.mdx | 2 +- api_docs/kbn_optimizer_webpack_helpers.mdx | 2 +- api_docs/kbn_osquery_io_ts_types.mdx | 2 +- ..._performance_testing_dataset_extractor.mdx | 2 +- api_docs/kbn_plugin_generator.mdx | 2 +- api_docs/kbn_plugin_helpers.mdx | 2 +- api_docs/kbn_react_field.mdx | 2 +- api_docs/kbn_repo_file_maps.mdx | 2 +- api_docs/kbn_repo_linter.mdx | 2 +- api_docs/kbn_repo_path.mdx | 2 +- api_docs/kbn_repo_source_classifier.mdx | 2 +- api_docs/kbn_rison.mdx | 2 +- api_docs/kbn_rule_data_utils.mdx | 2 +- .../kbn_securitysolution_autocomplete.mdx | 2 +- api_docs/kbn_securitysolution_ecs.mdx | 2 +- api_docs/kbn_securitysolution_es_utils.mdx | 2 +- ...ion_exception_list_components.devdocs.json | 10 +- ...ritysolution_exception_list_components.mdx | 2 +- api_docs/kbn_securitysolution_hook_utils.mdx | 2 +- ..._securitysolution_io_ts_alerting_types.mdx | 2 +- ...ritysolution_io_ts_list_types.devdocs.json | 227 ++- .../kbn_securitysolution_io_ts_list_types.mdx | 4 +- api_docs/kbn_securitysolution_io_ts_types.mdx | 2 +- api_docs/kbn_securitysolution_io_ts_utils.mdx | 2 +- ...kbn_securitysolution_list_api.devdocs.json | 16 +- api_docs/kbn_securitysolution_list_api.mdx | 2 +- .../kbn_securitysolution_list_constants.mdx | 2 +- ...n_securitysolution_list_hooks.devdocs.json | 34 +- api_docs/kbn_securitysolution_list_hooks.mdx | 2 +- ...n_securitysolution_list_utils.devdocs.json | 102 +- api_docs/kbn_securitysolution_list_utils.mdx | 4 +- api_docs/kbn_securitysolution_rules.mdx | 2 +- api_docs/kbn_securitysolution_t_grid.mdx | 2 +- api_docs/kbn_securitysolution_utils.mdx | 2 +- api_docs/kbn_server_http_tools.mdx | 2 +- api_docs/kbn_server_route_repository.mdx | 2 +- api_docs/kbn_shared_svg.mdx | 2 +- api_docs/kbn_shared_ux_avatar_solution.mdx | 2 +- ...ared_ux_avatar_user_profile_components.mdx | 2 +- .../kbn_shared_ux_button_exit_full_screen.mdx | 2 +- ...hared_ux_button_exit_full_screen_mocks.mdx | 2 +- api_docs/kbn_shared_ux_button_toolbar.mdx | 2 +- api_docs/kbn_shared_ux_card_no_data.mdx | 2 +- api_docs/kbn_shared_ux_card_no_data_mocks.mdx | 2 +- api_docs/kbn_shared_ux_file_context.mdx | 2 +- api_docs/kbn_shared_ux_file_image.mdx | 2 +- api_docs/kbn_shared_ux_file_image_mocks.mdx | 2 +- api_docs/kbn_shared_ux_file_mocks.mdx | 2 +- api_docs/kbn_shared_ux_file_picker.mdx | 2 +- api_docs/kbn_shared_ux_file_upload.mdx | 2 +- api_docs/kbn_shared_ux_file_util.mdx | 2 +- api_docs/kbn_shared_ux_link_redirect_app.mdx | 2 +- .../kbn_shared_ux_link_redirect_app_mocks.mdx | 2 +- api_docs/kbn_shared_ux_markdown.mdx | 2 +- api_docs/kbn_shared_ux_markdown_mocks.mdx | 2 +- .../kbn_shared_ux_page_analytics_no_data.mdx | 2 +- ...shared_ux_page_analytics_no_data_mocks.mdx | 2 +- .../kbn_shared_ux_page_kibana_no_data.mdx | 2 +- ...bn_shared_ux_page_kibana_no_data_mocks.mdx | 2 +- .../kbn_shared_ux_page_kibana_template.mdx | 2 +- ...n_shared_ux_page_kibana_template_mocks.mdx | 2 +- api_docs/kbn_shared_ux_page_no_data.mdx | 2 +- .../kbn_shared_ux_page_no_data_config.mdx | 2 +- ...bn_shared_ux_page_no_data_config_mocks.mdx | 2 +- api_docs/kbn_shared_ux_page_no_data_mocks.mdx | 2 +- api_docs/kbn_shared_ux_page_solution_nav.mdx | 2 +- .../kbn_shared_ux_prompt_no_data_views.mdx | 2 +- ...n_shared_ux_prompt_no_data_views_mocks.mdx | 2 +- api_docs/kbn_shared_ux_prompt_not_found.mdx | 2 +- api_docs/kbn_shared_ux_router.mdx | 2 +- api_docs/kbn_shared_ux_router_mocks.mdx | 2 +- api_docs/kbn_shared_ux_storybook_config.mdx | 2 +- api_docs/kbn_shared_ux_storybook_mock.mdx | 2 +- api_docs/kbn_shared_ux_utility.mdx | 2 +- api_docs/kbn_slo_schema.mdx | 2 +- api_docs/kbn_some_dev_log.mdx | 2 +- api_docs/kbn_std.mdx | 2 +- api_docs/kbn_stdio_dev_helpers.mdx | 2 +- api_docs/kbn_storybook.mdx | 2 +- api_docs/kbn_telemetry_tools.mdx | 2 +- api_docs/kbn_test.mdx | 2 +- api_docs/kbn_test_jest_helpers.mdx | 2 +- api_docs/kbn_test_subj_selector.mdx | 2 +- api_docs/kbn_tooling_log.mdx | 2 +- api_docs/kbn_ts_projects.mdx | 2 +- api_docs/kbn_typed_react_router_config.mdx | 2 +- api_docs/kbn_ui_actions_browser.mdx | 2 +- api_docs/kbn_ui_shared_deps_src.mdx | 2 +- api_docs/kbn_ui_theme.mdx | 2 +- api_docs/kbn_user_profile_components.mdx | 2 +- api_docs/kbn_utility_types.mdx | 2 +- api_docs/kbn_utility_types_jest.mdx | 2 +- api_docs/kbn_utils.mdx | 2 +- api_docs/kbn_yarn_lock_validator.mdx | 2 +- api_docs/kibana_overview.mdx | 2 +- api_docs/kibana_react.mdx | 2 +- api_docs/kibana_utils.mdx | 2 +- api_docs/kubernetes_security.mdx | 2 +- api_docs/lens.devdocs.json | 4 +- api_docs/lens.mdx | 2 +- api_docs/license_api_guard.mdx | 2 +- api_docs/license_management.mdx | 2 +- api_docs/licensing.mdx | 2 +- api_docs/lists.devdocs.json | 78 +- api_docs/lists.mdx | 4 +- api_docs/management.mdx | 2 +- api_docs/maps.mdx | 2 +- api_docs/maps_ems.mdx | 2 +- api_docs/ml.devdocs.json | 2 +- api_docs/ml.mdx | 2 +- api_docs/monitoring.mdx | 2 +- api_docs/monitoring_collection.mdx | 2 +- api_docs/navigation.mdx | 2 +- api_docs/newsfeed.mdx | 2 +- api_docs/notifications.mdx | 2 +- api_docs/observability.devdocs.json | 238 +++ api_docs/observability.mdx | 4 +- api_docs/osquery.mdx | 2 +- api_docs/plugin_directory.mdx | 35 +- api_docs/presentation_util.mdx | 2 +- api_docs/profiling.devdocs.json | 2 +- api_docs/profiling.mdx | 2 +- api_docs/remote_clusters.mdx | 2 +- api_docs/reporting.mdx | 2 +- api_docs/rollup.mdx | 2 +- api_docs/rule_registry.mdx | 2 +- api_docs/runtime_fields.mdx | 2 +- api_docs/saved_objects.mdx | 2 +- api_docs/saved_objects_finder.mdx | 2 +- api_docs/saved_objects_management.mdx | 2 +- api_docs/saved_objects_tagging.mdx | 2 +- api_docs/saved_objects_tagging_oss.mdx | 2 +- api_docs/saved_search.mdx | 2 +- api_docs/screenshot_mode.mdx | 2 +- api_docs/screenshotting.mdx | 2 +- api_docs/security.mdx | 2 +- api_docs/security_solution.mdx | 2 +- api_docs/session_view.mdx | 2 +- api_docs/share.mdx | 2 +- api_docs/snapshot_restore.mdx | 2 +- api_docs/spaces.mdx | 2 +- api_docs/stack_alerts.mdx | 2 +- api_docs/stack_connectors.mdx | 2 +- api_docs/task_manager.mdx | 2 +- api_docs/telemetry.mdx | 2 +- api_docs/telemetry_collection_manager.mdx | 2 +- api_docs/telemetry_collection_xpack.mdx | 2 +- api_docs/telemetry_management_section.mdx | 2 +- api_docs/threat_intelligence.mdx | 2 +- api_docs/timelines.devdocs.json | 4 +- api_docs/timelines.mdx | 2 +- api_docs/transform.mdx | 2 +- api_docs/triggers_actions_ui.devdocs.json | 6 +- api_docs/triggers_actions_ui.mdx | 2 +- api_docs/ui_actions.mdx | 2 +- api_docs/ui_actions_enhanced.mdx | 2 +- api_docs/unified_field_list.mdx | 2 +- api_docs/unified_histogram.devdocs.json | 1731 ++++++++--------- api_docs/unified_histogram.mdx | 4 +- api_docs/unified_search.mdx | 2 +- api_docs/unified_search_autocomplete.mdx | 2 +- api_docs/url_forwarding.mdx | 2 +- api_docs/usage_collection.mdx | 2 +- api_docs/ux.mdx | 2 +- api_docs/vis_default_editor.mdx | 2 +- api_docs/vis_type_gauge.mdx | 2 +- api_docs/vis_type_heatmap.mdx | 2 +- api_docs/vis_type_pie.mdx | 2 +- api_docs/vis_type_table.mdx | 2 +- api_docs/vis_type_timelion.mdx | 2 +- api_docs/vis_type_timeseries.mdx | 2 +- api_docs/vis_type_vega.mdx | 2 +- api_docs/vis_type_vislib.mdx | 2 +- api_docs/vis_type_xy.mdx | 2 +- api_docs/visualizations.mdx | 2 +- 506 files changed, 3356 insertions(+), 1729 deletions(-) create mode 100644 api_docs/kbn_alerts_ui_shared.devdocs.json create mode 100644 api_docs/kbn_alerts_ui_shared.mdx diff --git a/api_docs/actions.mdx b/api_docs/actions.mdx index 3ba970f4118c1..ef35d56d63b16 100644 --- a/api_docs/actions.mdx +++ b/api_docs/actions.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/actions title: "actions" image: https://source.unsplash.com/400x175/?github description: API docs for the actions plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'actions'] --- import actionsObj from './actions.devdocs.json'; diff --git a/api_docs/advanced_settings.mdx b/api_docs/advanced_settings.mdx index db3fe435f1a30..928057041b4d1 100644 --- a/api_docs/advanced_settings.mdx +++ b/api_docs/advanced_settings.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/advancedSettings title: "advancedSettings" image: https://source.unsplash.com/400x175/?github description: API docs for the advancedSettings plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'advancedSettings'] --- import advancedSettingsObj from './advanced_settings.devdocs.json'; diff --git a/api_docs/aiops.mdx b/api_docs/aiops.mdx index 5af3e2fb16988..b792796879d8f 100644 --- a/api_docs/aiops.mdx +++ b/api_docs/aiops.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/aiops title: "aiops" image: https://source.unsplash.com/400x175/?github description: API docs for the aiops plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'aiops'] --- import aiopsObj from './aiops.devdocs.json'; diff --git a/api_docs/alerting.devdocs.json b/api_docs/alerting.devdocs.json index 6d65646822c9c..23201eb38ee2b 100644 --- a/api_docs/alerting.devdocs.json +++ b/api_docs/alerting.devdocs.json @@ -1994,7 +1994,7 @@ "section": "def-common.SanitizedRule", "text": "SanitizedRule" }, - ", \"name\" | \"tags\" | \"id\" | \"enabled\" | \"actions\" | \"throttle\" | \"consumer\" | \"schedule\" | \"createdBy\" | \"updatedBy\" | \"createdAt\" | \"updatedAt\" | \"notifyWhen\"> & { producer: string; ruleTypeId: string; ruleTypeName: string; }" + ", \"name\" | \"tags\" | \"id\" | \"enabled\" | \"actions\" | \"throttle\" | \"consumer\" | \"schedule\" | \"createdBy\" | \"updatedBy\" | \"createdAt\" | \"updatedAt\" | \"muteAll\" | \"notifyWhen\" | \"snoozeSchedule\"> & { producer: string; ruleTypeId: string; ruleTypeName: string; }" ], "path": "x-pack/plugins/alerting/server/types.ts", "deprecated": false, @@ -6080,6 +6080,20 @@ "deprecated": false, "trackAdoption": false }, + { + "parentPluginId": "alerting", + "id": "def-common.RuleLastRun.outcomeOrder", + "type": "number", + "tags": [], + "label": "outcomeOrder", + "description": [], + "signature": [ + "number | undefined" + ], + "path": "x-pack/plugins/alerting/common/rule.ts", + "deprecated": false, + "trackAdoption": false + }, { "parentPluginId": "alerting", "id": "def-common.RuleLastRun.warning", @@ -7998,7 +8012,7 @@ "section": "def-common.SanitizedRule", "text": "SanitizedRule" }, - ", \"name\" | \"tags\" | \"id\" | \"enabled\" | \"actions\" | \"throttle\" | \"consumer\" | \"schedule\" | \"createdBy\" | \"updatedBy\" | \"createdAt\" | \"updatedAt\" | \"notifyWhen\"> & { producer: string; ruleTypeId: string; ruleTypeName: string; }" + ", \"name\" | \"tags\" | \"id\" | \"enabled\" | \"actions\" | \"throttle\" | \"consumer\" | \"schedule\" | \"createdBy\" | \"updatedBy\" | \"createdAt\" | \"updatedAt\" | \"muteAll\" | \"notifyWhen\" | \"snoozeSchedule\"> & { producer: string; ruleTypeId: string; ruleTypeName: string; }" ], "path": "x-pack/plugins/alerting/common/rule.ts", "deprecated": false, @@ -8400,6 +8414,53 @@ "trackAdoption": false, "initialIsOpen": false }, + { + "parentPluginId": "alerting", + "id": "def-common.RuleLastRunOutcomeOrderMap", + "type": "Object", + "tags": [], + "label": "RuleLastRunOutcomeOrderMap", + "description": [], + "path": "x-pack/plugins/alerting/common/rule.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "alerting", + "id": "def-common.RuleLastRunOutcomeOrderMap.succeeded", + "type": "number", + "tags": [], + "label": "succeeded", + "description": [], + "path": "x-pack/plugins/alerting/common/rule.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "alerting", + "id": "def-common.RuleLastRunOutcomeOrderMap.warning", + "type": "number", + "tags": [], + "label": "warning", + "description": [], + "path": "x-pack/plugins/alerting/common/rule.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "alerting", + "id": "def-common.RuleLastRunOutcomeOrderMap.failed", + "type": "number", + "tags": [], + "label": "failed", + "description": [], + "path": "x-pack/plugins/alerting/common/rule.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + }, { "parentPluginId": "alerting", "id": "def-common.RuleLastRunOutcomeValues", diff --git a/api_docs/alerting.mdx b/api_docs/alerting.mdx index cbc14cce11e3e..d22dbd1c249b1 100644 --- a/api_docs/alerting.mdx +++ b/api_docs/alerting.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/alerting title: "alerting" image: https://source.unsplash.com/400x175/?github description: API docs for the alerting plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'alerting'] --- import alertingObj from './alerting.devdocs.json'; @@ -21,7 +21,7 @@ Contact [Response Ops](https://github.com/orgs/elastic/teams/response-ops) for q | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 471 | 1 | 461 | 39 | +| 476 | 1 | 466 | 39 | ## Client diff --git a/api_docs/apm.devdocs.json b/api_docs/apm.devdocs.json index b51fad1b153ba..5beab1c31de15 100644 --- a/api_docs/apm.devdocs.json +++ b/api_docs/apm.devdocs.json @@ -1358,6 +1358,10 @@ "TypeC", "<{ useSpanName: ", "Type", + "; enableServiceTransactionMetrics: ", + "Type", + "; enableContinuousRollups: ", + "Type", "; }>, ", "TypeC", "<{ kuery: ", @@ -6620,6 +6624,8 @@ "StringC", "; serviceGroup: ", "StringC", + "; kuery: ", + "StringC", "; }>, ", "TypeC", "<{ environment: ", diff --git a/api_docs/apm.mdx b/api_docs/apm.mdx index 0165d4f0b364a..cf0a9adf1e71a 100644 --- a/api_docs/apm.mdx +++ b/api_docs/apm.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/apm title: "apm" image: https://source.unsplash.com/400x175/?github description: API docs for the apm plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'apm'] --- import apmObj from './apm.devdocs.json'; diff --git a/api_docs/banners.mdx b/api_docs/banners.mdx index f292ea0186524..a8bbe1bdcf5b2 100644 --- a/api_docs/banners.mdx +++ b/api_docs/banners.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/banners title: "banners" image: https://source.unsplash.com/400x175/?github description: API docs for the banners plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'banners'] --- import bannersObj from './banners.devdocs.json'; diff --git a/api_docs/bfetch.mdx b/api_docs/bfetch.mdx index ebf72b61a4b2a..de115543071b6 100644 --- a/api_docs/bfetch.mdx +++ b/api_docs/bfetch.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/bfetch title: "bfetch" image: https://source.unsplash.com/400x175/?github description: API docs for the bfetch plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'bfetch'] --- import bfetchObj from './bfetch.devdocs.json'; diff --git a/api_docs/canvas.mdx b/api_docs/canvas.mdx index c22791f7de815..8a8585f198ac5 100644 --- a/api_docs/canvas.mdx +++ b/api_docs/canvas.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/canvas title: "canvas" image: https://source.unsplash.com/400x175/?github description: API docs for the canvas plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'canvas'] --- import canvasObj from './canvas.devdocs.json'; diff --git a/api_docs/cases.mdx b/api_docs/cases.mdx index 3dabaf44f09a4..ef505bea85c3a 100644 --- a/api_docs/cases.mdx +++ b/api_docs/cases.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/cases title: "cases" image: https://source.unsplash.com/400x175/?github description: API docs for the cases plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'cases'] --- import casesObj from './cases.devdocs.json'; diff --git a/api_docs/charts.mdx b/api_docs/charts.mdx index 23d021370466a..0da599274c98f 100644 --- a/api_docs/charts.mdx +++ b/api_docs/charts.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/charts title: "charts" image: https://source.unsplash.com/400x175/?github description: API docs for the charts plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'charts'] --- import chartsObj from './charts.devdocs.json'; diff --git a/api_docs/cloud.mdx b/api_docs/cloud.mdx index aede4e71fd19e..ff486e08150ba 100644 --- a/api_docs/cloud.mdx +++ b/api_docs/cloud.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/cloud title: "cloud" image: https://source.unsplash.com/400x175/?github description: API docs for the cloud plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'cloud'] --- import cloudObj from './cloud.devdocs.json'; diff --git a/api_docs/cloud_chat.mdx b/api_docs/cloud_chat.mdx index 6b2bbf437d941..1f83dbad63dae 100644 --- a/api_docs/cloud_chat.mdx +++ b/api_docs/cloud_chat.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/cloudChat title: "cloudChat" image: https://source.unsplash.com/400x175/?github description: API docs for the cloudChat plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'cloudChat'] --- import cloudChatObj from './cloud_chat.devdocs.json'; diff --git a/api_docs/cloud_data_migration.mdx b/api_docs/cloud_data_migration.mdx index d0810c875d703..9a8cb6b18d019 100644 --- a/api_docs/cloud_data_migration.mdx +++ b/api_docs/cloud_data_migration.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/cloudDataMigration title: "cloudDataMigration" image: https://source.unsplash.com/400x175/?github description: API docs for the cloudDataMigration plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'cloudDataMigration'] --- import cloudDataMigrationObj from './cloud_data_migration.devdocs.json'; diff --git a/api_docs/cloud_defend.mdx b/api_docs/cloud_defend.mdx index df770a4f04e89..1e519b6111a6e 100644 --- a/api_docs/cloud_defend.mdx +++ b/api_docs/cloud_defend.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/cloudDefend title: "cloudDefend" image: https://source.unsplash.com/400x175/?github description: API docs for the cloudDefend plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'cloudDefend'] --- import cloudDefendObj from './cloud_defend.devdocs.json'; diff --git a/api_docs/cloud_experiments.mdx b/api_docs/cloud_experiments.mdx index d3904afff1417..72b099491f954 100644 --- a/api_docs/cloud_experiments.mdx +++ b/api_docs/cloud_experiments.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/cloudExperiments title: "cloudExperiments" image: https://source.unsplash.com/400x175/?github description: API docs for the cloudExperiments plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'cloudExperiments'] --- import cloudExperimentsObj from './cloud_experiments.devdocs.json'; diff --git a/api_docs/cloud_security_posture.mdx b/api_docs/cloud_security_posture.mdx index 990ab1988d90b..55990918e4035 100644 --- a/api_docs/cloud_security_posture.mdx +++ b/api_docs/cloud_security_posture.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/cloudSecurityPosture title: "cloudSecurityPosture" image: https://source.unsplash.com/400x175/?github description: API docs for the cloudSecurityPosture plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'cloudSecurityPosture'] --- import cloudSecurityPostureObj from './cloud_security_posture.devdocs.json'; diff --git a/api_docs/console.mdx b/api_docs/console.mdx index 71c4d57113721..ff5bc21ddb6bc 100644 --- a/api_docs/console.mdx +++ b/api_docs/console.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/console title: "console" image: https://source.unsplash.com/400x175/?github description: API docs for the console plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'console'] --- import consoleObj from './console.devdocs.json'; diff --git a/api_docs/content_management.devdocs.json b/api_docs/content_management.devdocs.json index 338c6568fdb4d..191b6341bb3b0 100644 --- a/api_docs/content_management.devdocs.json +++ b/api_docs/content_management.devdocs.json @@ -17,7 +17,22 @@ "path": "src/plugins/content_management/public/types.ts", "deprecated": false, "trackAdoption": false, - "children": [], + "children": [ + { + "parentPluginId": "contentManagement", + "id": "def-public.ContentManagementPublicStart.client", + "type": "Object", + "tags": [], + "label": "client", + "description": [], + "signature": [ + "ContentClient" + ], + "path": "src/plugins/content_management/public/types.ts", + "deprecated": false, + "trackAdoption": false + } + ], "lifecycle": "start", "initialIsOpen": true } @@ -61,7 +76,192 @@ "common": { "classes": [], "functions": [], - "interfaces": [], + "interfaces": [ + { + "parentPluginId": "contentManagement", + "id": "def-common.CreateIn", + "type": "Interface", + "tags": [], + "label": "CreateIn", + "description": [], + "signature": [ + { + "pluginId": "contentManagement", + "scope": "common", + "docId": "kibContentManagementPluginApi", + "section": "def-common.CreateIn", + "text": "CreateIn" + }, + "" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "contentManagement", + "id": "def-common.CreateIn.contentType", + "type": "Uncategorized", + "tags": [], + "label": "contentType", + "description": [], + "signature": [ + "T" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.CreateIn.data", + "type": "Uncategorized", + "tags": [], + "label": "data", + "description": [], + "signature": [ + "Data" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.CreateIn.options", + "type": "Uncategorized", + "tags": [], + "label": "options", + "description": [], + "signature": [ + "Options | undefined" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.GetIn", + "type": "Interface", + "tags": [], + "label": "GetIn", + "description": [], + "signature": [ + { + "pluginId": "contentManagement", + "scope": "common", + "docId": "kibContentManagementPluginApi", + "section": "def-common.GetIn", + "text": "GetIn" + }, + "" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "contentManagement", + "id": "def-common.GetIn.id", + "type": "string", + "tags": [], + "label": "id", + "description": [], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.GetIn.contentType", + "type": "string", + "tags": [], + "label": "contentType", + "description": [], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.GetIn.options", + "type": "Uncategorized", + "tags": [], + "label": "options", + "description": [], + "signature": [ + "Options | undefined" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.ProcedureSchemas", + "type": "Interface", + "tags": [], + "label": "ProcedureSchemas", + "description": [], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "contentManagement", + "id": "def-common.ProcedureSchemas.in", + "type": "CompoundType", + "tags": [], + "label": "in", + "description": [], + "signature": [ + "false | ", + { + "pluginId": "@kbn/config-schema", + "scope": "common", + "docId": "kibKbnConfigSchemaPluginApi", + "section": "def-common.Type", + "text": "Type" + }, + " | undefined" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.ProcedureSchemas.out", + "type": "CompoundType", + "tags": [], + "label": "out", + "description": [], + "signature": [ + "false | ", + { + "pluginId": "@kbn/config-schema", + "scope": "common", + "docId": "kibKbnConfigSchemaPluginApi", + "section": "def-common.Type", + "text": "Type" + }, + " | undefined" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + } + ], "enums": [], "misc": [ { @@ -93,8 +293,93 @@ "deprecated": false, "trackAdoption": false, "initialIsOpen": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.ProcedureName", + "type": "Type", + "tags": [], + "label": "ProcedureName", + "description": [], + "signature": [ + "\"get\" | \"create\"" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false } ], - "objects": [] + "objects": [ + { + "parentPluginId": "contentManagement", + "id": "def-common.procedureNames", + "type": "Object", + "tags": [], + "label": "procedureNames", + "description": [], + "signature": [ + "readonly [\"get\", \"create\"]" + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.schemas", + "type": "Object", + "tags": [], + "label": "schemas", + "description": [], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "contentManagement", + "id": "def-common.schemas.get", + "type": "Object", + "tags": [], + "label": "get", + "description": [], + "signature": [ + { + "pluginId": "contentManagement", + "scope": "common", + "docId": "kibContentManagementPluginApi", + "section": "def-common.ProcedureSchemas", + "text": "ProcedureSchemas" + } + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "contentManagement", + "id": "def-common.schemas.create", + "type": "Object", + "tags": [], + "label": "create", + "description": [], + "signature": [ + { + "pluginId": "contentManagement", + "scope": "common", + "docId": "kibContentManagementPluginApi", + "section": "def-common.ProcedureSchemas", + "text": "ProcedureSchemas" + } + ], + "path": "src/plugins/content_management/common/rpc.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + } + ] } } \ No newline at end of file diff --git a/api_docs/content_management.mdx b/api_docs/content_management.mdx index e7cf55833194e..b6960949cd248 100644 --- a/api_docs/content_management.mdx +++ b/api_docs/content_management.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/contentManagement title: "contentManagement" image: https://source.unsplash.com/400x175/?github description: API docs for the contentManagement plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'contentManagement'] --- import contentManagementObj from './content_management.devdocs.json'; @@ -21,7 +21,7 @@ Contact [@elastic/kibana-global-experience](https://github.com/orgs/elastic/team | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 5 | 0 | 5 | 0 | +| 22 | 0 | 22 | 1 | ## Client @@ -38,6 +38,12 @@ Contact [@elastic/kibana-global-experience](https://github.com/orgs/elastic/team ## Common +### Objects + + +### Interfaces + + ### Consts, variables and types diff --git a/api_docs/controls.mdx b/api_docs/controls.mdx index 0e6b485d34eab..6b4e0c8f5605e 100644 --- a/api_docs/controls.mdx +++ b/api_docs/controls.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/controls title: "controls" image: https://source.unsplash.com/400x175/?github description: API docs for the controls plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'controls'] --- import controlsObj from './controls.devdocs.json'; diff --git a/api_docs/core.devdocs.json b/api_docs/core.devdocs.json index 4c82e4fc45cc0..f9698898bc46e 100644 --- a/api_docs/core.devdocs.json +++ b/api_docs/core.devdocs.json @@ -23432,6 +23432,17 @@ "deprecated": false, "trackAdoption": false }, + { + "parentPluginId": "core", + "id": "def-server.CspConfig.disableUnsafeEval", + "type": "boolean", + "tags": [], + "label": "disableUnsafeEval", + "description": [], + "path": "packages/core/http/core-http-server-internal/src/csp/csp_config.ts", + "deprecated": false, + "trackAdoption": false + }, { "parentPluginId": "core", "id": "def-server.CspConfig.warnLegacyBrowsers", @@ -62931,6 +62942,55 @@ "path": "packages/core/saved-objects/core-saved-objects-server/src/saved_objects_type.ts", "deprecated": false, "trackAdoption": false + }, + { + "parentPluginId": "core", + "id": "def-server.SavedObjectsType.modelVersions", + "type": "CompoundType", + "tags": [ + "alpha" + ], + "label": "modelVersions", + "description": [ + "\nA map of model versions associated with this type.\n\nModel versions supersede the {@link SavedObjectsType.migrations | migrations} (and {@link SavedObjectsType.schemas | schemas}) APIs\nby exposing an unified way of describing the changes of shape or data of the type.\n\nModel versioning is decoupled from Kibana versioning, and isolated between types.\nModel versions are identified by a single numeric value, starting at `1` and without gaps.\n\nPlease refer to {@link SavedObjectsModelVersion} for details on the API's usages.\n\nA **valid** versioning would be:\n\n```ts\n{\n name: 'foo',\n // other mandatory attributes...\n modelVersions: {\n '1': modelVersion1,\n '2': modelVersion2,\n '3': modelVersion3,\n }\n}\n```\n\nA **invalid** versioning would be:\n\n```ts\n{\n name: 'foo',\n // other mandatory attributes...\n modelVersions: {\n '1': modelVersion1,\n '3': modelVersion3, // ERROR, no model version 2\n '3.1': modelVersion31, // ERROR, model version is a single numeric value\n }\n}\n```\n" + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsModelVersionMap", + "text": "SavedObjectsModelVersionMap" + }, + " | ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsModelVersionMapProvider", + "text": "SavedObjectsModelVersionMapProvider" + }, + " | undefined" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/saved_objects_type.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "core", + "id": "def-server.SavedObjectsType.switchToModelVersionAt", + "type": "string", + "tags": [], + "label": "switchToModelVersionAt", + "description": [ + "\nAllows to opt-in to the new model version API.\n\nMust be a valid semver version (with the patch version being necessarily 0)\n\nWhen specified, the type will switch from using the {@link SavedObjectsType.migrations | legacy migration API}\nto use the {@link SavedObjectsType.modelVersions | modelVersion API} after the specified version.\n\nWhen opted in, it will no longer be possible to use the legacy migration API after the specified version.\n\nA **valid** usage example would be:\n\n```ts\n{\n name: 'foo',\n // other mandatory attributes...\n switchToModelVersionAt: '8.8.0',\n migrations: {\n '8.1.0': migrateTo810,\n '8.7.0': migrateTo870,\n },\n modelVersions: {\n '1': modelVersion1\n }\n}\n```\n\nAn **invalid** usage example would be:\n\n```ts\n{\n name: 'foo',\n // other mandatory attributes...\n switchToModelVersionAt: '8.9.0',\n migrations: {\n '8.1.0': migrateTo8_1,\n '8.9.0': migrateTo8_9, // error: migration registered for the switch version\n '8.10.0': migrateTo8_10, // error: migration registered for after the switch version\n },\n modelVersions: {\n '1': modelVersion1\n }\n}\n```\n\nPlease refer to the {@link SavedObjectsType.modelVersions | modelVersion API} for more documentation on\nthe new API.\n" + ], + "signature": [ + "string | undefined" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/saved_objects_type.ts", + "deprecated": false, + "trackAdoption": false } ], "initialIsOpen": false diff --git a/api_docs/core.mdx b/api_docs/core.mdx index 98ade83d17019..04a997143d21b 100644 --- a/api_docs/core.mdx +++ b/api_docs/core.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/core title: "core" image: https://source.unsplash.com/400x175/?github description: API docs for the core plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'core'] --- import coreObj from './core.devdocs.json'; @@ -21,7 +21,7 @@ Contact [Kibana Core](https://github.com/orgs/elastic/teams/kibana-core) for que | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 2845 | 17 | 1029 | 0 | +| 2848 | 17 | 1030 | 0 | ## Client diff --git a/api_docs/custom_integrations.mdx b/api_docs/custom_integrations.mdx index 11e0ff18cd678..abac3f825321a 100644 --- a/api_docs/custom_integrations.mdx +++ b/api_docs/custom_integrations.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/customIntegrations title: "customIntegrations" image: https://source.unsplash.com/400x175/?github description: API docs for the customIntegrations plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'customIntegrations'] --- import customIntegrationsObj from './custom_integrations.devdocs.json'; diff --git a/api_docs/dashboard.devdocs.json b/api_docs/dashboard.devdocs.json index 7a51fb8b8f8a7..f65ebc3b42b65 100644 --- a/api_docs/dashboard.devdocs.json +++ b/api_docs/dashboard.devdocs.json @@ -876,7 +876,7 @@ "section": "def-common.PanelState", "text": "PanelState" }, - "<{ id: string; }>>, generateNewId?: boolean | undefined) => Promise" + "<{ id: string; }>>, generateNewId?: boolean | undefined) => Promise" ], "path": "src/plugins/dashboard/public/dashboard_container/embeddable/dashboard_container.tsx", "deprecated": false, @@ -1094,7 +1094,7 @@ "section": "def-public.DashboardContainer", "text": "DashboardContainer" }, - ", type: string, explicitInput: Partial, embeddableId?: string | undefined) => Promise, embeddableId?: string | undefined) => Promise | [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [test_script.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/components/scripting_help/test_script.tsx#:~:text=title), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=title), [create_edit_field.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/create_edit_field/create_edit_field.tsx#:~:text=title), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [test_script.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/components/scripting_help/test_script.tsx#:~:text=title), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=title), [create_edit_field.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/create_edit_field/create_edit_field.tsx#:~:text=title) | - | | | [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=removeScriptedField), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=removeScriptedField), [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=removeScriptedField), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=removeScriptedField) | - | -| | [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields) | - | +| | [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields) | - | | | [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=getScriptedFields), [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=getScriptedFields) | - | | | [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [test_script.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/components/scripting_help/test_script.tsx#:~:text=title), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=title), [create_edit_field.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/create_edit_field/create_edit_field.tsx#:~:text=title), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [test_script.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/components/scripting_help/test_script.tsx#:~:text=title), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=title), [create_edit_field.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/create_edit_field/create_edit_field.tsx#:~:text=title) | - | | | [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=removeScriptedField), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=removeScriptedField), [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=removeScriptedField), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=removeScriptedField) | - | -| | [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields) | - | +| | [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields) | - | | | [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=getScriptedFields), [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=getScriptedFields) | - | | | [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=title), [test_script.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/components/scripting_help/test_script.tsx#:~:text=title), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=title), [create_edit_field.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/create_edit_field/create_edit_field.tsx#:~:text=title) | - | | | [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=removeScriptedField), [field_editor.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/field_editor/field_editor.tsx#:~:text=removeScriptedField) | - | -| | [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields) | - | +| | [table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/source_filters_table/components/table/table.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields), [edit_index_pattern.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/edit_index_pattern.tsx#:~:text=getNonScriptedFields) | - | | | [scripted_fields_table.tsx](https://github.com/elastic/kibana/tree/main/src/plugins/data_view_management/public/components/edit_index_pattern/scripted_fields_table/scripted_fields_table.tsx#:~:text=getScriptedFields) | - | diff --git a/api_docs/deprecations_by_team.mdx b/api_docs/deprecations_by_team.mdx index 4ab6c7239919f..7ed175273aff5 100644 --- a/api_docs/deprecations_by_team.mdx +++ b/api_docs/deprecations_by_team.mdx @@ -7,7 +7,7 @@ id: kibDevDocsDeprecationsDueByTeam slug: /kibana-dev-docs/api-meta/deprecations-due-by-team title: Deprecated APIs due to be removed, by team description: Lists the teams that are referencing deprecated APIs with a remove by date. -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana'] --- diff --git a/api_docs/dev_tools.mdx b/api_docs/dev_tools.mdx index 56812df7a1d37..01d6abca8a3ff 100644 --- a/api_docs/dev_tools.mdx +++ b/api_docs/dev_tools.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/devTools title: "devTools" image: https://source.unsplash.com/400x175/?github description: API docs for the devTools plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'devTools'] --- import devToolsObj from './dev_tools.devdocs.json'; diff --git a/api_docs/discover.mdx b/api_docs/discover.mdx index 1e26ab13c2deb..b582a8ab7082d 100644 --- a/api_docs/discover.mdx +++ b/api_docs/discover.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/discover title: "discover" image: https://source.unsplash.com/400x175/?github description: API docs for the discover plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'discover'] --- import discoverObj from './discover.devdocs.json'; diff --git a/api_docs/discover_enhanced.mdx b/api_docs/discover_enhanced.mdx index 3dc9d5192dcf4..95d841d278fa9 100644 --- a/api_docs/discover_enhanced.mdx +++ b/api_docs/discover_enhanced.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/discoverEnhanced title: "discoverEnhanced" image: https://source.unsplash.com/400x175/?github description: API docs for the discoverEnhanced plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'discoverEnhanced'] --- import discoverEnhancedObj from './discover_enhanced.devdocs.json'; diff --git a/api_docs/ecs_data_quality_dashboard.mdx b/api_docs/ecs_data_quality_dashboard.mdx index d24bd912d018b..b9ef67e54beb0 100644 --- a/api_docs/ecs_data_quality_dashboard.mdx +++ b/api_docs/ecs_data_quality_dashboard.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/ecsDataQualityDashboard title: "ecsDataQualityDashboard" image: https://source.unsplash.com/400x175/?github description: API docs for the ecsDataQualityDashboard plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'ecsDataQualityDashboard'] --- import ecsDataQualityDashboardObj from './ecs_data_quality_dashboard.devdocs.json'; diff --git a/api_docs/embeddable.mdx b/api_docs/embeddable.mdx index e960942ffc7ac..74e447101a8d6 100644 --- a/api_docs/embeddable.mdx +++ b/api_docs/embeddable.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/embeddable title: "embeddable" image: https://source.unsplash.com/400x175/?github description: API docs for the embeddable plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'embeddable'] --- import embeddableObj from './embeddable.devdocs.json'; diff --git a/api_docs/embeddable_enhanced.mdx b/api_docs/embeddable_enhanced.mdx index 81b3dc703df6c..3ea0c6c5a1004 100644 --- a/api_docs/embeddable_enhanced.mdx +++ b/api_docs/embeddable_enhanced.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/embeddableEnhanced title: "embeddableEnhanced" image: https://source.unsplash.com/400x175/?github description: API docs for the embeddableEnhanced plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'embeddableEnhanced'] --- import embeddableEnhancedObj from './embeddable_enhanced.devdocs.json'; diff --git a/api_docs/encrypted_saved_objects.mdx b/api_docs/encrypted_saved_objects.mdx index 3d02811b73d7c..4d6b875f064f3 100644 --- a/api_docs/encrypted_saved_objects.mdx +++ b/api_docs/encrypted_saved_objects.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/encryptedSavedObjects title: "encryptedSavedObjects" image: https://source.unsplash.com/400x175/?github description: API docs for the encryptedSavedObjects plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'encryptedSavedObjects'] --- import encryptedSavedObjectsObj from './encrypted_saved_objects.devdocs.json'; diff --git a/api_docs/enterprise_search.mdx b/api_docs/enterprise_search.mdx index 9f4d87207eb71..6ea8c2cfdc964 100644 --- a/api_docs/enterprise_search.mdx +++ b/api_docs/enterprise_search.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/enterpriseSearch title: "enterpriseSearch" image: https://source.unsplash.com/400x175/?github description: API docs for the enterpriseSearch plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'enterpriseSearch'] --- import enterpriseSearchObj from './enterprise_search.devdocs.json'; diff --git a/api_docs/es_ui_shared.mdx b/api_docs/es_ui_shared.mdx index 6f1afc25be0de..1d502a267de4c 100644 --- a/api_docs/es_ui_shared.mdx +++ b/api_docs/es_ui_shared.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/esUiShared title: "esUiShared" image: https://source.unsplash.com/400x175/?github description: API docs for the esUiShared plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'esUiShared'] --- import esUiSharedObj from './es_ui_shared.devdocs.json'; diff --git a/api_docs/event_annotation.mdx b/api_docs/event_annotation.mdx index 0051a373b10dc..e613aec503e91 100644 --- a/api_docs/event_annotation.mdx +++ b/api_docs/event_annotation.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/eventAnnotation title: "eventAnnotation" image: https://source.unsplash.com/400x175/?github description: API docs for the eventAnnotation plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'eventAnnotation'] --- import eventAnnotationObj from './event_annotation.devdocs.json'; diff --git a/api_docs/event_log.mdx b/api_docs/event_log.mdx index 389b02648a8ea..f0997f74e72bb 100644 --- a/api_docs/event_log.mdx +++ b/api_docs/event_log.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/eventLog title: "eventLog" image: https://source.unsplash.com/400x175/?github description: API docs for the eventLog plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'eventLog'] --- import eventLogObj from './event_log.devdocs.json'; diff --git a/api_docs/expression_error.mdx b/api_docs/expression_error.mdx index 5f28b2b8ca52b..ac72fd3254383 100644 --- a/api_docs/expression_error.mdx +++ b/api_docs/expression_error.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionError title: "expressionError" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionError plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionError'] --- import expressionErrorObj from './expression_error.devdocs.json'; diff --git a/api_docs/expression_gauge.mdx b/api_docs/expression_gauge.mdx index 8c8835a3e342b..b832096373d3e 100644 --- a/api_docs/expression_gauge.mdx +++ b/api_docs/expression_gauge.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionGauge title: "expressionGauge" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionGauge plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionGauge'] --- import expressionGaugeObj from './expression_gauge.devdocs.json'; diff --git a/api_docs/expression_heatmap.mdx b/api_docs/expression_heatmap.mdx index 08243c1f43720..9fa3043100d66 100644 --- a/api_docs/expression_heatmap.mdx +++ b/api_docs/expression_heatmap.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionHeatmap title: "expressionHeatmap" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionHeatmap plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionHeatmap'] --- import expressionHeatmapObj from './expression_heatmap.devdocs.json'; diff --git a/api_docs/expression_image.mdx b/api_docs/expression_image.mdx index c391a56806965..f90dc600273e1 100644 --- a/api_docs/expression_image.mdx +++ b/api_docs/expression_image.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionImage title: "expressionImage" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionImage plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionImage'] --- import expressionImageObj from './expression_image.devdocs.json'; diff --git a/api_docs/expression_legacy_metric_vis.mdx b/api_docs/expression_legacy_metric_vis.mdx index ece42bacfcfcd..47ae9efe174a8 100644 --- a/api_docs/expression_legacy_metric_vis.mdx +++ b/api_docs/expression_legacy_metric_vis.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionLegacyMetricVis title: "expressionLegacyMetricVis" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionLegacyMetricVis plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionLegacyMetricVis'] --- import expressionLegacyMetricVisObj from './expression_legacy_metric_vis.devdocs.json'; diff --git a/api_docs/expression_metric.mdx b/api_docs/expression_metric.mdx index caa39ea326958..4c033f6a5e918 100644 --- a/api_docs/expression_metric.mdx +++ b/api_docs/expression_metric.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionMetric title: "expressionMetric" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionMetric plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionMetric'] --- import expressionMetricObj from './expression_metric.devdocs.json'; diff --git a/api_docs/expression_metric_vis.mdx b/api_docs/expression_metric_vis.mdx index 338a5a7cb0f43..79cd19c112954 100644 --- a/api_docs/expression_metric_vis.mdx +++ b/api_docs/expression_metric_vis.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionMetricVis title: "expressionMetricVis" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionMetricVis plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionMetricVis'] --- import expressionMetricVisObj from './expression_metric_vis.devdocs.json'; diff --git a/api_docs/expression_partition_vis.mdx b/api_docs/expression_partition_vis.mdx index 961157460f1a6..a26eda9594dd6 100644 --- a/api_docs/expression_partition_vis.mdx +++ b/api_docs/expression_partition_vis.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionPartitionVis title: "expressionPartitionVis" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionPartitionVis plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionPartitionVis'] --- import expressionPartitionVisObj from './expression_partition_vis.devdocs.json'; diff --git a/api_docs/expression_repeat_image.mdx b/api_docs/expression_repeat_image.mdx index 8a9499ea73f28..8f2aa24fbf52d 100644 --- a/api_docs/expression_repeat_image.mdx +++ b/api_docs/expression_repeat_image.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionRepeatImage title: "expressionRepeatImage" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionRepeatImage plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionRepeatImage'] --- import expressionRepeatImageObj from './expression_repeat_image.devdocs.json'; diff --git a/api_docs/expression_reveal_image.mdx b/api_docs/expression_reveal_image.mdx index 619626f6e0814..8ebf1cb95670f 100644 --- a/api_docs/expression_reveal_image.mdx +++ b/api_docs/expression_reveal_image.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionRevealImage title: "expressionRevealImage" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionRevealImage plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionRevealImage'] --- import expressionRevealImageObj from './expression_reveal_image.devdocs.json'; diff --git a/api_docs/expression_shape.mdx b/api_docs/expression_shape.mdx index fea5fd680ebc3..ff4341f5d4251 100644 --- a/api_docs/expression_shape.mdx +++ b/api_docs/expression_shape.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionShape title: "expressionShape" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionShape plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionShape'] --- import expressionShapeObj from './expression_shape.devdocs.json'; diff --git a/api_docs/expression_tagcloud.mdx b/api_docs/expression_tagcloud.mdx index be59582602b8c..c85eda0ebf2ae 100644 --- a/api_docs/expression_tagcloud.mdx +++ b/api_docs/expression_tagcloud.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionTagcloud title: "expressionTagcloud" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionTagcloud plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionTagcloud'] --- import expressionTagcloudObj from './expression_tagcloud.devdocs.json'; diff --git a/api_docs/expression_x_y.mdx b/api_docs/expression_x_y.mdx index 6fe27e22692ac..7c2fb48e77aa5 100644 --- a/api_docs/expression_x_y.mdx +++ b/api_docs/expression_x_y.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressionXY title: "expressionXY" image: https://source.unsplash.com/400x175/?github description: API docs for the expressionXY plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressionXY'] --- import expressionXYObj from './expression_x_y.devdocs.json'; diff --git a/api_docs/expressions.mdx b/api_docs/expressions.mdx index facc51eb94450..72f38cbcf706c 100644 --- a/api_docs/expressions.mdx +++ b/api_docs/expressions.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/expressions title: "expressions" image: https://source.unsplash.com/400x175/?github description: API docs for the expressions plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'expressions'] --- import expressionsObj from './expressions.devdocs.json'; diff --git a/api_docs/features.mdx b/api_docs/features.mdx index b2c0f12638ddc..dd358f351027e 100644 --- a/api_docs/features.mdx +++ b/api_docs/features.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/features title: "features" image: https://source.unsplash.com/400x175/?github description: API docs for the features plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'features'] --- import featuresObj from './features.devdocs.json'; diff --git a/api_docs/field_formats.mdx b/api_docs/field_formats.mdx index ed72a41dc4fa6..aba2831e7ceb5 100644 --- a/api_docs/field_formats.mdx +++ b/api_docs/field_formats.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/fieldFormats title: "fieldFormats" image: https://source.unsplash.com/400x175/?github description: API docs for the fieldFormats plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'fieldFormats'] --- import fieldFormatsObj from './field_formats.devdocs.json'; diff --git a/api_docs/file_upload.mdx b/api_docs/file_upload.mdx index d1398101e0fcc..92fffad68e1e7 100644 --- a/api_docs/file_upload.mdx +++ b/api_docs/file_upload.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/fileUpload title: "fileUpload" image: https://source.unsplash.com/400x175/?github description: API docs for the fileUpload plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'fileUpload'] --- import fileUploadObj from './file_upload.devdocs.json'; diff --git a/api_docs/files.mdx b/api_docs/files.mdx index e72ef4a7726ff..cfcd4ef908577 100644 --- a/api_docs/files.mdx +++ b/api_docs/files.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/files title: "files" image: https://source.unsplash.com/400x175/?github description: API docs for the files plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'files'] --- import filesObj from './files.devdocs.json'; diff --git a/api_docs/files_management.mdx b/api_docs/files_management.mdx index ae937b38ab5dd..1e9862d13ff31 100644 --- a/api_docs/files_management.mdx +++ b/api_docs/files_management.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/filesManagement title: "filesManagement" image: https://source.unsplash.com/400x175/?github description: API docs for the filesManagement plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'filesManagement'] --- import filesManagementObj from './files_management.devdocs.json'; diff --git a/api_docs/fleet.devdocs.json b/api_docs/fleet.devdocs.json index b50d330b5bfd7..b5be9409262d9 100644 --- a/api_docs/fleet.devdocs.json +++ b/api_docs/fleet.devdocs.json @@ -17584,7 +17584,7 @@ "label": "agent", "description": [], "signature": [ - "{ monitoring: { namespace?: string | undefined; use_output?: string | undefined; enabled: boolean; metrics: boolean; logs: boolean; }; download: { sourceURI: string; }; } | undefined" + "{ monitoring: { namespace?: string | undefined; use_output?: string | undefined; enabled: boolean; metrics: boolean; logs: boolean; }; download: { sourceURI: string; }; features: Record; } | undefined" ], "path": "x-pack/plugins/fleet/common/types/models/agent_policy.ts", "deprecated": false, @@ -19167,6 +19167,20 @@ "path": "x-pack/plugins/fleet/common/types/models/agent_policy.ts", "deprecated": false, "trackAdoption": false + }, + { + "parentPluginId": "fleet", + "id": "def-common.NewAgentPolicy.agent_features", + "type": "Array", + "tags": [], + "label": "agent_features", + "description": [], + "signature": [ + "{ name: string; enabled: boolean; }[] | undefined" + ], + "path": "x-pack/plugins/fleet/common/types/models/agent_policy.ts", + "deprecated": false, + "trackAdoption": false } ], "initialIsOpen": false diff --git a/api_docs/fleet.mdx b/api_docs/fleet.mdx index 5619c453e6e7f..f9f2f24138784 100644 --- a/api_docs/fleet.mdx +++ b/api_docs/fleet.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/fleet title: "fleet" image: https://source.unsplash.com/400x175/?github description: API docs for the fleet plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'fleet'] --- import fleetObj from './fleet.devdocs.json'; @@ -21,7 +21,7 @@ Contact [Fleet](https://github.com/orgs/elastic/teams/fleet) for questions regar | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 1068 | 3 | 963 | 26 | +| 1069 | 3 | 964 | 26 | ## Client diff --git a/api_docs/global_search.mdx b/api_docs/global_search.mdx index 98efd78f2657a..a6403e4ca59f1 100644 --- a/api_docs/global_search.mdx +++ b/api_docs/global_search.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/globalSearch title: "globalSearch" image: https://source.unsplash.com/400x175/?github description: API docs for the globalSearch plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'globalSearch'] --- import globalSearchObj from './global_search.devdocs.json'; diff --git a/api_docs/guided_onboarding.mdx b/api_docs/guided_onboarding.mdx index e18937f0e4b0e..2822ee9463157 100644 --- a/api_docs/guided_onboarding.mdx +++ b/api_docs/guided_onboarding.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/guidedOnboarding title: "guidedOnboarding" image: https://source.unsplash.com/400x175/?github description: API docs for the guidedOnboarding plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'guidedOnboarding'] --- import guidedOnboardingObj from './guided_onboarding.devdocs.json'; diff --git a/api_docs/home.mdx b/api_docs/home.mdx index 4878e8d8fad62..b8812dca0b8a6 100644 --- a/api_docs/home.mdx +++ b/api_docs/home.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/home title: "home" image: https://source.unsplash.com/400x175/?github description: API docs for the home plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'home'] --- import homeObj from './home.devdocs.json'; diff --git a/api_docs/image_embeddable.mdx b/api_docs/image_embeddable.mdx index e9147a31f60d1..038ab616592e5 100644 --- a/api_docs/image_embeddable.mdx +++ b/api_docs/image_embeddable.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/imageEmbeddable title: "imageEmbeddable" image: https://source.unsplash.com/400x175/?github description: API docs for the imageEmbeddable plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'imageEmbeddable'] --- import imageEmbeddableObj from './image_embeddable.devdocs.json'; diff --git a/api_docs/index_lifecycle_management.mdx b/api_docs/index_lifecycle_management.mdx index 60011f99267e6..e5727037baf62 100644 --- a/api_docs/index_lifecycle_management.mdx +++ b/api_docs/index_lifecycle_management.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/indexLifecycleManagement title: "indexLifecycleManagement" image: https://source.unsplash.com/400x175/?github description: API docs for the indexLifecycleManagement plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'indexLifecycleManagement'] --- import indexLifecycleManagementObj from './index_lifecycle_management.devdocs.json'; diff --git a/api_docs/index_management.mdx b/api_docs/index_management.mdx index 709f27c8dbca9..ec494ff345957 100644 --- a/api_docs/index_management.mdx +++ b/api_docs/index_management.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/indexManagement title: "indexManagement" image: https://source.unsplash.com/400x175/?github description: API docs for the indexManagement plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'indexManagement'] --- import indexManagementObj from './index_management.devdocs.json'; diff --git a/api_docs/infra.mdx b/api_docs/infra.mdx index 56bb5ed0e56dd..37fe8b8f2cb86 100644 --- a/api_docs/infra.mdx +++ b/api_docs/infra.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/infra title: "infra" image: https://source.unsplash.com/400x175/?github description: API docs for the infra plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'infra'] --- import infraObj from './infra.devdocs.json'; diff --git a/api_docs/inspector.mdx b/api_docs/inspector.mdx index 4bc5f5a9f5ce9..5f8d797df6719 100644 --- a/api_docs/inspector.mdx +++ b/api_docs/inspector.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/inspector title: "inspector" image: https://source.unsplash.com/400x175/?github description: API docs for the inspector plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'inspector'] --- import inspectorObj from './inspector.devdocs.json'; diff --git a/api_docs/interactive_setup.mdx b/api_docs/interactive_setup.mdx index af939ff0a6862..9b3e8d6409daf 100644 --- a/api_docs/interactive_setup.mdx +++ b/api_docs/interactive_setup.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/interactiveSetup title: "interactiveSetup" image: https://source.unsplash.com/400x175/?github description: API docs for the interactiveSetup plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'interactiveSetup'] --- import interactiveSetupObj from './interactive_setup.devdocs.json'; diff --git a/api_docs/kbn_ace.mdx b/api_docs/kbn_ace.mdx index bd5959e7d82f3..677de56e3d211 100644 --- a/api_docs/kbn_ace.mdx +++ b/api_docs/kbn_ace.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ace title: "@kbn/ace" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ace plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ace'] --- import kbnAceObj from './kbn_ace.devdocs.json'; diff --git a/api_docs/kbn_aiops_components.mdx b/api_docs/kbn_aiops_components.mdx index 8e82d362e6d17..ede2ec9b2a899 100644 --- a/api_docs/kbn_aiops_components.mdx +++ b/api_docs/kbn_aiops_components.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-aiops-components title: "@kbn/aiops-components" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/aiops-components plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/aiops-components'] --- import kbnAiopsComponentsObj from './kbn_aiops_components.devdocs.json'; diff --git a/api_docs/kbn_aiops_utils.mdx b/api_docs/kbn_aiops_utils.mdx index 59618d0d654b1..12ace727a2a86 100644 --- a/api_docs/kbn_aiops_utils.mdx +++ b/api_docs/kbn_aiops_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-aiops-utils title: "@kbn/aiops-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/aiops-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/aiops-utils'] --- import kbnAiopsUtilsObj from './kbn_aiops_utils.devdocs.json'; diff --git a/api_docs/kbn_alerts.mdx b/api_docs/kbn_alerts.mdx index b6dbebf027522..45812c6ee2511 100644 --- a/api_docs/kbn_alerts.mdx +++ b/api_docs/kbn_alerts.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-alerts title: "@kbn/alerts" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/alerts plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/alerts'] --- import kbnAlertsObj from './kbn_alerts.devdocs.json'; diff --git a/api_docs/kbn_alerts_ui_shared.devdocs.json b/api_docs/kbn_alerts_ui_shared.devdocs.json new file mode 100644 index 0000000000000..7577f6d8519f5 --- /dev/null +++ b/api_docs/kbn_alerts_ui_shared.devdocs.json @@ -0,0 +1,119 @@ +{ + "id": "@kbn/alerts-ui-shared", + "client": { + "classes": [], + "functions": [], + "interfaces": [], + "enums": [], + "misc": [], + "objects": [] + }, + "server": { + "classes": [], + "functions": [], + "interfaces": [], + "enums": [], + "misc": [], + "objects": [] + }, + "common": { + "classes": [], + "functions": [ + { + "parentPluginId": "@kbn/alerts-ui-shared", + "id": "def-common.AlertLifecycleStatusBadge", + "type": "Function", + "tags": [], + "label": "AlertLifecycleStatusBadge", + "description": [], + "signature": [ + "React.NamedExoticComponent<", + { + "pluginId": "@kbn/alerts-ui-shared", + "scope": "common", + "docId": "kibKbnAlertsUiSharedPluginApi", + "section": "def-common.AlertLifecycleStatusBadgeProps", + "text": "AlertLifecycleStatusBadgeProps" + }, + "> & { readonly type: (props: ", + { + "pluginId": "@kbn/alerts-ui-shared", + "scope": "common", + "docId": "kibKbnAlertsUiSharedPluginApi", + "section": "def-common.AlertLifecycleStatusBadgeProps", + "text": "AlertLifecycleStatusBadgeProps" + }, + ") => JSX.Element; }" + ], + "path": "packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.tsx", + "deprecated": false, + "trackAdoption": false, + "returnComment": [], + "children": [ + { + "parentPluginId": "@kbn/alerts-ui-shared", + "id": "def-common.AlertLifecycleStatusBadge.$1", + "type": "Uncategorized", + "tags": [], + "label": "props", + "description": [], + "signature": [ + "P" + ], + "path": "node_modules/@types/react/index.d.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + } + ], + "interfaces": [ + { + "parentPluginId": "@kbn/alerts-ui-shared", + "id": "def-common.AlertLifecycleStatusBadgeProps", + "type": "Interface", + "tags": [], + "label": "AlertLifecycleStatusBadgeProps", + "description": [], + "path": "packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.tsx", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "@kbn/alerts-ui-shared", + "id": "def-common.AlertLifecycleStatusBadgeProps.alertStatus", + "type": "CompoundType", + "tags": [], + "label": "alertStatus", + "description": [], + "signature": [ + "\"recovered\" | \"active\"" + ], + "path": "packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.tsx", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/alerts-ui-shared", + "id": "def-common.AlertLifecycleStatusBadgeProps.flapping", + "type": "CompoundType", + "tags": [], + "label": "flapping", + "description": [], + "signature": [ + "string | boolean | undefined" + ], + "path": "packages/kbn-alerts-ui-shared/src/alert_lifecycle_status_badge/index.tsx", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + } + ], + "enums": [], + "misc": [], + "objects": [] + } +} \ No newline at end of file diff --git a/api_docs/kbn_alerts_ui_shared.mdx b/api_docs/kbn_alerts_ui_shared.mdx new file mode 100644 index 0000000000000..b6ad53e41b2c9 --- /dev/null +++ b/api_docs/kbn_alerts_ui_shared.mdx @@ -0,0 +1,33 @@ +--- +#### +#### This document is auto-generated and is meant to be viewed inside our experimental, new docs system. +#### Reach out in #docs-engineering for more info. +#### +id: kibKbnAlertsUiSharedPluginApi +slug: /kibana-dev-docs/api/kbn-alerts-ui-shared +title: "@kbn/alerts-ui-shared" +image: https://source.unsplash.com/400x175/?github +description: API docs for the @kbn/alerts-ui-shared plugin +date: 2023-02-08 +tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/alerts-ui-shared'] +--- +import kbnAlertsUiSharedObj from './kbn_alerts_ui_shared.devdocs.json'; + + + +Contact [Owner missing] for questions regarding this plugin. + +**Code health stats** + +| Public API count | Any count | Items lacking comments | Missing exports | +|-------------------|-----------|------------------------|-----------------| +| 5 | 0 | 4 | 0 | + +## Common + +### Functions + + +### Interfaces + + diff --git a/api_docs/kbn_analytics.mdx b/api_docs/kbn_analytics.mdx index f01e1f34223d4..2e658ae6c9565 100644 --- a/api_docs/kbn_analytics.mdx +++ b/api_docs/kbn_analytics.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-analytics title: "@kbn/analytics" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/analytics plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/analytics'] --- import kbnAnalyticsObj from './kbn_analytics.devdocs.json'; diff --git a/api_docs/kbn_analytics_client.mdx b/api_docs/kbn_analytics_client.mdx index 4fb8f6e1b58cd..0bf7133dca38b 100644 --- a/api_docs/kbn_analytics_client.mdx +++ b/api_docs/kbn_analytics_client.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-analytics-client title: "@kbn/analytics-client" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/analytics-client plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/analytics-client'] --- import kbnAnalyticsClientObj from './kbn_analytics_client.devdocs.json'; diff --git a/api_docs/kbn_analytics_shippers_elastic_v3_browser.mdx b/api_docs/kbn_analytics_shippers_elastic_v3_browser.mdx index e9d4ca59b0c2a..c9d24795e3a7a 100644 --- a/api_docs/kbn_analytics_shippers_elastic_v3_browser.mdx +++ b/api_docs/kbn_analytics_shippers_elastic_v3_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-analytics-shippers-elastic-v3-browser title: "@kbn/analytics-shippers-elastic-v3-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/analytics-shippers-elastic-v3-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/analytics-shippers-elastic-v3-browser'] --- import kbnAnalyticsShippersElasticV3BrowserObj from './kbn_analytics_shippers_elastic_v3_browser.devdocs.json'; diff --git a/api_docs/kbn_analytics_shippers_elastic_v3_common.mdx b/api_docs/kbn_analytics_shippers_elastic_v3_common.mdx index e48d7b3694b51..deffa9d10e139 100644 --- a/api_docs/kbn_analytics_shippers_elastic_v3_common.mdx +++ b/api_docs/kbn_analytics_shippers_elastic_v3_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-analytics-shippers-elastic-v3-common title: "@kbn/analytics-shippers-elastic-v3-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/analytics-shippers-elastic-v3-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/analytics-shippers-elastic-v3-common'] --- import kbnAnalyticsShippersElasticV3CommonObj from './kbn_analytics_shippers_elastic_v3_common.devdocs.json'; diff --git a/api_docs/kbn_analytics_shippers_elastic_v3_server.mdx b/api_docs/kbn_analytics_shippers_elastic_v3_server.mdx index 1c3dec0b3d1b0..d3d88e10dab86 100644 --- a/api_docs/kbn_analytics_shippers_elastic_v3_server.mdx +++ b/api_docs/kbn_analytics_shippers_elastic_v3_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-analytics-shippers-elastic-v3-server title: "@kbn/analytics-shippers-elastic-v3-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/analytics-shippers-elastic-v3-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/analytics-shippers-elastic-v3-server'] --- import kbnAnalyticsShippersElasticV3ServerObj from './kbn_analytics_shippers_elastic_v3_server.devdocs.json'; diff --git a/api_docs/kbn_analytics_shippers_fullstory.mdx b/api_docs/kbn_analytics_shippers_fullstory.mdx index c579c08e89a57..47073a516cccd 100644 --- a/api_docs/kbn_analytics_shippers_fullstory.mdx +++ b/api_docs/kbn_analytics_shippers_fullstory.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-analytics-shippers-fullstory title: "@kbn/analytics-shippers-fullstory" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/analytics-shippers-fullstory plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/analytics-shippers-fullstory'] --- import kbnAnalyticsShippersFullstoryObj from './kbn_analytics_shippers_fullstory.devdocs.json'; diff --git a/api_docs/kbn_analytics_shippers_gainsight.mdx b/api_docs/kbn_analytics_shippers_gainsight.mdx index c07838b49a8a8..1b79a515a5916 100644 --- a/api_docs/kbn_analytics_shippers_gainsight.mdx +++ b/api_docs/kbn_analytics_shippers_gainsight.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-analytics-shippers-gainsight title: "@kbn/analytics-shippers-gainsight" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/analytics-shippers-gainsight plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/analytics-shippers-gainsight'] --- import kbnAnalyticsShippersGainsightObj from './kbn_analytics_shippers_gainsight.devdocs.json'; diff --git a/api_docs/kbn_apm_config_loader.mdx b/api_docs/kbn_apm_config_loader.mdx index b61b78269d4a1..44fcc17d2a883 100644 --- a/api_docs/kbn_apm_config_loader.mdx +++ b/api_docs/kbn_apm_config_loader.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-apm-config-loader title: "@kbn/apm-config-loader" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/apm-config-loader plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/apm-config-loader'] --- import kbnApmConfigLoaderObj from './kbn_apm_config_loader.devdocs.json'; diff --git a/api_docs/kbn_apm_synthtrace.mdx b/api_docs/kbn_apm_synthtrace.mdx index 24ed27014b0e9..d9b40cb43524e 100644 --- a/api_docs/kbn_apm_synthtrace.mdx +++ b/api_docs/kbn_apm_synthtrace.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-apm-synthtrace title: "@kbn/apm-synthtrace" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/apm-synthtrace plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/apm-synthtrace'] --- import kbnApmSynthtraceObj from './kbn_apm_synthtrace.devdocs.json'; diff --git a/api_docs/kbn_apm_synthtrace_client.devdocs.json b/api_docs/kbn_apm_synthtrace_client.devdocs.json index 7c272f970dbc0..30e1816ad036a 100644 --- a/api_docs/kbn_apm_synthtrace_client.devdocs.json +++ b/api_docs/kbn_apm_synthtrace_client.devdocs.json @@ -1892,7 +1892,7 @@ "label": "timerange", "description": [], "signature": [ - "(from: number | Date, to: number | Date) => ", + "(from: number | Date | moment.Moment, to: number | Date | moment.Moment) => ", { "pluginId": "@kbn/apm-synthtrace-client", "scope": "common", @@ -1913,7 +1913,7 @@ "label": "from", "description": [], "signature": [ - "number | Date" + "number | Date | moment.Moment" ], "path": "packages/kbn-apm-synthtrace-client/src/lib/timerange.ts", "deprecated": false, @@ -1928,7 +1928,7 @@ "label": "to", "description": [], "signature": [ - "number | Date" + "number | Date | moment.Moment" ], "path": "packages/kbn-apm-synthtrace-client/src/lib/timerange.ts", "deprecated": false, @@ -2318,7 +2318,7 @@ "GeoLocation", "; 'client.geo.region_iso_code': string; 'client.geo.region_name': string; 'client.ip': string; 'cloud.account.id': string; 'cloud.account.name': string; 'cloud.availability_zone': string; 'cloud.machine.type': string; 'cloud.project.id': string; 'cloud.project.name': string; 'cloud.provider': string; 'cloud.region': string; 'cloud.service.name': string; 'container.id': string; 'destination.address': string; 'destination.port': number; 'device.id': string; 'device.manufacturer': string; 'device.model.identifier': string; 'device.model.name': string; 'ecs.version': string; 'error.exception': ", "ApmException", - "[]; 'error.grouping_key': string; 'error.grouping_name': string; 'error.id': string; 'event.ingested': number; 'event.name': string; 'event.outcome': string; 'event.outcome_numeric': number | { sum: number; value_count: number; }; 'faas.coldstart': boolean; 'faas.execution': string; 'faas.id': string; 'faas.name': string; 'faas.trigger.type': string; 'faas.version': string; 'host.architecture': string; 'host.hostname': string; 'host.name': string; 'host.os.full': string; 'host.os.name': string; 'host.os.platform': string; 'host.os.type': string; 'host.os.version': string; 'http.request.method': string; 'http.response.status_code': number; 'kubernetes.pod.name': string; 'kubernetes.pod.uid': string; 'metricset.name': string; 'network.carrier.icc': string; 'network.carrier.mcc': string; 'network.carrier.mnc': string; 'network.carrier.name': string; 'network.connection.subtype': string; 'network.connection.type': string; 'observer.type': string; 'observer.version_major': number; 'observer.version': string; 'parent.id': string; 'processor.event': string; 'processor.name': string; 'session.id': string; 'trace.id': string; 'transaction.aggregation.overflow_count': number; 'transaction.duration.us': number; 'transaction.id': string; 'transaction.name': string; 'transaction.type': string; 'transaction.duration.histogram': { values: number[]; counts: number[]; }; 'service.environment': string; 'service.framework.name': string; 'service.framework.version': string; 'service.language.name': string; 'service.language.version': string; 'service.name': string; 'service.node.name': string; 'service.runtime.name': string; 'service.runtime.version': string; 'service.target.name': string; 'service.target.type': string; 'service.version': string; 'span.action': string; 'span.destination.service.resource': string; 'span.destination.service.response_time.count': number; 'span.destination.service.response_time.sum.us': number; 'span.duration.us': number; 'span.id': string; 'span.name': string; 'span.self_time.count': number; 'span.self_time.sum.us': number; 'span.subtype': string; 'span.type': string; 'transaction.result': string; 'transaction.sampled': true; 'span.links': { trace: { id: string; }; span: { id: string; }; }[]; 'url.original': string; }> & Partial<{ 'system.process.memory.size': number; 'system.memory.actual.free': number; 'system.memory.total': number; 'system.cpu.total.norm.pct': number; 'system.process.memory.rss.bytes': number; 'system.process.cpu.total.norm.pct': number; 'jvm.memory.heap.used': number; 'jvm.memory.non_heap.used': number; 'jvm.thread.count': number; 'faas.billed_duration': number; 'faas.timeout': number; 'faas.coldstart_duration': number; 'faas.duration': number; }> & Partial<{ 'metricset.interval': string; 'transaction.duration.summary': string; }>" + "[]; 'error.grouping_key': string; 'error.grouping_name': string; 'error.id': string; 'event.ingested': number; 'event.name': string; 'event.outcome': string; 'event.outcome_numeric': number | { sum: number; value_count: number; }; 'faas.coldstart': boolean; 'faas.execution': string; 'faas.id': string; 'faas.name': string; 'faas.trigger.type': string; 'faas.version': string; 'host.architecture': string; 'host.hostname': string; 'host.name': string; 'host.os.full': string; 'host.os.name': string; 'host.os.platform': string; 'host.os.type': string; 'host.os.version': string; 'http.request.method': string; 'http.response.status_code': number; 'kubernetes.pod.name': string; 'kubernetes.pod.uid': string; 'labels.name': string; 'metricset.name': string; 'network.carrier.icc': string; 'network.carrier.mcc': string; 'network.carrier.mnc': string; 'network.carrier.name': string; 'network.connection.subtype': string; 'network.connection.type': string; 'observer.type': string; 'observer.version_major': number; 'observer.version': string; 'parent.id': string; 'processor.event': string; 'processor.name': string; 'session.id': string; 'trace.id': string; 'transaction.aggregation.overflow_count': number; 'transaction.duration.us': number; 'transaction.id': string; 'transaction.name': string; 'transaction.type': string; 'transaction.duration.histogram': { values: number[]; counts: number[]; }; 'service.environment': string; 'service.framework.name': string; 'service.framework.version': string; 'service.language.name': string; 'service.language.version': string; 'service.name': string; 'service.node.name': string; 'service.runtime.name': string; 'service.runtime.version': string; 'service.target.name': string; 'service.target.type': string; 'service.version': string; 'span.action': string; 'span.destination.service.resource': string; 'span.destination.service.response_time.count': number; 'span.destination.service.response_time.sum.us': number; 'span.duration.us': number; 'span.id': string; 'span.name': string; 'span.self_time.count': number; 'span.self_time.sum.us': number; 'span.subtype': string; 'span.type': string; 'transaction.result': string; 'transaction.sampled': true; 'span.links': { trace: { id: string; }; span: { id: string; }; }[]; 'url.original': string; }> & Partial<{ 'system.process.memory.size': number; 'system.memory.actual.free': number; 'system.memory.total': number; 'system.cpu.total.norm.pct': number; 'system.process.memory.rss.bytes': number; 'system.process.cpu.total.norm.pct': number; 'jvm.memory.heap.used': number; 'jvm.memory.non_heap.used': number; 'jvm.thread.count': number; 'faas.billed_duration': number; 'faas.timeout': number; 'faas.coldstart_duration': number; 'faas.duration': number; }> & Partial<{ 'metricset.interval': string; 'transaction.duration.summary': string; }>" ], "path": "packages/kbn-apm-synthtrace-client/src/lib/apm/apm_fields.ts", "deprecated": false, diff --git a/api_docs/kbn_apm_synthtrace_client.mdx b/api_docs/kbn_apm_synthtrace_client.mdx index 98372dda14b2f..e9c2fc217b306 100644 --- a/api_docs/kbn_apm_synthtrace_client.mdx +++ b/api_docs/kbn_apm_synthtrace_client.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-apm-synthtrace-client title: "@kbn/apm-synthtrace-client" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/apm-synthtrace-client plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/apm-synthtrace-client'] --- import kbnApmSynthtraceClientObj from './kbn_apm_synthtrace_client.devdocs.json'; diff --git a/api_docs/kbn_apm_utils.mdx b/api_docs/kbn_apm_utils.mdx index e46a72c8945d9..25fa157ba4c69 100644 --- a/api_docs/kbn_apm_utils.mdx +++ b/api_docs/kbn_apm_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-apm-utils title: "@kbn/apm-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/apm-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/apm-utils'] --- import kbnApmUtilsObj from './kbn_apm_utils.devdocs.json'; diff --git a/api_docs/kbn_axe_config.mdx b/api_docs/kbn_axe_config.mdx index 27cfdc9b8f946..8dfe0fe549118 100644 --- a/api_docs/kbn_axe_config.mdx +++ b/api_docs/kbn_axe_config.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-axe-config title: "@kbn/axe-config" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/axe-config plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/axe-config'] --- import kbnAxeConfigObj from './kbn_axe_config.devdocs.json'; diff --git a/api_docs/kbn_cases_components.mdx b/api_docs/kbn_cases_components.mdx index b1b97ecf4d3f7..935a9a733919f 100644 --- a/api_docs/kbn_cases_components.mdx +++ b/api_docs/kbn_cases_components.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-cases-components title: "@kbn/cases-components" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/cases-components plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/cases-components'] --- import kbnCasesComponentsObj from './kbn_cases_components.devdocs.json'; diff --git a/api_docs/kbn_cell_actions.mdx b/api_docs/kbn_cell_actions.mdx index 0f325222fdda7..2744f18e717d5 100644 --- a/api_docs/kbn_cell_actions.mdx +++ b/api_docs/kbn_cell_actions.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-cell-actions title: "@kbn/cell-actions" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/cell-actions plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/cell-actions'] --- import kbnCellActionsObj from './kbn_cell_actions.devdocs.json'; diff --git a/api_docs/kbn_chart_icons.mdx b/api_docs/kbn_chart_icons.mdx index 17f6642bf7f54..b68b44968e822 100644 --- a/api_docs/kbn_chart_icons.mdx +++ b/api_docs/kbn_chart_icons.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-chart-icons title: "@kbn/chart-icons" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/chart-icons plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/chart-icons'] --- import kbnChartIconsObj from './kbn_chart_icons.devdocs.json'; diff --git a/api_docs/kbn_ci_stats_core.mdx b/api_docs/kbn_ci_stats_core.mdx index 4049aa1a32456..f4b6ce6d4175a 100644 --- a/api_docs/kbn_ci_stats_core.mdx +++ b/api_docs/kbn_ci_stats_core.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ci-stats-core title: "@kbn/ci-stats-core" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ci-stats-core plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ci-stats-core'] --- import kbnCiStatsCoreObj from './kbn_ci_stats_core.devdocs.json'; diff --git a/api_docs/kbn_ci_stats_performance_metrics.mdx b/api_docs/kbn_ci_stats_performance_metrics.mdx index 470d03ab737fb..72c5c59b36b73 100644 --- a/api_docs/kbn_ci_stats_performance_metrics.mdx +++ b/api_docs/kbn_ci_stats_performance_metrics.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ci-stats-performance-metrics title: "@kbn/ci-stats-performance-metrics" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ci-stats-performance-metrics plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ci-stats-performance-metrics'] --- import kbnCiStatsPerformanceMetricsObj from './kbn_ci_stats_performance_metrics.devdocs.json'; diff --git a/api_docs/kbn_ci_stats_reporter.mdx b/api_docs/kbn_ci_stats_reporter.mdx index 396571acc2dab..133590a9dd98a 100644 --- a/api_docs/kbn_ci_stats_reporter.mdx +++ b/api_docs/kbn_ci_stats_reporter.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ci-stats-reporter title: "@kbn/ci-stats-reporter" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ci-stats-reporter plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ci-stats-reporter'] --- import kbnCiStatsReporterObj from './kbn_ci_stats_reporter.devdocs.json'; diff --git a/api_docs/kbn_cli_dev_mode.mdx b/api_docs/kbn_cli_dev_mode.mdx index 0ba2c6c354b0c..d447910ea6ec4 100644 --- a/api_docs/kbn_cli_dev_mode.mdx +++ b/api_docs/kbn_cli_dev_mode.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-cli-dev-mode title: "@kbn/cli-dev-mode" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/cli-dev-mode plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/cli-dev-mode'] --- import kbnCliDevModeObj from './kbn_cli_dev_mode.devdocs.json'; diff --git a/api_docs/kbn_code_editor.mdx b/api_docs/kbn_code_editor.mdx index 7635df0d50818..460d88762880c 100644 --- a/api_docs/kbn_code_editor.mdx +++ b/api_docs/kbn_code_editor.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-code-editor title: "@kbn/code-editor" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/code-editor plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/code-editor'] --- import kbnCodeEditorObj from './kbn_code_editor.devdocs.json'; diff --git a/api_docs/kbn_code_editor_mocks.mdx b/api_docs/kbn_code_editor_mocks.mdx index def3e23f62e11..df7cad5a23567 100644 --- a/api_docs/kbn_code_editor_mocks.mdx +++ b/api_docs/kbn_code_editor_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-code-editor-mocks title: "@kbn/code-editor-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/code-editor-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/code-editor-mocks'] --- import kbnCodeEditorMocksObj from './kbn_code_editor_mocks.devdocs.json'; diff --git a/api_docs/kbn_coloring.mdx b/api_docs/kbn_coloring.mdx index 34d399a215ee2..a115f85570790 100644 --- a/api_docs/kbn_coloring.mdx +++ b/api_docs/kbn_coloring.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-coloring title: "@kbn/coloring" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/coloring plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/coloring'] --- import kbnColoringObj from './kbn_coloring.devdocs.json'; diff --git a/api_docs/kbn_config.mdx b/api_docs/kbn_config.mdx index b05a88c1d3160..62f78030f6b17 100644 --- a/api_docs/kbn_config.mdx +++ b/api_docs/kbn_config.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-config title: "@kbn/config" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/config plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/config'] --- import kbnConfigObj from './kbn_config.devdocs.json'; diff --git a/api_docs/kbn_config_mocks.mdx b/api_docs/kbn_config_mocks.mdx index 50a4abde17ce4..9c975724ceab0 100644 --- a/api_docs/kbn_config_mocks.mdx +++ b/api_docs/kbn_config_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-config-mocks title: "@kbn/config-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/config-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/config-mocks'] --- import kbnConfigMocksObj from './kbn_config_mocks.devdocs.json'; diff --git a/api_docs/kbn_config_schema.mdx b/api_docs/kbn_config_schema.mdx index d3dafba3e6a04..435f2a4ab2ae1 100644 --- a/api_docs/kbn_config_schema.mdx +++ b/api_docs/kbn_config_schema.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-config-schema title: "@kbn/config-schema" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/config-schema plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/config-schema'] --- import kbnConfigSchemaObj from './kbn_config_schema.devdocs.json'; diff --git a/api_docs/kbn_content_management_content_editor.mdx b/api_docs/kbn_content_management_content_editor.mdx index b8c31b8fb0151..f7cc48ab128de 100644 --- a/api_docs/kbn_content_management_content_editor.mdx +++ b/api_docs/kbn_content_management_content_editor.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-content-management-content-editor title: "@kbn/content-management-content-editor" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/content-management-content-editor plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/content-management-content-editor'] --- import kbnContentManagementContentEditorObj from './kbn_content_management_content_editor.devdocs.json'; diff --git a/api_docs/kbn_content_management_table_list.mdx b/api_docs/kbn_content_management_table_list.mdx index eafc1dae14998..7d2aa2feb41af 100644 --- a/api_docs/kbn_content_management_table_list.mdx +++ b/api_docs/kbn_content_management_table_list.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-content-management-table-list title: "@kbn/content-management-table-list" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/content-management-table-list plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/content-management-table-list'] --- import kbnContentManagementTableListObj from './kbn_content_management_table_list.devdocs.json'; diff --git a/api_docs/kbn_core_analytics_browser.mdx b/api_docs/kbn_core_analytics_browser.mdx index a16db42bb56dc..8267f6fee8fe8 100644 --- a/api_docs/kbn_core_analytics_browser.mdx +++ b/api_docs/kbn_core_analytics_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-analytics-browser title: "@kbn/core-analytics-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-analytics-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-analytics-browser'] --- import kbnCoreAnalyticsBrowserObj from './kbn_core_analytics_browser.devdocs.json'; diff --git a/api_docs/kbn_core_analytics_browser_internal.mdx b/api_docs/kbn_core_analytics_browser_internal.mdx index 37ce06dd81d6c..cbff31b1cff0c 100644 --- a/api_docs/kbn_core_analytics_browser_internal.mdx +++ b/api_docs/kbn_core_analytics_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-analytics-browser-internal title: "@kbn/core-analytics-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-analytics-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-analytics-browser-internal'] --- import kbnCoreAnalyticsBrowserInternalObj from './kbn_core_analytics_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_analytics_browser_mocks.mdx b/api_docs/kbn_core_analytics_browser_mocks.mdx index 3f040deea4fad..f3d0de1df3441 100644 --- a/api_docs/kbn_core_analytics_browser_mocks.mdx +++ b/api_docs/kbn_core_analytics_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-analytics-browser-mocks title: "@kbn/core-analytics-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-analytics-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-analytics-browser-mocks'] --- import kbnCoreAnalyticsBrowserMocksObj from './kbn_core_analytics_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_analytics_server.mdx b/api_docs/kbn_core_analytics_server.mdx index 768433cd1e855..f6a4d660ae92c 100644 --- a/api_docs/kbn_core_analytics_server.mdx +++ b/api_docs/kbn_core_analytics_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-analytics-server title: "@kbn/core-analytics-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-analytics-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-analytics-server'] --- import kbnCoreAnalyticsServerObj from './kbn_core_analytics_server.devdocs.json'; diff --git a/api_docs/kbn_core_analytics_server_internal.mdx b/api_docs/kbn_core_analytics_server_internal.mdx index 4dc8b069b776a..396cce3ac4fc9 100644 --- a/api_docs/kbn_core_analytics_server_internal.mdx +++ b/api_docs/kbn_core_analytics_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-analytics-server-internal title: "@kbn/core-analytics-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-analytics-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-analytics-server-internal'] --- import kbnCoreAnalyticsServerInternalObj from './kbn_core_analytics_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_analytics_server_mocks.mdx b/api_docs/kbn_core_analytics_server_mocks.mdx index edf5e7ce0b7ef..d3480f74daf5a 100644 --- a/api_docs/kbn_core_analytics_server_mocks.mdx +++ b/api_docs/kbn_core_analytics_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-analytics-server-mocks title: "@kbn/core-analytics-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-analytics-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-analytics-server-mocks'] --- import kbnCoreAnalyticsServerMocksObj from './kbn_core_analytics_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_application_browser.mdx b/api_docs/kbn_core_application_browser.mdx index 4d2e574b934e0..33447456eca36 100644 --- a/api_docs/kbn_core_application_browser.mdx +++ b/api_docs/kbn_core_application_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-application-browser title: "@kbn/core-application-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-application-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-application-browser'] --- import kbnCoreApplicationBrowserObj from './kbn_core_application_browser.devdocs.json'; diff --git a/api_docs/kbn_core_application_browser_internal.mdx b/api_docs/kbn_core_application_browser_internal.mdx index bdbd0607fc99d..f0423843f854a 100644 --- a/api_docs/kbn_core_application_browser_internal.mdx +++ b/api_docs/kbn_core_application_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-application-browser-internal title: "@kbn/core-application-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-application-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-application-browser-internal'] --- import kbnCoreApplicationBrowserInternalObj from './kbn_core_application_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_application_browser_mocks.mdx b/api_docs/kbn_core_application_browser_mocks.mdx index a4780d77ec77e..b4868f10b0684 100644 --- a/api_docs/kbn_core_application_browser_mocks.mdx +++ b/api_docs/kbn_core_application_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-application-browser-mocks title: "@kbn/core-application-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-application-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-application-browser-mocks'] --- import kbnCoreApplicationBrowserMocksObj from './kbn_core_application_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_application_common.mdx b/api_docs/kbn_core_application_common.mdx index 86c7adf9a0e35..a434bfa348ed4 100644 --- a/api_docs/kbn_core_application_common.mdx +++ b/api_docs/kbn_core_application_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-application-common title: "@kbn/core-application-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-application-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-application-common'] --- import kbnCoreApplicationCommonObj from './kbn_core_application_common.devdocs.json'; diff --git a/api_docs/kbn_core_apps_browser_internal.mdx b/api_docs/kbn_core_apps_browser_internal.mdx index 8739ec300f427..6a844c29e713c 100644 --- a/api_docs/kbn_core_apps_browser_internal.mdx +++ b/api_docs/kbn_core_apps_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-apps-browser-internal title: "@kbn/core-apps-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-apps-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-apps-browser-internal'] --- import kbnCoreAppsBrowserInternalObj from './kbn_core_apps_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_apps_browser_mocks.mdx b/api_docs/kbn_core_apps_browser_mocks.mdx index 5cb5d6c0c0545..8106de9d0d800 100644 --- a/api_docs/kbn_core_apps_browser_mocks.mdx +++ b/api_docs/kbn_core_apps_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-apps-browser-mocks title: "@kbn/core-apps-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-apps-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-apps-browser-mocks'] --- import kbnCoreAppsBrowserMocksObj from './kbn_core_apps_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_apps_server_internal.mdx b/api_docs/kbn_core_apps_server_internal.mdx index ac34095183b62..0d7dca019de50 100644 --- a/api_docs/kbn_core_apps_server_internal.mdx +++ b/api_docs/kbn_core_apps_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-apps-server-internal title: "@kbn/core-apps-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-apps-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-apps-server-internal'] --- import kbnCoreAppsServerInternalObj from './kbn_core_apps_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_base_browser_mocks.mdx b/api_docs/kbn_core_base_browser_mocks.mdx index 05f5ea2574f8e..ab6e34a3b97d4 100644 --- a/api_docs/kbn_core_base_browser_mocks.mdx +++ b/api_docs/kbn_core_base_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-base-browser-mocks title: "@kbn/core-base-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-base-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-base-browser-mocks'] --- import kbnCoreBaseBrowserMocksObj from './kbn_core_base_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_base_common.mdx b/api_docs/kbn_core_base_common.mdx index bd16e1a4ef812..d25d7ca2c4c1c 100644 --- a/api_docs/kbn_core_base_common.mdx +++ b/api_docs/kbn_core_base_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-base-common title: "@kbn/core-base-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-base-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-base-common'] --- import kbnCoreBaseCommonObj from './kbn_core_base_common.devdocs.json'; diff --git a/api_docs/kbn_core_base_server_internal.mdx b/api_docs/kbn_core_base_server_internal.mdx index c45eb938ea8d0..15992e1ca9875 100644 --- a/api_docs/kbn_core_base_server_internal.mdx +++ b/api_docs/kbn_core_base_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-base-server-internal title: "@kbn/core-base-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-base-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-base-server-internal'] --- import kbnCoreBaseServerInternalObj from './kbn_core_base_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_base_server_mocks.mdx b/api_docs/kbn_core_base_server_mocks.mdx index d3b7d86398dea..001d47fb324b0 100644 --- a/api_docs/kbn_core_base_server_mocks.mdx +++ b/api_docs/kbn_core_base_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-base-server-mocks title: "@kbn/core-base-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-base-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-base-server-mocks'] --- import kbnCoreBaseServerMocksObj from './kbn_core_base_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_capabilities_browser_mocks.mdx b/api_docs/kbn_core_capabilities_browser_mocks.mdx index 4b9f07da23df1..7de06c0b77a19 100644 --- a/api_docs/kbn_core_capabilities_browser_mocks.mdx +++ b/api_docs/kbn_core_capabilities_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-capabilities-browser-mocks title: "@kbn/core-capabilities-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-capabilities-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-capabilities-browser-mocks'] --- import kbnCoreCapabilitiesBrowserMocksObj from './kbn_core_capabilities_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_capabilities_common.mdx b/api_docs/kbn_core_capabilities_common.mdx index edf627592e10d..7877c02e40f39 100644 --- a/api_docs/kbn_core_capabilities_common.mdx +++ b/api_docs/kbn_core_capabilities_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-capabilities-common title: "@kbn/core-capabilities-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-capabilities-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-capabilities-common'] --- import kbnCoreCapabilitiesCommonObj from './kbn_core_capabilities_common.devdocs.json'; diff --git a/api_docs/kbn_core_capabilities_server.mdx b/api_docs/kbn_core_capabilities_server.mdx index 95733e9018c01..a5df12de2a679 100644 --- a/api_docs/kbn_core_capabilities_server.mdx +++ b/api_docs/kbn_core_capabilities_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-capabilities-server title: "@kbn/core-capabilities-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-capabilities-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-capabilities-server'] --- import kbnCoreCapabilitiesServerObj from './kbn_core_capabilities_server.devdocs.json'; diff --git a/api_docs/kbn_core_capabilities_server_mocks.mdx b/api_docs/kbn_core_capabilities_server_mocks.mdx index 3ed44bc6e330c..08274aadeedf1 100644 --- a/api_docs/kbn_core_capabilities_server_mocks.mdx +++ b/api_docs/kbn_core_capabilities_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-capabilities-server-mocks title: "@kbn/core-capabilities-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-capabilities-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-capabilities-server-mocks'] --- import kbnCoreCapabilitiesServerMocksObj from './kbn_core_capabilities_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_chrome_browser.mdx b/api_docs/kbn_core_chrome_browser.mdx index 92599f78fd0d6..8dc321718000f 100644 --- a/api_docs/kbn_core_chrome_browser.mdx +++ b/api_docs/kbn_core_chrome_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-chrome-browser title: "@kbn/core-chrome-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-chrome-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-chrome-browser'] --- import kbnCoreChromeBrowserObj from './kbn_core_chrome_browser.devdocs.json'; diff --git a/api_docs/kbn_core_chrome_browser_mocks.mdx b/api_docs/kbn_core_chrome_browser_mocks.mdx index 6edcdd3bfe0ae..746ffe4d21d4e 100644 --- a/api_docs/kbn_core_chrome_browser_mocks.mdx +++ b/api_docs/kbn_core_chrome_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-chrome-browser-mocks title: "@kbn/core-chrome-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-chrome-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-chrome-browser-mocks'] --- import kbnCoreChromeBrowserMocksObj from './kbn_core_chrome_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_config_server_internal.mdx b/api_docs/kbn_core_config_server_internal.mdx index 845a862f30d92..9456355503080 100644 --- a/api_docs/kbn_core_config_server_internal.mdx +++ b/api_docs/kbn_core_config_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-config-server-internal title: "@kbn/core-config-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-config-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-config-server-internal'] --- import kbnCoreConfigServerInternalObj from './kbn_core_config_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_custom_branding_browser.mdx b/api_docs/kbn_core_custom_branding_browser.mdx index 63f4552466d56..cef9ed7fc18e5 100644 --- a/api_docs/kbn_core_custom_branding_browser.mdx +++ b/api_docs/kbn_core_custom_branding_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-custom-branding-browser title: "@kbn/core-custom-branding-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-custom-branding-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-custom-branding-browser'] --- import kbnCoreCustomBrandingBrowserObj from './kbn_core_custom_branding_browser.devdocs.json'; diff --git a/api_docs/kbn_core_custom_branding_browser_internal.mdx b/api_docs/kbn_core_custom_branding_browser_internal.mdx index 59c453123678c..44d33dc612e2d 100644 --- a/api_docs/kbn_core_custom_branding_browser_internal.mdx +++ b/api_docs/kbn_core_custom_branding_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-custom-branding-browser-internal title: "@kbn/core-custom-branding-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-custom-branding-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-custom-branding-browser-internal'] --- import kbnCoreCustomBrandingBrowserInternalObj from './kbn_core_custom_branding_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_custom_branding_browser_mocks.mdx b/api_docs/kbn_core_custom_branding_browser_mocks.mdx index f6e4aea1420fd..ea9d44e30dcca 100644 --- a/api_docs/kbn_core_custom_branding_browser_mocks.mdx +++ b/api_docs/kbn_core_custom_branding_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-custom-branding-browser-mocks title: "@kbn/core-custom-branding-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-custom-branding-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-custom-branding-browser-mocks'] --- import kbnCoreCustomBrandingBrowserMocksObj from './kbn_core_custom_branding_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_custom_branding_common.mdx b/api_docs/kbn_core_custom_branding_common.mdx index 6c06210748748..f2ec1363d9769 100644 --- a/api_docs/kbn_core_custom_branding_common.mdx +++ b/api_docs/kbn_core_custom_branding_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-custom-branding-common title: "@kbn/core-custom-branding-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-custom-branding-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-custom-branding-common'] --- import kbnCoreCustomBrandingCommonObj from './kbn_core_custom_branding_common.devdocs.json'; diff --git a/api_docs/kbn_core_custom_branding_server.mdx b/api_docs/kbn_core_custom_branding_server.mdx index ffe766f46c68f..dd6e031a56b91 100644 --- a/api_docs/kbn_core_custom_branding_server.mdx +++ b/api_docs/kbn_core_custom_branding_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-custom-branding-server title: "@kbn/core-custom-branding-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-custom-branding-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-custom-branding-server'] --- import kbnCoreCustomBrandingServerObj from './kbn_core_custom_branding_server.devdocs.json'; diff --git a/api_docs/kbn_core_custom_branding_server_internal.mdx b/api_docs/kbn_core_custom_branding_server_internal.mdx index e578ff6f222e7..3a929657a8e3f 100644 --- a/api_docs/kbn_core_custom_branding_server_internal.mdx +++ b/api_docs/kbn_core_custom_branding_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-custom-branding-server-internal title: "@kbn/core-custom-branding-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-custom-branding-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-custom-branding-server-internal'] --- import kbnCoreCustomBrandingServerInternalObj from './kbn_core_custom_branding_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_custom_branding_server_mocks.mdx b/api_docs/kbn_core_custom_branding_server_mocks.mdx index ec61d9e871e69..e8d75dd1ecbe2 100644 --- a/api_docs/kbn_core_custom_branding_server_mocks.mdx +++ b/api_docs/kbn_core_custom_branding_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-custom-branding-server-mocks title: "@kbn/core-custom-branding-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-custom-branding-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-custom-branding-server-mocks'] --- import kbnCoreCustomBrandingServerMocksObj from './kbn_core_custom_branding_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_deprecations_browser.mdx b/api_docs/kbn_core_deprecations_browser.mdx index 1c3712442b5f0..dc541c38ccf07 100644 --- a/api_docs/kbn_core_deprecations_browser.mdx +++ b/api_docs/kbn_core_deprecations_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-deprecations-browser title: "@kbn/core-deprecations-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-deprecations-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-deprecations-browser'] --- import kbnCoreDeprecationsBrowserObj from './kbn_core_deprecations_browser.devdocs.json'; diff --git a/api_docs/kbn_core_deprecations_browser_internal.mdx b/api_docs/kbn_core_deprecations_browser_internal.mdx index a1901060a7e91..9be3e542c85b8 100644 --- a/api_docs/kbn_core_deprecations_browser_internal.mdx +++ b/api_docs/kbn_core_deprecations_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-deprecations-browser-internal title: "@kbn/core-deprecations-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-deprecations-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-deprecations-browser-internal'] --- import kbnCoreDeprecationsBrowserInternalObj from './kbn_core_deprecations_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_deprecations_browser_mocks.mdx b/api_docs/kbn_core_deprecations_browser_mocks.mdx index 13e7500bca429..2f1de0733dee2 100644 --- a/api_docs/kbn_core_deprecations_browser_mocks.mdx +++ b/api_docs/kbn_core_deprecations_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-deprecations-browser-mocks title: "@kbn/core-deprecations-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-deprecations-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-deprecations-browser-mocks'] --- import kbnCoreDeprecationsBrowserMocksObj from './kbn_core_deprecations_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_deprecations_common.mdx b/api_docs/kbn_core_deprecations_common.mdx index 359636705dd71..aa35952826f33 100644 --- a/api_docs/kbn_core_deprecations_common.mdx +++ b/api_docs/kbn_core_deprecations_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-deprecations-common title: "@kbn/core-deprecations-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-deprecations-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-deprecations-common'] --- import kbnCoreDeprecationsCommonObj from './kbn_core_deprecations_common.devdocs.json'; diff --git a/api_docs/kbn_core_deprecations_server.mdx b/api_docs/kbn_core_deprecations_server.mdx index 1df75311b4c81..89945cc0a4e0c 100644 --- a/api_docs/kbn_core_deprecations_server.mdx +++ b/api_docs/kbn_core_deprecations_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-deprecations-server title: "@kbn/core-deprecations-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-deprecations-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-deprecations-server'] --- import kbnCoreDeprecationsServerObj from './kbn_core_deprecations_server.devdocs.json'; diff --git a/api_docs/kbn_core_deprecations_server_internal.mdx b/api_docs/kbn_core_deprecations_server_internal.mdx index b6aca33a1ac27..2285f349d2078 100644 --- a/api_docs/kbn_core_deprecations_server_internal.mdx +++ b/api_docs/kbn_core_deprecations_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-deprecations-server-internal title: "@kbn/core-deprecations-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-deprecations-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-deprecations-server-internal'] --- import kbnCoreDeprecationsServerInternalObj from './kbn_core_deprecations_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_deprecations_server_mocks.mdx b/api_docs/kbn_core_deprecations_server_mocks.mdx index 180a778426ad6..373042c7e38a3 100644 --- a/api_docs/kbn_core_deprecations_server_mocks.mdx +++ b/api_docs/kbn_core_deprecations_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-deprecations-server-mocks title: "@kbn/core-deprecations-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-deprecations-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-deprecations-server-mocks'] --- import kbnCoreDeprecationsServerMocksObj from './kbn_core_deprecations_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_doc_links_browser.mdx b/api_docs/kbn_core_doc_links_browser.mdx index b6c238567ffca..ff7cd97728f99 100644 --- a/api_docs/kbn_core_doc_links_browser.mdx +++ b/api_docs/kbn_core_doc_links_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-doc-links-browser title: "@kbn/core-doc-links-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-doc-links-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-doc-links-browser'] --- import kbnCoreDocLinksBrowserObj from './kbn_core_doc_links_browser.devdocs.json'; diff --git a/api_docs/kbn_core_doc_links_browser_mocks.mdx b/api_docs/kbn_core_doc_links_browser_mocks.mdx index f9fba5f4c6094..428ed28b0a4d2 100644 --- a/api_docs/kbn_core_doc_links_browser_mocks.mdx +++ b/api_docs/kbn_core_doc_links_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-doc-links-browser-mocks title: "@kbn/core-doc-links-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-doc-links-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-doc-links-browser-mocks'] --- import kbnCoreDocLinksBrowserMocksObj from './kbn_core_doc_links_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_doc_links_server.mdx b/api_docs/kbn_core_doc_links_server.mdx index 16818648c7493..6d539752ce544 100644 --- a/api_docs/kbn_core_doc_links_server.mdx +++ b/api_docs/kbn_core_doc_links_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-doc-links-server title: "@kbn/core-doc-links-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-doc-links-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-doc-links-server'] --- import kbnCoreDocLinksServerObj from './kbn_core_doc_links_server.devdocs.json'; diff --git a/api_docs/kbn_core_doc_links_server_mocks.mdx b/api_docs/kbn_core_doc_links_server_mocks.mdx index 541a80d1bea04..1dbb30fa5d0a3 100644 --- a/api_docs/kbn_core_doc_links_server_mocks.mdx +++ b/api_docs/kbn_core_doc_links_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-doc-links-server-mocks title: "@kbn/core-doc-links-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-doc-links-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-doc-links-server-mocks'] --- import kbnCoreDocLinksServerMocksObj from './kbn_core_doc_links_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_elasticsearch_client_server_internal.mdx b/api_docs/kbn_core_elasticsearch_client_server_internal.mdx index 929ca5e6caa1e..e781f5f88763f 100644 --- a/api_docs/kbn_core_elasticsearch_client_server_internal.mdx +++ b/api_docs/kbn_core_elasticsearch_client_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-elasticsearch-client-server-internal title: "@kbn/core-elasticsearch-client-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-elasticsearch-client-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-elasticsearch-client-server-internal'] --- import kbnCoreElasticsearchClientServerInternalObj from './kbn_core_elasticsearch_client_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_elasticsearch_client_server_mocks.mdx b/api_docs/kbn_core_elasticsearch_client_server_mocks.mdx index 498cb10a4def6..f9480ca088d8d 100644 --- a/api_docs/kbn_core_elasticsearch_client_server_mocks.mdx +++ b/api_docs/kbn_core_elasticsearch_client_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-elasticsearch-client-server-mocks title: "@kbn/core-elasticsearch-client-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-elasticsearch-client-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-elasticsearch-client-server-mocks'] --- import kbnCoreElasticsearchClientServerMocksObj from './kbn_core_elasticsearch_client_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_elasticsearch_server.mdx b/api_docs/kbn_core_elasticsearch_server.mdx index e65237e9ac49c..fb1248043c3d6 100644 --- a/api_docs/kbn_core_elasticsearch_server.mdx +++ b/api_docs/kbn_core_elasticsearch_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-elasticsearch-server title: "@kbn/core-elasticsearch-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-elasticsearch-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-elasticsearch-server'] --- import kbnCoreElasticsearchServerObj from './kbn_core_elasticsearch_server.devdocs.json'; diff --git a/api_docs/kbn_core_elasticsearch_server_internal.mdx b/api_docs/kbn_core_elasticsearch_server_internal.mdx index 4ddb09949223d..3be12a5f639d5 100644 --- a/api_docs/kbn_core_elasticsearch_server_internal.mdx +++ b/api_docs/kbn_core_elasticsearch_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-elasticsearch-server-internal title: "@kbn/core-elasticsearch-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-elasticsearch-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-elasticsearch-server-internal'] --- import kbnCoreElasticsearchServerInternalObj from './kbn_core_elasticsearch_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_elasticsearch_server_mocks.mdx b/api_docs/kbn_core_elasticsearch_server_mocks.mdx index 8a9797e655519..d80166fc58fc6 100644 --- a/api_docs/kbn_core_elasticsearch_server_mocks.mdx +++ b/api_docs/kbn_core_elasticsearch_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-elasticsearch-server-mocks title: "@kbn/core-elasticsearch-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-elasticsearch-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-elasticsearch-server-mocks'] --- import kbnCoreElasticsearchServerMocksObj from './kbn_core_elasticsearch_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_environment_server_internal.mdx b/api_docs/kbn_core_environment_server_internal.mdx index f6393471dcd17..448f794aa605d 100644 --- a/api_docs/kbn_core_environment_server_internal.mdx +++ b/api_docs/kbn_core_environment_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-environment-server-internal title: "@kbn/core-environment-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-environment-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-environment-server-internal'] --- import kbnCoreEnvironmentServerInternalObj from './kbn_core_environment_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_environment_server_mocks.mdx b/api_docs/kbn_core_environment_server_mocks.mdx index 6165d77ee5eca..64e728ad17fc4 100644 --- a/api_docs/kbn_core_environment_server_mocks.mdx +++ b/api_docs/kbn_core_environment_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-environment-server-mocks title: "@kbn/core-environment-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-environment-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-environment-server-mocks'] --- import kbnCoreEnvironmentServerMocksObj from './kbn_core_environment_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_execution_context_browser.mdx b/api_docs/kbn_core_execution_context_browser.mdx index fe060d70c55c5..7271800a87656 100644 --- a/api_docs/kbn_core_execution_context_browser.mdx +++ b/api_docs/kbn_core_execution_context_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-execution-context-browser title: "@kbn/core-execution-context-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-execution-context-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-execution-context-browser'] --- import kbnCoreExecutionContextBrowserObj from './kbn_core_execution_context_browser.devdocs.json'; diff --git a/api_docs/kbn_core_execution_context_browser_internal.mdx b/api_docs/kbn_core_execution_context_browser_internal.mdx index a2b222884a4df..519c9c0dd7bf0 100644 --- a/api_docs/kbn_core_execution_context_browser_internal.mdx +++ b/api_docs/kbn_core_execution_context_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-execution-context-browser-internal title: "@kbn/core-execution-context-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-execution-context-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-execution-context-browser-internal'] --- import kbnCoreExecutionContextBrowserInternalObj from './kbn_core_execution_context_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_execution_context_browser_mocks.mdx b/api_docs/kbn_core_execution_context_browser_mocks.mdx index c113243dee092..34fbdd850faf0 100644 --- a/api_docs/kbn_core_execution_context_browser_mocks.mdx +++ b/api_docs/kbn_core_execution_context_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-execution-context-browser-mocks title: "@kbn/core-execution-context-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-execution-context-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-execution-context-browser-mocks'] --- import kbnCoreExecutionContextBrowserMocksObj from './kbn_core_execution_context_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_execution_context_common.mdx b/api_docs/kbn_core_execution_context_common.mdx index d29a072ce8f79..ce7dee6ae3e27 100644 --- a/api_docs/kbn_core_execution_context_common.mdx +++ b/api_docs/kbn_core_execution_context_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-execution-context-common title: "@kbn/core-execution-context-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-execution-context-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-execution-context-common'] --- import kbnCoreExecutionContextCommonObj from './kbn_core_execution_context_common.devdocs.json'; diff --git a/api_docs/kbn_core_execution_context_server.mdx b/api_docs/kbn_core_execution_context_server.mdx index 7ca7ed98f95ef..d68cb5e03b9b9 100644 --- a/api_docs/kbn_core_execution_context_server.mdx +++ b/api_docs/kbn_core_execution_context_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-execution-context-server title: "@kbn/core-execution-context-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-execution-context-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-execution-context-server'] --- import kbnCoreExecutionContextServerObj from './kbn_core_execution_context_server.devdocs.json'; diff --git a/api_docs/kbn_core_execution_context_server_internal.mdx b/api_docs/kbn_core_execution_context_server_internal.mdx index 45bc829fb0f88..f8a0bdf6d90a2 100644 --- a/api_docs/kbn_core_execution_context_server_internal.mdx +++ b/api_docs/kbn_core_execution_context_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-execution-context-server-internal title: "@kbn/core-execution-context-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-execution-context-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-execution-context-server-internal'] --- import kbnCoreExecutionContextServerInternalObj from './kbn_core_execution_context_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_execution_context_server_mocks.mdx b/api_docs/kbn_core_execution_context_server_mocks.mdx index 9f7cfa97b24a3..926858f6bc233 100644 --- a/api_docs/kbn_core_execution_context_server_mocks.mdx +++ b/api_docs/kbn_core_execution_context_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-execution-context-server-mocks title: "@kbn/core-execution-context-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-execution-context-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-execution-context-server-mocks'] --- import kbnCoreExecutionContextServerMocksObj from './kbn_core_execution_context_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_fatal_errors_browser.mdx b/api_docs/kbn_core_fatal_errors_browser.mdx index d5bb1f575c6f8..c472c963b1903 100644 --- a/api_docs/kbn_core_fatal_errors_browser.mdx +++ b/api_docs/kbn_core_fatal_errors_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-fatal-errors-browser title: "@kbn/core-fatal-errors-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-fatal-errors-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-fatal-errors-browser'] --- import kbnCoreFatalErrorsBrowserObj from './kbn_core_fatal_errors_browser.devdocs.json'; diff --git a/api_docs/kbn_core_fatal_errors_browser_mocks.mdx b/api_docs/kbn_core_fatal_errors_browser_mocks.mdx index e264d8198b711..dc08f5123aa2d 100644 --- a/api_docs/kbn_core_fatal_errors_browser_mocks.mdx +++ b/api_docs/kbn_core_fatal_errors_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-fatal-errors-browser-mocks title: "@kbn/core-fatal-errors-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-fatal-errors-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-fatal-errors-browser-mocks'] --- import kbnCoreFatalErrorsBrowserMocksObj from './kbn_core_fatal_errors_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_http_browser.mdx b/api_docs/kbn_core_http_browser.mdx index 63967be48f38f..82bc094ae6a46 100644 --- a/api_docs/kbn_core_http_browser.mdx +++ b/api_docs/kbn_core_http_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-browser title: "@kbn/core-http-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-browser'] --- import kbnCoreHttpBrowserObj from './kbn_core_http_browser.devdocs.json'; diff --git a/api_docs/kbn_core_http_browser_internal.mdx b/api_docs/kbn_core_http_browser_internal.mdx index fc84c83a80837..c0739384e19ba 100644 --- a/api_docs/kbn_core_http_browser_internal.mdx +++ b/api_docs/kbn_core_http_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-browser-internal title: "@kbn/core-http-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-browser-internal'] --- import kbnCoreHttpBrowserInternalObj from './kbn_core_http_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_http_browser_mocks.mdx b/api_docs/kbn_core_http_browser_mocks.mdx index 71bd148c57a2d..a775e3254de3b 100644 --- a/api_docs/kbn_core_http_browser_mocks.mdx +++ b/api_docs/kbn_core_http_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-browser-mocks title: "@kbn/core-http-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-browser-mocks'] --- import kbnCoreHttpBrowserMocksObj from './kbn_core_http_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_http_common.mdx b/api_docs/kbn_core_http_common.mdx index 1d13ce00852ac..d9c8e8d1c5dfd 100644 --- a/api_docs/kbn_core_http_common.mdx +++ b/api_docs/kbn_core_http_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-common title: "@kbn/core-http-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-common'] --- import kbnCoreHttpCommonObj from './kbn_core_http_common.devdocs.json'; diff --git a/api_docs/kbn_core_http_context_server_mocks.mdx b/api_docs/kbn_core_http_context_server_mocks.mdx index cd6feaac819b1..57ad45d054f53 100644 --- a/api_docs/kbn_core_http_context_server_mocks.mdx +++ b/api_docs/kbn_core_http_context_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-context-server-mocks title: "@kbn/core-http-context-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-context-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-context-server-mocks'] --- import kbnCoreHttpContextServerMocksObj from './kbn_core_http_context_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_http_request_handler_context_server.mdx b/api_docs/kbn_core_http_request_handler_context_server.mdx index 81147ac9134ee..8262f80f7bffa 100644 --- a/api_docs/kbn_core_http_request_handler_context_server.mdx +++ b/api_docs/kbn_core_http_request_handler_context_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-request-handler-context-server title: "@kbn/core-http-request-handler-context-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-request-handler-context-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-request-handler-context-server'] --- import kbnCoreHttpRequestHandlerContextServerObj from './kbn_core_http_request_handler_context_server.devdocs.json'; diff --git a/api_docs/kbn_core_http_resources_server.mdx b/api_docs/kbn_core_http_resources_server.mdx index 04589671d9c8b..473f67a2effd9 100644 --- a/api_docs/kbn_core_http_resources_server.mdx +++ b/api_docs/kbn_core_http_resources_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-resources-server title: "@kbn/core-http-resources-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-resources-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-resources-server'] --- import kbnCoreHttpResourcesServerObj from './kbn_core_http_resources_server.devdocs.json'; diff --git a/api_docs/kbn_core_http_resources_server_internal.mdx b/api_docs/kbn_core_http_resources_server_internal.mdx index 8048532f90fd9..e2caa7bac1675 100644 --- a/api_docs/kbn_core_http_resources_server_internal.mdx +++ b/api_docs/kbn_core_http_resources_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-resources-server-internal title: "@kbn/core-http-resources-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-resources-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-resources-server-internal'] --- import kbnCoreHttpResourcesServerInternalObj from './kbn_core_http_resources_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_http_resources_server_mocks.mdx b/api_docs/kbn_core_http_resources_server_mocks.mdx index aedf50d4022af..25ed715de528f 100644 --- a/api_docs/kbn_core_http_resources_server_mocks.mdx +++ b/api_docs/kbn_core_http_resources_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-resources-server-mocks title: "@kbn/core-http-resources-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-resources-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-resources-server-mocks'] --- import kbnCoreHttpResourcesServerMocksObj from './kbn_core_http_resources_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_http_router_server_internal.mdx b/api_docs/kbn_core_http_router_server_internal.mdx index 5edcfeacf73fb..9cb73653f3d2c 100644 --- a/api_docs/kbn_core_http_router_server_internal.mdx +++ b/api_docs/kbn_core_http_router_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-router-server-internal title: "@kbn/core-http-router-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-router-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-router-server-internal'] --- import kbnCoreHttpRouterServerInternalObj from './kbn_core_http_router_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_http_router_server_mocks.mdx b/api_docs/kbn_core_http_router_server_mocks.mdx index 1b41384d41792..f7561515e9b4a 100644 --- a/api_docs/kbn_core_http_router_server_mocks.mdx +++ b/api_docs/kbn_core_http_router_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-router-server-mocks title: "@kbn/core-http-router-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-router-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-router-server-mocks'] --- import kbnCoreHttpRouterServerMocksObj from './kbn_core_http_router_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_http_server.mdx b/api_docs/kbn_core_http_server.mdx index de04a5d277297..607e2f0a15cc6 100644 --- a/api_docs/kbn_core_http_server.mdx +++ b/api_docs/kbn_core_http_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-server title: "@kbn/core-http-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-server'] --- import kbnCoreHttpServerObj from './kbn_core_http_server.devdocs.json'; diff --git a/api_docs/kbn_core_http_server_internal.devdocs.json b/api_docs/kbn_core_http_server_internal.devdocs.json index bee16276e70e4..60d62f15f154d 100644 --- a/api_docs/kbn_core_http_server_internal.devdocs.json +++ b/api_docs/kbn_core_http_server_internal.devdocs.json @@ -93,6 +93,17 @@ "deprecated": false, "trackAdoption": false }, + { + "parentPluginId": "@kbn/core-http-server-internal", + "id": "def-common.CspConfig.disableUnsafeEval", + "type": "boolean", + "tags": [], + "label": "disableUnsafeEval", + "description": [], + "path": "packages/core/http/core-http-server-internal/src/csp/csp_config.ts", + "deprecated": false, + "trackAdoption": false + }, { "parentPluginId": "@kbn/core-http-server-internal", "id": "def-common.CspConfig.warnLegacyBrowsers", @@ -912,10 +923,10 @@ "pluginId": "@kbn/config-schema", "scope": "common", "docId": "kibKbnConfigSchemaPluginApi", - "section": "def-common.ConditionalType", - "text": "ConditionalType" + "section": "def-common.Type", + "text": "Type" }, - "; script_src: ", + "; script_src: ", { "pluginId": "@kbn/config-schema", "scope": "common", diff --git a/api_docs/kbn_core_http_server_internal.mdx b/api_docs/kbn_core_http_server_internal.mdx index aca4f2410ad30..005bd4490a0b9 100644 --- a/api_docs/kbn_core_http_server_internal.mdx +++ b/api_docs/kbn_core_http_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-server-internal title: "@kbn/core-http-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-server-internal'] --- import kbnCoreHttpServerInternalObj from './kbn_core_http_server_internal.devdocs.json'; @@ -21,7 +21,7 @@ Contact Kibana Core for questions regarding this plugin. | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 54 | 0 | 48 | 6 | +| 55 | 0 | 49 | 6 | ## Common diff --git a/api_docs/kbn_core_http_server_mocks.mdx b/api_docs/kbn_core_http_server_mocks.mdx index 4d3f0730e5acf..dc33168bf536b 100644 --- a/api_docs/kbn_core_http_server_mocks.mdx +++ b/api_docs/kbn_core_http_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-http-server-mocks title: "@kbn/core-http-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-http-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-http-server-mocks'] --- import kbnCoreHttpServerMocksObj from './kbn_core_http_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_i18n_browser.mdx b/api_docs/kbn_core_i18n_browser.mdx index c86f6a4c451f2..9ef4fae9d9b0c 100644 --- a/api_docs/kbn_core_i18n_browser.mdx +++ b/api_docs/kbn_core_i18n_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-i18n-browser title: "@kbn/core-i18n-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-i18n-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-i18n-browser'] --- import kbnCoreI18nBrowserObj from './kbn_core_i18n_browser.devdocs.json'; diff --git a/api_docs/kbn_core_i18n_browser_mocks.mdx b/api_docs/kbn_core_i18n_browser_mocks.mdx index 8de9286f4106e..21dc9418a0b81 100644 --- a/api_docs/kbn_core_i18n_browser_mocks.mdx +++ b/api_docs/kbn_core_i18n_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-i18n-browser-mocks title: "@kbn/core-i18n-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-i18n-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-i18n-browser-mocks'] --- import kbnCoreI18nBrowserMocksObj from './kbn_core_i18n_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_i18n_server.mdx b/api_docs/kbn_core_i18n_server.mdx index eb15fb4a47b67..30f06f7816615 100644 --- a/api_docs/kbn_core_i18n_server.mdx +++ b/api_docs/kbn_core_i18n_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-i18n-server title: "@kbn/core-i18n-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-i18n-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-i18n-server'] --- import kbnCoreI18nServerObj from './kbn_core_i18n_server.devdocs.json'; diff --git a/api_docs/kbn_core_i18n_server_internal.mdx b/api_docs/kbn_core_i18n_server_internal.mdx index 06ffcd6a61b4a..01be69e512f7b 100644 --- a/api_docs/kbn_core_i18n_server_internal.mdx +++ b/api_docs/kbn_core_i18n_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-i18n-server-internal title: "@kbn/core-i18n-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-i18n-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-i18n-server-internal'] --- import kbnCoreI18nServerInternalObj from './kbn_core_i18n_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_i18n_server_mocks.mdx b/api_docs/kbn_core_i18n_server_mocks.mdx index 9d52f727daa74..1c0a3e24f9b51 100644 --- a/api_docs/kbn_core_i18n_server_mocks.mdx +++ b/api_docs/kbn_core_i18n_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-i18n-server-mocks title: "@kbn/core-i18n-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-i18n-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-i18n-server-mocks'] --- import kbnCoreI18nServerMocksObj from './kbn_core_i18n_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_injected_metadata_browser_mocks.mdx b/api_docs/kbn_core_injected_metadata_browser_mocks.mdx index d30da2296a083..ac2590408c594 100644 --- a/api_docs/kbn_core_injected_metadata_browser_mocks.mdx +++ b/api_docs/kbn_core_injected_metadata_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-injected-metadata-browser-mocks title: "@kbn/core-injected-metadata-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-injected-metadata-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-injected-metadata-browser-mocks'] --- import kbnCoreInjectedMetadataBrowserMocksObj from './kbn_core_injected_metadata_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_integrations_browser_internal.mdx b/api_docs/kbn_core_integrations_browser_internal.mdx index 2dae763b46197..7fe560c8497a1 100644 --- a/api_docs/kbn_core_integrations_browser_internal.mdx +++ b/api_docs/kbn_core_integrations_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-integrations-browser-internal title: "@kbn/core-integrations-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-integrations-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-integrations-browser-internal'] --- import kbnCoreIntegrationsBrowserInternalObj from './kbn_core_integrations_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_integrations_browser_mocks.mdx b/api_docs/kbn_core_integrations_browser_mocks.mdx index d578e8d7b0d8b..54f2f1bc1d329 100644 --- a/api_docs/kbn_core_integrations_browser_mocks.mdx +++ b/api_docs/kbn_core_integrations_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-integrations-browser-mocks title: "@kbn/core-integrations-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-integrations-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-integrations-browser-mocks'] --- import kbnCoreIntegrationsBrowserMocksObj from './kbn_core_integrations_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_lifecycle_browser.mdx b/api_docs/kbn_core_lifecycle_browser.mdx index 67232d6f5d9cf..8667e9ef00e47 100644 --- a/api_docs/kbn_core_lifecycle_browser.mdx +++ b/api_docs/kbn_core_lifecycle_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-lifecycle-browser title: "@kbn/core-lifecycle-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-lifecycle-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-lifecycle-browser'] --- import kbnCoreLifecycleBrowserObj from './kbn_core_lifecycle_browser.devdocs.json'; diff --git a/api_docs/kbn_core_lifecycle_browser_mocks.mdx b/api_docs/kbn_core_lifecycle_browser_mocks.mdx index 3869ee3e94ed8..933afe38cd83d 100644 --- a/api_docs/kbn_core_lifecycle_browser_mocks.mdx +++ b/api_docs/kbn_core_lifecycle_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-lifecycle-browser-mocks title: "@kbn/core-lifecycle-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-lifecycle-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-lifecycle-browser-mocks'] --- import kbnCoreLifecycleBrowserMocksObj from './kbn_core_lifecycle_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_lifecycle_server.mdx b/api_docs/kbn_core_lifecycle_server.mdx index 18fd2df3edc1b..243aa8dd2e3fb 100644 --- a/api_docs/kbn_core_lifecycle_server.mdx +++ b/api_docs/kbn_core_lifecycle_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-lifecycle-server title: "@kbn/core-lifecycle-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-lifecycle-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-lifecycle-server'] --- import kbnCoreLifecycleServerObj from './kbn_core_lifecycle_server.devdocs.json'; diff --git a/api_docs/kbn_core_lifecycle_server_mocks.mdx b/api_docs/kbn_core_lifecycle_server_mocks.mdx index 7f5da2fc1f82d..4dc2b975b502f 100644 --- a/api_docs/kbn_core_lifecycle_server_mocks.mdx +++ b/api_docs/kbn_core_lifecycle_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-lifecycle-server-mocks title: "@kbn/core-lifecycle-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-lifecycle-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-lifecycle-server-mocks'] --- import kbnCoreLifecycleServerMocksObj from './kbn_core_lifecycle_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_logging_browser_mocks.mdx b/api_docs/kbn_core_logging_browser_mocks.mdx index fc76dcd0f04a6..0ae241385b9b2 100644 --- a/api_docs/kbn_core_logging_browser_mocks.mdx +++ b/api_docs/kbn_core_logging_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-logging-browser-mocks title: "@kbn/core-logging-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-logging-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-logging-browser-mocks'] --- import kbnCoreLoggingBrowserMocksObj from './kbn_core_logging_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_logging_common_internal.mdx b/api_docs/kbn_core_logging_common_internal.mdx index 9fdb05e88447a..86727bbc72215 100644 --- a/api_docs/kbn_core_logging_common_internal.mdx +++ b/api_docs/kbn_core_logging_common_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-logging-common-internal title: "@kbn/core-logging-common-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-logging-common-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-logging-common-internal'] --- import kbnCoreLoggingCommonInternalObj from './kbn_core_logging_common_internal.devdocs.json'; diff --git a/api_docs/kbn_core_logging_server.mdx b/api_docs/kbn_core_logging_server.mdx index 29d4095e5395b..15e7ad74618a9 100644 --- a/api_docs/kbn_core_logging_server.mdx +++ b/api_docs/kbn_core_logging_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-logging-server title: "@kbn/core-logging-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-logging-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-logging-server'] --- import kbnCoreLoggingServerObj from './kbn_core_logging_server.devdocs.json'; diff --git a/api_docs/kbn_core_logging_server_internal.mdx b/api_docs/kbn_core_logging_server_internal.mdx index 35a50425965d2..10f0dbc980b71 100644 --- a/api_docs/kbn_core_logging_server_internal.mdx +++ b/api_docs/kbn_core_logging_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-logging-server-internal title: "@kbn/core-logging-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-logging-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-logging-server-internal'] --- import kbnCoreLoggingServerInternalObj from './kbn_core_logging_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_logging_server_mocks.mdx b/api_docs/kbn_core_logging_server_mocks.mdx index c6057a0dad1b4..28e7d1aee06ab 100644 --- a/api_docs/kbn_core_logging_server_mocks.mdx +++ b/api_docs/kbn_core_logging_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-logging-server-mocks title: "@kbn/core-logging-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-logging-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-logging-server-mocks'] --- import kbnCoreLoggingServerMocksObj from './kbn_core_logging_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_metrics_collectors_server_internal.mdx b/api_docs/kbn_core_metrics_collectors_server_internal.mdx index d988e2469ded8..1339e9b86302f 100644 --- a/api_docs/kbn_core_metrics_collectors_server_internal.mdx +++ b/api_docs/kbn_core_metrics_collectors_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-metrics-collectors-server-internal title: "@kbn/core-metrics-collectors-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-metrics-collectors-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-metrics-collectors-server-internal'] --- import kbnCoreMetricsCollectorsServerInternalObj from './kbn_core_metrics_collectors_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_metrics_collectors_server_mocks.mdx b/api_docs/kbn_core_metrics_collectors_server_mocks.mdx index 3a633bd70ae8d..2106369a6e067 100644 --- a/api_docs/kbn_core_metrics_collectors_server_mocks.mdx +++ b/api_docs/kbn_core_metrics_collectors_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-metrics-collectors-server-mocks title: "@kbn/core-metrics-collectors-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-metrics-collectors-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-metrics-collectors-server-mocks'] --- import kbnCoreMetricsCollectorsServerMocksObj from './kbn_core_metrics_collectors_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_metrics_server.mdx b/api_docs/kbn_core_metrics_server.mdx index 6a801616924de..fc82c9518b224 100644 --- a/api_docs/kbn_core_metrics_server.mdx +++ b/api_docs/kbn_core_metrics_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-metrics-server title: "@kbn/core-metrics-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-metrics-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-metrics-server'] --- import kbnCoreMetricsServerObj from './kbn_core_metrics_server.devdocs.json'; diff --git a/api_docs/kbn_core_metrics_server_internal.mdx b/api_docs/kbn_core_metrics_server_internal.mdx index 98f16d74311a3..fc39bc2a73b8d 100644 --- a/api_docs/kbn_core_metrics_server_internal.mdx +++ b/api_docs/kbn_core_metrics_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-metrics-server-internal title: "@kbn/core-metrics-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-metrics-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-metrics-server-internal'] --- import kbnCoreMetricsServerInternalObj from './kbn_core_metrics_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_metrics_server_mocks.mdx b/api_docs/kbn_core_metrics_server_mocks.mdx index 155ba6e7be2ab..cc0c1114bad3d 100644 --- a/api_docs/kbn_core_metrics_server_mocks.mdx +++ b/api_docs/kbn_core_metrics_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-metrics-server-mocks title: "@kbn/core-metrics-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-metrics-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-metrics-server-mocks'] --- import kbnCoreMetricsServerMocksObj from './kbn_core_metrics_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_mount_utils_browser.mdx b/api_docs/kbn_core_mount_utils_browser.mdx index 1a4d662b3a2df..f39452bf8e070 100644 --- a/api_docs/kbn_core_mount_utils_browser.mdx +++ b/api_docs/kbn_core_mount_utils_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-mount-utils-browser title: "@kbn/core-mount-utils-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-mount-utils-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-mount-utils-browser'] --- import kbnCoreMountUtilsBrowserObj from './kbn_core_mount_utils_browser.devdocs.json'; diff --git a/api_docs/kbn_core_node_server.mdx b/api_docs/kbn_core_node_server.mdx index 03bd610124f17..b5bd6a96a4aca 100644 --- a/api_docs/kbn_core_node_server.mdx +++ b/api_docs/kbn_core_node_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-node-server title: "@kbn/core-node-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-node-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-node-server'] --- import kbnCoreNodeServerObj from './kbn_core_node_server.devdocs.json'; diff --git a/api_docs/kbn_core_node_server_internal.mdx b/api_docs/kbn_core_node_server_internal.mdx index 0df9692e82295..21162f1a31434 100644 --- a/api_docs/kbn_core_node_server_internal.mdx +++ b/api_docs/kbn_core_node_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-node-server-internal title: "@kbn/core-node-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-node-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-node-server-internal'] --- import kbnCoreNodeServerInternalObj from './kbn_core_node_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_node_server_mocks.mdx b/api_docs/kbn_core_node_server_mocks.mdx index 1af721281233c..e30c59be682b6 100644 --- a/api_docs/kbn_core_node_server_mocks.mdx +++ b/api_docs/kbn_core_node_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-node-server-mocks title: "@kbn/core-node-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-node-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-node-server-mocks'] --- import kbnCoreNodeServerMocksObj from './kbn_core_node_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_notifications_browser.mdx b/api_docs/kbn_core_notifications_browser.mdx index e5ceb80bfbf3d..1670159e2f687 100644 --- a/api_docs/kbn_core_notifications_browser.mdx +++ b/api_docs/kbn_core_notifications_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-notifications-browser title: "@kbn/core-notifications-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-notifications-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-notifications-browser'] --- import kbnCoreNotificationsBrowserObj from './kbn_core_notifications_browser.devdocs.json'; diff --git a/api_docs/kbn_core_notifications_browser_internal.mdx b/api_docs/kbn_core_notifications_browser_internal.mdx index db585e1e7019d..d325d094d4def 100644 --- a/api_docs/kbn_core_notifications_browser_internal.mdx +++ b/api_docs/kbn_core_notifications_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-notifications-browser-internal title: "@kbn/core-notifications-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-notifications-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-notifications-browser-internal'] --- import kbnCoreNotificationsBrowserInternalObj from './kbn_core_notifications_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_notifications_browser_mocks.mdx b/api_docs/kbn_core_notifications_browser_mocks.mdx index 67229dca7a43b..fe3bdbbf829b6 100644 --- a/api_docs/kbn_core_notifications_browser_mocks.mdx +++ b/api_docs/kbn_core_notifications_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-notifications-browser-mocks title: "@kbn/core-notifications-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-notifications-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-notifications-browser-mocks'] --- import kbnCoreNotificationsBrowserMocksObj from './kbn_core_notifications_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_overlays_browser.mdx b/api_docs/kbn_core_overlays_browser.mdx index 35e54d77796de..eb925a4e42d84 100644 --- a/api_docs/kbn_core_overlays_browser.mdx +++ b/api_docs/kbn_core_overlays_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-overlays-browser title: "@kbn/core-overlays-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-overlays-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-overlays-browser'] --- import kbnCoreOverlaysBrowserObj from './kbn_core_overlays_browser.devdocs.json'; diff --git a/api_docs/kbn_core_overlays_browser_internal.mdx b/api_docs/kbn_core_overlays_browser_internal.mdx index b6f0a91c14752..2d519679f553c 100644 --- a/api_docs/kbn_core_overlays_browser_internal.mdx +++ b/api_docs/kbn_core_overlays_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-overlays-browser-internal title: "@kbn/core-overlays-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-overlays-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-overlays-browser-internal'] --- import kbnCoreOverlaysBrowserInternalObj from './kbn_core_overlays_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_overlays_browser_mocks.mdx b/api_docs/kbn_core_overlays_browser_mocks.mdx index 4b7d2625fd3c1..1b8f5f179d50d 100644 --- a/api_docs/kbn_core_overlays_browser_mocks.mdx +++ b/api_docs/kbn_core_overlays_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-overlays-browser-mocks title: "@kbn/core-overlays-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-overlays-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-overlays-browser-mocks'] --- import kbnCoreOverlaysBrowserMocksObj from './kbn_core_overlays_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_plugins_browser.mdx b/api_docs/kbn_core_plugins_browser.mdx index 86f325a025185..4a8934e207fa2 100644 --- a/api_docs/kbn_core_plugins_browser.mdx +++ b/api_docs/kbn_core_plugins_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-plugins-browser title: "@kbn/core-plugins-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-plugins-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-plugins-browser'] --- import kbnCorePluginsBrowserObj from './kbn_core_plugins_browser.devdocs.json'; diff --git a/api_docs/kbn_core_plugins_browser_mocks.mdx b/api_docs/kbn_core_plugins_browser_mocks.mdx index 82a3ca522cb2b..e962cd3083098 100644 --- a/api_docs/kbn_core_plugins_browser_mocks.mdx +++ b/api_docs/kbn_core_plugins_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-plugins-browser-mocks title: "@kbn/core-plugins-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-plugins-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-plugins-browser-mocks'] --- import kbnCorePluginsBrowserMocksObj from './kbn_core_plugins_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_plugins_server.mdx b/api_docs/kbn_core_plugins_server.mdx index 998a86017f32b..4444c4d6a9cb1 100644 --- a/api_docs/kbn_core_plugins_server.mdx +++ b/api_docs/kbn_core_plugins_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-plugins-server title: "@kbn/core-plugins-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-plugins-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-plugins-server'] --- import kbnCorePluginsServerObj from './kbn_core_plugins_server.devdocs.json'; diff --git a/api_docs/kbn_core_plugins_server_mocks.mdx b/api_docs/kbn_core_plugins_server_mocks.mdx index 7b6c1e6265bff..88e742da3699c 100644 --- a/api_docs/kbn_core_plugins_server_mocks.mdx +++ b/api_docs/kbn_core_plugins_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-plugins-server-mocks title: "@kbn/core-plugins-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-plugins-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-plugins-server-mocks'] --- import kbnCorePluginsServerMocksObj from './kbn_core_plugins_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_preboot_server.mdx b/api_docs/kbn_core_preboot_server.mdx index 859ae78a6bc92..82f9c4abc73be 100644 --- a/api_docs/kbn_core_preboot_server.mdx +++ b/api_docs/kbn_core_preboot_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-preboot-server title: "@kbn/core-preboot-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-preboot-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-preboot-server'] --- import kbnCorePrebootServerObj from './kbn_core_preboot_server.devdocs.json'; diff --git a/api_docs/kbn_core_preboot_server_mocks.mdx b/api_docs/kbn_core_preboot_server_mocks.mdx index 0a2fc227d5caa..ceb899ef4a90d 100644 --- a/api_docs/kbn_core_preboot_server_mocks.mdx +++ b/api_docs/kbn_core_preboot_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-preboot-server-mocks title: "@kbn/core-preboot-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-preboot-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-preboot-server-mocks'] --- import kbnCorePrebootServerMocksObj from './kbn_core_preboot_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_rendering_browser_mocks.mdx b/api_docs/kbn_core_rendering_browser_mocks.mdx index 191991e420a16..0274f4c1a4620 100644 --- a/api_docs/kbn_core_rendering_browser_mocks.mdx +++ b/api_docs/kbn_core_rendering_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-rendering-browser-mocks title: "@kbn/core-rendering-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-rendering-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-rendering-browser-mocks'] --- import kbnCoreRenderingBrowserMocksObj from './kbn_core_rendering_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_rendering_server_internal.mdx b/api_docs/kbn_core_rendering_server_internal.mdx index e003dcea80ff6..184db0f4d4fd8 100644 --- a/api_docs/kbn_core_rendering_server_internal.mdx +++ b/api_docs/kbn_core_rendering_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-rendering-server-internal title: "@kbn/core-rendering-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-rendering-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-rendering-server-internal'] --- import kbnCoreRenderingServerInternalObj from './kbn_core_rendering_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_rendering_server_mocks.mdx b/api_docs/kbn_core_rendering_server_mocks.mdx index e77835e381a14..93da8edb91bc4 100644 --- a/api_docs/kbn_core_rendering_server_mocks.mdx +++ b/api_docs/kbn_core_rendering_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-rendering-server-mocks title: "@kbn/core-rendering-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-rendering-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-rendering-server-mocks'] --- import kbnCoreRenderingServerMocksObj from './kbn_core_rendering_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_root_server_internal.mdx b/api_docs/kbn_core_root_server_internal.mdx index 3bab1873e311b..cba0484b0eb04 100644 --- a/api_docs/kbn_core_root_server_internal.mdx +++ b/api_docs/kbn_core_root_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-root-server-internal title: "@kbn/core-root-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-root-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-root-server-internal'] --- import kbnCoreRootServerInternalObj from './kbn_core_root_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_api_browser.mdx b/api_docs/kbn_core_saved_objects_api_browser.mdx index b717e572cd129..b5a336adde3ce 100644 --- a/api_docs/kbn_core_saved_objects_api_browser.mdx +++ b/api_docs/kbn_core_saved_objects_api_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-api-browser title: "@kbn/core-saved-objects-api-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-api-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-api-browser'] --- import kbnCoreSavedObjectsApiBrowserObj from './kbn_core_saved_objects_api_browser.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_api_server.mdx b/api_docs/kbn_core_saved_objects_api_server.mdx index f528f3c2a7c21..d1a85a7e43662 100644 --- a/api_docs/kbn_core_saved_objects_api_server.mdx +++ b/api_docs/kbn_core_saved_objects_api_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-api-server title: "@kbn/core-saved-objects-api-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-api-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-api-server'] --- import kbnCoreSavedObjectsApiServerObj from './kbn_core_saved_objects_api_server.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_api_server_internal.mdx b/api_docs/kbn_core_saved_objects_api_server_internal.mdx index 4cb188adf676c..90dac2cb4466d 100644 --- a/api_docs/kbn_core_saved_objects_api_server_internal.mdx +++ b/api_docs/kbn_core_saved_objects_api_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-api-server-internal title: "@kbn/core-saved-objects-api-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-api-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-api-server-internal'] --- import kbnCoreSavedObjectsApiServerInternalObj from './kbn_core_saved_objects_api_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_api_server_mocks.mdx b/api_docs/kbn_core_saved_objects_api_server_mocks.mdx index 01da8e89e62fc..990d07e6d15ec 100644 --- a/api_docs/kbn_core_saved_objects_api_server_mocks.mdx +++ b/api_docs/kbn_core_saved_objects_api_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-api-server-mocks title: "@kbn/core-saved-objects-api-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-api-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-api-server-mocks'] --- import kbnCoreSavedObjectsApiServerMocksObj from './kbn_core_saved_objects_api_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_base_server_internal.mdx b/api_docs/kbn_core_saved_objects_base_server_internal.mdx index 54bb3e5d59610..c24bed21e641f 100644 --- a/api_docs/kbn_core_saved_objects_base_server_internal.mdx +++ b/api_docs/kbn_core_saved_objects_base_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-base-server-internal title: "@kbn/core-saved-objects-base-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-base-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-base-server-internal'] --- import kbnCoreSavedObjectsBaseServerInternalObj from './kbn_core_saved_objects_base_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_base_server_mocks.mdx b/api_docs/kbn_core_saved_objects_base_server_mocks.mdx index 35e22c223d0ee..b110c4a9ef8f2 100644 --- a/api_docs/kbn_core_saved_objects_base_server_mocks.mdx +++ b/api_docs/kbn_core_saved_objects_base_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-base-server-mocks title: "@kbn/core-saved-objects-base-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-base-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-base-server-mocks'] --- import kbnCoreSavedObjectsBaseServerMocksObj from './kbn_core_saved_objects_base_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_browser.mdx b/api_docs/kbn_core_saved_objects_browser.mdx index 03c1b6ea78491..002fb201413a2 100644 --- a/api_docs/kbn_core_saved_objects_browser.mdx +++ b/api_docs/kbn_core_saved_objects_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-browser title: "@kbn/core-saved-objects-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-browser'] --- import kbnCoreSavedObjectsBrowserObj from './kbn_core_saved_objects_browser.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_browser_internal.mdx b/api_docs/kbn_core_saved_objects_browser_internal.mdx index 46f1fc4e5eeaf..b8efbdbf1f382 100644 --- a/api_docs/kbn_core_saved_objects_browser_internal.mdx +++ b/api_docs/kbn_core_saved_objects_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-browser-internal title: "@kbn/core-saved-objects-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-browser-internal'] --- import kbnCoreSavedObjectsBrowserInternalObj from './kbn_core_saved_objects_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_browser_mocks.mdx b/api_docs/kbn_core_saved_objects_browser_mocks.mdx index 77fcd6aec301f..01f7bd6b42ce9 100644 --- a/api_docs/kbn_core_saved_objects_browser_mocks.mdx +++ b/api_docs/kbn_core_saved_objects_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-browser-mocks title: "@kbn/core-saved-objects-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-browser-mocks'] --- import kbnCoreSavedObjectsBrowserMocksObj from './kbn_core_saved_objects_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_common.mdx b/api_docs/kbn_core_saved_objects_common.mdx index bceaf34acb141..63fd8f4d83b47 100644 --- a/api_docs/kbn_core_saved_objects_common.mdx +++ b/api_docs/kbn_core_saved_objects_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-common title: "@kbn/core-saved-objects-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-common'] --- import kbnCoreSavedObjectsCommonObj from './kbn_core_saved_objects_common.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_import_export_server_internal.mdx b/api_docs/kbn_core_saved_objects_import_export_server_internal.mdx index 76df69eb5e2b3..02907deecd41e 100644 --- a/api_docs/kbn_core_saved_objects_import_export_server_internal.mdx +++ b/api_docs/kbn_core_saved_objects_import_export_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-import-export-server-internal title: "@kbn/core-saved-objects-import-export-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-import-export-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-import-export-server-internal'] --- import kbnCoreSavedObjectsImportExportServerInternalObj from './kbn_core_saved_objects_import_export_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_import_export_server_mocks.mdx b/api_docs/kbn_core_saved_objects_import_export_server_mocks.mdx index 2217467893a31..5984dd9889d01 100644 --- a/api_docs/kbn_core_saved_objects_import_export_server_mocks.mdx +++ b/api_docs/kbn_core_saved_objects_import_export_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-import-export-server-mocks title: "@kbn/core-saved-objects-import-export-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-import-export-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-import-export-server-mocks'] --- import kbnCoreSavedObjectsImportExportServerMocksObj from './kbn_core_saved_objects_import_export_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_migration_server_internal.mdx b/api_docs/kbn_core_saved_objects_migration_server_internal.mdx index 4c3a30ef6b819..9838057eaae58 100644 --- a/api_docs/kbn_core_saved_objects_migration_server_internal.mdx +++ b/api_docs/kbn_core_saved_objects_migration_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-migration-server-internal title: "@kbn/core-saved-objects-migration-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-migration-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-migration-server-internal'] --- import kbnCoreSavedObjectsMigrationServerInternalObj from './kbn_core_saved_objects_migration_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_migration_server_mocks.mdx b/api_docs/kbn_core_saved_objects_migration_server_mocks.mdx index f58d85478ab76..e32c04a7e3925 100644 --- a/api_docs/kbn_core_saved_objects_migration_server_mocks.mdx +++ b/api_docs/kbn_core_saved_objects_migration_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-migration-server-mocks title: "@kbn/core-saved-objects-migration-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-migration-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-migration-server-mocks'] --- import kbnCoreSavedObjectsMigrationServerMocksObj from './kbn_core_saved_objects_migration_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_server.devdocs.json b/api_docs/kbn_core_saved_objects_server.devdocs.json index 3890cd7f96e1e..1500c2294268b 100644 --- a/api_docs/kbn_core_saved_objects_server.devdocs.json +++ b/api_docs/kbn_core_saved_objects_server.devdocs.json @@ -3081,6 +3081,301 @@ ], "initialIsOpen": false }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelBidirectionalTransformation", + "type": "Interface", + "tags": [], + "label": "SavedObjectModelBidirectionalTransformation", + "description": [ + "\nA bidirectional transformation.\n\nBidirectional transformations define migration functions that can be used to\ntransform a document from the lower version to the higher one (`up`), and\nthe other way around, from the higher version to the lower one (`down`)\n" + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelBidirectionalTransformation", + "text": "SavedObjectModelBidirectionalTransformation" + }, + "" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelBidirectionalTransformation.up", + "type": "Function", + "tags": [], + "label": "up", + "description": [ + "\nThe upward (previous=>next) transformation." + ], + "signature": [ + "(document: ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationDoc", + "text": "SavedObjectModelTransformationDoc" + }, + ", context: ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationContext", + "text": "SavedObjectModelTransformationContext" + }, + ") => ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationResult", + "text": "SavedObjectModelTransformationResult" + }, + "" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false, + "returnComment": [], + "children": [ + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelBidirectionalTransformation.up.$1", + "type": "CompoundType", + "tags": [], + "label": "document", + "description": [], + "signature": [ + "SavedObjectDoc & { references: ", + { + "pluginId": "@kbn/core-saved-objects-common", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsCommonPluginApi", + "section": "def-common.SavedObjectReference", + "text": "SavedObjectReference" + }, + "[]; }" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelBidirectionalTransformation.up.$2", + "type": "Object", + "tags": [], + "label": "context", + "description": [], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationContext", + "text": "SavedObjectModelTransformationContext" + } + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false + } + ] + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelBidirectionalTransformation.down", + "type": "Function", + "tags": [], + "label": "down", + "description": [ + "\nThe downward (next=>previous) transformation." + ], + "signature": [ + "(document: ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationDoc", + "text": "SavedObjectModelTransformationDoc" + }, + ", context: ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationContext", + "text": "SavedObjectModelTransformationContext" + }, + ") => ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationResult", + "text": "SavedObjectModelTransformationResult" + }, + "" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false, + "returnComment": [], + "children": [ + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelBidirectionalTransformation.down.$1", + "type": "CompoundType", + "tags": [], + "label": "document", + "description": [], + "signature": [ + "SavedObjectDoc & { references: ", + { + "pluginId": "@kbn/core-saved-objects-common", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsCommonPluginApi", + "section": "def-common.SavedObjectReference", + "text": "SavedObjectReference" + }, + "[]; }" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelBidirectionalTransformation.down.$2", + "type": "Object", + "tags": [], + "label": "context", + "description": [], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationContext", + "text": "SavedObjectModelTransformationContext" + } + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false + } + ] + } + ], + "initialIsOpen": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelTransformationContext", + "type": "Interface", + "tags": [], + "label": "SavedObjectModelTransformationContext", + "description": [ + "\nContext passed down to {@link SavedObjectModelTransformationFn | transformation functions}.\n" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelTransformationContext.log", + "type": "Object", + "tags": [], + "label": "log", + "description": [ + "\nlogger instance to be used by the migration handler" + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsMigrationLogger", + "text": "SavedObjectsMigrationLogger" + } + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelTransformationContext.modelVersion", + "type": "number", + "tags": [], + "label": "modelVersion", + "description": [ + "\nThe model version this migration is registered for" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelTransformationResult", + "type": "Interface", + "tags": [], + "label": "SavedObjectModelTransformationResult", + "description": [ + "\nReturn type for the {@link SavedObjectModelTransformationFn | transformation functions}\n" + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationResult", + "text": "SavedObjectModelTransformationResult" + }, + "" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelTransformationResult.document", + "type": "CompoundType", + "tags": [], + "label": "document", + "description": [], + "signature": [ + "SavedObjectDoc & { references: ", + { + "pluginId": "@kbn/core-saved-objects-common", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsCommonPluginApi", + "section": "def-common.SavedObjectReference", + "text": "SavedObjectReference" + }, + "[]; }" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + }, { "parentPluginId": "@kbn/core-saved-objects-server", "id": "def-common.SavedObjectReference", @@ -3936,6 +4231,186 @@ ], "initialIsOpen": false }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelExpansionChange", + "type": "Interface", + "tags": [], + "label": "SavedObjectsModelExpansionChange", + "description": [ + "\n{@link SavedObjectsModelChange | model change} representing an expansion.\n\nA model expansion can do either, or both, or those:\n- add new mappings\n- migrate data in a backward-compatible way\n" + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsModelExpansionChange", + "text": "SavedObjectsModelExpansionChange" + }, + "" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelExpansionChange.type", + "type": "string", + "tags": [], + "label": "type", + "description": [ + "\nThe type of {@link SavedObjectsModelChange | change}, used to identify them internally." + ], + "signature": [ + "\"expansion\"" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelExpansionChange.transformation", + "type": "Object", + "tags": [], + "label": "transformation", + "description": [ + "\n(optional) A bidirectional transformation to migrate the document from and/or to the previous model version." + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelBidirectionalTransformation", + "text": "SavedObjectModelBidirectionalTransformation" + }, + " | undefined" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelExpansionChange.addedMappings", + "type": "Object", + "tags": [], + "label": "addedMappings", + "description": [ + "\n(optional) The new mappings introduced in this version." + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsMappingProperties", + "text": "SavedObjectsMappingProperties" + }, + " | undefined" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelExpansionChange.deprecatedMappings", + "type": "Array", + "tags": [], + "label": "deprecatedMappings", + "description": [ + "\n(optional) A list of paths to mappings to flag as deprecated. Deprecated mappings should no longer be used and will\neventually be deleted later." + ], + "signature": [ + "string[] | undefined" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelVersion", + "type": "Interface", + "tags": [], + "label": "SavedObjectsModelVersion", + "description": [ + "\nRepresents a model version of a given savedObjects type.\n\nModel versions supersede the {@link SavedObjectsType.migrations | migrations} (and {@link SavedObjectsType.schemas | schemas}) APIs\nby exposing an unified way of describing the changes of shape or data of a type.\n" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelVersion.modelChange", + "type": "Object", + "tags": [], + "label": "modelChange", + "description": [ + "\nThe {@link SavedObjectsModelChange | changes} associated with this version." + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsModelExpansionChange", + "text": "SavedObjectsModelExpansionChange" + }, + "" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelVersionMap", + "type": "Interface", + "tags": [], + "label": "SavedObjectsModelVersionMap", + "description": [ + "\nA record of {@link SavedObjectsModelVersion | model versions} for a given savedObjects type.\nThe record's keys must be integers, starting with 1 for the first entry, and there shouldn't be gaps.\n" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelVersionMap.Unnamed", + "type": "IndexSignature", + "tags": [], + "label": "[modelVersion: string]: SavedObjectsModelVersion", + "description": [], + "signature": [ + "[modelVersion: string]: ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsModelVersion", + "text": "SavedObjectsModelVersion" + } + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + }, { "parentPluginId": "@kbn/core-saved-objects-server", "id": "def-common.SavedObjectsRawDoc", @@ -5917,6 +6392,55 @@ "path": "packages/core/saved-objects/core-saved-objects-server/src/saved_objects_type.ts", "deprecated": false, "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsType.modelVersions", + "type": "CompoundType", + "tags": [ + "alpha" + ], + "label": "modelVersions", + "description": [ + "\nA map of model versions associated with this type.\n\nModel versions supersede the {@link SavedObjectsType.migrations | migrations} (and {@link SavedObjectsType.schemas | schemas}) APIs\nby exposing an unified way of describing the changes of shape or data of the type.\n\nModel versioning is decoupled from Kibana versioning, and isolated between types.\nModel versions are identified by a single numeric value, starting at `1` and without gaps.\n\nPlease refer to {@link SavedObjectsModelVersion} for details on the API's usages.\n\nA **valid** versioning would be:\n\n```ts\n{\n name: 'foo',\n // other mandatory attributes...\n modelVersions: {\n '1': modelVersion1,\n '2': modelVersion2,\n '3': modelVersion3,\n }\n}\n```\n\nA **invalid** versioning would be:\n\n```ts\n{\n name: 'foo',\n // other mandatory attributes...\n modelVersions: {\n '1': modelVersion1,\n '3': modelVersion3, // ERROR, no model version 2\n '3.1': modelVersion31, // ERROR, model version is a single numeric value\n }\n}\n```\n" + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsModelVersionMap", + "text": "SavedObjectsModelVersionMap" + }, + " | ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsModelVersionMapProvider", + "text": "SavedObjectsModelVersionMapProvider" + }, + " | undefined" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/saved_objects_type.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsType.switchToModelVersionAt", + "type": "string", + "tags": [], + "label": "switchToModelVersionAt", + "description": [ + "\nAllows to opt-in to the new model version API.\n\nMust be a valid semver version (with the patch version being necessarily 0)\n\nWhen specified, the type will switch from using the {@link SavedObjectsType.migrations | legacy migration API}\nto use the {@link SavedObjectsType.modelVersions | modelVersion API} after the specified version.\n\nWhen opted in, it will no longer be possible to use the legacy migration API after the specified version.\n\nA **valid** usage example would be:\n\n```ts\n{\n name: 'foo',\n // other mandatory attributes...\n switchToModelVersionAt: '8.8.0',\n migrations: {\n '8.1.0': migrateTo810,\n '8.7.0': migrateTo870,\n },\n modelVersions: {\n '1': modelVersion1\n }\n}\n```\n\nAn **invalid** usage example would be:\n\n```ts\n{\n name: 'foo',\n // other mandatory attributes...\n switchToModelVersionAt: '8.9.0',\n migrations: {\n '8.1.0': migrateTo8_1,\n '8.9.0': migrateTo8_9, // error: migration registered for the switch version\n '8.10.0': migrateTo8_10, // error: migration registered for after the switch version\n },\n modelVersions: {\n '1': modelVersion1\n }\n}\n```\n\nPlease refer to the {@link SavedObjectsType.modelVersions | modelVersion API} for more documentation on\nthe new API.\n" + ], + "signature": [ + "string | undefined" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/saved_objects_type.ts", + "deprecated": false, + "trackAdoption": false } ], "initialIsOpen": false @@ -6559,6 +7083,117 @@ ], "initialIsOpen": false }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelTransformationDoc", + "type": "Type", + "tags": [], + "label": "SavedObjectModelTransformationDoc", + "description": [ + "\nDocument type used during model migration.\n" + ], + "signature": [ + "SavedObjectDoc & { references: ", + { + "pluginId": "@kbn/core-saved-objects-common", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsCommonPluginApi", + "section": "def-common.SavedObjectReference", + "text": "SavedObjectReference" + }, + "[]; }" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelTransformationFn", + "type": "Type", + "tags": [], + "label": "SavedObjectModelTransformationFn", + "description": [ + "\nTransformation function for the model version API.\n\nSimilar to the old migration system, model version transformations take the document to migrate\nand a context object as input and must return the transformed document in its return value.\n" + ], + "signature": [ + "(document: ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationDoc", + "text": "SavedObjectModelTransformationDoc" + }, + ", context: ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationContext", + "text": "SavedObjectModelTransformationContext" + }, + ") => ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationResult", + "text": "SavedObjectModelTransformationResult" + }, + "" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false, + "returnComment": [], + "children": [ + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelTransformationFn.$1", + "type": "CompoundType", + "tags": [], + "label": "document", + "description": [], + "signature": [ + "SavedObjectDoc & { references: ", + { + "pluginId": "@kbn/core-saved-objects-common", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsCommonPluginApi", + "section": "def-common.SavedObjectReference", + "text": "SavedObjectReference" + }, + "[]; }" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectModelTransformationFn.$2", + "type": "Object", + "tags": [], + "label": "context", + "description": [], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectModelTransformationContext", + "text": "SavedObjectModelTransformationContext" + } + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/transformations.ts", + "deprecated": false, + "trackAdoption": false + } + ], + "initialIsOpen": false + }, { "parentPluginId": "@kbn/core-saved-objects-server", "id": "def-common.SavedObjectSanitizedDoc", @@ -7077,6 +7712,56 @@ ], "initialIsOpen": false }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelChange", + "type": "Type", + "tags": [], + "label": "SavedObjectsModelChange", + "description": [ + "\nIdentify the model change associated with a given {@link SavedObjectsModelVersion}.\n\nAt the moment, Only one type of change is supported: {@link SavedObjectsModelExpansionChange | expansions}.\n" + ], + "signature": [ + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsModelExpansionChange", + "text": "SavedObjectsModelExpansionChange" + }, + "" + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, + { + "parentPluginId": "@kbn/core-saved-objects-server", + "id": "def-common.SavedObjectsModelVersionMapProvider", + "type": "Type", + "tags": [], + "label": "SavedObjectsModelVersionMapProvider", + "description": [ + "\nA function returning a {@link SavedObjectsModelVersionMap | model version map}\n\nEnsured to be called after all plugins executed their `setup` phase.\nSimilar to what was done with migrations, can be used to defer resolving the model versions\nassociated to a type to after all plugins have been set up.\n" + ], + "signature": [ + "() => ", + { + "pluginId": "@kbn/core-saved-objects-server", + "scope": "common", + "docId": "kibKbnCoreSavedObjectsServerPluginApi", + "section": "def-common.SavedObjectsModelVersionMap", + "text": "SavedObjectsModelVersionMap" + } + ], + "path": "packages/core/saved-objects/core-saved-objects-server/src/model_version/model_version.ts", + "deprecated": false, + "trackAdoption": false, + "returnComment": [], + "children": [], + "initialIsOpen": false + }, { "parentPluginId": "@kbn/core-saved-objects-server", "id": "def-common.SavedObjectsSecurityExtensionFactory", diff --git a/api_docs/kbn_core_saved_objects_server.mdx b/api_docs/kbn_core_saved_objects_server.mdx index 0972d95cd67b3..b066ca00e218f 100644 --- a/api_docs/kbn_core_saved_objects_server.mdx +++ b/api_docs/kbn_core_saved_objects_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-server title: "@kbn/core-saved-objects-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-server'] --- import kbnCoreSavedObjectsServerObj from './kbn_core_saved_objects_server.devdocs.json'; @@ -21,7 +21,7 @@ Contact Kibana Core for questions regarding this plugin. | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 329 | 0 | 96 | 1 | +| 358 | 0 | 104 | 1 | ## Common diff --git a/api_docs/kbn_core_saved_objects_server_internal.mdx b/api_docs/kbn_core_saved_objects_server_internal.mdx index 6f327ed6d46cd..43d284da0bade 100644 --- a/api_docs/kbn_core_saved_objects_server_internal.mdx +++ b/api_docs/kbn_core_saved_objects_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-server-internal title: "@kbn/core-saved-objects-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-server-internal'] --- import kbnCoreSavedObjectsServerInternalObj from './kbn_core_saved_objects_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_server_mocks.mdx b/api_docs/kbn_core_saved_objects_server_mocks.mdx index dcb59cf245b2d..f700f12335378 100644 --- a/api_docs/kbn_core_saved_objects_server_mocks.mdx +++ b/api_docs/kbn_core_saved_objects_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-server-mocks title: "@kbn/core-saved-objects-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-server-mocks'] --- import kbnCoreSavedObjectsServerMocksObj from './kbn_core_saved_objects_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_saved_objects_utils_server.mdx b/api_docs/kbn_core_saved_objects_utils_server.mdx index a71f5aa44486e..f4a0f73809a90 100644 --- a/api_docs/kbn_core_saved_objects_utils_server.mdx +++ b/api_docs/kbn_core_saved_objects_utils_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-saved-objects-utils-server title: "@kbn/core-saved-objects-utils-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-saved-objects-utils-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-saved-objects-utils-server'] --- import kbnCoreSavedObjectsUtilsServerObj from './kbn_core_saved_objects_utils_server.devdocs.json'; diff --git a/api_docs/kbn_core_status_common.mdx b/api_docs/kbn_core_status_common.mdx index 99371df20a800..26757f46823fd 100644 --- a/api_docs/kbn_core_status_common.mdx +++ b/api_docs/kbn_core_status_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-status-common title: "@kbn/core-status-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-status-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-status-common'] --- import kbnCoreStatusCommonObj from './kbn_core_status_common.devdocs.json'; diff --git a/api_docs/kbn_core_status_common_internal.mdx b/api_docs/kbn_core_status_common_internal.mdx index 10d10f176db26..2c358781e9f0e 100644 --- a/api_docs/kbn_core_status_common_internal.mdx +++ b/api_docs/kbn_core_status_common_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-status-common-internal title: "@kbn/core-status-common-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-status-common-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-status-common-internal'] --- import kbnCoreStatusCommonInternalObj from './kbn_core_status_common_internal.devdocs.json'; diff --git a/api_docs/kbn_core_status_server.mdx b/api_docs/kbn_core_status_server.mdx index cb47fa309e3da..5dc293b7c5127 100644 --- a/api_docs/kbn_core_status_server.mdx +++ b/api_docs/kbn_core_status_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-status-server title: "@kbn/core-status-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-status-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-status-server'] --- import kbnCoreStatusServerObj from './kbn_core_status_server.devdocs.json'; diff --git a/api_docs/kbn_core_status_server_internal.mdx b/api_docs/kbn_core_status_server_internal.mdx index a442f76ebbd8f..8748d7014e393 100644 --- a/api_docs/kbn_core_status_server_internal.mdx +++ b/api_docs/kbn_core_status_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-status-server-internal title: "@kbn/core-status-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-status-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-status-server-internal'] --- import kbnCoreStatusServerInternalObj from './kbn_core_status_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_status_server_mocks.mdx b/api_docs/kbn_core_status_server_mocks.mdx index e4c9055227729..ca7ae3a224734 100644 --- a/api_docs/kbn_core_status_server_mocks.mdx +++ b/api_docs/kbn_core_status_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-status-server-mocks title: "@kbn/core-status-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-status-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-status-server-mocks'] --- import kbnCoreStatusServerMocksObj from './kbn_core_status_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_test_helpers_deprecations_getters.mdx b/api_docs/kbn_core_test_helpers_deprecations_getters.mdx index 793ca7f5bd0c8..5347d5e3682b3 100644 --- a/api_docs/kbn_core_test_helpers_deprecations_getters.mdx +++ b/api_docs/kbn_core_test_helpers_deprecations_getters.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-test-helpers-deprecations-getters title: "@kbn/core-test-helpers-deprecations-getters" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-test-helpers-deprecations-getters plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-test-helpers-deprecations-getters'] --- import kbnCoreTestHelpersDeprecationsGettersObj from './kbn_core_test_helpers_deprecations_getters.devdocs.json'; diff --git a/api_docs/kbn_core_test_helpers_http_setup_browser.mdx b/api_docs/kbn_core_test_helpers_http_setup_browser.mdx index 5e8abda566982..979a31c0ff625 100644 --- a/api_docs/kbn_core_test_helpers_http_setup_browser.mdx +++ b/api_docs/kbn_core_test_helpers_http_setup_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-test-helpers-http-setup-browser title: "@kbn/core-test-helpers-http-setup-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-test-helpers-http-setup-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-test-helpers-http-setup-browser'] --- import kbnCoreTestHelpersHttpSetupBrowserObj from './kbn_core_test_helpers_http_setup_browser.devdocs.json'; diff --git a/api_docs/kbn_core_test_helpers_kbn_server.mdx b/api_docs/kbn_core_test_helpers_kbn_server.mdx index 67bef888192aa..26ab3d8e58fe4 100644 --- a/api_docs/kbn_core_test_helpers_kbn_server.mdx +++ b/api_docs/kbn_core_test_helpers_kbn_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-test-helpers-kbn-server title: "@kbn/core-test-helpers-kbn-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-test-helpers-kbn-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-test-helpers-kbn-server'] --- import kbnCoreTestHelpersKbnServerObj from './kbn_core_test_helpers_kbn_server.devdocs.json'; diff --git a/api_docs/kbn_core_test_helpers_so_type_serializer.devdocs.json b/api_docs/kbn_core_test_helpers_so_type_serializer.devdocs.json index 82290b2116ef2..89a4cdb2015f7 100644 --- a/api_docs/kbn_core_test_helpers_so_type_serializer.devdocs.json +++ b/api_docs/kbn_core_test_helpers_so_type_serializer.devdocs.json @@ -242,6 +242,35 @@ "path": "packages/core/test-helpers/core-test-helpers-so-type-serializer/src/extract_migration_info.ts", "deprecated": false, "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-test-helpers-so-type-serializer", + "id": "def-common.SavedObjectTypeMigrationInfo.modelVersions", + "type": "Array", + "tags": [], + "label": "modelVersions", + "description": [], + "signature": [ + "ModelVersionSummary", + "[]" + ], + "path": "packages/core/test-helpers/core-test-helpers-so-type-serializer/src/extract_migration_info.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "@kbn/core-test-helpers-so-type-serializer", + "id": "def-common.SavedObjectTypeMigrationInfo.switchToModelVersionAt", + "type": "string", + "tags": [], + "label": "switchToModelVersionAt", + "description": [], + "signature": [ + "string | undefined" + ], + "path": "packages/core/test-helpers/core-test-helpers-so-type-serializer/src/extract_migration_info.ts", + "deprecated": false, + "trackAdoption": false } ], "initialIsOpen": false diff --git a/api_docs/kbn_core_test_helpers_so_type_serializer.mdx b/api_docs/kbn_core_test_helpers_so_type_serializer.mdx index a5e87c444766d..b146eb5577bbc 100644 --- a/api_docs/kbn_core_test_helpers_so_type_serializer.mdx +++ b/api_docs/kbn_core_test_helpers_so_type_serializer.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-test-helpers-so-type-serializer title: "@kbn/core-test-helpers-so-type-serializer" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-test-helpers-so-type-serializer plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-test-helpers-so-type-serializer'] --- import kbnCoreTestHelpersSoTypeSerializerObj from './kbn_core_test_helpers_so_type_serializer.devdocs.json'; @@ -21,7 +21,7 @@ Contact Kibana Core for questions regarding this plugin. | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 13 | 0 | 12 | 0 | +| 15 | 0 | 14 | 1 | ## Common diff --git a/api_docs/kbn_core_test_helpers_test_utils.mdx b/api_docs/kbn_core_test_helpers_test_utils.mdx index a06a9084b18b1..26f135670b35e 100644 --- a/api_docs/kbn_core_test_helpers_test_utils.mdx +++ b/api_docs/kbn_core_test_helpers_test_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-test-helpers-test-utils title: "@kbn/core-test-helpers-test-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-test-helpers-test-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-test-helpers-test-utils'] --- import kbnCoreTestHelpersTestUtilsObj from './kbn_core_test_helpers_test_utils.devdocs.json'; diff --git a/api_docs/kbn_core_theme_browser.mdx b/api_docs/kbn_core_theme_browser.mdx index a8cd19ae434d3..10f574c4ae7cc 100644 --- a/api_docs/kbn_core_theme_browser.mdx +++ b/api_docs/kbn_core_theme_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-theme-browser title: "@kbn/core-theme-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-theme-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-theme-browser'] --- import kbnCoreThemeBrowserObj from './kbn_core_theme_browser.devdocs.json'; diff --git a/api_docs/kbn_core_theme_browser_internal.mdx b/api_docs/kbn_core_theme_browser_internal.mdx index d397fd1b9bc19..384afff458347 100644 --- a/api_docs/kbn_core_theme_browser_internal.mdx +++ b/api_docs/kbn_core_theme_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-theme-browser-internal title: "@kbn/core-theme-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-theme-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-theme-browser-internal'] --- import kbnCoreThemeBrowserInternalObj from './kbn_core_theme_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_theme_browser_mocks.mdx b/api_docs/kbn_core_theme_browser_mocks.mdx index 118532bd25a1a..82493b26f3074 100644 --- a/api_docs/kbn_core_theme_browser_mocks.mdx +++ b/api_docs/kbn_core_theme_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-theme-browser-mocks title: "@kbn/core-theme-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-theme-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-theme-browser-mocks'] --- import kbnCoreThemeBrowserMocksObj from './kbn_core_theme_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_ui_settings_browser.mdx b/api_docs/kbn_core_ui_settings_browser.mdx index 8f0ffccb27c9c..90367f863c499 100644 --- a/api_docs/kbn_core_ui_settings_browser.mdx +++ b/api_docs/kbn_core_ui_settings_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-ui-settings-browser title: "@kbn/core-ui-settings-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-ui-settings-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-ui-settings-browser'] --- import kbnCoreUiSettingsBrowserObj from './kbn_core_ui_settings_browser.devdocs.json'; diff --git a/api_docs/kbn_core_ui_settings_browser_internal.mdx b/api_docs/kbn_core_ui_settings_browser_internal.mdx index 91b5622bf35c5..c500702f66b1b 100644 --- a/api_docs/kbn_core_ui_settings_browser_internal.mdx +++ b/api_docs/kbn_core_ui_settings_browser_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-ui-settings-browser-internal title: "@kbn/core-ui-settings-browser-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-ui-settings-browser-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-ui-settings-browser-internal'] --- import kbnCoreUiSettingsBrowserInternalObj from './kbn_core_ui_settings_browser_internal.devdocs.json'; diff --git a/api_docs/kbn_core_ui_settings_browser_mocks.mdx b/api_docs/kbn_core_ui_settings_browser_mocks.mdx index c475e76a698ba..42bfe1d721920 100644 --- a/api_docs/kbn_core_ui_settings_browser_mocks.mdx +++ b/api_docs/kbn_core_ui_settings_browser_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-ui-settings-browser-mocks title: "@kbn/core-ui-settings-browser-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-ui-settings-browser-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-ui-settings-browser-mocks'] --- import kbnCoreUiSettingsBrowserMocksObj from './kbn_core_ui_settings_browser_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_ui_settings_common.mdx b/api_docs/kbn_core_ui_settings_common.mdx index 58816825f33fe..3610d8a24330b 100644 --- a/api_docs/kbn_core_ui_settings_common.mdx +++ b/api_docs/kbn_core_ui_settings_common.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-ui-settings-common title: "@kbn/core-ui-settings-common" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-ui-settings-common plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-ui-settings-common'] --- import kbnCoreUiSettingsCommonObj from './kbn_core_ui_settings_common.devdocs.json'; diff --git a/api_docs/kbn_core_ui_settings_server.mdx b/api_docs/kbn_core_ui_settings_server.mdx index 7159a34214e63..98143b14d96cb 100644 --- a/api_docs/kbn_core_ui_settings_server.mdx +++ b/api_docs/kbn_core_ui_settings_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-ui-settings-server title: "@kbn/core-ui-settings-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-ui-settings-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-ui-settings-server'] --- import kbnCoreUiSettingsServerObj from './kbn_core_ui_settings_server.devdocs.json'; diff --git a/api_docs/kbn_core_ui_settings_server_internal.mdx b/api_docs/kbn_core_ui_settings_server_internal.mdx index 9fea9dbb6b2d1..b8ee9132cd4ae 100644 --- a/api_docs/kbn_core_ui_settings_server_internal.mdx +++ b/api_docs/kbn_core_ui_settings_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-ui-settings-server-internal title: "@kbn/core-ui-settings-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-ui-settings-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-ui-settings-server-internal'] --- import kbnCoreUiSettingsServerInternalObj from './kbn_core_ui_settings_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_ui_settings_server_mocks.mdx b/api_docs/kbn_core_ui_settings_server_mocks.mdx index 98e0a21db126f..b0658255b66c6 100644 --- a/api_docs/kbn_core_ui_settings_server_mocks.mdx +++ b/api_docs/kbn_core_ui_settings_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-ui-settings-server-mocks title: "@kbn/core-ui-settings-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-ui-settings-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-ui-settings-server-mocks'] --- import kbnCoreUiSettingsServerMocksObj from './kbn_core_ui_settings_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_core_usage_data_server.mdx b/api_docs/kbn_core_usage_data_server.mdx index 8040f1bbb40a1..3e60641c257b6 100644 --- a/api_docs/kbn_core_usage_data_server.mdx +++ b/api_docs/kbn_core_usage_data_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-usage-data-server title: "@kbn/core-usage-data-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-usage-data-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-usage-data-server'] --- import kbnCoreUsageDataServerObj from './kbn_core_usage_data_server.devdocs.json'; diff --git a/api_docs/kbn_core_usage_data_server_internal.mdx b/api_docs/kbn_core_usage_data_server_internal.mdx index 7a8d46712ec62..635cc81f1f886 100644 --- a/api_docs/kbn_core_usage_data_server_internal.mdx +++ b/api_docs/kbn_core_usage_data_server_internal.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-usage-data-server-internal title: "@kbn/core-usage-data-server-internal" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-usage-data-server-internal plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-usage-data-server-internal'] --- import kbnCoreUsageDataServerInternalObj from './kbn_core_usage_data_server_internal.devdocs.json'; diff --git a/api_docs/kbn_core_usage_data_server_mocks.mdx b/api_docs/kbn_core_usage_data_server_mocks.mdx index 88b2724c6628b..31432f5fc2e65 100644 --- a/api_docs/kbn_core_usage_data_server_mocks.mdx +++ b/api_docs/kbn_core_usage_data_server_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-core-usage-data-server-mocks title: "@kbn/core-usage-data-server-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/core-usage-data-server-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/core-usage-data-server-mocks'] --- import kbnCoreUsageDataServerMocksObj from './kbn_core_usage_data_server_mocks.devdocs.json'; diff --git a/api_docs/kbn_crypto.mdx b/api_docs/kbn_crypto.mdx index 54cbf7b9c3128..e59119daef449 100644 --- a/api_docs/kbn_crypto.mdx +++ b/api_docs/kbn_crypto.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-crypto title: "@kbn/crypto" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/crypto plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/crypto'] --- import kbnCryptoObj from './kbn_crypto.devdocs.json'; diff --git a/api_docs/kbn_crypto_browser.mdx b/api_docs/kbn_crypto_browser.mdx index 7c46776abe985..615f9aadbeab8 100644 --- a/api_docs/kbn_crypto_browser.mdx +++ b/api_docs/kbn_crypto_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-crypto-browser title: "@kbn/crypto-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/crypto-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/crypto-browser'] --- import kbnCryptoBrowserObj from './kbn_crypto_browser.devdocs.json'; diff --git a/api_docs/kbn_cypress_config.mdx b/api_docs/kbn_cypress_config.mdx index 2dad325478146..6c04240b236d3 100644 --- a/api_docs/kbn_cypress_config.mdx +++ b/api_docs/kbn_cypress_config.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-cypress-config title: "@kbn/cypress-config" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/cypress-config plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/cypress-config'] --- import kbnCypressConfigObj from './kbn_cypress_config.devdocs.json'; diff --git a/api_docs/kbn_datemath.mdx b/api_docs/kbn_datemath.mdx index 5d30b54a0587e..0544d9edf8187 100644 --- a/api_docs/kbn_datemath.mdx +++ b/api_docs/kbn_datemath.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-datemath title: "@kbn/datemath" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/datemath plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/datemath'] --- import kbnDatemathObj from './kbn_datemath.devdocs.json'; diff --git a/api_docs/kbn_dev_cli_errors.mdx b/api_docs/kbn_dev_cli_errors.mdx index 560e2ae92467d..3a089f493ec5e 100644 --- a/api_docs/kbn_dev_cli_errors.mdx +++ b/api_docs/kbn_dev_cli_errors.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-dev-cli-errors title: "@kbn/dev-cli-errors" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/dev-cli-errors plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/dev-cli-errors'] --- import kbnDevCliErrorsObj from './kbn_dev_cli_errors.devdocs.json'; diff --git a/api_docs/kbn_dev_cli_runner.mdx b/api_docs/kbn_dev_cli_runner.mdx index 39204d4ac0b22..4947603b2f3ae 100644 --- a/api_docs/kbn_dev_cli_runner.mdx +++ b/api_docs/kbn_dev_cli_runner.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-dev-cli-runner title: "@kbn/dev-cli-runner" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/dev-cli-runner plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/dev-cli-runner'] --- import kbnDevCliRunnerObj from './kbn_dev_cli_runner.devdocs.json'; diff --git a/api_docs/kbn_dev_proc_runner.mdx b/api_docs/kbn_dev_proc_runner.mdx index 4769b3108a57b..b5376671b964e 100644 --- a/api_docs/kbn_dev_proc_runner.mdx +++ b/api_docs/kbn_dev_proc_runner.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-dev-proc-runner title: "@kbn/dev-proc-runner" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/dev-proc-runner plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/dev-proc-runner'] --- import kbnDevProcRunnerObj from './kbn_dev_proc_runner.devdocs.json'; diff --git a/api_docs/kbn_dev_utils.mdx b/api_docs/kbn_dev_utils.mdx index b0839412cd4d9..1f6cceed24ebf 100644 --- a/api_docs/kbn_dev_utils.mdx +++ b/api_docs/kbn_dev_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-dev-utils title: "@kbn/dev-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/dev-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/dev-utils'] --- import kbnDevUtilsObj from './kbn_dev_utils.devdocs.json'; diff --git a/api_docs/kbn_doc_links.devdocs.json b/api_docs/kbn_doc_links.devdocs.json index 7bdb77584718b..5c2b615b39011 100644 --- a/api_docs/kbn_doc_links.devdocs.json +++ b/api_docs/kbn_doc_links.devdocs.json @@ -398,7 +398,7 @@ "label": "aggs", "description": [], "signature": [ - "{ readonly composite: string; readonly composite_missing_bucket: string; readonly date_histogram: string; readonly date_range: string; readonly date_format_pattern: string; readonly filter: string; readonly filters: string; readonly geohash_grid: string; readonly histogram: string; readonly ip_range: string; readonly range: string; readonly significant_terms: string; readonly terms: string; readonly terms_doc_count_error: string; readonly rare_terms: string; readonly avg: string; readonly avg_bucket: string; readonly max_bucket: string; readonly min_bucket: string; readonly sum_bucket: string; readonly cardinality: string; readonly count: string; readonly cumulative_sum: string; readonly derivative: string; readonly geo_bounds: string; readonly geo_centroid: string; readonly max: string; readonly median: string; readonly min: string; readonly moving_avg: string; readonly percentile_ranks: string; readonly serial_diff: string; readonly std_dev: string; readonly sum: string; readonly top_hits: string; }" + "{ readonly composite: string; readonly composite_missing_bucket: string; readonly date_histogram: string; readonly date_range: string; readonly date_format_pattern: string; readonly filter: string; readonly filters: string; readonly geohash_grid: string; readonly histogram: string; readonly ip_range: string; readonly range: string; readonly significant_terms: string; readonly terms: string; readonly terms_doc_count_error: string; readonly rare_terms: string; readonly avg: string; readonly avg_bucket: string; readonly max_bucket: string; readonly min_bucket: string; readonly sum_bucket: string; readonly cardinality: string; readonly count: string; readonly cumulative_sum: string; readonly derivative: string; readonly geo_bounds: string; readonly geo_centroid: string; readonly max: string; readonly median: string; readonly min: string; readonly moving_avg: string; readonly percentile_ranks: string; readonly serial_diff: string; readonly std_dev: string; readonly sum: string; readonly top_hits: string; readonly change_point: string; }" ], "path": "packages/kbn-doc-links/src/types.ts", "deprecated": false, diff --git a/api_docs/kbn_doc_links.mdx b/api_docs/kbn_doc_links.mdx index bb9fbbee94fee..18676e953ebd3 100644 --- a/api_docs/kbn_doc_links.mdx +++ b/api_docs/kbn_doc_links.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-doc-links title: "@kbn/doc-links" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/doc-links plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/doc-links'] --- import kbnDocLinksObj from './kbn_doc_links.devdocs.json'; diff --git a/api_docs/kbn_docs_utils.mdx b/api_docs/kbn_docs_utils.mdx index b217ba24d780b..aae474232c77e 100644 --- a/api_docs/kbn_docs_utils.mdx +++ b/api_docs/kbn_docs_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-docs-utils title: "@kbn/docs-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/docs-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/docs-utils'] --- import kbnDocsUtilsObj from './kbn_docs_utils.devdocs.json'; diff --git a/api_docs/kbn_ebt_tools.mdx b/api_docs/kbn_ebt_tools.mdx index 9ae9f63865031..2fbb9b87425b9 100644 --- a/api_docs/kbn_ebt_tools.mdx +++ b/api_docs/kbn_ebt_tools.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ebt-tools title: "@kbn/ebt-tools" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ebt-tools plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ebt-tools'] --- import kbnEbtToolsObj from './kbn_ebt_tools.devdocs.json'; diff --git a/api_docs/kbn_ecs.mdx b/api_docs/kbn_ecs.mdx index 0f385928af215..5058d0d699ab7 100644 --- a/api_docs/kbn_ecs.mdx +++ b/api_docs/kbn_ecs.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ecs title: "@kbn/ecs" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ecs plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ecs'] --- import kbnEcsObj from './kbn_ecs.devdocs.json'; diff --git a/api_docs/kbn_ecs_data_quality_dashboard.mdx b/api_docs/kbn_ecs_data_quality_dashboard.mdx index 527468ce299d5..b959f93de3d3a 100644 --- a/api_docs/kbn_ecs_data_quality_dashboard.mdx +++ b/api_docs/kbn_ecs_data_quality_dashboard.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ecs-data-quality-dashboard title: "@kbn/ecs-data-quality-dashboard" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ecs-data-quality-dashboard plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ecs-data-quality-dashboard'] --- import kbnEcsDataQualityDashboardObj from './kbn_ecs_data_quality_dashboard.devdocs.json'; diff --git a/api_docs/kbn_es.mdx b/api_docs/kbn_es.mdx index 4ecc3ffd100eb..de1dc993dba64 100644 --- a/api_docs/kbn_es.mdx +++ b/api_docs/kbn_es.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-es title: "@kbn/es" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/es plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/es'] --- import kbnEsObj from './kbn_es.devdocs.json'; diff --git a/api_docs/kbn_es_archiver.mdx b/api_docs/kbn_es_archiver.mdx index e75dac18dd5ed..83ccb0b73cf91 100644 --- a/api_docs/kbn_es_archiver.mdx +++ b/api_docs/kbn_es_archiver.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-es-archiver title: "@kbn/es-archiver" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/es-archiver plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/es-archiver'] --- import kbnEsArchiverObj from './kbn_es_archiver.devdocs.json'; diff --git a/api_docs/kbn_es_errors.mdx b/api_docs/kbn_es_errors.mdx index cb48293350234..5e52db6c43404 100644 --- a/api_docs/kbn_es_errors.mdx +++ b/api_docs/kbn_es_errors.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-es-errors title: "@kbn/es-errors" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/es-errors plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/es-errors'] --- import kbnEsErrorsObj from './kbn_es_errors.devdocs.json'; diff --git a/api_docs/kbn_es_query.mdx b/api_docs/kbn_es_query.mdx index 5a4c847cc29e9..51b09726d5ced 100644 --- a/api_docs/kbn_es_query.mdx +++ b/api_docs/kbn_es_query.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-es-query title: "@kbn/es-query" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/es-query plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/es-query'] --- import kbnEsQueryObj from './kbn_es_query.devdocs.json'; diff --git a/api_docs/kbn_es_types.mdx b/api_docs/kbn_es_types.mdx index dc66020dc884e..1bc7b7380e390 100644 --- a/api_docs/kbn_es_types.mdx +++ b/api_docs/kbn_es_types.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-es-types title: "@kbn/es-types" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/es-types plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/es-types'] --- import kbnEsTypesObj from './kbn_es_types.devdocs.json'; diff --git a/api_docs/kbn_eslint_plugin_imports.mdx b/api_docs/kbn_eslint_plugin_imports.mdx index e5c350063e150..e39c81260da9c 100644 --- a/api_docs/kbn_eslint_plugin_imports.mdx +++ b/api_docs/kbn_eslint_plugin_imports.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-eslint-plugin-imports title: "@kbn/eslint-plugin-imports" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/eslint-plugin-imports plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/eslint-plugin-imports'] --- import kbnEslintPluginImportsObj from './kbn_eslint_plugin_imports.devdocs.json'; diff --git a/api_docs/kbn_field_types.mdx b/api_docs/kbn_field_types.mdx index ca6213c81e380..2667fcce6c1d9 100644 --- a/api_docs/kbn_field_types.mdx +++ b/api_docs/kbn_field_types.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-field-types title: "@kbn/field-types" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/field-types plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/field-types'] --- import kbnFieldTypesObj from './kbn_field_types.devdocs.json'; diff --git a/api_docs/kbn_find_used_node_modules.mdx b/api_docs/kbn_find_used_node_modules.mdx index 7b9d7a56bcd77..5211d59ed0e15 100644 --- a/api_docs/kbn_find_used_node_modules.mdx +++ b/api_docs/kbn_find_used_node_modules.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-find-used-node-modules title: "@kbn/find-used-node-modules" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/find-used-node-modules plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/find-used-node-modules'] --- import kbnFindUsedNodeModulesObj from './kbn_find_used_node_modules.devdocs.json'; diff --git a/api_docs/kbn_ftr_common_functional_services.mdx b/api_docs/kbn_ftr_common_functional_services.mdx index 95e49b66ce1fc..edb9ebe7f1ce0 100644 --- a/api_docs/kbn_ftr_common_functional_services.mdx +++ b/api_docs/kbn_ftr_common_functional_services.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ftr-common-functional-services title: "@kbn/ftr-common-functional-services" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ftr-common-functional-services plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ftr-common-functional-services'] --- import kbnFtrCommonFunctionalServicesObj from './kbn_ftr_common_functional_services.devdocs.json'; diff --git a/api_docs/kbn_generate.mdx b/api_docs/kbn_generate.mdx index b37050dc7dfa8..8946a109f08ef 100644 --- a/api_docs/kbn_generate.mdx +++ b/api_docs/kbn_generate.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-generate title: "@kbn/generate" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/generate plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/generate'] --- import kbnGenerateObj from './kbn_generate.devdocs.json'; diff --git a/api_docs/kbn_get_repo_files.mdx b/api_docs/kbn_get_repo_files.mdx index 3e18fd3dabc7e..958daed209096 100644 --- a/api_docs/kbn_get_repo_files.mdx +++ b/api_docs/kbn_get_repo_files.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-get-repo-files title: "@kbn/get-repo-files" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/get-repo-files plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/get-repo-files'] --- import kbnGetRepoFilesObj from './kbn_get_repo_files.devdocs.json'; diff --git a/api_docs/kbn_guided_onboarding.mdx b/api_docs/kbn_guided_onboarding.mdx index 3ad32ba17077c..2f7ebd1c99470 100644 --- a/api_docs/kbn_guided_onboarding.mdx +++ b/api_docs/kbn_guided_onboarding.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-guided-onboarding title: "@kbn/guided-onboarding" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/guided-onboarding plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/guided-onboarding'] --- import kbnGuidedOnboardingObj from './kbn_guided_onboarding.devdocs.json'; diff --git a/api_docs/kbn_handlebars.devdocs.json b/api_docs/kbn_handlebars.devdocs.json index 7136c0d8fdbba..d3edc8759dbe3 100644 --- a/api_docs/kbn_handlebars.devdocs.json +++ b/api_docs/kbn_handlebars.devdocs.json @@ -18,189 +18,10 @@ }, "common": { "classes": [], - "functions": [ - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.create", - "type": "Function", - "tags": [], - "label": "create", - "description": [ - "\nCreates an isolated Handlebars environment.\n\nEach environment has its own helpers.\nThis is only necessary for use cases that demand distinct helpers.\nMost use cases can use the root Handlebars environment directly.\n" - ], - "signature": [ - "() => typeof ", - "node_modules/handlebars/types/index.d.ts" - ], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false, - "children": [], - "returnComment": [ - "A sandboxed/scoped version of the" - ], - "initialIsOpen": false - } - ], - "interfaces": [ - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.DecoratorOptions", - "type": "Interface", - "tags": [], - "label": "DecoratorOptions", - "description": [], - "signature": [ - { - "pluginId": "@kbn/handlebars", - "scope": "common", - "docId": "kibKbnHandlebarsPluginApi", - "section": "def-common.DecoratorOptions", - "text": "DecoratorOptions" - }, - " extends Omit<", - "HelperOptions", - ", \"lookupProperties\">" - ], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false, - "children": [ - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.DecoratorOptions.args", - "type": "Array", - "tags": [], - "label": "args", - "description": [], - "signature": [ - "any[] | undefined" - ], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false - } - ], - "initialIsOpen": false - }, - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.DecoratorsHash", - "type": "Interface", - "tags": [], - "label": "DecoratorsHash", - "description": [], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false, - "children": [ - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.DecoratorsHash.Unnamed", - "type": "IndexSignature", - "tags": [], - "label": "[name: string]: DecoratorFunction", - "description": [], - "signature": [ - "[name: string]: ", - { - "pluginId": "@kbn/handlebars", - "scope": "common", - "docId": "kibKbnHandlebarsPluginApi", - "section": "def-common.DecoratorFunction", - "text": "DecoratorFunction" - } - ], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false - } - ], - "initialIsOpen": false - }, - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.HelpersHash", - "type": "Interface", - "tags": [], - "label": "HelpersHash", - "description": [], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false, - "children": [ - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.HelpersHash.Unnamed", - "type": "IndexSignature", - "tags": [], - "label": "[name: string]: HelperDelegate", - "description": [], - "signature": [ - "[name: string]: ", - "HelperDelegate" - ], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false - } - ], - "initialIsOpen": false - }, - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.PartialsHash", - "type": "Interface", - "tags": [], - "label": "PartialsHash", - "description": [], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false, - "children": [ - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.PartialsHash.Unnamed", - "type": "IndexSignature", - "tags": [], - "label": "[name: string]: HandlebarsTemplateDelegate", - "description": [], - "signature": [ - "[name: string]: HandlebarsTemplateDelegate" - ], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false - } - ], - "initialIsOpen": false - } - ], + "functions": [], + "interfaces": [], "enums": [], "misc": [ - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.AmbiguousHelperOptions", - "type": "Type", - "tags": [], - "label": "AmbiguousHelperOptions", - "description": [], - "signature": [ - "HelperOptions", - " | ", - { - "pluginId": "@kbn/handlebars", - "scope": "common", - "docId": "kibKbnHandlebarsPluginApi", - "section": "def-common.NonBlockHelperOptions", - "text": "NonBlockHelperOptions" - } - ], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false, - "initialIsOpen": false - }, { "parentPluginId": "@kbn/handlebars", "id": "def-common.compileFnName", @@ -230,9 +51,11 @@ "signature": [ "(prog: ", "TemplateDelegate", - ", props: Record, container: Container, options: any) => any" + ", props: Record, container: ", + "Container", + ", options: any) => any" ], - "path": "packages/kbn-handlebars/index.ts", + "path": "packages/kbn-handlebars/src/types.ts", "deprecated": false, "trackAdoption": false, "returnComment": [], @@ -248,7 +71,7 @@ "TemplateDelegate", "" ], - "path": "packages/kbn-handlebars/index.ts", + "path": "packages/kbn-handlebars/src/types.ts", "deprecated": false, "trackAdoption": false }, @@ -262,7 +85,7 @@ "signature": [ "{ [x: string]: any; }" ], - "path": "packages/kbn-handlebars/index.ts", + "path": "packages/kbn-handlebars/src/types.ts", "deprecated": false, "trackAdoption": false }, @@ -276,7 +99,7 @@ "signature": [ "Container" ], - "path": "packages/kbn-handlebars/index.ts", + "path": "packages/kbn-handlebars/src/types.ts", "deprecated": false, "trackAdoption": false }, @@ -290,7 +113,7 @@ "signature": [ "any" ], - "path": "packages/kbn-handlebars/index.ts", + "path": "packages/kbn-handlebars/src/types.ts", "deprecated": false, "trackAdoption": false } @@ -309,7 +132,7 @@ "signature": [ "{ data?: boolean | undefined; strict?: boolean | undefined; knownHelpers?: KnownHelpers | undefined; knownHelpersOnly?: boolean | undefined; noEscape?: boolean | undefined; assumeObjects?: boolean | undefined; preventIndent?: boolean | undefined; explicitPartialContext?: boolean | undefined; }" ], - "path": "packages/kbn-handlebars/index.ts", + "path": "packages/kbn-handlebars/src/types.ts", "deprecated": false, "trackAdoption": false, "initialIsOpen": false @@ -326,22 +149,7 @@ "signature": [ "{ data?: any; helpers?: { [name: string]: Function; } | undefined; partials?: { [name: string]: HandlebarsTemplateDelegate; } | undefined; decorators?: { [name: string]: Function; } | undefined; blockParams?: any[] | undefined; }" ], - "path": "packages/kbn-handlebars/index.ts", - "deprecated": false, - "trackAdoption": false, - "initialIsOpen": false - }, - { - "parentPluginId": "@kbn/handlebars", - "id": "def-common.NonBlockHelperOptions", - "type": "Type", - "tags": [], - "label": "NonBlockHelperOptions", - "description": [], - "signature": [ - "{ name: string; data?: any; hash: any; loc: { start: hbs.AST.Position; end: hbs.AST.Position; }; lookupProperty: LookupProperty; }" - ], - "path": "packages/kbn-handlebars/index.ts", + "path": "packages/kbn-handlebars/src/types.ts", "deprecated": false, "trackAdoption": false, "initialIsOpen": false @@ -361,7 +169,7 @@ "typeof ", "node_modules/handlebars/types/index.d.ts" ], - "path": "packages/kbn-handlebars/index.ts", + "path": "packages/kbn-handlebars/src/types.ts", "deprecated": false, "trackAdoption": false, "initialIsOpen": false diff --git a/api_docs/kbn_handlebars.mdx b/api_docs/kbn_handlebars.mdx index 158c60596c1d5..f8c58f04f6db8 100644 --- a/api_docs/kbn_handlebars.mdx +++ b/api_docs/kbn_handlebars.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-handlebars title: "@kbn/handlebars" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/handlebars plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/handlebars'] --- import kbnHandlebarsObj from './kbn_handlebars.devdocs.json'; @@ -21,19 +21,13 @@ Contact [Owner missing] for questions regarding this plugin. | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 21 | 1 | 14 | 0 | +| 10 | 1 | 4 | 1 | ## Common ### Objects -### Functions - - -### Interfaces - - ### Consts, variables and types diff --git a/api_docs/kbn_hapi_mocks.mdx b/api_docs/kbn_hapi_mocks.mdx index a2f8c6c95fde7..c66c96ad011c2 100644 --- a/api_docs/kbn_hapi_mocks.mdx +++ b/api_docs/kbn_hapi_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-hapi-mocks title: "@kbn/hapi-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/hapi-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/hapi-mocks'] --- import kbnHapiMocksObj from './kbn_hapi_mocks.devdocs.json'; diff --git a/api_docs/kbn_health_gateway_server.mdx b/api_docs/kbn_health_gateway_server.mdx index 4327ab9588121..2bc9c0508211f 100644 --- a/api_docs/kbn_health_gateway_server.mdx +++ b/api_docs/kbn_health_gateway_server.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-health-gateway-server title: "@kbn/health-gateway-server" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/health-gateway-server plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/health-gateway-server'] --- import kbnHealthGatewayServerObj from './kbn_health_gateway_server.devdocs.json'; diff --git a/api_docs/kbn_home_sample_data_card.mdx b/api_docs/kbn_home_sample_data_card.mdx index 2a833b8f08d08..e7c6a45663900 100644 --- a/api_docs/kbn_home_sample_data_card.mdx +++ b/api_docs/kbn_home_sample_data_card.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-home-sample-data-card title: "@kbn/home-sample-data-card" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/home-sample-data-card plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/home-sample-data-card'] --- import kbnHomeSampleDataCardObj from './kbn_home_sample_data_card.devdocs.json'; diff --git a/api_docs/kbn_home_sample_data_tab.mdx b/api_docs/kbn_home_sample_data_tab.mdx index 1f5da1d622c5b..63e21688ef709 100644 --- a/api_docs/kbn_home_sample_data_tab.mdx +++ b/api_docs/kbn_home_sample_data_tab.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-home-sample-data-tab title: "@kbn/home-sample-data-tab" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/home-sample-data-tab plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/home-sample-data-tab'] --- import kbnHomeSampleDataTabObj from './kbn_home_sample_data_tab.devdocs.json'; diff --git a/api_docs/kbn_i18n.mdx b/api_docs/kbn_i18n.mdx index 8893927e1e0d9..8cd02148d237e 100644 --- a/api_docs/kbn_i18n.mdx +++ b/api_docs/kbn_i18n.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-i18n title: "@kbn/i18n" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/i18n plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/i18n'] --- import kbnI18nObj from './kbn_i18n.devdocs.json'; diff --git a/api_docs/kbn_i18n_react.mdx b/api_docs/kbn_i18n_react.mdx index 808d0020d6066..e9821a162593f 100644 --- a/api_docs/kbn_i18n_react.mdx +++ b/api_docs/kbn_i18n_react.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-i18n-react title: "@kbn/i18n-react" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/i18n-react plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/i18n-react'] --- import kbnI18nReactObj from './kbn_i18n_react.devdocs.json'; diff --git a/api_docs/kbn_import_resolver.mdx b/api_docs/kbn_import_resolver.mdx index 6abed10054cc2..a0ce56db33dc6 100644 --- a/api_docs/kbn_import_resolver.mdx +++ b/api_docs/kbn_import_resolver.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-import-resolver title: "@kbn/import-resolver" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/import-resolver plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/import-resolver'] --- import kbnImportResolverObj from './kbn_import_resolver.devdocs.json'; diff --git a/api_docs/kbn_interpreter.mdx b/api_docs/kbn_interpreter.mdx index 0274e4c8fc0d8..a2dd8cef6ad27 100644 --- a/api_docs/kbn_interpreter.mdx +++ b/api_docs/kbn_interpreter.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-interpreter title: "@kbn/interpreter" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/interpreter plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/interpreter'] --- import kbnInterpreterObj from './kbn_interpreter.devdocs.json'; diff --git a/api_docs/kbn_io_ts_utils.mdx b/api_docs/kbn_io_ts_utils.mdx index a63fdf66043cc..5982dfe196071 100644 --- a/api_docs/kbn_io_ts_utils.mdx +++ b/api_docs/kbn_io_ts_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-io-ts-utils title: "@kbn/io-ts-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/io-ts-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/io-ts-utils'] --- import kbnIoTsUtilsObj from './kbn_io_ts_utils.devdocs.json'; diff --git a/api_docs/kbn_jest_serializers.mdx b/api_docs/kbn_jest_serializers.mdx index 06ec7740a70be..39247278e6b3d 100644 --- a/api_docs/kbn_jest_serializers.mdx +++ b/api_docs/kbn_jest_serializers.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-jest-serializers title: "@kbn/jest-serializers" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/jest-serializers plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/jest-serializers'] --- import kbnJestSerializersObj from './kbn_jest_serializers.devdocs.json'; diff --git a/api_docs/kbn_journeys.mdx b/api_docs/kbn_journeys.mdx index 2d3bf270d4e04..bbfd294a03d06 100644 --- a/api_docs/kbn_journeys.mdx +++ b/api_docs/kbn_journeys.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-journeys title: "@kbn/journeys" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/journeys plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/journeys'] --- import kbnJourneysObj from './kbn_journeys.devdocs.json'; diff --git a/api_docs/kbn_json_ast.mdx b/api_docs/kbn_json_ast.mdx index 53b66596abe06..8ff203b3f108f 100644 --- a/api_docs/kbn_json_ast.mdx +++ b/api_docs/kbn_json_ast.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-json-ast title: "@kbn/json-ast" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/json-ast plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/json-ast'] --- import kbnJsonAstObj from './kbn_json_ast.devdocs.json'; diff --git a/api_docs/kbn_kibana_manifest_schema.mdx b/api_docs/kbn_kibana_manifest_schema.mdx index 40e9af3dd0942..6bd575022a626 100644 --- a/api_docs/kbn_kibana_manifest_schema.mdx +++ b/api_docs/kbn_kibana_manifest_schema.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-kibana-manifest-schema title: "@kbn/kibana-manifest-schema" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/kibana-manifest-schema plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/kibana-manifest-schema'] --- import kbnKibanaManifestSchemaObj from './kbn_kibana_manifest_schema.devdocs.json'; diff --git a/api_docs/kbn_language_documentation_popover.mdx b/api_docs/kbn_language_documentation_popover.mdx index 4f17f96800d1b..21ced2a72f06e 100644 --- a/api_docs/kbn_language_documentation_popover.mdx +++ b/api_docs/kbn_language_documentation_popover.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-language-documentation-popover title: "@kbn/language-documentation-popover" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/language-documentation-popover plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/language-documentation-popover'] --- import kbnLanguageDocumentationPopoverObj from './kbn_language_documentation_popover.devdocs.json'; diff --git a/api_docs/kbn_logging.mdx b/api_docs/kbn_logging.mdx index 5235b83bc90ac..d1ce2f1c57e48 100644 --- a/api_docs/kbn_logging.mdx +++ b/api_docs/kbn_logging.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-logging title: "@kbn/logging" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/logging plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/logging'] --- import kbnLoggingObj from './kbn_logging.devdocs.json'; diff --git a/api_docs/kbn_logging_mocks.mdx b/api_docs/kbn_logging_mocks.mdx index f08b27876fcbe..502ac16e3e17c 100644 --- a/api_docs/kbn_logging_mocks.mdx +++ b/api_docs/kbn_logging_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-logging-mocks title: "@kbn/logging-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/logging-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/logging-mocks'] --- import kbnLoggingMocksObj from './kbn_logging_mocks.devdocs.json'; diff --git a/api_docs/kbn_managed_vscode_config.mdx b/api_docs/kbn_managed_vscode_config.mdx index 1ef83c71f603b..39eca8890c670 100644 --- a/api_docs/kbn_managed_vscode_config.mdx +++ b/api_docs/kbn_managed_vscode_config.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-managed-vscode-config title: "@kbn/managed-vscode-config" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/managed-vscode-config plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/managed-vscode-config'] --- import kbnManagedVscodeConfigObj from './kbn_managed_vscode_config.devdocs.json'; diff --git a/api_docs/kbn_mapbox_gl.mdx b/api_docs/kbn_mapbox_gl.mdx index 14965886a3e6e..dc067eec0906b 100644 --- a/api_docs/kbn_mapbox_gl.mdx +++ b/api_docs/kbn_mapbox_gl.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-mapbox-gl title: "@kbn/mapbox-gl" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/mapbox-gl plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/mapbox-gl'] --- import kbnMapboxGlObj from './kbn_mapbox_gl.devdocs.json'; diff --git a/api_docs/kbn_ml_agg_utils.mdx b/api_docs/kbn_ml_agg_utils.mdx index c40a53ad05568..a864e918ad789 100644 --- a/api_docs/kbn_ml_agg_utils.mdx +++ b/api_docs/kbn_ml_agg_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ml-agg-utils title: "@kbn/ml-agg-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ml-agg-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ml-agg-utils'] --- import kbnMlAggUtilsObj from './kbn_ml_agg_utils.devdocs.json'; diff --git a/api_docs/kbn_ml_date_picker.devdocs.json b/api_docs/kbn_ml_date_picker.devdocs.json index e50bbe5efc0a0..53d6b048fdbcb 100644 --- a/api_docs/kbn_ml_date_picker.devdocs.json +++ b/api_docs/kbn_ml_date_picker.devdocs.json @@ -234,6 +234,33 @@ ], "initialIsOpen": false }, + { + "parentPluginId": "@kbn/ml-date-picker", + "id": "def-common.useRefresh", + "type": "Function", + "tags": [], + "label": "useRefresh", + "description": [ + "\nProvides the latest refresh, both manual or auto." + ], + "signature": [ + "() => ", + { + "pluginId": "@kbn/ml-date-picker", + "scope": "common", + "docId": "kibKbnMlDatePickerPluginApi", + "section": "def-common.Refresh", + "text": "Refresh" + }, + " | undefined" + ], + "path": "x-pack/packages/ml/date_picker/src/hooks/use_timefilter.ts", + "deprecated": false, + "trackAdoption": false, + "children": [], + "returnComment": [], + "initialIsOpen": false + }, { "parentPluginId": "@kbn/ml-date-picker", "id": "def-common.useRefreshIntervalUpdates", diff --git a/api_docs/kbn_ml_date_picker.mdx b/api_docs/kbn_ml_date_picker.mdx index 4a3ebca5864dd..916da1a9c29e4 100644 --- a/api_docs/kbn_ml_date_picker.mdx +++ b/api_docs/kbn_ml_date_picker.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ml-date-picker title: "@kbn/ml-date-picker" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ml-date-picker plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ml-date-picker'] --- import kbnMlDatePickerObj from './kbn_ml_date_picker.devdocs.json'; @@ -21,7 +21,7 @@ Contact [Owner missing] for questions regarding this plugin. | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 49 | 0 | 4 | 0 | +| 50 | 0 | 4 | 0 | ## Common diff --git a/api_docs/kbn_ml_is_defined.mdx b/api_docs/kbn_ml_is_defined.mdx index 9669b49177e5e..7fa5360a5c451 100644 --- a/api_docs/kbn_ml_is_defined.mdx +++ b/api_docs/kbn_ml_is_defined.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ml-is-defined title: "@kbn/ml-is-defined" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ml-is-defined plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ml-is-defined'] --- import kbnMlIsDefinedObj from './kbn_ml_is_defined.devdocs.json'; diff --git a/api_docs/kbn_ml_is_populated_object.mdx b/api_docs/kbn_ml_is_populated_object.mdx index dfe7bf6280cb3..9433f9f616e7b 100644 --- a/api_docs/kbn_ml_is_populated_object.mdx +++ b/api_docs/kbn_ml_is_populated_object.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ml-is-populated-object title: "@kbn/ml-is-populated-object" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ml-is-populated-object plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ml-is-populated-object'] --- import kbnMlIsPopulatedObjectObj from './kbn_ml_is_populated_object.devdocs.json'; diff --git a/api_docs/kbn_ml_local_storage.mdx b/api_docs/kbn_ml_local_storage.mdx index 299ca53741106..b8e3e252851ba 100644 --- a/api_docs/kbn_ml_local_storage.mdx +++ b/api_docs/kbn_ml_local_storage.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ml-local-storage title: "@kbn/ml-local-storage" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ml-local-storage plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ml-local-storage'] --- import kbnMlLocalStorageObj from './kbn_ml_local_storage.devdocs.json'; diff --git a/api_docs/kbn_ml_nested_property.mdx b/api_docs/kbn_ml_nested_property.mdx index 9d52c5879194f..9dba1efc923d1 100644 --- a/api_docs/kbn_ml_nested_property.mdx +++ b/api_docs/kbn_ml_nested_property.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ml-nested-property title: "@kbn/ml-nested-property" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ml-nested-property plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ml-nested-property'] --- import kbnMlNestedPropertyObj from './kbn_ml_nested_property.devdocs.json'; diff --git a/api_docs/kbn_ml_query_utils.mdx b/api_docs/kbn_ml_query_utils.mdx index a529d972ab9aa..4c3b9362af006 100644 --- a/api_docs/kbn_ml_query_utils.mdx +++ b/api_docs/kbn_ml_query_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ml-query-utils title: "@kbn/ml-query-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ml-query-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ml-query-utils'] --- import kbnMlQueryUtilsObj from './kbn_ml_query_utils.devdocs.json'; diff --git a/api_docs/kbn_ml_string_hash.mdx b/api_docs/kbn_ml_string_hash.mdx index f183462e4a98b..6b978e1ec3aa9 100644 --- a/api_docs/kbn_ml_string_hash.mdx +++ b/api_docs/kbn_ml_string_hash.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ml-string-hash title: "@kbn/ml-string-hash" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ml-string-hash plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ml-string-hash'] --- import kbnMlStringHashObj from './kbn_ml_string_hash.devdocs.json'; diff --git a/api_docs/kbn_ml_url_state.mdx b/api_docs/kbn_ml_url_state.mdx index e5c1fc22380f7..f22f6640f9b8d 100644 --- a/api_docs/kbn_ml_url_state.mdx +++ b/api_docs/kbn_ml_url_state.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ml-url-state title: "@kbn/ml-url-state" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ml-url-state plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ml-url-state'] --- import kbnMlUrlStateObj from './kbn_ml_url_state.devdocs.json'; diff --git a/api_docs/kbn_monaco.mdx b/api_docs/kbn_monaco.mdx index 481afd6c398b1..fe48c552db063 100644 --- a/api_docs/kbn_monaco.mdx +++ b/api_docs/kbn_monaco.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-monaco title: "@kbn/monaco" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/monaco plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/monaco'] --- import kbnMonacoObj from './kbn_monaco.devdocs.json'; diff --git a/api_docs/kbn_optimizer.mdx b/api_docs/kbn_optimizer.mdx index 2ca82258c2e62..157fba5b113c3 100644 --- a/api_docs/kbn_optimizer.mdx +++ b/api_docs/kbn_optimizer.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-optimizer title: "@kbn/optimizer" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/optimizer plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/optimizer'] --- import kbnOptimizerObj from './kbn_optimizer.devdocs.json'; diff --git a/api_docs/kbn_optimizer_webpack_helpers.mdx b/api_docs/kbn_optimizer_webpack_helpers.mdx index 36428b40abbab..5b39ddb812a8d 100644 --- a/api_docs/kbn_optimizer_webpack_helpers.mdx +++ b/api_docs/kbn_optimizer_webpack_helpers.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-optimizer-webpack-helpers title: "@kbn/optimizer-webpack-helpers" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/optimizer-webpack-helpers plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/optimizer-webpack-helpers'] --- import kbnOptimizerWebpackHelpersObj from './kbn_optimizer_webpack_helpers.devdocs.json'; diff --git a/api_docs/kbn_osquery_io_ts_types.mdx b/api_docs/kbn_osquery_io_ts_types.mdx index 7f9edf9420173..d7fc9e0aa989e 100644 --- a/api_docs/kbn_osquery_io_ts_types.mdx +++ b/api_docs/kbn_osquery_io_ts_types.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-osquery-io-ts-types title: "@kbn/osquery-io-ts-types" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/osquery-io-ts-types plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/osquery-io-ts-types'] --- import kbnOsqueryIoTsTypesObj from './kbn_osquery_io_ts_types.devdocs.json'; diff --git a/api_docs/kbn_performance_testing_dataset_extractor.mdx b/api_docs/kbn_performance_testing_dataset_extractor.mdx index 6992d7584228b..ae9ec0da0563c 100644 --- a/api_docs/kbn_performance_testing_dataset_extractor.mdx +++ b/api_docs/kbn_performance_testing_dataset_extractor.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-performance-testing-dataset-extractor title: "@kbn/performance-testing-dataset-extractor" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/performance-testing-dataset-extractor plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/performance-testing-dataset-extractor'] --- import kbnPerformanceTestingDatasetExtractorObj from './kbn_performance_testing_dataset_extractor.devdocs.json'; diff --git a/api_docs/kbn_plugin_generator.mdx b/api_docs/kbn_plugin_generator.mdx index f55faae505430..0a1e1a1fc3034 100644 --- a/api_docs/kbn_plugin_generator.mdx +++ b/api_docs/kbn_plugin_generator.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-plugin-generator title: "@kbn/plugin-generator" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/plugin-generator plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/plugin-generator'] --- import kbnPluginGeneratorObj from './kbn_plugin_generator.devdocs.json'; diff --git a/api_docs/kbn_plugin_helpers.mdx b/api_docs/kbn_plugin_helpers.mdx index fcb46b33ef383..5eaabe15b12c0 100644 --- a/api_docs/kbn_plugin_helpers.mdx +++ b/api_docs/kbn_plugin_helpers.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-plugin-helpers title: "@kbn/plugin-helpers" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/plugin-helpers plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/plugin-helpers'] --- import kbnPluginHelpersObj from './kbn_plugin_helpers.devdocs.json'; diff --git a/api_docs/kbn_react_field.mdx b/api_docs/kbn_react_field.mdx index 9797c96594f31..720de9e2cebdc 100644 --- a/api_docs/kbn_react_field.mdx +++ b/api_docs/kbn_react_field.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-react-field title: "@kbn/react-field" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/react-field plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/react-field'] --- import kbnReactFieldObj from './kbn_react_field.devdocs.json'; diff --git a/api_docs/kbn_repo_file_maps.mdx b/api_docs/kbn_repo_file_maps.mdx index b4b8e854ab7f7..a2d4dbadb6df0 100644 --- a/api_docs/kbn_repo_file_maps.mdx +++ b/api_docs/kbn_repo_file_maps.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-repo-file-maps title: "@kbn/repo-file-maps" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/repo-file-maps plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/repo-file-maps'] --- import kbnRepoFileMapsObj from './kbn_repo_file_maps.devdocs.json'; diff --git a/api_docs/kbn_repo_linter.mdx b/api_docs/kbn_repo_linter.mdx index 6d9d4bd31633f..d8b41a4a84944 100644 --- a/api_docs/kbn_repo_linter.mdx +++ b/api_docs/kbn_repo_linter.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-repo-linter title: "@kbn/repo-linter" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/repo-linter plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/repo-linter'] --- import kbnRepoLinterObj from './kbn_repo_linter.devdocs.json'; diff --git a/api_docs/kbn_repo_path.mdx b/api_docs/kbn_repo_path.mdx index 20a7f7e792f7d..2a4440cf0651f 100644 --- a/api_docs/kbn_repo_path.mdx +++ b/api_docs/kbn_repo_path.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-repo-path title: "@kbn/repo-path" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/repo-path plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/repo-path'] --- import kbnRepoPathObj from './kbn_repo_path.devdocs.json'; diff --git a/api_docs/kbn_repo_source_classifier.mdx b/api_docs/kbn_repo_source_classifier.mdx index 62c5b1327bfed..2fd30a14e9412 100644 --- a/api_docs/kbn_repo_source_classifier.mdx +++ b/api_docs/kbn_repo_source_classifier.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-repo-source-classifier title: "@kbn/repo-source-classifier" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/repo-source-classifier plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/repo-source-classifier'] --- import kbnRepoSourceClassifierObj from './kbn_repo_source_classifier.devdocs.json'; diff --git a/api_docs/kbn_rison.mdx b/api_docs/kbn_rison.mdx index 6d9a81f63c935..a8276f3dce124 100644 --- a/api_docs/kbn_rison.mdx +++ b/api_docs/kbn_rison.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-rison title: "@kbn/rison" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/rison plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/rison'] --- import kbnRisonObj from './kbn_rison.devdocs.json'; diff --git a/api_docs/kbn_rule_data_utils.mdx b/api_docs/kbn_rule_data_utils.mdx index 9b1a46ae7fbb4..fb177a8c1370b 100644 --- a/api_docs/kbn_rule_data_utils.mdx +++ b/api_docs/kbn_rule_data_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-rule-data-utils title: "@kbn/rule-data-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/rule-data-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/rule-data-utils'] --- import kbnRuleDataUtilsObj from './kbn_rule_data_utils.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_autocomplete.mdx b/api_docs/kbn_securitysolution_autocomplete.mdx index 52cd9fca3742e..c3a27e0cd07bb 100644 --- a/api_docs/kbn_securitysolution_autocomplete.mdx +++ b/api_docs/kbn_securitysolution_autocomplete.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-autocomplete title: "@kbn/securitysolution-autocomplete" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-autocomplete plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-autocomplete'] --- import kbnSecuritysolutionAutocompleteObj from './kbn_securitysolution_autocomplete.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_ecs.mdx b/api_docs/kbn_securitysolution_ecs.mdx index 3cf533ae5676a..d3b9ed5dc3320 100644 --- a/api_docs/kbn_securitysolution_ecs.mdx +++ b/api_docs/kbn_securitysolution_ecs.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-ecs title: "@kbn/securitysolution-ecs" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-ecs plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-ecs'] --- import kbnSecuritysolutionEcsObj from './kbn_securitysolution_ecs.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_es_utils.mdx b/api_docs/kbn_securitysolution_es_utils.mdx index 2ec7d76728d08..fde1cd53fcb60 100644 --- a/api_docs/kbn_securitysolution_es_utils.mdx +++ b/api_docs/kbn_securitysolution_es_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-es-utils title: "@kbn/securitysolution-es-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-es-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-es-utils'] --- import kbnSecuritysolutionEsUtilsObj from './kbn_securitysolution_es_utils.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_exception_list_components.devdocs.json b/api_docs/kbn_securitysolution_exception_list_components.devdocs.json index c798c33780ef8..ac133f4bb5cda 100644 --- a/api_docs/kbn_securitysolution_exception_list_components.devdocs.json +++ b/api_docs/kbn_securitysolution_exception_list_components.devdocs.json @@ -721,7 +721,7 @@ "label": "item", "description": [], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" ], "path": "packages/kbn-securitysolution-exception-list-components/src/exception_item_card/header/index.tsx", "deprecated": false, @@ -788,7 +788,7 @@ "label": "item", "description": [], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" ], "path": "packages/kbn-securitysolution-exception-list-components/src/exception_item_card/meta/index.tsx", "deprecated": false, @@ -904,7 +904,7 @@ "label": "exceptionItem", "description": [], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" ], "path": "packages/kbn-securitysolution-exception-list-components/src/exception_item_card/exception_item_card.tsx", "deprecated": false, @@ -1095,7 +1095,7 @@ "label": "onEditException", "description": [], "signature": [ - "(item: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => void" + "(item: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => void" ], "path": "packages/kbn-securitysolution-exception-list-components/src/exception_item_card/exception_item_card.tsx", "deprecated": false, @@ -1109,7 +1109,7 @@ "label": "item", "description": [], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" ], "path": "packages/kbn-securitysolution-exception-list-components/src/exception_item_card/exception_item_card.tsx", "deprecated": false, diff --git a/api_docs/kbn_securitysolution_exception_list_components.mdx b/api_docs/kbn_securitysolution_exception_list_components.mdx index bae06c5a982fa..7eabfe249b136 100644 --- a/api_docs/kbn_securitysolution_exception_list_components.mdx +++ b/api_docs/kbn_securitysolution_exception_list_components.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-exception-list-components title: "@kbn/securitysolution-exception-list-components" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-exception-list-components plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-exception-list-components'] --- import kbnSecuritysolutionExceptionListComponentsObj from './kbn_securitysolution_exception_list_components.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_hook_utils.mdx b/api_docs/kbn_securitysolution_hook_utils.mdx index d2cb1e09271b4..6bf6e2f225458 100644 --- a/api_docs/kbn_securitysolution_hook_utils.mdx +++ b/api_docs/kbn_securitysolution_hook_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-hook-utils title: "@kbn/securitysolution-hook-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-hook-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-hook-utils'] --- import kbnSecuritysolutionHookUtilsObj from './kbn_securitysolution_hook_utils.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_io_ts_alerting_types.mdx b/api_docs/kbn_securitysolution_io_ts_alerting_types.mdx index ddcf822de96fd..f888f3c7759fc 100644 --- a/api_docs/kbn_securitysolution_io_ts_alerting_types.mdx +++ b/api_docs/kbn_securitysolution_io_ts_alerting_types.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-io-ts-alerting-types title: "@kbn/securitysolution-io-ts-alerting-types" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-io-ts-alerting-types plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-io-ts-alerting-types'] --- import kbnSecuritysolutionIoTsAlertingTypesObj from './kbn_securitysolution_io_ts_alerting_types.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_io_ts_list_types.devdocs.json b/api_docs/kbn_securitysolution_io_ts_list_types.devdocs.json index 9bcbaf8108ab8..e0f7d8909b79b 100644 --- a/api_docs/kbn_securitysolution_io_ts_list_types.devdocs.json +++ b/api_docs/kbn_securitysolution_io_ts_list_types.devdocs.json @@ -27,7 +27,7 @@ "label": "updateExceptionListItemValidate", "description": [], "signature": [ - "(schema: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) => string[]" + "(schema: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) => string[]" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/update_exception_list_item_validation/index.ts", "deprecated": false, @@ -41,7 +41,7 @@ "label": "schema", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/update_exception_list_item_validation/index.ts", "deprecated": false, @@ -60,7 +60,7 @@ "label": "validateComments", "description": [], "signature": [ - "(item: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) => string[]" + "(item: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) => string[]" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/update_exception_list_item_validation/index.ts", "deprecated": false, @@ -74,7 +74,7 @@ "label": "item", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/update_exception_list_item_validation/index.ts", "deprecated": false, @@ -162,7 +162,7 @@ "label": "listItem", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/typescript_types/index.ts", "deprecated": false, @@ -718,7 +718,7 @@ "label": "exceptions", "description": [], "signature": [ - "({ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }))[]" + "({ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }))[]" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/typescript_types/index.ts", "deprecated": false, @@ -1037,6 +1037,17 @@ "deprecated": false, "trackAdoption": false }, + { + "parentPluginId": "@kbn/securitysolution-io-ts-list-types", + "id": "def-common.ApiListExportProps.includeExpiredExceptions", + "type": "boolean", + "tags": [], + "label": "includeExpiredExceptions", + "description": [], + "path": "packages/kbn-securitysolution-io-ts-list-types/src/typescript_types/index.ts", + "deprecated": false, + "trackAdoption": false + }, { "parentPluginId": "@kbn/securitysolution-io-ts-list-types", "id": "def-common.ApiListExportProps.listId", @@ -1424,6 +1435,17 @@ "deprecated": false, "trackAdoption": false }, + { + "parentPluginId": "@kbn/securitysolution-io-ts-list-types", + "id": "def-common.ExportExceptionListProps.includeExpiredExceptions", + "type": "boolean", + "tags": [], + "label": "includeExpiredExceptions", + "description": [], + "path": "packages/kbn-securitysolution-io-ts-list-types/src/typescript_types/index.ts", + "deprecated": false, + "trackAdoption": false + }, { "parentPluginId": "@kbn/securitysolution-io-ts-list-types", "id": "def-common.ExportExceptionListProps.signal", @@ -1589,7 +1611,7 @@ "label": "exceptions", "description": [], "signature": [ - "({ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }))[]" + "({ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }))[]" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/typescript_types/index.ts", "deprecated": false, @@ -1847,7 +1869,7 @@ "label": "listItem", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/typescript_types/index.ts", "deprecated": false, @@ -1945,7 +1967,7 @@ "label": "exceptions", "description": [], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/typescript_types/index.ts", "deprecated": false, @@ -2602,7 +2624,7 @@ "label": "CreateEndpointListItemSchema", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"included\"; type: \"wildcard\"; value: string; } | { entries: ({ field: string; operator: \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"included\"; type: \"match_any\"; value: string[]; })[]; field: string; type: \"nested\"; })[]; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"included\"; type: \"wildcard\"; value: string; } | { entries: ({ field: string; operator: \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"included\"; type: \"match_any\"; value: string[]; })[]; field: string; type: \"nested\"; })[]; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; expire_time?: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/create_endpoint_list_item_schema/index.ts", "deprecated": false, @@ -2617,7 +2639,7 @@ "label": "CreateEndpointListItemSchemaDecoded", "description": [], "signature": [ - "Omit<{ description: string; entries: ({ field: string; operator: \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"included\"; type: \"wildcard\"; value: string; } | { entries: ({ field: string; operator: \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"included\"; type: \"match_any\"; value: string[]; })[]; field: string; type: \"nested\"; })[]; name: string; type: \"simple\"; comments: { comment: string; }[] | undefined; item_id: string | undefined; meta: object | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"item_id\" | \"os_types\"> & { comments: { comment: string; }[]; tags: string[]; item_id: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; os_types: (\"windows\" | \"linux\" | \"macos\")[]; }" + "Omit<{ description: string; entries: ({ field: string; operator: \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"included\"; type: \"wildcard\"; value: string; } | { entries: ({ field: string; operator: \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"included\"; type: \"match_any\"; value: string[]; })[]; field: string; type: \"nested\"; })[]; name: string; type: \"simple\"; comments: { comment: string; }[] | undefined; item_id: string | undefined; meta: object | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; expire_time: string | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"expire_time\" | \"item_id\" | \"os_types\"> & { comments: { comment: string; }[]; tags: string[]; item_id: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; os_types: (\"windows\" | \"linux\" | \"macos\")[]; expire_time: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/create_endpoint_list_item_schema/index.ts", "deprecated": false, @@ -2647,7 +2669,7 @@ "label": "CreateExceptionListItemSchema", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/create_exception_list_item_schema/index.ts", "deprecated": false, @@ -2662,7 +2684,7 @@ "label": "CreateExceptionListItemSchemaDecoded", "description": [], "signature": [ - "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; comments: { comment: string; }[] | undefined; item_id: string | undefined; meta: object | undefined; namespace_type: \"single\" | \"agnostic\" | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"item_id\" | \"namespace_type\"> & { comments: { comment: string; }[]; tags: string[]; item_id: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; }" + "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; comments: { comment: string; }[] | undefined; expire_time: string | undefined; item_id: string | undefined; meta: object | undefined; namespace_type: \"single\" | \"agnostic\" | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"expire_time\" | \"item_id\" | \"namespace_type\"> & { comments: { comment: string; }[]; expire_time: string | undefined; tags: string[]; item_id: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/create_exception_list_item_schema/index.ts", "deprecated": false, @@ -2767,7 +2789,7 @@ "label": "CreateRuleExceptionListItemSchema", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; list_id?: undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; list_id?: undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; expire_time?: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/create_rule_exception_item_schema/index.ts", "deprecated": false, @@ -2782,7 +2804,7 @@ "label": "CreateRuleExceptionListItemSchemaDecoded", "description": [], "signature": [ - "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; comments: { comment: string; }[] | undefined; item_id: string | undefined; list_id: undefined; meta: object | undefined; namespace_type: \"single\" | \"agnostic\" | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"item_id\" | \"namespace_type\"> & { comments: { comment: string; }[]; tags: string[]; item_id: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; }" + "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; comments: { comment: string; }[] | undefined; item_id: string | undefined; list_id: undefined; meta: object | undefined; namespace_type: \"single\" | \"agnostic\" | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; expire_time: string | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"expire_time\" | \"item_id\" | \"namespace_type\"> & { comments: { comment: string; }[]; tags: string[]; item_id: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; expire_time: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/create_rule_exception_item_schema/index.ts", "deprecated": false, @@ -3247,7 +3269,7 @@ "label": "ExceptionListItemSchema", "description": [], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/response/exception_list_item_schema/index.ts", "deprecated": false, @@ -3344,6 +3366,21 @@ "trackAdoption": false, "initialIsOpen": false }, + { + "parentPluginId": "@kbn/securitysolution-io-ts-list-types", + "id": "def-common.ExpireTimeOrUndefined", + "type": "Type", + "tags": [], + "label": "ExpireTimeOrUndefined", + "description": [], + "signature": [ + "string | undefined" + ], + "path": "packages/kbn-securitysolution-io-ts-list-types/src/common/expire_time/index.ts", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, { "parentPluginId": "@kbn/securitysolution-io-ts-list-types", "id": "def-common.ExportExceptionDetails", @@ -3367,7 +3404,7 @@ "label": "ExportExceptionListQuerySchema", "description": [], "signature": [ - "{ id: string; list_id: string; namespace_type: \"single\" | \"agnostic\" | undefined; }" + "{ id: string; list_id: string; namespace_type: \"single\" | \"agnostic\" | undefined; include_expired_exceptions: \"false\" | \"true\" | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/export_exception_list_query_schema/index.ts", "deprecated": false, @@ -3607,7 +3644,7 @@ "label": "FoundExceptionListItemSchema", "description": [], "signature": [ - "{ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }" + "{ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/response/found_exception_list_item_schema/index.ts", "deprecated": false, @@ -3682,7 +3719,7 @@ "label": "GetExceptionFilterSchema", "description": [], "signature": [ - "({ exception_list_ids: { exception_list_id: string; namespace_type: \"single\" | \"agnostic\"; }[]; type: \"exception_list_ids\"; } | { exceptions: ({ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }))[]; type: \"exception_items\"; }) & { alias?: string | undefined; chunk_size?: number | undefined; exclude_exceptions?: boolean | undefined; }" + "({ exception_list_ids: { exception_list_id: string; namespace_type: \"single\" | \"agnostic\"; }[]; type: \"exception_list_ids\"; } | { exceptions: ({ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }))[]; type: \"exception_items\"; }) & { alias?: string | undefined; chunk_size?: number | undefined; exclude_exceptions?: boolean | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/get_exception_filter_schema/index.ts", "deprecated": false, @@ -3802,7 +3839,7 @@ "label": "ImportExceptionListItemSchema", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; item_id: string; list_id: string; name: string; type: \"simple\"; } & { id?: string | undefined; comments?: (({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; }) | { comment: string; })[] | undefined; created_at?: string | undefined; updated_at?: string | undefined; created_by?: string | undefined; updated_by?: string | undefined; _version?: string | undefined; tie_breaker_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; item_id: string; list_id: string; name: string; type: \"simple\"; } & { id?: string | undefined; comments?: (({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; }) | { comment: string; })[] | undefined; created_at?: string | undefined; updated_at?: string | undefined; created_by?: string | undefined; updated_by?: string | undefined; _version?: string | undefined; tie_breaker_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; expire_time?: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/import_exception_item_schema/index.ts", "deprecated": false, @@ -3817,7 +3854,7 @@ "label": "ImportExceptionListItemSchemaDecoded", "description": [], "signature": [ - "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; item_id: string; list_id: string; name: string; type: \"simple\"; } & { id?: string | undefined; comments?: (({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; }) | { comment: string; })[] | undefined; created_at?: string | undefined; updated_at?: string | undefined; created_by?: string | undefined; updated_by?: string | undefined; _version?: string | undefined; tie_breaker_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"item_id\" | \"namespace_type\"> & { comments: (({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; }) | { comment: string; })[]; tags: string[]; item_id: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; }" + "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; item_id: string; list_id: string; name: string; type: \"simple\"; } & { id?: string | undefined; comments?: (({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; }) | { comment: string; })[] | undefined; created_at?: string | undefined; updated_at?: string | undefined; created_by?: string | undefined; updated_by?: string | undefined; _version?: string | undefined; tie_breaker_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; expire_time?: string | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"expire_time\" | \"item_id\" | \"namespace_type\"> & { comments: (({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; }) | { comment: string; })[]; tags: string[]; item_id: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; expire_time: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/import_exception_item_schema/index.ts", "deprecated": false, @@ -5077,7 +5114,7 @@ "label": "UpdateEndpointListItemSchema", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; expire_time?: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/update_endpoint_list_item_schema/index.ts", "deprecated": false, @@ -5092,7 +5129,7 @@ "label": "UpdateEndpointListItemSchemaDecoded", "description": [], "signature": [ - "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; _version: string | undefined; comments: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id: string | undefined; item_id: string | undefined; meta: object | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; }, \"tags\" | \"entries\" | \"comments\"> & { comments: ({ comment: string; } & { id?: string | undefined; })[]; tags: string[]; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; os_types: (\"windows\" | \"linux\" | \"macos\")[]; }" + "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; _version: string | undefined; comments: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id: string | undefined; item_id: string | undefined; meta: object | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; expire_time: string | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"expire_time\"> & { comments: ({ comment: string; } & { id?: string | undefined; })[]; tags: string[]; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; os_types: (\"windows\" | \"linux\" | \"macos\")[]; expire_time: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/update_endpoint_list_item_schema/index.ts", "deprecated": false, @@ -5107,7 +5144,7 @@ "label": "UpdateExceptionListItemSchema", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/update_exception_list_item_schema/index.ts", "deprecated": false, @@ -5122,7 +5159,7 @@ "label": "UpdateExceptionListItemSchemaDecoded", "description": [], "signature": [ - "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; _version: string | undefined; comments: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id: string | undefined; item_id: string | undefined; meta: object | undefined; namespace_type: \"single\" | \"agnostic\" | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"namespace_type\" | \"os_types\"> & { comments: ({ comment: string; } & { id?: string | undefined; })[]; tags: string[]; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; }" + "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; _version: string | undefined; comments: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time: string | undefined; id: string | undefined; item_id: string | undefined; meta: object | undefined; namespace_type: \"single\" | \"agnostic\" | undefined; os_types: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags: string[] | undefined; }, \"tags\" | \"entries\" | \"comments\" | \"expire_time\" | \"namespace_type\" | \"os_types\"> & { comments: ({ comment: string; } & { id?: string | undefined; })[]; tags: string[]; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; expire_time: string | undefined; }" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/update_exception_list_item_schema/index.ts", "deprecated": false, @@ -5587,7 +5624,13 @@ "UndefinedC", "]>; tags: ", "Type", - "; }>>]>" + "; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; }>>]>" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/create_endpoint_list_item_schema/index.ts", "deprecated": false, @@ -5689,7 +5732,13 @@ "PartialC", "<{ comments: ", "Type", - "<{ comment: string; }[], { comment: string; }[], unknown>; item_id: ", + "<{ comment: string; }[], { comment: string; }[], unknown>; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; item_id: ", "Type", "; meta: ", "ObjectC", @@ -5871,7 +5920,13 @@ "UndefinedC", "]>; tags: ", "Type", - "; }>>]>" + "; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; }>>]>" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/create_rule_exception_item_schema/index.ts", "deprecated": false, @@ -6890,7 +6945,13 @@ "KeyofC", "<{ wildcard: null; }>; value: ", "Type", - "; }>>]>>; id: ", + "; }>>]>>; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; id: ", "Type", "; item_id: ", "Type", @@ -7214,7 +7275,13 @@ "KeyofC", "<{ wildcard: null; }>; value: ", "Type", - "; }>>]>>; id: ", + "; }>>]>>; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; id: ", "Type", "; item_id: ", "Type", @@ -7264,7 +7331,13 @@ "PartialC", "<{ comments: ", "Type", - "<{ comment: string; }[], { comment: string; }[], unknown>; item_id: ", + "<{ comment: string; }[], { comment: string; }[], unknown>; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; item_id: ", "Type", "; meta: ", "ObjectC", @@ -7287,6 +7360,42 @@ "trackAdoption": false, "initialIsOpen": false }, + { + "parentPluginId": "@kbn/securitysolution-io-ts-list-types", + "id": "def-common.expireTime", + "type": "Object", + "tags": [], + "label": "expireTime", + "description": [], + "signature": [ + "Type", + "" + ], + "path": "packages/kbn-securitysolution-io-ts-list-types/src/common/expire_time/index.ts", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, + { + "parentPluginId": "@kbn/securitysolution-io-ts-list-types", + "id": "def-common.expireTimeOrUndefined", + "type": "Object", + "tags": [], + "label": "expireTimeOrUndefined", + "description": [], + "signature": [ + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>" + ], + "path": "packages/kbn-securitysolution-io-ts-list-types/src/common/expire_time/index.ts", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, { "parentPluginId": "@kbn/securitysolution-io-ts-list-types", "id": "def-common.exportExceptionDetails", @@ -7458,7 +7567,13 @@ "Type", "; namespace_type: ", "Type", - "<\"single\" | \"agnostic\", \"single\" | \"agnostic\" | undefined, unknown>; }>>" + "<\"single\" | \"agnostic\", \"single\" | \"agnostic\" | undefined, unknown>; include_expired_exceptions: ", + "UnionC", + "<[", + "KeyofC", + "<{ true: null; false: null; }>, ", + "UndefinedC", + "]>; }>>" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/export_exception_list_query_schema/index.ts", "deprecated": false, @@ -7947,7 +8062,13 @@ "KeyofC", "<{ wildcard: null; }>; value: ", "Type", - "; }>>]>>; id: ", + "; }>>]>>; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; id: ", "Type", "; item_id: ", "Type", @@ -8483,7 +8604,13 @@ "KeyofC", "<{ wildcard: null; }>; value: ", "Type", - "; }>>]>>; id: ", + "; }>>]>>; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; id: ", "Type", "; item_id: ", "Type", @@ -8533,7 +8660,13 @@ "PartialC", "<{ comments: ", "Type", - "<{ comment: string; }[], { comment: string; }[], unknown>; item_id: ", + "<{ comment: string; }[], { comment: string; }[], unknown>; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; item_id: ", "Type", "; meta: ", "ObjectC", @@ -8848,7 +8981,13 @@ "UndefinedC", "]>; tags: ", "Type", - "; }>>]>" + "; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; }>>]>" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/import_exception_item_schema/index.ts", "deprecated": false, @@ -10888,7 +11027,13 @@ "UndefinedC", "]>; tags: ", "Type", - "; }>>]>" + "; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; }>>]>" ], "path": "packages/kbn-securitysolution-io-ts-list-types/src/request/update_endpoint_list_item_schema/index.ts", "deprecated": false, @@ -10924,7 +11069,13 @@ "StringC", "; comments: ", "Type", - "<({ comment: string; } & { id?: string | undefined; })[], ({ comment: string; } & { id?: string | undefined; })[], unknown>; id: ", + "<({ comment: string; } & { id?: string | undefined; })[], ({ comment: string; } & { id?: string | undefined; })[], unknown>; expire_time: ", + "UnionC", + "<[", + "Type", + ", ", + "UndefinedC", + "]>; id: ", "Type", "; item_id: ", "UnionC", diff --git a/api_docs/kbn_securitysolution_io_ts_list_types.mdx b/api_docs/kbn_securitysolution_io_ts_list_types.mdx index 87c025c2d59ea..0a6d48191c77c 100644 --- a/api_docs/kbn_securitysolution_io_ts_list_types.mdx +++ b/api_docs/kbn_securitysolution_io_ts_list_types.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-io-ts-list-types title: "@kbn/securitysolution-io-ts-list-types" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-io-ts-list-types plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-io-ts-list-types'] --- import kbnSecuritysolutionIoTsListTypesObj from './kbn_securitysolution_io_ts_list_types.devdocs.json'; @@ -21,7 +21,7 @@ Contact [Owner missing] for questions regarding this plugin. | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 511 | 1 | 498 | 0 | +| 516 | 1 | 503 | 0 | ## Common diff --git a/api_docs/kbn_securitysolution_io_ts_types.mdx b/api_docs/kbn_securitysolution_io_ts_types.mdx index dcec40a90dd20..20f250b74f1ce 100644 --- a/api_docs/kbn_securitysolution_io_ts_types.mdx +++ b/api_docs/kbn_securitysolution_io_ts_types.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-io-ts-types title: "@kbn/securitysolution-io-ts-types" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-io-ts-types plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-io-ts-types'] --- import kbnSecuritysolutionIoTsTypesObj from './kbn_securitysolution_io_ts_types.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_io_ts_utils.mdx b/api_docs/kbn_securitysolution_io_ts_utils.mdx index 5e447a827e7d4..05b26d868ca70 100644 --- a/api_docs/kbn_securitysolution_io_ts_utils.mdx +++ b/api_docs/kbn_securitysolution_io_ts_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-io-ts-utils title: "@kbn/securitysolution-io-ts-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-io-ts-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-io-ts-utils'] --- import kbnSecuritysolutionIoTsUtilsObj from './kbn_securitysolution_io_ts_utils.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_list_api.devdocs.json b/api_docs/kbn_securitysolution_list_api.devdocs.json index cd8334e742dda..06ea8141f8bf8 100644 --- a/api_docs/kbn_securitysolution_list_api.devdocs.json +++ b/api_docs/kbn_securitysolution_list_api.devdocs.json @@ -82,7 +82,7 @@ "section": "def-common.AddExceptionListItemProps", "text": "AddExceptionListItemProps" }, - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" ], "path": "packages/kbn-securitysolution-list-api/src/api/index.ts", "deprecated": false, @@ -270,7 +270,7 @@ "section": "def-common.ApiCallByIdProps", "text": "ApiCallByIdProps" }, - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" ], "path": "packages/kbn-securitysolution-list-api/src/api/index.ts", "deprecated": false, @@ -357,10 +357,10 @@ ], "label": "exportExceptionList", "description": [ - "\nFetch an ExceptionList by providing a ExceptionList ID\n" + "\nExport an ExceptionList by providing a ExceptionList ID\n" ], "signature": [ - "({ http, id, listId, namespaceType, signal, }: ", + "({ http, id, includeExpiredExceptions, listId, namespaceType, signal, }: ", { "pluginId": "@kbn/securitysolution-io-ts-list-types", "scope": "common", @@ -379,7 +379,7 @@ "id": "def-common.exportExceptionList.$1", "type": "Object", "tags": [], - "label": "{\n http,\n id,\n listId,\n namespaceType,\n signal,\n}", + "label": "{\n http,\n id,\n includeExpiredExceptions,\n listId,\n namespaceType,\n signal,\n}", "description": [], "signature": [ { @@ -509,7 +509,7 @@ "section": "def-common.ApiCallByIdProps", "text": "ApiCallByIdProps" }, - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" ], "path": "packages/kbn-securitysolution-list-api/src/api/index.ts", "deprecated": false, @@ -556,7 +556,7 @@ "section": "def-common.ApiCallByListIdProps", "text": "ApiCallByListIdProps" }, - ") => Promise<{ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }>" + ") => Promise<{ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }>" ], "path": "packages/kbn-securitysolution-list-api/src/api/index.ts", "deprecated": false, @@ -1072,7 +1072,7 @@ "section": "def-common.UpdateExceptionListItemProps", "text": "UpdateExceptionListItemProps" }, - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" ], "path": "packages/kbn-securitysolution-list-api/src/api/index.ts", "deprecated": false, diff --git a/api_docs/kbn_securitysolution_list_api.mdx b/api_docs/kbn_securitysolution_list_api.mdx index 634ddd56b3b60..04608accb4089 100644 --- a/api_docs/kbn_securitysolution_list_api.mdx +++ b/api_docs/kbn_securitysolution_list_api.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-list-api title: "@kbn/securitysolution-list-api" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-list-api plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-list-api'] --- import kbnSecuritysolutionListApiObj from './kbn_securitysolution_list_api.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_list_constants.mdx b/api_docs/kbn_securitysolution_list_constants.mdx index cdb41f0ccd69a..d7eb2f840a04c 100644 --- a/api_docs/kbn_securitysolution_list_constants.mdx +++ b/api_docs/kbn_securitysolution_list_constants.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-list-constants title: "@kbn/securitysolution-list-constants" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-list-constants plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-list-constants'] --- import kbnSecuritysolutionListConstantsObj from './kbn_securitysolution_list_constants.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_list_hooks.devdocs.json b/api_docs/kbn_securitysolution_list_hooks.devdocs.json index befcfaaecfb13..17612ab74ada0 100644 --- a/api_docs/kbn_securitysolution_list_hooks.devdocs.json +++ b/api_docs/kbn_securitysolution_list_hooks.devdocs.json @@ -29,7 +29,7 @@ "\nThis adds an id to the incoming exception item entries as ReactJS prefers to have\nan id added to them for use as a stable id. Later if we decide to change the data\nmodel to have id's within the array then this code should be removed. If not, then\nthis code should stay as an adapter for ReactJS.\n\nThis does break the type system slightly as we are lying a bit to the type system as we return\nthe same exceptionItem as we have previously but are augmenting the arrays with an id which TypeScript\ndoesn't mind us doing here. However, downstream you will notice that you have an id when the type\ndoes not indicate it. In that case use (ExceptionItem & { id: string }) temporarily if you're using the id. If you're not,\nyou can ignore the id and just use the normal TypeScript with ReactJS.\n" ], "signature": [ - "(exceptionItem: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" + "(exceptionItem: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -45,7 +45,7 @@ "The exceptionItem to add an id to the threat matches." ], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -68,7 +68,7 @@ "\nThis removes createdAt, createdBy from the exceptionItem if a comment was added to\nthe Exception item, and return the comment message with id to prevent creating the commet\ntwice" ], "signature": [ - "(exceptionItem: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })) => { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "(exceptionItem: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })) => { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -84,7 +84,7 @@ "The exceptionItem to remove createdAt, createdBy from the comments array." ], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -146,7 +146,7 @@ "\nTransforms the output of rules to compensate for technical debt or UI concerns such as\nReactJS preferences for having ids within arrays if the data is not modeled that way.\n\nIf you add a new transform of the input called \"myNewTransform\" do it\nin the form of:\nflow(addIdToExceptionItemEntries, myNewTransform)(exceptionItem)\n" ], "signature": [ - "(exceptionItem: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" + "(exceptionItem: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -162,7 +162,7 @@ "The exceptionItem to transform the output of" ], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -183,7 +183,7 @@ "label": "transformNewItemOutput", "description": [], "signature": [ - "(exceptionItem: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) => { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "(exceptionItem: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) => { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -197,7 +197,7 @@ "label": "exceptionItem", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -218,7 +218,7 @@ "\nTransforms the output of exception items to compensate for technical debt or UI concerns such as\nReactJS preferences for having ids within arrays if the data is not modeled that way.\n\nIf you add a new transform of the output called \"myNewTransform\" do it\nin the form of:\nflow(removeIdFromExceptionItemsEntries, myNewTransform)(exceptionItem)\n" ], "signature": [ - "(exceptionItem: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })) => { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })" + "(exceptionItem: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })) => { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -234,7 +234,7 @@ "The exceptionItem to transform the output of" ], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })" ], "path": "packages/kbn-securitysolution-list-hooks/src/transforms/index.ts", "deprecated": false, @@ -851,7 +851,7 @@ "label": "addExceptionListItem", "description": [], "signature": [ - "(arg: { listItem: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }; }) => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" + "(arg: { listItem: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }; }) => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" ], "path": "packages/kbn-securitysolution-list-hooks/src/use_api/index.ts", "deprecated": false, @@ -876,7 +876,7 @@ "label": "listItem", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/use_api/index.ts", "deprecated": false, @@ -895,7 +895,7 @@ "label": "updateExceptionListItem", "description": [], "signature": [ - "(arg: { listItem: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }; }) => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" + "(arg: { listItem: { description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }; }) => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" ], "path": "packages/kbn-securitysolution-list-hooks/src/use_api/index.ts", "deprecated": false, @@ -920,7 +920,7 @@ "label": "listItem", "description": [], "signature": [ - "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" + "{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/use_api/index.ts", "deprecated": false, @@ -1039,7 +1039,7 @@ "section": "def-common.ApiCallMemoProps", "text": "ApiCallMemoProps" }, - " & { onSuccess: (arg: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => void; }) => Promise" + " & { onSuccess: (arg: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => void; }) => Promise" ], "path": "packages/kbn-securitysolution-list-hooks/src/use_api/index.ts", "deprecated": false, @@ -1060,7 +1060,7 @@ "section": "def-common.ApiCallMemoProps", "text": "ApiCallMemoProps" }, - " & { onSuccess: (arg: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => void; }" + " & { onSuccess: (arg: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }) => void; }" ], "path": "packages/kbn-securitysolution-list-hooks/src/use_api/index.ts", "deprecated": false, @@ -1423,7 +1423,7 @@ "label": "ReturnPersistExceptionItem", "description": [], "signature": [ - "[PersistReturnExceptionItem, React.Dispatch<({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) | null>]" + "[PersistReturnExceptionItem, React.Dispatch<({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { _version?: string | undefined; comments?: ({ comment: string; } & { id?: string | undefined; })[] | undefined; expire_time?: string | undefined; id?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) | null>]" ], "path": "packages/kbn-securitysolution-list-hooks/src/use_persist_exception_item/index.ts", "deprecated": false, diff --git a/api_docs/kbn_securitysolution_list_hooks.mdx b/api_docs/kbn_securitysolution_list_hooks.mdx index 4710c86dc94f9..167947b91524a 100644 --- a/api_docs/kbn_securitysolution_list_hooks.mdx +++ b/api_docs/kbn_securitysolution_list_hooks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-list-hooks title: "@kbn/securitysolution-list-hooks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-list-hooks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-list-hooks'] --- import kbnSecuritysolutionListHooksObj from './kbn_securitysolution_list_hooks.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_list_utils.devdocs.json b/api_docs/kbn_securitysolution_list_utils.devdocs.json index c986b7d4d909f..742d5ec178963 100644 --- a/api_docs/kbn_securitysolution_list_utils.devdocs.json +++ b/api_docs/kbn_securitysolution_list_utils.devdocs.json @@ -52,6 +52,102 @@ "returnComment": [], "initialIsOpen": false }, + { + "parentPluginId": "@kbn/securitysolution-list-utils", + "id": "def-common.buildShowActiveExceptionsFilter", + "type": "Function", + "tags": [], + "label": "buildShowActiveExceptionsFilter", + "description": [], + "signature": [ + "(savedObjectPrefix: ", + { + "pluginId": "@kbn/securitysolution-list-utils", + "scope": "common", + "docId": "kibKbnSecuritysolutionListUtilsPluginApi", + "section": "def-common.SavedObjectType", + "text": "SavedObjectType" + }, + "[]) => string" + ], + "path": "packages/kbn-securitysolution-list-utils/src/helpers/index.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "@kbn/securitysolution-list-utils", + "id": "def-common.buildShowActiveExceptionsFilter.$1", + "type": "Array", + "tags": [], + "label": "savedObjectPrefix", + "description": [], + "signature": [ + { + "pluginId": "@kbn/securitysolution-list-utils", + "scope": "common", + "docId": "kibKbnSecuritysolutionListUtilsPluginApi", + "section": "def-common.SavedObjectType", + "text": "SavedObjectType" + }, + "[]" + ], + "path": "packages/kbn-securitysolution-list-utils/src/helpers/index.ts", + "deprecated": false, + "trackAdoption": false, + "isRequired": true + } + ], + "returnComment": [], + "initialIsOpen": false + }, + { + "parentPluginId": "@kbn/securitysolution-list-utils", + "id": "def-common.buildShowExpiredExceptionsFilter", + "type": "Function", + "tags": [], + "label": "buildShowExpiredExceptionsFilter", + "description": [], + "signature": [ + "(savedObjectPrefix: ", + { + "pluginId": "@kbn/securitysolution-list-utils", + "scope": "common", + "docId": "kibKbnSecuritysolutionListUtilsPluginApi", + "section": "def-common.SavedObjectType", + "text": "SavedObjectType" + }, + "[]) => string" + ], + "path": "packages/kbn-securitysolution-list-utils/src/helpers/index.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "@kbn/securitysolution-list-utils", + "id": "def-common.buildShowExpiredExceptionsFilter.$1", + "type": "Array", + "tags": [], + "label": "savedObjectPrefix", + "description": [], + "signature": [ + { + "pluginId": "@kbn/securitysolution-list-utils", + "scope": "common", + "docId": "kibKbnSecuritysolutionListUtilsPluginApi", + "section": "def-common.SavedObjectType", + "text": "SavedObjectType" + }, + "[]" + ], + "path": "packages/kbn-securitysolution-list-utils/src/helpers/index.ts", + "deprecated": false, + "trackAdoption": false, + "isRequired": true + } + ], + "returnComment": [], + "initialIsOpen": false + }, { "parentPluginId": "@kbn/securitysolution-list-utils", "id": "def-common.containsValueListEntry", @@ -2996,7 +3092,7 @@ "label": "CreateExceptionListItemBuilderSchema", "description": [], "signature": [ - "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }, \"entries\" | \"meta\" | \"list_id\" | \"namespace_type\"> & { meta: { temporaryUuid: string; }; entries: ", + "Omit<{ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }, \"entries\" | \"meta\" | \"list_id\" | \"namespace_type\"> & { meta: { temporaryUuid: string; }; entries: ", { "pluginId": "@kbn/securitysolution-list-utils", "scope": "common", @@ -3122,7 +3218,7 @@ "label": "ExceptionListItemBuilderSchema", "description": [], "signature": [ - "Omit<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }, \"entries\"> & { entries: ", + "Omit<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }, \"entries\"> & { entries: ", { "pluginId": "@kbn/securitysolution-list-utils", "scope": "common", @@ -3189,7 +3285,7 @@ "label": "ExceptionsBuilderReturnExceptionItem", "description": [], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; list_id?: undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; })" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; list_id: string; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; expire_time?: string | undefined; item_id?: string | undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; }) | ({ description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; name: string; type: \"simple\"; } & { comments?: { comment: string; }[] | undefined; item_id?: string | undefined; list_id?: undefined; meta?: object | undefined; namespace_type?: \"single\" | \"agnostic\" | undefined; os_types?: (\"windows\" | \"linux\" | \"macos\")[] | undefined; tags?: string[] | undefined; expire_time?: string | undefined; })" ], "path": "packages/kbn-securitysolution-list-utils/src/types/index.ts", "deprecated": false, diff --git a/api_docs/kbn_securitysolution_list_utils.mdx b/api_docs/kbn_securitysolution_list_utils.mdx index e3c3832e66e49..ced8398dd4b36 100644 --- a/api_docs/kbn_securitysolution_list_utils.mdx +++ b/api_docs/kbn_securitysolution_list_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-list-utils title: "@kbn/securitysolution-list-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-list-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-list-utils'] --- import kbnSecuritysolutionListUtilsObj from './kbn_securitysolution_list_utils.devdocs.json'; @@ -21,7 +21,7 @@ Contact [Owner missing] for questions regarding this plugin. | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 202 | 10 | 155 | 0 | +| 206 | 10 | 159 | 0 | ## Common diff --git a/api_docs/kbn_securitysolution_rules.mdx b/api_docs/kbn_securitysolution_rules.mdx index 40ff524695859..b73302312431b 100644 --- a/api_docs/kbn_securitysolution_rules.mdx +++ b/api_docs/kbn_securitysolution_rules.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-rules title: "@kbn/securitysolution-rules" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-rules plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-rules'] --- import kbnSecuritysolutionRulesObj from './kbn_securitysolution_rules.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_t_grid.mdx b/api_docs/kbn_securitysolution_t_grid.mdx index e000a16750235..f3fd855cab0d6 100644 --- a/api_docs/kbn_securitysolution_t_grid.mdx +++ b/api_docs/kbn_securitysolution_t_grid.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-t-grid title: "@kbn/securitysolution-t-grid" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-t-grid plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-t-grid'] --- import kbnSecuritysolutionTGridObj from './kbn_securitysolution_t_grid.devdocs.json'; diff --git a/api_docs/kbn_securitysolution_utils.mdx b/api_docs/kbn_securitysolution_utils.mdx index a118ef42e9292..f2e5eab9d4bce 100644 --- a/api_docs/kbn_securitysolution_utils.mdx +++ b/api_docs/kbn_securitysolution_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-securitysolution-utils title: "@kbn/securitysolution-utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/securitysolution-utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/securitysolution-utils'] --- import kbnSecuritysolutionUtilsObj from './kbn_securitysolution_utils.devdocs.json'; diff --git a/api_docs/kbn_server_http_tools.mdx b/api_docs/kbn_server_http_tools.mdx index 2471d185564e8..ac2de050d04f0 100644 --- a/api_docs/kbn_server_http_tools.mdx +++ b/api_docs/kbn_server_http_tools.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-server-http-tools title: "@kbn/server-http-tools" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/server-http-tools plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/server-http-tools'] --- import kbnServerHttpToolsObj from './kbn_server_http_tools.devdocs.json'; diff --git a/api_docs/kbn_server_route_repository.mdx b/api_docs/kbn_server_route_repository.mdx index 46cc3e8022286..37600d05e54ef 100644 --- a/api_docs/kbn_server_route_repository.mdx +++ b/api_docs/kbn_server_route_repository.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-server-route-repository title: "@kbn/server-route-repository" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/server-route-repository plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/server-route-repository'] --- import kbnServerRouteRepositoryObj from './kbn_server_route_repository.devdocs.json'; diff --git a/api_docs/kbn_shared_svg.mdx b/api_docs/kbn_shared_svg.mdx index a5a8e452b1a0b..ec3d5ee69d0a9 100644 --- a/api_docs/kbn_shared_svg.mdx +++ b/api_docs/kbn_shared_svg.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-svg title: "@kbn/shared-svg" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-svg plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-svg'] --- import kbnSharedSvgObj from './kbn_shared_svg.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_avatar_solution.mdx b/api_docs/kbn_shared_ux_avatar_solution.mdx index a20ea41fd39b6..242fa9bde480a 100644 --- a/api_docs/kbn_shared_ux_avatar_solution.mdx +++ b/api_docs/kbn_shared_ux_avatar_solution.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-avatar-solution title: "@kbn/shared-ux-avatar-solution" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-avatar-solution plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-avatar-solution'] --- import kbnSharedUxAvatarSolutionObj from './kbn_shared_ux_avatar_solution.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_avatar_user_profile_components.mdx b/api_docs/kbn_shared_ux_avatar_user_profile_components.mdx index 0e68addd6fccb..bff1ca51c1cf0 100644 --- a/api_docs/kbn_shared_ux_avatar_user_profile_components.mdx +++ b/api_docs/kbn_shared_ux_avatar_user_profile_components.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-avatar-user-profile-components title: "@kbn/shared-ux-avatar-user-profile-components" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-avatar-user-profile-components plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-avatar-user-profile-components'] --- import kbnSharedUxAvatarUserProfileComponentsObj from './kbn_shared_ux_avatar_user_profile_components.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_button_exit_full_screen.mdx b/api_docs/kbn_shared_ux_button_exit_full_screen.mdx index 0a13d89e8fa3a..746dc70ecdf1a 100644 --- a/api_docs/kbn_shared_ux_button_exit_full_screen.mdx +++ b/api_docs/kbn_shared_ux_button_exit_full_screen.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-button-exit-full-screen title: "@kbn/shared-ux-button-exit-full-screen" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-button-exit-full-screen plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-button-exit-full-screen'] --- import kbnSharedUxButtonExitFullScreenObj from './kbn_shared_ux_button_exit_full_screen.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_button_exit_full_screen_mocks.mdx b/api_docs/kbn_shared_ux_button_exit_full_screen_mocks.mdx index eadbee884d434..7d6e9d90ef635 100644 --- a/api_docs/kbn_shared_ux_button_exit_full_screen_mocks.mdx +++ b/api_docs/kbn_shared_ux_button_exit_full_screen_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-button-exit-full-screen-mocks title: "@kbn/shared-ux-button-exit-full-screen-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-button-exit-full-screen-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-button-exit-full-screen-mocks'] --- import kbnSharedUxButtonExitFullScreenMocksObj from './kbn_shared_ux_button_exit_full_screen_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_button_toolbar.mdx b/api_docs/kbn_shared_ux_button_toolbar.mdx index fc0abad984436..e19ae2898056c 100644 --- a/api_docs/kbn_shared_ux_button_toolbar.mdx +++ b/api_docs/kbn_shared_ux_button_toolbar.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-button-toolbar title: "@kbn/shared-ux-button-toolbar" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-button-toolbar plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-button-toolbar'] --- import kbnSharedUxButtonToolbarObj from './kbn_shared_ux_button_toolbar.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_card_no_data.mdx b/api_docs/kbn_shared_ux_card_no_data.mdx index 64ded261cbf82..915a5533e79d9 100644 --- a/api_docs/kbn_shared_ux_card_no_data.mdx +++ b/api_docs/kbn_shared_ux_card_no_data.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-card-no-data title: "@kbn/shared-ux-card-no-data" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-card-no-data plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-card-no-data'] --- import kbnSharedUxCardNoDataObj from './kbn_shared_ux_card_no_data.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_card_no_data_mocks.mdx b/api_docs/kbn_shared_ux_card_no_data_mocks.mdx index 30d2b316ed83a..033e13e53ae8f 100644 --- a/api_docs/kbn_shared_ux_card_no_data_mocks.mdx +++ b/api_docs/kbn_shared_ux_card_no_data_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-card-no-data-mocks title: "@kbn/shared-ux-card-no-data-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-card-no-data-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-card-no-data-mocks'] --- import kbnSharedUxCardNoDataMocksObj from './kbn_shared_ux_card_no_data_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_file_context.mdx b/api_docs/kbn_shared_ux_file_context.mdx index c82fcb1f119e7..8f1ccdacd9035 100644 --- a/api_docs/kbn_shared_ux_file_context.mdx +++ b/api_docs/kbn_shared_ux_file_context.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-file-context title: "@kbn/shared-ux-file-context" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-file-context plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-file-context'] --- import kbnSharedUxFileContextObj from './kbn_shared_ux_file_context.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_file_image.mdx b/api_docs/kbn_shared_ux_file_image.mdx index 1f29487e02a00..347c13b2eee30 100644 --- a/api_docs/kbn_shared_ux_file_image.mdx +++ b/api_docs/kbn_shared_ux_file_image.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-file-image title: "@kbn/shared-ux-file-image" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-file-image plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-file-image'] --- import kbnSharedUxFileImageObj from './kbn_shared_ux_file_image.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_file_image_mocks.mdx b/api_docs/kbn_shared_ux_file_image_mocks.mdx index b804cd4df130a..d9c4d8fca6aec 100644 --- a/api_docs/kbn_shared_ux_file_image_mocks.mdx +++ b/api_docs/kbn_shared_ux_file_image_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-file-image-mocks title: "@kbn/shared-ux-file-image-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-file-image-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-file-image-mocks'] --- import kbnSharedUxFileImageMocksObj from './kbn_shared_ux_file_image_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_file_mocks.mdx b/api_docs/kbn_shared_ux_file_mocks.mdx index fc718ca3768b8..cde9d3b845bdf 100644 --- a/api_docs/kbn_shared_ux_file_mocks.mdx +++ b/api_docs/kbn_shared_ux_file_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-file-mocks title: "@kbn/shared-ux-file-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-file-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-file-mocks'] --- import kbnSharedUxFileMocksObj from './kbn_shared_ux_file_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_file_picker.mdx b/api_docs/kbn_shared_ux_file_picker.mdx index 13b8d92994548..557c5b7d82e0f 100644 --- a/api_docs/kbn_shared_ux_file_picker.mdx +++ b/api_docs/kbn_shared_ux_file_picker.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-file-picker title: "@kbn/shared-ux-file-picker" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-file-picker plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-file-picker'] --- import kbnSharedUxFilePickerObj from './kbn_shared_ux_file_picker.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_file_upload.mdx b/api_docs/kbn_shared_ux_file_upload.mdx index bc54d2cb82af9..e7a024233b3d6 100644 --- a/api_docs/kbn_shared_ux_file_upload.mdx +++ b/api_docs/kbn_shared_ux_file_upload.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-file-upload title: "@kbn/shared-ux-file-upload" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-file-upload plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-file-upload'] --- import kbnSharedUxFileUploadObj from './kbn_shared_ux_file_upload.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_file_util.mdx b/api_docs/kbn_shared_ux_file_util.mdx index 31b6d8bace03b..161e71ee47e14 100644 --- a/api_docs/kbn_shared_ux_file_util.mdx +++ b/api_docs/kbn_shared_ux_file_util.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-file-util title: "@kbn/shared-ux-file-util" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-file-util plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-file-util'] --- import kbnSharedUxFileUtilObj from './kbn_shared_ux_file_util.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_link_redirect_app.mdx b/api_docs/kbn_shared_ux_link_redirect_app.mdx index c95515ec57f6b..5597eaf399d4d 100644 --- a/api_docs/kbn_shared_ux_link_redirect_app.mdx +++ b/api_docs/kbn_shared_ux_link_redirect_app.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-link-redirect-app title: "@kbn/shared-ux-link-redirect-app" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-link-redirect-app plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-link-redirect-app'] --- import kbnSharedUxLinkRedirectAppObj from './kbn_shared_ux_link_redirect_app.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_link_redirect_app_mocks.mdx b/api_docs/kbn_shared_ux_link_redirect_app_mocks.mdx index e5bb0c8195a4a..85897c68d5109 100644 --- a/api_docs/kbn_shared_ux_link_redirect_app_mocks.mdx +++ b/api_docs/kbn_shared_ux_link_redirect_app_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-link-redirect-app-mocks title: "@kbn/shared-ux-link-redirect-app-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-link-redirect-app-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-link-redirect-app-mocks'] --- import kbnSharedUxLinkRedirectAppMocksObj from './kbn_shared_ux_link_redirect_app_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_markdown.mdx b/api_docs/kbn_shared_ux_markdown.mdx index e2f86c1536432..e36ffd5463351 100644 --- a/api_docs/kbn_shared_ux_markdown.mdx +++ b/api_docs/kbn_shared_ux_markdown.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-markdown title: "@kbn/shared-ux-markdown" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-markdown plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-markdown'] --- import kbnSharedUxMarkdownObj from './kbn_shared_ux_markdown.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_markdown_mocks.mdx b/api_docs/kbn_shared_ux_markdown_mocks.mdx index c7b7f92125c2b..164d846bb0b86 100644 --- a/api_docs/kbn_shared_ux_markdown_mocks.mdx +++ b/api_docs/kbn_shared_ux_markdown_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-markdown-mocks title: "@kbn/shared-ux-markdown-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-markdown-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-markdown-mocks'] --- import kbnSharedUxMarkdownMocksObj from './kbn_shared_ux_markdown_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_analytics_no_data.mdx b/api_docs/kbn_shared_ux_page_analytics_no_data.mdx index 1066381444291..80501cc72e5a9 100644 --- a/api_docs/kbn_shared_ux_page_analytics_no_data.mdx +++ b/api_docs/kbn_shared_ux_page_analytics_no_data.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-analytics-no-data title: "@kbn/shared-ux-page-analytics-no-data" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-analytics-no-data plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-analytics-no-data'] --- import kbnSharedUxPageAnalyticsNoDataObj from './kbn_shared_ux_page_analytics_no_data.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_analytics_no_data_mocks.mdx b/api_docs/kbn_shared_ux_page_analytics_no_data_mocks.mdx index c309da0df8581..301a6e7457223 100644 --- a/api_docs/kbn_shared_ux_page_analytics_no_data_mocks.mdx +++ b/api_docs/kbn_shared_ux_page_analytics_no_data_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-analytics-no-data-mocks title: "@kbn/shared-ux-page-analytics-no-data-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-analytics-no-data-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-analytics-no-data-mocks'] --- import kbnSharedUxPageAnalyticsNoDataMocksObj from './kbn_shared_ux_page_analytics_no_data_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_kibana_no_data.mdx b/api_docs/kbn_shared_ux_page_kibana_no_data.mdx index 7c06121b0a272..ac37ae176d9c5 100644 --- a/api_docs/kbn_shared_ux_page_kibana_no_data.mdx +++ b/api_docs/kbn_shared_ux_page_kibana_no_data.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-kibana-no-data title: "@kbn/shared-ux-page-kibana-no-data" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-kibana-no-data plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-kibana-no-data'] --- import kbnSharedUxPageKibanaNoDataObj from './kbn_shared_ux_page_kibana_no_data.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_kibana_no_data_mocks.mdx b/api_docs/kbn_shared_ux_page_kibana_no_data_mocks.mdx index 2107f409250ff..7c2acbd47614e 100644 --- a/api_docs/kbn_shared_ux_page_kibana_no_data_mocks.mdx +++ b/api_docs/kbn_shared_ux_page_kibana_no_data_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-kibana-no-data-mocks title: "@kbn/shared-ux-page-kibana-no-data-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-kibana-no-data-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-kibana-no-data-mocks'] --- import kbnSharedUxPageKibanaNoDataMocksObj from './kbn_shared_ux_page_kibana_no_data_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_kibana_template.mdx b/api_docs/kbn_shared_ux_page_kibana_template.mdx index 9e71b8ea0b70f..ca6525bcf8b22 100644 --- a/api_docs/kbn_shared_ux_page_kibana_template.mdx +++ b/api_docs/kbn_shared_ux_page_kibana_template.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-kibana-template title: "@kbn/shared-ux-page-kibana-template" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-kibana-template plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-kibana-template'] --- import kbnSharedUxPageKibanaTemplateObj from './kbn_shared_ux_page_kibana_template.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_kibana_template_mocks.mdx b/api_docs/kbn_shared_ux_page_kibana_template_mocks.mdx index 37b20f87221ba..8d99129e2076a 100644 --- a/api_docs/kbn_shared_ux_page_kibana_template_mocks.mdx +++ b/api_docs/kbn_shared_ux_page_kibana_template_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-kibana-template-mocks title: "@kbn/shared-ux-page-kibana-template-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-kibana-template-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-kibana-template-mocks'] --- import kbnSharedUxPageKibanaTemplateMocksObj from './kbn_shared_ux_page_kibana_template_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_no_data.mdx b/api_docs/kbn_shared_ux_page_no_data.mdx index f045d255aff50..248f6ef947986 100644 --- a/api_docs/kbn_shared_ux_page_no_data.mdx +++ b/api_docs/kbn_shared_ux_page_no_data.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-no-data title: "@kbn/shared-ux-page-no-data" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-no-data plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-no-data'] --- import kbnSharedUxPageNoDataObj from './kbn_shared_ux_page_no_data.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_no_data_config.mdx b/api_docs/kbn_shared_ux_page_no_data_config.mdx index 08e9ddc433bb1..796584a3c4fd7 100644 --- a/api_docs/kbn_shared_ux_page_no_data_config.mdx +++ b/api_docs/kbn_shared_ux_page_no_data_config.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-no-data-config title: "@kbn/shared-ux-page-no-data-config" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-no-data-config plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-no-data-config'] --- import kbnSharedUxPageNoDataConfigObj from './kbn_shared_ux_page_no_data_config.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_no_data_config_mocks.mdx b/api_docs/kbn_shared_ux_page_no_data_config_mocks.mdx index d06493994b648..220f5d24cf56d 100644 --- a/api_docs/kbn_shared_ux_page_no_data_config_mocks.mdx +++ b/api_docs/kbn_shared_ux_page_no_data_config_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-no-data-config-mocks title: "@kbn/shared-ux-page-no-data-config-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-no-data-config-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-no-data-config-mocks'] --- import kbnSharedUxPageNoDataConfigMocksObj from './kbn_shared_ux_page_no_data_config_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_no_data_mocks.mdx b/api_docs/kbn_shared_ux_page_no_data_mocks.mdx index a8de8f722ecf4..be47361955cbe 100644 --- a/api_docs/kbn_shared_ux_page_no_data_mocks.mdx +++ b/api_docs/kbn_shared_ux_page_no_data_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-no-data-mocks title: "@kbn/shared-ux-page-no-data-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-no-data-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-no-data-mocks'] --- import kbnSharedUxPageNoDataMocksObj from './kbn_shared_ux_page_no_data_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_page_solution_nav.mdx b/api_docs/kbn_shared_ux_page_solution_nav.mdx index 217d92ce69baf..958791ee219df 100644 --- a/api_docs/kbn_shared_ux_page_solution_nav.mdx +++ b/api_docs/kbn_shared_ux_page_solution_nav.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-page-solution-nav title: "@kbn/shared-ux-page-solution-nav" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-page-solution-nav plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-page-solution-nav'] --- import kbnSharedUxPageSolutionNavObj from './kbn_shared_ux_page_solution_nav.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_prompt_no_data_views.mdx b/api_docs/kbn_shared_ux_prompt_no_data_views.mdx index 27a97daed7045..8b240abd7d4e1 100644 --- a/api_docs/kbn_shared_ux_prompt_no_data_views.mdx +++ b/api_docs/kbn_shared_ux_prompt_no_data_views.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-prompt-no-data-views title: "@kbn/shared-ux-prompt-no-data-views" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-prompt-no-data-views plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-prompt-no-data-views'] --- import kbnSharedUxPromptNoDataViewsObj from './kbn_shared_ux_prompt_no_data_views.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_prompt_no_data_views_mocks.mdx b/api_docs/kbn_shared_ux_prompt_no_data_views_mocks.mdx index 0299e0620f636..a63046ec5578d 100644 --- a/api_docs/kbn_shared_ux_prompt_no_data_views_mocks.mdx +++ b/api_docs/kbn_shared_ux_prompt_no_data_views_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-prompt-no-data-views-mocks title: "@kbn/shared-ux-prompt-no-data-views-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-prompt-no-data-views-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-prompt-no-data-views-mocks'] --- import kbnSharedUxPromptNoDataViewsMocksObj from './kbn_shared_ux_prompt_no_data_views_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_prompt_not_found.mdx b/api_docs/kbn_shared_ux_prompt_not_found.mdx index 79719bcf04711..a1d0769a40b4c 100644 --- a/api_docs/kbn_shared_ux_prompt_not_found.mdx +++ b/api_docs/kbn_shared_ux_prompt_not_found.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-prompt-not-found title: "@kbn/shared-ux-prompt-not-found" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-prompt-not-found plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-prompt-not-found'] --- import kbnSharedUxPromptNotFoundObj from './kbn_shared_ux_prompt_not_found.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_router.mdx b/api_docs/kbn_shared_ux_router.mdx index ce4f047e86ce4..822e4939de412 100644 --- a/api_docs/kbn_shared_ux_router.mdx +++ b/api_docs/kbn_shared_ux_router.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-router title: "@kbn/shared-ux-router" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-router plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-router'] --- import kbnSharedUxRouterObj from './kbn_shared_ux_router.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_router_mocks.mdx b/api_docs/kbn_shared_ux_router_mocks.mdx index b5420eaface8c..7e2b6cc1b1e2b 100644 --- a/api_docs/kbn_shared_ux_router_mocks.mdx +++ b/api_docs/kbn_shared_ux_router_mocks.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-router-mocks title: "@kbn/shared-ux-router-mocks" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-router-mocks plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-router-mocks'] --- import kbnSharedUxRouterMocksObj from './kbn_shared_ux_router_mocks.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_storybook_config.mdx b/api_docs/kbn_shared_ux_storybook_config.mdx index f163ac35cae58..d8475b719b692 100644 --- a/api_docs/kbn_shared_ux_storybook_config.mdx +++ b/api_docs/kbn_shared_ux_storybook_config.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-storybook-config title: "@kbn/shared-ux-storybook-config" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-storybook-config plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-storybook-config'] --- import kbnSharedUxStorybookConfigObj from './kbn_shared_ux_storybook_config.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_storybook_mock.mdx b/api_docs/kbn_shared_ux_storybook_mock.mdx index 3b0b70d1e10c7..6e44723e8872e 100644 --- a/api_docs/kbn_shared_ux_storybook_mock.mdx +++ b/api_docs/kbn_shared_ux_storybook_mock.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-storybook-mock title: "@kbn/shared-ux-storybook-mock" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-storybook-mock plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-storybook-mock'] --- import kbnSharedUxStorybookMockObj from './kbn_shared_ux_storybook_mock.devdocs.json'; diff --git a/api_docs/kbn_shared_ux_utility.mdx b/api_docs/kbn_shared_ux_utility.mdx index 2f1dfe03c4afb..c788ee3d93b23 100644 --- a/api_docs/kbn_shared_ux_utility.mdx +++ b/api_docs/kbn_shared_ux_utility.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-shared-ux-utility title: "@kbn/shared-ux-utility" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/shared-ux-utility plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/shared-ux-utility'] --- import kbnSharedUxUtilityObj from './kbn_shared_ux_utility.devdocs.json'; diff --git a/api_docs/kbn_slo_schema.mdx b/api_docs/kbn_slo_schema.mdx index e893afa2b9bec..bc7dc01ebbf12 100644 --- a/api_docs/kbn_slo_schema.mdx +++ b/api_docs/kbn_slo_schema.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-slo-schema title: "@kbn/slo-schema" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/slo-schema plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/slo-schema'] --- import kbnSloSchemaObj from './kbn_slo_schema.devdocs.json'; diff --git a/api_docs/kbn_some_dev_log.mdx b/api_docs/kbn_some_dev_log.mdx index de9399bb42735..4bcb17ed3251d 100644 --- a/api_docs/kbn_some_dev_log.mdx +++ b/api_docs/kbn_some_dev_log.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-some-dev-log title: "@kbn/some-dev-log" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/some-dev-log plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/some-dev-log'] --- import kbnSomeDevLogObj from './kbn_some_dev_log.devdocs.json'; diff --git a/api_docs/kbn_std.mdx b/api_docs/kbn_std.mdx index a03301f209b92..db8daa138177e 100644 --- a/api_docs/kbn_std.mdx +++ b/api_docs/kbn_std.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-std title: "@kbn/std" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/std plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/std'] --- import kbnStdObj from './kbn_std.devdocs.json'; diff --git a/api_docs/kbn_stdio_dev_helpers.mdx b/api_docs/kbn_stdio_dev_helpers.mdx index d1da4dc55c50c..9b01f7a741a27 100644 --- a/api_docs/kbn_stdio_dev_helpers.mdx +++ b/api_docs/kbn_stdio_dev_helpers.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-stdio-dev-helpers title: "@kbn/stdio-dev-helpers" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/stdio-dev-helpers plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/stdio-dev-helpers'] --- import kbnStdioDevHelpersObj from './kbn_stdio_dev_helpers.devdocs.json'; diff --git a/api_docs/kbn_storybook.mdx b/api_docs/kbn_storybook.mdx index 663d00c3d0b92..f30b44ac3c512 100644 --- a/api_docs/kbn_storybook.mdx +++ b/api_docs/kbn_storybook.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-storybook title: "@kbn/storybook" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/storybook plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/storybook'] --- import kbnStorybookObj from './kbn_storybook.devdocs.json'; diff --git a/api_docs/kbn_telemetry_tools.mdx b/api_docs/kbn_telemetry_tools.mdx index bc6b9f06c7ac8..780521738ab3d 100644 --- a/api_docs/kbn_telemetry_tools.mdx +++ b/api_docs/kbn_telemetry_tools.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-telemetry-tools title: "@kbn/telemetry-tools" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/telemetry-tools plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/telemetry-tools'] --- import kbnTelemetryToolsObj from './kbn_telemetry_tools.devdocs.json'; diff --git a/api_docs/kbn_test.mdx b/api_docs/kbn_test.mdx index 3fc06bc66273b..a434501c279b9 100644 --- a/api_docs/kbn_test.mdx +++ b/api_docs/kbn_test.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-test title: "@kbn/test" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/test plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/test'] --- import kbnTestObj from './kbn_test.devdocs.json'; diff --git a/api_docs/kbn_test_jest_helpers.mdx b/api_docs/kbn_test_jest_helpers.mdx index 6fd89dad00365..1646650facb1a 100644 --- a/api_docs/kbn_test_jest_helpers.mdx +++ b/api_docs/kbn_test_jest_helpers.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-test-jest-helpers title: "@kbn/test-jest-helpers" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/test-jest-helpers plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/test-jest-helpers'] --- import kbnTestJestHelpersObj from './kbn_test_jest_helpers.devdocs.json'; diff --git a/api_docs/kbn_test_subj_selector.mdx b/api_docs/kbn_test_subj_selector.mdx index 36785a240a316..6e1a066f22f19 100644 --- a/api_docs/kbn_test_subj_selector.mdx +++ b/api_docs/kbn_test_subj_selector.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-test-subj-selector title: "@kbn/test-subj-selector" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/test-subj-selector plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/test-subj-selector'] --- import kbnTestSubjSelectorObj from './kbn_test_subj_selector.devdocs.json'; diff --git a/api_docs/kbn_tooling_log.mdx b/api_docs/kbn_tooling_log.mdx index 2edba2d696413..80e8fb8d38ebd 100644 --- a/api_docs/kbn_tooling_log.mdx +++ b/api_docs/kbn_tooling_log.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-tooling-log title: "@kbn/tooling-log" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/tooling-log plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/tooling-log'] --- import kbnToolingLogObj from './kbn_tooling_log.devdocs.json'; diff --git a/api_docs/kbn_ts_projects.mdx b/api_docs/kbn_ts_projects.mdx index 406cee9f9e4e4..77e4aecd03ab5 100644 --- a/api_docs/kbn_ts_projects.mdx +++ b/api_docs/kbn_ts_projects.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ts-projects title: "@kbn/ts-projects" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ts-projects plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ts-projects'] --- import kbnTsProjectsObj from './kbn_ts_projects.devdocs.json'; diff --git a/api_docs/kbn_typed_react_router_config.mdx b/api_docs/kbn_typed_react_router_config.mdx index c308e26fe8fe0..911782f53f833 100644 --- a/api_docs/kbn_typed_react_router_config.mdx +++ b/api_docs/kbn_typed_react_router_config.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-typed-react-router-config title: "@kbn/typed-react-router-config" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/typed-react-router-config plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/typed-react-router-config'] --- import kbnTypedReactRouterConfigObj from './kbn_typed_react_router_config.devdocs.json'; diff --git a/api_docs/kbn_ui_actions_browser.mdx b/api_docs/kbn_ui_actions_browser.mdx index 2ddb3e143940a..b1151d3b94852 100644 --- a/api_docs/kbn_ui_actions_browser.mdx +++ b/api_docs/kbn_ui_actions_browser.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ui-actions-browser title: "@kbn/ui-actions-browser" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ui-actions-browser plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ui-actions-browser'] --- import kbnUiActionsBrowserObj from './kbn_ui_actions_browser.devdocs.json'; diff --git a/api_docs/kbn_ui_shared_deps_src.mdx b/api_docs/kbn_ui_shared_deps_src.mdx index 4c992a0b7ba97..48e4bbf70b49c 100644 --- a/api_docs/kbn_ui_shared_deps_src.mdx +++ b/api_docs/kbn_ui_shared_deps_src.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ui-shared-deps-src title: "@kbn/ui-shared-deps-src" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ui-shared-deps-src plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ui-shared-deps-src'] --- import kbnUiSharedDepsSrcObj from './kbn_ui_shared_deps_src.devdocs.json'; diff --git a/api_docs/kbn_ui_theme.mdx b/api_docs/kbn_ui_theme.mdx index b7cf721b289d8..5ff04426ef871 100644 --- a/api_docs/kbn_ui_theme.mdx +++ b/api_docs/kbn_ui_theme.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-ui-theme title: "@kbn/ui-theme" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/ui-theme plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/ui-theme'] --- import kbnUiThemeObj from './kbn_ui_theme.devdocs.json'; diff --git a/api_docs/kbn_user_profile_components.mdx b/api_docs/kbn_user_profile_components.mdx index b38dda89ff359..66c4133c15d99 100644 --- a/api_docs/kbn_user_profile_components.mdx +++ b/api_docs/kbn_user_profile_components.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-user-profile-components title: "@kbn/user-profile-components" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/user-profile-components plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/user-profile-components'] --- import kbnUserProfileComponentsObj from './kbn_user_profile_components.devdocs.json'; diff --git a/api_docs/kbn_utility_types.mdx b/api_docs/kbn_utility_types.mdx index d197cd04edbf7..e23696e0f2e05 100644 --- a/api_docs/kbn_utility_types.mdx +++ b/api_docs/kbn_utility_types.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-utility-types title: "@kbn/utility-types" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/utility-types plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/utility-types'] --- import kbnUtilityTypesObj from './kbn_utility_types.devdocs.json'; diff --git a/api_docs/kbn_utility_types_jest.mdx b/api_docs/kbn_utility_types_jest.mdx index 0feb47cbc6bc9..e2658da185277 100644 --- a/api_docs/kbn_utility_types_jest.mdx +++ b/api_docs/kbn_utility_types_jest.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-utility-types-jest title: "@kbn/utility-types-jest" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/utility-types-jest plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/utility-types-jest'] --- import kbnUtilityTypesJestObj from './kbn_utility_types_jest.devdocs.json'; diff --git a/api_docs/kbn_utils.mdx b/api_docs/kbn_utils.mdx index 84096ebbc599e..12d938196b18e 100644 --- a/api_docs/kbn_utils.mdx +++ b/api_docs/kbn_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-utils title: "@kbn/utils" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/utils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/utils'] --- import kbnUtilsObj from './kbn_utils.devdocs.json'; diff --git a/api_docs/kbn_yarn_lock_validator.mdx b/api_docs/kbn_yarn_lock_validator.mdx index 8637fad69054c..91bf4368988f7 100644 --- a/api_docs/kbn_yarn_lock_validator.mdx +++ b/api_docs/kbn_yarn_lock_validator.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kbn-yarn-lock-validator title: "@kbn/yarn-lock-validator" image: https://source.unsplash.com/400x175/?github description: API docs for the @kbn/yarn-lock-validator plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', '@kbn/yarn-lock-validator'] --- import kbnYarnLockValidatorObj from './kbn_yarn_lock_validator.devdocs.json'; diff --git a/api_docs/kibana_overview.mdx b/api_docs/kibana_overview.mdx index 4bb00bbc43296..860c660198410 100644 --- a/api_docs/kibana_overview.mdx +++ b/api_docs/kibana_overview.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kibanaOverview title: "kibanaOverview" image: https://source.unsplash.com/400x175/?github description: API docs for the kibanaOverview plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'kibanaOverview'] --- import kibanaOverviewObj from './kibana_overview.devdocs.json'; diff --git a/api_docs/kibana_react.mdx b/api_docs/kibana_react.mdx index e1e393434e236..6e512ca05cf75 100644 --- a/api_docs/kibana_react.mdx +++ b/api_docs/kibana_react.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kibanaReact title: "kibanaReact" image: https://source.unsplash.com/400x175/?github description: API docs for the kibanaReact plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'kibanaReact'] --- import kibanaReactObj from './kibana_react.devdocs.json'; diff --git a/api_docs/kibana_utils.mdx b/api_docs/kibana_utils.mdx index b1808a5b8ea79..8c9d69a5879f0 100644 --- a/api_docs/kibana_utils.mdx +++ b/api_docs/kibana_utils.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kibanaUtils title: "kibanaUtils" image: https://source.unsplash.com/400x175/?github description: API docs for the kibanaUtils plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'kibanaUtils'] --- import kibanaUtilsObj from './kibana_utils.devdocs.json'; diff --git a/api_docs/kubernetes_security.mdx b/api_docs/kubernetes_security.mdx index c4a4435c11755..f96055486171a 100644 --- a/api_docs/kubernetes_security.mdx +++ b/api_docs/kubernetes_security.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/kubernetesSecurity title: "kubernetesSecurity" image: https://source.unsplash.com/400x175/?github description: API docs for the kubernetesSecurity plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'kubernetesSecurity'] --- import kubernetesSecurityObj from './kubernetes_security.devdocs.json'; diff --git a/api_docs/lens.devdocs.json b/api_docs/lens.devdocs.json index ac39b1e6d687a..598494045f2c7 100644 --- a/api_docs/lens.devdocs.json +++ b/api_docs/lens.devdocs.json @@ -9027,8 +9027,6 @@ "description": [], "signature": [ "(", - "LensByReferenceInput", - " | ", { "pluginId": "lens", "scope": "public", @@ -9036,6 +9034,8 @@ "section": "def-public.TypedLensByValueInput", "text": "TypedLensByValueInput" }, + " | ", + "LensByReferenceInput", ") & { withDefaultActions?: boolean | undefined; extraActions?: ", { "pluginId": "uiActions", diff --git a/api_docs/lens.mdx b/api_docs/lens.mdx index e3f29fec395bb..5cd7aa7dd47be 100644 --- a/api_docs/lens.mdx +++ b/api_docs/lens.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/lens title: "lens" image: https://source.unsplash.com/400x175/?github description: API docs for the lens plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'lens'] --- import lensObj from './lens.devdocs.json'; diff --git a/api_docs/license_api_guard.mdx b/api_docs/license_api_guard.mdx index 88da4e9c6f55a..f1baf92388b48 100644 --- a/api_docs/license_api_guard.mdx +++ b/api_docs/license_api_guard.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/licenseApiGuard title: "licenseApiGuard" image: https://source.unsplash.com/400x175/?github description: API docs for the licenseApiGuard plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'licenseApiGuard'] --- import licenseApiGuardObj from './license_api_guard.devdocs.json'; diff --git a/api_docs/license_management.mdx b/api_docs/license_management.mdx index 8d62bffef5c9e..bdd1d8715ebe5 100644 --- a/api_docs/license_management.mdx +++ b/api_docs/license_management.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/licenseManagement title: "licenseManagement" image: https://source.unsplash.com/400x175/?github description: API docs for the licenseManagement plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'licenseManagement'] --- import licenseManagementObj from './license_management.devdocs.json'; diff --git a/api_docs/licensing.mdx b/api_docs/licensing.mdx index b445cf8518378..ffbefeaa0bbfa 100644 --- a/api_docs/licensing.mdx +++ b/api_docs/licensing.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/licensing title: "licensing" image: https://source.unsplash.com/400x175/?github description: API docs for the licensing plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'licensing'] --- import licensingObj from './licensing.devdocs.json'; diff --git a/api_docs/lists.devdocs.json b/api_docs/lists.devdocs.json index b8681cc8d97db..0ccba8e01b9be 100644 --- a/api_docs/lists.devdocs.json +++ b/api_docs/lists.devdocs.json @@ -345,7 +345,7 @@ "label": "exceptionsToDelete", "description": [], "signature": [ - "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]" + "{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]" ], "path": "x-pack/plugins/lists/public/exceptions/components/builder/exception_items_renderer.tsx", "deprecated": false, @@ -622,7 +622,7 @@ "signature": [ "({ itemId, id, namespaceType, }: ", "GetExceptionListItemOptions", - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -698,9 +698,9 @@ "\nThis is the same as \"createListItem\" except it applies specifically to the agnostic endpoint list and will\nauto-call the \"createEndpointList\" for you so that you have the best chance of the agnostic endpoint\nbeing there and existing before the item is inserted into the agnostic endpoint list." ], "signature": [ - "({ comments, description, entries, itemId, meta, name, osTypes, tags, type, }: ", + "({ comments, description, entries, expireTime, itemId, meta, name, osTypes, tags, type, }: ", "CreateEndpointListItemOptions", - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -711,7 +711,7 @@ "id": "def-server.ExceptionListClient.createEndpointListItem.$1", "type": "Object", "tags": [], - "label": "{\n comments,\n description,\n entries,\n itemId,\n meta,\n name,\n osTypes,\n tags,\n type,\n }", + "label": "{\n comments,\n description,\n entries,\n expireTime,\n itemId,\n meta,\n name,\n osTypes,\n tags,\n type,\n }", "description": [], "signature": [ "CreateEndpointListItemOptions" @@ -774,9 +774,9 @@ "\nThis is the same as \"updateExceptionListItem\" except it applies specifically to the endpoint list and will\nauto-call the \"createEndpointList\" for you so that you have the best chance of the endpoint\nbeing there if it did not exist before. If the list did not exist before, then creating it here will still cause a\nreturn of null but at least the list exists again." ], "signature": [ - "({ _version, comments, description, entries, id, itemId, meta, name, osTypes, tags, type, }: ", + "({ _version, comments, description, entries, expireTime, id, itemId, meta, name, osTypes, tags, type, }: ", "UpdateEndpointListItemOptions", - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -787,7 +787,7 @@ "id": "def-server.ExceptionListClient.updateEndpointListItem.$1", "type": "Object", "tags": [], - "label": "{\n _version,\n comments,\n description,\n entries,\n id,\n itemId,\n meta,\n name,\n osTypes,\n tags,\n type,\n }", + "label": "{\n _version,\n comments,\n description,\n entries,\n expireTime,\n id,\n itemId,\n meta,\n name,\n osTypes,\n tags,\n type,\n }", "description": [], "signature": [ "UpdateEndpointListItemOptions" @@ -814,7 +814,7 @@ "signature": [ "({ itemId, id, }: ", "GetEndpointListItemOptions", - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -964,7 +964,7 @@ "\nCreate an exception list item container" ], "signature": [ - "({ comments, description, entries, itemId, listId, meta, name, namespaceType, osTypes, tags, type, }: ", + "({ comments, description, entries, expireTime, itemId, listId, meta, name, namespaceType, osTypes, tags, type, }: ", { "pluginId": "lists", "scope": "server", @@ -972,7 +972,7 @@ "section": "def-server.CreateExceptionListItemOptions", "text": "CreateExceptionListItemOptions" }, - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -983,7 +983,7 @@ "id": "def-server.ExceptionListClient.createExceptionListItem.$1", "type": "Object", "tags": [], - "label": "{\n comments,\n description,\n entries,\n itemId,\n listId,\n meta,\n name,\n namespaceType,\n osTypes,\n tags,\n type,\n }", + "label": "{\n comments,\n description,\n entries,\n expireTime,\n itemId,\n listId,\n meta,\n name,\n namespaceType,\n osTypes,\n tags,\n type,\n }", "description": [], "signature": [ { @@ -1014,7 +1014,7 @@ "\nUpdate an existing exception list item" ], "signature": [ - "({ _version, comments, description, entries, id, itemId, meta, name, namespaceType, osTypes, tags, type, }: ", + "({ _version, comments, description, entries, expireTime, id, itemId, meta, name, namespaceType, osTypes, tags, type, }: ", { "pluginId": "lists", "scope": "server", @@ -1022,7 +1022,7 @@ "section": "def-server.UpdateExceptionListItemOptions", "text": "UpdateExceptionListItemOptions" }, - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -1033,7 +1033,7 @@ "id": "def-server.ExceptionListClient.updateExceptionListItem.$1", "type": "Object", "tags": [], - "label": "{\n _version,\n comments,\n description,\n entries,\n id,\n itemId,\n meta,\n name,\n namespaceType,\n osTypes,\n tags,\n type,\n }", + "label": "{\n _version,\n comments,\n description,\n entries,\n expireTime,\n id,\n itemId,\n meta,\n name,\n namespaceType,\n osTypes,\n tags,\n type,\n }", "description": [], "signature": [ { @@ -1066,7 +1066,7 @@ "signature": [ "({ id, itemId, namespaceType, }: ", "DeleteExceptionListItemOptions", - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -1140,7 +1140,7 @@ "signature": [ "({ id, itemId, }: ", "DeleteEndpointListItemOptions", - ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" + ") => Promise<{ _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; } | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -1176,7 +1176,7 @@ "signature": [ "({ listId, filter, perPage, pit, page, search, searchAfter, sortField, sortOrder, namespaceType, }: ", "FindExceptionListItemOptions", - ") => Promise<({ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }) | null>" + ") => Promise<({ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }) | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -1214,7 +1214,7 @@ "signature": [ "({ listId, filter, perPage, pit, page, search, searchAfter, sortField, sortOrder, namespaceType, }: ", "FindExceptionListsItemOptions", - ") => Promise<({ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }) | null>" + ") => Promise<({ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }) | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -1252,7 +1252,7 @@ "signature": [ "({ perPage, pit, page, searchAfter, sortField, sortOrder, valueListId, }: ", "FindValueListExceptionListsItems", - ") => Promise<({ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }) | null>" + ") => Promise<({ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }) | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -1328,7 +1328,7 @@ "signature": [ "({ filter, perPage, page, pit, search, searchAfter, sortField, sortOrder, }: ", "FindEndpointListItemOptions", - ") => Promise<({ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }) | null>" + ") => Promise<({ data: { _version: string | undefined; comments: ({ comment: string; created_at: string; created_by: string; id: string; } & { updated_at?: string | undefined; updated_by?: string | undefined; })[]; created_at: string; created_by: string; description: string; entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; list: { id: string; type: \"boolean\" | \"date\" | \"keyword\" | \"ip\" | \"text\" | \"geo_point\" | \"geo_shape\" | \"date_nanos\" | \"long\" | \"double\" | \"date_range\" | \"ip_range\" | \"shape\" | \"short\" | \"binary\" | \"byte\" | \"float\" | \"half_float\" | \"integer\" | \"double_range\" | \"float_range\" | \"integer_range\" | \"long_range\"; }; operator: \"excluded\" | \"included\"; type: \"list\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; } | { entries: ({ field: string; operator: \"excluded\" | \"included\"; type: \"match\"; value: string; } | { field: string; operator: \"excluded\" | \"included\"; type: \"match_any\"; value: string[]; } | { field: string; operator: \"excluded\" | \"included\"; type: \"exists\"; })[]; field: string; type: \"nested\"; } | { field: string; operator: \"excluded\" | \"included\"; type: \"wildcard\"; value: string; })[]; expire_time: string | undefined; id: string; item_id: string; list_id: string; meta: object | undefined; name: string; namespace_type: \"single\" | \"agnostic\"; os_types: (\"windows\" | \"linux\" | \"macos\")[]; tags: string[]; tie_breaker_id: string; type: \"simple\"; updated_at: string; updated_by: string; }[]; page: number; per_page: number; total: number; } & { pit?: string | undefined; }) | null>" ], "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client.ts", "deprecated": false, @@ -1364,7 +1364,7 @@ "\nExport an exception list parent container and it's items" ], "signature": [ - "({ listId, id, namespaceType, }: ", + "({ listId, id, namespaceType, includeExpiredExceptions, }: ", "ExportExceptionListAndItemsOptions", ") => Promise<", { @@ -1385,7 +1385,7 @@ "id": "def-server.ExceptionListClient.exportExceptionListAndItems.$1", "type": "Object", "tags": [], - "label": "{\n listId,\n id,\n namespaceType,\n }", + "label": "{\n listId,\n id,\n namespaceType,\n includeExpiredExceptions,\n }", "description": [], "signature": [ "ExportExceptionListAndItemsOptions" @@ -3003,6 +3003,22 @@ "deprecated": false, "trackAdoption": false }, + { + "parentPluginId": "lists", + "id": "def-server.CreateExceptionListItemOptions.expireTime", + "type": "string", + "tags": [], + "label": "expireTime", + "description": [ + "an optional datetime string with an expiration time" + ], + "signature": [ + "string | undefined" + ], + "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client_types.ts", + "deprecated": false, + "trackAdoption": false + }, { "parentPluginId": "lists", "id": "def-server.CreateExceptionListItemOptions.itemId", @@ -3315,6 +3331,22 @@ "deprecated": false, "trackAdoption": false }, + { + "parentPluginId": "lists", + "id": "def-server.UpdateExceptionListItemOptions.expireTime", + "type": "string", + "tags": [], + "label": "expireTime", + "description": [ + "an optional datetime string with an expiration time" + ], + "signature": [ + "string | undefined" + ], + "path": "x-pack/plugins/lists/server/services/exception_lists/exception_list_client_types.ts", + "deprecated": false, + "trackAdoption": false + }, { "parentPluginId": "lists", "id": "def-server.UpdateExceptionListItemOptions.id", diff --git a/api_docs/lists.mdx b/api_docs/lists.mdx index 9052518d9ee1e..44e9c1c6f2f23 100644 --- a/api_docs/lists.mdx +++ b/api_docs/lists.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/lists title: "lists" image: https://source.unsplash.com/400x175/?github description: API docs for the lists plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'lists'] --- import listsObj from './lists.devdocs.json'; @@ -21,7 +21,7 @@ Contact [Security detections response](https://github.com/orgs/elastic/teams/sec | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 206 | 0 | 93 | 51 | +| 208 | 0 | 93 | 51 | ## Client diff --git a/api_docs/management.mdx b/api_docs/management.mdx index dccfbe6ead7c8..80aa1f2949a37 100644 --- a/api_docs/management.mdx +++ b/api_docs/management.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/management title: "management" image: https://source.unsplash.com/400x175/?github description: API docs for the management plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'management'] --- import managementObj from './management.devdocs.json'; diff --git a/api_docs/maps.mdx b/api_docs/maps.mdx index b1fae75481fef..789ee9aa9ea2f 100644 --- a/api_docs/maps.mdx +++ b/api_docs/maps.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/maps title: "maps" image: https://source.unsplash.com/400x175/?github description: API docs for the maps plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'maps'] --- import mapsObj from './maps.devdocs.json'; diff --git a/api_docs/maps_ems.mdx b/api_docs/maps_ems.mdx index 6dce3959c9b6a..16a9a6a081766 100644 --- a/api_docs/maps_ems.mdx +++ b/api_docs/maps_ems.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/mapsEms title: "mapsEms" image: https://source.unsplash.com/400x175/?github description: API docs for the mapsEms plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'mapsEms'] --- import mapsEmsObj from './maps_ems.devdocs.json'; diff --git a/api_docs/ml.devdocs.json b/api_docs/ml.devdocs.json index e7a6ab48c2dfc..d58430fd0174c 100644 --- a/api_docs/ml.devdocs.json +++ b/api_docs/ml.devdocs.json @@ -1630,7 +1630,7 @@ "label": "ML_PAGES", "description": [], "signature": [ - "{ readonly ANOMALY_DETECTION_JOBS_MANAGE: \"jobs\"; readonly ANOMALY_EXPLORER: \"explorer\"; readonly SINGLE_METRIC_VIEWER: \"timeseriesexplorer\"; readonly DATA_FRAME_ANALYTICS_JOBS_MANAGE: \"data_frame_analytics\"; readonly DATA_FRAME_ANALYTICS_SOURCE_SELECTION: \"data_frame_analytics/source_selection\"; readonly DATA_FRAME_ANALYTICS_CREATE_JOB: \"data_frame_analytics/new_job\"; readonly TRAINED_MODELS_MANAGE: \"trained_models\"; readonly TRAINED_MODELS_NODES: \"trained_models/nodes\"; readonly DATA_FRAME_ANALYTICS_EXPLORATION: \"data_frame_analytics/exploration\"; readonly DATA_FRAME_ANALYTICS_MAP: \"data_frame_analytics/map\"; readonly DATA_VISUALIZER: \"datavisualizer\"; readonly DATA_VISUALIZER_INDEX_SELECT: \"datavisualizer_index_select\"; readonly DATA_VISUALIZER_FILE: \"filedatavisualizer\"; readonly DATA_VISUALIZER_INDEX_VIEWER: \"jobs/new_job/datavisualizer\"; readonly ANOMALY_DETECTION_CREATE_JOB: \"jobs/new_job\"; readonly ANOMALY_DETECTION_CREATE_JOB_RECOGNIZER: \"jobs/new_job/recognize\"; readonly ANOMALY_DETECTION_CREATE_JOB_SINGLE_METRIC: \"jobs/new_job/single_metric\"; readonly ANOMALY_DETECTION_CREATE_JOB_MULTI_METRIC: \"jobs/new_job/multi_metric\"; readonly ANOMALY_DETECTION_CREATE_JOB_CONVERT_TO_MULTI_METRIC: \"jobs/new_job/convert_to_multi_metric\"; readonly ANOMALY_DETECTION_CREATE_JOB_ADVANCED: \"jobs/new_job/advanced\"; readonly ANOMALY_DETECTION_CREATE_JOB_POPULATION: \"jobs/new_job/population\"; readonly ANOMALY_DETECTION_CREATE_JOB_CATEGORIZATION: \"jobs/new_job/categorization\"; readonly ANOMALY_DETECTION_CREATE_JOB_RARE: \"jobs/new_job/rare\"; readonly ANOMALY_DETECTION_CREATE_JOB_GEO: \"jobs/new_job/geo\"; readonly ANOMALY_DETECTION_CREATE_JOB_CONVERT_TO_ADVANCED: \"jobs/new_job/convert_to_advanced\"; readonly ANOMALY_DETECTION_CREATE_JOB_SELECT_TYPE: \"jobs/new_job/step/job_type\"; readonly ANOMALY_DETECTION_CREATE_JOB_SELECT_INDEX: \"jobs/new_job/step/index_or_search\"; readonly ANOMALY_DETECTION_CREATE_JOB_FROM_LENS: \"jobs/new_job/from_lens\"; readonly ANOMALY_DETECTION_CREATE_JOB_FROM_MAP: \"jobs/new_job/from_map\"; readonly ANOMALY_DETECTION_MODULES_VIEW_OR_CREATE: \"/modules/check_view_or_create\"; readonly SETTINGS: \"settings\"; readonly CALENDARS_MANAGE: \"settings/calendars_list\"; readonly CALENDARS_NEW: \"settings/calendars_list/new_calendar\"; readonly CALENDARS_EDIT: \"settings/calendars_list/edit_calendar\"; readonly FILTER_LISTS_MANAGE: \"settings/filter_lists\"; readonly FILTER_LISTS_NEW: \"settings/filter_lists/new_filter_list\"; readonly FILTER_LISTS_EDIT: \"settings/filter_lists/edit_filter_list\"; readonly ACCESS_DENIED: \"access-denied\"; readonly OVERVIEW: \"overview\"; readonly NOTIFICATIONS: \"notifications\"; readonly AIOPS: \"aiops\"; readonly AIOPS_EXPLAIN_LOG_RATE_SPIKES: \"aiops/explain_log_rate_spikes\"; readonly AIOPS_EXPLAIN_LOG_RATE_SPIKES_INDEX_SELECT: \"aiops/explain_log_rate_spikes_index_select\"; readonly AIOPS_LOG_CATEGORIZATION: \"aiops/log_categorization\"; readonly AIOPS_LOG_CATEGORIZATION_INDEX_SELECT: \"aiops/log_categorization_index_select\"; readonly AIOPS_CHANGE_POINT_DETECTION: \"aiops/change_point_detection\"; readonly AIOPS_CHANGE_POINT_DETECTION_INDEX_SELECT: \"aiops/change_point_detection_index_select\"; }" + "{ readonly ANOMALY_DETECTION_JOBS_MANAGE: \"jobs\"; readonly ANOMALY_EXPLORER: \"explorer\"; readonly SINGLE_METRIC_VIEWER: \"timeseriesexplorer\"; readonly DATA_FRAME_ANALYTICS_JOBS_MANAGE: \"data_frame_analytics\"; readonly DATA_FRAME_ANALYTICS_SOURCE_SELECTION: \"data_frame_analytics/source_selection\"; readonly DATA_FRAME_ANALYTICS_CREATE_JOB: \"data_frame_analytics/new_job\"; readonly TRAINED_MODELS_MANAGE: \"trained_models\"; readonly MEMORY_USAGE: \"memory_usage\"; readonly DATA_FRAME_ANALYTICS_EXPLORATION: \"data_frame_analytics/exploration\"; readonly DATA_FRAME_ANALYTICS_MAP: \"data_frame_analytics/map\"; readonly DATA_VISUALIZER: \"datavisualizer\"; readonly DATA_VISUALIZER_INDEX_SELECT: \"datavisualizer_index_select\"; readonly DATA_VISUALIZER_FILE: \"filedatavisualizer\"; readonly DATA_VISUALIZER_INDEX_VIEWER: \"jobs/new_job/datavisualizer\"; readonly ANOMALY_DETECTION_CREATE_JOB: \"jobs/new_job\"; readonly ANOMALY_DETECTION_CREATE_JOB_RECOGNIZER: \"jobs/new_job/recognize\"; readonly ANOMALY_DETECTION_CREATE_JOB_SINGLE_METRIC: \"jobs/new_job/single_metric\"; readonly ANOMALY_DETECTION_CREATE_JOB_MULTI_METRIC: \"jobs/new_job/multi_metric\"; readonly ANOMALY_DETECTION_CREATE_JOB_CONVERT_TO_MULTI_METRIC: \"jobs/new_job/convert_to_multi_metric\"; readonly ANOMALY_DETECTION_CREATE_JOB_ADVANCED: \"jobs/new_job/advanced\"; readonly ANOMALY_DETECTION_CREATE_JOB_POPULATION: \"jobs/new_job/population\"; readonly ANOMALY_DETECTION_CREATE_JOB_CATEGORIZATION: \"jobs/new_job/categorization\"; readonly ANOMALY_DETECTION_CREATE_JOB_RARE: \"jobs/new_job/rare\"; readonly ANOMALY_DETECTION_CREATE_JOB_GEO: \"jobs/new_job/geo\"; readonly ANOMALY_DETECTION_CREATE_JOB_CONVERT_TO_ADVANCED: \"jobs/new_job/convert_to_advanced\"; readonly ANOMALY_DETECTION_CREATE_JOB_SELECT_TYPE: \"jobs/new_job/step/job_type\"; readonly ANOMALY_DETECTION_CREATE_JOB_SELECT_INDEX: \"jobs/new_job/step/index_or_search\"; readonly ANOMALY_DETECTION_CREATE_JOB_FROM_LENS: \"jobs/new_job/from_lens\"; readonly ANOMALY_DETECTION_CREATE_JOB_FROM_MAP: \"jobs/new_job/from_map\"; readonly ANOMALY_DETECTION_MODULES_VIEW_OR_CREATE: \"modules/check_view_or_create\"; readonly SETTINGS: \"settings\"; readonly CALENDARS_MANAGE: \"settings/calendars_list\"; readonly CALENDARS_NEW: \"settings/calendars_list/new_calendar\"; readonly CALENDARS_EDIT: \"settings/calendars_list/edit_calendar\"; readonly FILTER_LISTS_MANAGE: \"settings/filter_lists\"; readonly FILTER_LISTS_NEW: \"settings/filter_lists/new_filter_list\"; readonly FILTER_LISTS_EDIT: \"settings/filter_lists/edit_filter_list\"; readonly ACCESS_DENIED: \"access-denied\"; readonly OVERVIEW: \"overview\"; readonly NOTIFICATIONS: \"notifications\"; readonly AIOPS: \"aiops\"; readonly AIOPS_EXPLAIN_LOG_RATE_SPIKES: \"aiops/explain_log_rate_spikes\"; readonly AIOPS_EXPLAIN_LOG_RATE_SPIKES_INDEX_SELECT: \"aiops/explain_log_rate_spikes_index_select\"; readonly AIOPS_LOG_CATEGORIZATION: \"aiops/log_categorization\"; readonly AIOPS_LOG_CATEGORIZATION_INDEX_SELECT: \"aiops/log_categorization_index_select\"; readonly AIOPS_CHANGE_POINT_DETECTION: \"aiops/change_point_detection\"; readonly AIOPS_CHANGE_POINT_DETECTION_INDEX_SELECT: \"aiops/change_point_detection_index_select\"; }" ], "path": "x-pack/plugins/ml/common/constants/locator.ts", "deprecated": false, diff --git a/api_docs/ml.mdx b/api_docs/ml.mdx index eb06159f2f6ab..d67628094763a 100644 --- a/api_docs/ml.mdx +++ b/api_docs/ml.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/ml title: "ml" image: https://source.unsplash.com/400x175/?github description: API docs for the ml plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'ml'] --- import mlObj from './ml.devdocs.json'; diff --git a/api_docs/monitoring.mdx b/api_docs/monitoring.mdx index d05078fa193c1..5dd07978760fc 100644 --- a/api_docs/monitoring.mdx +++ b/api_docs/monitoring.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/monitoring title: "monitoring" image: https://source.unsplash.com/400x175/?github description: API docs for the monitoring plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'monitoring'] --- import monitoringObj from './monitoring.devdocs.json'; diff --git a/api_docs/monitoring_collection.mdx b/api_docs/monitoring_collection.mdx index 192d984ea3a5c..b5d70cb8c827b 100644 --- a/api_docs/monitoring_collection.mdx +++ b/api_docs/monitoring_collection.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/monitoringCollection title: "monitoringCollection" image: https://source.unsplash.com/400x175/?github description: API docs for the monitoringCollection plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'monitoringCollection'] --- import monitoringCollectionObj from './monitoring_collection.devdocs.json'; diff --git a/api_docs/navigation.mdx b/api_docs/navigation.mdx index b0d05d781f546..c5622f9a10683 100644 --- a/api_docs/navigation.mdx +++ b/api_docs/navigation.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/navigation title: "navigation" image: https://source.unsplash.com/400x175/?github description: API docs for the navigation plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'navigation'] --- import navigationObj from './navigation.devdocs.json'; diff --git a/api_docs/newsfeed.mdx b/api_docs/newsfeed.mdx index 60c19eb9a71cc..5c631c7b93b76 100644 --- a/api_docs/newsfeed.mdx +++ b/api_docs/newsfeed.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/newsfeed title: "newsfeed" image: https://source.unsplash.com/400x175/?github description: API docs for the newsfeed plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'newsfeed'] --- import newsfeedObj from './newsfeed.devdocs.json'; diff --git a/api_docs/notifications.mdx b/api_docs/notifications.mdx index 07f0428038f1e..6f06c2c2b066e 100644 --- a/api_docs/notifications.mdx +++ b/api_docs/notifications.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/notifications title: "notifications" image: https://source.unsplash.com/400x175/?github description: API docs for the notifications plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'notifications'] --- import notificationsObj from './notifications.devdocs.json'; diff --git a/api_docs/observability.devdocs.json b/api_docs/observability.devdocs.json index df3ecc2382fd7..c1519112d0af0 100644 --- a/api_docs/observability.devdocs.json +++ b/api_docs/observability.devdocs.json @@ -12857,6 +12857,214 @@ } ] }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableServiceMetrics", + "type": "Object", + "tags": [], + "label": "[apmEnableServiceMetrics]", + "description": [], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableServiceMetrics.category", + "type": "Array", + "tags": [], + "label": "category", + "description": [], + "signature": [ + "string[]" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableServiceMetrics.name", + "type": "Any", + "tags": [], + "label": "name", + "description": [], + "signature": [ + "any" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableServiceMetrics.value", + "type": "boolean", + "tags": [], + "label": "value", + "description": [], + "signature": [ + "true" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableServiceMetrics.description", + "type": "Any", + "tags": [], + "label": "description", + "description": [], + "signature": [ + "any" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableServiceMetrics.schema", + "type": "Object", + "tags": [], + "label": "schema", + "description": [], + "signature": [ + { + "pluginId": "@kbn/config-schema", + "scope": "common", + "docId": "kibKbnConfigSchemaPluginApi", + "section": "def-common.Type", + "text": "Type" + }, + "" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableServiceMetrics.requiresPageReload", + "type": "boolean", + "tags": [], + "label": "requiresPageReload", + "description": [], + "signature": [ + "true" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + } + ] + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableContinuousRollups", + "type": "Object", + "tags": [], + "label": "[apmEnableContinuousRollups]", + "description": [], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableContinuousRollups.category", + "type": "Array", + "tags": [], + "label": "category", + "description": [], + "signature": [ + "string[]" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableContinuousRollups.name", + "type": "Any", + "tags": [], + "label": "name", + "description": [], + "signature": [ + "any" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableContinuousRollups.value", + "type": "boolean", + "tags": [], + "label": "value", + "description": [], + "signature": [ + "true" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableContinuousRollups.description", + "type": "Any", + "tags": [], + "label": "description", + "description": [], + "signature": [ + "any" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableContinuousRollups.schema", + "type": "Object", + "tags": [], + "label": "schema", + "description": [], + "signature": [ + { + "pluginId": "@kbn/config-schema", + "scope": "common", + "docId": "kibKbnConfigSchemaPluginApi", + "section": "def-common.Type", + "text": "Type" + }, + "" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "observability", + "id": "def-server.uiSettings.apmEnableContinuousRollups.requiresPageReload", + "type": "boolean", + "tags": [], + "label": "requiresPageReload", + "description": [], + "signature": [ + "true" + ], + "path": "x-pack/plugins/observability/server/ui_settings.ts", + "deprecated": false, + "trackAdoption": false + } + ] + }, { "parentPluginId": "observability", "id": "def-server.uiSettings.enableCriticalPath", @@ -13493,6 +13701,36 @@ "trackAdoption": false, "initialIsOpen": false }, + { + "parentPluginId": "observability", + "id": "def-common.apmEnableContinuousRollups", + "type": "string", + "tags": [], + "label": "apmEnableContinuousRollups", + "description": [], + "signature": [ + "\"observability:apmEnableContinuousRollups\"" + ], + "path": "x-pack/plugins/observability/common/ui_settings_keys.ts", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, + { + "parentPluginId": "observability", + "id": "def-common.apmEnableServiceMetrics", + "type": "string", + "tags": [], + "label": "apmEnableServiceMetrics", + "description": [], + "signature": [ + "\"observability:apmEnableServiceMetrics\"" + ], + "path": "x-pack/plugins/observability/common/ui_settings_keys.ts", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, { "parentPluginId": "observability", "id": "def-common.apmLabsButton", diff --git a/api_docs/observability.mdx b/api_docs/observability.mdx index 961ee4c3532bd..1ef0957710d9c 100644 --- a/api_docs/observability.mdx +++ b/api_docs/observability.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/observability title: "observability" image: https://source.unsplash.com/400x175/?github description: API docs for the observability plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'observability'] --- import observabilityObj from './observability.devdocs.json'; @@ -21,7 +21,7 @@ Contact [Observability UI](https://github.com/orgs/elastic/teams/observability-u | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 598 | 39 | 592 | 32 | +| 614 | 43 | 608 | 32 | ## Client diff --git a/api_docs/osquery.mdx b/api_docs/osquery.mdx index c104339237870..903035dd74eb5 100644 --- a/api_docs/osquery.mdx +++ b/api_docs/osquery.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/osquery title: "osquery" image: https://source.unsplash.com/400x175/?github description: API docs for the osquery plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'osquery'] --- import osqueryObj from './osquery.devdocs.json'; diff --git a/api_docs/plugin_directory.mdx b/api_docs/plugin_directory.mdx index 3e388c16b1d10..1b7df39170081 100644 --- a/api_docs/plugin_directory.mdx +++ b/api_docs/plugin_directory.mdx @@ -7,7 +7,7 @@ id: kibDevDocsPluginDirectory slug: /kibana-dev-docs/api-meta/plugin-api-directory title: Directory description: Directory of public APIs available through plugins or packages. -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana'] --- @@ -15,13 +15,13 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | Count | Plugins or Packages with a
public API | Number of teams | |--------------|----------|------------------------| -| 570 | 469 | 45 | +| 571 | 470 | 45 | ### Public API health stats | API Count | Any Count | Missing comments | Missing exports | |--------------|----------|-----------------|--------| -| 70199 | 525 | 59391 | 1218 | +| 70277 | 529 | 59452 | 1221 | ## Plugin Directory @@ -30,7 +30,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | [Response Ops](https://github.com/orgs/elastic/teams/response-ops) | - | 256 | 8 | 251 | 24 | | | [Kibana Core](https://github.com/orgs/elastic/teams/kibana-core) | - | 36 | 1 | 32 | 2 | | | [Machine Learning UI](https://github.com/orgs/elastic/teams/ml-ui) | AIOps plugin maintained by ML team. | 12 | 0 | 1 | 2 | -| | [Response Ops](https://github.com/orgs/elastic/teams/response-ops) | - | 471 | 1 | 461 | 39 | +| | [Response Ops](https://github.com/orgs/elastic/teams/response-ops) | - | 476 | 1 | 466 | 39 | | | [APM UI](https://github.com/orgs/elastic/teams/apm-ui) | The user interface for Elastic APM | 42 | 0 | 42 | 65 | | | [Kibana Core](https://github.com/orgs/elastic/teams/kibana-core) | - | 9 | 0 | 9 | 0 | | | [App Services](https://github.com/orgs/elastic/teams/kibana-app-services) | Considering using bfetch capabilities when fetching large amounts of data. This services supports batching HTTP requests and streaming responses back. | 89 | 1 | 74 | 2 | @@ -47,9 +47,9 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | cloudLinks | [Kibana Core](https://github.com/orgs/elastic/teams/@kibana-core) | Adds the links to the Elastic Cloud console | 0 | 0 | 0 | 0 | | | [Cloud Security Posture](https://github.com/orgs/elastic/teams/cloud-posture-security) | The cloud security posture plugin | 17 | 0 | 2 | 2 | | | [Stack Management](https://github.com/orgs/elastic/teams/kibana-stack-management) | - | 13 | 0 | 13 | 1 | -| | [@elastic/kibana-global-experience](https://github.com/orgs/elastic/teams/@elastic/kibana-global-experience) | Content management app | 5 | 0 | 5 | 0 | +| | [@elastic/kibana-global-experience](https://github.com/orgs/elastic/teams/@elastic/kibana-global-experience) | Content management app | 22 | 0 | 22 | 1 | | | [Kibana Presentation](https://github.com/orgs/elastic/teams/kibana-presentation) | The Controls Plugin contains embeddable components intended to create a simple query interface for end users, and a powerful editing suite that allows dashboard authors to build controls | 270 | 0 | 266 | 9 | -| | [Kibana Core](https://github.com/orgs/elastic/teams/kibana-core) | - | 2845 | 17 | 1029 | 0 | +| | [Kibana Core](https://github.com/orgs/elastic/teams/kibana-core) | - | 2848 | 17 | 1030 | 0 | | crossClusterReplication | [Stack Management](https://github.com/orgs/elastic/teams/kibana-stack-management) | - | 0 | 0 | 0 | 0 | | customBranding | [global-experience](https://github.com/orgs/elastic/teams/kibana-global-experience) | Enables customization of Kibana | 0 | 0 | 0 | 0 | | | [Fleet](https://github.com/orgs/elastic/teams/fleet) | Add custom data integrations so they can be displayed in the Fleet integrations app | 107 | 0 | 88 | 1 | @@ -91,7 +91,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | [Machine Learning UI](https://github.com/orgs/elastic/teams/ml-ui) | The file upload plugin contains components and services for uploading a file, analyzing its data, and then importing the data into an Elasticsearch index. Supported file types include CSV, TSV, newline-delimited JSON and GeoJSON. | 62 | 0 | 62 | 2 | | | [@elastic/kibana-app-services](https://github.com/orgs/elastic/teams/team:AppServicesUx) | File upload, download, sharing, and serving over HTTP implementation in Kibana. | 254 | 1 | 45 | 5 | | | [@elastic/appex-sharedux](https://github.com/orgs/elastic/teams/@elastic/appex-sharedux) | Simple UI for managing files in Kibana | 2 | 1 | 2 | 0 | -| | [Fleet](https://github.com/orgs/elastic/teams/fleet) | - | 1068 | 3 | 963 | 26 | +| | [Fleet](https://github.com/orgs/elastic/teams/fleet) | - | 1069 | 3 | 964 | 26 | | ftrApis | [Core](https://github.com/orgs/elastic/teams/kibana-core) | - | 0 | 0 | 0 | 0 | | | [Kibana Core](https://github.com/orgs/elastic/teams/kibana-core) | - | 68 | 0 | 14 | 5 | | globalSearchBar | [Kibana Core](https://github.com/orgs/elastic/teams/kibana-core) | - | 0 | 0 | 0 | 0 | @@ -117,7 +117,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | [Stack Management](https://github.com/orgs/elastic/teams/kibana-stack-management) | - | 8 | 0 | 8 | 0 | | | [Stack Management](https://github.com/orgs/elastic/teams/kibana-stack-management) | - | 3 | 0 | 3 | 0 | | | [Kibana Core](https://github.com/orgs/elastic/teams/kibana-core) | - | 117 | 0 | 42 | 10 | -| | [Security detections response](https://github.com/orgs/elastic/teams/security-detections-response) | - | 206 | 0 | 93 | 51 | +| | [Security detections response](https://github.com/orgs/elastic/teams/security-detections-response) | - | 208 | 0 | 93 | 51 | | logstash | [Logstash](https://github.com/orgs/elastic/teams/logstash) | - | 0 | 0 | 0 | 0 | | | [Vis Editors](https://github.com/orgs/elastic/teams/kibana-visualizations) | - | 41 | 0 | 41 | 6 | | | [GIS](https://github.com/orgs/elastic/teams/kibana-gis) | - | 267 | 0 | 266 | 27 | @@ -128,7 +128,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | [App Services](https://github.com/orgs/elastic/teams/kibana-app-services) | - | 34 | 0 | 34 | 2 | | | [Kibana Core](https://github.com/orgs/elastic/teams/kibana-core) | - | 17 | 0 | 17 | 0 | | | [App Services](https://github.com/orgs/elastic/teams/kibana-app-services) | - | 2 | 0 | 2 | 1 | -| | [Observability UI](https://github.com/orgs/elastic/teams/observability-ui) | - | 598 | 39 | 592 | 32 | +| | [Observability UI](https://github.com/orgs/elastic/teams/observability-ui) | - | 614 | 43 | 608 | 32 | | | [Security asset management](https://github.com/orgs/elastic/teams/security-asset-management) | - | 24 | 0 | 24 | 7 | | painlessLab | [Stack Management](https://github.com/orgs/elastic/teams/kibana-stack-management) | - | 0 | 0 | 0 | 0 | | | [Kibana Presentation](https://github.com/orgs/elastic/teams/kibana-presentation) | The Presentation Utility Plugin is a set of common, shared components and toolkits for solutions within the Presentation space, (e.g. Dashboards, Canvas). | 217 | 7 | 161 | 11 | @@ -169,7 +169,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | [App Services](https://github.com/orgs/elastic/teams/kibana-app-services) | Adds UI Actions service to Kibana | 134 | 2 | 92 | 9 | | | [App Services](https://github.com/orgs/elastic/teams/kibana-app-services) | Extends UI Actions plugin with more functionality | 206 | 0 | 140 | 9 | | | [Data Discovery](https://github.com/orgs/elastic/teams/kibana-data-discovery) | Contains functionality for the field list which can be integrated into apps | 267 | 0 | 242 | 7 | -| | [Data Discovery](https://github.com/orgs/elastic/teams/kibana-data-discovery) | The `unifiedHistogram` plugin provides UI components to create a layout including a resizable histogram and a main display. | 63 | 0 | 16 | 1 | +| | [Data Discovery](https://github.com/orgs/elastic/teams/kibana-data-discovery) | The `unifiedHistogram` plugin provides UI components to create a layout including a resizable histogram and a main display. | 61 | 0 | 23 | 1 | | | [Visualizations](https://github.com/orgs/elastic/teams/kibana-visualizations) | Contains all the key functionality of Kibana's unified search experience.Contains all the key functionality of Kibana's unified search experience. | 134 | 2 | 99 | 20 | | upgradeAssistant | [Stack Management](https://github.com/orgs/elastic/teams/kibana-stack-management) | - | 0 | 0 | 0 | 0 | | urlDrilldown | [App Services](https://github.com/orgs/elastic/teams/kibana-app-services) | Adds drilldown implementations to Kibana | 0 | 0 | 0 | 0 | @@ -200,6 +200,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | Machine Learning UI | React components for AIOps related efforts. | 6 | 0 | 6 | 0 | | | Machine Learning UI | Static utilities for AIOps related efforts. | 53 | 0 | 22 | 0 | | | [Owner missing] | Alerts components and hooks | 9 | 1 | 9 | 0 | +| | [Owner missing] | - | 5 | 0 | 4 | 0 | | | Kibana Core | Kibana Analytics tool | 73 | 0 | 73 | 2 | | | Kibana Core | - | 98 | 0 | 0 | 0 | | | Kibana Core | - | 19 | 0 | 0 | 0 | @@ -297,7 +298,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | Kibana Core | - | 25 | 5 | 25 | 1 | | | Kibana Core | - | 7 | 0 | 7 | 1 | | | Kibana Core | - | 403 | 1 | 160 | 0 | -| | Kibana Core | - | 54 | 0 | 48 | 6 | +| | Kibana Core | - | 55 | 0 | 49 | 6 | | | Kibana Core | - | 41 | 0 | 40 | 0 | | | Kibana Core | - | 4 | 0 | 2 | 0 | | | Kibana Core | - | 3 | 0 | 3 | 0 | @@ -355,7 +356,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | Kibana Core | - | 4 | 0 | 4 | 0 | | | Kibana Core | - | 112 | 0 | 79 | 45 | | | Kibana Core | - | 12 | 0 | 12 | 0 | -| | Kibana Core | - | 329 | 0 | 96 | 1 | +| | Kibana Core | - | 358 | 0 | 104 | 1 | | | Kibana Core | - | 69 | 0 | 69 | 4 | | | Kibana Core | - | 14 | 0 | 14 | 0 | | | Kibana Core | - | 108 | 1 | 84 | 0 | @@ -367,7 +368,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | Kibana Core | - | 11 | 0 | 11 | 0 | | | Kibana Core | - | 5 | 0 | 5 | 0 | | | Kibana Core | - | 54 | 1 | 48 | 0 | -| | Kibana Core | - | 13 | 0 | 12 | 0 | +| | Kibana Core | - | 15 | 0 | 14 | 1 | | | [Owner missing] | - | 9 | 0 | 9 | 0 | | | Kibana Core | - | 6 | 0 | 4 | 0 | | | Kibana Core | - | 2 | 0 | 1 | 0 | @@ -407,7 +408,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | [Owner missing] | - | 1 | 0 | 0 | 0 | | | [Owner missing] | - | 6 | 0 | 0 | 0 | | | [Owner missing] | - | 52 | 0 | 50 | 2 | -| | [Owner missing] | - | 21 | 1 | 14 | 0 | +| | [Owner missing] | - | 10 | 1 | 4 | 1 | | | [Owner missing] | - | 3 | 0 | 3 | 0 | | | Kibana Core | - | 1 | 0 | 1 | 0 | | | [Owner missing] | - | 32 | 0 | 22 | 0 | @@ -427,7 +428,7 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | [Owner missing] | - | 6 | 0 | 1 | 1 | | | [Owner missing] | - | 534 | 1 | 1 | 0 | | | Machine Learning UI | This package includes utility functions related to creating elasticsearch aggregation queries, data manipulation and verification. | 83 | 2 | 59 | 0 | -| | [Owner missing] | - | 49 | 0 | 4 | 0 | +| | [Owner missing] | - | 50 | 0 | 4 | 0 | | | [Owner missing] | - | 2 | 0 | 0 | 0 | | | Machine Learning UI | A type guard to check record like object structures. | 3 | 0 | 2 | 0 | | | Machine Learning UI | Utilities to combine url state management with local storage. | 5 | 0 | 3 | 0 | @@ -455,13 +456,13 @@ tags: ['contributor', 'dev', 'apidocs', 'kibana'] | | [Owner missing] | - | 104 | 0 | 93 | 1 | | | [Owner missing] | Security Solution utilities for React hooks | 15 | 0 | 7 | 0 | | | [Owner missing] | io ts utilities and types to be shared with plugins from the security solution project | 138 | 0 | 119 | 0 | -| | [Owner missing] | io ts utilities and types to be shared with plugins from the security solution project | 511 | 1 | 498 | 0 | +| | [Owner missing] | io ts utilities and types to be shared with plugins from the security solution project | 516 | 1 | 503 | 0 | | | [Owner missing] | io ts utilities and types to be shared with plugins from the security solution project | 65 | 0 | 36 | 0 | | | [Owner missing] | io ts utilities and types to be shared with plugins from the security solution project | 28 | 0 | 21 | 0 | | | [Owner missing] | security solution list REST API | 67 | 0 | 64 | 0 | | | [Owner missing] | security solution list constants to use across plugins such lists, security_solution, cases, etc... | 35 | 0 | 23 | 0 | | | [Owner missing] | Security solution list ReactJS hooks | 60 | 0 | 47 | 0 | -| | [Owner missing] | security solution list utilities | 202 | 10 | 155 | 0 | +| | [Owner missing] | security solution list utilities | 206 | 10 | 159 | 0 | | | [Owner missing] | security solution rule utilities to use across plugins | 26 | 0 | 23 | 0 | | | [Owner missing] | security solution t-grid packages will allow sharing components between timelines and security_solution plugin until we transfer all functionality to timelines plugin | 120 | 0 | 116 | 0 | | | [Owner missing] | security solution utilities to use across plugins such lists, security_solution, cases, etc... | 31 | 2 | 29 | 0 | diff --git a/api_docs/presentation_util.mdx b/api_docs/presentation_util.mdx index 03c1f4acb2680..2d00dd7fc3b7c 100644 --- a/api_docs/presentation_util.mdx +++ b/api_docs/presentation_util.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/presentationUtil title: "presentationUtil" image: https://source.unsplash.com/400x175/?github description: API docs for the presentationUtil plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'presentationUtil'] --- import presentationUtilObj from './presentation_util.devdocs.json'; diff --git a/api_docs/profiling.devdocs.json b/api_docs/profiling.devdocs.json index 035a78aebe58c..10f7adf5bc3bc 100644 --- a/api_docs/profiling.devdocs.json +++ b/api_docs/profiling.devdocs.json @@ -104,7 +104,7 @@ "label": "getRoutePaths", "description": [], "signature": [ - "() => { TopN: string; TopNContainers: string; TopNDeployments: string; TopNFunctions: string; TopNHosts: string; TopNThreads: string; TopNTraces: string; Flamechart: string; CacheExecutables: string; CacheStackFrames: string; }" + "() => { TopN: string; TopNContainers: string; TopNDeployments: string; TopNFunctions: string; TopNHosts: string; TopNThreads: string; TopNTraces: string; Flamechart: string; CacheExecutables: string; CacheStackFrames: string; HasSetupESResources: string; HasSetupDataCollection: string; SetupDataCollectionInstructions: string; }" ], "path": "x-pack/plugins/profiling/common/index.ts", "deprecated": false, diff --git a/api_docs/profiling.mdx b/api_docs/profiling.mdx index 4148815eefdf4..f94a329646a66 100644 --- a/api_docs/profiling.mdx +++ b/api_docs/profiling.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/profiling title: "profiling" image: https://source.unsplash.com/400x175/?github description: API docs for the profiling plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'profiling'] --- import profilingObj from './profiling.devdocs.json'; diff --git a/api_docs/remote_clusters.mdx b/api_docs/remote_clusters.mdx index e38dd73a1d13d..c291c3d708b5b 100644 --- a/api_docs/remote_clusters.mdx +++ b/api_docs/remote_clusters.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/remoteClusters title: "remoteClusters" image: https://source.unsplash.com/400x175/?github description: API docs for the remoteClusters plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'remoteClusters'] --- import remoteClustersObj from './remote_clusters.devdocs.json'; diff --git a/api_docs/reporting.mdx b/api_docs/reporting.mdx index 17a918294935d..7d6ae021aa183 100644 --- a/api_docs/reporting.mdx +++ b/api_docs/reporting.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/reporting title: "reporting" image: https://source.unsplash.com/400x175/?github description: API docs for the reporting plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'reporting'] --- import reportingObj from './reporting.devdocs.json'; diff --git a/api_docs/rollup.mdx b/api_docs/rollup.mdx index 1fc983ed105d5..f273be32bc2a7 100644 --- a/api_docs/rollup.mdx +++ b/api_docs/rollup.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/rollup title: "rollup" image: https://source.unsplash.com/400x175/?github description: API docs for the rollup plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'rollup'] --- import rollupObj from './rollup.devdocs.json'; diff --git a/api_docs/rule_registry.mdx b/api_docs/rule_registry.mdx index 76d668d8caa65..2b4236d6a1553 100644 --- a/api_docs/rule_registry.mdx +++ b/api_docs/rule_registry.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/ruleRegistry title: "ruleRegistry" image: https://source.unsplash.com/400x175/?github description: API docs for the ruleRegistry plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'ruleRegistry'] --- import ruleRegistryObj from './rule_registry.devdocs.json'; diff --git a/api_docs/runtime_fields.mdx b/api_docs/runtime_fields.mdx index 0c2f66b4944e2..a8252100dc1d6 100644 --- a/api_docs/runtime_fields.mdx +++ b/api_docs/runtime_fields.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/runtimeFields title: "runtimeFields" image: https://source.unsplash.com/400x175/?github description: API docs for the runtimeFields plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'runtimeFields'] --- import runtimeFieldsObj from './runtime_fields.devdocs.json'; diff --git a/api_docs/saved_objects.mdx b/api_docs/saved_objects.mdx index cf7a001a620b2..c27003a30f94a 100644 --- a/api_docs/saved_objects.mdx +++ b/api_docs/saved_objects.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/savedObjects title: "savedObjects" image: https://source.unsplash.com/400x175/?github description: API docs for the savedObjects plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'savedObjects'] --- import savedObjectsObj from './saved_objects.devdocs.json'; diff --git a/api_docs/saved_objects_finder.mdx b/api_docs/saved_objects_finder.mdx index db78b1aabc68c..43b2a97ac3d03 100644 --- a/api_docs/saved_objects_finder.mdx +++ b/api_docs/saved_objects_finder.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/savedObjectsFinder title: "savedObjectsFinder" image: https://source.unsplash.com/400x175/?github description: API docs for the savedObjectsFinder plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'savedObjectsFinder'] --- import savedObjectsFinderObj from './saved_objects_finder.devdocs.json'; diff --git a/api_docs/saved_objects_management.mdx b/api_docs/saved_objects_management.mdx index 4377f1beac2e2..e7c19ce3b9108 100644 --- a/api_docs/saved_objects_management.mdx +++ b/api_docs/saved_objects_management.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/savedObjectsManagement title: "savedObjectsManagement" image: https://source.unsplash.com/400x175/?github description: API docs for the savedObjectsManagement plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'savedObjectsManagement'] --- import savedObjectsManagementObj from './saved_objects_management.devdocs.json'; diff --git a/api_docs/saved_objects_tagging.mdx b/api_docs/saved_objects_tagging.mdx index 8c73088fa2659..b494ad068691d 100644 --- a/api_docs/saved_objects_tagging.mdx +++ b/api_docs/saved_objects_tagging.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/savedObjectsTagging title: "savedObjectsTagging" image: https://source.unsplash.com/400x175/?github description: API docs for the savedObjectsTagging plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'savedObjectsTagging'] --- import savedObjectsTaggingObj from './saved_objects_tagging.devdocs.json'; diff --git a/api_docs/saved_objects_tagging_oss.mdx b/api_docs/saved_objects_tagging_oss.mdx index cfe1398a962a6..c0a4a057dbfc9 100644 --- a/api_docs/saved_objects_tagging_oss.mdx +++ b/api_docs/saved_objects_tagging_oss.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/savedObjectsTaggingOss title: "savedObjectsTaggingOss" image: https://source.unsplash.com/400x175/?github description: API docs for the savedObjectsTaggingOss plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'savedObjectsTaggingOss'] --- import savedObjectsTaggingOssObj from './saved_objects_tagging_oss.devdocs.json'; diff --git a/api_docs/saved_search.mdx b/api_docs/saved_search.mdx index 2ced43ac416dc..b2acb4a2cee7d 100644 --- a/api_docs/saved_search.mdx +++ b/api_docs/saved_search.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/savedSearch title: "savedSearch" image: https://source.unsplash.com/400x175/?github description: API docs for the savedSearch plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'savedSearch'] --- import savedSearchObj from './saved_search.devdocs.json'; diff --git a/api_docs/screenshot_mode.mdx b/api_docs/screenshot_mode.mdx index 5dcdb0e78d97e..bece61ddeb3f3 100644 --- a/api_docs/screenshot_mode.mdx +++ b/api_docs/screenshot_mode.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/screenshotMode title: "screenshotMode" image: https://source.unsplash.com/400x175/?github description: API docs for the screenshotMode plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'screenshotMode'] --- import screenshotModeObj from './screenshot_mode.devdocs.json'; diff --git a/api_docs/screenshotting.mdx b/api_docs/screenshotting.mdx index 370529b6a6a98..984bbfbcee17b 100644 --- a/api_docs/screenshotting.mdx +++ b/api_docs/screenshotting.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/screenshotting title: "screenshotting" image: https://source.unsplash.com/400x175/?github description: API docs for the screenshotting plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'screenshotting'] --- import screenshottingObj from './screenshotting.devdocs.json'; diff --git a/api_docs/security.mdx b/api_docs/security.mdx index 78ff2f6aaff02..7a612da59190c 100644 --- a/api_docs/security.mdx +++ b/api_docs/security.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/security title: "security" image: https://source.unsplash.com/400x175/?github description: API docs for the security plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'security'] --- import securityObj from './security.devdocs.json'; diff --git a/api_docs/security_solution.mdx b/api_docs/security_solution.mdx index cc4bdbfdcdc83..7146bc36bad15 100644 --- a/api_docs/security_solution.mdx +++ b/api_docs/security_solution.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/securitySolution title: "securitySolution" image: https://source.unsplash.com/400x175/?github description: API docs for the securitySolution plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'securitySolution'] --- import securitySolutionObj from './security_solution.devdocs.json'; diff --git a/api_docs/session_view.mdx b/api_docs/session_view.mdx index c286437356f5b..fb819b9b9d84a 100644 --- a/api_docs/session_view.mdx +++ b/api_docs/session_view.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/sessionView title: "sessionView" image: https://source.unsplash.com/400x175/?github description: API docs for the sessionView plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'sessionView'] --- import sessionViewObj from './session_view.devdocs.json'; diff --git a/api_docs/share.mdx b/api_docs/share.mdx index c698baa7152db..5e0ba91e52847 100644 --- a/api_docs/share.mdx +++ b/api_docs/share.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/share title: "share" image: https://source.unsplash.com/400x175/?github description: API docs for the share plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'share'] --- import shareObj from './share.devdocs.json'; diff --git a/api_docs/snapshot_restore.mdx b/api_docs/snapshot_restore.mdx index 881af5e8dfa24..d9a745375314d 100644 --- a/api_docs/snapshot_restore.mdx +++ b/api_docs/snapshot_restore.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/snapshotRestore title: "snapshotRestore" image: https://source.unsplash.com/400x175/?github description: API docs for the snapshotRestore plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'snapshotRestore'] --- import snapshotRestoreObj from './snapshot_restore.devdocs.json'; diff --git a/api_docs/spaces.mdx b/api_docs/spaces.mdx index 0e6ee0a35f11b..3173b3468d392 100644 --- a/api_docs/spaces.mdx +++ b/api_docs/spaces.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/spaces title: "spaces" image: https://source.unsplash.com/400x175/?github description: API docs for the spaces plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'spaces'] --- import spacesObj from './spaces.devdocs.json'; diff --git a/api_docs/stack_alerts.mdx b/api_docs/stack_alerts.mdx index 6b1c54c5e45c9..3901be8abc82e 100644 --- a/api_docs/stack_alerts.mdx +++ b/api_docs/stack_alerts.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/stackAlerts title: "stackAlerts" image: https://source.unsplash.com/400x175/?github description: API docs for the stackAlerts plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'stackAlerts'] --- import stackAlertsObj from './stack_alerts.devdocs.json'; diff --git a/api_docs/stack_connectors.mdx b/api_docs/stack_connectors.mdx index d52f86ad8d6ae..c884b8c8b6671 100644 --- a/api_docs/stack_connectors.mdx +++ b/api_docs/stack_connectors.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/stackConnectors title: "stackConnectors" image: https://source.unsplash.com/400x175/?github description: API docs for the stackConnectors plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'stackConnectors'] --- import stackConnectorsObj from './stack_connectors.devdocs.json'; diff --git a/api_docs/task_manager.mdx b/api_docs/task_manager.mdx index 5d260a89bf443..0500a156b6786 100644 --- a/api_docs/task_manager.mdx +++ b/api_docs/task_manager.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/taskManager title: "taskManager" image: https://source.unsplash.com/400x175/?github description: API docs for the taskManager plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'taskManager'] --- import taskManagerObj from './task_manager.devdocs.json'; diff --git a/api_docs/telemetry.mdx b/api_docs/telemetry.mdx index 01af319f3bda4..bb782eda7bfdd 100644 --- a/api_docs/telemetry.mdx +++ b/api_docs/telemetry.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/telemetry title: "telemetry" image: https://source.unsplash.com/400x175/?github description: API docs for the telemetry plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'telemetry'] --- import telemetryObj from './telemetry.devdocs.json'; diff --git a/api_docs/telemetry_collection_manager.mdx b/api_docs/telemetry_collection_manager.mdx index c86d8166f16f9..4df7964b466c0 100644 --- a/api_docs/telemetry_collection_manager.mdx +++ b/api_docs/telemetry_collection_manager.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/telemetryCollectionManager title: "telemetryCollectionManager" image: https://source.unsplash.com/400x175/?github description: API docs for the telemetryCollectionManager plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'telemetryCollectionManager'] --- import telemetryCollectionManagerObj from './telemetry_collection_manager.devdocs.json'; diff --git a/api_docs/telemetry_collection_xpack.mdx b/api_docs/telemetry_collection_xpack.mdx index 59e2d2847e0dd..421c6e80b9b14 100644 --- a/api_docs/telemetry_collection_xpack.mdx +++ b/api_docs/telemetry_collection_xpack.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/telemetryCollectionXpack title: "telemetryCollectionXpack" image: https://source.unsplash.com/400x175/?github description: API docs for the telemetryCollectionXpack plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'telemetryCollectionXpack'] --- import telemetryCollectionXpackObj from './telemetry_collection_xpack.devdocs.json'; diff --git a/api_docs/telemetry_management_section.mdx b/api_docs/telemetry_management_section.mdx index 0594a57e39211..7cd17cdd23fef 100644 --- a/api_docs/telemetry_management_section.mdx +++ b/api_docs/telemetry_management_section.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/telemetryManagementSection title: "telemetryManagementSection" image: https://source.unsplash.com/400x175/?github description: API docs for the telemetryManagementSection plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'telemetryManagementSection'] --- import telemetryManagementSectionObj from './telemetry_management_section.devdocs.json'; diff --git a/api_docs/threat_intelligence.mdx b/api_docs/threat_intelligence.mdx index e2621fa11d1ab..080ca2a6d3ee5 100644 --- a/api_docs/threat_intelligence.mdx +++ b/api_docs/threat_intelligence.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/threatIntelligence title: "threatIntelligence" image: https://source.unsplash.com/400x175/?github description: API docs for the threatIntelligence plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'threatIntelligence'] --- import threatIntelligenceObj from './threat_intelligence.devdocs.json'; diff --git a/api_docs/timelines.devdocs.json b/api_docs/timelines.devdocs.json index a0b03b6f182b4..1c87640cc7f23 100644 --- a/api_docs/timelines.devdocs.json +++ b/api_docs/timelines.devdocs.json @@ -2388,7 +2388,7 @@ "label": "value", "description": [], "signature": [ - "string | number | (string | number)[]" + "string | number | boolean | (string | number | boolean)[]" ], "path": "x-pack/plugins/timelines/common/types/timeline/data_provider/index.ts", "deprecated": false, @@ -2402,7 +2402,7 @@ "label": "displayValue", "description": [], "signature": [ - "string | number | undefined" + "string | number | boolean | undefined" ], "path": "x-pack/plugins/timelines/common/types/timeline/data_provider/index.ts", "deprecated": false, diff --git a/api_docs/timelines.mdx b/api_docs/timelines.mdx index c8d8886c92dd1..12b767bcd392b 100644 --- a/api_docs/timelines.mdx +++ b/api_docs/timelines.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/timelines title: "timelines" image: https://source.unsplash.com/400x175/?github description: API docs for the timelines plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'timelines'] --- import timelinesObj from './timelines.devdocs.json'; diff --git a/api_docs/transform.mdx b/api_docs/transform.mdx index d381c66753f23..dc044d96529bb 100644 --- a/api_docs/transform.mdx +++ b/api_docs/transform.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/transform title: "transform" image: https://source.unsplash.com/400x175/?github description: API docs for the transform plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'transform'] --- import transformObj from './transform.devdocs.json'; diff --git a/api_docs/triggers_actions_ui.devdocs.json b/api_docs/triggers_actions_ui.devdocs.json index 727eba233d35b..9e7b341daabc3 100644 --- a/api_docs/triggers_actions_ui.devdocs.json +++ b/api_docs/triggers_actions_ui.devdocs.json @@ -8561,9 +8561,9 @@ "description": [], "signature": [ "(props: ", - "RulesListNotifyBadgeProps", + "RulesListNotifyBadgePropsWithApi", ") => React.ReactElement<", - "RulesListNotifyBadgeProps", + "RulesListNotifyBadgePropsWithApi", ", string | React.JSXElementConstructor>" ], "path": "x-pack/plugins/triggers_actions_ui/public/plugin.ts", @@ -8578,7 +8578,7 @@ "label": "props", "description": [], "signature": [ - "RulesListNotifyBadgeProps" + "RulesListNotifyBadgePropsWithApi" ], "path": "x-pack/plugins/triggers_actions_ui/public/plugin.ts", "deprecated": false, diff --git a/api_docs/triggers_actions_ui.mdx b/api_docs/triggers_actions_ui.mdx index 1a60684e2242a..5e0415688da41 100644 --- a/api_docs/triggers_actions_ui.mdx +++ b/api_docs/triggers_actions_ui.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/triggersActionsUi title: "triggersActionsUi" image: https://source.unsplash.com/400x175/?github description: API docs for the triggersActionsUi plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'triggersActionsUi'] --- import triggersActionsUiObj from './triggers_actions_ui.devdocs.json'; diff --git a/api_docs/ui_actions.mdx b/api_docs/ui_actions.mdx index ac0099c091616..2d2aea7f1e51a 100644 --- a/api_docs/ui_actions.mdx +++ b/api_docs/ui_actions.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/uiActions title: "uiActions" image: https://source.unsplash.com/400x175/?github description: API docs for the uiActions plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'uiActions'] --- import uiActionsObj from './ui_actions.devdocs.json'; diff --git a/api_docs/ui_actions_enhanced.mdx b/api_docs/ui_actions_enhanced.mdx index c94aa6bb6d19e..356d1ba0e4ea7 100644 --- a/api_docs/ui_actions_enhanced.mdx +++ b/api_docs/ui_actions_enhanced.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/uiActionsEnhanced title: "uiActionsEnhanced" image: https://source.unsplash.com/400x175/?github description: API docs for the uiActionsEnhanced plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'uiActionsEnhanced'] --- import uiActionsEnhancedObj from './ui_actions_enhanced.devdocs.json'; diff --git a/api_docs/unified_field_list.mdx b/api_docs/unified_field_list.mdx index 927c393480ae1..d2e0c28e81a43 100644 --- a/api_docs/unified_field_list.mdx +++ b/api_docs/unified_field_list.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/unifiedFieldList title: "unifiedFieldList" image: https://source.unsplash.com/400x175/?github description: API docs for the unifiedFieldList plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'unifiedFieldList'] --- import unifiedFieldListObj from './unified_field_list.devdocs.json'; diff --git a/api_docs/unified_histogram.devdocs.json b/api_docs/unified_histogram.devdocs.json index a5555275c7b58..66a0bdd1a0fda 100644 --- a/api_docs/unified_histogram.devdocs.json +++ b/api_docs/unified_histogram.devdocs.json @@ -5,1104 +5,1044 @@ "functions": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayout", + "id": "def-public.getBreakdownField", "type": "Function", "tags": [], - "label": "UnifiedHistogramLayout", + "label": "getBreakdownField", "description": [ - "\nA resizable layout component with two panels that renders a histogram with a hits\ncounter in the top panel, and a main display (data table, etc.) in the bottom panel.\nIf all context props are left undefined, the layout will render in a single panel\nmode including only the main display." + "\nGet the breakdown field from local storage" ], "signature": [ - "React.ForwardRefExoticComponent<", + "(storage: ", { - "pluginId": "unifiedHistogram", + "pluginId": "kibanaUtils", "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramLayoutProps", - "text": "UnifiedHistogramLayoutProps" + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" }, - " & React.RefAttributes<{}>>" + ", localStorageKeyPrefix: string) => string | undefined" ], - "path": "src/plugins/unified_histogram/public/layout/index.tsx", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, "trackAdoption": false, - "returnComment": [], "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayout.$1", - "type": "Uncategorized", + "id": "def-public.getBreakdownField.$1", + "type": "Object", "tags": [], - "label": "props", + "label": "storage", "description": [], "signature": [ - "P" + { + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + } ], - "path": "node_modules/@types/react/index.d.ts", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": true + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.getBreakdownField.$2", + "type": "string", + "tags": [], + "label": "localStorageKeyPrefix", + "description": [], + "signature": [ + "string" + ], + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", + "deprecated": false, + "trackAdoption": false, + "isRequired": true } ], + "returnComment": [], "initialIsOpen": false - } - ], - "interfaces": [ + }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramBreakdownContext", - "type": "Interface", + "id": "def-public.getChartHidden", + "type": "Function", "tags": [], - "label": "UnifiedHistogramBreakdownContext", + "label": "getChartHidden", "description": [ - "\nContext object for the histogram breakdown" + "\nGet the chart hidden state from local storage" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "signature": [ + "(storage: ", + { + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + }, + ", localStorageKeyPrefix: string) => boolean | undefined" + ], + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, "trackAdoption": false, "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramBreakdownContext.field", + "id": "def-public.getChartHidden.$1", "type": "Object", "tags": [], - "label": "field", - "description": [ - "\nThe field used for the breakdown" - ], + "label": "storage", + "description": [], "signature": [ { - "pluginId": "dataViews", - "scope": "common", - "docId": "kibDataViewsPluginApi", - "section": "def-common.DataViewField", - "text": "DataViewField" - }, - " | undefined" + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + } ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": true + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.getChartHidden.$2", + "type": "string", + "tags": [], + "label": "localStorageKeyPrefix", + "description": [], + "signature": [ + "string" + ], + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", + "deprecated": false, + "trackAdoption": false, + "isRequired": true } ], + "returnComment": [], "initialIsOpen": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramChartContext", - "type": "Interface", + "id": "def-public.getTopPanelHeight", + "type": "Function", "tags": [], - "label": "UnifiedHistogramChartContext", + "label": "getTopPanelHeight", "description": [ - "\nContext object for the chart" + "\nGet the top panel height from local storage" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "signature": [ + "(storage: ", + { + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + }, + ", localStorageKeyPrefix: string) => number | undefined" + ], + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, "trackAdoption": false, "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramChartContext.hidden", - "type": "CompoundType", - "tags": [], - "label": "hidden", - "description": [ - "\nControls whether or not the chart is hidden" - ], - "signature": [ - "boolean | undefined" - ], - "path": "src/plugins/unified_histogram/public/types.ts", - "deprecated": false, - "trackAdoption": false - }, - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramChartContext.timeInterval", - "type": "string", + "id": "def-public.getTopPanelHeight.$1", + "type": "Object", "tags": [], - "label": "timeInterval", - "description": [ - "\nControls the time interval of the chart" - ], + "label": "storage", + "description": [], "signature": [ - "string | undefined" + { + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + } ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": true }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramChartContext.title", + "id": "def-public.getTopPanelHeight.$2", "type": "string", "tags": [], - "label": "title", - "description": [ - "\nThe chart title -- sets the title property on the Lens chart input" - ], + "label": "localStorageKeyPrefix", + "description": [], "signature": [ - "string | undefined" + "string" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": true } ], + "returnComment": [], "initialIsOpen": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramChartLoadEvent", - "type": "Interface", + "id": "def-public.setBreakdownField", + "type": "Function", "tags": [], - "label": "UnifiedHistogramChartLoadEvent", + "label": "setBreakdownField", "description": [ - "\nEmitted when the histogram loading status changes" + "\nSet the breakdown field in local storage" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "signature": [ + "(storage: ", + { + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + }, + ", localStorageKeyPrefix: string, breakdownField: string | undefined) => false | void" + ], + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, "trackAdoption": false, "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramChartLoadEvent.adapters", + "id": "def-public.setBreakdownField.$1", "type": "Object", "tags": [], - "label": "adapters", - "description": [ - "\nInspector adapters for the request" - ], + "label": "storage", + "description": [], "signature": [ - "{ requests?: ", - { - "pluginId": "inspector", - "scope": "common", - "docId": "kibInspectorPluginApi", - "section": "def-common.RequestAdapter", - "text": "RequestAdapter" - }, - " | undefined; tables?: ", - { - "pluginId": "expressions", - "scope": "common", - "docId": "kibExpressionsPluginApi", - "section": "def-common.TablesAdapter", - "text": "TablesAdapter" - }, - " | undefined; expression?: ", { - "pluginId": "expressions", - "scope": "common", - "docId": "kibExpressionsPluginApi", - "section": "def-common.ExpressionsInspectorAdapter", - "text": "ExpressionsInspectorAdapter" - }, - " | undefined; }" + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + } ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": true + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.setBreakdownField.$2", + "type": "string", + "tags": [], + "label": "localStorageKeyPrefix", + "description": [], + "signature": [ + "string" + ], + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", + "deprecated": false, + "trackAdoption": false, + "isRequired": true + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.setBreakdownField.$3", + "type": "string", + "tags": [], + "label": "breakdownField", + "description": [], + "signature": [ + "string | undefined" + ], + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", + "deprecated": false, + "trackAdoption": false, + "isRequired": false } ], + "returnComment": [], "initialIsOpen": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramHitsContext", - "type": "Interface", + "id": "def-public.setChartHidden", + "type": "Function", "tags": [], - "label": "UnifiedHistogramHitsContext", + "label": "setChartHidden", "description": [ - "\nContext object for the hits count" + "\nSet the chart hidden state in local storage" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "signature": [ + "(storage: ", + { + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + }, + ", localStorageKeyPrefix: string, chartHidden: boolean | undefined) => false | void" + ], + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, "trackAdoption": false, "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramHitsContext.status", - "type": "CompoundType", + "id": "def-public.setChartHidden.$1", + "type": "Object", "tags": [], - "label": "status", - "description": [ - "\nThe fetch status of the hits count request" - ], + "label": "storage", + "description": [], "signature": [ { - "pluginId": "unifiedHistogram", + "pluginId": "kibanaUtils", "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramFetchStatus", - "text": "UnifiedHistogramFetchStatus" - }, - " | undefined" + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + } ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": true }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramHitsContext.total", - "type": "number", + "id": "def-public.setChartHidden.$2", + "type": "string", "tags": [], - "label": "total", - "description": [ - "\nThe total number of hits" + "label": "localStorageKeyPrefix", + "description": [], + "signature": [ + "string" ], + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", + "deprecated": false, + "trackAdoption": false, + "isRequired": true + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.setChartHidden.$3", + "type": "CompoundType", + "tags": [], + "label": "chartHidden", + "description": [], "signature": [ - "number | undefined" + "boolean | undefined" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": false } ], + "returnComment": [], "initialIsOpen": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps", - "type": "Interface", + "id": "def-public.setTopPanelHeight", + "type": "Function", "tags": [], - "label": "UnifiedHistogramLayoutProps", - "description": [], + "label": "setTopPanelHeight", + "description": [ + "\nSet the top panel height in local storage" + ], "signature": [ + "(storage: ", { - "pluginId": "unifiedHistogram", + "pluginId": "kibanaUtils", "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramLayoutProps", - "text": "UnifiedHistogramLayoutProps" + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" }, - " extends { children?: React.ReactNode; }" + ", localStorageKeyPrefix: string, topPanelHeight: number | undefined) => false | void" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, "trackAdoption": false, "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.className", - "type": "string", + "id": "def-public.setTopPanelHeight.$1", + "type": "Object", "tags": [], - "label": "className", - "description": [ - "\nOptional class name to add to the layout container" - ], + "label": "storage", + "description": [], "signature": [ - "string | undefined" + { + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + } ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": true }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.services", - "type": "Object", + "id": "def-public.setTopPanelHeight.$2", + "type": "string", "tags": [], - "label": "services", - "description": [ - "\nRequired services" - ], + "label": "localStorageKeyPrefix", + "description": [], "signature": [ - { - "pluginId": "unifiedHistogram", - "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramServices", - "text": "UnifiedHistogramServices" - } + "string" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": true }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.dataView", - "type": "Object", + "id": "def-public.setTopPanelHeight.$3", + "type": "number", "tags": [], - "label": "dataView", - "description": [ - "\nThe current data view" - ], + "label": "topPanelHeight", + "description": [], "signature": [ - { - "pluginId": "dataViews", - "scope": "common", - "docId": "kibDataViewsPluginApi", - "section": "def-common.DataView", - "text": "DataView" - } + "number | undefined" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/utils/local_storage_utils.ts", "deprecated": false, - "trackAdoption": false + "trackAdoption": false, + "isRequired": false + } + ], + "returnComment": [], + "initialIsOpen": false + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.UnifiedHistogramContainer", + "type": "Function", + "tags": [], + "label": "UnifiedHistogramContainer", + "description": [ + "\nA resizable layout component with two panels that renders a histogram with a hits\ncounter in the top panel, and a main display (data table, etc.) in the bottom panel.\nIf all context props are left undefined, the layout will render in a single panel\nmode including only the main display." + ], + "signature": [ + "React.ForwardRefExoticComponent, \"children\" | \"className\" | \"key\" | \"css\" | \"resizeRef\" | \"appendHitsCounter\"> & React.RefAttributes<{}>>" + ], + "path": "src/plugins/unified_histogram/public/container/index.tsx", + "deprecated": false, + "trackAdoption": false, + "returnComment": [], + "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.filters", - "type": "Array", + "id": "def-public.UnifiedHistogramContainer.$1", + "type": "Uncategorized", "tags": [], - "label": "filters", - "description": [ - "\nThe current filters" - ], + "label": "props", + "description": [], "signature": [ - { - "pluginId": "@kbn/es-query", - "scope": "common", - "docId": "kibKbnEsQueryPluginApi", - "section": "def-common.Filter", - "text": "Filter" - }, - "[] | undefined" + "P" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "node_modules/@types/react/index.d.ts", "deprecated": false, "trackAdoption": false - }, + } + ], + "initialIsOpen": false + } + ], + "interfaces": [ + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.UnifiedHistogramChartLoadEvent", + "type": "Interface", + "tags": [], + "label": "UnifiedHistogramChartLoadEvent", + "description": [ + "\nEmitted when the histogram loading status changes" + ], + "path": "src/plugins/unified_histogram/public/types.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.timeRange", + "id": "def-public.UnifiedHistogramChartLoadEvent.adapters", "type": "Object", "tags": [], - "label": "timeRange", + "label": "adapters", "description": [ - "\nThe current time range" + "\nInspector adapters for the request" ], "signature": [ + "{ requests?: ", { - "pluginId": "@kbn/es-query", + "pluginId": "inspector", "scope": "common", - "docId": "kibKbnEsQueryPluginApi", - "section": "def-common.TimeRange", - "text": "TimeRange" + "docId": "kibInspectorPluginApi", + "section": "def-common.RequestAdapter", + "text": "RequestAdapter" }, - " | undefined" + " | undefined; tables?: ", + { + "pluginId": "expressions", + "scope": "common", + "docId": "kibExpressionsPluginApi", + "section": "def-common.TablesAdapter", + "text": "TablesAdapter" + }, + " | undefined; expression?: ", + { + "pluginId": "expressions", + "scope": "common", + "docId": "kibExpressionsPluginApi", + "section": "def-common.ExpressionsInspectorAdapter", + "text": "ExpressionsInspectorAdapter" + }, + " | undefined; }" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/types.ts", "deprecated": false, "trackAdoption": false - }, + } + ], + "initialIsOpen": false + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.UnifiedHistogramServices", + "type": "Interface", + "tags": [], + "label": "UnifiedHistogramServices", + "description": [ + "\nThe services required by the Unified Histogram components" + ], + "path": "src/plugins/unified_histogram/public/types.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.request", + "id": "def-public.UnifiedHistogramServices.data", "type": "Object", "tags": [], - "label": "request", - "description": [ - "\nContext object for requests made by unified histogram components -- optional" - ], + "label": "data", + "description": [], "signature": [ { - "pluginId": "unifiedHistogram", + "pluginId": "data", "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramRequestContext", - "text": "UnifiedHistogramRequestContext" - }, - " | undefined" + "docId": "kibDataPluginApi", + "section": "def-public.DataPublicPluginStart", + "text": "DataPublicPluginStart" + } ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/types.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.hits", + "id": "def-public.UnifiedHistogramServices.theme", "type": "Object", "tags": [], - "label": "hits", - "description": [ - "\nContext object for the hits count -- leave undefined to hide the hits count" - ], + "label": "theme", + "description": [], "signature": [ - { - "pluginId": "unifiedHistogram", - "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramHitsContext", - "text": "UnifiedHistogramHitsContext" - }, - " | undefined" + "{ readonly chartsDefaultTheme: ", + "RecursivePartial", + "<", + "Theme", + ">; readonly chartsDefaultBaseTheme: ", + "Theme", + "; chartsTheme$: ", + "Observable", + "<", + "RecursivePartial", + "<", + "Theme", + ">>; chartsBaseTheme$: ", + "Observable", + "<", + "Theme", + ">; readonly darkModeEnabled$: ", + "Observable", + "; useDarkMode: () => boolean; useChartsTheme: () => ", + "RecursivePartial", + "<", + "Theme", + ">; useChartsBaseTheme: () => ", + "Theme", + "; }" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/types.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.chart", + "id": "def-public.UnifiedHistogramServices.uiActions", "type": "Object", "tags": [], - "label": "chart", - "description": [ - "\nContext object for the chart -- leave undefined to hide the chart" - ], + "label": "uiActions", + "description": [], "signature": [ + "{ readonly clear: () => void; readonly addTriggerAction: (triggerId: string, action: ", { - "pluginId": "unifiedHistogram", + "pluginId": "uiActions", "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramChartContext", - "text": "UnifiedHistogramChartContext" + "docId": "kibUiActionsPluginApi", + "section": "def-public.ActionDefinition", + "text": "ActionDefinition" }, - " | undefined" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false - }, - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.breakdown", - "type": "Object", - "tags": [], - "label": "breakdown", - "description": [ - "\nContext object for the breakdown -- leave undefined to hide the breakdown" - ], - "signature": [ + ") => void; readonly attachAction: (triggerId: string, actionId: string) => void; readonly detachAction: (triggerId: string, actionId: string) => void; readonly registerAction: (definition: ", { - "pluginId": "unifiedHistogram", + "pluginId": "uiActions", "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramBreakdownContext", - "text": "UnifiedHistogramBreakdownContext" + "docId": "kibUiActionsPluginApi", + "section": "def-public.ActionDefinition", + "text": "ActionDefinition" }, - " | undefined" + ") => ", + { + "pluginId": "uiActions", + "scope": "public", + "docId": "kibUiActionsPluginApi", + "section": "def-public.Action", + "text": "Action" + }, + "; readonly registerTrigger: (trigger: ", + { + "pluginId": "uiActions", + "scope": "public", + "docId": "kibUiActionsPluginApi", + "section": "def-public.Trigger", + "text": "Trigger" + }, + ") => void; readonly unregisterAction: (actionId: string) => void; readonly getTrigger: (triggerId: string) => ", + "TriggerContract", + "; readonly hasAction: (actionId: string) => boolean; readonly getAction: (id: string) => ", + { + "pluginId": "uiActions", + "scope": "public", + "docId": "kibUiActionsPluginApi", + "section": "def-public.Action", + "text": "Action" + }, + "; readonly getTriggerActions: (triggerId: string) => ", + { + "pluginId": "uiActions", + "scope": "public", + "docId": "kibUiActionsPluginApi", + "section": "def-public.Action", + "text": "Action" + }, + "[]; readonly getTriggerCompatibleActions: (triggerId: string, context: object) => Promise<", + { + "pluginId": "uiActions", + "scope": "public", + "docId": "kibUiActionsPluginApi", + "section": "def-public.Action", + "text": "Action" + }, + "[]>; readonly executeTriggerActions: (triggerId: string, context: object) => Promise; readonly fork: () => ", + { + "pluginId": "uiActions", + "scope": "public", + "docId": "kibUiActionsPluginApi", + "section": "def-public.UiActionsService", + "text": "UiActionsService" + }, + "; }" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/types.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.resizeRef", + "id": "def-public.UnifiedHistogramServices.uiSettings", "type": "Object", "tags": [], - "label": "resizeRef", - "description": [ - "\nRef to the element wrapping the layout which will be used for resize calculations" - ], + "label": "uiSettings", + "description": [], "signature": [ - "React.RefObject" + { + "pluginId": "@kbn/core-ui-settings-browser", + "scope": "common", + "docId": "kibKbnCoreUiSettingsBrowserPluginApi", + "section": "def-common.IUiSettingsClient", + "text": "IUiSettingsClient" + } ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/types.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.topPanelHeight", - "type": "number", + "id": "def-public.UnifiedHistogramServices.fieldFormats", + "type": "CompoundType", "tags": [], - "label": "topPanelHeight", - "description": [ - "\nCurrent top panel height -- leave undefined to use the default" - ], + "label": "fieldFormats", + "description": [], "signature": [ - "number | undefined" + "Omit<", + { + "pluginId": "fieldFormats", + "scope": "common", + "docId": "kibFieldFormatsPluginApi", + "section": "def-common.FieldFormatsRegistry", + "text": "FieldFormatsRegistry" + }, + ", \"init\" | \"register\"> & { deserialize: ", + { + "pluginId": "fieldFormats", + "scope": "common", + "docId": "kibFieldFormatsPluginApi", + "section": "def-common.FormatFactory", + "text": "FormatFactory" + }, + "; }" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/types.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.appendHitsCounter", + "id": "def-public.UnifiedHistogramServices.lens", "type": "Object", "tags": [], - "label": "appendHitsCounter", - "description": [ - "\nAppend a custom element to the right of the hits count" - ], + "label": "lens", + "description": [], "signature": [ - "React.ReactElement> | undefined" + { + "pluginId": "lens", + "scope": "public", + "docId": "kibLensPluginApi", + "section": "def-public.LensPublicStart", + "text": "LensPublicStart" + } ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/types.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.disableAutoFetching", - "type": "CompoundType", + "id": "def-public.UnifiedHistogramServices.storage", + "type": "Object", "tags": [], - "label": "disableAutoFetching", - "description": [ - "\nDisable automatic refetching based on props changes, and instead wait for a `refetch` message" - ], + "label": "storage", + "description": [], "signature": [ - "boolean | undefined" + { + "pluginId": "kibanaUtils", + "scope": "public", + "docId": "kibKibanaUtilsPluginApi", + "section": "def-public.Storage", + "text": "Storage" + } ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/types.ts", "deprecated": false, "trackAdoption": false - }, + } + ], + "initialIsOpen": false + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.UnifiedHistogramState", + "type": "Interface", + "tags": [], + "label": "UnifiedHistogramState", + "description": [ + "\nThe current state of the container" + ], + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", + "deprecated": false, + "trackAdoption": false, + "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.disableTriggers", - "type": "CompoundType", + "id": "def-public.UnifiedHistogramState.breakdownField", + "type": "string", "tags": [], - "label": "disableTriggers", + "label": "breakdownField", "description": [ - "\nDisable triggers for the Lens embeddable" + "\nThe current field used for the breakdown" ], "signature": [ - "boolean | undefined" + "string | undefined" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.disabledActions", - "type": "Array", + "id": "def-public.UnifiedHistogramState.chartHidden", + "type": "boolean", "tags": [], - "label": "disabledActions", + "label": "chartHidden", "description": [ - "\nDisabled action IDs for the Lens embeddable" + "\nWhether or not the chart is hidden" ], - "signature": [ - "string[] | undefined" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.input$", + "id": "def-public.UnifiedHistogramState.dataView", "type": "Object", "tags": [], - "label": "input$", + "label": "dataView", "description": [ - "\nInput observable" + "\nThe current data view" ], "signature": [ - "UnifiedHistogramInput", - "$ | undefined" + { + "pluginId": "dataViews", + "scope": "common", + "docId": "kibDataViewsPluginApi", + "section": "def-common.DataView", + "text": "DataView" + } ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onTopPanelHeightChange", - "type": "Function", + "id": "def-public.UnifiedHistogramState.filters", + "type": "Array", "tags": [], - "label": "onTopPanelHeightChange", + "label": "filters", "description": [ - "\nCallback to update the topPanelHeight prop when a resize is triggered" + "\nThe current filters" ], "signature": [ - "((topPanelHeight: number | undefined) => void) | undefined" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "children": [ { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onTopPanelHeightChange.$1", - "type": "number", - "tags": [], - "label": "topPanelHeight", - "description": [], - "signature": [ - "number | undefined" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "isRequired": false - } + "pluginId": "@kbn/es-query", + "scope": "common", + "docId": "kibKbnEsQueryPluginApi", + "section": "def-common.Filter", + "text": "Filter" + }, + "[]" ], - "returnComment": [] + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", + "deprecated": false, + "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onEditVisualization", - "type": "Function", + "id": "def-public.UnifiedHistogramState.lensRequestAdapter", + "type": "Object", "tags": [], - "label": "onEditVisualization", + "label": "lensRequestAdapter", "description": [ - "\nCallback to invoke when the user clicks the edit visualization button -- leave undefined to hide the button" + "\nThe current Lens request adapter" ], "signature": [ - "((lensAttributes: LensAttributes<\"lnsXY\", ", - { - "pluginId": "lens", - "scope": "public", - "docId": "kibLensPluginApi", - "section": "def-public.XYState", - "text": "XYState" - }, - "> | LensAttributes<\"lnsPie\", ", - { - "pluginId": "lens", - "scope": "common", - "docId": "kibLensPluginApi", - "section": "def-common.PieVisualizationState", - "text": "PieVisualizationState" - }, - "> | LensAttributes<\"lnsDatatable\", ", { - "pluginId": "lens", - "scope": "public", - "docId": "kibLensPluginApi", - "section": "def-public.DatatableVisualizationState", - "text": "DatatableVisualizationState" - }, - "> | LensAttributes<\"lnsLegacyMetric\", ", - { - "pluginId": "lens", + "pluginId": "inspector", "scope": "common", - "docId": "kibLensPluginApi", - "section": "def-common.LegacyMetricState", - "text": "LegacyMetricState" - }, - "> | LensAttributes<\"lnsMetric\", ", - "MetricVisualizationState", - "> | LensAttributes<\"lnsHeatmap\", ", - { - "pluginId": "lens", - "scope": "public", - "docId": "kibLensPluginApi", - "section": "def-public.HeatmapVisualizationState", - "text": "HeatmapVisualizationState" - }, - "> | LensAttributes<\"lnsGauge\", ", - { - "pluginId": "lens", - "scope": "public", - "docId": "kibLensPluginApi", - "section": "def-public.GaugeVisualizationState", - "text": "GaugeVisualizationState" + "docId": "kibInspectorPluginApi", + "section": "def-common.RequestAdapter", + "text": "RequestAdapter" }, - "> | LensAttributes) => void) | undefined" + " | undefined" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, - "trackAdoption": false, - "children": [ - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onEditVisualization.$1", - "type": "CompoundType", - "tags": [], - "label": "lensAttributes", - "description": [], - "signature": [ - "LensAttributes<\"lnsXY\", ", - { - "pluginId": "lens", - "scope": "public", - "docId": "kibLensPluginApi", - "section": "def-public.XYState", - "text": "XYState" - }, - "> | LensAttributes<\"lnsPie\", ", - { - "pluginId": "lens", - "scope": "common", - "docId": "kibLensPluginApi", - "section": "def-common.PieVisualizationState", - "text": "PieVisualizationState" - }, - "> | LensAttributes<\"lnsDatatable\", ", - { - "pluginId": "lens", - "scope": "public", - "docId": "kibLensPluginApi", - "section": "def-public.DatatableVisualizationState", - "text": "DatatableVisualizationState" - }, - "> | LensAttributes<\"lnsLegacyMetric\", ", - { - "pluginId": "lens", - "scope": "common", - "docId": "kibLensPluginApi", - "section": "def-common.LegacyMetricState", - "text": "LegacyMetricState" - }, - "> | LensAttributes<\"lnsMetric\", ", - "MetricVisualizationState", - "> | LensAttributes<\"lnsHeatmap\", ", - { - "pluginId": "lens", - "scope": "public", - "docId": "kibLensPluginApi", - "section": "def-public.HeatmapVisualizationState", - "text": "HeatmapVisualizationState" - }, - "> | LensAttributes<\"lnsGauge\", ", - { - "pluginId": "lens", - "scope": "public", - "docId": "kibLensPluginApi", - "section": "def-public.GaugeVisualizationState", - "text": "GaugeVisualizationState" - }, - "> | LensAttributes" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "isRequired": true - } - ], - "returnComment": [] + "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onChartHiddenChange", - "type": "Function", + "id": "def-public.UnifiedHistogramState.query", + "type": "CompoundType", "tags": [], - "label": "onChartHiddenChange", + "label": "query", "description": [ - "\nCallback to hide or show the chart -- should set {@link UnifiedHistogramChartContext.hidden} to chartHidden" + "\nThe current query" ], "signature": [ - "((chartHidden: boolean) => void) | undefined" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "children": [ { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onChartHiddenChange.$1", - "type": "boolean", - "tags": [], - "label": "chartHidden", - "description": [], - "signature": [ - "boolean" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "isRequired": true + "pluginId": "@kbn/es-query", + "scope": "common", + "docId": "kibKbnEsQueryPluginApi", + "section": "def-common.Query", + "text": "Query" + }, + " | ", + { + "pluginId": "@kbn/es-query", + "scope": "common", + "docId": "kibKbnEsQueryPluginApi", + "section": "def-common.AggregateQuery", + "text": "AggregateQuery" } ], - "returnComment": [] + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", + "deprecated": false, + "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onTimeIntervalChange", - "type": "Function", + "id": "def-public.UnifiedHistogramState.requestAdapter", + "type": "Object", "tags": [], - "label": "onTimeIntervalChange", + "label": "requestAdapter", "description": [ - "\nCallback to update the time interval -- should set {@link UnifiedHistogramChartContext.timeInterval} to timeInterval" + "\nThe current request adapter used for non-Lens requests" ], "signature": [ - "((timeInterval: string) => void) | undefined" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "children": [ { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onTimeIntervalChange.$1", - "type": "string", - "tags": [], - "label": "timeInterval", - "description": [], - "signature": [ - "string" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "isRequired": true - } + "pluginId": "inspector", + "scope": "common", + "docId": "kibInspectorPluginApi", + "section": "def-common.RequestAdapter", + "text": "RequestAdapter" + }, + " | undefined" ], - "returnComment": [] + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", + "deprecated": false, + "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onBreakdownFieldChange", - "type": "Function", + "id": "def-public.UnifiedHistogramState.searchSessionId", + "type": "string", "tags": [], - "label": "onBreakdownFieldChange", + "label": "searchSessionId", "description": [ - "\nCallback to update the breakdown field -- should set {@link UnifiedHistogramBreakdownContext.field} to breakdownField" + "\nThe current search session ID" ], "signature": [ - "((breakdownField: ", - { - "pluginId": "dataViews", - "scope": "common", - "docId": "kibDataViewsPluginApi", - "section": "def-common.DataViewField", - "text": "DataViewField" - }, - " | undefined) => void) | undefined" + "string | undefined" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, - "trackAdoption": false, - "children": [ - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onBreakdownFieldChange.$1", - "type": "Object", - "tags": [], - "label": "breakdownField", - "description": [], - "signature": [ - { - "pluginId": "dataViews", - "scope": "common", - "docId": "kibDataViewsPluginApi", - "section": "def-common.DataViewField", - "text": "DataViewField" - }, - " | undefined" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "isRequired": false - } - ], - "returnComment": [] + "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onTotalHitsChange", - "type": "Function", + "id": "def-public.UnifiedHistogramState.timeInterval", + "type": "string", "tags": [], - "label": "onTotalHitsChange", + "label": "timeInterval", "description": [ - "\nCallback to update the total hits -- should set {@link UnifiedHistogramHitsContext.status} to status\nand {@link UnifiedHistogramHitsContext.total} to result" - ], - "signature": [ - "((status: ", - { - "pluginId": "unifiedHistogram", - "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramFetchStatus", - "text": "UnifiedHistogramFetchStatus" - }, - ", result?: number | Error | undefined) => void) | undefined" + "\nThe current time interval of the chart" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, - "trackAdoption": false, - "children": [ - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onTotalHitsChange.$1", - "type": "Enum", - "tags": [], - "label": "status", - "description": [], - "signature": [ - { - "pluginId": "unifiedHistogram", - "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramFetchStatus", - "text": "UnifiedHistogramFetchStatus" - } - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "isRequired": true - }, - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onTotalHitsChange.$2", - "type": "CompoundType", - "tags": [], - "label": "result", - "description": [], - "signature": [ - "number | Error | undefined" - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "isRequired": false - } - ], - "returnComment": [] + "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onChartLoad", - "type": "Function", + "id": "def-public.UnifiedHistogramState.timeRange", + "type": "Object", "tags": [], - "label": "onChartLoad", + "label": "timeRange", "description": [ - "\nCalled when the histogram loading status changes" - ], - "signature": [ - "((event: ", - { - "pluginId": "unifiedHistogram", - "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramChartLoadEvent", - "text": "UnifiedHistogramChartLoadEvent" - }, - ") => void) | undefined" + "\nThe current time range" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "children": [ - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onChartLoad.$1", - "type": "Object", - "tags": [], - "label": "event", - "description": [], - "signature": [ - { - "pluginId": "unifiedHistogram", - "scope": "public", - "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramChartLoadEvent", - "text": "UnifiedHistogramChartLoadEvent" - } - ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", - "deprecated": false, - "trackAdoption": false, - "isRequired": true - } + "signature": [ + "{ from: string; to: string; mode?: \"absolute\" | \"relative\" | undefined; }" ], - "returnComment": [] + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", + "deprecated": false, + "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onFilter", - "type": "Function", + "id": "def-public.UnifiedHistogramState.topPanelHeight", + "type": "number", "tags": [], - "label": "onFilter", + "label": "topPanelHeight", "description": [ - "\nCallback to pass to the Lens embeddable to handle filter changes" + "\nThe current top panel height" ], "signature": [ - "((data: { data: { table: Pick<", - { - "pluginId": "expressions", - "scope": "common", - "docId": "kibExpressionsPluginApi", - "section": "def-common.Datatable", - "text": "Datatable" - }, - ", \"rows\" | \"columns\">; column: number; row: number; value: any; }[]; timeFieldName?: string | undefined; negate?: boolean | undefined; } | { data: { table: Pick<", - { - "pluginId": "expressions", - "scope": "common", - "docId": "kibExpressionsPluginApi", - "section": "def-common.Datatable", - "text": "Datatable" - }, - ", \"rows\" | \"columns\">; column: number; value: any[]; }; timeFieldName?: string | undefined; negate?: boolean | undefined; }) => void) | undefined" + "number | undefined" ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramLayoutProps.onBrushEnd", - "type": "Function", + "id": "def-public.UnifiedHistogramState.totalHitsStatus", + "type": "Enum", "tags": [], - "label": "onBrushEnd", + "label": "totalHitsStatus", "description": [ - "\nCallback to pass to the Lens embeddable to handle brush events" + "\nThe current fetch status of the hits count request" ], "signature": [ - "((data: { table: ", { - "pluginId": "expressions", - "scope": "common", - "docId": "kibExpressionsPluginApi", - "section": "def-common.Datatable", - "text": "Datatable" - }, - "; column: number; range: number[]; timeFieldName?: string | undefined; }) => void) | undefined" + "pluginId": "unifiedHistogram", + "scope": "public", + "docId": "kibUnifiedHistogramPluginApi", + "section": "def-public.UnifiedHistogramFetchStatus", + "text": "UnifiedHistogramFetchStatus" + } ], - "path": "src/plugins/unified_histogram/public/layout/layout.tsx", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, "trackAdoption": false - } - ], - "initialIsOpen": false - }, - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramRefetchMessage", - "type": "Interface", - "tags": [], - "label": "UnifiedHistogramRefetchMessage", - "description": [ - "\nMessage to refetch the chart and total hits" - ], - "path": "src/plugins/unified_histogram/public/types.ts", - "deprecated": false, - "trackAdoption": false, - "children": [ + }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramRefetchMessage.type", - "type": "string", + "id": "def-public.UnifiedHistogramState.totalHitsResult", + "type": "CompoundType", "tags": [], - "label": "type", - "description": [], + "label": "totalHitsResult", + "description": [ + "\nThe current result of the hits count request" + ], "signature": [ - "\"refetch\"" + "number | Error | undefined" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, "trackAdoption": false } @@ -1111,53 +1051,84 @@ }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramRequestContext", + "id": "def-public.UnifiedHistogramStateOptions", "type": "Interface", "tags": [], - "label": "UnifiedHistogramRequestContext", + "label": "UnifiedHistogramStateOptions", "description": [ - "\nContext object for requests made by unified histogram components" + "\nThe options used to initialize the comntainer state" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, "trackAdoption": false, "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramRequestContext.searchSessionId", + "id": "def-public.UnifiedHistogramStateOptions.services", + "type": "Object", + "tags": [], + "label": "services", + "description": [ + "\nThe services required by the Unified Histogram components" + ], + "signature": [ + { + "pluginId": "unifiedHistogram", + "scope": "public", + "docId": "kibUnifiedHistogramPluginApi", + "section": "def-public.UnifiedHistogramServices", + "text": "UnifiedHistogramServices" + } + ], + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", + "deprecated": false, + "trackAdoption": false + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.UnifiedHistogramStateOptions.localStorageKeyPrefix", "type": "string", "tags": [], - "label": "searchSessionId", + "label": "localStorageKeyPrefix", "description": [ - "\nCurrent search session ID" + "\nThe prefix for the keys used in local storage -- leave undefined to avoid using local storage" ], "signature": [ "string | undefined" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramRequestContext.adapter", - "type": "Object", + "id": "def-public.UnifiedHistogramStateOptions.initialState", + "type": "CompoundType", "tags": [], - "label": "adapter", + "label": "initialState", "description": [ - "\nThe adapter to use for requests (does not apply to Lens requests)" + "\nThe initial state of the container" ], "signature": [ + "Partial<", { - "pluginId": "inspector", - "scope": "common", - "docId": "kibInspectorPluginApi", - "section": "def-common.RequestAdapter", - "text": "RequestAdapter" + "pluginId": "unifiedHistogram", + "scope": "public", + "docId": "kibUnifiedHistogramPluginApi", + "section": "def-public.UnifiedHistogramState", + "text": "UnifiedHistogramState" }, - " | undefined" + "> & Pick<", + { + "pluginId": "unifiedHistogram", + "scope": "public", + "docId": "kibUnifiedHistogramPluginApi", + "section": "def-public.UnifiedHistogramState", + "text": "UnifiedHistogramState" + }, + ", \"dataView\">" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/services/state_service.ts", "deprecated": false, "trackAdoption": false } @@ -1166,144 +1137,80 @@ }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramServices", + "id": "def-public.UnifiedHistogramUninitializedApi", "type": "Interface", "tags": [], - "label": "UnifiedHistogramServices", + "label": "UnifiedHistogramUninitializedApi", "description": [ - "\nThe services required by the unified histogram components" + "\nThe uninitialized API exposed by the container" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/container.tsx", "deprecated": false, "trackAdoption": false, "children": [ { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramServices.data", - "type": "Object", + "id": "def-public.UnifiedHistogramUninitializedApi.initialized", + "type": "boolean", "tags": [], - "label": "data", - "description": [], - "signature": [ - { - "pluginId": "data", - "scope": "public", - "docId": "kibDataPluginApi", - "section": "def-public.DataPublicPluginStart", - "text": "DataPublicPluginStart" - } + "label": "initialized", + "description": [ + "\nWhether the container has been initialized" ], - "path": "src/plugins/unified_histogram/public/types.ts", - "deprecated": false, - "trackAdoption": false - }, - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramServices.theme", - "type": "Object", - "tags": [], - "label": "theme", - "description": [], "signature": [ - "{ readonly chartsDefaultTheme: ", - "RecursivePartial", - "<", - "Theme", - ">; readonly chartsDefaultBaseTheme: ", - "Theme", - "; chartsTheme$: ", - "Observable", - "<", - "RecursivePartial", - "<", - "Theme", - ">>; chartsBaseTheme$: ", - "Observable", - "<", - "Theme", - ">; readonly darkModeEnabled$: ", - "Observable", - "; useDarkMode: () => boolean; useChartsTheme: () => ", - "RecursivePartial", - "<", - "Theme", - ">; useChartsBaseTheme: () => ", - "Theme", - "; }" + "false" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/container.tsx", "deprecated": false, "trackAdoption": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramServices.uiSettings", - "type": "Object", + "id": "def-public.UnifiedHistogramUninitializedApi.initialize", + "type": "Function", "tags": [], - "label": "uiSettings", - "description": [], - "signature": [ - { - "pluginId": "@kbn/core-ui-settings-browser", - "scope": "common", - "docId": "kibKbnCoreUiSettingsBrowserPluginApi", - "section": "def-common.IUiSettingsClient", - "text": "IUiSettingsClient" - } + "label": "initialize", + "description": [ + "\nInitialize the container" ], - "path": "src/plugins/unified_histogram/public/types.ts", - "deprecated": false, - "trackAdoption": false - }, - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramServices.fieldFormats", - "type": "CompoundType", - "tags": [], - "label": "fieldFormats", - "description": [], "signature": [ - "Omit<", - { - "pluginId": "fieldFormats", - "scope": "common", - "docId": "kibFieldFormatsPluginApi", - "section": "def-common.FieldFormatsRegistry", - "text": "FieldFormatsRegistry" - }, - ", \"init\" | \"register\"> & { deserialize: ", + "(options: ", { - "pluginId": "fieldFormats", - "scope": "common", - "docId": "kibFieldFormatsPluginApi", - "section": "def-common.FormatFactory", - "text": "FormatFactory" + "pluginId": "unifiedHistogram", + "scope": "public", + "docId": "kibUnifiedHistogramPluginApi", + "section": "def-public.UnifiedHistogramInitializeOptions", + "text": "UnifiedHistogramInitializeOptions" }, - "; }" + ") => void" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/container.tsx", "deprecated": false, - "trackAdoption": false - }, - { - "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramServices.lens", - "type": "Object", - "tags": [], - "label": "lens", - "description": [], - "signature": [ + "trackAdoption": false, + "children": [ { - "pluginId": "lens", - "scope": "public", - "docId": "kibLensPluginApi", - "section": "def-public.LensPublicStart", - "text": "LensPublicStart" + "parentPluginId": "unifiedHistogram", + "id": "def-public.UnifiedHistogramUninitializedApi.initialize.$1", + "type": "CompoundType", + "tags": [], + "label": "options", + "description": [], + "signature": [ + { + "pluginId": "unifiedHistogram", + "scope": "public", + "docId": "kibUnifiedHistogramPluginApi", + "section": "def-public.UnifiedHistogramInitializeOptions", + "text": "UnifiedHistogramInitializeOptions" + } + ], + "path": "src/plugins/unified_histogram/public/container/container.tsx", + "deprecated": false, + "trackAdoption": false, + "isRequired": true } ], - "path": "src/plugins/unified_histogram/public/types.ts", - "deprecated": false, - "trackAdoption": false + "returnComment": [] } ], "initialIsOpen": false @@ -1317,7 +1224,7 @@ "tags": [], "label": "UnifiedHistogramFetchStatus", "description": [ - "\nThe fetch status of a unified histogram request" + "\nThe fetch status of a Unified Histogram request" ], "path": "src/plugins/unified_histogram/public/types.ts", "deprecated": false, @@ -1332,7 +1239,9 @@ "type": "Type", "tags": [], "label": "UnifiedHistogramAdapters", - "description": [], + "description": [ + "\nThe adapters passed up from Lens" + ], "signature": [ "{ requests?: ", { @@ -1367,49 +1276,91 @@ }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramInput$", + "id": "def-public.UnifiedHistogramApi", "type": "Type", "tags": [], - "label": "UnifiedHistogramInput$", + "label": "UnifiedHistogramApi", "description": [ - "\nUnified histogram input observable" + "\nThe API exposed by the container" ], "signature": [ - "Subject", - "<", { "pluginId": "unifiedHistogram", "scope": "public", "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramRefetchMessage", - "text": "UnifiedHistogramRefetchMessage" + "section": "def-public.UnifiedHistogramUninitializedApi", + "text": "UnifiedHistogramUninitializedApi" }, - ">" + " | ", + { + "pluginId": "unifiedHistogram", + "scope": "public", + "docId": "kibUnifiedHistogramPluginApi", + "section": "def-public.UnifiedHistogramInitializedApi", + "text": "UnifiedHistogramInitializedApi" + } ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/container.tsx", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.UnifiedHistogramContainerProps", + "type": "Type", + "tags": [], + "label": "UnifiedHistogramContainerProps", + "description": [ + "\nThe props exposed by the container" + ], + "signature": [ + "{ children?: React.ReactNode; className?: string | undefined; resizeRef: React.RefObject; appendHitsCounter?: React.ReactElement> | undefined; }" + ], + "path": "src/plugins/unified_histogram/public/container/container.tsx", + "deprecated": false, + "trackAdoption": false, + "initialIsOpen": false + }, + { + "parentPluginId": "unifiedHistogram", + "id": "def-public.UnifiedHistogramInitializedApi", + "type": "Type", + "tags": [], + "label": "UnifiedHistogramInitializedApi", + "description": [ + "\nThe initialized API exposed by the container" + ], + "signature": [ + "{ initialized: true; refetch: () => void; } & Pick<", + "UnifiedHistogramStateService", + ", \"state$\" | \"setChartHidden\" | \"setTopPanelHeight\" | \"setBreakdownField\" | \"setTimeInterval\" | \"setRequestParams\" | \"setTotalHits\">" + ], + "path": "src/plugins/unified_histogram/public/container/container.tsx", "deprecated": false, "trackAdoption": false, "initialIsOpen": false }, { "parentPluginId": "unifiedHistogram", - "id": "def-public.UnifiedHistogramInputMessage", + "id": "def-public.UnifiedHistogramInitializeOptions", "type": "Type", "tags": [], - "label": "UnifiedHistogramInputMessage", + "label": "UnifiedHistogramInitializeOptions", "description": [ - "\nUnified histogram input message" + "\nThe options used to initialize the container" ], "signature": [ { "pluginId": "unifiedHistogram", "scope": "public", "docId": "kibUnifiedHistogramPluginApi", - "section": "def-public.UnifiedHistogramRefetchMessage", - "text": "UnifiedHistogramRefetchMessage" - } + "section": "def-public.UnifiedHistogramStateOptions", + "text": "UnifiedHistogramStateOptions" + }, + " & Omit" ], - "path": "src/plugins/unified_histogram/public/types.ts", + "path": "src/plugins/unified_histogram/public/container/container.tsx", "deprecated": false, "trackAdoption": false, "initialIsOpen": false diff --git a/api_docs/unified_histogram.mdx b/api_docs/unified_histogram.mdx index eecbec56ea228..12a822294c9ff 100644 --- a/api_docs/unified_histogram.mdx +++ b/api_docs/unified_histogram.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/unifiedHistogram title: "unifiedHistogram" image: https://source.unsplash.com/400x175/?github description: API docs for the unifiedHistogram plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'unifiedHistogram'] --- import unifiedHistogramObj from './unified_histogram.devdocs.json'; @@ -21,7 +21,7 @@ Contact [Data Discovery](https://github.com/orgs/elastic/teams/kibana-data-disco | Public API count | Any count | Items lacking comments | Missing exports | |-------------------|-----------|------------------------|-----------------| -| 63 | 0 | 16 | 1 | +| 61 | 0 | 23 | 1 | ## Client diff --git a/api_docs/unified_search.mdx b/api_docs/unified_search.mdx index 669425698a9dd..70a232a096925 100644 --- a/api_docs/unified_search.mdx +++ b/api_docs/unified_search.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/unifiedSearch title: "unifiedSearch" image: https://source.unsplash.com/400x175/?github description: API docs for the unifiedSearch plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'unifiedSearch'] --- import unifiedSearchObj from './unified_search.devdocs.json'; diff --git a/api_docs/unified_search_autocomplete.mdx b/api_docs/unified_search_autocomplete.mdx index ebf92c69d8ada..2c15b06184fe4 100644 --- a/api_docs/unified_search_autocomplete.mdx +++ b/api_docs/unified_search_autocomplete.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/unifiedSearch-autocomplete title: "unifiedSearch.autocomplete" image: https://source.unsplash.com/400x175/?github description: API docs for the unifiedSearch.autocomplete plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'unifiedSearch.autocomplete'] --- import unifiedSearchAutocompleteObj from './unified_search_autocomplete.devdocs.json'; diff --git a/api_docs/url_forwarding.mdx b/api_docs/url_forwarding.mdx index 04ca3c115c656..0bd32cbf4eb94 100644 --- a/api_docs/url_forwarding.mdx +++ b/api_docs/url_forwarding.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/urlForwarding title: "urlForwarding" image: https://source.unsplash.com/400x175/?github description: API docs for the urlForwarding plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'urlForwarding'] --- import urlForwardingObj from './url_forwarding.devdocs.json'; diff --git a/api_docs/usage_collection.mdx b/api_docs/usage_collection.mdx index 510eb08b21d64..b45bd1c267651 100644 --- a/api_docs/usage_collection.mdx +++ b/api_docs/usage_collection.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/usageCollection title: "usageCollection" image: https://source.unsplash.com/400x175/?github description: API docs for the usageCollection plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'usageCollection'] --- import usageCollectionObj from './usage_collection.devdocs.json'; diff --git a/api_docs/ux.mdx b/api_docs/ux.mdx index 179032e14f600..f235a323d406e 100644 --- a/api_docs/ux.mdx +++ b/api_docs/ux.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/ux title: "ux" image: https://source.unsplash.com/400x175/?github description: API docs for the ux plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'ux'] --- import uxObj from './ux.devdocs.json'; diff --git a/api_docs/vis_default_editor.mdx b/api_docs/vis_default_editor.mdx index d7b4887709063..c6cdde0be6849 100644 --- a/api_docs/vis_default_editor.mdx +++ b/api_docs/vis_default_editor.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visDefaultEditor title: "visDefaultEditor" image: https://source.unsplash.com/400x175/?github description: API docs for the visDefaultEditor plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visDefaultEditor'] --- import visDefaultEditorObj from './vis_default_editor.devdocs.json'; diff --git a/api_docs/vis_type_gauge.mdx b/api_docs/vis_type_gauge.mdx index 961d21d69ca6f..718274c1875d5 100644 --- a/api_docs/vis_type_gauge.mdx +++ b/api_docs/vis_type_gauge.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visTypeGauge title: "visTypeGauge" image: https://source.unsplash.com/400x175/?github description: API docs for the visTypeGauge plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visTypeGauge'] --- import visTypeGaugeObj from './vis_type_gauge.devdocs.json'; diff --git a/api_docs/vis_type_heatmap.mdx b/api_docs/vis_type_heatmap.mdx index 677e037635458..30b030530c5a6 100644 --- a/api_docs/vis_type_heatmap.mdx +++ b/api_docs/vis_type_heatmap.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visTypeHeatmap title: "visTypeHeatmap" image: https://source.unsplash.com/400x175/?github description: API docs for the visTypeHeatmap plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visTypeHeatmap'] --- import visTypeHeatmapObj from './vis_type_heatmap.devdocs.json'; diff --git a/api_docs/vis_type_pie.mdx b/api_docs/vis_type_pie.mdx index 9f1bcb41f5a78..b3f3029be760c 100644 --- a/api_docs/vis_type_pie.mdx +++ b/api_docs/vis_type_pie.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visTypePie title: "visTypePie" image: https://source.unsplash.com/400x175/?github description: API docs for the visTypePie plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visTypePie'] --- import visTypePieObj from './vis_type_pie.devdocs.json'; diff --git a/api_docs/vis_type_table.mdx b/api_docs/vis_type_table.mdx index 4d666bac893e5..4f25f3eb5ab6f 100644 --- a/api_docs/vis_type_table.mdx +++ b/api_docs/vis_type_table.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visTypeTable title: "visTypeTable" image: https://source.unsplash.com/400x175/?github description: API docs for the visTypeTable plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visTypeTable'] --- import visTypeTableObj from './vis_type_table.devdocs.json'; diff --git a/api_docs/vis_type_timelion.mdx b/api_docs/vis_type_timelion.mdx index d73d4e7a73228..64b90ee04bc45 100644 --- a/api_docs/vis_type_timelion.mdx +++ b/api_docs/vis_type_timelion.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visTypeTimelion title: "visTypeTimelion" image: https://source.unsplash.com/400x175/?github description: API docs for the visTypeTimelion plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visTypeTimelion'] --- import visTypeTimelionObj from './vis_type_timelion.devdocs.json'; diff --git a/api_docs/vis_type_timeseries.mdx b/api_docs/vis_type_timeseries.mdx index 3bbbf5c0e3727..73c7dac395f32 100644 --- a/api_docs/vis_type_timeseries.mdx +++ b/api_docs/vis_type_timeseries.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visTypeTimeseries title: "visTypeTimeseries" image: https://source.unsplash.com/400x175/?github description: API docs for the visTypeTimeseries plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visTypeTimeseries'] --- import visTypeTimeseriesObj from './vis_type_timeseries.devdocs.json'; diff --git a/api_docs/vis_type_vega.mdx b/api_docs/vis_type_vega.mdx index 54dc81ca6623b..1b9525efcb8bb 100644 --- a/api_docs/vis_type_vega.mdx +++ b/api_docs/vis_type_vega.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visTypeVega title: "visTypeVega" image: https://source.unsplash.com/400x175/?github description: API docs for the visTypeVega plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visTypeVega'] --- import visTypeVegaObj from './vis_type_vega.devdocs.json'; diff --git a/api_docs/vis_type_vislib.mdx b/api_docs/vis_type_vislib.mdx index 44af403e42b17..7d2ca4b17cdbf 100644 --- a/api_docs/vis_type_vislib.mdx +++ b/api_docs/vis_type_vislib.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visTypeVislib title: "visTypeVislib" image: https://source.unsplash.com/400x175/?github description: API docs for the visTypeVislib plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visTypeVislib'] --- import visTypeVislibObj from './vis_type_vislib.devdocs.json'; diff --git a/api_docs/vis_type_xy.mdx b/api_docs/vis_type_xy.mdx index 3a3e58d4118cf..65880960b2d79 100644 --- a/api_docs/vis_type_xy.mdx +++ b/api_docs/vis_type_xy.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visTypeXy title: "visTypeXy" image: https://source.unsplash.com/400x175/?github description: API docs for the visTypeXy plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visTypeXy'] --- import visTypeXyObj from './vis_type_xy.devdocs.json'; diff --git a/api_docs/visualizations.mdx b/api_docs/visualizations.mdx index 2d09aebd2231a..8245eea38e0de 100644 --- a/api_docs/visualizations.mdx +++ b/api_docs/visualizations.mdx @@ -8,7 +8,7 @@ slug: /kibana-dev-docs/api/visualizations title: "visualizations" image: https://source.unsplash.com/400x175/?github description: API docs for the visualizations plugin -date: 2023-02-07 +date: 2023-02-08 tags: ['contributor', 'dev', 'apidocs', 'kibana', 'visualizations'] --- import visualizationsObj from './visualizations.devdocs.json'; From 1841fa7a5dcf17a063f61105786332c87b324a88 Mon Sep 17 00:00:00 2001 From: Shahzad Date: Wed, 8 Feb 2023 07:41:47 +0100 Subject: [PATCH 05/60] [Synthetics] Fix overview status query (#150285) --- .../observability_data_views.ts | 7 +- .../synthetics_overview_status.ts | 23 ++- .../common/runtime_types/ping/ping.ts | 77 ++++---- .../overview/overview/metric_item_icon.tsx | 4 +- .../overview/overview/overview_grid_item.tsx | 12 +- .../hooks/use_last_50_duration_chart.ts | 3 + .../synthetics/hooks/use_last_x_checks.ts | 4 +- .../alert_rules/status_rule/message_utils.ts | 8 +- .../legacy_uptime/lib/alerts/status_check.ts | 3 +- .../server/queries/query_monitor_status.ts | 186 +++++++++--------- .../plugins/synthetics/server/routes/index.ts | 2 +- .../overview_status.test.ts} | 10 +- .../overview_status.ts} | 11 +- .../synthetics_monitor/get_all_monitors.ts | 6 +- .../project_monitor_formatter.ts | 2 +- 15 files changed, 207 insertions(+), 151 deletions(-) rename x-pack/plugins/synthetics/server/routes/{status/current_status.test.ts => overview_status/overview_status.test.ts} (98%) rename x-pack/plugins/synthetics/server/routes/{status/current_status.ts => overview_status/overview_status.ts} (96%) diff --git a/x-pack/plugins/observability/public/utils/observability_data_views/observability_data_views.ts b/x-pack/plugins/observability/public/utils/observability_data_views/observability_data_views.ts index 1dcd7707ec937..00552c0adc6f1 100644 --- a/x-pack/plugins/observability/public/utils/observability_data_views/observability_data_views.ts +++ b/x-pack/plugins/observability/public/utils/observability_data_views/observability_data_views.ts @@ -199,11 +199,14 @@ export class ObservabilityDataViews { async getDataView(app: AppDataType, indices?: string): Promise { let appIndices = indices; + let hasData = false; if (!appIndices) { - appIndices = (await getDataTypeIndices(app)).indices; + const { indices: indicesT, hasData: hData } = await getDataTypeIndices(app); + hasData = hData; + appIndices = indicesT; } - if (appIndices) { + if (appIndices && (hasData || indices)) { try { const dataViewId = getAppDataViewId(app, appIndices); const dataViewTitle = getAppIndicesWithPattern(app, appIndices); diff --git a/x-pack/plugins/synthetics/common/runtime_types/monitor_management/synthetics_overview_status.ts b/x-pack/plugins/synthetics/common/runtime_types/monitor_management/synthetics_overview_status.ts index 046f030b4d712..027527a118d08 100644 --- a/x-pack/plugins/synthetics/common/runtime_types/monitor_management/synthetics_overview_status.ts +++ b/x-pack/plugins/synthetics/common/runtime_types/monitor_management/synthetics_overview_status.ts @@ -6,7 +6,23 @@ */ import * as t from 'io-ts'; -import { PingType } from '..'; +import { ErrorStateCodec } from '../ping/error_state'; +import { AgentType, MonitorType, ObserverType, PingErrorType, UrlType } from '..'; + +export const OverviewPingCode = t.interface({ + '@timestamp': t.string, + summary: t.partial({ + down: t.number, + up: t.number, + }), + monitor: MonitorType, + observer: ObserverType, + config_id: t.string, + error: PingErrorType, + agent: AgentType, + url: UrlType, + state: ErrorStateCodec, +}); export const OverviewStatusMetaDataCodec = t.interface({ monitorQueryId: t.string, @@ -14,7 +30,7 @@ export const OverviewStatusMetaDataCodec = t.interface({ status: t.string, location: t.string, timestamp: t.string, - ping: PingType, + ping: OverviewPingCode, }); export const OverviewPendingStatusMetaDataCodec = t.intersection([ @@ -26,7 +42,7 @@ export const OverviewPendingStatusMetaDataCodec = t.intersection([ }), t.partial({ timestamp: t.string, - ping: PingType, + ping: OverviewPingCode, }), ]); @@ -52,6 +68,7 @@ export const OverviewStatusStateCodec = t.intersection([ }), ]); +export type OverviewPing = t.TypeOf; export type OverviewStatus = t.TypeOf; export type OverviewStatusState = t.TypeOf; export type OverviewStatusMetaData = t.TypeOf; diff --git a/x-pack/plugins/synthetics/common/runtime_types/ping/ping.ts b/x-pack/plugins/synthetics/common/runtime_types/ping/ping.ts index b15c47070911f..971c3116e2bf2 100644 --- a/x-pack/plugins/synthetics/common/runtime_types/ping/ping.ts +++ b/x-pack/plugins/synthetics/common/runtime_types/ping/ping.ts @@ -120,6 +120,45 @@ export const PingHeadersType = t.record(t.string, t.union([t.string, t.array(t.s export type PingHeaders = t.TypeOf; +export const ObserverType = t.partial({ + hostname: t.string, + ip: t.array(t.string), + mac: t.array(t.string), + geo: t.partial({ + name: t.string, + continent_name: t.string, + city_name: t.string, + country_iso_code: t.string, + location: t.union([ + t.string, + t.partial({ lat: t.number, lon: t.number }), + t.partial({ lat: t.string, lon: t.string }), + ]), + }), +}); + +export const AgentType = t.intersection([ + t.type({ + ephemeral_id: t.string, + id: t.string, + type: t.string, + version: t.string, + }), + t.partial({ + name: t.string, + hostname: t.string, + }), +]); + +// should this be partial? +export const UrlType = t.partial({ + domain: t.string, + full: t.string, + port: t.number, + scheme: t.string, + path: t.string, +}); + export const PingType = t.intersection([ t.type({ timestamp: t.string, @@ -127,18 +166,7 @@ export const PingType = t.intersection([ docId: t.string, }), t.partial({ - agent: t.intersection([ - t.type({ - ephemeral_id: t.string, - id: t.string, - type: t.string, - version: t.string, - }), - t.partial({ - name: t.string, - hostname: t.string, - }), - ]), + agent: AgentType, container: t.partial({ id: t.string, image: t.partial({ @@ -185,22 +213,7 @@ export const PingType = t.intersection([ uid: t.string, }), }), - observer: t.partial({ - hostname: t.string, - ip: t.array(t.string), - mac: t.array(t.string), - geo: t.partial({ - name: t.string, - continent_name: t.string, - city_name: t.string, - country_iso_code: t.string, - location: t.union([ - t.string, - t.partial({ lat: t.number, lon: t.number }), - t.partial({ lat: t.string, lon: t.string }), - ]), - }), - }), + observer: ObserverType, resolve: t.partial({ ip: t.string, rtt: t.partial({ @@ -222,13 +235,7 @@ export const PingType = t.intersection([ }), tls: TlsType, // should this be partial? - url: t.partial({ - domain: t.string, - full: t.string, - port: t.number, - scheme: t.string, - path: t.string, - }), + url: UrlType, service: t.partial({ name: t.string, }), diff --git a/x-pack/plugins/synthetics/public/apps/synthetics/components/monitors_page/overview/overview/metric_item_icon.tsx b/x-pack/plugins/synthetics/public/apps/synthetics/components/monitors_page/overview/overview/metric_item_icon.tsx index 18d3ab61da901..b2ccd7b8680a1 100644 --- a/x-pack/plugins/synthetics/public/apps/synthetics/components/monitors_page/overview/overview/metric_item_icon.tsx +++ b/x-pack/plugins/synthetics/public/apps/synthetics/components/monitors_page/overview/overview/metric_item_icon.tsx @@ -23,7 +23,7 @@ import { i18n } from '@kbn/i18n'; import { euiStyled } from '@kbn/kibana-react-plugin/common'; import { selectErrorPopoverState, toggleErrorPopoverOpen } from '../../../../state'; import { useErrorDetailsLink } from '../../../common/links/error_details_link'; -import { MonitorOverviewItem, Ping } from '../../../../../../../common/runtime_types'; +import { MonitorOverviewItem, OverviewPing } from '../../../../../../../common/runtime_types'; import { manualTestRunSelector } from '../../../../state/manual_test_runs'; import { useFormatTestRunAt } from '../../../../utils/monitor_test_result/test_time_formats'; @@ -46,7 +46,7 @@ export const MetricItemIcon = ({ status: string; configIdByLocation: string; timestamp?: string; - ping?: Ping; + ping?: OverviewPing; }) => { const testNowRun = useSelector(manualTestRunSelector(monitor.configId)); const isPopoverOpen = useSelector(selectErrorPopoverState); diff --git a/x-pack/plugins/synthetics/public/apps/synthetics/components/monitors_page/overview/overview/overview_grid_item.tsx b/x-pack/plugins/synthetics/public/apps/synthetics/components/monitors_page/overview/overview/overview_grid_item.tsx index d2c14a746a9e5..de153cf01eca7 100644 --- a/x-pack/plugins/synthetics/public/apps/synthetics/components/monitors_page/overview/overview/overview_grid_item.tsx +++ b/x-pack/plugins/synthetics/public/apps/synthetics/components/monitors_page/overview/overview/overview_grid_item.tsx @@ -6,7 +6,11 @@ */ import React from 'react'; import { MetricItem } from './metric_item'; -import { useLast50DurationChart } from '../../../../hooks'; +import { + useLast50DurationChart, + useLocationName, + useStatusByLocationOverview, +} from '../../../../hooks'; import { MonitorOverviewItem } from '../../../../../../../common/runtime_types'; export interface FlyoutParamProps { @@ -23,9 +27,15 @@ export const OverviewGridItem = ({ monitor: MonitorOverviewItem; onClick: (params: FlyoutParamProps) => void; }) => { + const locationName = + useLocationName({ locationId: monitor.location?.id })?.label || monitor.location?.id; + + const { timestamp } = useStatusByLocationOverview(monitor.configId, locationName); + const { data, averageDuration } = useLast50DurationChart({ locationId: monitor.location?.id, monitorId: monitor.id, + timestamp, }); return ( diff --git a/x-pack/plugins/synthetics/public/apps/synthetics/hooks/use_last_50_duration_chart.ts b/x-pack/plugins/synthetics/public/apps/synthetics/hooks/use_last_50_duration_chart.ts index a543c146ec82b..78e4cc6cecbbf 100644 --- a/x-pack/plugins/synthetics/public/apps/synthetics/hooks/use_last_50_duration_chart.ts +++ b/x-pack/plugins/synthetics/public/apps/synthetics/hooks/use_last_50_duration_chart.ts @@ -13,8 +13,10 @@ const fields = ['monitor.duration.us']; export function useLast50DurationChart({ monitorId, locationId, + timestamp, }: { monitorId: string; + timestamp?: string; locationId: string; }) { const { hits, loading } = useLastXChecks<{ @@ -24,6 +26,7 @@ export function useLast50DurationChart({ locationId, fields, size: 50, + timestamp, }); const { data, averageDuration } = useMemo(() => { if (loading) { diff --git a/x-pack/plugins/synthetics/public/apps/synthetics/hooks/use_last_x_checks.ts b/x-pack/plugins/synthetics/public/apps/synthetics/hooks/use_last_x_checks.ts index c64e78d6961a2..66f9e9dbf572d 100644 --- a/x-pack/plugins/synthetics/public/apps/synthetics/hooks/use_last_x_checks.ts +++ b/x-pack/plugins/synthetics/public/apps/synthetics/hooks/use_last_x_checks.ts @@ -25,9 +25,11 @@ export function useLastXChecks({ locationId, fields = ['*'], size = 50, + timestamp, }: { monitorId: string; locationId: string; + timestamp?: string; fields?: string[]; size?: number; }) { @@ -63,7 +65,7 @@ export function useLastXChecks({ const { data } = useReduxEsSearch(params, [lastRefresh], { name: `zGetLastXMonitorRunsByLocation/${monitorId}/${locationId}`, - isRequestReady: locationsLoaded, // don't run query until locations are loaded + isRequestReady: locationsLoaded && Boolean(timestamp), // don't run query until locations are loaded }); const dataAsJSON = JSON.stringify(data?.hits?.hits); diff --git a/x-pack/plugins/synthetics/server/alert_rules/status_rule/message_utils.ts b/x-pack/plugins/synthetics/server/alert_rules/status_rule/message_utils.ts index 233ea808c96e0..bd10aa2b34754 100644 --- a/x-pack/plugins/synthetics/server/alert_rules/status_rule/message_utils.ts +++ b/x-pack/plugins/synthetics/server/alert_rules/status_rule/message_utils.ts @@ -18,7 +18,7 @@ import { ERROR_MESSAGE, AGENT_NAME, } from '../../../common/field_names'; -import { Ping } from '../../../common/runtime_types'; +import { OverviewPing } from '../../../common/runtime_types'; import { UNNAMED_LOCATION } from '../../../common/constants'; import { ALERT_REASON_MSG } from '../../legacy_uptime/lib/alerts/action_variables'; @@ -37,14 +37,14 @@ export const getMonitorAlertDocument = (monitorSummary: MonitorSummaryStatusRule }); export const getMonitorSummary = ( - monitorInfo: Ping & { '@timestamp'?: string }, + monitorInfo: OverviewPing, statusMessage: string, locationId: string, configId: string ): MonitorSummaryStatusRule => { const monitorName = monitorInfo.monitor?.name ?? monitorInfo.monitor?.id; const observerLocation = monitorInfo.observer?.geo?.name ?? UNNAMED_LOCATION; - const checkedAt = moment(monitorInfo['@timestamp'] ?? monitorInfo.timestamp).format('LLL'); + const checkedAt = moment(monitorInfo['@timestamp']).format('LLL'); return { checkedAt, @@ -62,7 +62,7 @@ export const getMonitorSummary = ( name: monitorName, location: observerLocation, status: statusMessage, - timestamp: monitorInfo['@timestamp'] ?? monitorInfo.timestamp, + timestamp: monitorInfo['@timestamp'], }), }; }; diff --git a/x-pack/plugins/synthetics/server/legacy_uptime/lib/alerts/status_check.ts b/x-pack/plugins/synthetics/server/legacy_uptime/lib/alerts/status_check.ts index 6dd200b11fda2..488a3ef2d284c 100644 --- a/x-pack/plugins/synthetics/server/legacy_uptime/lib/alerts/status_check.ts +++ b/x-pack/plugins/synthetics/server/legacy_uptime/lib/alerts/status_check.ts @@ -20,6 +20,7 @@ import { StatusCheckFilters, Ping, GetMonitorAvailabilityParams, + OverviewPing, } from '../../../../common/runtime_types'; import { CLIENT_ALERT_TYPES, MONITOR_STATUS } from '../../../../common/constants/uptime_alerts'; import { @@ -233,7 +234,7 @@ export const getStatusMessage = ( return statusMessage + availabilityMessage; }; -export const getInstanceId = (monitorInfo: Ping, monIdByLoc: string) => { +export const getInstanceId = (monitorInfo: Ping | OverviewPing, monIdByLoc: string) => { const normalizeText = (txt: string) => { // replace url and name special characters with - return txt.replace(/[^A-Z0-9]+/gi, '_').toLowerCase(); diff --git a/x-pack/plugins/synthetics/server/queries/query_monitor_status.ts b/x-pack/plugins/synthetics/server/queries/query_monitor_status.ts index fef2eaa7be319..058d28d046c8a 100644 --- a/x-pack/plugins/synthetics/server/queries/query_monitor_status.ts +++ b/x-pack/plugins/synthetics/server/queries/query_monitor_status.ts @@ -4,23 +4,38 @@ * 2.0; you may not use this file except in compliance with the Elastic License * 2.0. */ + +import pMap from 'p-map'; +import times from 'lodash/times'; +import { QueryDslQueryContainer } from '@elastic/elasticsearch/lib/api/typesWithBodyKey'; import { cloneDeep, intersection } from 'lodash'; -import { SearchRequest } from '@elastic/elasticsearch/lib/api/types'; import { SUMMARY_FILTER } from '../../common/constants/client_defaults'; -import { UptimeEsClient } from '../legacy_uptime/lib/lib'; +import { createEsParams, UptimeEsClient } from '../legacy_uptime/lib/lib'; import { + OverviewPendingStatusMetaData, + OverviewPing, OverviewStatus, OverviewStatusMetaData, - OverviewPendingStatusMetaData, - Ping, } from '../../common/runtime_types'; const DEFAULT_MAX_ES_BUCKET_SIZE = 10000; +const fields = [ + '@timestamp', + 'summary', + 'monitor', + 'observer', + 'config_id', + 'error', + 'agent', + 'url', + 'state', +]; + export async function queryMonitorStatus( esClient: UptimeEsClient, listOfLocations: string[], - range: { from: string | number; to: string }, + range: { from: string; to: string }, monitorQueryIds: string[], monitorLocationsMap: Record, monitorQueryIdToConfigIdMap: Record @@ -36,77 +51,68 @@ export async function queryMonitorStatus( > { const idSize = Math.trunc(DEFAULT_MAX_ES_BUCKET_SIZE / listOfLocations.length || 1); const pageCount = Math.ceil(monitorQueryIds.length / idSize); - const promises: Array> = []; + let up = 0; + let down = 0; + let pending = 0; + const upConfigs: Record = {}; + const downConfigs: Record = {}; const monitorsWithoutData = new Map(Object.entries(cloneDeep(monitorLocationsMap))); - for (let i = 0; i < pageCount; i++) { - const params: SearchRequest = { - size: 0, - query: { - bool: { - filter: [ - SUMMARY_FILTER, - { - range: { - '@timestamp': { - // @ts-ignore - gte: range.from, - // @ts-expect-error can't mix number and string in client definition - lte: range.to, - }, - }, - }, - { - terms: { - 'monitor.id': (monitorQueryIds as string[]).slice(i * idSize, i * idSize + idSize), - }, - }, - ...(listOfLocations.length > 0 - ? [ - { - terms: { - 'observer.geo.name': listOfLocations, + const pendingConfigs: Record = {}; + + await pMap( + times(pageCount), + async (i) => { + const idsToQuery = (monitorQueryIds as string[]).slice(i * idSize, i * idSize + idSize); + const params = createEsParams({ + body: { + size: 0, + query: { + bool: { + filter: [ + SUMMARY_FILTER, + { + range: { + '@timestamp': { + gte: range.from, + lte: range.to, }, }, - ] - : []), - ], - }, - }, - aggs: { - id: { - terms: { - field: 'monitor.id', - size: idSize, + }, + { + terms: { + 'monitor.id': idsToQuery, + }, + }, + ] as QueryDslQueryContainer[], + }, }, aggs: { - location: { + id: { terms: { - field: 'observer.geo.name', - size: listOfLocations.length || 100, + field: 'monitor.id', + size: idSize, }, aggs: { - status: { - top_hits: { - size: 1, - sort: [ - { - '@timestamp': { - order: 'desc', + location: { + terms: { + field: 'observer.geo.name', + size: listOfLocations.length || 100, + }, + aggs: { + status: { + top_hits: { + size: 1, + sort: [ + { + '@timestamp': { + order: 'desc', + }, + }, + ], + _source: { + includes: fields, }, }, - ], - _source: { - includes: [ - '@timestamp', - 'summary', - 'monitor', - 'observer', - 'config_id', - 'error', - 'agent', - 'url', - 'state', - ], }, }, }, @@ -114,27 +120,28 @@ export async function queryMonitorStatus( }, }, }, - }, - }; + }); - promises.push(esClient.search({ body: params }, 'getCurrentStatusOverview' + i)); - } - let up = 0; - let down = 0; - let pending = 0; - const upConfigs: Record = {}; - const downConfigs: Record = {}; - const pendingConfigs: Record = {}; + if (listOfLocations.length > 0) { + params.body.query.bool.filter.push({ + terms: { + 'observer.geo.name': listOfLocations, + }, + }); + } - for await (const response of promises) { - response.body.aggregations?.id.buckets.forEach( - ({ location, key: queryId }: { location: any; key: string }) => { - const locationSummaries = location.buckets.map( - ({ status, key: locationName }: { key: string; status: any }) => { - const ping = status.hits.hits[0]._source as Ping & { '@timestamp': string }; - return { location: locationName, ping }; - } - ) as Array<{ location: string; ping: Ping & { '@timestamp': string } }>; + const { body: result } = await esClient.search( + params, + 'getCurrentStatusOverview' + i + ); + + pending += idsToQuery.length - (result.aggregations?.id.buckets.length ?? 0); + + result.aggregations?.id.buckets.forEach(({ location, key: queryId }) => { + const locationSummaries = location.buckets.map(({ status, key: locationName }) => { + const ping = status.hits.hits[0]._source; + return { location: locationName, ping }; + }); // discard any locations that are not in the monitorLocationsMap for the given monitor as well as those which are // in monitorLocationsMap but not in listOfLocations @@ -185,11 +192,12 @@ export async function queryMonitorStatus( pending += 1; } }); - } - ); - } + }); + }, + { concurrency: 5 } + ); - // identify the remaining monitos without data, to determine pending monitors + // identify the remaining monitors without data, to determine pending monitors for (const [queryId, locs] of monitorsWithoutData) { locs.forEach((loc) => { pendingConfigs[`${monitorQueryIdToConfigIdMap[queryId]}-${loc}`] = { diff --git a/x-pack/plugins/synthetics/server/routes/index.ts b/x-pack/plugins/synthetics/server/routes/index.ts index 5312074520ac9..69406cd5ff612 100644 --- a/x-pack/plugins/synthetics/server/routes/index.ts +++ b/x-pack/plugins/synthetics/server/routes/index.ts @@ -35,7 +35,7 @@ import { addSyntheticsMonitorRoute } from './monitor_cruds/add_monitor'; import { addSyntheticsProjectMonitorRoute } from './monitor_cruds/add_monitor_project'; import { addSyntheticsProjectMonitorRouteLegacy } from './monitor_cruds/add_monitor_project_legacy'; import { syntheticsGetPingsRoute, syntheticsGetPingStatusesRoute } from './pings'; -import { createGetCurrentStatusRoute } from './status/current_status'; +import { createGetCurrentStatusRoute } from './overview_status/overview_status'; import { SyntheticsRestApiRouteFactory, SyntheticsStreamingRouteFactory, diff --git a/x-pack/plugins/synthetics/server/routes/status/current_status.test.ts b/x-pack/plugins/synthetics/server/routes/overview_status/overview_status.test.ts similarity index 98% rename from x-pack/plugins/synthetics/server/routes/status/current_status.test.ts rename to x-pack/plugins/synthetics/server/routes/overview_status/overview_status.test.ts index 484c556339d74..4679d555f6504 100644 --- a/x-pack/plugins/synthetics/server/routes/status/current_status.test.ts +++ b/x-pack/plugins/synthetics/server/routes/overview_status/overview_status.test.ts @@ -6,7 +6,7 @@ */ import { getUptimeESMockClient } from '../../legacy_uptime/lib/requests/test_helpers'; -import { periodToMs } from './current_status'; +import { periodToMs } from './overview_status'; import { queryMonitorStatus } from '../../queries/query_monitor_status'; import times from 'lodash/times'; @@ -170,7 +170,7 @@ describe('current status route', () => { await queryMonitorStatus( uptimeEsClient, ['Europe - Germany', 'Asia/Pacific - Japan'], - { from: 140000, to: 'now' }, + { from: 'now-1d', to: 'now' }, ['id1', 'id2'], { id1: ['Asia/Pacific - Japan'], id2: ['Europe - Germany', 'Asia/Pacific - Japan'] }, { @@ -335,7 +335,7 @@ describe('current status route', () => { await queryMonitorStatus( uptimeEsClient, [...concernedLocations, ...times(9997).map((n) => 'Europe - Germany' + n)], - { from: 2500, to: 'now' }, + { from: 'now-24h', to: 'now' }, ['id1', 'id2'], { id1: [concernedLocations[0]], id2: [concernedLocations[1], concernedLocations[2]] }, { @@ -498,7 +498,7 @@ describe('current status route', () => { await queryMonitorStatus( uptimeEsClient, ['Europe - Germany', 'Asia/Pacific - Japan'], - { from: 140000, to: 'now' }, + { from: 'now-12h', to: 'now' }, ['id1', 'id2', 'project-monitor-id', 'id4'], { id1: ['Asia/Pacific - Japan'], @@ -514,7 +514,7 @@ describe('current status route', () => { } ) ).toEqual({ - pending: 0, + pending: 2, down: 1, enabledMonitorQueryIds: ['id1', 'id2', 'project-monitor-id', 'id4'], up: 2, diff --git a/x-pack/plugins/synthetics/server/routes/status/current_status.ts b/x-pack/plugins/synthetics/server/routes/overview_status/overview_status.ts similarity index 96% rename from x-pack/plugins/synthetics/server/routes/status/current_status.ts rename to x-pack/plugins/synthetics/server/routes/overview_status/overview_status.ts index a07a250cd65bf..670ebcab2d73c 100644 --- a/x-pack/plugins/synthetics/server/routes/status/current_status.ts +++ b/x-pack/plugins/synthetics/server/routes/overview_status/overview_status.ts @@ -4,10 +4,11 @@ * 2.0; you may not use this file except in compliance with the Elastic License * 2.0. */ - import { intersection } from 'lodash'; import datemath, { Unit } from '@kbn/datemath'; import { SavedObjectsClientContract } from '@kbn/core/server'; +import moment from 'moment'; +import { ConfigKey } from '../../../common/runtime_types'; import { getAllMonitors, processMonitors, @@ -19,7 +20,6 @@ import { UMServerLibs } from '../../legacy_uptime/uptime_server'; import { SyntheticsRestApiRouteFactory } from '../../legacy_uptime/routes'; import { UptimeEsClient } from '../../legacy_uptime/lib/lib'; import { SyntheticsMonitorClient } from '../../synthetics_service/synthetics_monitor/synthetics_monitor_client'; -import { ConfigKey } from '../../../common/runtime_types'; import { getMonitorFilters, OverviewStatusSchema, OverviewStatusQuery } from '../common'; /** @@ -92,10 +92,15 @@ export async function getStatus( ? intersection(listOfLocations, queryLocationsArray) : listOfLocations; + const range = { + from: moment().subtract(maxPeriod, 'milliseconds').subtract(20, 'minutes').toISOString(), + to: 'now', + }; + const { up, down, pending, upConfigs, downConfigs, pendingConfigs } = await queryMonitorStatus( uptimeEsClient, listOfLocationAfterFilter, - { from: maxPeriod, to: 'now' }, + range, enabledMonitorQueryIds, monitorLocationMap, monitorQueryIdToConfigIdMap diff --git a/x-pack/plugins/synthetics/server/saved_objects/synthetics_monitor/get_all_monitors.ts b/x-pack/plugins/synthetics/server/saved_objects/synthetics_monitor/get_all_monitors.ts index 12fe8209e1bb7..c8518823af95f 100644 --- a/x-pack/plugins/synthetics/server/saved_objects/synthetics_monitor/get_all_monitors.ts +++ b/x-pack/plugins/synthetics/server/saved_objects/synthetics_monitor/get_all_monitors.ts @@ -11,7 +11,7 @@ import { SavedObjectsFindResult, } from '@kbn/core-saved-objects-api-server'; import pMap from 'p-map'; -import { periodToMs } from '../../routes/status/current_status'; +import { periodToMs } from '../../routes/overview_status/overview_status'; import { UptimeServerSetup } from '../../legacy_uptime/lib/adapters'; import { getAllLocations } from '../../synthetics_service/get_all_locations'; import { syntheticsMonitorType } from '../../legacy_uptime/lib/saved_objects/synthetics_monitor'; @@ -28,8 +28,8 @@ export const getAllMonitors = async ({ search, fields, filter, - sortField, - sortOrder, + sortField = 'name.keyword', + sortOrder = 'asc', searchFields, }: { soClient: SavedObjectsClientContract; diff --git a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/project_monitor_formatter.ts b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/project_monitor_formatter.ts index a759041b1cb36..796b14307048c 100644 --- a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/project_monitor_formatter.ts +++ b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/project_monitor_formatter.ts @@ -264,7 +264,7 @@ export class ProjectMonitorFormatter { public getProjectMonitorsForProject = async () => { const finder = this.savedObjectsClient.createPointInTimeFinder({ type: syntheticsMonitorType, - perPage: 1000, + perPage: 5000, filter: this.projectFilter, }); From c3bab3eca94b0aa9645daeb29eee62fb96351bad Mon Sep 17 00:00:00 2001 From: Stratoula Kalafateli Date: Wed, 8 Feb 2023 09:06:18 +0200 Subject: [PATCH 06/60] [Unified search] Fixes ally issues (#150411) ## Summary Closes https://github.com/elastic/kibana/issues/150368 Fixes ally issues on Unified search introduced by the new UI. --- .../public/filter_bar/filter_editor/phrase_value_input.tsx | 4 ++++ .../public/filter_bar/filter_editor/phrases_values_input.tsx | 4 ++++ .../public/filter_bar/filter_editor/value_input_type.tsx | 5 +++++ .../public/filters_builder/filter_item/field_input.tsx | 1 + .../public/filters_builder/filter_item/filter_item.tsx | 1 + .../public/filters_builder/filter_item/operator_input.tsx | 1 + 6 files changed, 16 insertions(+) diff --git a/src/plugins/unified_search/public/filter_bar/filter_editor/phrase_value_input.tsx b/src/plugins/unified_search/public/filter_bar/filter_editor/phrase_value_input.tsx index ff5fbc97477ca..ae87024bb61a9 100644 --- a/src/plugins/unified_search/public/filter_bar/filter_editor/phrase_value_input.tsx +++ b/src/plugins/unified_search/public/filter_bar/filter_editor/phrase_value_input.tsx @@ -78,6 +78,10 @@ class PhraseValueInputUI extends PhraseSuggestorUI { id: 'unifiedSearch.filter.filterEditor.valueSelectPlaceholder', defaultMessage: 'Select a value', })} + aria-label={intl.formatMessage({ + id: 'unifiedSearch.filter.filterEditor.valueSelectPlaceholder', + defaultMessage: 'Select a value', + })} options={options} getLabel={(option) => option} selectedOptions={value ? [valueAsStr] : []} diff --git a/src/plugins/unified_search/public/filter_bar/filter_editor/phrases_values_input.tsx b/src/plugins/unified_search/public/filter_bar/filter_editor/phrases_values_input.tsx index c1cb11f816535..336849c4ee65a 100644 --- a/src/plugins/unified_search/public/filter_bar/filter_editor/phrases_values_input.tsx +++ b/src/plugins/unified_search/public/filter_bar/filter_editor/phrases_values_input.tsx @@ -54,6 +54,10 @@ class PhrasesValuesInputUI extends PhraseSuggestorUI { id: 'unifiedSearch.filter.filterEditor.valuesSelectPlaceholder', defaultMessage: 'Select values', })} + aria-label={intl.formatMessage({ + id: 'unifiedSearch.filter.filterEditor.valuesSelectPlaceholder', + defaultMessage: 'Select values', + })} delimiter="," isCaseSensitive={true} options={options} diff --git a/src/plugins/unified_search/public/filter_bar/filter_editor/value_input_type.tsx b/src/plugins/unified_search/public/filter_bar/filter_editor/value_input_type.tsx index fc53c0e4631f7..f12c29897ff50 100644 --- a/src/plugins/unified_search/public/filter_bar/filter_editor/value_input_type.tsx +++ b/src/plugins/unified_search/public/filter_bar/filter_editor/value_input_type.tsx @@ -50,6 +50,7 @@ class ValueInputTypeUI extends Component { disabled={this.props.disabled} fullWidth={this.props.fullWidth} placeholder={this.props.placeholder} + aria-label={this.props.placeholder} value={value} onChange={this.onChange} isInvalid={!validateParams(value, this.props.field)} @@ -67,6 +68,7 @@ class ValueInputTypeUI extends Component { disabled={this.props.disabled} fullWidth={this.props.fullWidth} placeholder={this.props.placeholder} + aria-label={this.props.placeholder} value={this.getValueForNumberField(value)} onChange={this.onChange} controlOnly={this.props.controlOnly} @@ -83,6 +85,7 @@ class ValueInputTypeUI extends Component { disabled={this.props.disabled} fullWidth={this.props.fullWidth} placeholder={this.props.placeholder} + aria-label={this.props.placeholder} value={value} onChange={this.onChange} onBlur={this.onBlur} @@ -100,6 +103,7 @@ class ValueInputTypeUI extends Component { fullWidth={this.props.fullWidth} disabled={this.props.disabled} placeholder={this.props.placeholder} + aria-label={this.props.placeholder} value={value} onChange={this.onChange} isInvalid={!isEmpty(value) && !validateParams(value, this.props.field)} @@ -132,6 +136,7 @@ class ValueInputTypeUI extends Component { ]} value={value} onChange={this.onBoolChange} + aria-label={this.props.placeholder} className={this.props.className} fullWidth={this.props.fullWidth} compressed={this.props.compressed} diff --git a/src/plugins/unified_search/public/filters_builder/filter_item/field_input.tsx b/src/plugins/unified_search/public/filters_builder/filter_item/field_input.tsx index cbfe059b09263..7d2f3ac8cfa3d 100644 --- a/src/plugins/unified_search/public/filters_builder/filter_item/field_input.tsx +++ b/src/plugins/unified_search/public/filters_builder/filter_item/field_input.tsx @@ -84,6 +84,7 @@ export function FieldInput({ field, dataView, onHandleField }: FieldInputProps) placeholder={strings.getFieldSelectPlaceholderLabel()} sortMatchesBy="startsWith" singleSelection={{ asPlainText: true }} + aria-label={strings.getFieldSelectPlaceholderLabel()} isClearable={false} compressed fullWidth diff --git a/src/plugins/unified_search/public/filters_builder/filter_item/filter_item.tsx b/src/plugins/unified_search/public/filters_builder/filter_item/filter_item.tsx index b24429860d416..ac8fefa26a99f 100644 --- a/src/plugins/unified_search/public/filters_builder/filter_item/filter_item.tsx +++ b/src/plugins/unified_search/public/filters_builder/filter_item/filter_item.tsx @@ -240,6 +240,7 @@ export function FilterItem({ })} > ({ compressed isDisabled={!field || disabled} placeholder={strings.getOperatorSelectPlaceholderSelectLabel()} + aria-label={strings.getOperatorSelectPlaceholderSelectLabel()} options={operators} selectedOptions={operator ? [operator] : []} getLabel={({ message }) => message} From 064829675aeffddb5bcd4b66a3af7d6f3617a30d Mon Sep 17 00:00:00 2001 From: Achyut Jhunjhunwala Date: Wed, 8 Feb 2023 09:33:22 +0100 Subject: [PATCH 07/60] [APM] switch get environment function to use terms_enum api (#150175) Fixes https://github.com/elastic/kibana/issues/144544 ## Summary To get the list of Environments, aggregation was used on search api. With this change, list of environments will now be retrieved using the [Terms Enum API](https://www.elastic.co/guide/en/elasticsearch/reference/current/search-terms-enum.html#search-terms-enum) --------- Co-authored-by: kibanamachine <42973632+kibanamachine@users.noreply.github.com> --- .../public/hooks/use_environments_fetcher.tsx | 29 +++++- .../plugins/apm/public/hooks/use_fetcher.tsx | 31 +++--- .../routes/environments/get_environments.ts | 2 +- .../apm/server/routes/environments/route.ts | 7 +- .../tests/environment/generate_data.ts | 67 +++++++++++++ .../tests/environment/get_environment.spec.ts | 94 +++++++++++++++++++ 6 files changed, 210 insertions(+), 20 deletions(-) create mode 100644 x-pack/test/apm_api_integration/tests/environment/generate_data.ts create mode 100644 x-pack/test/apm_api_integration/tests/environment/get_environment.spec.ts diff --git a/x-pack/plugins/apm/public/hooks/use_environments_fetcher.tsx b/x-pack/plugins/apm/public/hooks/use_environments_fetcher.tsx index 50ad012e1aa02..4dc32754cbfe4 100644 --- a/x-pack/plugins/apm/public/hooks/use_environments_fetcher.tsx +++ b/x-pack/plugins/apm/public/hooks/use_environments_fetcher.tsx @@ -5,10 +5,14 @@ * 2.0. */ +import { SERVICE_ENVIRONMENT } from '../../common/es_fields/apm'; import { useFetcher } from './use_fetcher'; +import { Environment } from '../../common/environment_rt'; +import { APIReturnType } from '../services/rest/create_call_apm_api'; -const INITIAL_DATA = { environments: [] }; +type EnvironmentsAPIResponse = APIReturnType<'GET /internal/apm/environments'>; +const INITIAL_DATA: EnvironmentsAPIResponse = { environments: [] }; export function useEnvironmentsFetcher({ serviceName, start, @@ -20,7 +24,11 @@ export function useEnvironmentsFetcher({ }) { const { data = INITIAL_DATA, status } = useFetcher( (callApmApi) => { - if (start && end) { + if (!start || !end) { + return; + } + + if (serviceName) { return callApmApi('GET /internal/apm/environments', { params: { query: { @@ -31,9 +39,24 @@ export function useEnvironmentsFetcher({ }, }); } + return callApmApi('GET /internal/apm/suggestions', { + params: { + query: { + start, + end, + fieldName: SERVICE_ENVIRONMENT, + fieldValue: '', + }, + }, + }).then((response) => { + return { environments: response.terms }; + }); }, [start, end, serviceName] ); - return { environments: data.environments, status }; + return { + environments: data.environments as Environment[], + status, + }; } diff --git a/x-pack/plugins/apm/public/hooks/use_fetcher.tsx b/x-pack/plugins/apm/public/hooks/use_fetcher.tsx index 80f2451863b42..28e06341965f6 100644 --- a/x-pack/plugins/apm/public/hooks/use_fetcher.tsx +++ b/x-pack/plugins/apm/public/hooks/use_fetcher.tsx @@ -54,13 +54,28 @@ function getDetailsFromErrorResponse( } const createAutoAbortedAPMClient = ( - signal: AbortSignal + signal: AbortSignal, + addInspectorRequest: (result: FetcherResult) => void ): AutoAbortedAPMClient => { return ((endpoint, options) => { return callApmApi(endpoint, { ...options, signal, - } as any); + } as any) + .catch((err) => { + addInspectorRequest({ + status: FETCH_STATUS.FAILURE, + data: err.body?.attributes, + }); + throw err; + }) + .then((response) => { + addInspectorRequest({ + data: response, + status: FETCH_STATUS.SUCCESS, + }); + return response; + }); }) as AutoAbortedAPMClient; }; @@ -102,7 +117,9 @@ export function useFetcher( const signal = controller.signal; - const promise = fn(createAutoAbortedAPMClient(signal)); + const promise = fn( + createAutoAbortedAPMClient(signal, addInspectorRequest) + ); // if `fn` doesn't return a promise it is a signal that data fetching was not initiated. // This can happen if the data fetching is conditional (based on certain inputs). // In these cases it is not desirable to invoke the global loading spinner, or change the status to success @@ -179,14 +196,6 @@ export function useFetcher( /* eslint-enable react-hooks/exhaustive-deps */ ]); - useEffect(() => { - if (result.error) { - addInspectorRequest({ ...result, data: result.error.body?.attributes }); - } else { - addInspectorRequest(result); - } - }, [addInspectorRequest, result]); - return useMemo(() => { return { ...result, diff --git a/x-pack/plugins/apm/server/routes/environments/get_environments.ts b/x-pack/plugins/apm/server/routes/environments/get_environments.ts index f04d67fe7d339..056bfa731880b 100644 --- a/x-pack/plugins/apm/server/routes/environments/get_environments.ts +++ b/x-pack/plugins/apm/server/routes/environments/get_environments.ts @@ -17,7 +17,7 @@ import { Environment } from '../../../common/environment_rt'; import { APMEventClient } from '../../lib/helpers/create_es_client/create_apm_event_client'; /** - * This is used for getting the list of environments for the environments selector, + * This is used for getting the list of environments for the environment selector, * filtered by range. */ export async function getEnvironments({ diff --git a/x-pack/plugins/apm/server/routes/environments/route.ts b/x-pack/plugins/apm/server/routes/environments/route.ts index 32b7d2a5117d5..8757d7f99f544 100644 --- a/x-pack/plugins/apm/server/routes/environments/route.ts +++ b/x-pack/plugins/apm/server/routes/environments/route.ts @@ -7,6 +7,7 @@ import * as t from 'io-ts'; import { maxSuggestions } from '@kbn/observability-plugin/common'; +import { Environment } from '../../../common/environment_rt'; import { getSearchTransactionsEvents } from '../../lib/helpers/transactions'; import { getEnvironments } from './get_environments'; import { rangeRt } from '../default_api_types'; @@ -27,11 +28,7 @@ const environmentsRoute = createApmServerRoute({ handler: async ( resources ): Promise<{ - environments: Array< - | 'ENVIRONMENT_NOT_DEFINED' - | 'ENVIRONMENT_ALL' - | t.Branded - >; + environments: Environment[]; }> => { const apmEventClient = await getApmEventClient(resources); const { context, params, config } = resources; diff --git a/x-pack/test/apm_api_integration/tests/environment/generate_data.ts b/x-pack/test/apm_api_integration/tests/environment/generate_data.ts new file mode 100644 index 0000000000000..6e9ae2831e6be --- /dev/null +++ b/x-pack/test/apm_api_integration/tests/environment/generate_data.ts @@ -0,0 +1,67 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { apm, timerange } from '@kbn/apm-synthtrace-client'; +import type { ApmSynthtraceEsClient } from '@kbn/apm-synthtrace'; + +// Generate synthetic data for the environment test suite +export async function generateData({ + synthtraceEsClient, + start, + end, +}: { + synthtraceEsClient: ApmSynthtraceEsClient; + start: number; + end: number; +}) { + const environmentNames = ['production', 'development', 'staging']; + const serviceNames = ['go', 'java', 'node']; + + const services = environmentNames.flatMap((environment) => { + return serviceNames.flatMap((serviceName) => { + return apm + .service({ + name: serviceName, + environment, + agentName: serviceName, + }) + .instance('instance-a'); + }); + }); + + const goServiceWithAdditionalEnvironment = apm + .service({ + name: 'go', + environment: 'custom-go-environment', + agentName: 'go', + }) + .instance('instance-a'); + + // Generate a transaction for each service + const docs = timerange(start, end) + .ratePerMinute(1) + .generator((timestamp) => { + const loopGeneratedDocs = services.flatMap((service) => { + return service + .transaction({ transactionName: 'GET /api/product/:id' }) + .timestamp(timestamp) + .duration(1000); + }); + + const customDoc = goServiceWithAdditionalEnvironment + .transaction({ + transactionName: 'GET /api/go/memory', + transactionType: 'custom-go-type', + }) + .timestamp(timestamp) + .duration(1000); + + return [...loopGeneratedDocs, customDoc]; + }); + + await synthtraceEsClient.index(docs); +} diff --git a/x-pack/test/apm_api_integration/tests/environment/get_environment.spec.ts b/x-pack/test/apm_api_integration/tests/environment/get_environment.spec.ts new file mode 100644 index 0000000000000..5a3e850c88d0a --- /dev/null +++ b/x-pack/test/apm_api_integration/tests/environment/get_environment.spec.ts @@ -0,0 +1,94 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ +import expect from '@kbn/expect'; +import { FtrProviderContext } from '../../common/ftr_provider_context'; +import { generateData } from './generate_data'; + +const startNumber = new Date('2021-01-01T00:00:00.000Z').getTime(); +const endNumber = new Date('2021-01-01T00:05:00.000Z').getTime() - 1; + +const start = new Date(startNumber).toISOString(); +const end = new Date(endNumber).toISOString(); + +export default function environmentsAPITests({ getService }: FtrProviderContext) { + const registry = getService('registry'); + const apmApiClient = getService('apmApiClient'); + const synthtraceEsClient = getService('synthtraceEsClient'); + + registry.when('environments when data is loaded', { config: 'basic', archives: [] }, async () => { + before(async () => { + await generateData({ + synthtraceEsClient, + start: startNumber, + end: endNumber, + }); + }); + + after(() => synthtraceEsClient.clean()); + + describe('get environments', () => { + describe('when service name is not specified', () => { + it('returns all environments', async () => { + const { body } = await apmApiClient.readUser({ + endpoint: 'GET /internal/apm/environments', + params: { + query: { start, end }, + }, + }); + expect(body.environments.length).to.be.equal(4); + expectSnapshot(body.environments).toMatchInline(` + Array [ + "development", + "production", + "staging", + "custom-go-environment", + ] + `); + }); + }); + + describe('when service name is specified', () => { + it('returns service specific environments for go', async () => { + const { body } = await apmApiClient.readUser({ + endpoint: 'GET /internal/apm/environments', + params: { + query: { start, end, serviceName: 'go' }, + }, + }); + + expect(body.environments.length).to.be.equal(4); + expectSnapshot(body.environments).toMatchInline(` + Array [ + "custom-go-environment", + "development", + "production", + "staging", + ] + `); + }); + + it('returns service specific environments for java', async () => { + const { body } = await apmApiClient.readUser({ + endpoint: 'GET /internal/apm/environments', + params: { + query: { start, end, serviceName: 'java' }, + }, + }); + + expect(body.environments.length).to.be.equal(3); + expectSnapshot(body.environments).toMatchInline(` + Array [ + "development", + "production", + "staging", + ] + `); + }); + }); + }); + }); +} From c190a5f9141f96a15a4b30d285d2e121b3eb7651 Mon Sep 17 00:00:00 2001 From: Dzmitry Lemechko Date: Wed, 8 Feb 2023 09:56:40 +0100 Subject: [PATCH 08/60] [ftr tests] split x-pack functional_with_es_ssl config (#150416) ## Summary Splitting config as it takes over 40 minutes into smaller ones to speedup CI ``` The following "Functional Tests" configs have durations that exceed the maximum amount of time desired for a single CI job. This is not an error, and if you don't own any of these configs then you can ignore this warning.If you own any of these configs please split them up ASAP and ask Operations if you have questions about how to do that. x-pack/test/functional_with_es_ssl/config.ts: 40.6 minutes ``` Quick tests execution time [analysis](https://buildkite.com/elastic/kibana-pull-request/builds/105995#01862b40-f797-4537-9e05-a56453173b6d): /apps/triggers_actions_ui ~ 13 min 09:01:15 CEST - 09:14:10 CEST /apps/discover ~ 6 min 09:14:10 CEST - 09:20:21 CEST /apps/uptime. ~ 2 min 09:20:21 CEST - 09:22:08 CEST /apps/ml ~1 min 09:22:08 CEST - 09:22:57 CEST /apps/cases ~ 17 min 09:23:02 CEST - 09:40:19 CEST Splitting into 3 groups: x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/config.ts 12m 46s x-pack/test/functional_with_es_ssl/apps/cases/config.ts 18m 07s x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/config.ts 10m 38s Splitting cases/config into 2 groups: x-pack/test/functional_with_es_ssl/apps/cases/group1/config.ts 10m 18s x-pack/test/functional_with_es_ssl/apps/cases/group2/config.ts 8m 58s --- .buildkite/ftr_configs.yml | 6 ++++- .github/CODEOWNERS | 6 ++--- .../apps/cases/group1/config.ts | 20 +++++++++++++++ .../cases/{ => group1}/create_case_form.ts | 6 ++--- .../apps/cases/{ => group1}/deletion.ts | 6 ++--- .../apps/cases/group1/index.ts | 16 ++++++++++++ .../apps/cases/{ => group1}/view_case.ts | 6 ++--- .../{ => group2}/attachment_framework.ts | 4 +-- .../apps/cases/group2/config.ts | 20 +++++++++++++++ .../apps/cases/{ => group2}/configure.ts | 2 +- .../apps/cases/{ => group2}/index.ts | 5 +--- .../apps/cases/{ => group2}/list_view.ts | 6 ++--- .../apps/cases/{ => group2}/upgrade.ts | 4 +-- .../apps/discover_ml_uptime/config.ts | 25 +++++++++++++++++++ .../discover/index.ts | 2 +- .../discover/search_source_alert.ts | 2 +- .../ml/alert_flyout.ts | 2 +- .../apps/{ => discover_ml_uptime}/ml/index.ts | 2 +- .../uptime/alert_flyout.ts | 2 +- .../{ => discover_ml_uptime}/uptime/index.ts | 2 +- .../uptime/simple_down_alert.ts | 4 +-- .../apps/triggers_actions_ui/config.ts | 20 +++++++++++++++ .../{config.ts => config.base.ts} | 11 ++------ 23 files changed, 137 insertions(+), 42 deletions(-) create mode 100644 x-pack/test/functional_with_es_ssl/apps/cases/group1/config.ts rename x-pack/test/functional_with_es_ssl/apps/cases/{ => group1}/create_case_form.ts (93%) rename x-pack/test/functional_with_es_ssl/apps/cases/{ => group1}/deletion.ts (96%) create mode 100644 x-pack/test/functional_with_es_ssl/apps/cases/group1/index.ts rename x-pack/test/functional_with_es_ssl/apps/cases/{ => group1}/view_case.ts (98%) rename x-pack/test/functional_with_es_ssl/apps/cases/{ => group2}/attachment_framework.ts (98%) create mode 100644 x-pack/test/functional_with_es_ssl/apps/cases/group2/config.ts rename x-pack/test/functional_with_es_ssl/apps/cases/{ => group2}/configure.ts (96%) rename x-pack/test/functional_with_es_ssl/apps/cases/{ => group2}/index.ts (71%) rename x-pack/test/functional_with_es_ssl/apps/cases/{ => group2}/list_view.ts (99%) rename x-pack/test/functional_with_es_ssl/apps/cases/{ => group2}/upgrade.ts (98%) create mode 100644 x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/config.ts rename x-pack/test/functional_with_es_ssl/apps/{ => discover_ml_uptime}/discover/index.ts (86%) rename x-pack/test/functional_with_es_ssl/apps/{ => discover_ml_uptime}/discover/search_source_alert.ts (99%) rename x-pack/test/functional_with_es_ssl/apps/{ => discover_ml_uptime}/ml/alert_flyout.ts (98%) rename x-pack/test/functional_with_es_ssl/apps/{ => discover_ml_uptime}/ml/index.ts (94%) rename x-pack/test/functional_with_es_ssl/apps/{ => discover_ml_uptime}/uptime/alert_flyout.ts (99%) rename x-pack/test/functional_with_es_ssl/apps/{ => discover_ml_uptime}/uptime/index.ts (93%) rename x-pack/test/functional_with_es_ssl/apps/{ => discover_ml_uptime}/uptime/simple_down_alert.ts (96%) create mode 100644 x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/config.ts rename x-pack/test/functional_with_es_ssl/{config.ts => config.base.ts} (93%) diff --git a/.buildkite/ftr_configs.yml b/.buildkite/ftr_configs.yml index 5c3f6aef0271e..beb991bd19788 100644 --- a/.buildkite/ftr_configs.yml +++ b/.buildkite/ftr_configs.yml @@ -9,6 +9,7 @@ disabled: - x-pack/test/functional_enterprise_search/base_config.ts - x-pack/test/localization/config.base.ts - test/server_integration/config.base.js + - x-pack/test/functional_with_es_ssl/config.base.ts # QA suites that are run out-of-band - x-pack/test/stack_functional_integration/configs/config.stack_functional_integration_base.js @@ -180,7 +181,10 @@ enabled: - x-pack/test/functional_embedded/config.ts - x-pack/test/functional_enterprise_search/without_host_configured.config.ts - x-pack/test/functional_execution_context/config.ts - - x-pack/test/functional_with_es_ssl/config.ts + - x-pack/test/functional_with_es_ssl/apps/cases/group1/config.ts + - x-pack/test/functional_with_es_ssl/apps/cases/group2/config.ts + - x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/config.ts + - x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/config.ts - x-pack/test/functional/apps/advanced_settings/config.ts - x-pack/test/functional/apps/aiops/config.ts - x-pack/test/functional/apps/api_keys/config.ts diff --git a/.github/CODEOWNERS b/.github/CODEOWNERS index 547c8f5d33edd..e600849f8095e 100644 --- a/.github/CODEOWNERS +++ b/.github/CODEOWNERS @@ -13,7 +13,7 @@ /src/plugins/saved_search/ @elastic/kibana-data-discovery /x-pack/plugins/discover_enhanced/ @elastic/kibana-data-discovery /x-pack/test/functional/apps/discover/ @elastic/kibana-data-discovery -/x-pack/test/functional_with_es_ssl/apps/discover/ @elastic/kibana-data-discovery +/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/discover/ @elastic/kibana-data-discovery /test/functional/apps/discover/ @elastic/kibana-data-discovery /test/functional/apps/context/ @elastic/kibana-data-discovery /test/api_integration/apis/unified_field_list/ @elastic/kibana-data-discovery @@ -184,7 +184,7 @@ # Uptime /x-pack/plugins/synthetics @elastic/uptime /x-pack/plugins/ux @elastic/uptime -/x-pack/test/functional_with_es_ssl/apps/uptime @elastic/uptime +/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/ @elastic/uptime /x-pack/test/functional/apps/uptime @elastic/uptime /x-pack/test/functional/es_archives/uptime @elastic/uptime /x-pack/test/functional/services/uptime @elastic/uptime @@ -244,7 +244,7 @@ /x-pack/test/functional/es_archives/ml/ @elastic/ml-ui /x-pack/test/functional/services/ml/ @elastic/ml-ui /x-pack/test/functional_basic/apps/ml/ @elastic/ml-ui -/x-pack/test/functional_with_es_ssl/apps/ml/ @elastic/ml-ui +/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/ml/ @elastic/ml-ui /x-pack/test/alerting_api_integration/spaces_only/tests/alerting/ml_rule_types/ @elastic/ml-ui /x-pack/test/alerting_api_integration/spaces_only/tests/alerting/transform_rule_types/ @elastic/ml-ui /x-pack/test/screenshot_creation/apps/ml_docs @elastic/ml-ui diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/group1/config.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group1/config.ts new file mode 100644 index 0000000000000..ee1fc48c1084f --- /dev/null +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group1/config.ts @@ -0,0 +1,20 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { FtrConfigProviderContext } from '@kbn/test'; + +export default async function ({ readConfigFile }: FtrConfigProviderContext) { + const baseConfig = await readConfigFile(require.resolve('../../../config.base.ts')); + + return { + ...baseConfig.getAll(), + testFiles: [require.resolve('.')], + junit: { + reportName: 'Chrome X-Pack UI Functional Tests with ES SSL - Cases - group 1', + }, + }; +} diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/create_case_form.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group1/create_case_form.ts similarity index 93% rename from x-pack/test/functional_with_es_ssl/apps/cases/create_case_form.ts rename to x-pack/test/functional_with_es_ssl/apps/cases/group1/create_case_form.ts index 4a744071cb694..40cbbc53c5596 100644 --- a/x-pack/test/functional_with_es_ssl/apps/cases/create_case_form.ts +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group1/create_case_form.ts @@ -8,12 +8,12 @@ import expect from '@kbn/expect'; import { v4 as uuidv4 } from 'uuid'; import { CaseSeverity } from '@kbn/cases-plugin/common/api'; -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; import { createUsersAndRoles, deleteUsersAndRoles, -} from '../../../cases_api_integration/common/lib/authentication'; -import { users, roles, casesAllUser, casesAllUser2 } from './common'; +} from '../../../../cases_api_integration/common/lib/authentication'; +import { users, roles, casesAllUser, casesAllUser2 } from '../common'; export default ({ getService, getPageObject }: FtrProviderContext) => { describe('Create case', function () { diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/deletion.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group1/deletion.ts similarity index 96% rename from x-pack/test/functional_with_es_ssl/apps/cases/deletion.ts rename to x-pack/test/functional_with_es_ssl/apps/cases/group1/deletion.ts index 4179c549484fb..f23d0d01867cf 100644 --- a/x-pack/test/functional_with_es_ssl/apps/cases/deletion.ts +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group1/deletion.ts @@ -5,12 +5,12 @@ * 2.0. */ -import { FtrProviderContext } from '../../ftr_provider_context'; -import { users, roles, casesReadDeleteUser, casesAllUser, casesNoDeleteUser } from './common'; +import { FtrProviderContext } from '../../../ftr_provider_context'; +import { users, roles, casesReadDeleteUser, casesAllUser, casesNoDeleteUser } from '../common'; import { createUsersAndRoles, deleteUsersAndRoles, -} from '../../../cases_api_integration/common/lib/authentication'; +} from '../../../../cases_api_integration/common/lib/authentication'; export default ({ getPageObjects, getService }: FtrProviderContext) => { const PageObjects = getPageObjects(['security', 'header']); diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/group1/index.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group1/index.ts new file mode 100644 index 0000000000000..330bd820aea85 --- /dev/null +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group1/index.ts @@ -0,0 +1,16 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { FtrProviderContext } from '../../../ftr_provider_context'; + +export default ({ loadTestFile }: FtrProviderContext) => { + describe('Cases - group 1', function () { + loadTestFile(require.resolve('./create_case_form')); + loadTestFile(require.resolve('./view_case')); + loadTestFile(require.resolve('./deletion')); + }); +}; diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/view_case.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group1/view_case.ts similarity index 98% rename from x-pack/test/functional_with_es_ssl/apps/cases/view_case.ts rename to x-pack/test/functional_with_es_ssl/apps/cases/group1/view_case.ts index e808aaa8a4463..ecd99ba459cdd 100644 --- a/x-pack/test/functional_with_es_ssl/apps/cases/view_case.ts +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group1/view_case.ts @@ -9,12 +9,12 @@ import expect from '@kbn/expect'; import { v4 as uuidv4 } from 'uuid'; import { CaseStatuses } from '@kbn/cases-plugin/common'; import { CaseSeverity } from '@kbn/cases-plugin/common/api'; -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; import { createUsersAndRoles, deleteUsersAndRoles, -} from '../../../cases_api_integration/common/lib/authentication'; -import { users, roles, casesAllUser, casesAllUser2 } from './common'; +} from '../../../../cases_api_integration/common/lib/authentication'; +import { users, roles, casesAllUser, casesAllUser2 } from '../common'; export default ({ getPageObject, getService }: FtrProviderContext) => { const header = getPageObject('header'); diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/attachment_framework.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group2/attachment_framework.ts similarity index 98% rename from x-pack/test/functional_with_es_ssl/apps/cases/attachment_framework.ts rename to x-pack/test/functional_with_es_ssl/apps/cases/group2/attachment_framework.ts index 207434635829f..4e271da9e28d8 100644 --- a/x-pack/test/functional_with_es_ssl/apps/cases/attachment_framework.ts +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group2/attachment_framework.ts @@ -17,8 +17,8 @@ import { deleteAllCaseItems, findCases, getCase, -} from '../../../cases_api_integration/common/lib/utils'; -import { FtrProviderContext } from '../../ftr_provider_context'; +} from '../../../../cases_api_integration/common/lib/utils'; +import { FtrProviderContext } from '../../../ftr_provider_context'; const createLogStashDataView = async ( supertest: SuperTest.SuperTest diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/group2/config.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group2/config.ts new file mode 100644 index 0000000000000..8824daa639098 --- /dev/null +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group2/config.ts @@ -0,0 +1,20 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { FtrConfigProviderContext } from '@kbn/test'; + +export default async function ({ readConfigFile }: FtrConfigProviderContext) { + const baseConfig = await readConfigFile(require.resolve('../../../config.base.ts')); + + return { + ...baseConfig.getAll(), + testFiles: [require.resolve('.')], + junit: { + reportName: 'Chrome X-Pack UI Functional Tests with ES SSL - Cases - group 2', + }, + }; +} diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/configure.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group2/configure.ts similarity index 96% rename from x-pack/test/functional_with_es_ssl/apps/cases/configure.ts rename to x-pack/test/functional_with_es_ssl/apps/cases/group2/configure.ts index 0c826baa252b1..b812bbaeb019b 100644 --- a/x-pack/test/functional_with_es_ssl/apps/cases/configure.ts +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group2/configure.ts @@ -6,7 +6,7 @@ */ import expect from '@kbn/expect'; -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; export default ({ getPageObject, getService }: FtrProviderContext) => { const common = getPageObject('common'); diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/index.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group2/index.ts similarity index 71% rename from x-pack/test/functional_with_es_ssl/apps/cases/index.ts rename to x-pack/test/functional_with_es_ssl/apps/cases/group2/index.ts index 59f1dce3e947e..054d21a756fe1 100644 --- a/x-pack/test/functional_with_es_ssl/apps/cases/index.ts +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group2/index.ts @@ -5,16 +5,13 @@ * 2.0. */ -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; export default ({ loadTestFile }: FtrProviderContext) => { describe('Cases', function () { - loadTestFile(require.resolve('./create_case_form')); - loadTestFile(require.resolve('./view_case')); loadTestFile(require.resolve('./list_view')); loadTestFile(require.resolve('./configure')); loadTestFile(require.resolve('./attachment_framework')); - loadTestFile(require.resolve('./deletion')); loadTestFile(require.resolve('./upgrade')); }); }; diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/list_view.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group2/list_view.ts similarity index 99% rename from x-pack/test/functional_with_es_ssl/apps/cases/list_view.ts rename to x-pack/test/functional_with_es_ssl/apps/cases/group2/list_view.ts index a05c11940db7d..485f99f4db94a 100644 --- a/x-pack/test/functional_with_es_ssl/apps/cases/list_view.ts +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group2/list_view.ts @@ -10,12 +10,12 @@ import { CaseStatuses } from '@kbn/cases-plugin/common'; import { CaseSeverity } from '@kbn/cases-plugin/common/api'; import { SeverityAll } from '@kbn/cases-plugin/common/ui'; import { UserProfile } from '@kbn/user-profile-components'; -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; import { createUsersAndRoles, deleteUsersAndRoles, -} from '../../../cases_api_integration/common/lib/authentication'; -import { users, roles, casesAllUser, casesAllUser2 } from './common'; +} from '../../../../cases_api_integration/common/lib/authentication'; +import { users, roles, casesAllUser, casesAllUser2 } from '../common'; export default ({ getPageObject, getService }: FtrProviderContext) => { const header = getPageObject('header'); diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/upgrade.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group2/upgrade.ts similarity index 98% rename from x-pack/test/functional_with_es_ssl/apps/cases/upgrade.ts rename to x-pack/test/functional_with_es_ssl/apps/cases/group2/upgrade.ts index 6186d949905e7..120af4b555821 100644 --- a/x-pack/test/functional_with_es_ssl/apps/cases/upgrade.ts +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group2/upgrade.ts @@ -9,8 +9,8 @@ import expect from '@kbn/expect'; import { getExternalServiceSimulatorPath, ExternalServiceSimulator, -} from '../../../alerting_api_integration/common/plugins/actions_simulators/server/plugin'; -import { FtrProviderContext } from '../../ftr_provider_context'; +} from '../../../../alerting_api_integration/common/plugins/actions_simulators/server/plugin'; +import { FtrProviderContext } from '../../../ftr_provider_context'; export default ({ getPageObject, getService }: FtrProviderContext) => { const cases = getService('cases'); diff --git a/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/config.ts b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/config.ts new file mode 100644 index 0000000000000..1b3e58492e7ae --- /dev/null +++ b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/config.ts @@ -0,0 +1,25 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { FtrConfigProviderContext } from '@kbn/test'; +import { resolve } from 'path'; + +export default async function ({ readConfigFile }: FtrConfigProviderContext) { + const baseConfig = await readConfigFile(require.resolve('../../config.base.ts')); + + return { + ...baseConfig.getAll(), + testFiles: [ + resolve(__dirname, './discover'), + resolve(__dirname, './uptime'), + resolve(__dirname, './ml'), + ], + junit: { + reportName: 'Chrome X-Pack UI Functional Tests with ES SSL - Discover, Uptime, ML', + }, + }; +} diff --git a/x-pack/test/functional_with_es_ssl/apps/discover/index.ts b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/discover/index.ts similarity index 86% rename from x-pack/test/functional_with_es_ssl/apps/discover/index.ts rename to x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/discover/index.ts index f876140dbc92a..47ab9c33ce1cf 100644 --- a/x-pack/test/functional_with_es_ssl/apps/discover/index.ts +++ b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/discover/index.ts @@ -4,7 +4,7 @@ * 2.0; you may not use this file except in compliance with the Elastic License * 2.0. */ -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; export default ({ loadTestFile, getService }: FtrProviderContext) => { describe('Discover alerting', function () { diff --git a/x-pack/test/functional_with_es_ssl/apps/discover/search_source_alert.ts b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/discover/search_source_alert.ts similarity index 99% rename from x-pack/test/functional_with_es_ssl/apps/discover/search_source_alert.ts rename to x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/discover/search_source_alert.ts index 853d568f89d96..bc8b39d4cecfd 100644 --- a/x-pack/test/functional_with_es_ssl/apps/discover/search_source_alert.ts +++ b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/discover/search_source_alert.ts @@ -7,7 +7,7 @@ import expect from '@kbn/expect'; import { asyncForEach } from '@kbn/std'; -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; export default function ({ getService, getPageObjects }: FtrProviderContext) { const log = getService('log'); diff --git a/x-pack/test/functional_with_es_ssl/apps/ml/alert_flyout.ts b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/ml/alert_flyout.ts similarity index 98% rename from x-pack/test/functional_with_es_ssl/apps/ml/alert_flyout.ts rename to x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/ml/alert_flyout.ts index 4676004d9eb89..de7a2e42fda01 100644 --- a/x-pack/test/functional_with_es_ssl/apps/ml/alert_flyout.ts +++ b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/ml/alert_flyout.ts @@ -7,7 +7,7 @@ import type * as estypes from '@elastic/elasticsearch/lib/api/typesWithBodyKey'; import { DATAFEED_STATE } from '@kbn/ml-plugin/common/constants/states'; -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; function createTestJobAndDatafeed() { const timestamp = Date.now(); diff --git a/x-pack/test/functional_with_es_ssl/apps/ml/index.ts b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/ml/index.ts similarity index 94% rename from x-pack/test/functional_with_es_ssl/apps/ml/index.ts rename to x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/ml/index.ts index 942416c73b357..ef104c74b820d 100644 --- a/x-pack/test/functional_with_es_ssl/apps/ml/index.ts +++ b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/ml/index.ts @@ -5,7 +5,7 @@ * 2.0. */ -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; export default ({ loadTestFile, getService }: FtrProviderContext) => { const ml = getService('ml'); diff --git a/x-pack/test/functional_with_es_ssl/apps/uptime/alert_flyout.ts b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/alert_flyout.ts similarity index 99% rename from x-pack/test/functional_with_es_ssl/apps/uptime/alert_flyout.ts rename to x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/alert_flyout.ts index 140f85ff068ef..b68ecb3c08d9e 100644 --- a/x-pack/test/functional_with_es_ssl/apps/uptime/alert_flyout.ts +++ b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/alert_flyout.ts @@ -8,7 +8,7 @@ import expect from '@kbn/expect'; import { setTimeout as setTimeoutAsync } from 'timers/promises'; -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; export default ({ getPageObjects, getService }: FtrProviderContext) => { describe('uptime alerts', () => { diff --git a/x-pack/test/functional_with_es_ssl/apps/uptime/index.ts b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/index.ts similarity index 93% rename from x-pack/test/functional_with_es_ssl/apps/uptime/index.ts rename to x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/index.ts index 2c39ef045972f..80d91ef96a904 100644 --- a/x-pack/test/functional_with_es_ssl/apps/uptime/index.ts +++ b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/index.ts @@ -5,7 +5,7 @@ * 2.0. */ -import { FtrProviderContext } from '../../ftr_provider_context'; +import { FtrProviderContext } from '../../../ftr_provider_context'; const ARCHIVE = 'x-pack/test/functional/es_archives/uptime/full_heartbeat'; diff --git a/x-pack/test/functional_with_es_ssl/apps/uptime/simple_down_alert.ts b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/simple_down_alert.ts similarity index 96% rename from x-pack/test/functional_with_es_ssl/apps/uptime/simple_down_alert.ts rename to x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/simple_down_alert.ts index d9d37bcb76526..a0e041996f4bc 100644 --- a/x-pack/test/functional_with_es_ssl/apps/uptime/simple_down_alert.ts +++ b/x-pack/test/functional_with_es_ssl/apps/discover_ml_uptime/uptime/simple_down_alert.ts @@ -7,8 +7,8 @@ import expect from '@kbn/expect'; import { MonitorStatusTranslations } from '@kbn/synthetics-plugin/common/translations'; -import { FtrProviderContext } from '../../ftr_provider_context'; -import { deleteUptimeSettingsObject } from '../../../functional/apps/uptime'; +import { FtrProviderContext } from '../../../ftr_provider_context'; +import { deleteUptimeSettingsObject } from '../../../../functional/apps/uptime'; export default ({ getPageObjects, getService }: FtrProviderContext) => { describe('uptime simple status alert', () => { diff --git a/x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/config.ts b/x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/config.ts new file mode 100644 index 0000000000000..14c7161df49f7 --- /dev/null +++ b/x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/config.ts @@ -0,0 +1,20 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { FtrConfigProviderContext } from '@kbn/test'; + +export default async function ({ readConfigFile }: FtrConfigProviderContext) { + const baseConfig = await readConfigFile(require.resolve('../../config.base.ts')); + + return { + ...baseConfig.getAll(), + testFiles: [require.resolve('.')], + junit: { + reportName: 'Chrome X-Pack UI Functional Tests with ES SSL - Triggers Actions UI', + }, + }; +} diff --git a/x-pack/test/functional_with_es_ssl/config.ts b/x-pack/test/functional_with_es_ssl/config.base.ts similarity index 93% rename from x-pack/test/functional_with_es_ssl/config.ts rename to x-pack/test/functional_with_es_ssl/config.base.ts index 92d96a7a4ced5..8d8b32fc48463 100644 --- a/x-pack/test/functional_with_es_ssl/config.ts +++ b/x-pack/test/functional_with_es_ssl/config.base.ts @@ -6,7 +6,7 @@ */ import Fs from 'fs'; -import { resolve, join } from 'path'; +import { join } from 'path'; import { CA_CERT_PATH } from '@kbn/dev-utils'; import { FtrConfigProviderContext } from '@kbn/test'; import { pageObjects } from './page_objects'; @@ -51,14 +51,7 @@ export default async function ({ readConfigFile }: FtrConfigProviderContext) { ...xpackFunctionalConfig.getAll(), servers, pageObjects, - // list paths to the files that contain your plugins tests - testFiles: [ - resolve(__dirname, './apps/triggers_actions_ui'), - resolve(__dirname, './apps/discover'), - resolve(__dirname, './apps/uptime'), - resolve(__dirname, './apps/ml'), - resolve(__dirname, './apps/cases'), - ], + // Don't list paths to the files that contain your plugins tests here apps: { ...xpackFunctionalConfig.get('apps'), triggersActions: { From 67d1a4695f141d1b5f4f400a6185d4c4d6d9e537 Mon Sep 17 00:00:00 2001 From: Julia Bardi <90178898+juliaElastic@users.noreply.github.com> Date: Wed, 8 Feb 2023 10:12:40 +0100 Subject: [PATCH 09/60] [Fleet] refactor install registry and upload to extract common logic (#150444) ## Summary Related to https://github.com/elastic/kibana/issues/148599 Closes https://github.com/elastic/kibana/issues/82007 Factored out common logic in `installPackageFromRegistry` and `installPackageByUpload` to a new function. This improves the upload flow as well to handle install failure. We might want to introduce a `force` flag for the upload API to reinstall a package, now the logic does not do anything if the installed version package is uploaded again. EDIT: found [here](https://github.com/elastic/kibana/issues/82007) that upload should work with an implicit `force` flag, so will update that. More manual and automated tests needed. ### Checklist - [ ] [Unit or functional tests](https://www.elastic.co/guide/en/kibana/master/development-tests.html) were updated or added to match the most common scenarios --- .../services/epm/packages/install.test.ts | 44 ++++ .../server/services/epm/packages/install.ts | 226 ++++++++++-------- 2 files changed, 169 insertions(+), 101 deletions(-) diff --git a/x-pack/plugins/fleet/server/services/epm/packages/install.test.ts b/x-pack/plugins/fleet/server/services/epm/packages/install.test.ts index d8f4f4a70adaa..5466c61313d97 100644 --- a/x-pack/plugins/fleet/server/services/epm/packages/install.test.ts +++ b/x-pack/plugins/fleet/server/services/epm/packages/install.test.ts @@ -233,6 +233,50 @@ describe('install', () => { expect.objectContaining({ installSource: 'upload' }) ); }); + + it('should fetch latest version if version not provided', async () => { + jest.spyOn(licenseService, 'hasAtLeast').mockReturnValue(true); + const response = await installPackage({ + spaceId: DEFAULT_SPACE_ID, + installSource: 'registry', + pkgkey: 'test_package', + savedObjectsClient: savedObjectsClientMock.create(), + esClient: {} as ElasticsearchClient, + }); + + expect(response.status).toEqual('installed'); + + expect(sendTelemetryEvents).toHaveBeenCalledWith( + expect.anything(), + undefined, + expect.objectContaining({ + newVersion: '1.3.0', + }) + ); + }); + + it('should do nothing if same version is installed', async () => { + jest.spyOn(obj, 'getInstallationObject').mockImplementationOnce(() => + Promise.resolve({ + attributes: { + version: '1.2.0', + install_status: 'installed', + installed_es: [], + installed_kibana: [], + }, + } as any) + ); + jest.spyOn(licenseService, 'hasAtLeast').mockReturnValue(true); + const response = await installPackage({ + spaceId: DEFAULT_SPACE_ID, + installSource: 'registry', + pkgkey: 'apache-1.2.0', + savedObjectsClient: savedObjectsClientMock.create(), + esClient: {} as ElasticsearchClient, + }); + + expect(response.status).toEqual('already_installed'); + }); }); describe('upload', () => { diff --git a/x-pack/plugins/fleet/server/services/epm/packages/install.ts b/x-pack/plugins/fleet/server/services/epm/packages/install.ts index cf00ec4e3aed1..a3d087d828b01 100644 --- a/x-pack/plugins/fleet/server/services/epm/packages/install.ts +++ b/x-pack/plugins/fleet/server/services/epm/packages/install.ts @@ -30,6 +30,7 @@ import { FLEET_INSTALL_FORMAT_VERSION } from '../../../constants/fleet_es_assets import { generateESIndexPatterns } from '../elasticsearch/template/template'; import type { + ArchivePackage, BulkInstallPackageInfo, EpmPackageInstallStatus, EsAssetReference, @@ -293,15 +294,11 @@ async function installPackageFromRegistry({ const logger = appContextService.getLogger(); // TODO: change epm API to /packageName/version so we don't need to do this const { pkgName, pkgVersion: version } = Registry.splitPkgKey(pkgkey); - let pkgVersion = version; - - // Workaround apm issue with async spans: https://github.com/elastic/apm-agent-nodejs/issues/2611 - await Promise.resolve(); - const span = apm.startSpan(`Install package from registry ${pkgName}@${pkgVersion}`, 'package'); + let pkgVersion = version ?? ''; // if an error happens during getInstallType, report that we don't know let installType: InstallType = 'unknown'; - + const installSource = 'registry'; const telemetryEvent: PackageUpdateEvent = getTelemetryEvent(pkgName, pkgVersion); try { @@ -309,11 +306,8 @@ async function installPackageFromRegistry({ const installedPkg = await getInstallationObject({ savedObjectsClient, pkgName }); installType = getInstallType({ pkgVersion, installedPkg }); - span?.addLabels({ - packageName: pkgName, - packageVersion: pkgVersion, - installType, - }); + telemetryEvent.installType = installType; + telemetryEvent.currentVersion = installedPkg?.attributes.version || 'not_installed'; const queryLatest = () => Registry.fetchFindLatestPackageOrThrow(pkgName, { @@ -340,6 +334,100 @@ async function installPackageFromRegistry({ const installOutOfDateVersionOk = force || ['reinstall', 'reupdate', 'rollback'].includes(installType); + // if the requested version is out-of-date of the latest package version, check if we allow it + // if we don't allow it, return an error + if (semverLt(pkgVersion, latestPackage.version)) { + if (!installOutOfDateVersionOk) { + throw new PackageOutdatedError( + `${pkgkey} is out-of-date and cannot be installed or updated` + ); + } + logger.debug( + `${pkgkey} is out-of-date, installing anyway due to ${ + force ? 'force flag' : `install type ${installType}` + }` + ); + } + + return await installPackageCommon({ + pkgName, + pkgVersion, + installSource, + installedPkg, + installType, + savedObjectsClient, + esClient, + spaceId, + force, + packageInfo, + paths, + verificationResult, + }); + } catch (e) { + sendEvent({ + ...telemetryEvent, + errorMessage: e.message, + }); + return { + error: e, + installType, + installSource, + }; + } +} + +async function installPackageCommon(options: { + pkgName: string; + pkgVersion: string; + installSource: 'registry' | 'upload'; + installedPkg?: SavedObject; + installType: InstallType; + savedObjectsClient: SavedObjectsClientContract; + esClient: ElasticsearchClient; + spaceId: string; + force?: boolean; + packageInfo: ArchivePackage; + paths: string[]; + verificationResult?: PackageVerificationResult; + telemetryEvent?: PackageUpdateEvent; +}): Promise { + const { + pkgName, + pkgVersion, + installSource, + installedPkg, + installType, + savedObjectsClient, + force, + esClient, + spaceId, + packageInfo, + paths, + verificationResult, + } = options; + let { telemetryEvent } = options; + const logger = appContextService.getLogger(); + + // Workaround apm issue with async spans: https://github.com/elastic/apm-agent-nodejs/issues/2611 + await Promise.resolve(); + const span = apm.startSpan( + `Install package from ${installSource} ${pkgName}@${pkgVersion}`, + 'package' + ); + + if (!telemetryEvent) { + telemetryEvent = getTelemetryEvent(pkgName, pkgVersion); + telemetryEvent.installType = installType; + telemetryEvent.currentVersion = installedPkg?.attributes.version || 'not_installed'; + } + + try { + span?.addLabels({ + packageName: pkgName, + packageVersion: pkgVersion, + installType, + }); + // if the requested version is the same as installed version, check if we allow it based on // current installed package status and force flag, if we don't allow it, // just return the asset references from the existing installation @@ -348,7 +436,7 @@ async function installPackageFromRegistry({ installedPkg?.attributes.install_status === 'installed' ) { if (!force) { - logger.debug(`${pkgkey} is already installed, skipping installation`); + logger.debug(`${pkgName}-${pkgVersion} is already installed, skipping installation`); return { assets: [ ...installedPkg.attributes.installed_es, @@ -356,36 +444,18 @@ async function installPackageFromRegistry({ ], status: 'already_installed', installType, - installSource: 'registry', + installSource, }; } } - telemetryEvent.installType = installType; - telemetryEvent.currentVersion = installedPkg?.attributes.version || 'not_installed'; - - // if the requested version is out-of-date of the latest package version, check if we allow it - // if we don't allow it, return an error - if (semverLt(pkgVersion, latestPackage.version)) { - if (!installOutOfDateVersionOk) { - throw new PackageOutdatedError( - `${pkgkey} is out-of-date and cannot be installed or updated` - ); - } - logger.debug( - `${pkgkey} is out-of-date, installing anyway due to ${ - force ? 'force flag' : `install type ${installType}` - }` - ); - } - if (!licenseService.hasAtLeast(packageInfo.license || 'basic')) { const err = new Error(`Requires ${packageInfo.license} license`); sendEvent({ ...telemetryEvent, errorMessage: err.message, }); - return { error: err, installType, installSource: 'registry' }; + return { error: err, installType, installSource }; } const savedObjectsImporter = appContextService @@ -415,7 +485,7 @@ async function installPackageFromRegistry({ installType, spaceId, verificationResult, - installSource: 'registry', + installSource, }) .then(async (assets) => { await removeOldAssets({ @@ -424,10 +494,10 @@ async function installPackageFromRegistry({ currentVersion: packageInfo.version, }); sendEvent({ - ...telemetryEvent, + ...telemetryEvent!, status: 'success', }); - return { assets, status: 'installed', installType, installSource: 'registry' }; + return { assets, status: 'installed', installType, installSource }; }) .catch(async (err: Error) => { logger.warn(`Failure to install package [${pkgName}]: [${err.toString()}]`); @@ -441,10 +511,10 @@ async function installPackageFromRegistry({ esClient, }); sendEvent({ - ...telemetryEvent, + ...telemetryEvent!, errorMessage: err.message, }); - return { error: err, installType, installSource: 'registry' }; + return { error: err, installType, installSource }; }); } catch (e) { sendEvent({ @@ -454,7 +524,7 @@ async function installPackageFromRegistry({ return { error: e, installType, - installSource: 'registry', + installSource, }; } finally { span?.end(); @@ -469,16 +539,12 @@ async function installPackageByUpload({ spaceId, version, }: InstallUploadedArchiveParams): Promise { - // Workaround apm issue with async spans: https://github.com/elastic/apm-agent-nodejs/issues/2611 - await Promise.resolve(); - const span = apm.startSpan(`Install package from upload`, 'package'); - - const logger = appContextService.getLogger(); // if an error happens during getInstallType, report that we don't know let installType: InstallType = 'unknown'; - const telemetryEvent: PackageUpdateEvent = getTelemetryEvent('', ''); + const installSource = 'upload'; try { const { packageInfo } = await generatePackageInfoFromArchiveBuffer(archiveBuffer, contentType); + const pkgName = packageInfo.name; // Allow for overriding the version in the manifest for cases where we install // stack-aligned bundled packages to support special cases around the @@ -487,23 +553,11 @@ async function installPackageByUpload({ const installedPkg = await getInstallationObject({ savedObjectsClient, - pkgName: packageInfo.name, + pkgName, }); installType = getInstallType({ pkgVersion, installedPkg }); - span?.addLabels({ - packageName: packageInfo.name, - packageVersion: pkgVersion, - installType, - }); - - telemetryEvent.packageName = packageInfo.name; - telemetryEvent.newVersion = pkgVersion; - telemetryEvent.installType = installType; - telemetryEvent.currentVersion = installedPkg?.attributes.version || 'not_installed'; - - const installSource = 'upload'; // as we do not verify uploaded packages, we must invalidate the verification cache deleteVerificationResult(packageInfo); const paths = await unpackBufferToCache({ @@ -519,55 +573,25 @@ async function installPackageByUpload({ packageInfo, }); - const savedObjectsImporter = appContextService - .getSavedObjects() - .createImporter(savedObjectsClient); - - const savedObjectTagAssignmentService = appContextService - .getSavedObjectsTagging() - .createInternalAssignmentService({ client: savedObjectsClient }); - - const savedObjectTagClient = appContextService - .getSavedObjectsTagging() - .createTagClient({ client: savedObjectsClient }); - - // @ts-expect-error status is string instead of InstallResult.status 'installed' | 'already_installed' - return await _installPackage({ + return await installPackageCommon({ + pkgName, + pkgVersion, + installSource, + installedPkg, + installType, savedObjectsClient, - savedObjectsImporter, - savedObjectTagAssignmentService, - savedObjectTagClient, esClient, - logger, - installedPkg, + spaceId, + force: true, // upload has implicit force + packageInfo, paths, - packageInfo: { ...packageInfo, version: pkgVersion }, + }); + } catch (e) { + return { + error: e, installType, installSource, - spaceId, - }) - .then((assets) => { - sendEvent({ - ...telemetryEvent, - status: 'success', - }); - return { assets, status: 'installed', installType }; - }) - .catch(async (err: Error) => { - sendEvent({ - ...telemetryEvent, - errorMessage: err.message, - }); - return { error: err, installType }; - }); - } catch (e) { - sendEvent({ - ...telemetryEvent, - errorMessage: e.message, - }); - return { error: e, installType, installSource: 'upload' }; - } finally { - span?.end(); + }; } } From a2df4d6f85675b623900ad728d75b03be2eb20b4 Mon Sep 17 00:00:00 2001 From: Yngrid Coello Date: Wed, 8 Feb 2023 10:42:01 +0100 Subject: [PATCH 10/60] Making maxTransactionGroupsExceeded false by default (#150458) Relates to https://github.com/elastic/kibana/issues/146648. `maxTransactionGroupsExceeded` is currently `true` by default which is causing a flickering in transactions page specifically for the table, where we can see the callout for some milliseconds and then, after getting results from endpoint, disappears. ### before this change https://user-images.githubusercontent.com/1313018/217316916-e6434f4a-c4e6-4e12-ba2b-5f5ab0011984.mov --- .../apm/public/components/shared/transactions_table/index.tsx | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/x-pack/plugins/apm/public/components/shared/transactions_table/index.tsx b/x-pack/plugins/apm/public/components/shared/transactions_table/index.tsx index 4d80fff82c4fe..3990c0de33a47 100644 --- a/x-pack/plugins/apm/public/components/shared/transactions_table/index.tsx +++ b/x-pack/plugins/apm/public/components/shared/transactions_table/index.tsx @@ -49,7 +49,7 @@ const INITIAL_STATE: InitialState = { requestId: '', mainStatisticsData: { transactionGroups: [], - maxTransactionGroupsExceeded: true, + maxTransactionGroupsExceeded: false, transactionOverflowCount: 0, transactionGroupsTotalItems: 0, }, From 752f87b7de54684daa39414988e61af6af71317d Mon Sep 17 00:00:00 2001 From: Rickyanto Ang Date: Wed, 8 Feb 2023 02:28:13 -0800 Subject: [PATCH 11/60] [Cloud Posture][Bug]added fix for resource tab + small css fix on CSPM onboarding (#149997) ## Summary - Added Fix for Resource tab has empty component - Added small CSS fix for button on CSPM not centered --------- Co-authored-by: kibanamachine <42973632+kibanamachine@users.noreply.github.com> --- .../public/components/cloud_posture_page.tsx | 8 +------- .../pages/findings/findings_flyout/resource_tab.tsx | 2 +- 2 files changed, 2 insertions(+), 8 deletions(-) diff --git a/x-pack/plugins/cloud_security_posture/public/components/cloud_posture_page.tsx b/x-pack/plugins/cloud_security_posture/public/components/cloud_posture_page.tsx index 905d5ae8c2942..de9728d5d52b5 100644 --- a/x-pack/plugins/cloud_security_posture/public/components/cloud_posture_page.tsx +++ b/x-pack/plugins/cloud_security_posture/public/components/cloud_posture_page.tsx @@ -14,7 +14,6 @@ import { EuiFlexGroup, EuiFlexItem, EuiLink, - useEuiTheme, } from '@elastic/eui'; import { FormattedMessage } from '@kbn/i18n-react'; import { NoDataPage, NoDataPageProps } from '@kbn/kibana-react-plugin/public'; @@ -75,19 +74,14 @@ export const CspNoDataPage = ({ actionDescription, testId, }: CspNoDataPageProps) => { - const { euiTheme } = useEuiTheme(); return ( :nth-child(3) { display: block; margin: auto; width: 450px; - button { - margin: 0 auto; - margin-top: ${euiTheme.size.base}; - } } `} pageTitle={pageTitle} diff --git a/x-pack/plugins/cloud_security_posture/public/pages/findings/findings_flyout/resource_tab.tsx b/x-pack/plugins/cloud_security_posture/public/pages/findings/findings_flyout/resource_tab.tsx index 771caa5a070d8..86ea3f67acd79 100644 --- a/x-pack/plugins/cloud_security_posture/public/pages/findings/findings_flyout/resource_tab.tsx +++ b/x-pack/plugins/cloud_security_posture/public/pages/findings/findings_flyout/resource_tab.tsx @@ -92,7 +92,7 @@ export const ResourceTab = ({ data }: { data: CspFinding }) => { listItems={accordion.listItems} type="column" style={{ - marginTop: euiTheme.size.l, + paddingTop: euiTheme.size.l, }} titleProps={{ style: { width: '35%' } }} descriptionProps={{ style: { width: '65%' } }} From ebc675095fdfe58dabab8bf41cfc645868626b59 Mon Sep 17 00:00:00 2001 From: Boris Kirov Date: Wed, 8 Feb 2023 11:42:43 +0100 Subject: [PATCH 12/60] [APM] Removing the icon for tech preview and fixing some of the alert badges (#150528) After a discussion with @maciejforcone and @grabowskit it was recommended to remove the tech preview badge for the Alerts tab. We also made small change in the alert badge in different areas in APM to make easier to understand and align them with the actionable o11y team. Before / After ![image](https://user-images.githubusercontent.com/13353203/217280187-939fbc76-d036-4fea-b1e8-50983738f73b.png) ![image](https://user-images.githubusercontent.com/13353203/217280566-ae5a2d00-c939-496d-9642-ba20735fc91b.png) --------- Co-authored-by: kibanamachine <42973632+kibanamachine@users.noreply.github.com> --- .../service_group_card.tsx | 47 ++++++++++++------- .../service_inventory/service_list/index.tsx | 38 ++++++++++----- .../templates/apm_service_template/index.tsx | 20 +++++--- 3 files changed, 68 insertions(+), 37 deletions(-) diff --git a/x-pack/plugins/apm/public/components/app/service_groups/service_groups_list/service_group_card.tsx b/x-pack/plugins/apm/public/components/app/service_groups/service_groups_list/service_group_card.tsx index 26a642b39a911..1ac56f1867841 100644 --- a/x-pack/plugins/apm/public/components/app/service_groups/service_groups_list/service_group_card.tsx +++ b/x-pack/plugins/apm/public/components/app/service_groups/service_groups_list/service_group_card.tsx @@ -4,6 +4,7 @@ * 2.0; you may not use this file except in compliance with the Elastic License * 2.0. */ +import { EuiToolTip } from '@elastic/eui'; import { EuiAvatar, EuiBadge, @@ -62,10 +63,10 @@ export function ServiceGroupsCard({ )} - + - + {serviceGroupCounts !== undefined && i18n.translate( 'xpack.apm.serviceGroups.cardsList.serviceCount', @@ -80,25 +81,35 @@ export function ServiceGroupsCard({ {serviceGroupCounts && serviceGroupCounts.alerts > 0 && ( - - {i18n.translate( - 'xpack.apm.serviceGroups.cardsList.alertCount', + + > + + {i18n.translate( + 'xpack.apm.serviceGroups.cardsList.alertCount', + { + defaultMessage: + '{alertsCount} {alertsCount, plural, one {alert} other {alerts}}', + values: { alertsCount: serviceGroupCounts.alerts }, + } + )} + + )} diff --git a/x-pack/plugins/apm/public/components/app/service_inventory/service_list/index.tsx b/x-pack/plugins/apm/public/components/app/service_inventory/service_list/index.tsx index 1938b2dfe0bda..0f7d64477b2f4 100644 --- a/x-pack/plugins/apm/public/components/app/service_inventory/service_list/index.tsx +++ b/x-pack/plugins/apm/public/components/app/service_inventory/service_list/index.tsx @@ -82,8 +82,10 @@ export function getServiceColumns({ ? [ { field: ServiceInventoryFieldName.AlertsCount, - name: '', - width: `${unit * 5}px`, + name: i18n.translate('xpack.apm.servicesTable.alertsColumnLabel', { + defaultMessage: 'Active alerts', + }), + width: `${unit * 8}px`, sortable: true, render: (_, { serviceName, alertsCount }) => { if (!alertsCount) { @@ -91,16 +93,26 @@ export function getServiceColumns({ } return ( - - {alertsCount} - + + {alertsCount} + + ); }, } as ITableColumn, @@ -150,7 +162,7 @@ export function getServiceColumns({ defaultMessage: 'Environment', } ), - width: `${unit * 10}px`, + width: `${unit * 9}px`, sortable: true, render: (_, { environments }) => ( @@ -166,7 +178,7 @@ export function getServiceColumns({ 'xpack.apm.servicesTable.transactionColumnLabel', { defaultMessage: 'Transaction type' } ), - width: `${unit * 10}px`, + width: `${unit * 8}px`, sortable: true, }, ] diff --git a/x-pack/plugins/apm/public/components/routing/templates/apm_service_template/index.tsx b/x-pack/plugins/apm/public/components/routing/templates/apm_service_template/index.tsx index 6f5fd0f364d5b..02929c63e2e59 100644 --- a/x-pack/plugins/apm/public/components/routing/templates/apm_service_template/index.tsx +++ b/x-pack/plugins/apm/public/components/routing/templates/apm_service_template/index.tsx @@ -12,9 +12,10 @@ import { EuiPageHeaderProps, EuiSpacer, EuiTitle, + EuiToolTip, + EuiBadge, } from '@elastic/eui'; import { useLocation } from 'react-router-dom'; -import { EuiBadge } from '@elastic/eui'; import { i18n } from '@kbn/i18n'; import { enableAwsLambdaMetrics } from '@kbn/observability-plugin/common'; import { omit } from 'lodash'; @@ -357,13 +358,20 @@ function useTabs({ selectedTab }: { selectedTab: Tab['key'] }) { path: { serviceName }, query, }), - prepend: + append: serviceAlertsCount.alertsCount > 0 ? ( - - {serviceAlertsCount.alertsCount} - + + {serviceAlertsCount.alertsCount} + ) : null, - append: , label: i18n.translate('xpack.apm.home.alertsTabLabel', { defaultMessage: 'Alerts', }), From 9b82b6c65593152fbb011a32930c94f6a74a550d Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Yulia=20=C4=8Cech?= <6585477+yuliacech@users.noreply.github.com> Date: Wed, 8 Feb 2023 12:48:50 +0100 Subject: [PATCH 13/60] [Guided onboarding] Fix requests not firing (#150427) ## Summary I introduced a bug in https://github.com/elastic/kibana/pull/149528 that prevents some requests from being sent if other guided onboarding requests are in flight. That should not be the case, because it's intended that some requests will be sent at the same time. For example, the guide panel needs to load the plugin state and a config of the guide. At the same time, if the user is on the landing page, its needs to load the state of all guides. ### Checklist - [x] [Unit or functional tests](https://www.elastic.co/guide/en/kibana/master/development-tests.html) were updated or added to match the most common scenarios --- .../public/services/api.service.ts | 18 +----- .../public/services/api.test.ts | 56 +++++++++++++------ 2 files changed, 40 insertions(+), 34 deletions(-) diff --git a/src/plugins/guided_onboarding/public/services/api.service.ts b/src/plugins/guided_onboarding/public/services/api.service.ts index 398d1cf56a6a3..949002b19ea6a 100644 --- a/src/plugins/guided_onboarding/public/services/api.service.ts +++ b/src/plugins/guided_onboarding/public/services/api.service.ts @@ -123,18 +123,10 @@ export class ApiService implements GuidedOnboardingApi { if (!this.client) { throw new Error('ApiService has not be initialized.'); } - // don't send a request if a request is already in flight - if (this.isLoading$.value) { - return undefined; - } try { - this.isLoading$.next(true); - const response = await this.client.get<{ state: GuideState[] }>(`${API_BASE_PATH}/guides`); - this.isLoading$.next(false); - return response; + return await this.client.get<{ state: GuideState[] }>(`${API_BASE_PATH}/guides`); } catch (error) { - this.isLoading$.next(false); throw error; } } @@ -156,10 +148,6 @@ export class ApiService implements GuidedOnboardingApi { if (!this.client) { throw new Error('ApiService has not be initialized.'); } - // don't send a request if a request is already in flight - if (this.isLoading$.value) { - return undefined; - } try { this.isLoading$.next(true); @@ -482,10 +470,6 @@ export class ApiService implements GuidedOnboardingApi { if (!this.client) { throw new Error('ApiService has not be initialized.'); } - // don't send a request if a request is already in flight - if (this.isLoading$.value) { - return undefined; - } this.isLoading$.next(true); const config = await this.configService.getGuideConfig(guideId); this.isLoading$.next(false); diff --git a/src/plugins/guided_onboarding/public/services/api.test.ts b/src/plugins/guided_onboarding/public/services/api.test.ts index 1b5a7b02d0bb3..41c6a93faf27e 100644 --- a/src/plugins/guided_onboarding/public/services/api.test.ts +++ b/src/plugins/guided_onboarding/public/services/api.test.ts @@ -114,6 +114,17 @@ describe('GuidedOnboarding ApiService', () => { expect(httpClient.get).toHaveBeenCalledTimes(1); expect(httpClient.get).toHaveBeenCalledWith(`${API_BASE_PATH}/guides`); }); + + it('a request to all guides state API is sent even when a fetch plugin state request is in flight at the same time', async () => { + httpClient.get.mockImplementationOnce(() => { + return new Promise((resolve) => setTimeout(resolve)); + }); + await apiService.fetchPluginState$().subscribe(); + expect(apiService.isLoading$.value).toBe(true); + await apiService.fetchAllGuidesState(); + expect(httpClient.get).toHaveBeenCalledTimes(2); + expect(httpClient.get).toHaveBeenCalledWith(`${API_BASE_PATH}/guides`); + }); }); describe('updatePluginState', () => { @@ -132,6 +143,19 @@ describe('GuidedOnboarding ApiService', () => { body: JSON.stringify({ status: 'quit' }), }); }); + + it('a request to update plugin state API is sent even when a fetch plugin state request is in flight at the same time', async () => { + httpClient.get.mockImplementationOnce(() => { + return new Promise((resolve) => setTimeout(resolve)); + }); + await apiService.fetchPluginState$().subscribe(); + expect(apiService.isLoading$.value).toBe(true); + await apiService.updatePluginState({ guide: testGuideStep1InProgressState }, false); + expect(httpClient.put).toHaveBeenCalledTimes(1); + expect(httpClient.put).toHaveBeenCalledWith(`${API_BASE_PATH}/state`, { + body: JSON.stringify({ guide: testGuideStep1InProgressState }), + }); + }); }); describe('activateGuide', () => { @@ -627,8 +651,8 @@ describe('GuidedOnboarding ApiService', () => { }); }); - describe('is updated when fetching all guides state', () => { - it('true while request is in flight, false after the request completes', async () => { + describe('is not updated when fetching all guides state', () => { + it('false while request is in flight', async () => { httpClient.get.mockImplementation(() => { return new Promise((resolve) => setTimeout( @@ -644,20 +668,7 @@ describe('GuidedOnboarding ApiService', () => { // starting the request apiService.fetchAllGuidesState().then(); - await testRequest(); - }); - - it('true while request is in flight, false after the request fails', async () => { - httpClient.get.mockImplementation(() => { - return new Promise((resolve, reject) => - setTimeout(() => reject(new Error('test')), 2000) - ); - }); - apiService.setup(httpClient, true); - // starting the request - apiService.fetchAllGuidesState().catch(() => {}); - - await testRequest(true); + expect(apiService.isLoading$.value).toBe(false); }); }); @@ -735,7 +746,18 @@ describe('GuidedOnboarding ApiService', () => { apiService.setup(httpClient, true); await apiService.getGuideConfig(testGuideId); expect(httpClient.get).toHaveBeenCalledTimes(1); - expect(httpClient.get).toHaveBeenCalledWith(`${API_BASE_PATH}/configs/${testGuideId}`); + expect(httpClient.get).toHaveBeenLastCalledWith(`${API_BASE_PATH}/configs/${testGuideId}`); + }); + + it('a request to config API is sent even when a fetch plugin state request is in flight at the same time', async () => { + httpClient.get.mockImplementationOnce(() => { + return new Promise((resolve) => setTimeout(resolve)); + }); + await apiService.fetchPluginState$().subscribe(); + expect(apiService.isLoading$.value).toBe(true); + await apiService.getGuideConfig(testGuideId); + expect(httpClient.get).toHaveBeenCalledTimes(2); + expect(httpClient.get).toHaveBeenLastCalledWith(`${API_BASE_PATH}/configs/${testGuideId}`); }); }); From c5dfeba731d7d16bda7d34ef96ead4999f8c4aee Mon Sep 17 00:00:00 2001 From: Maryam Saeidi Date: Wed, 8 Feb 2023 12:51:30 +0100 Subject: [PATCH 14/60] [AO] Improve loading state in Overview page (#150327) Fixes #150305 ## Summary This PR fixes the loading state of the `infra_metrics` section. I also tried to check why the `Log` section appears without any loading state but it seems the API that returns if this section has data takes a bit more time than the other APIs (@weltenwort please let me know if my assumption is not correct or if you have suggestion about how to get the hasData info for `Log` section quicker) |Before|After| |---|---| |![image](https://user-images.githubusercontent.com/12370520/216984455-f9277a88-0759-4e5e-b8aa-6b8af745a82f.png)|![image](https://user-images.githubusercontent.com/12370520/216984578-a7392b90-3709-4487-9b9f-8bf70ddaffe5.png)| --- .../components/app/section/metrics/index.tsx | 37 ++++++++++++------- .../components/app/section/ux/index.tsx | 4 +- .../observability/public/context/constants.ts | 13 +++++++ .../public/context/has_data_context.tsx | 31 ++++++++++++---- 4 files changed, 61 insertions(+), 24 deletions(-) create mode 100644 x-pack/plugins/observability/public/context/constants.ts diff --git a/x-pack/plugins/observability/public/components/app/section/metrics/index.tsx b/x-pack/plugins/observability/public/components/app/section/metrics/index.tsx index ee82b80c3ace4..2d02a4cbb3566 100644 --- a/x-pack/plugins/observability/public/components/app/section/metrics/index.tsx +++ b/x-pack/plugins/observability/public/components/app/section/metrics/index.tsx @@ -10,6 +10,7 @@ import { Direction, EuiBasicTable, EuiBasicTableColumn, + EuiLoadingChart, EuiTableSortingType, } from '@elastic/eui'; import numeral from '@elastic/numeral'; @@ -99,14 +100,7 @@ export function MetricsSection({ bucketSize }: Props) { } const isLoading = status === FETCH_STATUS.LOADING; - const isPending = status === FETCH_STATUS.LOADING; - if (isLoading || isPending) { - return 
Loading
; - } - - if (!data) { - return 
No Data
; - } + const isInitialLoad = isLoading && !data; const columns: Array> = [ { @@ -218,12 +212,27 @@ export function MetricsSection({ bucketSize }: Props) { }} hasError={status === FETCH_STATUS.FAILURE} > - + {isInitialLoad ? ( +
+ +
+ ) : ( + + )} ); } diff --git a/x-pack/plugins/observability/public/components/app/section/ux/index.tsx b/x-pack/plugins/observability/public/components/app/section/ux/index.tsx index bdc783938211f..2bfc534c641db 100644 --- a/x-pack/plugins/observability/public/components/app/section/ux/index.tsx +++ b/x-pack/plugins/observability/public/components/app/section/ux/index.tsx @@ -9,8 +9,8 @@ import { i18n } from '@kbn/i18n'; import React from 'react'; import { useKibana } from '@kbn/kibana-react-plugin/public'; import { CoreStart } from '@kbn/core/public'; +import { UX_APP } from '../../../../context/constants'; import { ObservabilityPublicPluginsStart } from '../../../..'; -import type { AppDataType } from '../../../shared/exploratory_view/types'; import { SectionContainer } from '..'; import { getDataHandler } from '../../../../data_handler'; import { FETCH_STATUS, useFetcher } from '../../../../hooks/use_fetcher'; @@ -52,7 +52,7 @@ export function UXSection({ bucketSize }: Props) { [SERVICE_NAME]: ['ALL_VALUES'], }, breakdown: SERVICE_NAME, - dataType: 'ux' as AppDataType, + dataType: UX_APP, selectedMetricField: TRANSACTION_DURATION, showPercentileAnnotations: false, }, diff --git a/x-pack/plugins/observability/public/context/constants.ts b/x-pack/plugins/observability/public/context/constants.ts new file mode 100644 index 0000000000000..695febb81aff6 --- /dev/null +++ b/x-pack/plugins/observability/public/context/constants.ts @@ -0,0 +1,13 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +export const ALERT_APP = 'alert'; +export const UX_APP = 'ux'; +export const SYNTHETICS_APP = 'synthetics'; +export const APM_APP = 'apm'; +export const INFRA_LOGS_APP = 'infra_logs'; +export const INFRA_METRICS_APP = 'infra_metrics'; diff --git a/x-pack/plugins/observability/public/context/has_data_context.tsx b/x-pack/plugins/observability/public/context/has_data_context.tsx index e5e281979ef2f..775b401b50866 100644 --- a/x-pack/plugins/observability/public/context/has_data_context.tsx +++ b/x-pack/plugins/observability/public/context/has_data_context.tsx @@ -10,6 +10,14 @@ import React, { createContext, useEffect, useState } from 'react'; import { useRouteMatch } from 'react-router-dom'; import { asyncForEach } from '@kbn/std'; import { useKibana } from '@kbn/kibana-react-plugin/public'; +import { + ALERT_APP, + APM_APP, + INFRA_LOGS_APP, + INFRA_METRICS_APP, + SYNTHETICS_APP, + UX_APP, +} from './constants'; import { getDataHandler } from '../data_handler'; import { FETCH_STATUS } from '../hooks/use_fetcher'; import { useDatePickerContext } from '../hooks/use_date_picker_context'; @@ -40,7 +48,14 @@ export interface HasDataContextValue { export const HasDataContext = createContext({} as HasDataContextValue); -const apps: DataContextApps[] = ['apm', 'synthetics', 'infra_logs', 'infra_metrics', 'ux', 'alert']; +const apps: DataContextApps[] = [ + APM_APP, + SYNTHETICS_APP, + INFRA_LOGS_APP, + INFRA_METRICS_APP, + UX_APP, + ALERT_APP, +]; export function HasDataContextProvider({ children }: { children: React.ReactNode }) { const { http } = useKibana().services; @@ -76,7 +91,7 @@ export function HasDataContextProvider({ children }: { children: React.ReactNode })); }; switch (app) { - case 'ux': + case UX_APP: const params = { absoluteTime: { start: absoluteStart!, end: absoluteEnd! } }; const resultUx = await getDataHandler(app)?.hasData(params); updateState({ @@ -85,24 +100,24 @@ export function HasDataContextProvider({ children }: { children: React.ReactNode serviceName: resultUx?.serviceName as string, }); break; - case 'synthetics': + case SYNTHETICS_APP: const resultSy = await getDataHandler(app)?.hasData(); updateState({ hasData: resultSy?.hasData, indices: resultSy?.indices }); break; - case 'apm': + case APM_APP: const resultApm = await getDataHandler(app)?.hasData(); updateState({ hasData: resultApm?.hasData, indices: resultApm?.indices }); break; - case 'infra_logs': + case INFRA_LOGS_APP: const resultInfraLogs = await getDataHandler(app)?.hasData(); updateState({ hasData: resultInfraLogs?.hasData, indices: resultInfraLogs?.indices, }); break; - case 'infra_metrics': + case INFRA_METRICS_APP: const resultInfraMetrics = await getDataHandler(app)?.hasData(); updateState({ hasData: resultInfraMetrics?.hasData, @@ -131,7 +146,7 @@ export function HasDataContextProvider({ children }: { children: React.ReactNode const alerts = await getObservabilityAlerts({ http }); setHasDataMap((prevState) => ({ ...prevState, - alert: { + [ALERT_APP]: { hasData: alerts.length > 0, status: FETCH_STATUS.SUCCESS, }, @@ -139,7 +154,7 @@ export function HasDataContextProvider({ children }: { children: React.ReactNode } catch (e) { setHasDataMap((prevState) => ({ ...prevState, - alert: { + [ALERT_APP]: { hasData: undefined, status: FETCH_STATUS.FAILURE, }, From 86e91b72ddc421964304788e44e46480144ce097 Mon Sep 17 00:00:00 2001 From: Marco Liberati Date: Wed, 8 Feb 2023 13:05:27 +0100 Subject: [PATCH 15/60] [Lens] Always use resolved time range when computing Top values order agg with timeshifts (#150418) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit ## Summary Fix #150313 This was a very tricky bug to discover but with a relative "easy" solution: the main difference here between Lens and Dashboard was that the former is always converting timeRange data into absolute dates, while the latter keeps the original date format. This difference in how dates are handled by the app triggers the bug when a specific Lens configuration is used, as `moment` could not handle a relative time range, as it's not an ISO format, which makes it fallback into the `Date` constructor therefore a final `null` value: this `null` is passed underneath to the aggs logic which 💥 when traversing the object and find a `null` value where a timestamp was expected instead. As an example think of: ```ts moment.tz("now-15m", "Europe/Rome").subtract(undefined || 0).toISOString(); ``` this will produce a `new Date("now-15m")` and the `toISOString()` method translates it into a `null` value. All this to give some more debugging context of the work behind this simple one-line fix. :) ### Checklist Delete any items that are not applicable to this PR. - [ ] Any text added follows [EUI's writing guidelines](https://elastic.github.io/eui/#/guidelines/writing), uses sentence case text and includes [i18n support](https://github.com/elastic/kibana/blob/main/packages/kbn-i18n/README.md) - [ ] [Documentation](https://www.elastic.co/guide/en/kibana/master/development-documentation.html) was added for features that require explanation or tutorials - [ ] [Unit or functional tests](https://www.elastic.co/guide/en/kibana/master/development-tests.html) were updated or added to match the most common scenarios - [ ] Any UI touched in this PR is usable by keyboard only (learn more about [keyboard accessibility](https://webaim.org/techniques/keyboard/)) - [ ] Any UI touched in this PR does not create any new axe failures (run axe in browser: [FF](https://addons.mozilla.org/en-US/firefox/addon/axe-devtools/), [Chrome](https://chrome.google.com/webstore/detail/axe-web-accessibility-tes/lhdoppojpmngadmnindnejefpokejbdd?hl=en-US)) - [ ] If a plugin configuration key changed, check if it needs to be allowlisted in the cloud and added to the [docker list](https://github.com/elastic/kibana/blob/main/src/dev/build/tasks/os_packages/docker_generator/resources/base/bin/kibana-docker) - [ ] This renders correctly on smaller devices using a responsive layout. (You can test this [in your browser](https://www.browserstack.com/guide/responsive-testing-on-local-server)) - [ ] This was checked for [cross-browser compatibility](https://www.elastic.co/support/matrix#matrix_browsers) ### Risk Matrix Delete this section if it is not applicable to this PR. Before closing this PR, invite QA, stakeholders, and other developers to identify risks that should be tested prior to the change/feature release. When forming the risk matrix, consider some of the following examples and how they may potentially impact the change: | Risk | Probability | Severity | Mitigation/Notes | |---------------------------|-------------|----------|-------------------------| | Multiple Spaces—unexpected behavior in non-default Kibana Space. | Low | High | Integration tests will verify that all features are still supported in non-default Kibana Space and when user switches between spaces. | | Multiple nodes—Elasticsearch polling might have race conditions when multiple Kibana nodes are polling for the same tasks. | High | Low | Tasks are idempotent, so executing them multiple times will not result in logical error, but will degrade performance. To test for this case we add plenty of unit tests around this logic and document manual testing procedure. | | Code should gracefully handle cases when feature X or plugin Y are disabled. | Medium | High | Unit tests will verify that any feature flag or plugin combination still results in our service operational. | | [See more potential risk examples](https://github.com/elastic/kibana/blob/main/RISK_MATRIX.mdx) | ### For maintainers - [ ] This was checked for breaking API changes and was [labeled appropriately](https://www.elastic.co/guide/en/kibana/master/contributing.html#kibana-release-notes-process) --- .../data/common/search/aggs/buckets/_terms_order_helper.ts | 7 +++++-- 1 file changed, 5 insertions(+), 2 deletions(-) diff --git a/src/plugins/data/common/search/aggs/buckets/_terms_order_helper.ts b/src/plugins/data/common/search/aggs/buckets/_terms_order_helper.ts index c53e43acb37c4..fecfc94229208 100644 --- a/src/plugins/data/common/search/aggs/buckets/_terms_order_helper.ts +++ b/src/plugins/data/common/search/aggs/buckets/_terms_order_helper.ts @@ -67,6 +67,9 @@ export const termsOrderAggParamDefinition: Partial 1 && aggs.timeRange) { const shift = orderAgg.getTimeShift(); + // The timeRange can be either absolute or relative + // We need the absolute/resolved one for moment, so use the helper method + const timeRange = aggs.getResolvedTimeRange(); orderAgg = aggs.createAggConfig( { type: 'filtered_metric', @@ -84,11 +87,11 @@ export const termsOrderAggParamDefinition: Partial Date: Wed, 8 Feb 2023 13:15:48 +0100 Subject: [PATCH 16/60] [Saved Objects] Update `resolve` doc comment (#150540) ## Summary Per title --- .../src/saved_objects_client.ts | 14 ++++++++++++-- .../src/saved_objects_client.ts | 14 ++++++++++++-- 2 files changed, 24 insertions(+), 4 deletions(-) diff --git a/packages/core/saved-objects/core-saved-objects-api-browser/src/saved_objects_client.ts b/packages/core/saved-objects/core-saved-objects-api-browser/src/saved_objects_client.ts index fc4285406effe..d92b39f6c15a6 100644 --- a/packages/core/saved-objects/core-saved-objects-api-browser/src/saved_objects_client.ts +++ b/packages/core/saved-objects/core-saved-objects-api-browser/src/saved_objects_client.ts @@ -129,7 +129,15 @@ export interface SavedObjectsClientContract { bulkGet(objects: SavedObjectTypeIdTuple[]): Promise>; /** - * Resolves a single object + * Resolves a single object. + * + * After 8.0.0, saved objects are provided a unique ID _across_ spaces. + * A subset of existing saved objects may have IDs regenerated while upgrading to 8+. + * `.resolve` provides a way for clients with legacy IDs to still retrieve the correct + * saved object. + * + * An example of a client with a "legacy ID" is a bookmarked dashboard in a + * non-default space. * * @param {string} type - the type of the object to resolve * @param {string} id - the ID of the object to resolve @@ -144,7 +152,9 @@ export interface SavedObjectsClientContract { resolve(type: string, id: string): Promise>; /** - * Resolves an array of objects by id, using any legacy URL aliases if they exist + * Resolves an array of objects by id. + * + * See documentation for `.resolve`. * * @param objects - an array of objects containing id, type * @returns The bulk resolve result for the saved objects for the given types and ids. diff --git a/packages/core/saved-objects/core-saved-objects-api-server/src/saved_objects_client.ts b/packages/core/saved-objects/core-saved-objects-api-server/src/saved_objects_client.ts index de7fcfd19fc4b..a7ba3f2818971 100644 --- a/packages/core/saved-objects/core-saved-objects-api-server/src/saved_objects_client.ts +++ b/packages/core/saved-objects/core-saved-objects-api-server/src/saved_objects_client.ts @@ -210,7 +210,9 @@ export interface SavedObjectsClientContract { ): Promise>; /** - * Resolves an array of objects by id, using any legacy URL aliases if they exist + * Resolves an array of objects by id. + * + * See documentation for `.resolve`. * * @param objects - an array of objects to resolve (contains id and type) * @param options {@link SavedObjectsBaseOptions} - options for the bulk resolve operation @@ -232,7 +234,15 @@ export interface SavedObjectsClientContract { ): Promise>; /** - * Resolves a single object, using any legacy URL alias if it exists + * Resolves a single object. + * + * After 8.0.0, saved objects are provided a unique ID _across_ spaces. + * A subset of existing saved objects may have IDs regenerated while upgrading to 8+. + * `.resolve` provides a way for clients with legacy IDs to still retrieve the correct + * saved object. + * + * An example of a client with a "legacy ID" is a bookmarked dashboard in a + * non-default space. * * @param type - The type of SavedObject to retrieve * @param id - The ID of the SavedObject to retrieve From 1856323bbd343cbb8c45aafc8cb6b5050352fa0a Mon Sep 17 00:00:00 2001 From: Alexi Doak <109488926+doakalexi@users.noreply.github.com> Date: Wed, 8 Feb 2023 08:10:09 -0500 Subject: [PATCH 17/60] [ResponseOps][Alerting] A redundant summary alert is shown on rule details alerts list (#150088) Resolves https://github.com/elastic/kibana/issues/149824 ## Summary Added a filter to filter out logs that have an action set to `execute-action` in the `alert_summary` route on the rules details page. Updated how we log summary alerts by removing the `alertId` and `group` fields. I added a new summary field to `kibana.alerting` that includes the counts for new, ongoing, and recovered alerts. ### Checklist - [x] [Unit or functional tests](https://www.elastic.co/guide/en/kibana/master/development-tests.html) were updated or added to match the most common scenarios ### To verify - Create a rule that has Alert Summary and let the rule run. - Click on the rule to navigate to the rule details page and look at the `Alerts` tab. Verify that the summary alert is not listed in the table. **This is a screen shot of the table in the issue:** We want to verify that the last row is no longer there. Screen Shot 2023-02-01 at 3 02 21 PM --- .../alerting_event_logger.ts | 8 +++++- ...eate_alert_event_log_record_object.test.ts | 16 ++++++++++++ .../create_alert_event_log_record_object.ts | 17 ++++++++++++- .../rules_client/methods/get_alert_summary.ts | 2 ++ .../tests/get_alert_summary.test.ts | 2 ++ .../task_runner/execution_handler.test.ts | 12 +++++++++ .../server/task_runner/execution_handler.ts | 7 ++++-- .../plugins/event_log/generated/mappings.json | 25 +++++++++++++++++++ x-pack/plugins/event_log/generated/schemas.ts | 19 ++++++++++++++ x-pack/plugins/event_log/scripts/mappings.js | 25 +++++++++++++++++++ 10 files changed, 129 insertions(+), 4 deletions(-) diff --git a/x-pack/plugins/alerting/server/lib/alerting_event_logger/alerting_event_logger.ts b/x-pack/plugins/alerting/server/lib/alerting_event_logger/alerting_event_logger.ts index fff026a358bc8..dd8c52bebc0e0 100644 --- a/x-pack/plugins/alerting/server/lib/alerting_event_logger/alerting_event_logger.ts +++ b/x-pack/plugins/alerting/server/lib/alerting_event_logger/alerting_event_logger.ts @@ -54,8 +54,13 @@ interface AlertOpts { interface ActionOpts { id: string; typeId: string; - alertId: string; + alertId?: string; alertGroup?: string; + alertSummary?: { + new: number; + ongoing: number; + recovered: number; + }; } export class AlertingEventLogger { @@ -278,6 +283,7 @@ export function createActionExecuteRecord(context: RuleContextOpts, action: Acti }, ], ruleName: context.ruleName, + alertSummary: action.alertSummary, }); } diff --git a/x-pack/plugins/alerting/server/lib/create_alert_event_log_record_object.test.ts b/x-pack/plugins/alerting/server/lib/create_alert_event_log_record_object.test.ts index 8f73ba3a56860..185aa098a49d7 100644 --- a/x-pack/plugins/alerting/server/lib/create_alert_event_log_record_object.test.ts +++ b/x-pack/plugins/alerting/server/lib/create_alert_event_log_record_object.test.ts @@ -191,6 +191,11 @@ describe('createAlertEventLogRecordObject', () => { }, ], spaceId: 'default', + alertSummary: { + new: 2, + ongoing: 3, + recovered: 1, + }, }) ).toStrictEqual({ event: { @@ -214,6 +219,17 @@ describe('createAlertEventLogRecordObject', () => { alerting: { action_group_id: 'group 1', instance_id: 'test1', + summary: { + new: { + count: 2, + }, + ongoing: { + count: 3, + }, + recovered: { + count: 1, + }, + }, }, saved_objects: [ { diff --git a/x-pack/plugins/alerting/server/lib/create_alert_event_log_record_object.ts b/x-pack/plugins/alerting/server/lib/create_alert_event_log_record_object.ts index ea74cab5d11cf..280f498422fd0 100644 --- a/x-pack/plugins/alerting/server/lib/create_alert_event_log_record_object.ts +++ b/x-pack/plugins/alerting/server/lib/create_alert_event_log_record_object.ts @@ -36,6 +36,11 @@ interface CreateAlertEventLogRecordParams { relation?: string; }>; flapping?: boolean; + alertSummary?: { + new: number; + ongoing: number; + recovered: number; + }; } export function createAlertEventLogRecordObject(params: CreateAlertEventLogRecordParams): Event { @@ -52,13 +57,23 @@ export function createAlertEventLogRecordObject(params: CreateAlertEventLogRecor consumer, spaceId, flapping, + alertSummary, } = params; const alerting = - params.instanceId || group + params.instanceId || group || alertSummary ? { alerting: { ...(params.instanceId ? { instance_id: params.instanceId } : {}), ...(group ? { action_group_id: group } : {}), + ...(alertSummary + ? { + summary: { + new: { count: alertSummary.new }, + ongoing: { count: alertSummary.ongoing }, + recovered: { count: alertSummary.recovered }, + }, + } + : {}), }, } : undefined; diff --git a/x-pack/plugins/alerting/server/rules_client/methods/get_alert_summary.ts b/x-pack/plugins/alerting/server/rules_client/methods/get_alert_summary.ts index e841423ad1949..8d194b850816b 100644 --- a/x-pack/plugins/alerting/server/rules_client/methods/get_alert_summary.ts +++ b/x-pack/plugins/alerting/server/rules_client/methods/get_alert_summary.ts @@ -56,6 +56,8 @@ export async function getAlertSummary( start: parsedDateStart.toISOString(), sort: [{ sort_field: '@timestamp', sort_order: 'desc' }], end: dateNow.toISOString(), + // filter out execute-action event logs + filter: 'NOT event.action: execute-action AND event.provider: alerting', }, rule.legacyId !== null ? [rule.legacyId] : undefined ), diff --git a/x-pack/plugins/alerting/server/rules_client/tests/get_alert_summary.test.ts b/x-pack/plugins/alerting/server/rules_client/tests/get_alert_summary.test.ts index f0f634538d6f7..cbf766bd482d5 100644 --- a/x-pack/plugins/alerting/server/rules_client/tests/get_alert_summary.test.ts +++ b/x-pack/plugins/alerting/server/rules_client/tests/get_alert_summary.test.ts @@ -222,6 +222,7 @@ describe('getAlertSummary()', () => { ], Object { "end": "2019-02-12T21:01:22.479Z", + "filter": "NOT event.action: execute-action AND event.provider: alerting", "page": 1, "per_page": 10000, "sort": Array [ @@ -264,6 +265,7 @@ describe('getAlertSummary()', () => { ], Object { "end": "2019-02-12T21:01:22.479Z", + "filter": "NOT event.action: execute-action AND event.provider: alerting", "page": 1, "per_page": 10000, "sort": Array [ diff --git a/x-pack/plugins/alerting/server/task_runner/execution_handler.test.ts b/x-pack/plugins/alerting/server/task_runner/execution_handler.test.ts index ed88a9ecb60c1..b41db1147f3b7 100644 --- a/x-pack/plugins/alerting/server/task_runner/execution_handler.test.ts +++ b/x-pack/plugins/alerting/server/task_runner/execution_handler.test.ts @@ -907,6 +907,11 @@ describe('Execution Handler', () => { ], ] `); + expect(alertingEventLogger.logAction).toBeCalledWith({ + alertSummary: { new: 1, ongoing: 0, recovered: 0 }, + id: '1', + typeId: 'testActionTypeId', + }); }); test('skips summary actions (per rule run) when there is no alerts', async () => { @@ -946,6 +951,7 @@ describe('Execution Handler', () => { expect(getSummarizedAlertsMock).not.toHaveBeenCalled(); expect(actionsClient.bulkEnqueueExecution).not.toHaveBeenCalled(); + expect(alertingEventLogger.logAction).not.toHaveBeenCalled(); }); test('triggers summary actions (custom interval)', async () => { @@ -1030,6 +1036,11 @@ describe('Execution Handler', () => { ], ] `); + expect(alertingEventLogger.logAction).toBeCalledWith({ + alertSummary: { new: 1, ongoing: 0, recovered: 0 }, + id: '1', + typeId: 'testActionTypeId', + }); }); test('does not trigger summary actions if it is still being throttled (custom interval)', async () => { @@ -1075,6 +1086,7 @@ describe('Execution Handler', () => { ); expect(getSummarizedAlertsMock).not.toHaveBeenCalled(); expect(actionsClient.bulkEnqueueExecution).not.toHaveBeenCalled(); + expect(alertingEventLogger.logAction).not.toHaveBeenCalled(); }); test('removes the obsolete actions from the task state', async () => { diff --git a/x-pack/plugins/alerting/server/task_runner/execution_handler.ts b/x-pack/plugins/alerting/server/task_runner/execution_handler.ts index 8755d480621d7..d0784805c5942 100644 --- a/x-pack/plugins/alerting/server/task_runner/execution_handler.ts +++ b/x-pack/plugins/alerting/server/task_runner/execution_handler.ts @@ -239,8 +239,11 @@ export class ExecutionHandler< logActions.push({ id: action.id, typeId: action.actionTypeId, - alertId: 'summary', - alertGroup: action.group, + alertSummary: { + new: summarizedAlerts.new.count, + ongoing: summarizedAlerts.ongoing.count, + recovered: summarizedAlerts.recovered.count, + }, }); } else { const executableAlert = alert!; diff --git a/x-pack/plugins/event_log/generated/mappings.json b/x-pack/plugins/event_log/generated/mappings.json index 1e3c5396927b7..a5212917393f8 100644 --- a/x-pack/plugins/event_log/generated/mappings.json +++ b/x-pack/plugins/event_log/generated/mappings.json @@ -271,6 +271,31 @@ "outcome": { "type": "keyword", "ignore_above": 1024 + }, + "summary": { + "properties": { + "new": { + "properties": { + "count": { + "type": "long" + } + } + }, + "ongoing": { + "properties": { + "count": { + "type": "long" + } + } + }, + "recovered": { + "properties": { + "count": { + "type": "long" + } + } + } + } } } }, diff --git a/x-pack/plugins/event_log/generated/schemas.ts b/x-pack/plugins/event_log/generated/schemas.ts index 430feda52f1fb..93ee9f2977a36 100644 --- a/x-pack/plugins/event_log/generated/schemas.ts +++ b/x-pack/plugins/event_log/generated/schemas.ts @@ -116,6 +116,25 @@ export const EventSchema = schema.maybe( action_subgroup: ecsString(), status: ecsString(), outcome: ecsString(), + summary: schema.maybe( + schema.object({ + new: schema.maybe( + schema.object({ + count: ecsStringOrNumber(), + }) + ), + ongoing: schema.maybe( + schema.object({ + count: ecsStringOrNumber(), + }) + ), + recovered: schema.maybe( + schema.object({ + count: ecsStringOrNumber(), + }) + ), + }) + ), }) ), alert: schema.maybe( diff --git a/x-pack/plugins/event_log/scripts/mappings.js b/x-pack/plugins/event_log/scripts/mappings.js index fc4d40ee9f774..36838a4208a87 100644 --- a/x-pack/plugins/event_log/scripts/mappings.js +++ b/x-pack/plugins/event_log/scripts/mappings.js @@ -54,6 +54,31 @@ exports.EcsCustomPropertyMappings = { type: 'keyword', ignore_above: 1024, }, + summary: { + properties: { + new: { + properties: { + count: { + type: 'long', + }, + }, + }, + ongoing: { + properties: { + count: { + type: 'long', + }, + }, + }, + recovered: { + properties: { + count: { + type: 'long', + }, + }, + }, + }, + }, }, }, alert: { From 9aae30e35fec6b9b10e92b7846ed02af9d04df2e Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Alejandro=20Fern=C3=A1ndez=20G=C3=B3mez?= Date: Wed, 8 Feb 2023 14:15:53 +0100 Subject: [PATCH 18/60] [Synthetics UI] Add deprecation warnings for the synthetics integration monitors (#150437) Closes #150287 ## Summary Adds or updates deprecation notices regarding the synthetics integration when the user has monitors created through it. ## Screenshots In the Uptime UI: Screenshot 2023-02-07 at 15 10 37 When editing an integration: Screenshot 2023-02-07 at 15 44 57 --- .../synthetics/common/constants/rest_api.ts | 2 +- .../plugins/synthetics/common/types/index.ts | 2 +- ...recation.ts => integration_deprecation.ts} | 4 +- ...nthetics_policy_edit_extension_wrapper.tsx | 5 +- .../integration_deprecation/index.tsx | 52 +++++++++++ .../integration_deprecation.test.tsx} | 38 ++++---- .../integration_deprecation_callout.tsx | 66 +++++++++++++ .../overview/zip_url_deprecation/index.tsx | 92 ------------------- .../public/legacy_uptime/pages/overview.tsx | 4 +- ...onitors.ts => has_integration_monitors.ts} | 9 +- .../fleet/get_has_integration_monitors.ts | 24 +++++ .../routes/fleet/get_has_zip_url_monitors.ts | 31 ------- .../plugins/synthetics/server/routes/index.ts | 4 +- .../translations/translations/fr-FR.json | 4 - .../translations/translations/ja-JP.json | 4 - .../translations/translations/zh-CN.json | 4 - 16 files changed, 179 insertions(+), 166 deletions(-) rename x-pack/plugins/synthetics/common/types/{zip_url_deprecation.ts => integration_deprecation.ts} (72%) create mode 100644 x-pack/plugins/synthetics/public/legacy_uptime/components/overview/integration_deprecation/index.tsx rename x-pack/plugins/synthetics/public/legacy_uptime/components/overview/{zip_url_deprecation/zip_url_deprecation.test.tsx => integration_deprecation/integration_deprecation.test.tsx} (56%) create mode 100644 x-pack/plugins/synthetics/public/legacy_uptime/components/overview/integration_deprecation/integration_deprecation_callout.tsx delete mode 100644 x-pack/plugins/synthetics/public/legacy_uptime/components/overview/zip_url_deprecation/index.tsx rename x-pack/plugins/synthetics/public/legacy_uptime/state/api/{has_zip_url_monitors.ts => has_integration_monitors.ts} (53%) create mode 100644 x-pack/plugins/synthetics/server/routes/fleet/get_has_integration_monitors.ts delete mode 100644 x-pack/plugins/synthetics/server/routes/fleet/get_has_zip_url_monitors.ts diff --git a/x-pack/plugins/synthetics/common/constants/rest_api.ts b/x-pack/plugins/synthetics/common/constants/rest_api.ts index eaf3ba8c36b14..552980758c3ec 100644 --- a/x-pack/plugins/synthetics/common/constants/rest_api.ts +++ b/x-pack/plugins/synthetics/common/constants/rest_api.ts @@ -45,7 +45,7 @@ export enum API_URLS { TRIGGER_MONITOR = '/internal/uptime/service/monitors/trigger', SERVICE_ALLOWED = '/internal/uptime/service/allowed', SYNTHETICS_APIKEY = '/internal/uptime/service/api_key', - SYNTHETICS_HAS_ZIP_URL_MONITORS = '/internal/uptime/fleet/has_zip_url_monitors', + SYNTHETICS_HAS_INTEGRATION_MONITORS = '/internal/uptime/fleet/has_integration_monitors', // Project monitor public endpoint SYNTHETICS_MONITORS_PROJECT = '/api/synthetics/project/{projectName}/monitors', diff --git a/x-pack/plugins/synthetics/common/types/index.ts b/x-pack/plugins/synthetics/common/types/index.ts index b26fcaccba881..6a864b700092d 100644 --- a/x-pack/plugins/synthetics/common/types/index.ts +++ b/x-pack/plugins/synthetics/common/types/index.ts @@ -8,4 +8,4 @@ export * from './monitor_duration'; export * from './synthetics_monitor'; export * from './monitor_validation'; -export * from './zip_url_deprecation'; +export * from './integration_deprecation'; diff --git a/x-pack/plugins/synthetics/common/types/zip_url_deprecation.ts b/x-pack/plugins/synthetics/common/types/integration_deprecation.ts similarity index 72% rename from x-pack/plugins/synthetics/common/types/zip_url_deprecation.ts rename to x-pack/plugins/synthetics/common/types/integration_deprecation.ts index 793d1d35ddb97..951de85c046b6 100644 --- a/x-pack/plugins/synthetics/common/types/zip_url_deprecation.ts +++ b/x-pack/plugins/synthetics/common/types/integration_deprecation.ts @@ -5,6 +5,6 @@ * 2.0. */ -export interface SyntheticsHasZipUrlMonitorsResponse { - hasZipUrlMonitors: boolean; +export interface SyntheticsHasIntegrationMonitorsResponse { + hasIntegrationMonitors: boolean; } diff --git a/x-pack/plugins/synthetics/public/legacy_uptime/components/fleet_package/synthetics_policy_edit_extension_wrapper.tsx b/x-pack/plugins/synthetics/public/legacy_uptime/components/fleet_package/synthetics_policy_edit_extension_wrapper.tsx index abe156475755d..5c1f6dd7c1159 100644 --- a/x-pack/plugins/synthetics/public/legacy_uptime/components/fleet_package/synthetics_policy_edit_extension_wrapper.tsx +++ b/x-pack/plugins/synthetics/public/legacy_uptime/components/fleet_package/synthetics_policy_edit_extension_wrapper.tsx @@ -8,7 +8,7 @@ import React, { memo, useMemo } from 'react'; import { i18n } from '@kbn/i18n'; import { PackagePolicyEditExtensionComponentProps } from '@kbn/fleet-plugin/public'; -import { EuiButton, EuiCallOut } from '@elastic/eui'; +import { EuiButton, EuiCallOut, EuiSpacer } from '@elastic/eui'; import { useKibana } from '@kbn/kibana-react-plugin/public'; import { PolicyConfig, MonitorFields } from './types'; import { ConfigKey, DataStream, TLSFields } from './types'; @@ -22,6 +22,7 @@ import { TLSFieldsContextProvider, } from './contexts'; import { normalizers } from './helpers/normalizers'; +import { IntegrationDeprecationCallout } from '../overview/integration_deprecation/integration_deprecation_callout'; /** * Exports Synthetics-specific package policy instructions @@ -124,6 +125,8 @@ export const SyntheticsPolicyEditExtensionWrapper = memo + + { + const monitorList = useSelector(monitorListSelector); + const noticeHasBeenDismissed = + window.sessionStorage.getItem(INTEGRATION_DEPRECATION_SESSION_STORAGE_KEY) === 'true'; + const { data, loading } = useFetcher(() => { + // load it when list is loaded + if (!noticeHasBeenDismissed && monitorList.isLoaded) { + return getHasIntegrationMonitors(); + } + return undefined; + }, [monitorList.isLoaded]); + const hasIntegrationMonitors = !loading && data && data.hasIntegrationMonitors; + const [shouldShowNotice, setShouldShowNotice] = useState( + Boolean(hasIntegrationMonitors && !noticeHasBeenDismissed) + ); + + const handleDismissDeprecationNotice = () => { + window.sessionStorage.setItem(INTEGRATION_DEPRECATION_SESSION_STORAGE_KEY, 'true'); + setShouldShowNotice(false); + }; + + useEffect(() => { + setShouldShowNotice(Boolean(hasIntegrationMonitors && !noticeHasBeenDismissed)); + }, [hasIntegrationMonitors, noticeHasBeenDismissed]); + + return shouldShowNotice ? ( + <> + + + + ) : null; +}; diff --git a/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/zip_url_deprecation/zip_url_deprecation.test.tsx b/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/integration_deprecation/integration_deprecation.test.tsx similarity index 56% rename from x-pack/plugins/synthetics/public/legacy_uptime/components/overview/zip_url_deprecation/zip_url_deprecation.test.tsx rename to x-pack/plugins/synthetics/public/legacy_uptime/components/overview/integration_deprecation/integration_deprecation.test.tsx index 2d49f529e0379..68373ad85ba6b 100644 --- a/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/zip_url_deprecation/zip_url_deprecation.test.tsx +++ b/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/integration_deprecation/integration_deprecation.test.tsx @@ -9,62 +9,64 @@ import userEvent from '@testing-library/user-event'; import { StubBrowserStorage } from '@kbn/test-jest-helpers'; import { screen } from '@testing-library/react'; import { render } from '../../../lib/helper/rtl_helpers'; -import { ZipUrlDeprecation, ZIP_URL_DEPRECATION_SESSION_STORAGE_KEY } from '.'; +import { IntegrationDeprecation, INTEGRATION_DEPRECATION_SESSION_STORAGE_KEY } from '.'; import * as observabilityPublic from '@kbn/observability-plugin/public'; export const mockStorage = new StubBrowserStorage(); jest.mock('@kbn/observability-plugin/public'); -describe('ZipUrlDeprecation', () => { +const DEPRECATION_TITLE = 'Migrate your Elastic Synthetics integration monitors before Elastic 8.8'; + +describe('IntegrationDeprecation', () => { const { FETCH_STATUS } = observabilityPublic; - it('shows deprecation notice when hasZipUrlMonitors is true', () => { + it('shows deprecation notice when hasIntegrationMonitors is true', () => { jest.spyOn(observabilityPublic, 'useFetcher').mockReturnValue({ status: FETCH_STATUS.SUCCESS, - data: { hasZipUrlMonitors: true }, + data: { hasIntegrationMonitors: true }, refetch: () => null, loading: false, }); - render(); - expect(screen.getByText('Deprecation notice')).toBeInTheDocument(); + render(); + expect(screen.getByText(DEPRECATION_TITLE)).toBeInTheDocument(); }); - it('does not show deprecation notice when hasZipUrlMonitors is false', () => { + it('does not show deprecation notice when hasIntegrationMonitors is false', () => { jest.spyOn(observabilityPublic, 'useFetcher').mockReturnValue({ status: FETCH_STATUS.SUCCESS, - data: { hasZipUrlMonitors: false }, + data: { hasIntegrationMonitors: false }, refetch: () => null, loading: false, }); - render(); - expect(screen.queryByText('Deprecation notice')).not.toBeInTheDocument(); + render(); + expect(screen.queryByText(DEPRECATION_TITLE)).not.toBeInTheDocument(); }); it('dismisses notification', () => { jest.spyOn(observabilityPublic, 'useFetcher').mockReturnValue({ status: FETCH_STATUS.SUCCESS, - data: { hasZipUrlMonitors: true }, + data: { hasIntegrationMonitors: true }, refetch: () => null, loading: false, }); - render(); - expect(screen.getByText('Deprecation notice')).toBeInTheDocument(); + render(); + expect(screen.getByText(DEPRECATION_TITLE)).toBeInTheDocument(); userEvent.click(screen.getByText('Dismiss')); - expect(screen.queryByText('Deprecation notice')).not.toBeInTheDocument(); + expect(screen.queryByText(DEPRECATION_TITLE)).not.toBeInTheDocument(); }); it('does not show notification when session storage key is true', () => { jest.spyOn(observabilityPublic, 'useFetcher').mockReturnValue({ status: FETCH_STATUS.SUCCESS, - data: { hasZipUrlMonitors: true }, + data: { hasIntegrationMonitors: true }, refetch: () => null, loading: false, }); - mockStorage.setItem(ZIP_URL_DEPRECATION_SESSION_STORAGE_KEY, 'true'); + mockStorage.setItem(INTEGRATION_DEPRECATION_SESSION_STORAGE_KEY, 'true'); - render(); - expect(screen.queryByText('Deprecation notice')).not.toBeInTheDocument(); + render(); + expect(screen.queryByText(DEPRECATION_TITLE)).not.toBeInTheDocument(); }); }); diff --git a/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/integration_deprecation/integration_deprecation_callout.tsx b/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/integration_deprecation/integration_deprecation_callout.tsx new file mode 100644 index 0000000000000..3a5e1ad9394f4 --- /dev/null +++ b/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/integration_deprecation/integration_deprecation_callout.tsx @@ -0,0 +1,66 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import React from 'react'; +import { EuiButton, EuiCallOut, EuiFlexGroup, EuiFlexItem, EuiLink } from '@elastic/eui'; +import { FormattedMessage } from '@kbn/i18n-react'; +import { getDocLinks } from '../../../../kibana_services'; + +interface IntegrationDeprecationCalloutProps { + handleDismissDeprecationNotice?: () => void; +} + +export function IntegrationDeprecationCallout({ + handleDismissDeprecationNotice, +}: IntegrationDeprecationCalloutProps) { + return ( + + } + color="warning" + > + + + + + + + ), + }} + /> + + + {handleDismissDeprecationNotice ? ( + + + + + + ) : null} + + + ); +} diff --git a/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/zip_url_deprecation/index.tsx b/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/zip_url_deprecation/index.tsx deleted file mode 100644 index 3d1b3ce0719de..0000000000000 --- a/x-pack/plugins/synthetics/public/legacy_uptime/components/overview/zip_url_deprecation/index.tsx +++ /dev/null @@ -1,92 +0,0 @@ -/* - * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one - * or more contributor license agreements. Licensed under the Elastic License - * 2.0; you may not use this file except in compliance with the Elastic License - * 2.0. - */ - -import React, { useState, useEffect } from 'react'; -import { FormattedMessage } from '@kbn/i18n-react'; -import { EuiCallOut, EuiLink, EuiButton, EuiFlexItem, EuiFlexGroup, EuiSpacer } from '@elastic/eui'; -import { useFetcher } from '@kbn/observability-plugin/public'; -import { useSelector } from 'react-redux'; -import { getHasZipUrlMonitors } from '../../../state/api/has_zip_url_monitors'; -import { getDocLinks } from '../../../../kibana_services'; -import { monitorListSelector } from '../../../state/selectors'; - -export const ZIP_URL_DEPRECATION_SESSION_STORAGE_KEY = - 'SYNTHETICS_ZIP_URL_DEPRECATION_HAS_BEEN_DISMISSED'; - -export const ZipUrlDeprecation = () => { - const monitorList = useSelector(monitorListSelector); - const noticeHasBeenDismissed = - window.sessionStorage.getItem(ZIP_URL_DEPRECATION_SESSION_STORAGE_KEY) === 'true'; - const { data, loading } = useFetcher(() => { - // load it when list is loaded - if (!noticeHasBeenDismissed && monitorList.isLoaded) { - return getHasZipUrlMonitors(); - } - return undefined; - }, [monitorList.isLoaded]); - const hasZipUrlMonitors = !loading && data && data.hasZipUrlMonitors; - const [shouldShowNotice, setShouldShowNotice] = useState( - Boolean(hasZipUrlMonitors && !noticeHasBeenDismissed) - ); - - const handleDismissDeprecationNotice = () => { - window.sessionStorage.setItem(ZIP_URL_DEPRECATION_SESSION_STORAGE_KEY, 'true'); - setShouldShowNotice(false); - }; - - useEffect(() => { - setShouldShowNotice(Boolean(hasZipUrlMonitors && !noticeHasBeenDismissed)); - }, [hasZipUrlMonitors, noticeHasBeenDismissed]); - - return shouldShowNotice ? ( - <> - - } - color="warning" - > - - - - - - - ), - }} - /> - - - - - - - - - - - - ) : null; -}; diff --git a/x-pack/plugins/synthetics/public/legacy_uptime/pages/overview.tsx b/x-pack/plugins/synthetics/public/legacy_uptime/pages/overview.tsx index 60a7ba30b3ec2..88d292a7e06cd 100644 --- a/x-pack/plugins/synthetics/public/legacy_uptime/pages/overview.tsx +++ b/x-pack/plugins/synthetics/public/legacy_uptime/pages/overview.tsx @@ -12,7 +12,7 @@ import styled from 'styled-components'; import { useTrackPageview } from '@kbn/observability-plugin/public'; import { useBreadcrumbs } from '../hooks/use_breadcrumbs'; import { MonitorList } from '../components/overview/monitor_list/monitor_list_container'; -import { ZipUrlDeprecation } from '../components/overview/zip_url_deprecation'; +import { IntegrationDeprecation } from '../components/overview/integration_deprecation'; import { StatusPanel } from '../components/overview/status_panel'; import { QueryBar } from '../components/overview/query_bar/query_bar'; import { MONITORING_OVERVIEW_LABEL } from '../routes'; @@ -40,7 +40,7 @@ export const OverviewPageComponent = () => { <> - + diff --git a/x-pack/plugins/synthetics/public/legacy_uptime/state/api/has_zip_url_monitors.ts b/x-pack/plugins/synthetics/public/legacy_uptime/state/api/has_integration_monitors.ts similarity index 53% rename from x-pack/plugins/synthetics/public/legacy_uptime/state/api/has_zip_url_monitors.ts rename to x-pack/plugins/synthetics/public/legacy_uptime/state/api/has_integration_monitors.ts index 78f45620aad84..a376411adad09 100644 --- a/x-pack/plugins/synthetics/public/legacy_uptime/state/api/has_zip_url_monitors.ts +++ b/x-pack/plugins/synthetics/public/legacy_uptime/state/api/has_integration_monitors.ts @@ -6,9 +6,10 @@ */ import { API_URLS } from '../../../../common/constants'; -import { SyntheticsHasZipUrlMonitorsResponse } from '../../../../common/types/zip_url_deprecation'; +import { SyntheticsHasIntegrationMonitorsResponse } from '../../../../common/types/integration_deprecation'; import { apiService } from './utils'; -export const getHasZipUrlMonitors = async (): Promise => { - return await apiService.get(API_URLS.SYNTHETICS_HAS_ZIP_URL_MONITORS); -}; +export const getHasIntegrationMonitors = + async (): Promise => { + return await apiService.get(API_URLS.SYNTHETICS_HAS_INTEGRATION_MONITORS); + }; diff --git a/x-pack/plugins/synthetics/server/routes/fleet/get_has_integration_monitors.ts b/x-pack/plugins/synthetics/server/routes/fleet/get_has_integration_monitors.ts new file mode 100644 index 0000000000000..966affd83b255 --- /dev/null +++ b/x-pack/plugins/synthetics/server/routes/fleet/get_has_integration_monitors.ts @@ -0,0 +1,24 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ +import { API_URLS } from '../../../common/constants'; +import { SyntheticsRestApiRouteFactory } from '../../legacy_uptime/routes/types'; + +export const getHasIntegrationMonitorsRoute: SyntheticsRestApiRouteFactory = () => ({ + method: 'GET', + path: API_URLS.SYNTHETICS_HAS_INTEGRATION_MONITORS, + validate: {}, + handler: async ({ savedObjectsClient, server }): Promise => { + const monitors = await server.fleet.packagePolicyService.list(savedObjectsClient, { + kuery: + 'ingest-package-policies.package.name:synthetics and not ingest-package-policies.is_managed:true', + perPage: 1, + }); + return { + hasIntegrationMonitors: monitors.total > 0, + }; + }, +}); diff --git a/x-pack/plugins/synthetics/server/routes/fleet/get_has_zip_url_monitors.ts b/x-pack/plugins/synthetics/server/routes/fleet/get_has_zip_url_monitors.ts deleted file mode 100644 index 0527169b80ff4..0000000000000 --- a/x-pack/plugins/synthetics/server/routes/fleet/get_has_zip_url_monitors.ts +++ /dev/null @@ -1,31 +0,0 @@ -/* - * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one - * or more contributor license agreements. Licensed under the Elastic License - * 2.0; you may not use this file except in compliance with the Elastic License - * 2.0. - */ -import { API_URLS } from '../../../common/constants'; -import { ConfigKey } from '../../../common/runtime_types'; -import { SyntheticsRestApiRouteFactory } from '../../legacy_uptime/routes/types'; - -export const getHasZipUrlMonitorRoute: SyntheticsRestApiRouteFactory = () => ({ - method: 'GET', - path: API_URLS.SYNTHETICS_HAS_ZIP_URL_MONITORS, - validate: {}, - handler: async ({ savedObjectsClient, server }): Promise => { - const monitors = await server.fleet.packagePolicyService.list(savedObjectsClient, { - kuery: 'ingest-package-policies.package.name:synthetics', - }); - const hasZipUrlMonitors = monitors.items.some((item) => { - const browserInput = item.inputs.find((input) => input.type === 'synthetics/browser'); - const streams = browserInput?.streams || []; - return streams.find((stream) => stream.data_stream.dataset === 'browser')?.compiled_stream?.[ - ConfigKey.SOURCE_ZIP_URL - ]; - }); - return { - hasZipUrlMonitors, - monitors: [], - }; - }, -}); diff --git a/x-pack/plugins/synthetics/server/routes/index.ts b/x-pack/plugins/synthetics/server/routes/index.ts index 69406cd5ff612..6978a38b2be46 100644 --- a/x-pack/plugins/synthetics/server/routes/index.ts +++ b/x-pack/plugins/synthetics/server/routes/index.ts @@ -40,7 +40,7 @@ import { SyntheticsRestApiRouteFactory, SyntheticsStreamingRouteFactory, } from '../legacy_uptime/routes'; -import { getHasZipUrlMonitorRoute } from './fleet/get_has_zip_url_monitors'; +import { getHasIntegrationMonitorsRoute } from './fleet/get_has_integration_monitors'; import { addSyntheticsParamsRoute } from './settings/add_param'; import { enableDefaultAlertingRoute } from './default_alerts/enable_default_alert'; import { getDefaultAlertingRoute } from './default_alerts/get_default_alert'; @@ -66,7 +66,7 @@ export const syntheticsAppRestApiRoutes: SyntheticsRestApiRouteFactory[] = [ getAPIKeySyntheticsRoute, syntheticsGetPingsRoute, syntheticsGetPingStatusesRoute, - getHasZipUrlMonitorRoute, + getHasIntegrationMonitorsRoute, createGetCurrentStatusRoute, getIndexSizesRoute, getSyntheticsParamsRoute, diff --git a/x-pack/plugins/translations/translations/fr-FR.json b/x-pack/plugins/translations/translations/fr-FR.json index 0e1aabfd937a5..df4eefe6efa18 100644 --- a/x-pack/plugins/translations/translations/fr-FR.json +++ b/x-pack/plugins/translations/translations/fr-FR.json @@ -32743,7 +32743,6 @@ "xpack.synthetics.alerts.tls.validBeforeExpiredString": "valide depuis le {date}, il y a {relativeDate} jours.", "xpack.synthetics.alerts.tls.validBeforeExpiringString": "non valide jusqu'au {date}, dans {relativeDate} jours.", "xpack.synthetics.availabilityLabelText": "{value} %", - "xpack.synthetics.browser.zipUrl.deprecation.content": "L'URL du Zip est déclassée et sera supprimée dans une prochaine version. Utilisez les moniteurs de projet à la place pour créer des moniteurs à partir d'un référentiel distant et pour migrer les moniteurs d'URL de Zip existants. {link}", "xpack.synthetics.certificates.heading": "Certificats TLS ({total})", "xpack.synthetics.certificatesRoute.title": "Certificats | {baseTitle}", "xpack.synthetics.certs.status.ok.label": " {okRelativeDate}", @@ -33028,9 +33027,6 @@ "xpack.synthetics.browser.project.monitorIntegrationSettingsSectionTitle": "Paramètres du moniteur", "xpack.synthetics.browser.project.readOnly.callout.content": "Ce moniteur a été ajouté depuis un projet externe. La configuration est en lecture seule.", "xpack.synthetics.browser.project.readOnly.callout.title": "Lecture seule", - "xpack.synthetics.browser.zipUrl.deprecation.dismiss": "Rejeter", - "xpack.synthetics.browser.zipUrl.deprecation.link": "En savoir plus", - "xpack.synthetics.browser.zipUrl.deprecation.title": "Avis de déclassement", "xpack.synthetics.certificates.loading": "Chargement des certificats...", "xpack.synthetics.certificates.refresh": "Actualiser", "xpack.synthetics.certificatesPage.heading": "Certificats TLS", diff --git a/x-pack/plugins/translations/translations/ja-JP.json b/x-pack/plugins/translations/translations/ja-JP.json index 92cab0ec41d51..7cb33c2275dcc 100644 --- a/x-pack/plugins/translations/translations/ja-JP.json +++ b/x-pack/plugins/translations/translations/ja-JP.json @@ -32714,7 +32714,6 @@ "xpack.synthetics.alerts.tls.validBeforeExpiredString": "{relativeDate}日前、{date}以降有効です。", "xpack.synthetics.alerts.tls.validBeforeExpiringString": "今から{relativeDate}日間、{date}まで無効です。", "xpack.synthetics.availabilityLabelText": "{value} %", - "xpack.synthetics.browser.zipUrl.deprecation.content": "Zip URLは廃止予定であり、将来のバージョンでは削除されます。リモートリポジトリからモニターを作成して、既存のZip URLモニターを移行するのではなく、プロジェクトモニターを使用してください。{link}", "xpack.synthetics.certificates.heading": "TLS証明書（{total}）", "xpack.synthetics.certificatesRoute.title": "証明書 | {baseTitle}", "xpack.synthetics.certs.status.ok.label": " for {okRelativeDate}", @@ -32999,9 +32998,6 @@ "xpack.synthetics.browser.project.monitorIntegrationSettingsSectionTitle": "モニター設定", "xpack.synthetics.browser.project.readOnly.callout.content": "この監視は外部プロジェクトから追加されました。構成は読み取り専用です。", "xpack.synthetics.browser.project.readOnly.callout.title": "読み取り専用", - "xpack.synthetics.browser.zipUrl.deprecation.dismiss": "閉じる", - "xpack.synthetics.browser.zipUrl.deprecation.link": "詳細", - "xpack.synthetics.browser.zipUrl.deprecation.title": "廃止通知", "xpack.synthetics.certificates.loading": "証明書を読み込んでいます...", "xpack.synthetics.certificates.refresh": "更新", "xpack.synthetics.certificatesPage.heading": "TLS証明書", diff --git a/x-pack/plugins/translations/translations/zh-CN.json b/x-pack/plugins/translations/translations/zh-CN.json index 67e7b522e1d1a..dde2c552434b2 100644 --- a/x-pack/plugins/translations/translations/zh-CN.json +++ b/x-pack/plugins/translations/translations/zh-CN.json @@ -32749,7 +32749,6 @@ "xpack.synthetics.alerts.tls.validBeforeExpiredString": "自 {relativeDate} 天前，即 {date}开始生效。", "xpack.synthetics.alerts.tls.validBeforeExpiringString": "从现在到 {date}的 {relativeDate} 天里无效。", "xpack.synthetics.availabilityLabelText": "{value} %", - "xpack.synthetics.browser.zipUrl.deprecation.content": "Zip URL 已弃用，将在未来版本中移除。请改用项目监测以从远程存储库创建监测并迁移现有 Zip URL 监测。{link}", "xpack.synthetics.certificates.heading": "TLS 证书 ({total})", "xpack.synthetics.certificatesRoute.title": "证书 | {baseTitle}", "xpack.synthetics.certs.status.ok.label": " 对于 {okRelativeDate}", @@ -33034,9 +33033,6 @@ "xpack.synthetics.browser.project.monitorIntegrationSettingsSectionTitle": "监测设置", "xpack.synthetics.browser.project.readOnly.callout.content": "已从外部项目添加此监测。配置为只读状态。", "xpack.synthetics.browser.project.readOnly.callout.title": "只读", - "xpack.synthetics.browser.zipUrl.deprecation.dismiss": "关闭", - "xpack.synthetics.browser.zipUrl.deprecation.link": "了解详情", - "xpack.synthetics.browser.zipUrl.deprecation.title": "过时通知", "xpack.synthetics.certificates.loading": "正在加载证书......", "xpack.synthetics.certificates.refresh": "刷新", "xpack.synthetics.certificatesPage.heading": "TLS 证书", From 6a617e4e11b62f4ed87bd38485c4d0b839f66a16 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Yulia=20=C4=8Cech?= <6585477+yuliacech@users.noreply.github.com> Date: Wed, 8 Feb 2023 14:49:30 +0100 Subject: [PATCH 19/60] [Guided onboarding] Header button fix (#150445) ## Summary Fixes https://github.com/elastic/kibana/issues/148912 This PR fixes the header button behaviour when a user clicks a card on the landing page, views the guide in the dropdown checklist panel and then closes the panel without clicking "start" in the 1st step. We should not consider the guide "active" or "in_progress" in that case, because the user probably doesn't expect to see this guide when they click on the header button. They might be looking at several guides without starting any of them. We should not display the last viewed guide in the panel as "active" or "in_progress" but redirect the user back to the landing page where they can click a card and start a guide they want. The fix adds more conditions to how the header button is rendered and it leverages the state and status of `pluginState` and `guideState`. I think these systems need to be refactored in the future so that such situations can be described more cleaner and clearer. ### Checklist - [ ] [Unit or functional tests](https://www.elastic.co/guide/en/kibana/master/development-tests.html) were updated or added to match the most common scenarios --- .../public/components/guide_button.tsx | 15 +++++++++++++-- .../public/components/guide_panel.test.tsx | 10 ++++++++++ 2 files changed, 23 insertions(+), 2 deletions(-) diff --git a/src/plugins/guided_onboarding/public/components/guide_button.tsx b/src/plugins/guided_onboarding/public/components/guide_button.tsx index 3e2df70298c60..89849d22e7652 100644 --- a/src/plugins/guided_onboarding/public/components/guide_button.tsx +++ b/src/plugins/guided_onboarding/public/components/guide_button.tsx @@ -75,12 +75,23 @@ export const GuideButton = ({ ); // if there is no active guide - if (!pluginState || !pluginState.activeGuide || !pluginState.activeGuide.isActive) { + if ( + !pluginState || + !pluginState.activeGuide || + !pluginState.activeGuide.isActive || + // the guide has not started yet when the user just looks at the guide + // see https://github.com/elastic/kibana/issues/148912 for more context + pluginState.activeGuide.status === 'not_started' + ) { // if still active period and the user has not started a guide or skipped the guide, // display the button that redirects to the landing page if ( pluginState?.isActivePeriod && - (pluginState?.status === 'not_started' || pluginState?.status === 'skipped') + (pluginState?.status === 'not_started' || + pluginState?.status === 'skipped' || + // plugin state 'in_progress' without an active guide is when the guide has not started yet + // see https://github.com/elastic/kibana/issues/148912 for context + pluginState.status === 'in_progress') ) { return ( { expect(exists('guideButton')).toBe(false); }); + test('shows redirect button when a guide has been viewed but not started', async () => { + const { exists } = await setupComponentWithPluginStateMock(httpClient, { + status: 'in_progress', + isActivePeriod: true, + activeGuide: { ...testGuideStep1InProgressState, status: 'not_started' }, + }); + expect(exists('guideButtonRedirect')).toBe(true); + expect(exists('guideButton')).toBe(false); + }); + test('shows redirect button when a user skipped on the landing page', async () => { const { exists } = await setupComponentWithPluginStateMock(httpClient, { status: 'skipped', From 9bf320f8f6a4552f96ea470679f3835d16f7e31b Mon Sep 17 00:00:00 2001 From: Jonathan Buttner <56361221+jonathan-buttner@users.noreply.github.com> Date: Wed, 8 Feb 2023 09:02:56 -0500 Subject: [PATCH 20/60] [Cases] Fix flaky delete case test (#150476) This PR adds some `await` to functions that might have been causing flakiness for some of our end to end tests. Fixes: https://github.com/elastic/kibana/issues/145502 Flaky test run: https://buildkite.com/elastic/kibana-flaky-test-suite-runner/builds/1878 --- x-pack/test/functional/services/cases/api.ts | 17 +++++++---------- 1 file changed, 7 insertions(+), 10 deletions(-) diff --git a/x-pack/test/functional/services/cases/api.ts b/x-pack/test/functional/services/cases/api.ts index d2c0fdf9415ba..1b461e60e7e2b 100644 --- a/x-pack/test/functional/services/cases/api.ts +++ b/x-pack/test/functional/services/cases/api.ts @@ -36,8 +36,8 @@ export function CasesAPIServiceProvider({ getService }: FtrProviderContext) { ...generateRandomCaseWithoutConnector(), ...overwrites, } as CasePostRequest; - const res = await createCaseAPI(kbnSupertest, caseData); - return res; + + return createCaseAPI(kbnSupertest, caseData); }, async createNthRandomCases(amount: number = 3) { @@ -45,17 +45,14 @@ export function CasesAPIServiceProvider({ getService }: FtrProviderContext) { { length: amount }, () => generateRandomCaseWithoutConnector() as CasePostRequest ); - await pMap( - cases, - (caseData) => { - return createCaseAPI(kbnSupertest, caseData); - }, - { concurrency: 4 } - ); + + await pMap(cases, async (caseData) => createCaseAPI(kbnSupertest, caseData), { + concurrency: 4, + }); }, async deleteAllCases() { - deleteAllCaseItems(es); + await deleteAllCaseItems(es); }, async createAttachment({ From 987dcbf77bbe67af6525eb7ab69fbb3a73b59200 Mon Sep 17 00:00:00 2001 From: Dominique Clarke Date: Wed, 8 Feb 2023 09:11:47 -0500 Subject: [PATCH 21/60] [Synthetics] project monitors - support custom namespace (#150388) ## Summary Relates to https://github.com/elastic/synthetics/issues/697 Allows custom namespaces for project monitors. Returns an error when the custom namepsace defined is not fleet-compliant. --- .../monitor_types_project.ts | 1 + .../normalizers/browser_monitor.ts | 4 +- .../normalizers/common_fields.ts | 28 ++- .../normalizers/http_monitor.ts | 5 +- .../normalizers/icmp_monitor.ts | 5 +- .../normalizers/tcp_monitor.ts | 5 +- .../apis/synthetics/add_monitor_project.ts | 219 ++++++++++++++++++ 7 files changed, 259 insertions(+), 8 deletions(-) diff --git a/x-pack/plugins/synthetics/common/runtime_types/monitor_management/monitor_types_project.ts b/x-pack/plugins/synthetics/common/runtime_types/monitor_management/monitor_types_project.ts index cdb583cc9f88c..78f14122157f1 100644 --- a/x-pack/plugins/synthetics/common/runtime_types/monitor_management/monitor_types_project.ts +++ b/x-pack/plugins/synthetics/common/runtime_types/monitor_management/monitor_types_project.ts @@ -46,6 +46,7 @@ export const ProjectMonitorCodec = t.intersection([ max_redirects: t.string, wait: t.string, hash: t.string, + namespace: t.string, }), ]); diff --git a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/browser_monitor.ts b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/browser_monitor.ts index aa4a9eba6ff58..b8c6448b9e6e0 100644 --- a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/browser_monitor.ts +++ b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/browser_monitor.ts @@ -29,7 +29,7 @@ export const getNormalizeBrowserFields = ({ }: NormalizedProjectProps): NormalizerResult => { const defaultFields = DEFAULT_FIELDS[DataStream.BROWSER]; - const commonFields = getNormalizeCommonFields({ + const { errors, normalizedFields: commonFields } = getNormalizeCommonFields({ locations, privateLocations, monitor, @@ -86,6 +86,6 @@ export const getNormalizeBrowserFields = ({ ...normalizedFields, }, unsupportedKeys: [], - errors: [], + errors, }; }; diff --git a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/common_fields.ts b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/common_fields.ts index 6ae8027d55107..e84990f5ac43a 100644 --- a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/common_fields.ts +++ b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/common_fields.ts @@ -7,6 +7,7 @@ import { omit } from 'lodash'; import { i18n } from '@kbn/i18n'; +import { isValidNamespace } from '@kbn/fleet-plugin/common'; import { formatLocation } from '../../../../common/utils/location_formatter'; import { formatKibanaNamespace } from '../../../../common/formatters'; import { @@ -50,8 +51,15 @@ export const getNormalizeCommonFields = ({ monitor, projectId, namespace, -}: NormalizedProjectProps): Partial => { +}: NormalizedProjectProps): { errors: Error[]; normalizedFields: Partial } => { const defaultFields = DEFAULT_COMMON_FIELDS; + const errors = []; + if (monitor.namespace) { + const namespaceError = isValidNamespace(monitor.namespace).error; + if (namespaceError) { + errors.push(getInvalidNamespaceError(monitor, namespaceError)); + } + } const normalizedFields = { [ConfigKey.JOURNEY_ID]: monitor.id || defaultFields[ConfigKey.JOURNEY_ID], [ConfigKey.MONITOR_SOURCE_TYPE]: SourceType.PROJECT, @@ -67,7 +75,8 @@ export const getNormalizeCommonFields = ({ publicLocations: locations, }), [ConfigKey.TAGS]: getOptionalListField(monitor.tags) || defaultFields[ConfigKey.TAGS], - [ConfigKey.NAMESPACE]: formatKibanaNamespace(namespace) || defaultFields[ConfigKey.NAMESPACE], + [ConfigKey.NAMESPACE]: + monitor.namespace || formatKibanaNamespace(namespace) || defaultFields[ConfigKey.NAMESPACE], [ConfigKey.ORIGINAL_SPACE]: namespace || defaultFields[ConfigKey.NAMESPACE], [ConfigKey.CUSTOM_HEARTBEAT_ID]: getCustomHeartbeatId(monitor, projectId, namespace), [ConfigKey.ENABLED]: monitor.enabled ?? defaultFields[ConfigKey.ENABLED], @@ -76,7 +85,7 @@ export const getNormalizeCommonFields = ({ : defaultFields[ConfigKey.TIMEOUT], [ConfigKey.CONFIG_HASH]: monitor.hash || defaultFields[ConfigKey.CONFIG_HASH], }; - return normalizedFields; + return { normalizedFields, errors }; }; export const getCustomHeartbeatId = ( @@ -128,6 +137,13 @@ const INVALID_CONFIGURATION_TITLE = i18n.translate( } ); +const INVALID_NAMESPACE_TITLE = i18n.translate( + 'xpack.synthetics.projectMonitorApi.validation.invalidNamespace.title', + { + defaultMessage: 'Invalid namespace', + } +); + export const getUnsupportedKeysError = ( monitor: ProjectMonitor, unsupportedKeys: string[], @@ -163,6 +179,12 @@ export const getInvalidUrlsOrHostsError = ( ), }); +export const getInvalidNamespaceError = (monitor: ProjectMonitor, error: string) => ({ + id: monitor.id, + reason: INVALID_NAMESPACE_TITLE, + details: error, +}); + export const getValueInSeconds = (value: string) => { const keyMap = { h: 60 * 60, diff --git a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/http_monitor.ts b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/http_monitor.ts index 9d8585db686c0..cd7ac7a26f6dd 100644 --- a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/http_monitor.ts +++ b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/http_monitor.ts @@ -37,7 +37,7 @@ export const getNormalizeHTTPFields = ({ const defaultFields = DEFAULT_FIELDS[DataStream.HTTP]; const errors = []; const { yamlConfig, unsupportedKeys } = normalizeYamlConfig(monitor); - const commonFields = getNormalizeCommonFields({ + const { errors: commonErrors, normalizedFields: commonFields } = getNormalizeCommonFields({ locations, privateLocations, monitor, @@ -46,6 +46,9 @@ export const getNormalizeHTTPFields = ({ version, }); + // Add common erros to errors arary + errors.push(...commonErrors); + /* Check if monitor has multiple urls */ const urls = getOptionalListField(monitor.urls); if (urls.length !== 1) { diff --git a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/icmp_monitor.ts b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/icmp_monitor.ts index e997fc3865298..b907c983d534b 100644 --- a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/icmp_monitor.ts +++ b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/icmp_monitor.ts @@ -36,7 +36,7 @@ export const getNormalizeICMPFields = ({ const errors = []; const { yamlConfig, unsupportedKeys } = normalizeYamlConfig(monitor); - const commonFields = getNormalizeCommonFields({ + const { errors: commonErrors, normalizedFields: commonFields } = getNormalizeCommonFields({ locations, privateLocations, monitor, @@ -45,6 +45,9 @@ export const getNormalizeICMPFields = ({ version, }); + // Add common erros to errors arary + errors.push(...commonErrors); + /* Check if monitor has multiple hosts */ const hosts = getOptionalListField(monitor.hosts); if (hosts.length !== 1) { diff --git a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/tcp_monitor.ts b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/tcp_monitor.ts index ecd8825f96f2a..9626937d98a7b 100644 --- a/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/tcp_monitor.ts +++ b/x-pack/plugins/synthetics/server/synthetics_service/project_monitor/normalizers/tcp_monitor.ts @@ -37,7 +37,7 @@ export const getNormalizeTCPFields = ({ const errors = []; const { yamlConfig, unsupportedKeys } = normalizeYamlConfig(monitor); - const commonFields = getNormalizeCommonFields({ + const { errors: commonErrors, normalizedFields: commonFields } = getNormalizeCommonFields({ locations, privateLocations, monitor, @@ -46,6 +46,9 @@ export const getNormalizeTCPFields = ({ version, }); + // Add common erros to errors arary + errors.push(...commonErrors); + /* Check if monitor has multiple hosts */ const hosts = getOptionalListField(monitor.hosts); if (hosts.length !== 1) { diff --git a/x-pack/test/api_integration/apis/synthetics/add_monitor_project.ts b/x-pack/test/api_integration/apis/synthetics/add_monitor_project.ts index 0ac7d13808a2a..ba98b589f83b1 100644 --- a/x-pack/test/api_integration/apis/synthetics/add_monitor_project.ts +++ b/x-pack/test/api_integration/apis/synthetics/add_monitor_project.ts @@ -763,6 +763,225 @@ export default function ({ getService }: FtrProviderContext) { } }); + it('project monitors - browser - handles custom namespace', async () => { + const project = `test-project-${uuidv4()}`; + const username = 'admin'; + const roleName = `synthetics_admin`; + const password = `${username}-password`; + const SPACE_ID = `test-space-${uuidv4()}`; + const SPACE_NAME = `test-space-name ${uuidv4()}`; + const customNamespace = 'custom.namespace'; + await kibanaServer.spaces.create({ id: SPACE_ID, name: SPACE_NAME }); + try { + await security.role.create(roleName, { + kibana: [ + { + feature: { + uptime: ['all'], + }, + spaces: ['*'], + }, + ], + }); + await security.user.create(username, { + password, + roles: [roleName], + full_name: 'a kibana user', + }); + await supertestWithoutAuth + .put( + `/s/${SPACE_ID}${API_URLS.SYNTHETICS_MONITORS_PROJECT_UPDATE.replace( + '{projectName}', + project + )}` + ) + .auth(username, password) + .set('kbn-xsrf', 'true') + .send({ monitors: [{ ...projectMonitors.monitors[0], namespace: customNamespace }] }) + .expect(200); + // expect monitor not to have been deleted + const getResponse = await supertestWithoutAuth + .get(`/s/${SPACE_ID}${API_URLS.SYNTHETICS_MONITORS}`) + .auth(username, password) + .query({ + filter: `${syntheticsMonitorType}.attributes.journey_id: ${projectMonitors.monitors[0].id}`, + }) + .set('kbn-xsrf', 'true') + .expect(200); + const { monitors } = getResponse.body; + expect(monitors.length).eql(1); + expect(monitors[0].attributes[ConfigKey.NAMESPACE]).eql(customNamespace); + } finally { + await deleteMonitor(projectMonitors.monitors[0].id, project, SPACE_ID); + await security.user.delete(username); + await security.role.delete(roleName); + } + }); + + it('project monitors - lightweight - handles custom namespace', async () => { + const project = `test-project-${uuidv4()}`; + const username = 'admin'; + const roleName = `synthetics_admin`; + const password = `${username}-password`; + const SPACE_ID = `test-space-${uuidv4()}`; + const SPACE_NAME = `test-space-name ${uuidv4()}`; + const customNamespace = 'custom.namespace'; + await kibanaServer.spaces.create({ id: SPACE_ID, name: SPACE_NAME }); + try { + await security.role.create(roleName, { + kibana: [ + { + feature: { + uptime: ['all'], + }, + spaces: ['*'], + }, + ], + }); + await security.user.create(username, { + password, + roles: [roleName], + full_name: 'a kibana user', + }); + await supertestWithoutAuth + .put( + `/s/${SPACE_ID}${API_URLS.SYNTHETICS_MONITORS_PROJECT_UPDATE.replace( + '{projectName}', + project + )}` + ) + .auth(username, password) + .set('kbn-xsrf', 'true') + .send({ monitors: [{ ...httpProjectMonitors.monitors[1], namespace: customNamespace }] }) + .expect(200); + + // expect monitor not to have been deleted + const getResponse = await supertestWithoutAuth + .get(`/s/${SPACE_ID}${API_URLS.SYNTHETICS_MONITORS}`) + .auth(username, password) + .query({ + filter: `${syntheticsMonitorType}.attributes.journey_id: ${httpProjectMonitors.monitors[1].id}`, + }) + .set('kbn-xsrf', 'true') + .expect(200); + const { monitors } = getResponse.body; + expect(monitors.length).eql(1); + expect(monitors[0].attributes[ConfigKey.NAMESPACE]).eql(customNamespace); + } finally { + await deleteMonitor(httpProjectMonitors.monitors[1].id, project, SPACE_ID); + await security.user.delete(username); + await security.role.delete(roleName); + } + }); + + it('project monitors - browser - handles custom namespace errors', async () => { + const project = `test-project-${uuidv4()}`; + const username = 'admin'; + const roleName = `synthetics_admin`; + const password = `${username}-password`; + const SPACE_ID = `test-space-${uuidv4()}`; + const SPACE_NAME = `test-space-name ${uuidv4()}`; + const customNamespace = 'custom-namespace'; + await kibanaServer.spaces.create({ id: SPACE_ID, name: SPACE_NAME }); + try { + await security.role.create(roleName, { + kibana: [ + { + feature: { + uptime: ['all'], + }, + spaces: ['*'], + }, + ], + }); + await security.user.create(username, { + password, + roles: [roleName], + full_name: 'a kibana user', + }); + const { body } = await supertestWithoutAuth + .put( + `/s/${SPACE_ID}${API_URLS.SYNTHETICS_MONITORS_PROJECT_UPDATE.replace( + '{projectName}', + project + )}` + ) + .auth(username, password) + .set('kbn-xsrf', 'true') + .send({ monitors: [{ ...projectMonitors.monitors[0], namespace: customNamespace }] }) + .expect(200); + // expect monitor not to have been deleted + expect(body).to.eql({ + createdMonitors: [], + failedMonitors: [ + { + details: 'Namespace contains invalid characters', + id: projectMonitors.monitors[0].id, + reason: 'Invalid namespace', + }, + ], + updatedMonitors: [], + }); + } finally { + await security.user.delete(username); + await security.role.delete(roleName); + } + }); + + it('project monitors - lightweight - handles custom namespace errors', async () => { + const project = `test-project-${uuidv4()}`; + const username = 'admin'; + const roleName = `synthetics_admin`; + const password = `${username}-password`; + const SPACE_ID = `test-space-${uuidv4()}`; + const SPACE_NAME = `test-space-name ${uuidv4()}`; + const customNamespace = 'custom-namespace'; + await kibanaServer.spaces.create({ id: SPACE_ID, name: SPACE_NAME }); + try { + await security.role.create(roleName, { + kibana: [ + { + feature: { + uptime: ['all'], + }, + spaces: ['*'], + }, + ], + }); + await security.user.create(username, { + password, + roles: [roleName], + full_name: 'a kibana user', + }); + const { body } = await supertestWithoutAuth + .put( + `/s/${SPACE_ID}${API_URLS.SYNTHETICS_MONITORS_PROJECT_UPDATE.replace( + '{projectName}', + project + )}` + ) + .auth(username, password) + .set('kbn-xsrf', 'true') + .send({ monitors: [{ ...httpProjectMonitors.monitors[1], namespace: customNamespace }] }) + .expect(200); + // expect monitor not to have been deleted + expect(body).to.eql({ + createdMonitors: [], + failedMonitors: [ + { + details: 'Namespace contains invalid characters', + id: httpProjectMonitors.monitors[1].id, + reason: 'Invalid namespace', + }, + ], + updatedMonitors: [], + }); + } finally { + await security.user.delete(username); + await security.role.delete(roleName); + } + }); + it('project monitors - handles editing with spaces', async () => { const project = `test-project-${uuidv4()}`; const username = 'admin'; From 1bd6b370ab97ba08b8a52b02731a8f29199c81a1 Mon Sep 17 00:00:00 2001 From: Rodney Norris Date: Wed, 8 Feb 2023 08:15:50 -0600 Subject: [PATCH 22/60] [Enterprise Search] remove link to engine schema page (#150498) ## Summary Removing the link from the overview page fields stat to the schema page since the schema page has not been added yet. --- .../components/engine/engine_overview.tsx | 34 +++++++------------ 1 file changed, 13 insertions(+), 21 deletions(-) diff --git a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_overview.tsx b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_overview.tsx index 83312c8290e21..20e60db46db80 100644 --- a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_overview.tsx +++ b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_overview.tsx @@ -79,27 +79,19 @@ export const EngineOverview: React.FC = () => { - - - - - - + + + + From 91ff71005081f34ebcf7eeadbec2f0ea4405dcab Mon Sep 17 00:00:00 2001 From: Pierre Gayvallet Date: Wed, 8 Feb 2023 15:17:39 +0100 Subject: [PATCH 23/60] Preliminary DocumentMigrator cleanup (#150529) Related to https://github.com/elastic/kibana/issues/150301 This PR tend to do some preliminary cleanup before diving into the actual implementation. I'm mostly extracting things from the (way too big and hard to read) document migrator, to increase readability, maintainability and testability (note: I did not add additional unit test for the extracted files, as I did not change the impl and as we'll be rewriting them all soon enough - it would just have been a loss of time) - Move the document migrator from `packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core` to it's dedicated folder `document_migrator` folder - Extract all the bits not directly performing the document transformation (e.g building the migration map, validation, utils) to their dedicated files - Only moving things around. No concrete code (apart from types) was modified, to ease managing conflicts with https://github.com/elastic/kibana/pull/150443 --- .../index.ts | 2 +- .../src/core/index.ts | 2 +- .../src/core/migrate_raw_docs.ts | 2 +- .../src/core/regenerate_object_id.ts | 21 + .../build_active_migrations.ts | 72 ++++ .../document_migrator.test.mock.ts | 0 .../document_migrator.test.ts | 2 +- .../document_migrator.ts | 393 +----------------- .../src/document_migrator/index.ts | 9 + .../document_migrator/internal_transforms.ts | 115 +++++ .../src/document_migrator/types.ts | 73 ++++ .../src/document_migrator/utils.ts | 78 ++++ .../document_migrator/validate_migrations.ts | 121 ++++++ .../src/index.ts | 2 +- .../src/kibana_migrator.test.ts | 6 +- .../src/kibana_migrator.ts | 2 +- 16 files changed, 502 insertions(+), 398 deletions(-) create mode 100644 packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/regenerate_object_id.ts create mode 100644 packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/build_active_migrations.ts rename packages/core/saved-objects/core-saved-objects-migration-server-internal/src/{core => document_migrator}/document_migrator.test.mock.ts (100%) rename packages/core/saved-objects/core-saved-objects-migration-server-internal/src/{core => document_migrator}/document_migrator.test.ts (99%) rename packages/core/saved-objects/core-saved-objects-migration-server-internal/src/{core => document_migrator}/document_migrator.ts (53%) create mode 100644 packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/index.ts create mode 100644 packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/internal_transforms.ts create mode 100644 packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/types.ts create mode 100644 packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/utils.ts create mode 100644 packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/validate_migrations.ts diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/index.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/index.ts index 1913a1c3de05e..21fbd6f8b5329 100644 --- a/packages/core/saved-objects/core-saved-objects-migration-server-internal/index.ts +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/index.ts @@ -52,9 +52,9 @@ export { isWriteBlockException, isIndexNotFoundException, } from './src/actions/es_errors'; -export { deterministicallyRegenerateObjectId } from './src/core/document_migrator'; export { REMOVED_TYPES, + deterministicallyRegenerateObjectId, type DocumentsTransformFailed, type DocumentsTransformSuccess, } from './src/core'; diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/index.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/index.ts index 2b1cd0e955b43..81bacea4a0cbd 100644 --- a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/index.ts +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/index.ts @@ -6,11 +6,11 @@ * Side Public License, v 1. */ -export { DocumentMigrator } from './document_migrator'; export { buildActiveMappings } from './build_active_mappings'; export type { LogFn } from './migration_logger'; export { excludeUnusedTypesQuery, REMOVED_TYPES } from './unused_types'; export { TransformSavedObjectDocumentError } from './transform_saved_object_document_error'; +export { deterministicallyRegenerateObjectId } from './regenerate_object_id'; export type { DocumentsTransformFailed, DocumentsTransformSuccess, diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/migrate_raw_docs.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/migrate_raw_docs.ts index d1ca65f1dd103..5c8ca0132ebf8 100644 --- a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/migrate_raw_docs.ts +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/migrate_raw_docs.ts @@ -17,7 +17,7 @@ import type { SavedObjectUnsanitizedDoc, } from '@kbn/core-saved-objects-server'; import { SavedObjectsSerializer } from '@kbn/core-saved-objects-base-server-internal'; -import { MigrateAndConvertFn } from './document_migrator'; +import type { MigrateAndConvertFn } from '../document_migrator/document_migrator'; import { TransformSavedObjectDocumentError } from '.'; export interface DocumentsTransformFailed { diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/regenerate_object_id.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/regenerate_object_id.ts new file mode 100644 index 0000000000000..eb6eec2dbb1c8 --- /dev/null +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/regenerate_object_id.ts @@ -0,0 +1,21 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +import { v5 as uuidv5 } from 'uuid'; + +/** + * Deterministically regenerates a saved object's ID based upon it's current namespace, type, and ID. This ensures that we can regenerate + * any existing object IDs without worrying about collisions if two objects that exist in different namespaces share an ID. It also ensures + * that we can later regenerate any inbound object references to match. + * + * @note This is only intended to be used when single-namespace object types are converted into multi-namespace object types. + * @internal + */ +export function deterministicallyRegenerateObjectId(namespace: string, type: string, id: string) { + return uuidv5(`${namespace}:${type}:${id}`, uuidv5.DNS); // the uuidv5 namespace constant (uuidv5.DNS) is arbitrary +} diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/build_active_migrations.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/build_active_migrations.ts new file mode 100644 index 0000000000000..e46dbac99ef01 --- /dev/null +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/build_active_migrations.ts @@ -0,0 +1,72 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +import _ from 'lodash'; +import type { Logger } from '@kbn/logging'; +import type { ISavedObjectTypeRegistry } from '@kbn/core-saved-objects-server'; +import type { Transform, ActiveMigrations } from './types'; +import { getReferenceTransforms, getConversionTransforms } from './internal_transforms'; +import { validateMigrationsMapObject } from './validate_migrations'; +import { transformComparator, wrapWithTry } from './utils'; + +/** + * Converts migrations from a format that is convenient for callers to a format that + * is convenient for our internal usage: + * From: { type: { version: fn } } + * To: { type: { latestMigrationVersion?: string; latestCoreMigrationVersion?: string; transforms: [{ version: string, transform: fn }] } } + */ +export function buildActiveMigrations( + typeRegistry: ISavedObjectTypeRegistry, + kibanaVersion: string, + log: Logger +): ActiveMigrations { + const referenceTransforms = getReferenceTransforms(typeRegistry); + + return typeRegistry.getAllTypes().reduce((migrations, type) => { + const migrationsMap = + typeof type.migrations === 'function' ? type.migrations() : type.migrations; + validateMigrationsMapObject(type.name, kibanaVersion, migrationsMap); + + const migrationTransforms = Object.entries(migrationsMap ?? {}).map( + ([version, transform]) => ({ + version, + transform: wrapWithTry(version, type, transform, log), + transformType: 'migrate', + }) + ); + const conversionTransforms = getConversionTransforms(type); + const transforms = [ + ...referenceTransforms, + ...conversionTransforms, + ...migrationTransforms, + ].sort(transformComparator); + + if (!transforms.length) { + return migrations; + } + + const migrationVersionTransforms: Transform[] = []; + const coreMigrationVersionTransforms: Transform[] = []; + transforms.forEach((x) => { + if (x.transformType === 'migrate' || x.transformType === 'convert') { + migrationVersionTransforms.push(x); + } else { + coreMigrationVersionTransforms.push(x); + } + }); + + return { + ...migrations, + [type.name]: { + latestMigrationVersion: _.last(migrationVersionTransforms)?.version, + latestCoreMigrationVersion: _.last(coreMigrationVersionTransforms)?.version, + transforms, + }, + }; + }, {} as ActiveMigrations); +} diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/document_migrator.test.mock.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/document_migrator.test.mock.ts similarity index 100% rename from packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/document_migrator.test.mock.ts rename to packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/document_migrator.test.mock.ts diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/document_migrator.test.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/document_migrator.test.ts similarity index 99% rename from packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/document_migrator.test.ts rename to packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/document_migrator.test.ts index dd64014f815bd..46ca8286d44a5 100644 --- a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/document_migrator.test.ts +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/document_migrator.test.ts @@ -15,7 +15,7 @@ import { LEGACY_URL_ALIAS_TYPE, } from '@kbn/core-saved-objects-base-server-internal'; import { DocumentMigrator } from './document_migrator'; -import { TransformSavedObjectDocumentError } from './transform_saved_object_document_error'; +import { TransformSavedObjectDocumentError } from '../core/transform_saved_object_document_error'; import { loggingSystemMock } from '@kbn/core-logging-server-mocks'; const mockLoggerFactory = loggingSystemMock.create(); diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/document_migrator.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/document_migrator.ts similarity index 53% rename from packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/document_migrator.ts rename to packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/document_migrator.ts index ae50d7fac643a..c9c84cba261c1 100644 --- a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/core/document_migrator.ts +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/document_migrator.ts @@ -42,45 +42,22 @@ */ import Boom from '@hapi/boom'; -import { v5 as uuidv5 } from 'uuid'; import { set } from '@kbn/safer-lodash-set'; import _ from 'lodash'; import Semver from 'semver'; import type { Logger } from '@kbn/logging'; -import type { - SavedObjectsMigrationVersion, - SavedObjectsNamespaceType, -} from '@kbn/core-saved-objects-common'; +import type { SavedObjectsMigrationVersion } from '@kbn/core-saved-objects-common'; import type { SavedObjectUnsanitizedDoc, - SavedObjectsType, ISavedObjectTypeRegistry, - SavedObjectMigrationFn, - SavedObjectMigrationMap, } from '@kbn/core-saved-objects-server'; -import { DEFAULT_NAMESPACE_STRING, SavedObjectsUtils } from '@kbn/core-saved-objects-utils-server'; -import { - type LegacyUrlAlias, - LEGACY_URL_ALIAS_TYPE, -} from '@kbn/core-saved-objects-base-server-internal'; -import { MigrationLogger } from './migration_logger'; -import { TransformSavedObjectDocumentError } from '.'; +import type { ActiveMigrations, TransformResult } from './types'; +import { buildActiveMigrations } from './build_active_migrations'; +import { validateMigrationDefinition } from './validate_migrations'; export type MigrateFn = (doc: SavedObjectUnsanitizedDoc) => SavedObjectUnsanitizedDoc; export type MigrateAndConvertFn = (doc: SavedObjectUnsanitizedDoc) => SavedObjectUnsanitizedDoc[]; -interface TransformResult { - /** - * This is the original document that has been transformed. - */ - transformedDoc: SavedObjectUnsanitizedDoc; - /** - * These are any new document(s) that have been created during the transformation process; these are not transformed, but they are marked - * as up-to-date. Only conversion transforms generate additional documents. - */ - additionalDocs: SavedObjectUnsanitizedDoc[]; -} - type ApplyTransformsFn = ( doc: SavedObjectUnsanitizedDoc, options?: TransformOptions @@ -97,35 +74,6 @@ interface DocumentMigratorOptions { log: Logger; } -interface ActiveMigrations { - [type: string]: { - /** Derived from `migrate` transforms and `convert` transforms */ - latestMigrationVersion?: string; - /** Derived from `reference` transforms */ - latestCoreMigrationVersion?: string; - transforms: Transform[]; - }; -} - -interface Transform { - version: string; - transform: (doc: SavedObjectUnsanitizedDoc) => TransformResult; - /** - * There are two "migrationVersion" transform types: - * * `migrate` - These transforms are defined and added by consumers using the type registry; each is applied to a single object type - * based on an object's `migrationVersion[type]` field. These are applied during index migrations and document migrations. - * * `convert` - These transforms are defined by core and added by consumers using the type registry; each is applied to a single object - * type based on an object's `migrationVersion[type]` field. These are applied during index migrations, NOT document migrations. - * - * There is one "coreMigrationVersion" transform type: - * * `reference` - These transforms are defined by core and added by consumers using the type registry; they are applied to all object - * types based on their `coreMigrationVersion` field. These are applied during index migrations, NOT document migrations. - * - * If any additional transform types are added, the functions below should be updated to account for them. - */ - transformType: 'migrate' | 'convert' | 'reference'; -} - /** * Manages migration of individual documents. */ @@ -156,7 +104,6 @@ export class DocumentMigrator implements VersionedTransformer { */ constructor({ typeRegistry, kibanaVersion, convertVersion, log }: DocumentMigratorOptions) { validateMigrationDefinition(typeRegistry, kibanaVersion, convertVersion); - this.documentMigratorOptions = { typeRegistry, kibanaVersion, log }; } @@ -241,170 +188,6 @@ export class DocumentMigrator implements VersionedTransformer { }; } -function validateMigrationsMapObject( - name: string, - kibanaVersion: string, - migrationsMap?: SavedObjectMigrationMap -) { - function assertObject(obj: any, prefix: string) { - if (!obj || typeof obj !== 'object') { - throw new Error(`${prefix} Got ${obj}.`); - } - } - - function assertValidSemver(version: string, type: string) { - if (!Semver.valid(version)) { - throw new Error( - `Invalid migration for type ${type}. Expected all properties to be semvers, but got ${version}.` - ); - } - if (Semver.gt(version, kibanaVersion)) { - throw new Error( - `Invalid migration for type ${type}. Property '${version}' cannot be greater than the current Kibana version '${kibanaVersion}'.` - ); - } - } - - function assertValidTransform(fn: any, version: string, type: string) { - if (typeof fn !== 'function') { - throw new Error(`Invalid migration ${type}.${version}: expected a function, but got ${fn}.`); - } - } - - if (migrationsMap) { - assertObject( - migrationsMap, - `Migrations map for type ${name} should be an object like { '2.0.0': (doc) => doc }.` - ); - - Object.entries(migrationsMap).forEach(([version, fn]) => { - assertValidSemver(version, name); - assertValidTransform(fn, version, name); - }); - } -} - -/** - * Basic validation that the migration definition matches our expectations. We can't - * rely on TypeScript here, as the caller may be JavaScript / ClojureScript / any compile-to-js - * language. So, this is just to provide a little developer-friendly error messaging. Joi was - * giving weird errors, so we're just doing manual validation. - */ -function validateMigrationDefinition( - registry: ISavedObjectTypeRegistry, - kibanaVersion: string, - convertVersion?: string -) { - function assertObjectOrFunction(entity: any, prefix: string) { - if (!entity || (typeof entity !== 'function' && typeof entity !== 'object')) { - throw new Error(`${prefix} Got! ${typeof entity}, ${JSON.stringify(entity)}.`); - } - } - - function assertValidConvertToMultiNamespaceType( - namespaceType: SavedObjectsNamespaceType, - convertToMultiNamespaceTypeVersion: string, - type: string - ) { - if (namespaceType !== 'multiple' && namespaceType !== 'multiple-isolated') { - throw new Error( - `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Expected namespaceType to be 'multiple' or 'multiple-isolated', but got '${namespaceType}'.` - ); - } else if (!Semver.valid(convertToMultiNamespaceTypeVersion)) { - throw new Error( - `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Expected value to be a semver, but got '${convertToMultiNamespaceTypeVersion}'.` - ); - } else if (convertVersion && Semver.neq(convertToMultiNamespaceTypeVersion, convertVersion)) { - throw new Error( - `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Value '${convertToMultiNamespaceTypeVersion}' cannot be any other than '${convertVersion}'.` - ); - } else if (Semver.gt(convertToMultiNamespaceTypeVersion, kibanaVersion)) { - throw new Error( - `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Value '${convertToMultiNamespaceTypeVersion}' cannot be greater than the current Kibana version '${kibanaVersion}'.` - ); - } else if (Semver.patch(convertToMultiNamespaceTypeVersion)) { - throw new Error( - `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Value '${convertToMultiNamespaceTypeVersion}' cannot be used on a patch version (must be like 'x.y.0').` - ); - } - } - - registry.getAllTypes().forEach((type) => { - const { name, migrations, convertToMultiNamespaceTypeVersion, namespaceType } = type; - if (migrations) { - assertObjectOrFunction( - type.migrations, - `Migration for type ${name} should be an object or a function returning an object like { '2.0.0': (doc) => doc }.` - ); - } - if (convertToMultiNamespaceTypeVersion) { - // CHECKPOINT 1 - assertValidConvertToMultiNamespaceType( - namespaceType, - convertToMultiNamespaceTypeVersion, - name - ); - } - }); -} - -/** - * Converts migrations from a format that is convenient for callers to a format that - * is convenient for our internal usage: - * From: { type: { version: fn } } - * To: { type: { latestMigrationVersion?: string; latestCoreMigrationVersion?: string; transforms: [{ version: string, transform: fn }] } } - */ -function buildActiveMigrations( - typeRegistry: ISavedObjectTypeRegistry, - kibanaVersion: string, - log: Logger -): ActiveMigrations { - const referenceTransforms = getReferenceTransforms(typeRegistry); - - return typeRegistry.getAllTypes().reduce((migrations, type) => { - const migrationsMap = - typeof type.migrations === 'function' ? type.migrations() : type.migrations; - validateMigrationsMapObject(type.name, kibanaVersion, migrationsMap); - - const migrationTransforms = Object.entries(migrationsMap ?? {}).map( - ([version, transform]) => ({ - version, - transform: wrapWithTry(version, type, transform, log), - transformType: 'migrate', - }) - ); - const conversionTransforms = getConversionTransforms(type); - const transforms = [ - ...referenceTransforms, - ...conversionTransforms, - ...migrationTransforms, - ].sort(transformComparator); - - if (!transforms.length) { - return migrations; - } - - const migrationVersionTransforms: Transform[] = []; - const coreMigrationVersionTransforms: Transform[] = []; - transforms.forEach((x) => { - if (x.transformType === 'migrate' || x.transformType === 'convert') { - migrationVersionTransforms.push(x); - } else { - coreMigrationVersionTransforms.push(x); - } - }); - - return { - ...migrations, - [type.name]: { - latestMigrationVersion: _.last(migrationVersionTransforms)?.version, - latestCoreMigrationVersion: _.last(coreMigrationVersionTransforms)?.version, - transforms, - }, - }; - }, {} as ActiveMigrations); -} - /** * Creates a function which migrates and validates any document that is passed to it. */ @@ -528,162 +311,6 @@ function markAsUpToDate( }; } -/** - * Converts a single-namespace object to a multi-namespace object. This primarily entails removing the `namespace` field and adding the - * `namespaces` field. - * - * If the object does not exist in the default namespace (undefined), its ID is also regenerated, and an "originId" is added to preserve - * legacy import/copy behavior. - */ -function convertNamespaceType(doc: SavedObjectUnsanitizedDoc) { - const { namespace, ...otherAttrs } = doc; - const additionalDocs: SavedObjectUnsanitizedDoc[] = []; - - // If this object exists in the default namespace, return it with the appropriate `namespaces` field without changing its ID. - if (namespace === undefined) { - return { - transformedDoc: { ...otherAttrs, namespaces: [DEFAULT_NAMESPACE_STRING] }, - additionalDocs, - }; - } - - const { id: originId, type } = otherAttrs; - const id = SavedObjectsUtils.getConvertedObjectId(namespace, type, originId!); - const legacyUrlAlias: SavedObjectUnsanitizedDoc = { - id: `${namespace}:${type}:${originId}`, - type: LEGACY_URL_ALIAS_TYPE, - attributes: { - // NOTE TO MAINTAINERS: If a saved object migration is added in `src/core/server/saved_objects/object_types/registration.ts`, these - // values must be updated accordingly. That's because a user can upgrade Kibana from 7.17 to 8.x, and any defined migrations will not - // be applied to aliases that are created during the conversion process. - sourceId: originId, - targetNamespace: namespace, - targetType: type, - targetId: id, - purpose: 'savedObjectConversion', - }, - }; - additionalDocs.push(legacyUrlAlias); - return { - transformedDoc: { ...otherAttrs, id, originId, namespaces: [namespace] }, - additionalDocs, - }; -} - -/** - * Returns all applicable conversion transforms for a given object type. - */ -function getConversionTransforms(type: SavedObjectsType): Transform[] { - const { convertToMultiNamespaceTypeVersion } = type; - if (!convertToMultiNamespaceTypeVersion) { - return []; - } - return [ - { - version: convertToMultiNamespaceTypeVersion, - transform: convertNamespaceType, - transformType: 'convert', - }, - ]; -} - -/** - * Returns all applicable reference transforms for all object types. - */ -function getReferenceTransforms(typeRegistry: ISavedObjectTypeRegistry): Transform[] { - const transformMap = typeRegistry - .getAllTypes() - .filter((type) => type.convertToMultiNamespaceTypeVersion) - .reduce((acc, { convertToMultiNamespaceTypeVersion: version, name }) => { - const types = acc.get(version!) ?? new Set(); - return acc.set(version!, types.add(name)); - }, new Map>()); - - return Array.from(transformMap, ([version, types]) => ({ - version, - transform: (doc) => { - const { namespace, references } = doc; - if (namespace && references?.length) { - return { - transformedDoc: { - ...doc, - references: references.map(({ type, id, ...attrs }) => ({ - ...attrs, - type, - id: types.has(type) - ? SavedObjectsUtils.getConvertedObjectId(namespace, type, id) - : id, - })), - }, - additionalDocs: [], - }; - } - return { transformedDoc: doc, additionalDocs: [] }; - }, - transformType: 'reference', - })); -} - -/** - * Transforms are sorted in ascending order by version. One version may contain multiple transforms; 'reference' transforms always run - * first, 'convert' transforms always run second, and 'migrate' transforms always run last. This is because: - * 1. 'convert' transforms get rid of the `namespace` field, which must be present for 'reference' transforms to function correctly. - * 2. 'migrate' transforms are defined by the consumer, and may change the object type or migrationVersion which resets the migration loop - * and could cause any remaining transforms for this version to be skipped. - */ -function transformComparator(a: Transform, b: Transform) { - const semver = Semver.compare(a.version, b.version); - if (semver !== 0) { - return semver; - } else if (a.transformType !== b.transformType) { - if (a.transformType === 'migrate') { - return 1; - } else if (b.transformType === 'migrate') { - return -1; - } else if (a.transformType === 'convert') { - return 1; - } else if (b.transformType === 'convert') { - return -1; - } - } - return 0; -} - -/** - * If a specific transform function fails, this tacks on a bit of information - * about the document and transform that caused the failure. - */ -function wrapWithTry( - version: string, - type: SavedObjectsType, - migrationFn: SavedObjectMigrationFn, - log: Logger -) { - const context = Object.freeze({ - log: new MigrationLogger(log), - migrationVersion: version, - convertToMultiNamespaceTypeVersion: type.convertToMultiNamespaceTypeVersion, - isSingleNamespaceType: type.namespaceType === 'single', - }); - - return function tryTransformDoc(doc: SavedObjectUnsanitizedDoc) { - try { - const result = migrationFn(doc, context); - - // A basic check to help migration authors detect basic errors - // (e.g. forgetting to return the transformed doc) - if (!result || !result.type) { - throw new Error(`Invalid saved object returned from migration ${type.name}:${version}.`); - } - - return { transformedDoc: result, additionalDocs: [] }; - } catch (error) { - log.error(error); - throw new TransformSavedObjectDocumentError(error, version); - } - }; -} - /** * Determines whether or not a document has any pending transforms that should be applied based on its coreMigrationVersion field. * Currently, only reference transforms qualify. @@ -834,15 +461,3 @@ function assertNoDowngrades( ); } } - -/** - * Deterministically regenerates a saved object's ID based upon it's current namespace, type, and ID. This ensures that we can regenerate - * any existing object IDs without worrying about collisions if two objects that exist in different namespaces share an ID. It also ensures - * that we can later regenerate any inbound object references to match. - * - * @note This is only intended to be used when single-namespace object types are converted into multi-namespace object types. - * @internal - */ -export function deterministicallyRegenerateObjectId(namespace: string, type: string, id: string) { - return uuidv5(`${namespace}:${type}:${id}`, uuidv5.DNS); // the uuidv5 namespace constant (uuidv5.DNS) is arbitrary -} diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/index.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/index.ts new file mode 100644 index 0000000000000..f34053388d764 --- /dev/null +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/index.ts @@ -0,0 +1,9 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +export { DocumentMigrator, type VersionedTransformer } from './document_migrator'; diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/internal_transforms.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/internal_transforms.ts new file mode 100644 index 0000000000000..d94865f23677b --- /dev/null +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/internal_transforms.ts @@ -0,0 +1,115 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +import { + ISavedObjectTypeRegistry, + SavedObjectsType, + SavedObjectUnsanitizedDoc, +} from '@kbn/core-saved-objects-server'; +import { DEFAULT_NAMESPACE_STRING, SavedObjectsUtils } from '@kbn/core-saved-objects-utils-server'; +import { + LEGACY_URL_ALIAS_TYPE, + LegacyUrlAlias, +} from '@kbn/core-saved-objects-base-server-internal'; +import type { Transform } from './types'; + +/** + * Returns all applicable conversion transforms for a given object type. + */ +export function getConversionTransforms(type: SavedObjectsType): Transform[] { + const { convertToMultiNamespaceTypeVersion } = type; + if (!convertToMultiNamespaceTypeVersion) { + return []; + } + return [ + { + version: convertToMultiNamespaceTypeVersion, + transform: convertNamespaceType, + transformType: 'convert', + }, + ]; +} + +/** + * Returns all applicable reference transforms for all object types. + */ +export function getReferenceTransforms(typeRegistry: ISavedObjectTypeRegistry): Transform[] { + const transformMap = typeRegistry + .getAllTypes() + .filter((type) => type.convertToMultiNamespaceTypeVersion) + .reduce((acc, { convertToMultiNamespaceTypeVersion: version, name }) => { + const types = acc.get(version!) ?? new Set(); + return acc.set(version!, types.add(name)); + }, new Map>()); + + return Array.from(transformMap, ([version, types]) => ({ + version, + transform: (doc) => { + const { namespace, references } = doc; + if (namespace && references?.length) { + return { + transformedDoc: { + ...doc, + references: references.map(({ type, id, ...attrs }) => ({ + ...attrs, + type, + id: types.has(type) + ? SavedObjectsUtils.getConvertedObjectId(namespace, type, id) + : id, + })), + }, + additionalDocs: [], + }; + } + return { transformedDoc: doc, additionalDocs: [] }; + }, + transformType: 'reference', + })); +} + +/** + * Converts a single-namespace object to a multi-namespace object. This primarily entails removing the `namespace` field and adding the + * `namespaces` field. + * + * If the object does not exist in the default namespace (undefined), its ID is also regenerated, and an "originId" is added to preserve + * legacy import/copy behavior. + */ +function convertNamespaceType(doc: SavedObjectUnsanitizedDoc) { + const { namespace, ...otherAttrs } = doc; + const additionalDocs: SavedObjectUnsanitizedDoc[] = []; + + // If this object exists in the default namespace, return it with the appropriate `namespaces` field without changing its ID. + if (namespace === undefined) { + return { + transformedDoc: { ...otherAttrs, namespaces: [DEFAULT_NAMESPACE_STRING] }, + additionalDocs, + }; + } + + const { id: originId, type } = otherAttrs; + const id = SavedObjectsUtils.getConvertedObjectId(namespace, type, originId!); + const legacyUrlAlias: SavedObjectUnsanitizedDoc = { + id: `${namespace}:${type}:${originId}`, + type: LEGACY_URL_ALIAS_TYPE, + attributes: { + // NOTE TO MAINTAINERS: If a saved object migration is added in `src/core/server/saved_objects/object_types/registration.ts`, these + // values must be updated accordingly. That's because a user can upgrade Kibana from 7.17 to 8.x, and any defined migrations will not + // be applied to aliases that are created during the conversion process. + sourceId: originId, + targetNamespace: namespace, + targetType: type, + targetId: id, + purpose: 'savedObjectConversion', + }, + }; + additionalDocs.push(legacyUrlAlias); + return { + transformedDoc: { ...otherAttrs, id, originId, namespaces: [namespace] }, + additionalDocs, + }; +} diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/types.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/types.ts new file mode 100644 index 0000000000000..3c9c836923caa --- /dev/null +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/types.ts @@ -0,0 +1,73 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +import type { SavedObjectUnsanitizedDoc } from '@kbn/core-saved-objects-server'; + +/** + * Map containing all the info to convert types + */ +export interface ActiveMigrations { + [type: string]: TypeConversion; +} + +/** + * Structure containing all the required info to perform a type's conversion + */ +export interface TypeConversion { + /** Derived from `migrate` transforms and `convert` transforms */ + latestMigrationVersion?: string; + /** Derived from `reference` transforms */ + latestCoreMigrationVersion?: string; + /** List of transforms registered for the type **/ + transforms: Transform[]; +} + +/** + * Internal representation of a document transformation + */ +export interface Transform { + /** The version this transform is registered for */ + version: string; + /** The transformation function */ + transform: TransformFn; + /** The type of this transform */ + transformType: TransformType; +} + +/** + * There are two "migrationVersion" transform types: + * * `migrate` - These transforms are defined and added by consumers using the type registry; each is applied to a single object type + * based on an object's `migrationVersion[type]` field. These are applied during index migrations and document migrations. + * * `convert` - These transforms are defined by core and added by consumers using the type registry; each is applied to a single object + * type based on an object's `migrationVersion[type]` field. These are applied during index migrations, NOT document migrations. + * + * There is one "coreMigrationVersion" transform type: + * * `reference` - These transforms are defined by core and added by consumers using the type registry; they are applied to all object + * types based on their `coreMigrationVersion` field. These are applied during index migrations, NOT document migrations. + */ +export type TransformType = 'migrate' | 'convert' | 'reference'; + +/** + * Transformation function for a {@link Transform} + */ +export type TransformFn = (doc: SavedObjectUnsanitizedDoc) => TransformResult; + +/** + * Return type for a {@link TransformFn} + */ +export interface TransformResult { + /** + * This is the original document that has been transformed. + */ + transformedDoc: SavedObjectUnsanitizedDoc; + /** + * These are any new document(s) that have been created during the transformation process; these are not transformed, but they are marked + * as up-to-date. Only conversion transforms generate additional documents. + */ + additionalDocs: SavedObjectUnsanitizedDoc[]; +} diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/utils.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/utils.ts new file mode 100644 index 0000000000000..a6a78a2c6baa8 --- /dev/null +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/utils.ts @@ -0,0 +1,78 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +import Semver from 'semver'; +import { + SavedObjectMigrationFn, + SavedObjectsType, + SavedObjectUnsanitizedDoc, +} from '@kbn/core-saved-objects-server'; +import { Logger } from '@kbn/logging'; +import { MigrationLogger } from '../core/migration_logger'; +import { TransformSavedObjectDocumentError } from '../core/transform_saved_object_document_error'; +import type { Transform, TransformFn } from './types'; + +/** + * If a specific transform function fails, this tacks on a bit of information + * about the document and transform that caused the failure. + */ +export function wrapWithTry( + version: string, + type: SavedObjectsType, + migrationFn: SavedObjectMigrationFn, + log: Logger +): TransformFn { + const context = Object.freeze({ + log: new MigrationLogger(log), + migrationVersion: version, + convertToMultiNamespaceTypeVersion: type.convertToMultiNamespaceTypeVersion, + isSingleNamespaceType: type.namespaceType === 'single', + }); + + return function tryTransformDoc(doc: SavedObjectUnsanitizedDoc) { + try { + const result = migrationFn(doc, context); + + // A basic check to help migration authors detect basic errors + // (e.g. forgetting to return the transformed doc) + if (!result || !result.type) { + throw new Error(`Invalid saved object returned from migration ${type.name}:${version}.`); + } + + return { transformedDoc: result, additionalDocs: [] }; + } catch (error) { + log.error(error); + throw new TransformSavedObjectDocumentError(error, version); + } + }; +} + +/** + * Transforms are sorted in ascending order by version. One version may contain multiple transforms; 'reference' transforms always run + * first, 'convert' transforms always run second, and 'migrate' transforms always run last. This is because: + * 1. 'convert' transforms get rid of the `namespace` field, which must be present for 'reference' transforms to function correctly. + * 2. 'migrate' transforms are defined by the consumer, and may change the object type or migrationVersion which resets the migration loop + * and could cause any remaining transforms for this version to be skipped. + */ +export function transformComparator(a: Transform, b: Transform) { + const semver = Semver.compare(a.version, b.version); + if (semver !== 0) { + return semver; + } else if (a.transformType !== b.transformType) { + if (a.transformType === 'migrate') { + return 1; + } else if (b.transformType === 'migrate') { + return -1; + } else if (a.transformType === 'convert') { + return 1; + } else if (b.transformType === 'convert') { + return -1; + } + } + return 0; +} diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/validate_migrations.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/validate_migrations.ts new file mode 100644 index 0000000000000..463ee85ac1808 --- /dev/null +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/document_migrator/validate_migrations.ts @@ -0,0 +1,121 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0 and the Server Side Public License, v 1; you may not use this file except + * in compliance with, at your election, the Elastic License 2.0 or the Server + * Side Public License, v 1. + */ + +import Semver from 'semver'; +import type { SavedObjectsNamespaceType } from '@kbn/core-saved-objects-common'; +import type { + SavedObjectMigrationMap, + ISavedObjectTypeRegistry, +} from '@kbn/core-saved-objects-server'; + +/** + * Basic validation that the migration definition matches our expectations. We can't + * rely on TypeScript here, as the caller may be JavaScript / ClojureScript / any compile-to-js + * language. So, this is just to provide a little developer-friendly error messaging. Joi was + * giving weird errors, so we're just doing manual validation. + */ +export function validateMigrationDefinition( + registry: ISavedObjectTypeRegistry, + kibanaVersion: string, + convertVersion?: string +) { + function assertObjectOrFunction(entity: any, prefix: string) { + if (!entity || (typeof entity !== 'function' && typeof entity !== 'object')) { + throw new Error(`${prefix} Got! ${typeof entity}, ${JSON.stringify(entity)}.`); + } + } + + function assertValidConvertToMultiNamespaceType( + namespaceType: SavedObjectsNamespaceType, + convertToMultiNamespaceTypeVersion: string, + type: string + ) { + if (namespaceType !== 'multiple' && namespaceType !== 'multiple-isolated') { + throw new Error( + `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Expected namespaceType to be 'multiple' or 'multiple-isolated', but got '${namespaceType}'.` + ); + } else if (!Semver.valid(convertToMultiNamespaceTypeVersion)) { + throw new Error( + `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Expected value to be a semver, but got '${convertToMultiNamespaceTypeVersion}'.` + ); + } else if (convertVersion && Semver.neq(convertToMultiNamespaceTypeVersion, convertVersion)) { + throw new Error( + `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Value '${convertToMultiNamespaceTypeVersion}' cannot be any other than '${convertVersion}'.` + ); + } else if (Semver.gt(convertToMultiNamespaceTypeVersion, kibanaVersion)) { + throw new Error( + `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Value '${convertToMultiNamespaceTypeVersion}' cannot be greater than the current Kibana version '${kibanaVersion}'.` + ); + } else if (Semver.patch(convertToMultiNamespaceTypeVersion)) { + throw new Error( + `Invalid convertToMultiNamespaceTypeVersion for type ${type}. Value '${convertToMultiNamespaceTypeVersion}' cannot be used on a patch version (must be like 'x.y.0').` + ); + } + } + + registry.getAllTypes().forEach((type) => { + const { name, migrations, convertToMultiNamespaceTypeVersion, namespaceType } = type; + if (migrations) { + assertObjectOrFunction( + type.migrations, + `Migration for type ${name} should be an object or a function returning an object like { '2.0.0': (doc) => doc }.` + ); + } + if (convertToMultiNamespaceTypeVersion) { + // CHECKPOINT 1 + assertValidConvertToMultiNamespaceType( + namespaceType, + convertToMultiNamespaceTypeVersion, + name + ); + } + }); +} + +export function validateMigrationsMapObject( + name: string, + kibanaVersion: string, + migrationsMap?: SavedObjectMigrationMap +) { + function assertObject(obj: any, prefix: string) { + if (!obj || typeof obj !== 'object') { + throw new Error(`${prefix} Got ${obj}.`); + } + } + + function assertValidSemver(version: string, type: string) { + if (!Semver.valid(version)) { + throw new Error( + `Invalid migration for type ${type}. Expected all properties to be semvers, but got ${version}.` + ); + } + if (Semver.gt(version, kibanaVersion)) { + throw new Error( + `Invalid migration for type ${type}. Property '${version}' cannot be greater than the current Kibana version '${kibanaVersion}'.` + ); + } + } + + function assertValidTransform(fn: any, version: string, type: string) { + if (typeof fn !== 'function') { + throw new Error(`Invalid migration ${type}.${version}: expected a function, but got ${fn}.`); + } + } + + if (migrationsMap) { + assertObject( + migrationsMap, + `Migrations map for type ${name} should be an object like { '2.0.0': (doc) => doc }.` + ); + + Object.entries(migrationsMap).forEach(([version, fn]) => { + assertValidSemver(version, name); + assertValidTransform(fn, version, name); + }); + } +} diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/index.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/index.ts index 7f520531f22e6..b50f64a26620d 100644 --- a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/index.ts +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/index.ts @@ -9,4 +9,4 @@ export { KibanaMigrator, mergeTypes } from './kibana_migrator'; export type { KibanaMigratorOptions } from './kibana_migrator'; export { buildActiveMappings } from './core'; -export { DocumentMigrator } from './core'; +export { DocumentMigrator } from './document_migrator'; diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/kibana_migrator.test.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/kibana_migrator.test.ts index 4e8dcdd7c7f54..655f164b831cf 100644 --- a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/kibana_migrator.test.ts +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/kibana_migrator.test.ts @@ -14,16 +14,16 @@ import { elasticsearchClientMock } from '@kbn/core-elasticsearch-client-server-m import type { SavedObjectsType } from '@kbn/core-saved-objects-server'; import { SavedObjectTypeRegistry } from '@kbn/core-saved-objects-base-server-internal'; import { type KibanaMigratorOptions, KibanaMigrator } from './kibana_migrator'; -import { DocumentMigrator } from './core/document_migrator'; +import { DocumentMigrator } from './document_migrator'; import { ByteSizeValue } from '@kbn/config-schema'; import { docLinksServiceMock } from '@kbn/core-doc-links-server-mocks'; import { lastValueFrom } from 'rxjs'; -jest.mock('./core/document_migrator', () => { +jest.mock('./document_migrator', () => { return { // Create a mock for spying on the constructor DocumentMigrator: jest.fn().mockImplementation((...args) => { - const { DocumentMigrator: RealDocMigrator } = jest.requireActual('./core/document_migrator'); + const { DocumentMigrator: RealDocMigrator } = jest.requireActual('./document_migrator'); return new RealDocMigrator(args[0]); }), }; diff --git a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/kibana_migrator.ts b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/kibana_migrator.ts index 58a5a741a6163..fa0c88629758b 100644 --- a/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/kibana_migrator.ts +++ b/packages/core/saved-objects/core-saved-objects-migration-server-internal/src/kibana_migrator.ts @@ -32,7 +32,7 @@ import { type MigrationResult, } from '@kbn/core-saved-objects-base-server-internal'; import { buildActiveMappings } from './core'; -import { DocumentMigrator, type VersionedTransformer } from './core/document_migrator'; +import { DocumentMigrator, type VersionedTransformer } from './document_migrator'; import { createIndexMap } from './core/build_index_map'; import { runResilientMigrator } from './run_resilient_migrator'; import { migrateRawDocsSafely } from './core/migrate_raw_docs'; From 8b816c32ccd7c362a2e6609ac88076b0e7b9d616 Mon Sep 17 00:00:00 2001 From: Stratoula Kalafateli Date: Wed, 8 Feb 2023 16:47:58 +0200 Subject: [PATCH 24/60] [Convert2Lens] Do not carry filters/query from dashboard to the converted embeddable (#150526) ## Summary Closes https://github.com/elastic/kibana/issues/150283 When a user navigates from another app to Lens with context (Discover, legacy editors, dashboard convert to Lens action) then the filters and query from the originating app are carried to Lens. This makes sense for the first 2 but not for the latter as we don't want to carry the dahsboard search context to the Lens editor. ![lens](https://user-images.githubusercontent.com/17003240/217473766-afe827a1-81db-4093-800f-450d33932507.gif) ### Checklist - [x] [Unit or functional tests](https://www.elastic.co/guide/en/kibana/master/development-tests.html) were updated or added to match the most common scenarios --- x-pack/plugins/lens/public/app_plugin/mounter.tsx | 6 ++++++ .../apps/lens/open_in_lens/dashboard/dashboard.ts | 6 ++++++ 2 files changed, 12 insertions(+) diff --git a/x-pack/plugins/lens/public/app_plugin/mounter.tsx b/x-pack/plugins/lens/public/app_plugin/mounter.tsx index 916664feffd84..45de1597148a7 100644 --- a/x-pack/plugins/lens/public/app_plugin/mounter.tsx +++ b/x-pack/plugins/lens/public/app_plugin/mounter.tsx @@ -310,6 +310,12 @@ export async function mountApp( if (!initialContext) { data.query.filterManager.setAppFilters([]); } + // if user comes from a dashboard to convert a legacy viz to a Lens chart + // we clear up the dashboard filters and query + if (initialContext && 'isEmbeddable' in initialContext && initialContext.isEmbeddable) { + data.query.filterManager.setAppFilters([]); + data.query.queryString.clearQuery(); + } lensStore.dispatch(setState(getPreloadedState(storeDeps) as LensAppState)); lensStore.dispatch(loadInitial({ redirectCallback, initialInput, history: props.history })); }, [initialInput, props.history, redirectCallback]); diff --git a/x-pack/test/functional/apps/lens/open_in_lens/dashboard/dashboard.ts b/x-pack/test/functional/apps/lens/open_in_lens/dashboard/dashboard.ts index b6c94a4f32969..47846ba3641a6 100644 --- a/x-pack/test/functional/apps/lens/open_in_lens/dashboard/dashboard.ts +++ b/x-pack/test/functional/apps/lens/open_in_lens/dashboard/dashboard.ts @@ -22,6 +22,7 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { const retry = getService('retry'); const panelActions = getService('dashboardPanelActions'); const dashboardAddPanel = getService('dashboardAddPanel'); + const filterBar = getService('filterBar'); describe('Convert to Lens action on dashboard', function describeIndexTests() { before(async () => { @@ -37,6 +38,9 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { await testSubjects.exists('visualizesaveAndReturnButton'); await testSubjects.click('visualizesaveAndReturnButton'); await dashboard.waitForRenderComplete(); + // define a filter + await filterBar.addFilter({ field: 'geo.src', operation: 'is', value: 'CN' }); + await dashboard.waitForRenderComplete(); expect(await dashboard.isNotificationExists(0)).to.be(true); }); @@ -46,6 +50,8 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { await lens.waitForVisualization('xyVisChart'); const lastBreadcrumbdcrumb = await testSubjects.getVisibleText('breadcrumb last'); expect(lastBreadcrumbdcrumb).to.be('Converting Area visualization'); + const filterCount = await filterBar.getFilterCount(); + expect(filterCount).to.equal(0); await lens.replaceInDashboard(); await retry.try(async () => { From 44d483a569a31646283f65b4f383bbe81f201ee5 Mon Sep 17 00:00:00 2001 From: Emmanuelle Raffenne <97166868+emma-raffenne@users.noreply.github.com> Date: Wed, 8 Feb 2023 14:55:51 +0000 Subject: [PATCH 25/60] Updating projectNext to 1.1.0 for AO actions (#150537) After getting errors on action execution for adding issues labeled with AO team to the corresponding project, we found out that we were using a version of projectNext that relies on a deprecated API. See [projectNext release notes](/richkuz/projectnext-label-assigner/releases/tag/1.1.0) for details. This PR updates the action to use version 1.1.0 of `projectNext` --- .github/workflows/add-to-ao-project.yml | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/.github/workflows/add-to-ao-project.yml b/.github/workflows/add-to-ao-project.yml index c89e8fcefb712..ea4b4fdeb1822 100644 --- a/.github/workflows/add-to-ao-project.yml +++ b/.github/workflows/add-to-ao-project.yml @@ -10,7 +10,7 @@ jobs: github.event.label.name == 'Team: Actionable Observability' steps: - name: Add - uses: richkuz/projectnext-label-assigner@1.0.2 + uses: richkuz/projectnext-label-assigner@1.1.0 id: add_to_projects with: config: | From d87733160ced8273498940404766fdcd79dfb6c3 Mon Sep 17 00:00:00 2001 From: Boris Kirov Date: Wed, 8 Feb 2023 15:57:50 +0100 Subject: [PATCH 26/60] Changing the Anomaly detection icon on APM (#150541) ## Summary We use `alert` icon to communicate when Anomaly detection is not enabled. This conflicts with the usage of the icon for alerting. So in this small PR I'm swapping the icons with the `machineLearning` icon to make the visual connection stronger. The ML icon is also used in their app so things would make more sense that way. image After / Before ![image](https://user-images.githubusercontent.com/13353203/217507185-44b7cb94-45d8-4c4e-824c-8ce0fb7adc7c.png) --- .../apm_header_action_menu/anomaly_detection_setup_link.tsx | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/x-pack/plugins/apm/public/components/shared/apm_header_action_menu/anomaly_detection_setup_link.tsx b/x-pack/plugins/apm/public/components/shared/apm_header_action_menu/anomaly_detection_setup_link.tsx index 48a5b4e81f1d6..74757fb5fd2c2 100644 --- a/x-pack/plugins/apm/public/components/shared/apm_header_action_menu/anomaly_detection_setup_link.tsx +++ b/x-pack/plugins/apm/public/components/shared/apm_header_action_menu/anomaly_detection_setup_link.tsx @@ -46,7 +46,7 @@ export function AnomalyDetectionSetupLink() { defaultMessage: 'Could not determine state of anomaly detection setup.', } ); - icon = 'alert'; + icon = 'machineLearningApp'; } else if ( anomalyDetectionSetupState === AnomalyDetectionSetupState.NoJobs || anomalyDetectionSetupState === @@ -54,7 +54,7 @@ export function AnomalyDetectionSetupLink() { ) { color = 'warning'; tooltipText = getNoJobsMessage(anomalyDetectionSetupState, environment); - icon = 'alert'; + icon = 'machineLearningApp'; } else if ( anomalyDetectionSetupState === AnomalyDetectionSetupState.UpgradeableJobs ) { From 031f67bb49a8a86303affb52a96d277807b8cdf7 Mon Sep 17 00:00:00 2001 From: Kyle Pollich Date: Wed, 8 Feb 2023 10:23:06 -0500 Subject: [PATCH 27/60] [Fleet] ON Week - Port Integrations UI to `@tanstack/query` (#146714) MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit ## Summary Migrates data fetching in `applications/integrations` to `@tanstack/query` - https://tanstack.com/query/latest This migration gives us some powerful tools around data fetching and state management in React, and follows suit with several other Kibana plugins that have migrated to `react-query` in the recent months. I took some time to write up some dev docs around this change in https://github.com/elastic/kibana/blob/bf9527a2bfd5a5335d16c09acb81bc89e3e267db/x-pack/plugins/fleet/dev_docs/react_query.md that should hopefully represent a good start in explaining the new data fetching patterns in detail. Note: I'm reviving this ON week PR from November after a few months, so there might be non-RQ data fetching changes that have landed in `main` since I initially filed these changes. If you find anything please let me know and I'll happily migrate that too. I'll also be doing some more manual testing of critical integrations UX flows to make sure there's no regressions here, though everything I can think of has looked good so far 🙂 --------- Co-authored-by: kibanamachine <42973632+kibanamachine@users.noreply.github.com> --- packages/kbn-optimizer/limits.yml | 2 +- x-pack/plugins/fleet/dev_docs/react_query.md | 238 ++++++++++++++++++ .../fleet/public/applications/fleet/app.tsx | 31 ++- .../multi_page_layout/index.tsx | 8 +- .../single_page_layout/index.test.tsx | 8 +- .../single_page_layout/index.tsx | 4 +- .../components/agent_dashboard_link.test.tsx | 18 +- .../components/agent_dashboard_link.tsx | 4 +- .../public/applications/integrations/app.tsx | 51 ++-- .../applications/integrations/hooks/index.ts | 2 - .../integrations/hooks/use_categories.tsx | 55 ---- .../hooks/use_package_install.tsx | 3 + .../integrations/hooks/use_packages.tsx | 56 ----- .../epm/screens/detail/hooks/index.ts | 2 +- .../hooks/use_is_first_time_agent_user.ts | 76 +++--- .../sections/epm/screens/detail/index.tsx | 55 ++-- .../epm/screens/detail/overview/details.tsx | 8 +- .../screens/detail/overview/license_modal.tsx | 30 +-- .../detail/policies/package_policies.tsx | 1 + .../epm/screens/detail/settings/settings.tsx | 121 ++++----- .../screens/detail/settings/update_button.tsx | 112 ++++----- .../home/hooks/use_available_packages.tsx | 6 +- .../sections/epm/screens/home/index.tsx | 12 +- .../sections/epm/screens/policy/index.tsx | 6 +- .../fleet/public/hooks/use_fleet_status.tsx | 1 + .../hooks/use_package_installations.tsx | 95 +++++++ .../public/hooks/use_request/agent_policy.ts | 15 +- .../fleet/public/hooks/use_request/agents.ts | 8 + .../fleet/public/hooks/use_request/app.ts | 15 +- .../fleet/public/hooks/use_request/epm.ts | 98 +++++--- .../hooks/use_request/package_policy.ts | 67 ++++- .../public/hooks/use_request/settings.ts | 14 +- .../public/hooks/use_request/use_request.ts | 20 ++ 33 files changed, 822 insertions(+), 420 deletions(-) create mode 100644 x-pack/plugins/fleet/dev_docs/react_query.md delete mode 100644 x-pack/plugins/fleet/public/applications/integrations/hooks/use_categories.tsx delete mode 100644 x-pack/plugins/fleet/public/applications/integrations/hooks/use_packages.tsx create mode 100644 x-pack/plugins/fleet/public/hooks/use_package_installations.tsx diff --git a/packages/kbn-optimizer/limits.yml b/packages/kbn-optimizer/limits.yml index 79670e025b8dc..d53fed770d6ff 100644 --- a/packages/kbn-optimizer/limits.yml +++ b/packages/kbn-optimizer/limits.yml @@ -60,7 +60,7 @@ pageLoadAssetSize: files: 22673 filesManagement: 18683 fileUpload: 25664 - fleet: 126917 + fleet: 142263 globalSearch: 29696 globalSearchBar: 50403 globalSearchProviders: 25554 diff --git a/x-pack/plugins/fleet/dev_docs/react_query.md b/x-pack/plugins/fleet/dev_docs/react_query.md new file mode 100644 index 0000000000000..55eca8669c1ec --- /dev/null +++ b/x-pack/plugins/fleet/dev_docs/react_query.md @@ -0,0 +1,238 @@ +# `@tanstack/query` Usage in Fleet + Integrations + +This document seeks to outline the Fleet + Integrations apps' usage of [`@tanstack/query`](https://tanstack.com/query/latest) - formally known generally as `react-query`. When we talk about the React-specific adapter for `@tanstack/query`, we'll use the library name `react-query`. Since Kibana doesn't have Vue, Solid, or Svelte plugins, we don't need to be worried about the other client implementations. This is a library for asynchronous state management that's most commonly utilized for data fetching logic. `@tanstack/query` helps developers write consistent state management logic around asynchronous operations, while providing end users with a performant, "jank-free" experience. + +## Helpful Links + +- `react-query` [docs](https://tanstack.com/query/latest/docs/react/overview) +- [Practical React Query](https://tanstack.com/query/latest/docs/react/overview) by maintainer [TkDodo](https://github.com/tkdodo) + - This series is long but extremely helpful. A highly recommended read for anyone working with data fetching in Fleet/Integrations! +- `@tanstack/query` source code on GitHub: https://github.com/TanStack/query + +## How Fleet/Integrations uses custom data fetching hooks + +Historically, Fleet/Integrations have used homegrown data fetching hooks in a common folder at [`public/hooks/use_request`](https://github.com/elastic/kibana/tree/main/x-pack/plugins/fleet/public/hooks/use_request). Each `.ts` file in this directory contains one or more data fetching hooks related to a particular resource or concept. For example, here's what some data fetching hooks for `packages` and `categories` might look like: + +```ts +// use_request/epm.ts + +export const useGetCategories = (query: GetCategoriesRequest['query'] = {}) => { + return useRequest({ + path: epmRouteService.getCategoriesPath(), + method: 'get', + query, + }); +}; + +export const sendGetCategories = (query: GetCategoriesRequest['query'] = {}) => { + return sendRequest({ + path: epmRouteService.getCategoriesPath(), + method: 'get', + query, + }); +}; + +export const useGetPackages = (query: GetPackagesRequest['query'] = {}) => { + return useRequest({ + path: epmRouteService.getListPath(), + method: 'get', + query, + }); +}; + +export const sendGetPackages = (query: GetPackagesRequest['query'] = {}) => { + return sendRequest({ + path: epmRouteService.getListPath(), + method: 'get', + query, + }); +}; +``` + +
+What are useRequest and sendRequest? + +The `useRequest` and `sendRequest` methods are common across all of these data fetching hooks, and use Kibana's provide `useRequest` hook and `sendRequest` helper with some additional logic on top. e.g. + +```ts +// use_request/use_request.ts - excerpts for clarity + +import { + sendRequest as _sendRequest, + useRequest as _useRequest, +} from '@kbn/es-ui-shared-plugin/public'; + +export const sendRequest = ( + config: SendRequestConfig +): Promise> => { + if (!httpClient) { + throw new Error('sendRequest has no http client set'); + } + return _sendRequest(httpClient, config); +}; + +export const useRequest = (config: UseRequestConfig) => { + if (!httpClient) { + throw new Error('sendRequest has no http client set'); + } + return _useRequest(httpClient, config); +}; +``` + +
+ +Consuming these data fetching hooks might look something like this + +```tsx +// applications/integrations/sections/epm/screens/detail/settings/update_button.tsx +const handleClickUpgradePolicies = useCallback(async () => { + if (isUpgradingPackagePolicies) { + return; + } + + setIsUpdateModalVisible(false); + setIsUpgradingPackagePolicies(true); + + await installPackage({ name, version, title }); + + await sendUpgradePackagePolicy( + // Only upgrade policies that don't have conflicts + packagePolicyIds.filter( + (id) => !dryRunData?.find((dryRunRecord) => dryRunRecord.diff?.[0].id === id)?.hasErrors + ) + ); + + setIsUpgradingPackagePolicies(false); + + notifications.toasts.addSuccess({ + title: toMountPoint( + , + { theme$ } + ), + text: toMountPoint( + , + { theme$ } + ), + }); + + navigateToNewSettingsPage(); +}, [ + dryRunData, + installPackage, + isUpgradingPackagePolicies, + name, + navigateToNewSettingsPage, + notifications.toasts, + packagePolicyIds, + setIsUpgradingPackagePolicies, + title, + version, + theme$, +]); +``` + +In the "custom data fetching" hooks world, there are a few big problems: + +1. Caching, cancellation, deduping/debouncing successive requests, and optimizations around re-renders are an afterthought +2. Mutations in particular are extremely verbose, as we need to "wire up" all error/loading state, "post-mutation" operations, etc +3. Revalidating queries from elsewhere in the component tree (e.g. update the agent policy table when a new agent policy is saved) is a tricky operation usually solved by intermittent polling or a `location.reload()` + +## How `react-query` helps + +`react-query` handles many of the "big problems" above out-of-the-box. By providing a basic key/value based cache for queries, consistent utilities around state transitions of async operations, and robust revalidation helpers, `react-query` makes working with the state around data fetching much more predictable and pleasant. + +### How Fleet/Integrations uses `react-query` + +There's a bit of setup involved to actually get `react-query` up and running. First and foremost, each Kibana application is wrapped in a `` that handles `react-query`'s internal query cache and various React context needs. e.g. + +```tsx +//... + + + + + + + + + {children} + + + + + + +``` + +We also set up `react-query`'s [dev tools](https://tanstack.com/query/v4/docs/react/devtools), which provide a useful developer console for debugging query and mutation state across the whole application. + +Another step required to use `react-query` in Fleet/Integrations is the introduction of a specialized data fetching utility. `react-query` operations expect a slightly different structure than what Kibana's `useRequest` and `sendRequest` helpers. For this purpose, we introduce the `sendRequestForRq` helper, e.g. + +```ts +// Sends requests with better ergonomics for React Query, e.g. throw error rather +// than resolving with an `error` property in the result. Also returns `data` directly +// as opposed to { data } in a response object. +export const sendRequestForRq = async ( + config: SendRequestConfig +): Promise => { + if (!httpClient) { + throw new Error('sendRequest has no http client set'); + } + + const response = await _sendRequest(httpClient, config); + + if (response.error) { + throw response.error; + } + + // Data can't be null so long as `_sendRequest` did not throw + return response.data!; +}; +``` + +So, with those pieces of setup in mind, adding a new query or mutation looks like this: + +```ts +export function useGetCategoriesQuery(query: GetCategoriesRequest['query'] = {}) { + return useQuery(['categories', query], () => + sendRequestForRq({ + path: epmRouteService.getCategoriesPath(), + method: 'get', + query, + }) + ); +} + +export const useGetPackagesQuery = (query: GetPackagesRequest['query']) => { + return useQuery(['get-packages', query.prerelease], () => + sendRequestForRq({ + path: epmRouteService.getListPath(), + method: 'get', + query, + }) + ); +}; + +export const useUpdatePackageMutation = () => { + return useMutation( + ({ pkgName, pkgVersion, body }: UpdatePackageArgs) => + sendRequestForRq({ + path: epmRouteService.getUpdatePath(pkgName, pkgVersion), + method: 'put', + body, + }) + ); +}; +``` + +### `react-query` operation naming conventions + +For `react-query` operations defined in `use_request/`, try to use a naming convention along the lines of `use{Action}{Resource}{Query/Mutation}` for your hooks. This helps with consistency and makes the intent of every data fetching operation clear. diff --git a/x-pack/plugins/fleet/public/applications/fleet/app.tsx b/x-pack/plugins/fleet/public/applications/fleet/app.tsx index 9afe8c10e18c3..3f657ed174483 100644 --- a/x-pack/plugins/fleet/public/applications/fleet/app.tsx +++ b/x-pack/plugins/fleet/public/applications/fleet/app.tsx @@ -15,6 +15,8 @@ import { FormattedMessage } from '@kbn/i18n-react'; import { i18n } from '@kbn/i18n'; import styled from 'styled-components'; import useObservable from 'react-use/lib/useObservable'; +import { QueryClient, QueryClientProvider } from '@tanstack/react-query'; +import { ReactQueryDevtools } from '@tanstack/react-query-devtools'; import type { TopNavMenuData } from '@kbn/navigation-plugin/public'; @@ -62,6 +64,8 @@ import { DebugPage } from './sections/debug'; const FEEDBACK_URL = 'https://ela.st/fleet-feedback'; +const queryClient = new QueryClient(); + const ErrorLayout: FunctionComponent<{ isAddIntegrationsPath: boolean }> = ({ isAddIntegrationsPath, children, @@ -257,18 +261,21 @@ export const FleetAppContext: React.FC<{ - - - - - {children} - - - - + + + + + + + {children} + + + + + diff --git a/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/multi_page_layout/index.tsx b/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/multi_page_layout/index.tsx index b63fa1ede3dc5..707b8f0fc5871 100644 --- a/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/multi_page_layout/index.tsx +++ b/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/multi_page_layout/index.tsx @@ -10,7 +10,11 @@ import { i18n } from '@kbn/i18n'; import { splitPkgKey } from '../../../../../../../common/services'; -import { useGetPackageInfoByKey, useLink, useFleetServerHostsForPolicy } from '../../../../hooks'; +import { + useGetPackageInfoByKeyQuery, + useLink, + useFleetServerHostsForPolicy, +} from '../../../../hooks'; import type { AddToPolicyParams, CreatePackagePolicyParams } from '../types'; @@ -70,7 +74,7 @@ export const CreatePackagePolicyMultiPage: CreatePackagePolicyParams = ({ data: packageInfoData, error: packageInfoError, isLoading: isPackageInfoLoading, - } = useGetPackageInfoByKey(pkgName, pkgVersion, { prerelease, full: true }); + } = useGetPackageInfoByKeyQuery(pkgName, pkgVersion, { prerelease, full: true }); const { agentPolicy, diff --git a/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/single_page_layout/index.test.tsx b/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/single_page_layout/index.test.tsx index 5c80b2276ae09..ee1be70ead43a 100644 --- a/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/single_page_layout/index.test.tsx +++ b/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/single_page_layout/index.test.tsx @@ -20,7 +20,7 @@ import { sendGetAgentStatus, useIntraAppState, useStartServices, - useGetPackageInfoByKey, + useGetPackageInfoByKeyQuery, } from '../../../../hooks'; jest.mock('../../../../hooks', () => { @@ -42,10 +42,10 @@ jest.mock('../../../../hooks', () => { sendGetOneAgentPolicy: jest.fn().mockResolvedValue({ data: { item: { id: 'agent-policy-1', name: 'Agent policy 1', namespace: 'default' } }, }), + useGetPackageInfoByKeyQuery: jest.fn(), sendGetSettings: jest.fn().mockResolvedValue({ data: { item: {} }, }), - useGetPackageInfoByKey: jest.fn(), sendCreatePackagePolicy: jest .fn() .mockResolvedValue({ data: { item: { id: 'policy-1', inputs: [] } } }), @@ -186,7 +186,7 @@ describe('when on the package policy create page', () => { isLoading: false, }; - (useGetPackageInfoByKey as jest.Mock).mockReturnValue(mockPackageInfo); + (useGetPackageInfoByKeyQuery as jest.Mock).mockReturnValue(mockPackageInfo); }); describe('and Route state is provided via Fleet HashRouter', () => { @@ -355,7 +355,7 @@ describe('when on the package policy create page', () => { }); test('should create agent policy without sys monitoring when new hosts is selected for system integration', async () => { - (useGetPackageInfoByKey as jest.Mock).mockReturnValue({ + (useGetPackageInfoByKeyQuery as jest.Mock).mockReturnValue({ ...mockPackageInfo, data: { item: { diff --git a/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/single_page_layout/index.tsx b/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/single_page_layout/index.tsx index 9a1c943763bd8..5ab6a7b0938d5 100644 --- a/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/single_page_layout/index.tsx +++ b/x-pack/plugins/fleet/public/applications/fleet/sections/agent_policy/create_package_policy_page/single_page_layout/index.tsx @@ -27,7 +27,7 @@ import { useCancelAddPackagePolicy } from '../hooks'; import { splitPkgKey } from '../../../../../../../common/services'; import { generateNewAgentPolicyWithDefaults } from '../../../../services'; import type { NewAgentPolicy } from '../../../../types'; -import { useConfig, sendGetAgentStatus, useGetPackageInfoByKey } from '../../../../hooks'; +import { useConfig, sendGetAgentStatus, useGetPackageInfoByKeyQuery } from '../../../../hooks'; import { Loading, Error as ErrorComponent, @@ -97,7 +97,7 @@ export const CreatePackagePolicySinglePage: CreatePackagePolicyParams = ({ data: packageInfoData, error: packageInfoError, isLoading: isPackageInfoLoading, - } = useGetPackageInfoByKey(pkgName, pkgVersion, { full: true, prerelease }); + } = useGetPackageInfoByKeyQuery(pkgName, pkgVersion, { full: true, prerelease }); const packageInfo = useMemo(() => { if (packageInfoData && packageInfoData.item) { return packageInfoData.item; diff --git a/x-pack/plugins/fleet/public/applications/fleet/sections/agents/agent_details_page/components/agent_dashboard_link.test.tsx b/x-pack/plugins/fleet/public/applications/fleet/sections/agents/agent_details_page/components/agent_dashboard_link.test.tsx index 6e425b53522a6..dbff5ac4375be 100644 --- a/x-pack/plugins/fleet/public/applications/fleet/sections/agents/agent_details_page/components/agent_dashboard_link.test.tsx +++ b/x-pack/plugins/fleet/public/applications/fleet/sections/agents/agent_details_page/components/agent_dashboard_link.test.tsx @@ -9,12 +9,12 @@ import React from 'react'; import { createFleetTestRendererMock } from '../../../../../../mock'; import type { Agent, AgentPolicy } from '../../../../types'; -import { useGetPackageInfoByKey } from '../../../../../../hooks/use_request/epm'; +import { useGetPackageInfoByKeyQuery } from '../../../../../../hooks/use_request/epm'; import { AgentDashboardLink } from './agent_dashboard_link'; -const mockedUseGetPackageInfoByKey = useGetPackageInfoByKey as jest.MockedFunction< - typeof useGetPackageInfoByKey +const mockedUseGetPackageInfoByKeyQuery = useGetPackageInfoByKeyQuery as jest.MockedFunction< + typeof useGetPackageInfoByKeyQuery >; jest.mock('../../../../../../hooks/use_fleet_status', () => ({ @@ -27,14 +27,14 @@ jest.mock('../../../../../../hooks/use_request/epm'); describe('AgentDashboardLink', () => { it('should enable the button if elastic_agent package is installed and policy has monitoring enabled', async () => { - mockedUseGetPackageInfoByKey.mockReturnValue({ + mockedUseGetPackageInfoByKeyQuery.mockReturnValue({ isLoading: false, data: { item: { status: 'installed', }, }, - } as ReturnType); + } as ReturnType); const testRenderer = createFleetTestRendererMock(); const result = testRenderer.render( @@ -57,14 +57,14 @@ describe('AgentDashboardLink', () => { }); it('should not enable the button if elastic_agent package is not installed and policy has monitoring enabled', async () => { - mockedUseGetPackageInfoByKey.mockReturnValue({ + mockedUseGetPackageInfoByKeyQuery.mockReturnValue({ isLoading: false, data: { item: { status: 'not_installed', }, }, - } as ReturnType); + } as ReturnType); const testRenderer = createFleetTestRendererMock(); const result = testRenderer.render( @@ -88,14 +88,14 @@ describe('AgentDashboardLink', () => { }); it('should link to the agent policy settings tab if logs and metrics are not enabled for that policy', async () => { - mockedUseGetPackageInfoByKey.mockReturnValue({ + mockedUseGetPackageInfoByKeyQuery.mockReturnValue({ isLoading: false, data: { item: { status: 'installed', }, }, - } as ReturnType); + } as ReturnType); const testRenderer = createFleetTestRendererMock(); const result = testRenderer.render( diff --git a/x-pack/plugins/fleet/public/applications/fleet/sections/agents/agent_details_page/components/agent_dashboard_link.tsx b/x-pack/plugins/fleet/public/applications/fleet/sections/agents/agent_details_page/components/agent_dashboard_link.tsx index 93be90219cdc9..cad402e602543 100644 --- a/x-pack/plugins/fleet/public/applications/fleet/sections/agents/agent_details_page/components/agent_dashboard_link.tsx +++ b/x-pack/plugins/fleet/public/applications/fleet/sections/agents/agent_details_page/components/agent_dashboard_link.tsx @@ -10,7 +10,7 @@ import { FormattedMessage } from '@kbn/i18n-react'; import { EuiButton, EuiToolTip } from '@elastic/eui'; import styled from 'styled-components'; -import { useGetPackageInfoByKey, useKibanaLink, useLink } from '../../../../hooks'; +import { useGetPackageInfoByKeyQuery, useKibanaLink, useLink } from '../../../../hooks'; import type { Agent, AgentPolicy } from '../../../../types'; import { FLEET_ELASTIC_AGENT_PACKAGE, @@ -18,7 +18,7 @@ import { } from '../../../../../../../common/constants'; function useAgentDashboardLink(agent: Agent) { - const { isLoading, data } = useGetPackageInfoByKey(FLEET_ELASTIC_AGENT_PACKAGE); + const { isLoading, data } = useGetPackageInfoByKeyQuery(FLEET_ELASTIC_AGENT_PACKAGE); const isInstalled = data?.item.status === 'installed'; diff --git a/x-pack/plugins/fleet/public/applications/integrations/app.tsx b/x-pack/plugins/fleet/public/applications/integrations/app.tsx index 3d47db8963d3f..c9e0d97a672b5 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/app.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/app.tsx @@ -11,6 +11,8 @@ import { EuiErrorBoundary, EuiPortal } from '@elastic/eui'; import type { History } from 'history'; import { Router, Redirect, Route, Switch } from 'react-router-dom'; import useObservable from 'react-use/lib/useObservable'; +import { QueryClient, QueryClientProvider } from '@tanstack/react-query'; +import { ReactQueryDevtools } from '@tanstack/react-query-devtools'; import { KibanaContextProvider, RedirectAppLinks } from '@kbn/kibana-react-plugin/public'; import { EuiThemeProvider } from '@kbn/kibana-react-plugin/common'; @@ -39,6 +41,8 @@ import { PackageInstallProvider, UIExtensionsContext, FlyoutContextProvider } fr import { IntegrationsHeader } from './components/header'; import { AgentEnrollmentFlyout } from './components'; +const queryClient = new QueryClient(); + const EmptyContext = () => <>; /** @@ -79,28 +83,31 @@ export const IntegrationsAppContext: React.FC<{ - - - - - - - - - - {children} - - - - - - - - - + + + + + + + + + + + + {children} + + + + + + + + + + diff --git a/x-pack/plugins/fleet/public/applications/integrations/hooks/index.ts b/x-pack/plugins/fleet/public/applications/integrations/hooks/index.ts index 76b6b49c8c5cb..5b6b19af169f0 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/hooks/index.ts +++ b/x-pack/plugins/fleet/public/applications/integrations/hooks/index.ts @@ -14,5 +14,3 @@ export * from './use_agent_policy_context'; export * from './use_integrations_state'; export * from './use_confirm_force_install'; export * from './use_confirm_open_unverified'; -export * from './use_packages'; -export * from './use_categories'; diff --git a/x-pack/plugins/fleet/public/applications/integrations/hooks/use_categories.tsx b/x-pack/plugins/fleet/public/applications/integrations/hooks/use_categories.tsx deleted file mode 100644 index abc601a3ceeb2..0000000000000 --- a/x-pack/plugins/fleet/public/applications/integrations/hooks/use_categories.tsx +++ /dev/null @@ -1,55 +0,0 @@ -/* - * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one - * or more contributor license agreements. Licensed under the Elastic License - * 2.0; you may not use this file except in compliance with the Elastic License - * 2.0. - */ - -import { useEffect, useCallback, useState } from 'react'; - -import type { RequestError } from '../../fleet/hooks'; -import { sendGetCategories } from '../../fleet/hooks'; -import type { GetCategoriesResponse } from '../types'; - -export function useCategories(prerelease?: boolean) { - const [data, setData] = useState(); - const [error, setError] = useState(); - const [isLoading, setIsLoading] = useState(true); - const [isPrereleaseEnabled, setIsPrereleaseEnabled] = useState(prerelease); - - const fetchData = useCallback(async () => { - if (prerelease === undefined) { - return; - } - if (isPrereleaseEnabled === prerelease) { - return; - } - setIsPrereleaseEnabled(prerelease); - setIsLoading(true); - try { - const res = await sendGetCategories({ - include_policy_templates: true, - prerelease, - }); - if (res.error) { - throw res.error; - } - if (res.data) { - setData(res.data); - } - } catch (err) { - setError(err); - } - setIsLoading(false); - }, [prerelease, isPrereleaseEnabled]); - - useEffect(() => { - fetchData(); - }, [fetchData]); - - return { - data, - error, - isLoading, - }; -} diff --git a/x-pack/plugins/fleet/public/applications/integrations/hooks/use_package_install.tsx b/x-pack/plugins/fleet/public/applications/integrations/hooks/use_package_install.tsx index 9afc51d96077f..101de2a30cef5 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/hooks/use_package_install.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/hooks/use_package_install.tsx @@ -5,7 +5,10 @@ * 2.0. */ +// TODO: Refactor this away from constate, which is unmaintained, as this is the only +// usage of it across the Fleet codebase import createContainer from 'constate'; + import React, { useCallback, useState } from 'react'; import { useHistory } from 'react-router-dom'; import { FormattedMessage } from '@kbn/i18n-react'; diff --git a/x-pack/plugins/fleet/public/applications/integrations/hooks/use_packages.tsx b/x-pack/plugins/fleet/public/applications/integrations/hooks/use_packages.tsx deleted file mode 100644 index c2dfa7e7406fa..0000000000000 --- a/x-pack/plugins/fleet/public/applications/integrations/hooks/use_packages.tsx +++ /dev/null @@ -1,56 +0,0 @@ -/* - * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one - * or more contributor license agreements. Licensed under the Elastic License - * 2.0; you may not use this file except in compliance with the Elastic License - * 2.0. - */ - -import { useEffect, useCallback, useState } from 'react'; - -import type { RequestError } from '../../fleet/hooks'; -import { sendGetPackages } from '../../fleet/hooks'; -import type { GetPackagesResponse } from '../types'; - -export function usePackages(prerelease?: boolean) { - const [data, setData] = useState(); - const [error, setError] = useState(); - const [isLoading, setIsLoading] = useState(true); - const [isPrereleaseEnabled, setIsPrereleaseEnabled] = useState(prerelease); - - const fetchData = useCallback(async () => { - if (prerelease === undefined) { - return; - } - if (isPrereleaseEnabled === prerelease) { - return; - } - setIsPrereleaseEnabled(prerelease); - setIsLoading(true); - try { - const res = await sendGetPackages({ - category: '', - excludeInstallStatus: true, - prerelease, - }); - if (res.error) { - throw res.error; - } - if (res.data) { - setData(res.data); - } - } catch (err) { - setError(err); - } - setIsLoading(false); - }, [prerelease, isPrereleaseEnabled]); - - useEffect(() => { - fetchData(); - }, [fetchData]); - - return { - data, - error, - isLoading, - }; -} diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/hooks/index.ts b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/hooks/index.ts index 997d3b0b48a53..6b2d3e80d259f 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/hooks/index.ts +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/hooks/index.ts @@ -5,4 +5,4 @@ * 2.0. */ -export { useIsFirstTimeAgentUser } from './use_is_first_time_agent_user'; +export { useIsFirstTimeAgentUserQuery } from './use_is_first_time_agent_user'; diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/hooks/use_is_first_time_agent_user.ts b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/hooks/use_is_first_time_agent_user.ts index 5eaf7334f2f7f..7c7a6f6aa4ebf 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/hooks/use_is_first_time_agent_user.ts +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/hooks/use_is_first_time_agent_user.ts @@ -5,50 +5,46 @@ * 2.0. */ -import { useEffect, useState } from 'react'; - -import { sendGetAgentPolicies, sendGetAgents } from '../../../../../hooks'; +import { useGetAgentPoliciesQuery, useGetAgentsQuery } from '../../../../../hooks'; import { policyHasFleetServer } from '../../../../../services'; interface UseIsFirstTimeAgentUserResponse { - isLoading: boolean; isFirstTimeAgentUser?: boolean; + isLoading?: boolean; } -export const useIsFirstTimeAgentUser = (): UseIsFirstTimeAgentUserResponse => { - const [result, setResult] = useState({ isLoading: true }); - useEffect(() => { - if (!result.isLoading) { - return; - } - - const getIsFirstTimeAgentUser = async () => { - const { data: agentPoliciesData } = await sendGetAgentPolicies({ - full: true, - }); - - // now get all agents that are NOT part of a fleet server policy - const serverPolicyIdsQuery = (agentPoliciesData?.items || []) - .filter((item) => policyHasFleetServer(item)) - .map((p) => `policy_id:${p.id}`) - .join(' or '); - - // get agents that are not unenrolled and not fleet server - const kuery = - `not (_exists_:"unenrolled_at")` + - (serverPolicyIdsQuery.length ? ` and not (${serverPolicyIdsQuery})` : ''); - - const { data: agentStatusData } = await sendGetAgents({ - page: 1, - perPage: 1, // we only need to know if there is at least one non-fleet agent - showInactive: true, - kuery, - }); - setResult({ isLoading: false, isFirstTimeAgentUser: agentStatusData?.total === 0 }); - }; - - getIsFirstTimeAgentUser(); - }, [result]); - - return result; +export const useIsFirstTimeAgentUserQuery = (): UseIsFirstTimeAgentUserResponse => { + const { + data: agentPolicies, + isLoading: areAgentPoliciesLoading, + isFetched: areAgentsFetched, + } = useGetAgentPoliciesQuery({ + full: true, + }); + + // now get all agents that are NOT part of a fleet server policy + const serverPolicyIdsQuery = (agentPolicies?.items || []) + .filter((item) => policyHasFleetServer(item)) + .map((p) => `policy_id:${p.id}`) + .join(' or '); + + // get agents that are not unenrolled and not fleet server + const kuery = + `not (_exists_:"unenrolled_at")` + + (serverPolicyIdsQuery.length ? ` and not (${serverPolicyIdsQuery})` : ''); + + const { data: agents, isLoading: areAgentsLoading } = useGetAgentsQuery( + { + page: 1, + perPage: 1, // we only need to know if there is at least one non-fleet agent + showInactive: true, + kuery, + }, + { enabled: areAgentsFetched } // don't run the query until agent policies are loaded + ); + + return { + isLoading: areAgentPoliciesLoading || areAgentsLoading, + isFirstTimeAgentUser: agents?.data?.total === 0, + }; }; diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/index.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/index.tsx index dafe901121c54..63314d6fc936f 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/index.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/index.tsx @@ -39,14 +39,14 @@ import { useBreadcrumbs, useStartServices, useAuthz, - usePermissionCheck, + usePermissionCheckQuery, useIntegrationsStateContext, - useGetSettings, + useGetSettingsQuery, } from '../../../../hooks'; import { INTEGRATIONS_ROUTING_PATHS } from '../../../../constants'; import { ExperimentalFeaturesService } from '../../../../services'; import { - useGetPackageInfoByKey, + useGetPackageInfoByKeyQuery, useLink, useAgentPolicyContext, useIsGuidedOnboardingActive, @@ -63,7 +63,7 @@ import { import type { WithHeaderLayoutProps } from '../../../../layouts'; import { WithHeaderLayout } from '../../../../layouts'; -import { useIsFirstTimeAgentUser } from './hooks'; +import { useIsFirstTimeAgentUserQuery } from './hooks'; import { getInstallPkgRouteOptions } from './utils'; import { IntegrationAgentPolicyCount, @@ -114,17 +114,24 @@ export function Detail() { const { getFromIntegrations } = useIntegrationsStateContext(); const { pkgkey, panel } = useParams(); const { getHref, getPath } = useLink(); - const canInstallPackages = useAuthz().integrations.installPackages; - const canReadPackageSettings = useAuthz().integrations.readPackageSettings; - const canReadIntegrationPolicies = useAuthz().integrations.readIntegrationPolicies; - const permissionCheck = usePermissionCheck(); - const missingSecurityConfiguration = - !permissionCheck.data?.success && permissionCheck.data?.error === 'MISSING_SECURITY'; - const userCanInstallPackages = canInstallPackages && permissionCheck.data?.success; const history = useHistory(); const { pathname, search, hash } = useLocation(); const queryParams = useMemo(() => new URLSearchParams(search), [search]); const integration = useMemo(() => queryParams.get('integration'), [queryParams]); + + const canInstallPackages = useAuthz().integrations.installPackages; + const canReadPackageSettings = useAuthz().integrations.readPackageSettings; + const canReadIntegrationPolicies = useAuthz().integrations.readIntegrationPolicies; + + const { + data: permissionCheck, + error: permissionCheckError, + isLoading: isPermissionCheckLoading, + } = usePermissionCheckQuery(); + const missingSecurityConfiguration = + !permissionCheck?.success && permissionCheckError === 'MISSING_SECURITY'; + const userCanInstallPackages = canInstallPackages && permissionCheck?.success; + const services = useStartServices(); const isCloud = !!services?.cloud?.cloudId; const { createPackagePolicyMultiPageLayout: isExperimentalAddIntegrationPageEnabled } = @@ -163,7 +170,7 @@ export function Detail() { boolean | undefined >(); - const { data: settings } = useGetSettings(); + const { data: settings } = useGetSettingsQuery(); useEffect(() => { const isEnabled = Boolean(settings?.item.prerelease_integrations_enabled); @@ -176,9 +183,8 @@ export function Detail() { data: packageInfoData, error: packageInfoError, isLoading: packageInfoLoading, - isInitialRequest: packageIsInitialRequest, - resendRequest: refreshPackageInfo, - } = useGetPackageInfoByKey(pkgName, pkgVersion, { + refetch: refetchPackageInfo, + } = useGetPackageInfoByKeyQuery(pkgName, pkgVersion, { prerelease: prereleaseIntegrationsEnabled, }); @@ -186,7 +192,7 @@ export function Detail() { const [latestPrereleaseVersion, setLatestPrereleaseVersion] = useState(); // fetch latest GA version (prerelease=false) - const { data: packageInfoLatestGAData } = useGetPackageInfoByKey(pkgName, '', { + const { data: packageInfoLatestGAData } = useGetPackageInfoByKeyQuery(pkgName, '', { prerelease: false, }); @@ -199,7 +205,7 @@ export function Detail() { }, [packageInfoLatestGAData?.item]); // fetch latest Prerelease version (prerelease=true) - const { data: packageInfoLatestPrereleaseData } = useGetPackageInfoByKey(pkgName, '', { + const { data: packageInfoLatestPrereleaseData } = useGetPackageInfoByKeyQuery(pkgName, '', { prerelease: true, }); @@ -208,7 +214,7 @@ export function Detail() { }, [packageInfoLatestPrereleaseData?.item.version]); const { isFirstTimeAgentUser = false, isLoading: firstTimeUserLoading } = - useIsFirstTimeAgentUser(); + useIsFirstTimeAgentUserQuery(); const isGuidedOnboardingActive = useIsGuidedOnboardingActive(pkgName); // Refresh package info when status change @@ -220,17 +226,14 @@ export function Detail() { } if (oldPackageInstallStatus === 'not_installed' && packageInstallStatus === 'installed') { setOldPackageStatus(packageInstallStatus); - refreshPackageInfo(); + refetchPackageInfo(); } - }, [packageInstallStatus, oldPackageInstallStatus, refreshPackageInfo]); + }, [packageInstallStatus, oldPackageInstallStatus, refetchPackageInfo]); - const isLoading = - (packageInfoLoading && !packageIsInitialRequest) || - permissionCheck.isLoading || - firstTimeUserLoading; + const isLoading = packageInfoLoading || isPermissionCheckLoading || firstTimeUserLoading; const showCustomTab = - useUIExtension(packageInfoData?.item.name ?? '', 'package-detail-custom') !== undefined; + useUIExtension(packageInfoData?.item?.name ?? '', 'package-detail-custom') !== undefined; // Track install status state useEffect(() => { @@ -698,7 +701,7 @@ export function Detail() { defaultMessage="Error loading integration details" /> } - error={packageInfoError} + error={packageInfoError.message} /> ) : isLoading || !packageInfo ? ( diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/overview/details.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/overview/details.tsx index 729975e8e8e37..94a2a223b122a 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/overview/details.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/overview/details.tsx @@ -29,7 +29,7 @@ import type { KibanaAssetType, } from '../../../../../types'; import { entries } from '../../../../../types'; -import { useGetCategories } from '../../../../../hooks'; +import { useGetCategoriesQuery } from '../../../../../hooks'; import { AssetTitleMap, DisplayedAssets, ServiceTitleMap } from '../../../constants'; import { NoticeModal } from './notice_modal'; @@ -59,10 +59,10 @@ const Replacements = euiStyled(EuiFlexItem)` `; export const Details: React.FC = memo(({ packageInfo }) => { - const { data: categoriesData, isLoading: isLoadingCategories } = useGetCategories(); + const { data: categoriesData, isLoading: isLoadingCategories } = useGetCategoriesQuery(); const packageCategories: string[] = useMemo(() => { - if (!isLoadingCategories && categoriesData && categoriesData.response) { - return categoriesData.response + if (!isLoadingCategories && categoriesData?.items) { + return categoriesData.items .filter((category) => packageInfo.categories?.includes(category.id as PackageSpecCategory)) .map((category) => category.title); } diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/overview/license_modal.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/overview/license_modal.tsx index 51aa501b71b42..9ae4bace737a1 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/overview/license_modal.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/overview/license_modal.tsx @@ -5,7 +5,7 @@ * 2.0. */ -import React, { useEffect, useState } from 'react'; +import React from 'react'; import { EuiCodeBlock, EuiLoadingContent, @@ -19,7 +19,7 @@ import { import { i18n } from '@kbn/i18n'; import { FormattedMessage } from '@kbn/i18n-react'; -import { sendGetFileByPath, useStartServices } from '../../../../../hooks'; +import { useGetFileByPathQuery, useStartServices } from '../../../../../hooks'; interface Props { licenseName?: string; @@ -33,23 +33,17 @@ export const LicenseModal: React.FunctionComponent = ({ onClose, }) => { const { notifications } = useStartServices(); - const [licenseText, setLicenseText] = useState(undefined); - useEffect(() => { - async function fetchData() { - try { - const { data } = await sendGetFileByPath(licensePath); - setLicenseText(data || ''); - } catch (err) { - notifications.toasts.addError(err, { - title: i18n.translate('xpack.fleet.epm.errorLoadingLicense', { - defaultMessage: 'Error loading license information', - }), - }); - } - } - fetchData(); - }, [licensePath, notifications]); + const { data: licenseText, error: licenseError } = useGetFileByPathQuery(licensePath); + + if (licenseError) { + notifications.toasts.addError(licenseError, { + title: i18n.translate('xpack.fleet.epm.errorLoadingLicense', { + defaultMessage: 'Error loading license information', + }), + }); + } + return ( diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/policies/package_policies.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/policies/package_policies.tsx index 3399f98515f57..647bb3715dcb0 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/policies/package_policies.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/policies/package_policies.tsx @@ -99,6 +99,7 @@ export const PackagePoliciesPage = ({ name, version }: PackagePoliciesPanelProps const getPackageInstallStatus = useGetPackageInstallStatus(); const packageInstallStatus = getPackageInstallStatus(name); const { pagination, pageSizeOptions, setPagination } = useUrlPagination(); + const { data, isLoading, diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/settings.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/settings.tsx index b990f6994430a..29e3ea7c95c81 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/settings.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/settings.tsx @@ -5,7 +5,7 @@ * 2.0. */ -import React, { memo, useCallback, useEffect, useMemo, useState } from 'react'; +import React, { memo, useCallback, useMemo, useState } from 'react'; import styled from 'styled-components'; import { FormattedMessage } from '@kbn/i18n-react'; import semverLt from 'semver/functions/lt'; @@ -25,15 +25,15 @@ import { i18n } from '@kbn/i18n'; import type { Observable } from 'rxjs'; import type { CoreTheme } from '@kbn/core/public'; -import type { PackageInfo, UpgradePackagePolicyDryRunResponse } from '../../../../../types'; +import type { PackageInfo } from '../../../../../types'; import { InstallStatus } from '../../../../../types'; import { - useGetPackagePolicies, + useGetPackagePoliciesQuery, useGetPackageInstallStatus, useLink, - sendUpgradePackagePolicyDryRun, - sendUpdatePackage, useStartServices, + useUpgradePackagePolicyDryRunQuery, + useUpdatePackageMutation, } from '../../../../../hooks'; import { PACKAGE_POLICY_SAVED_OBJECT_TYPE, @@ -100,15 +100,30 @@ interface Props { export const SettingsPage: React.FC = memo(({ packageInfo, theme$ }: Props) => { const { name, title, latestVersion, version, keepPoliciesUpToDate } = packageInfo; - const [dryRunData, setDryRunData] = useState(); const [isUpgradingPackagePolicies, setIsUpgradingPackagePolicies] = useState(false); const getPackageInstallStatus = useGetPackageInstallStatus(); - const { data: packagePoliciesData } = useGetPackagePolicies({ + + const { data: packagePoliciesData } = useGetPackagePoliciesQuery({ perPage: SO_SEARCH_LIMIT, page: 1, kuery: `${PACKAGE_POLICY_SAVED_OBJECT_TYPE}.package.name:${name}`, }); + const packagePolicyIds = useMemo( + () => packagePoliciesData?.items.map(({ id }) => id), + [packagePoliciesData] + ); + + const { data: dryRunData } = useUpgradePackagePolicyDryRunQuery( + packagePolicyIds ?? [], + latestVersion, + { + enabled: packagePolicyIds && packagePolicyIds.length > 0, + } + ); + + const updatePackageMutation = useUpdatePackageMutation(); + const { notifications } = useStartServices(); const shouldShowKeepPoliciesUpToDateSwitch = useMemo(() => { @@ -124,72 +139,60 @@ export const SettingsPage: React.FC = memo(({ packageInfo, theme$ }: Prop ); const handleKeepPoliciesUpToDateSwitchChange = useCallback(() => { - const saveKeepPoliciesUpToDate = async () => { - try { - setKeepPoliciesUpToDateSwitchValue((prev) => !prev); + setKeepPoliciesUpToDateSwitchValue((prev) => !prev); - await sendUpdatePackage(packageInfo.name, packageInfo.version, { + updatePackageMutation.mutate( + { + pkgName: packageInfo.name, + pkgVersion: packageInfo.version, + body: { keepPoliciesUpToDate: !keepPoliciesUpToDateSwitchValue, - }); - - notifications.toasts.addSuccess({ - title: i18n.translate('xpack.fleet.integrations.integrationSaved', { - defaultMessage: 'Integration settings saved', - }), - text: !keepPoliciesUpToDateSwitchValue - ? i18n.translate('xpack.fleet.integrations.keepPoliciesUpToDateEnabledSuccess', { - defaultMessage: - 'Fleet will automatically keep integration policies up to date for {title}', - values: { title }, - }) - : i18n.translate('xpack.fleet.integrations.keepPoliciesUpToDateDisabledSuccess', { - defaultMessage: - 'Fleet will not automatically keep integration policies up to date for {title}', - values: { title }, - }), - }); - } catch (error) { - notifications.toasts.addError(error, { - title: i18n.translate('xpack.fleet.integrations.integrationSavedError', { - defaultMessage: 'Error saving integration settings', - }), - toastMessage: i18n.translate('xpack.fleet.integrations.keepPoliciesUpToDateError', { - defaultMessage: 'Error saving integration settings for {title}', - values: { title }, - }), - }); + }, + }, + { + onSuccess: () => { + notifications.toasts.addSuccess({ + title: i18n.translate('xpack.fleet.integrations.integrationSaved', { + defaultMessage: 'Integration settings saved', + }), + text: !keepPoliciesUpToDateSwitchValue + ? i18n.translate('xpack.fleet.integrations.keepPoliciesUpToDateEnabledSuccess', { + defaultMessage: + 'Fleet will automatically keep integration policies up to date for {title}', + values: { title }, + }) + : i18n.translate('xpack.fleet.integrations.keepPoliciesUpToDateDisabledSuccess', { + defaultMessage: + 'Fleet will not automatically keep integration policies up to date for {title}', + values: { title }, + }), + }); + }, + onError: (error) => { + notifications.toasts.addError(error, { + title: i18n.translate('xpack.fleet.integrations.integrationSavedError', { + defaultMessage: 'Error saving integration settings', + }), + toastMessage: i18n.translate('xpack.fleet.integrations.keepPoliciesUpToDateError', { + defaultMessage: 'Error saving integration settings for {title}', + values: { title }, + }), + }); + }, } - }; - - saveKeepPoliciesUpToDate(); + ); }, [ keepPoliciesUpToDateSwitchValue, notifications.toasts, packageInfo.name, packageInfo.version, title, + updatePackageMutation, ]); const { status: installationStatus, version: installedVersion } = getPackageInstallStatus(name); const packageHasUsages = !!packagePoliciesData?.total; - const packagePolicyIds = useMemo( - () => packagePoliciesData?.items.map(({ id }) => id), - [packagePoliciesData] - ); - - useEffect(() => { - const fetchDryRunData = async () => { - if (packagePolicyIds && packagePolicyIds.length) { - const { data } = await sendUpgradePackagePolicyDryRun(packagePolicyIds, latestVersion); - - setDryRunData(data); - } - }; - - fetchDryRunData(); - }, [latestVersion, packagePolicyIds]); - const updateAvailable = installedVersion && semverLt(installedVersion, latestVersion) ? true : false; diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/update_button.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/update_button.tsx index 526c50aca1b96..800e77d687378 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/update_button.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/update_button.tsx @@ -5,7 +5,7 @@ * 2.0. */ -import React, { useCallback, useEffect, useMemo, useState } from 'react'; +import React, { useCallback, useMemo, useState } from 'react'; import { useHistory } from 'react-router-dom'; import { i18n } from '@kbn/i18n'; import { FormattedMessage } from '@kbn/i18n-react'; @@ -24,7 +24,6 @@ import type { CoreTheme } from '@kbn/core/public'; import { toMountPoint } from '@kbn/kibana-react-plugin/public'; import type { - GetAgentPoliciesResponse, PackageInfo, UpgradePackagePolicyDryRunResponse, PackagePolicy, @@ -32,13 +31,13 @@ import type { import { InstallStatus } from '../../../../../types'; import { AGENT_POLICY_SAVED_OBJECT_TYPE, SO_SEARCH_LIMIT } from '../../../../../constants'; import { - sendGetAgentPolicies, useInstallPackage, useGetPackageInstallStatus, - sendUpgradePackagePolicy, useStartServices, useAuthz, useLink, + useUpgradePackagePoliciesMutation, + useGetAgentPoliciesQuery, } from '../../../../../hooks'; interface UpdateButtonProps extends Pick { @@ -92,26 +91,17 @@ export const UpdateButton: React.FunctionComponent = ({ const [isUpdateModalVisible, setIsUpdateModalVisible] = useState(false); const [upgradePackagePolicies, setUpgradePackagePolicies] = useState(true); - const [agentPolicyData, setAgentPolicyData] = useState(); - - useEffect(() => { - const fetchAgentPolicyData = async () => { - if (packagePolicyIds && packagePolicyIds.length > 0) { - const { data } = await sendGetAgentPolicies({ - perPage: SO_SEARCH_LIMIT, - page: 1, - // Fetch all agent policies that include one of the eligible package policies - kuery: `${AGENT_POLICY_SAVED_OBJECT_TYPE}.package_policies:${packagePolicyIds - .map((id) => `"${id}"`) - .join(' or ')}`, - }); - - setAgentPolicyData(data); - } - }; - fetchAgentPolicyData(); - }, [packagePolicyIds]); + const { data: agentPolicyData } = useGetAgentPoliciesQuery({ + perPage: SO_SEARCH_LIMIT, + page: 1, + // Fetch all agent policies that include one of the eligible package policies + kuery: packagePolicyIds.length + ? `${AGENT_POLICY_SAVED_OBJECT_TYPE}.package_policies:${packagePolicyIds + .map((id) => `"${id}"`) + .join(' or ')}` + : '', + }); const packagePolicyCount = useMemo(() => packagePolicyIds.length, [packagePolicyIds]); @@ -164,6 +154,8 @@ export const UpdateButton: React.FunctionComponent = ({ await installPackage({ name, version, title, fromUpdate: true }); }, [installPackage, name, title, version]); + const upgradePackagePoliciesMutation = useUpgradePackagePoliciesMutation(); + const handleClickUpgradePolicies = useCallback(async () => { if (isUpgradingPackagePolicies) { return; @@ -174,47 +166,51 @@ export const UpdateButton: React.FunctionComponent = ({ await installPackage({ name, version, title }); - await sendUpgradePackagePolicy( - // Only upgrade policies that don't have conflicts - packagePolicyIds.filter( - (id) => !dryRunData?.find((dryRunRecord) => dryRunRecord.diff?.[0].id === id)?.hasErrors - ) - ); - - setIsUpgradingPackagePolicies(false); - - notifications.toasts.addSuccess({ - title: toMountPoint( - , - { theme$ } - ), - text: toMountPoint( - , - { theme$ } - ), - }); + upgradePackagePoliciesMutation.mutate( + { + // Only upgrade policies that don't have conflicts + packagePolicyIds: packagePolicyIds.filter( + (id) => !dryRunData?.find((dryRunRecord) => dryRunRecord.diff?.[0].id === id)?.hasErrors + ), + }, + { + onSuccess: () => { + notifications.toasts.addSuccess({ + title: toMountPoint( + , + { theme$ } + ), + text: toMountPoint( + , + { theme$ } + ), + }); - navigateToNewSettingsPage(); + navigateToNewSettingsPage(); + }, + } + ); }, [ - dryRunData, - installPackage, isUpgradingPackagePolicies, - name, - navigateToNewSettingsPage, - notifications.toasts, - packagePolicyIds, setIsUpgradingPackagePolicies, - title, + installPackage, + name, version, + title, + upgradePackagePoliciesMutation, + packagePolicyIds, + dryRunData, + notifications.toasts, theme$, + navigateToNewSettingsPage, ]); const updateModal = ( diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/home/hooks/use_available_packages.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/home/hooks/use_available_packages.tsx index b8d54b45759de..f11d82a9e20c3 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/home/hooks/use_available_packages.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/home/hooks/use_available_packages.tsx @@ -11,7 +11,7 @@ import { uniq, xorBy } from 'lodash'; import type { CustomIntegration } from '@kbn/custom-integrations-plugin/common'; import type { IntegrationPreferenceType } from '../../../components/integration_preference'; -import { usePackages, useCategories } from '../../../../../hooks'; +import { useGetPackagesQuery, useGetCategoriesQuery } from '../../../../../hooks'; import { useGetAppendCustomIntegrations, useGetReplacementCustomIntegrations, @@ -130,7 +130,7 @@ export const useAvailablePackages = () => { data: eprPackages, isLoading: isLoadingAllPackages, error: eprPackageLoadingError, - } = usePackages(prereleaseIntegrationsEnabled); + } = useGetPackagesQuery({ prerelease: prereleaseIntegrationsEnabled }); // Remove Kubernetes package granularity if (eprPackages?.items) { @@ -185,7 +185,7 @@ export const useAvailablePackages = () => { data: eprCategoriesRes, isLoading: isLoadingCategories, error: eprCategoryLoadingError, - } = useCategories(prereleaseIntegrationsEnabled); + } = useGetCategoriesQuery({ prerelease: prereleaseIntegrationsEnabled }); const eprCategories = useMemo(() => eprCategoriesRes?.items || [], [eprCategoriesRes]); // Subcategories diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/home/index.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/home/index.tsx index d69fe175f0961..bbe61f2910210 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/home/index.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/home/index.tsx @@ -5,7 +5,7 @@ * 2.0. */ -import React, { useMemo, useState } from 'react'; +import React, { useState } from 'react'; import { Switch, Route } from 'react-router-dom'; import type { CustomIntegration } from '@kbn/custom-integrations-plugin/common'; @@ -26,7 +26,7 @@ import type { IntegrationCardReleaseLabel, } from '../../../../../../../common/types/models'; -import { useGetPackages } from '../../../../hooks'; +import { useGetPackagesQuery } from '../../../../hooks'; import type { CategoryFacet, ExtendedIntegrationCategory } from './category_facets'; @@ -115,14 +115,12 @@ export const EPMHomePage: React.FC = () => { const [prereleaseEnabled, setPrereleaseEnabled] = useState(false); // loading packages to find installed ones - const { data: allPackages, isLoading } = useGetPackages({ + const { data: allPackages, isLoading } = useGetPackagesQuery({ prerelease: prereleaseEnabled, }); - const installedPackages = useMemo( - () => - (allPackages?.response || []).filter((pkg) => pkg.status === installationStatuses.Installed), - [allPackages?.response] + const installedPackages = (allPackages?.items || []).filter( + (pkg) => pkg.status === installationStatuses.Installed ); const unverifiedPackageCount = installedPackages.filter( diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/policy/index.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/policy/index.tsx index e78a2954a86d6..8eeb8622a56a7 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/policy/index.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/policy/index.tsx @@ -10,17 +10,17 @@ import { useRouteMatch } from 'react-router-dom'; // TODO: Needs to be moved import { EditPackagePolicyForm } from '../../../../../fleet/sections/agent_policy/edit_package_policy_page'; -import { useGetOnePackagePolicy, useUIExtension } from '../../../../hooks'; +import { useGetOnePackagePolicyQuery, useUIExtension } from '../../../../hooks'; export const Policy = memo(() => { const { params: { packagePolicyId }, } = useRouteMatch<{ packagePolicyId: string }>(); - const packagePolicy = useGetOnePackagePolicy(packagePolicyId); + const { data: packagePolicyData } = useGetOnePackagePolicyQuery(packagePolicyId); const extensionView = useUIExtension( - packagePolicy.data?.item?.package?.name ?? '', + packagePolicyData?.item?.package?.name ?? '', 'package-policy-edit' ); diff --git a/x-pack/plugins/fleet/public/hooks/use_fleet_status.tsx b/x-pack/plugins/fleet/public/hooks/use_fleet_status.tsx index 29fa37f3b7270..95067a3158d25 100644 --- a/x-pack/plugins/fleet/public/hooks/use_fleet_status.tsx +++ b/x-pack/plugins/fleet/public/hooks/use_fleet_status.tsx @@ -44,6 +44,7 @@ export const FleetStatusProvider: React.FC = ({ children }) => { isReady: false, }); + // TODO: Refactor to use react-query const sendGetStatus = useCallback( async function sendGetStatus() { try { diff --git a/x-pack/plugins/fleet/public/hooks/use_package_installations.tsx b/x-pack/plugins/fleet/public/hooks/use_package_installations.tsx new file mode 100644 index 0000000000000..f41bb9660f758 --- /dev/null +++ b/x-pack/plugins/fleet/public/hooks/use_package_installations.tsx @@ -0,0 +1,95 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { useMemo } from 'react'; +import semverLt from 'semver/functions/lt'; + +import { installationStatuses } from '../../common/constants'; +import type { PackagePolicy } from '../types'; + +import { useGetPackagesQuery } from './use_request/epm'; +import { useGetAgentPoliciesQuery } from './use_request/agent_policy'; + +interface UpdatableIntegration { + currentVersion: string; + policiesToUpgrade: Array<{ + id: string; + name: string; + agentsCount: number; + pkgPolicyId: string; + pkgPolicyName: string; + pkgPolicyIntegrationVersion: string; + }>; +} + +export const usePackageInstallationsQuery = () => { + const { data: allPackages, isLoading: isLoadingPackages } = useGetPackagesQuery({ + prerelease: true, + }); + + const { data: agentPolicyData, isLoading: isLoadingPolicies } = useGetAgentPoliciesQuery({ + full: true, + }); + + const allInstalledPackages = useMemo( + () => (allPackages?.items || []).filter((pkg) => pkg.status === installationStatuses.Installed), + [allPackages?.items] + ); + + const updatablePackages = useMemo( + () => + allInstalledPackages.filter( + (item) => + 'savedObject' in item && semverLt(item.savedObject.attributes.version, item.version) + ), + [allInstalledPackages] + ); + + const updatableIntegrations = useMemo>( + () => + (agentPolicyData?.items || []).reduce((result, policy) => { + policy.package_policies?.forEach((pkgPolicy: PackagePolicy) => { + if (!pkgPolicy.package) return false; + const { name, version } = pkgPolicy.package; + const installedPackage = allInstalledPackages.find( + (installedPkg) => + 'savedObject' in installedPkg && installedPkg.savedObject.attributes.name === name + ); + if ( + installedPackage && + 'savedObject' in installedPackage && + semverLt(version, installedPackage.savedObject.attributes.version) + ) { + const packageData = result.get(name) ?? { + currentVersion: installedPackage.savedObject.attributes.version, + policiesToUpgrade: [], + }; + packageData.policiesToUpgrade.push({ + id: policy.id, + name: policy.name, + agentsCount: policy.agents ?? 0, + pkgPolicyId: pkgPolicy.id, + pkgPolicyName: pkgPolicy.name, + pkgPolicyIntegrationVersion: version, + }); + result.set(name, packageData); + } + }); + return result; + }, new Map()), + [allInstalledPackages, agentPolicyData] + ); + + return { + allPackages, + allInstalledPackages, + updatablePackages, + updatableIntegrations, + isLoadingPackages, + isLoadingPolicies, + }; +}; diff --git a/x-pack/plugins/fleet/public/hooks/use_request/agent_policy.ts b/x-pack/plugins/fleet/public/hooks/use_request/agent_policy.ts index 248fb60f5bf70..39372fcc5c508 100644 --- a/x-pack/plugins/fleet/public/hooks/use_request/agent_policy.ts +++ b/x-pack/plugins/fleet/public/hooks/use_request/agent_policy.ts @@ -4,6 +4,7 @@ * 2.0; you may not use this file except in compliance with the Elastic License * 2.0. */ +import { useQuery } from '@tanstack/react-query'; import { agentPolicyRouteService } from '../../services'; @@ -22,8 +23,8 @@ import type { DeleteAgentPolicyResponse, } from '../../types'; -import { useRequest, sendRequest, useConditionalRequest } from './use_request'; -import type { SendConditionalRequestConfig } from './use_request'; +import { useRequest, sendRequest, useConditionalRequest, sendRequestForRq } from './use_request'; +import type { SendConditionalRequestConfig, RequestError } from './use_request'; export const useGetAgentPolicies = (query?: GetAgentPoliciesRequest['query']) => { return useRequest({ @@ -33,6 +34,16 @@ export const useGetAgentPolicies = (query?: GetAgentPoliciesRequest['query']) => }); }; +export const useGetAgentPoliciesQuery = (query?: GetAgentPoliciesRequest['query']) => { + return useQuery(['agentPolicies', query], () => + sendRequestForRq({ + path: agentPolicyRouteService.getListPath(), + method: 'get', + query, + }) + ); +}; + export const sendGetAgentPolicies = (query?: GetAgentPoliciesRequest['query']) => { return sendRequest({ path: agentPolicyRouteService.getListPath(), diff --git a/x-pack/plugins/fleet/public/hooks/use_request/agents.ts b/x-pack/plugins/fleet/public/hooks/use_request/agents.ts index 41e82bdf69015..ca53345bb5799 100644 --- a/x-pack/plugins/fleet/public/hooks/use_request/agents.ts +++ b/x-pack/plugins/fleet/public/hooks/use_request/agents.ts @@ -4,6 +4,7 @@ * 2.0; you may not use this file except in compliance with the Elastic License * 2.0. */ +import { useQuery } from '@tanstack/react-query'; import type { GetActionStatusResponse, @@ -72,6 +73,13 @@ export function useGetAgents(query: GetAgentsRequest['query'], options?: Request }); } +export function useGetAgentsQuery( + query: GetAgentsRequest['query'], + options: Partial<{ enabled: boolean }> = {} +) { + return useQuery(['agents', query], () => sendGetAgents(query), { enabled: options.enabled }); +} + export function sendGetAgents(query: GetAgentsRequest['query'], options?: RequestOptions) { return sendRequest({ method: 'get', diff --git a/x-pack/plugins/fleet/public/hooks/use_request/app.ts b/x-pack/plugins/fleet/public/hooks/use_request/app.ts index 25c7a9cf1f046..5236356180d83 100644 --- a/x-pack/plugins/fleet/public/hooks/use_request/app.ts +++ b/x-pack/plugins/fleet/public/hooks/use_request/app.ts @@ -5,10 +5,12 @@ * 2.0. */ +import { useQuery } from '@tanstack/react-query'; + import { appRoutesService } from '../../services'; import type { CheckPermissionsResponse, GenerateServiceTokenResponse } from '../../types'; -import { sendRequest, useRequest } from './use_request'; +import { sendRequest, sendRequestForRq, useRequest } from './use_request'; export const sendGetPermissionsCheck = (fleetServerSetup?: boolean) => { return sendRequest({ @@ -25,6 +27,17 @@ export const sendGenerateServiceToken = () => { }); }; +export const usePermissionCheckQuery = () => { + return useQuery( + ['permissionsCheck'], + () => + sendRequestForRq({ + path: appRoutesService.getCheckPermissionsPath(), + method: 'get', + }) + ); +}; + export const usePermissionCheck = () => { return useRequest({ path: appRoutesService.getCheckPermissionsPath(), diff --git a/x-pack/plugins/fleet/public/hooks/use_request/epm.ts b/x-pack/plugins/fleet/public/hooks/use_request/epm.ts index f1a248c44c07b..dc3b5d1048e7f 100644 --- a/x-pack/plugins/fleet/public/hooks/use_request/epm.ts +++ b/x-pack/plugins/fleet/public/hooks/use_request/epm.ts @@ -6,8 +6,11 @@ */ import useAsync from 'react-use/lib/useAsync'; +import { useMutation, useQuery } from '@tanstack/react-query'; -import { useEffect, useState } from 'react'; +import { useState } from 'react'; + +import type { SendRequestResponse } from '@kbn/es-ui-shared-plugin/public'; import { epmRouteService, isVerificationError } from '../../services'; import type { @@ -28,7 +31,8 @@ import { getCustomIntegrations } from '../../services/custom_integrations'; import { useConfirmOpenUnverified } from '../../applications/integrations/hooks/use_confirm_open_unverified'; -import { useRequest, sendRequest } from './use_request'; +import type { RequestError } from './use_request'; +import { useRequest, sendRequest, sendRequestForRq } from './use_request'; export function useGetAppendCustomIntegrations() { const customIntegrations = getCustomIntegrations(); @@ -40,13 +44,15 @@ export function useGetReplacementCustomIntegrations() { return useAsync(customIntegrations.getReplacementCustomIntegrations, []); } -export const useGetCategories = (query: GetCategoriesRequest['query'] = {}) => { - return useRequest({ - path: epmRouteService.getCategoriesPath(), - method: 'get', - query, - }); -}; +export function useGetCategoriesQuery(query: GetCategoriesRequest['query'] = {}) { + return useQuery(['categories', query], () => + sendRequestForRq({ + path: epmRouteService.getCategoriesPath(), + method: 'get', + query, + }) + ); +} export const sendGetCategories = (query: GetCategoriesRequest['query'] = {}) => { return sendRequest({ @@ -64,6 +70,16 @@ export const useGetPackages = (query: GetPackagesRequest['query'] = {}) => { }); }; +export const useGetPackagesQuery = (query: GetPackagesRequest['query']) => { + return useQuery(['get-packages', query], () => + sendRequestForRq({ + path: epmRouteService.getListPath(), + method: 'get', + query, + }) + ); +}; + export const sendGetPackages = (query: GetPackagesRequest['query'] = {}) => { return sendRequest({ path: epmRouteService.getListPath(), @@ -79,7 +95,7 @@ export const useGetLimitedPackages = () => { }); }; -export const useGetPackageInfoByKey = ( +export const useGetPackageInfoByKeyQuery = ( pkgName: string, pkgVersion?: string, options?: { @@ -92,30 +108,31 @@ export const useGetPackageInfoByKey = ( const [ignoreUnverifiedQueryParam, setIgnoreUnverifiedQueryParam] = useState( options?.ignoreUnverified ); - const res = useRequest({ - path: epmRouteService.getInfoPath(pkgName, pkgVersion), - method: 'get', - query: { - ...options, - ...(ignoreUnverifiedQueryParam && { ignoreUnverified: ignoreUnverifiedQueryParam }), - }, - }); - useEffect(() => { - const confirm = async () => { - const forceInstall = await confirmOpenUnverified(pkgName); + const response = useQuery([pkgName, pkgVersion, options], () => + sendRequestForRq({ + path: epmRouteService.getInfoPath(pkgName, pkgVersion), + method: 'get', + query: { + ...options, + ...(ignoreUnverifiedQueryParam && { ignoreUnverified: ignoreUnverifiedQueryParam }), + }, + }) + ); - if (forceInstall) { - setIgnoreUnverifiedQueryParam(true); - } - }; + const confirm = async () => { + const forceInstall = await confirmOpenUnverified(pkgName); - if (res.error && isVerificationError(res.error)) { - confirm(); + if (forceInstall) { + setIgnoreUnverifiedQueryParam(true); } - }, [res.error, pkgName, pkgVersion, confirmOpenUnverified]); + }; - return res; + if (response?.error && isVerificationError(response?.error)) { + confirm(); + } + + return response; }; export const useGetPackageStats = (pkgName: string) => { @@ -148,6 +165,12 @@ export const useGetFileByPath = (filePath: string) => { }); }; +export const useGetFileByPathQuery = (filePath: string) => { + return useQuery, RequestError>(['get-file', filePath], () => + sendRequest({ path: epmRouteService.getFilePath(filePath), method: 'get' }) + ); +}; + export const sendGetFileByPath = (filePath: string) => { return sendRequest({ path: epmRouteService.getFilePath(filePath), @@ -184,6 +207,23 @@ export const sendRemovePackage = (pkgName: string, pkgVersion: string, force: bo }); }; +interface UpdatePackageArgs { + pkgName: string; + pkgVersion: string; + body: UpdatePackageRequest['body']; +} + +export const useUpdatePackageMutation = () => { + return useMutation( + ({ pkgName, pkgVersion, body }: UpdatePackageArgs) => + sendRequestForRq({ + path: epmRouteService.getUpdatePath(pkgName, pkgVersion), + method: 'put', + body, + }) + ); +}; + export const sendUpdatePackage = ( pkgName: string, pkgVersion: string, diff --git a/x-pack/plugins/fleet/public/hooks/use_request/package_policy.ts b/x-pack/plugins/fleet/public/hooks/use_request/package_policy.ts index 3e029f6257d2e..4a573bb5e5883 100644 --- a/x-pack/plugins/fleet/public/hooks/use_request/package_policy.ts +++ b/x-pack/plugins/fleet/public/hooks/use_request/package_policy.ts @@ -5,6 +5,8 @@ * 2.0. */ +import { useMutation, useQuery } from '@tanstack/react-query'; + import { packagePolicyRouteService } from '../../services'; import type { CreatePackagePolicyRequest, @@ -22,7 +24,8 @@ import type { UpgradePackagePolicyResponse, } from '../../../common/types/rest_spec'; -import { sendRequest, useRequest } from './use_request'; +import type { RequestError } from './use_request'; +import { sendRequest, sendRequestForRq, useRequest } from './use_request'; export const sendCreatePackagePolicy = (body: CreatePackagePolicyRequest['body']) => { return sendRequest({ @@ -51,6 +54,16 @@ export const sendDeletePackagePolicy = (body: DeletePackagePoliciesRequest['body }); }; +export function useGetPackagePoliciesQuery(query: GetPackagePoliciesRequest['query']) { + return useQuery(['packagePolicies'], () => + sendRequestForRq({ + method: 'get', + path: packagePolicyRouteService.getListPath(), + query, + }) + ); +} + export function useGetPackagePolicies(query: GetPackagePoliciesRequest['query']) { return useRequest({ method: 'get', @@ -67,6 +80,17 @@ export const sendGetPackagePolicies = (query: GetPackagePoliciesRequest['query'] }); }; +export const useGetOnePackagePolicyQuery = (packagePolicyId: string) => { + return useQuery( + ['packagePolicy', packagePolicyId], + () => + sendRequestForRq({ + method: 'get', + path: packagePolicyRouteService.getInfoPath(packagePolicyId), + }) + ); +}; + export const useGetOnePackagePolicy = (packagePolicyId: string) => { return useRequest({ path: packagePolicyRouteService.getInfoPath(packagePolicyId), @@ -81,6 +105,31 @@ export const sendGetOnePackagePolicy = (packagePolicyId: string) => { }); }; +export function useUpgradePackagePolicyDryRunQuery( + packagePolicyIds: string[], + packageVersion?: string, + { enabled }: Partial<{ enabled: boolean }> = {} +) { + const body: { packagePolicyIds: string[]; packageVersion?: string } = { + packagePolicyIds, + }; + + if (packageVersion) { + body.packageVersion = packageVersion; + } + + return useQuery( + ['upgradePackagePolicyDryRun', packagePolicyIds, packageVersion], + () => + sendRequestForRq({ + path: packagePolicyRouteService.getDryRunPath(), + method: 'post', + body: JSON.stringify(body), + }), + { enabled } + ); +} + export function sendUpgradePackagePolicyDryRun( packagePolicyIds: string[], packageVersion?: string @@ -100,6 +149,22 @@ export function sendUpgradePackagePolicyDryRun( }); } +export function useUpgradePackagePoliciesMutation() { + return useMutation< + UpgradePackagePolicyDryRunResponse, + RequestError, + { packagePolicyIds: string[] } + >(({ packagePolicyIds }) => + sendRequestForRq({ + path: packagePolicyRouteService.getUpgradePath(), + method: 'post', + body: JSON.stringify({ + packagePolicyIds, + }), + }) + ); +} + export function sendUpgradePackagePolicy(packagePolicyIds: string[]) { return sendRequest({ path: packagePolicyRouteService.getUpgradePath(), diff --git a/x-pack/plugins/fleet/public/hooks/use_request/settings.ts b/x-pack/plugins/fleet/public/hooks/use_request/settings.ts index fdd6e87bdc02f..41131a32593de 100644 --- a/x-pack/plugins/fleet/public/hooks/use_request/settings.ts +++ b/x-pack/plugins/fleet/public/hooks/use_request/settings.ts @@ -5,10 +5,22 @@ * 2.0. */ +import { useQuery } from '@tanstack/react-query'; + import { settingsRoutesService } from '../../services'; import type { PutSettingsResponse, PutSettingsRequest, GetSettingsResponse } from '../../types'; -import { sendRequest, useRequest } from './use_request'; +import type { RequestError } from './use_request'; +import { sendRequest, sendRequestForRq, useRequest } from './use_request'; + +export function useGetSettingsQuery() { + return useQuery(['settings'], () => + sendRequestForRq({ + method: 'get', + path: settingsRoutesService.getInfoPath(), + }) + ); +} export function useGetSettings() { return useRequest({ diff --git a/x-pack/plugins/fleet/public/hooks/use_request/use_request.ts b/x-pack/plugins/fleet/public/hooks/use_request/use_request.ts index 79afb6e2238da..9bd7d482e7e4a 100644 --- a/x-pack/plugins/fleet/public/hooks/use_request/use_request.ts +++ b/x-pack/plugins/fleet/public/hooks/use_request/use_request.ts @@ -42,6 +42,26 @@ export const sendRequest = ( return _sendRequest(httpClient, config); }; +// Sends requests with better ergonomics for React Query, e.g. throw error rather +// than resolving with an `error` property in the result. Also returns `data` directly +// as opposed to { data } in a response object. +export const sendRequestForRq = async ( + config: SendRequestConfig +): Promise => { + if (!httpClient) { + throw new Error('sendRequest has no http client set'); + } + + const response = await _sendRequest(httpClient, config); + + if (response.error) { + throw response.error; + } + + // Data can't be null so long as `_sendRequest` did not throw + return response.data!; +}; + export const useRequest = (config: UseRequestConfig) => { if (!httpClient) { throw new Error('sendRequest has no http client set'); From 84003d2a8b34d6e066d8551a670387b5dd97b55a Mon Sep 17 00:00:00 2001 From: Julia Bardi <90178898+juliaElastic@users.noreply.github.com> Date: Wed, 8 Feb 2023 16:25:27 +0100 Subject: [PATCH 28/60] [Fleet] disable reinstall with tooltip for uploaded packages (#150535) ## Summary Disable Reinstall button and added tooltip to prevent clicking Reinstall for uploaded packages. Related to https://github.com/elastic/kibana/issues/148599#issuecomment-1420869104 image ### Checklist - [x] Any text added follows [EUI's writing guidelines](https://elastic.github.io/eui/#/guidelines/writing), uses sentence case text and includes [i18n support](https://github.com/elastic/kibana/blob/main/packages/kbn-i18n/README.md) --- .../detail/settings/reinstall_button.tsx | 69 +++++++++++++------ .../epm/screens/detail/settings/settings.tsx | 9 ++- 2 files changed, 55 insertions(+), 23 deletions(-) diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/reinstall_button.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/reinstall_button.tsx index c14e4eeb2edf6..5a63208d55e9c 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/reinstall_button.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/reinstall_button.tsx @@ -5,7 +5,7 @@ * 2.0. */ -import { EuiButton } from '@elastic/eui'; +import { EuiButton, EuiToolTip } from '@elastic/eui'; import React, { Fragment, useCallback } from 'react'; import { FormattedMessage } from '@kbn/i18n-react'; @@ -13,41 +13,66 @@ import type { PackageInfo } from '../../../../../types'; import { InstallStatus } from '../../../../../types'; import { useAuthz, useGetPackageInstallStatus, useInstallPackage } from '../../../../../hooks'; -type ReinstallationButtonProps = Pick; +type ReinstallationButtonProps = Pick & { + installSource: string; +}; export function ReinstallButton(props: ReinstallationButtonProps) { - const { name, title, version } = props; + const { name, title, version, installSource } = props; const canInstallPackages = useAuthz().integrations.installPackages; const installPackage = useInstallPackage(); const getPackageInstallStatus = useGetPackageInstallStatus(); const { status: installationStatus } = getPackageInstallStatus(name); const isReinstalling = installationStatus === InstallStatus.reinstalling; + const isUploadedPackage = installSource === 'upload'; const handleClickReinstall = useCallback(() => { installPackage({ name, version, title, isReinstall: true }); }, [installPackage, name, title, version]); + const reinstallButton = ( + + {isReinstalling ? ( + + ) : ( + + )} + + ); + return canInstallPackages ? ( - - {isReinstalling ? ( - - ) : ( - - )} - + {isUploadedPackage ? ( + + } + > + {reinstallButton} + + ) : ( + reinstallButton + )} ) : null; } diff --git a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/settings.tsx b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/settings.tsx index 29e3ea7c95c81..966b0419285ec 100644 --- a/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/settings.tsx +++ b/x-pack/plugins/fleet/public/applications/integrations/sections/epm/screens/detail/settings/settings.tsx @@ -410,7 +410,14 @@ export const SettingsPage: React.FC = memo(({ packageInfo, theme$ }: Prop
- +
From f2943a369afc62aab59d2d852aff2bde6713d5d5 Mon Sep 17 00:00:00 2001 From: Elastic Machine Date: Thu, 9 Feb 2023 01:55:43 +1030 Subject: [PATCH 29/60] [main] Sync bundled packages with Package Storage (#150523) Automated by https://internal-ci.elastic.co/job/package_storage/job/sync-bundled-packages-job/job/main/1704/ Co-authored-by: apmmachine --- fleet_packages.json | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/fleet_packages.json b/fleet_packages.json index fcb628f52610f..109fa8e5da7dc 100644 --- a/fleet_packages.json +++ b/fleet_packages.json @@ -25,7 +25,7 @@ }, { "name": "elastic_agent", - "version": "1.5.0" + "version": "1.5.1" }, { "name": "endpoint", From f935d066f6b07b20f5bf76636a3d09dd70e06e32 Mon Sep 17 00:00:00 2001 From: Katerina Patticha Date: Wed, 8 Feb 2023 16:37:13 +0100 Subject: [PATCH 30/60] [APM] Fix sorting by transaction name (#150547) Closes https://github.com/elastic/kibana/issues/99345 https://user-images.githubusercontent.com/3369346/217521154-012aca9a-5857-463c-8e56-bee44c2b002b.mov --- .../public/components/app/top_traces_overview/trace_list.tsx | 2 +- 1 file changed, 1 insertion(+), 1 deletion(-) diff --git a/x-pack/plugins/apm/public/components/app/top_traces_overview/trace_list.tsx b/x-pack/plugins/apm/public/components/app/top_traces_overview/trace_list.tsx index 76ec4720fa060..32044af7219b0 100644 --- a/x-pack/plugins/apm/public/components/app/top_traces_overview/trace_list.tsx +++ b/x-pack/plugins/apm/public/components/app/top_traces_overview/trace_list.tsx @@ -45,7 +45,7 @@ export function getTraceListColumns({ }): Array> { return [ { - field: 'name', + field: 'transactionName', name: i18n.translate('xpack.apm.tracesTable.nameColumnLabel', { defaultMessage: 'Name', }), From 5f43b49df31f1318f4bcee7dc1beb31b80db190e Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Cau=C3=AA=20Marcondes?= <55978943+cauemarcondes@users.noreply.github.com> Date: Wed, 8 Feb 2023 11:26:10 -0500 Subject: [PATCH 31/60] [APM]Latency threshold rule's threshold context variable should use milliseconds instead of microseconds (#150234) closes https://github.com/elastic/kibana/issues/125323 I couldn't test it yet, since alerts are firing with any context variable. I'll hold on to merge this until I can fully test it. --------- Co-authored-by: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> --- .../register_transaction_duration_rule_type.test.ts | 2 +- .../register_transaction_duration_rule_type.ts | 4 ++-- 2 files changed, 3 insertions(+), 3 deletions(-) diff --git a/x-pack/plugins/apm/server/routes/alerts/rule_types/transaction_duration/register_transaction_duration_rule_type.test.ts b/x-pack/plugins/apm/server/routes/alerts/rule_types/transaction_duration/register_transaction_duration_rule_type.test.ts index 1066eb8a987d8..cebf71f1bad97 100644 --- a/x-pack/plugins/apm/server/routes/alerts/rule_types/transaction_duration/register_transaction_duration_rule_type.test.ts +++ b/x-pack/plugins/apm/server/routes/alerts/rule_types/transaction_duration/register_transaction_duration_rule_type.test.ts @@ -65,7 +65,7 @@ describe('registerTransactionDurationRuleType', () => { 'Avg. latency is 5,500 ms in the last 5 mins for opbeans-java. Alert when > 3,000 ms.', transactionType: 'request', serviceName: 'opbeans-java', - threshold: 3000000, + threshold: 3000, triggerValue: '5,500 ms', viewInAppUrl: 'http://localhost:5601/eyr/app/apm/services/opbeans-java?transactionType=request&environment=ENVIRONMENT_ALL', diff --git a/x-pack/plugins/apm/server/routes/alerts/rule_types/transaction_duration/register_transaction_duration_rule_type.ts b/x-pack/plugins/apm/server/routes/alerts/rule_types/transaction_duration/register_transaction_duration_rule_type.ts index 75e1aef357088..803945568494b 100644 --- a/x-pack/plugins/apm/server/routes/alerts/rule_types/transaction_duration/register_transaction_duration_rule_type.ts +++ b/x-pack/plugins/apm/server/routes/alerts/rule_types/transaction_duration/register_transaction_duration_rule_type.ts @@ -281,7 +281,7 @@ export function registerTransactionDurationRuleType({ [TRANSACTION_TYPE]: transactionType, [PROCESSOR_EVENT]: ProcessorEvent.transaction, [ALERT_EVALUATION_VALUE]: transactionDuration, - [ALERT_EVALUATION_THRESHOLD]: thresholdMicroseconds, + [ALERT_EVALUATION_THRESHOLD]: ruleParams.threshold, [ALERT_REASON]: reason, ...sourceFields, }, @@ -292,7 +292,7 @@ export function registerTransactionDurationRuleType({ interval: `${ruleParams.windowSize}${ruleParams.windowUnit}`, reason, serviceName, - threshold: thresholdMicroseconds, + threshold: ruleParams.threshold, transactionType, triggerValue: transactionDurationFormatted, viewInAppUrl, From 903173dff13bb2ac17f386a73ef97bb8812c1043 Mon Sep 17 00:00:00 2001 From: Lisa Cawley Date: Wed, 8 Feb 2023 08:30:14 -0800 Subject: [PATCH 32/60] [DOCS] Add summary capabilities to the open API specification (#149998) --- .../rules/rule-apis-passthru.asciidoc | 86 ++++++++++- .../alerting/docs/openapi/bundled.json | 143 +++++++++++++----- .../alerting/docs/openapi/bundled.yaml | 130 +++++++++++----- .../examples/create_rule_request.yaml | 4 +- .../examples/create_rule_response.yaml | 5 + .../examples/update_rule_request.yaml | 27 ++-- .../examples/update_rule_response.yaml | 26 +++- .../openapi/components/schemas/actions.yaml | 21 +++ .../schemas/create_rule_request.yaml | 1 - .../schemas/rule_response_properties.yaml | 4 +- .../schemas/update_rule_request.yaml | 1 - 11 files changed, 344 insertions(+), 104 deletions(-) diff --git a/docs/api-generated/rules/rule-apis-passthru.asciidoc b/docs/api-generated/rules/rule-apis-passthru.asciidoc index 0626e0e43a8bd..12515fba838ee 100644 --- a/docs/api-generated/rules/rule-apis-passthru.asciidoc +++ b/docs/api-generated/rules/rule-apis-passthru.asciidoc @@ -119,6 +119,7 @@ Any modifications made to this file will be overwritten. "muted_alert_ids" : [ "muted_alert_ids", "muted_alert_ids" ], "rule_type_id" : "monitoring_alert_cluster_health", "tags" : [ "tags", "tags" ], + "running" : true, "api_key_owner" : "elastic", "schedule" : { "interval" : "1m" @@ -141,12 +142,24 @@ Any modifications made to this file will be overwritten. "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" }, { "id" : "9dca3e00-74f5-11ed-9801-35303b735aef", "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" } ], "consumer" : "alerts" @@ -402,6 +415,7 @@ Any modifications made to this file will be overwritten. "muted_alert_ids" : [ "muted_alert_ids", "muted_alert_ids" ], "rule_type_id" : "monitoring_alert_cluster_health", "tags" : [ "tags", "tags" ], + "running" : true, "api_key_owner" : "elastic", "schedule" : { "interval" : "1m" @@ -424,12 +438,24 @@ Any modifications made to this file will be overwritten. "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" }, { "id" : "9dca3e00-74f5-11ed-9801-35303b735aef", "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" } ], "consumer" : "alerts" @@ -455,6 +481,7 @@ Any modifications made to this file will be overwritten. "muted_alert_ids" : [ "muted_alert_ids", "muted_alert_ids" ], "rule_type_id" : "monitoring_alert_cluster_health", "tags" : [ "tags", "tags" ], + "running" : true, "api_key_owner" : "elastic", "schedule" : { "interval" : "1m" @@ -477,12 +504,24 @@ Any modifications made to this file will be overwritten. "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" }, { "id" : "9dca3e00-74f5-11ed-9801-35303b735aef", "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" } ], "consumer" : "alerts" @@ -638,6 +677,7 @@ Any modifications made to this file will be overwritten. "muted_alert_ids" : [ "muted_alert_ids", "muted_alert_ids" ], "rule_type_id" : "monitoring_alert_cluster_health", "tags" : [ "tags", "tags" ], + "running" : true, "api_key_owner" : "elastic", "schedule" : { "interval" : "1m" @@ -660,12 +700,24 @@ Any modifications made to this file will be overwritten. "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" }, { "id" : "9dca3e00-74f5-11ed-9801-35303b735aef", "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" } ], "consumer" : "alerts" @@ -1983,6 +2035,7 @@ Any modifications made to this file will be overwritten. "muted_alert_ids" : [ "muted_alert_ids", "muted_alert_ids" ], "rule_type_id" : "monitoring_alert_cluster_health", "tags" : [ "tags", "tags" ], + "running" : true, "api_key_owner" : "elastic", "schedule" : { "interval" : "1m" @@ -2005,12 +2058,24 @@ Any modifications made to this file will be overwritten. "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" }, { "id" : "9dca3e00-74f5-11ed-9801-35303b735aef", "params" : { "key" : "" }, + "connector_type_id" : ".server-log", + "frequency" : { + "summary" : true, + "throttle" : "10m", + "notify_when" : "onActiveAlert" + }, "group" : "default" } ], "consumer" : "alerts" @@ -2049,6 +2114,7 @@ Any modifications made to this file will be overwritten.
  • Legacy_update_alert_request_properties_actions_inner -
  • Legacy_update_alert_request_properties_schedule -
  • actions_inner -
    • +
  • actions_inner_frequency -
  • alert_response_properties - Legacy alert response properties
  • alert_response_properties_executionStatus -
  • alert_response_properties_schedule -
    • @@ -2177,11 +2243,22 @@ Any modifications made to this file will be overwritten.

    actions_inner - Up

    -
    group (optional)
    String The group name for the actions. If you don't need to group actions, set to default.
    +
    connector_type_id (optional)
    String The type of connector. This property appears in responses but cannot be set in requests.
    +
    frequency (optional)
    actions_inner_frequency
    +
    group (optional)
    String The group name for the actions. If you don't need to group actions, set to default.
    id (optional)
    String The identifier for the connector saved object.
    params (optional)
    map[String, oas_any_type_not_mapped] The parameters for the action, which are sent to the connector. The params are handled as Mustache templates and passed a default set of context.
    +
    +

    actions_inner_frequency - Up

    +
    The parameters that affect how often actions are generated. NOTE: You cannot specify these parameters when notify_when or throttle are defined at the rule level.
    +
    +
    notify_when
    notify_when
    +
    summary
    Boolean Indicates whether the action is a summary.
    +
    throttle (optional)
    String The throttle interval, which defines how often an alert generates repeated actions. It is applicable only if notify_when is set to onThrottleInterval. It is specified in seconds, minutes, hours, or days.
    +
    +

    alert_response_properties - Legacy alert response properties Up

    @@ -2230,7 +2307,7 @@ Any modifications made to this file will be overwritten.
    consumer
    String The name of the application or feature that owns the rule. For example: alerts, apm, discover, infrastructure, logs, metrics, ml, monitoring, securitySolution, siem, stackAlerts, or uptime.
    enabled (optional)
    Boolean Indicates whether you want to run the rule on an interval basis after it is created.
    name
    String The name of the rule. While this name does not have to be unique, a distinctive name can help you identify a rule.
    -
    notify_when
    notify_when
    +
    notify_when (optional)
    notify_when
    params
    map[String, oas_any_type_not_mapped] The parameters for the rule.
    rule_type_id
    String The ID of the rule type that you want to call when the rule is scheduled to run. For example, .es-query, .index-threshold, logs.alert.document.count, monitoring_alert_cluster_health, siem.thresholdRule, or xpack.ml.anomaly_detection_alert.
    schedule
    schedule
    @@ -2537,9 +2614,10 @@ Any modifications made to this file will be overwritten.
    mute_all
    Boolean
    name
    String The name of the rule.
    next_run (optional)
    Date format: date-time
    -
    notify_when
    notify_when
    +
    notify_when (optional)
    notify_when
    params
    map[String, oas_any_type_not_mapped] The parameters for the rule.
    rule_type_id
    String The identifier for the type of rule. For example, .es-query, .index-threshold, logs.alert.document.count, monitoring_alert_cluster_health, siem.thresholdRule, or xpack.ml.anomaly_detection_alert.
    +
    running (optional)
    Boolean Indicates whether the rule is running.
    schedule
    schedule
    scheduled_task_id (optional)
    String
    tags
    array[String] The tags for the rule.
    @@ -2590,7 +2668,7 @@ Any modifications made to this file will be overwritten.
    actions (optional)
    array[actions_inner]
    name
    String The name of the rule.
    -
    notify_when
    notify_when
    +
    notify_when (optional)
    notify_when
    params
    map[String, oas_any_type_not_mapped] The parameters for the rule.
    schedule
    schedule
    tags (optional)
    array[String] The tags for the rule.
    diff --git a/x-pack/plugins/alerting/docs/openapi/bundled.json b/x-pack/plugins/alerting/docs/openapi/bundled.json index a245616abe461..e7fbc15c77c01 100644 --- a/x-pack/plugins/alerting/docs/openapi/bundled.json +++ b/x-pack/plugins/alerting/docs/openapi/bundled.json @@ -2500,6 +2500,23 @@ } }, "schemas": { + "notify_when": { + "type": "string", + "description": "Indicates how often alerts generate actions. Valid values include: `onActionGroupChange`: Actions run when the alert status changes; `onActiveAlert`: Actions run when the alert becomes active and at each check interval while the rule conditions are met; `onThrottleInterval`: Actions run when the alert becomes active and at the interval specified in the throttle property while the rule conditions are met.\n", + "enum": [ + "onActionGroupChange", + "onActiveAlert", + "onThrottleInterval" + ], + "example": "onActiveAlert" + }, + "throttle": { + "type": "string", + "description": "The throttle interval, which defines how often an alert generates repeated actions. It is applicable only if `notify_when` is set to `onThrottleInterval`. It is specified in seconds, minutes, hours, or days.", + "nullable": true, + "default": null, + "example": "10m" + }, "actions": { "type": "array", "default": [], @@ -2512,6 +2529,32 @@ "items": { "type": "object", "properties": { + "connector_type_id": { + "type": "string", + "description": "The type of connector. This property appears in responses but cannot be set in requests.", + "example": ".server-log", + "readOnly": true + }, + "frequency": { + "type": "object", + "description": "The parameters that affect how often actions are generated. NOTE: You cannot specify these parameters when `notify_when` or `throttle` are defined at the rule level.\n", + "required": [ + "notify_when", + "summary" + ], + "properties": { + "notify_when": { + "$ref": "#/components/schemas/notify_when" + }, + "summary": { + "type": "boolean", + "description": "Indicates whether the action is a summary." + }, + "throttle": { + "$ref": "#/components/schemas/throttle" + } + } + }, "group": { "type": "string", "description": "The group name for the actions. If you don't need to group actions, set to `default`.", @@ -2530,16 +2573,6 @@ } } }, - "notify_when": { - "type": "string", - "description": "Indicates how often alerts generate actions. Valid values include: `onActionGroupChange`: Actions run when the alert status changes; `onActiveAlert`: Actions run when the alert becomes active and at each check interval while the rule conditions are met; `onThrottleInterval`: Actions run when the alert becomes active and at the interval specified in the throttle property while the rule conditions are met.\n", - "enum": [ - "onActionGroupChange", - "onActiveAlert", - "onThrottleInterval" - ], - "example": "onActiveAlert" - }, "schedule": { "type": "object", "description": "The check interval, which specifies how frequently the rule conditions are checked. The interval is specified in seconds, minutes, hours, or days.", @@ -2558,13 +2591,6 @@ }, "default": [] }, - "throttle": { - "type": "string", - "description": "The throttle interval, which defines how often an alert generates repeated actions. It is applicable only if `notify_when` is set to `onThrottleInterval`. It is specified in seconds, minutes, hours, or days.", - "nullable": true, - "default": null, - "example": "10m" - }, "rule_response_properties": { "title": "Rule response properties", "type": "object", @@ -2580,7 +2606,6 @@ "mute_all", "muted_alert_ids", "name", - "notify_when", "params", "rule_type_id", "schedule", @@ -2714,6 +2739,10 @@ "description": "The identifier for the type of rule. For example, `.es-query`, `.index-threshold`, `logs.alert.document.count`, `monitoring_alert_cluster_health`, `siem.thresholdRule`, or `xpack.ml.anomaly_detection_alert`.\n", "example": "monitoring_alert_cluster_health" }, + "running": { + "type": "boolean", + "description": "Indicates whether the rule is running." + }, "schedule": { "$ref": "#/components/schemas/schedule" }, @@ -2792,7 +2821,6 @@ "type": "object", "required": [ "name", - "notify_when", "params", "schedule" ], @@ -2831,7 +2859,6 @@ "required": [ "consumer", "name", - "notify_when", "params", "rule_type_id", "schedule" @@ -3064,30 +3091,42 @@ "update_rule_request": { "summary": "Update an index threshold rule.", "value": { - "notify_when": "onActionGroupChange", + "actions": [ + { + "frequency": { + "summary": false, + "notify_when": "onActionGroupChange" + }, + "group": "threshold met", + "id": "96b668d0-a1b6-11ed-afdf-d39a49596974", + "params": { + "level": "info", + "message": "alert {{alertName}} is active for group {{context.group}}:\n\n- Value: {{context.value}}\n- Conditions Met: {{context.conditions}} over {{params.timeWindowSize}}{{params.timeWindowUnit}}\n- Timestamp: {{context.date}}" + } + } + ], "params": { + "aggField": "sheet.version", + "aggType": "avg", "index": [ ".test-index" ], - "timeField": "@timestamp", "groupBy": "top", - "aggType": "avg", - "timeWindowSize": 5, - "timeWindowUnit": "m", - "thresholdComparator": ">", + "termField": "name.keyword", + "termSize": 6, "threshold": [ 1000 ], - "aggField": "sheet.version", - "termField": "name.keyword", - "termSize": 6 + "thresholdComparator": ">", + "timeField": "@timestamp", + "timeWindowSize": 5, + "timeWindowUnit": "m" }, + "name": "new name", "schedule": { "interval": "1m" }, - "actions": [], "tags": [], - "name": "new name", "throttle": null } }, @@ -3100,8 +3139,9 @@ "name": "new name", "enabled": true, "throttle": null, + "running": false, "schedule": { - "interval": "1m" + "interval": "10m" }, "params": { "index": [ @@ -3125,17 +3165,31 @@ "updated_by": "elastic", "rule_type_id": ".index-threshold", "scheduled_task_id": "4c5eda00-e74f-11ec-b72f-5b18752ff9ea", - "created_at": "2022-12-12T22:43:20.578Z", - "updated_at": "2022-12-12T22:44:21.783Z", - "notify_when": "onActionGroupChange", + "created_at": "2023-01-31T23:03:33.127Z", + "updated_at": "2023-01-31T23:55:27.314Z", "mute_all": false, "muted_alert_ids": [], "execution_status": { "status": "ok", - "last_execution_date": "2022-12-12T22:43:21.723Z", - "last_duration": 125 + "last_execution_date": "2023-01-31T23:48:42.499Z", + "last_duration": 52 }, - "actions": [], + "actions": [ + { + "group": "threshold met", + "params": { + "level": "info", + "message": "alert {{alertName}} is active for group {{context.group}}:\n\n- Value: {{context.value}}\n- Conditions Met: {{context.conditions}} over {{params.timeWindowSize}}{{params.timeWindowUnit}}\n- Timestamp: {{context.date}" + }, + "id": "96b668d0-a1b6-11ed-afdf-d39a49596974", + "connector_type_id": ".server-log", + "frequency": { + "summary": false, + "throttle": null, + "notify_when": "onActionGroupChange" + } + } + ], "last_run": { "alerts_count": { "new": 0, @@ -3147,7 +3201,7 @@ "warning": null, "outcome": "succeeded" }, - "next_run": "2022-12-12T22:44:21.653Z" + "next_run": "2023-01-31T23:49:42.432Z" } }, "create_rule_request": { @@ -3156,6 +3210,10 @@ "actions": [ { "id": "dceeb5d0-6b41-11eb-802b-85b0c1bc8ba2", + "frequency": { + "notify_when": "onActionGroupChange", + "summary": false + }, "group": "threshold met", "params": { "level": "info", @@ -3165,7 +3223,6 @@ ], "consumer": "alerts", "name": "my rule", - "notify_when": "onActionGroupChange", "params": { "aggType": "avg", "termSize": 6, @@ -3199,6 +3256,11 @@ { "group": "threshold met", "id": "dceeb5d0-6b41-11eb-802b-85b0c1bc8ba2", + "frequency": { + "notify_when": "onActionGroupChange", + "summary": false, + "throttle": null + }, "params": { "level": "info", "message": "alert {{alertName}} is active for group {{context.group} :\n\n- Value: {{context.value}}\n- Conditions Met: {{context.conditions}} over {{params.timeWindowSize}}{{params.timeWindowUnit}}\n- Timestamp: {{context.date}}" @@ -3237,6 +3299,7 @@ "termField": "name.keyword" }, "rule_type_id": ".index-threshold", + "running": false, "schedule": { "interval": "1m" }, diff --git a/x-pack/plugins/alerting/docs/openapi/bundled.yaml b/x-pack/plugins/alerting/docs/openapi/bundled.yaml index ad2ea6a72f15a..a82f2156f3581 100644 --- a/x-pack/plugins/alerting/docs/openapi/bundled.yaml +++ b/x-pack/plugins/alerting/docs/openapi/bundled.yaml @@ -1583,6 +1583,21 @@ components: type: string example: ac4e6b90-6be7-11eb-ba0d-9b1c1f912d74 schemas: + notify_when: + type: string + description: | + Indicates how often alerts generate actions. Valid values include: `onActionGroupChange`: Actions run when the alert status changes; `onActiveAlert`: Actions run when the alert becomes active and at each check interval while the rule conditions are met; `onThrottleInterval`: Actions run when the alert becomes active and at the interval specified in the throttle property while the rule conditions are met. + enum: + - onActionGroupChange + - onActiveAlert + - onThrottleInterval + example: onActiveAlert + throttle: + type: string + description: The throttle interval, which defines how often an alert generates repeated actions. It is applicable only if `notify_when` is set to `onThrottleInterval`. It is specified in seconds, minutes, hours, or days. + nullable: true + default: null + example: 10m actions: type: array default: [] @@ -1594,6 +1609,26 @@ components: items: type: object properties: + connector_type_id: + type: string + description: The type of connector. This property appears in responses but cannot be set in requests. + example: .server-log + readOnly: true + frequency: + type: object + description: | + The parameters that affect how often actions are generated. NOTE: You cannot specify these parameters when `notify_when` or `throttle` are defined at the rule level. + required: + - notify_when + - summary + properties: + notify_when: + $ref: '#/components/schemas/notify_when' + summary: + type: boolean + description: Indicates whether the action is a summary. + throttle: + $ref: '#/components/schemas/throttle' group: type: string description: The group name for the actions. If you don't need to group actions, set to `default`. @@ -1606,15 +1641,6 @@ components: type: object description: The parameters for the action, which are sent to the connector. The `params` are handled as Mustache templates and passed a default set of context. additionalProperties: true - notify_when: - type: string - description: | - Indicates how often alerts generate actions. Valid values include: `onActionGroupChange`: Actions run when the alert status changes; `onActiveAlert`: Actions run when the alert becomes active and at each check interval while the rule conditions are met; `onThrottleInterval`: Actions run when the alert becomes active and at the interval specified in the throttle property while the rule conditions are met. - enum: - - onActionGroupChange - - onActiveAlert - - onThrottleInterval - example: onActiveAlert schedule: type: object description: The check interval, which specifies how frequently the rule conditions are checked. The interval is specified in seconds, minutes, hours, or days. @@ -1628,12 +1654,6 @@ components: items: type: string default: [] - throttle: - type: string - description: The throttle interval, which defines how often an alert generates repeated actions. It is applicable only if `notify_when` is set to `onThrottleInterval`. It is specified in seconds, minutes, hours, or days. - nullable: true - default: null - example: 10m rule_response_properties: title: Rule response properties type: object @@ -1649,7 +1669,6 @@ components: - mute_all - muted_alert_ids - name - - notify_when - params - rule_type_id - schedule @@ -1752,6 +1771,9 @@ components: description: | The identifier for the type of rule. For example, `.es-query`, `.index-threshold`, `logs.alert.document.count`, `monitoring_alert_cluster_health`, `siem.thresholdRule`, or `xpack.ml.anomaly_detection_alert`. example: monitoring_alert_cluster_health + running: + type: boolean + description: Indicates whether the rule is running. schedule: $ref: '#/components/schemas/schedule' scheduled_task_id: @@ -1808,7 +1830,6 @@ components: type: object required: - name - - notify_when - params - schedule properties: @@ -1837,7 +1858,6 @@ components: required: - consumer - name - - notify_when - params - rule_type_id - schedule @@ -2020,26 +2040,38 @@ components: update_rule_request: summary: Update an index threshold rule. value: - notify_when: onActionGroupChange + actions: + - frequency: + summary: false + notify_when: onActionGroupChange + group: threshold met + id: 96b668d0-a1b6-11ed-afdf-d39a49596974 + params: + level: info + message: |- + alert {{alertName}} is active for group {{context.group}}: + + - Value: {{context.value}} + - Conditions Met: {{context.conditions}} over {{params.timeWindowSize}}{{params.timeWindowUnit}} + - Timestamp: {{context.date}} params: + aggField: sheet.version + aggType: avg index: - .test-index - timeField: '@timestamp' groupBy: top - aggType: avg - timeWindowSize: 5 - timeWindowUnit: m - thresholdComparator: '>' - threshold: - - 1000 - aggField: sheet.version termField: name.keyword termSize: 6 + threshold: + - 1000 + thresholdComparator: '>' + timeField: '@timestamp' + timeWindowSize: 5 + timeWindowUnit: m + name: new name schedule: interval: 1m - actions: [] tags: [] - name: new name throttle: null update_rule_response: summary: The update rule API returns a JSON object that contains details about the rule. @@ -2050,8 +2082,9 @@ components: name: new name enabled: true throttle: null + running: false schedule: - interval: 1m + interval: 10m params: index: - .updated-index @@ -2071,16 +2104,30 @@ components: updated_by: elastic rule_type_id: .index-threshold scheduled_task_id: 4c5eda00-e74f-11ec-b72f-5b18752ff9ea - created_at: '2022-12-12T22:43:20.578Z' - updated_at: '2022-12-12T22:44:21.783Z' - notify_when: onActionGroupChange + created_at: '2023-01-31T23:03:33.127Z' + updated_at: '2023-01-31T23:55:27.314Z' mute_all: false muted_alert_ids: [] execution_status: status: ok - last_execution_date: '2022-12-12T22:43:21.723Z' - last_duration: 125 - actions: [] + last_execution_date: '2023-01-31T23:48:42.499Z' + last_duration: 52 + actions: + - group: threshold met + params: + level: info + message: |- + alert {{alertName}} is active for group {{context.group}}: + + - Value: {{context.value}} + - Conditions Met: {{context.conditions}} over {{params.timeWindowSize}}{{params.timeWindowUnit}} + - Timestamp: {{context.date} + id: 96b668d0-a1b6-11ed-afdf-d39a49596974 + connector_type_id: .server-log + frequency: + summary: false + throttle: null + notify_when: onActionGroupChange last_run: alerts_count: new: 0 @@ -2090,12 +2137,15 @@ components: outcome_msg: null warning: null outcome: succeeded - next_run: '2022-12-12T22:44:21.653Z' + next_run: '2023-01-31T23:49:42.432Z' create_rule_request: summary: Create an index threshold rule. value: actions: - id: dceeb5d0-6b41-11eb-802b-85b0c1bc8ba2 + frequency: + notify_when: onActionGroupChange + summary: false group: threshold met params: level: info @@ -2107,7 +2157,6 @@ components: - Timestamp: {{context.date}} consumer: alerts name: my rule - notify_when: onActionGroupChange params: aggType: avg termSize: 6 @@ -2133,6 +2182,10 @@ components: actions: - group: threshold met id: dceeb5d0-6b41-11eb-802b-85b0c1bc8ba2 + frequency: + notify_when: onActionGroupChange + summary: false + throttle: null params: level: info message: |- @@ -2169,6 +2222,7 @@ components: aggField: sheet.version termField: name.keyword rule_type_id: .index-threshold + running: false schedule: interval: 1m scheduled_task_id: 425b0800-6bca-11eb-9e0d-85d233e3ee35 diff --git a/x-pack/plugins/alerting/docs/openapi/components/examples/create_rule_request.yaml b/x-pack/plugins/alerting/docs/openapi/components/examples/create_rule_request.yaml index da587ebc22e52..0ca040446cda6 100644 --- a/x-pack/plugins/alerting/docs/openapi/components/examples/create_rule_request.yaml +++ b/x-pack/plugins/alerting/docs/openapi/components/examples/create_rule_request.yaml @@ -2,13 +2,15 @@ summary: Create an index threshold rule. value: actions: - id: dceeb5d0-6b41-11eb-802b-85b0c1bc8ba2 + frequency: + notify_when: onActionGroupChange + summary: false group: threshold met params: level: info message: "alert '{{alertName}}' is active for group '{{context.group}}':\n\n- Value: {{context.value}}\n- Conditions Met: {{context.conditions}} over {{params.timeWindowSize}}{{params.timeWindowUnit}}\n- Timestamp: {{context.date}}" consumer: alerts name: my rule - notify_when: onActionGroupChange params: aggType: avg termSize: 6 diff --git a/x-pack/plugins/alerting/docs/openapi/components/examples/create_rule_response.yaml b/x-pack/plugins/alerting/docs/openapi/components/examples/create_rule_response.yaml index 1a1b45199ba58..daef9b2e3a39b 100644 --- a/x-pack/plugins/alerting/docs/openapi/components/examples/create_rule_response.yaml +++ b/x-pack/plugins/alerting/docs/openapi/components/examples/create_rule_response.yaml @@ -3,6 +3,10 @@ value: actions: - group: threshold met id: dceeb5d0-6b41-11eb-802b-85b0c1bc8ba2 + frequency: + notify_when: onActionGroupChange + summary: false + throttle: null params: level: info message: "alert {{alertName}} is active for group {{context.group} :\n\n- Value: {{context.value}}\n- Conditions Met: {{context.conditions}} over {{params.timeWindowSize}}{{params.timeWindowUnit}}\n- Timestamp: {{context.date}}" @@ -34,6 +38,7 @@ value: aggField: sheet.version termField: name.keyword rule_type_id: .index-threshold + running: false schedule: interval: 1m scheduled_task_id: 425b0800-6bca-11eb-9e0d-85d233e3ee35 diff --git a/x-pack/plugins/alerting/docs/openapi/components/examples/update_rule_request.yaml b/x-pack/plugins/alerting/docs/openapi/components/examples/update_rule_request.yaml index 464645358990a..20ee916284ed0 100644 --- a/x-pack/plugins/alerting/docs/openapi/components/examples/update_rule_request.yaml +++ b/x-pack/plugins/alerting/docs/openapi/components/examples/update_rule_request.yaml @@ -1,21 +1,28 @@ summary: Update an index threshold rule. value: - notify_when: onActionGroupChange + actions: + - frequency: + summary: false + notify_when: onActionGroupChange + group: threshold met + id: 96b668d0-a1b6-11ed-afdf-d39a49596974 + params: + level: info + message: "alert {{alertName}} is active for group {{context.group}}:\n\n- Value: {{context.value}}\n- Conditions Met: {{context.conditions}} over {{params.timeWindowSize}}{{params.timeWindowUnit}}\n- Timestamp: {{context.date}}" params: + aggField: sheet.version + aggType: avg index: [".test-index"] - timeField: "@timestamp" groupBy: top - aggType: avg - timeWindowSize: 5 - timeWindowUnit: m - thresholdComparator: ">" - threshold: [1000] - aggField: sheet.version termField: name.keyword termSize: 6 + threshold: [1000] + thresholdComparator: ">" + timeField: "@timestamp" + timeWindowSize: 5 + timeWindowUnit: m + name: new name schedule: interval: 1m - actions: [] tags: [] - name: new name throttle: null \ No newline at end of file diff --git a/x-pack/plugins/alerting/docs/openapi/components/examples/update_rule_response.yaml b/x-pack/plugins/alerting/docs/openapi/components/examples/update_rule_response.yaml index 7bbdba73774ac..a2195d0e15947 100644 --- a/x-pack/plugins/alerting/docs/openapi/components/examples/update_rule_response.yaml +++ b/x-pack/plugins/alerting/docs/openapi/components/examples/update_rule_response.yaml @@ -6,8 +6,9 @@ value: name: new name enabled: true throttle: null + running: false schedule: - interval: 1m + interval: 10m params: index: [".updated-index"] timeField: "@timestamp" @@ -25,16 +26,25 @@ value: updated_by: elastic rule_type_id: .index-threshold scheduled_task_id: 4c5eda00-e74f-11ec-b72f-5b18752ff9ea - created_at: '2022-12-12T22:43:20.578Z' - updated_at: '2022-12-12T22:44:21.783Z' - notify_when: onActionGroupChange + created_at: '2023-01-31T23:03:33.127Z' + updated_at: '2023-01-31T23:55:27.314Z' mute_all: false muted_alert_ids: [] execution_status: status: ok - last_execution_date: '2022-12-12T22:43:21.723Z' - last_duration: 125 - actions: [] + last_execution_date: '2023-01-31T23:48:42.499Z' + last_duration: 52 + actions: + - group: threshold met + params: + level: info + message: "alert {{alertName}} is active for group {{context.group}}:\n\n- Value: {{context.value}}\n- Conditions Met: {{context.conditions}} over {{params.timeWindowSize}}{{params.timeWindowUnit}}\n- Timestamp: {{context.date}" + id: 96b668d0-a1b6-11ed-afdf-d39a49596974 + connector_type_id: .server-log + frequency: + summary: false + throttle: null + notify_when: onActionGroupChange last_run: alerts_count: new: 0 @@ -44,4 +54,4 @@ value: outcome_msg: null warning: null outcome: succeeded - next_run: '2022-12-12T22:44:21.653Z' \ No newline at end of file + next_run: '2023-01-31T23:49:42.432Z' \ No newline at end of file diff --git a/x-pack/plugins/alerting/docs/openapi/components/schemas/actions.yaml b/x-pack/plugins/alerting/docs/openapi/components/schemas/actions.yaml index ae381d6b370f3..5d0d877a4c177 100644 --- a/x-pack/plugins/alerting/docs/openapi/components/schemas/actions.yaml +++ b/x-pack/plugins/alerting/docs/openapi/components/schemas/actions.yaml @@ -8,6 +8,27 @@ nullable: true items: type: object properties: + connector_type_id: + type: string + description: The type of connector. This property appears in responses but cannot be set in requests. + example: .server-log + readOnly: true + frequency: + type: object + description: > + The parameters that affect how often actions are generated. + NOTE: You cannot specify these parameters when `notify_when` or `throttle` are defined at the rule level. + required: + - notify_when + - summary + properties: + notify_when: + $ref: 'notify_when.yaml' + summary: + type: boolean + description: Indicates whether the action is a summary. + throttle: + $ref: 'throttle.yaml' group: type: string description: The group name for the actions. If you don't need to group actions, set to `default`. diff --git a/x-pack/plugins/alerting/docs/openapi/components/schemas/create_rule_request.yaml b/x-pack/plugins/alerting/docs/openapi/components/schemas/create_rule_request.yaml index e916f02227ea0..ca143eeb51cd8 100644 --- a/x-pack/plugins/alerting/docs/openapi/components/schemas/create_rule_request.yaml +++ b/x-pack/plugins/alerting/docs/openapi/components/schemas/create_rule_request.yaml @@ -5,7 +5,6 @@ type: object required: - consumer - name - - notify_when - params - rule_type_id - schedule diff --git a/x-pack/plugins/alerting/docs/openapi/components/schemas/rule_response_properties.yaml b/x-pack/plugins/alerting/docs/openapi/components/schemas/rule_response_properties.yaml index 39f35d97d846b..827e89938f8fd 100644 --- a/x-pack/plugins/alerting/docs/openapi/components/schemas/rule_response_properties.yaml +++ b/x-pack/plugins/alerting/docs/openapi/components/schemas/rule_response_properties.yaml @@ -12,7 +12,6 @@ required: - mute_all - muted_alert_ids - name - - notify_when - params - rule_type_id - schedule @@ -115,6 +114,9 @@ properties: description: > The identifier for the type of rule. For example, `.es-query`, `.index-threshold`, `logs.alert.document.count`, `monitoring_alert_cluster_health`, `siem.thresholdRule`, or `xpack.ml.anomaly_detection_alert`. example: monitoring_alert_cluster_health + running: + type: boolean + description: Indicates whether the rule is running. schedule: $ref: 'schedule.yaml' scheduled_task_id: diff --git a/x-pack/plugins/alerting/docs/openapi/components/schemas/update_rule_request.yaml b/x-pack/plugins/alerting/docs/openapi/components/schemas/update_rule_request.yaml index fb4bd9586ea1f..4d08574698888 100644 --- a/x-pack/plugins/alerting/docs/openapi/components/schemas/update_rule_request.yaml +++ b/x-pack/plugins/alerting/docs/openapi/components/schemas/update_rule_request.yaml @@ -4,7 +4,6 @@ description: >- type: object required: - name - - notify_when - params - schedule properties: From 38cab322f092d148dc8bf483d76d7ae70a66118e Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 11:32:55 -0500 Subject: [PATCH 33/60] skip failing test suite (#150561) --- .../functional/apps/dashboard/group3/reporting/download_csv.ts | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts index d062eb8feb432..766d2ea500dc5 100644 --- a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts +++ b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts @@ -67,7 +67,8 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { await testSubjects.existOrFail('csvDownloadStarted'); // validate toast panel }; - describe('Download CSV', () => { + // Failing: See https://github.com/elastic/kibana/issues/150561 + describe.skip('Download CSV', () => { before('initialize tests', async () => { log.debug('ReportingPage:initTests'); await browser.setWindowSize(1600, 850); From 15904a12745f31217afc56a987ab66a57507e29f Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 11:49:32 -0500 Subject: [PATCH 34/60] skip failing test suite (#150565) --- .../apis/uptime/rest/uptime_zip_url_deprecation.ts | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/x-pack/test/api_integration/apis/uptime/rest/uptime_zip_url_deprecation.ts b/x-pack/test/api_integration/apis/uptime/rest/uptime_zip_url_deprecation.ts index 1a9fd56d01b17..9070def93704a 100644 --- a/x-pack/test/api_integration/apis/uptime/rest/uptime_zip_url_deprecation.ts +++ b/x-pack/test/api_integration/apis/uptime/rest/uptime_zip_url_deprecation.ts @@ -65,7 +65,8 @@ export default function (providerContext: FtrProviderContext) { ], }); - describe('UptimeZipUrlDeprecation', () => { + // Failing: See https://github.com/elastic/kibana/issues/150565 + describe.skip('UptimeZipUrlDeprecation', () => { let agentPolicyId: string; before(async function () { From a9cd313de4425f47c4c54a0c8a67065de239f945 Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 11:54:11 -0500 Subject: [PATCH 35/60] skip failing test suite (#150562) --- .../functional/apps/dashboard/group3/reporting/download_csv.ts | 1 + 1 file changed, 1 insertion(+) diff --git a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts index 766d2ea500dc5..114460975a769 100644 --- a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts +++ b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts @@ -68,6 +68,7 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { }; // Failing: See https://github.com/elastic/kibana/issues/150561 + // Failing: See https://github.com/elastic/kibana/issues/150562 describe.skip('Download CSV', () => { before('initialize tests', async () => { log.debug('ReportingPage:initTests'); From d5286352790c3a5a1545cd6cb20689b244705e91 Mon Sep 17 00:00:00 2001 From: Drew Tate Date: Wed, 8 Feb 2023 11:26:08 -0600 Subject: [PATCH 36/60] [Lens] better missing fields test (#150466) --- test/functional/page_objects/time_picker.ts | 4 + .../apps/lens/group3/error_handling.ts | 43 ++- .../kbn_archiver/lens/missing_fields.json | 283 +++++++++++++++++- .../test/functional/page_objects/lens_page.ts | 19 ++ 4 files changed, 331 insertions(+), 18 deletions(-) diff --git a/test/functional/page_objects/time_picker.ts b/test/functional/page_objects/time_picker.ts index 44aec2e3fb187..51d2f21290431 100644 --- a/test/functional/page_objects/time_picker.ts +++ b/test/functional/page_objects/time_picker.ts @@ -47,6 +47,10 @@ export class TimePickerPageObject extends FtrService { await this.setAbsoluteRange(this.defaultStartTime, this.defaultEndTime); } + async waitForNoDataPopover() { + await this.testSubjects.find('noDataPopoverDismissButton'); + } + async ensureHiddenNoDataPopover() { const isVisible = await this.testSubjects.exists('noDataPopoverDismissButton', { timeout: 100, diff --git a/x-pack/test/functional/apps/lens/group3/error_handling.ts b/x-pack/test/functional/apps/lens/group3/error_handling.ts index 9a995d9980748..85f9cad73992c 100644 --- a/x-pack/test/functional/apps/lens/group3/error_handling.ts +++ b/x-pack/test/functional/apps/lens/group3/error_handling.ts @@ -5,6 +5,8 @@ * 2.0. */ +import expect from '@kbn/expect'; +import { intersection, uniq } from 'lodash'; import { FtrProviderContext } from '../../../ftr_provider_context'; export default function ({ getService, getPageObjects }: FtrProviderContext) { @@ -21,6 +23,7 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { const listingTable = getService('listingTable'); const kibanaServer = getService('kibanaServer'); const dashboardPanelActions = getService('dashboardPanelActions'); + const testSubjects = getService('testSubjects'); describe('Lens error handling', () => { describe('Index Pattern missing', () => { @@ -85,20 +88,42 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { ); await PageObjects.common.navigateToApp('dashboard'); - await PageObjects.dashboard.loadSavedDashboard('Dashboard with missing field Lens'); - await PageObjects.lens.assertMessageListContains( - 'Field missing field was not found.', - 'error' + await PageObjects.dashboard.loadSavedDashboard( + 'dashboard containing vis with missing fields' ); - await PageObjects.lens.waitForVisualization('mtrVis'); + + const expectedMessages = [ + 'Field @timestamp was not found.', + 'Field kubernetes.node.memory.allocatable.bytes was not found.', + 'Field kubernetes.node.name was not found.', + 'Field kubernetes.container.memory.usage.bytes was not found.', + 'Sort field @timestamp was not found.', + 'Field @timestamp was not found.', + 'Field kubernetes.container.name was not found.', + ]; + + const dashboardMessageList = await PageObjects.lens.getMessageListTexts('error'); + + // make sure all the expected messages are there + expect(intersection(expectedMessages, dashboardMessageList).length).to.be( + uniq(expectedMessages).length + ); + expect(dashboardMessageList.length).to.be(expectedMessages.length); + // make sure the visualization is rendering + await testSubjects.find('emptyPlaceholder'); await PageObjects.dashboard.switchToEditMode(); await dashboardPanelActions.editPanelByTitle(); - await PageObjects.lens.assertMessageListContains( - 'Field missing field was not found.', - 'error' + await PageObjects.timePicker.waitForNoDataPopover(); + await PageObjects.timePicker.ensureHiddenNoDataPopover(); + + const editorMessageList = await PageObjects.lens.getMessageListTexts('error'); + + expect(intersection(expectedMessages, editorMessageList).length).to.be( + uniq(expectedMessages).length ); - await PageObjects.lens.waitForVisualization('mtrVis'); + expect(editorMessageList.length).to.be(expectedMessages.length); + await testSubjects.find('emptyPlaceholder'); await kibanaServer.importExport.unload( 'x-pack/test/functional/fixtures/kbn_archiver/lens/missing_fields' diff --git a/x-pack/test/functional/fixtures/kbn_archiver/lens/missing_fields.json b/x-pack/test/functional/fixtures/kbn_archiver/lens/missing_fields.json index 78b225f6b8424..5668dea137400 100644 --- a/x-pack/test/functional/fixtures/kbn_archiver/lens/missing_fields.json +++ b/x-pack/test/functional/fixtures/kbn_archiver/lens/missing_fields.json @@ -1,3 +1,268 @@ +{ + "attributes": { + "allowNoIndex": true, + "fieldAttrs": "{\"kubernetes.node.fs.available.bytes\":{\"count\":2},\"kubernetes.node.fs.capacity.bytes\":{\"count\":2},\"kubernetes.node.fs.used.bytes\":{\"count\":2},\"kubernetes.node.name\":{\"count\":2},\"event.dataset\":{\"count\":3}}", + "fieldFormatMap": "{}", + "fields": "[]", + "name": "metrics-*", + "runtimeFieldMap": "{}", + "sourceFilters": "[]", + "timeFieldName": "@timestamp", + "title": "metrics-*", + "typeMeta": "{}" + }, + "coreMigrationVersion": "8.7.0", + "created_at": "2023-02-07T14:48:09.633Z", + "id": "metrics-*", + "migrationVersion": { "index-pattern": "8.0.0" }, + "references": [], + "type": "index-pattern", + "updated_at": "2023-02-07T14:48:09.633Z", + "version": "WzE1OSwxXQ==" +} + +{ + "attributes": { + "description": "", + "state": { + "adHocDataViews": {}, + "datasourceStates": { + "formBased": { + "layers": { + "dfd1702f-213e-4fa2-98e3-5106657c62e7": { + "columnOrder": [ + "f0953a4e-8498-4b22-a63a-d24e4a069ed3", + "5c33dcdb-21de-4bdc-b564-ba82ed037d11", + "62125b6d-3199-420b-9d3b-46f159e15d7f" + ], + "columns": { + "5c33dcdb-21de-4bdc-b564-ba82ed037d11": { + "dataType": "date", + "isBucketed": true, + "label": "Missing field", + "operationType": "date_histogram", + "params": { + "dropPartials": false, + "includeEmptyRows": true, + "interval": "30s" + }, + "scale": "interval", + "sourceField": "@timestamp" + }, + "62125b6d-3199-420b-9d3b-46f159e15d7f": { + "customLabel": true, + "dataType": "number", + "isBucketed": false, + "label": "Total Memory", + "operationType": "formula", + "params": { + "format": { "id": "bytes", "params": { "decimals": 2 } }, + "formula": "last_value(kubernetes.node.memory.allocatable.bytes, kql='kubernetes.node.status.ready:\"true\" and event.dataset :\"kubernetes.state_node\" ')", + "isFormulaBroken": true + }, + "references": [], + "scale": "ratio" + }, + "f0953a4e-8498-4b22-a63a-d24e4a069ed3": { + "dataType": "string", + "isBucketed": true, + "label": "Top 100000 values of Missing field", + "operationType": "terms", + "params": { + "missingBucket": false, + "orderAgg": { + "customLabel": false, + "dataType": "number", + "isBucketed": false, + "label": "Count of records", + "operationType": "count", + "params": {}, + "scale": "ratio", + "sourceField": "___records___" + }, + "orderBy": { "type": "custom" }, + "orderDirection": "desc", + "otherBucket": false, + "parentFormat": { "id": "terms" }, + "secondaryFields": [], + "size": 100000 + }, + "scale": "ordinal", + "sourceField": "kubernetes.node.name" + } + }, + "incompleteColumns": {} + }, + "dff09473-7596-48c7-bbf4-beccee70d845": { + "columnOrder": [ + "6677e92c-5874-49c1-979e-c16c0d3838cd", + "46082fb5-9abc-42a0-8e4d-8a8d40a66ddf", + "307be273-94a6-41ab-b93b-0debde733492" + ], + "columns": { + "307be273-94a6-41ab-b93b-0debde733492": { + "customLabel": true, + "dataType": "number", + "filter": { + "language": "kuery", + "query": "event.dataset :\"kubernetes.container\" " + }, + "isBucketed": false, + "label": "Memory Used", + "operationType": "last_value", + "params": { + "format": { "id": "bytes", "params": { "decimals": 2 } }, + "showArrayValues": false, + "sortField": "@timestamp" + }, + "scale": "ratio", + "sourceField": "kubernetes.container.memory.usage.bytes" + }, + "46082fb5-9abc-42a0-8e4d-8a8d40a66ddf": { + "dataType": "date", + "isBucketed": true, + "label": "@timestamp", + "operationType": "date_histogram", + "params": { + "dropPartials": false, + "includeEmptyRows": true, + "interval": "30s" + }, + "scale": "interval", + "sourceField": "@timestamp" + }, + "6677e92c-5874-49c1-979e-c16c0d3838cd": { + "dataType": "string", + "isBucketed": true, + "label": "Top 100000 values of kubernetes.container.name", + "operationType": "terms", + "params": { + "missingBucket": false, + "orderAgg": { + "customLabel": false, + "dataType": "number", + "isBucketed": false, + "label": "Count of records", + "operationType": "count", + "params": {}, + "scale": "ratio", + "sourceField": "___records___" + }, + "orderBy": { "type": "custom" }, + "orderDirection": "desc", + "otherBucket": false, + "parentFormat": { "id": "terms" }, + "secondaryFields": [], + "size": 100000 + }, + "scale": "ordinal", + "sourceField": "kubernetes.container.name" + } + }, + "incompleteColumns": {} + } + } + } + }, + "filters": [], + "internalReferences": [], + "query": { "language": "kuery", "query": "" }, + "visualization": { + "axisTitlesVisibilitySettings": { + "x": false, + "yLeft": false, + "yRight": true + }, + "fillOpacity": 0.5, + "fittingFunction": "None", + "gridlinesVisibilitySettings": { + "x": true, + "yLeft": true, + "yRight": true + }, + "labelsOrientation": { "x": 0, "yLeft": 0, "yRight": 0 }, + "layers": [ + { + "accessors": ["307be273-94a6-41ab-b93b-0debde733492"], + "collapseFn": "sum", + "layerId": "dff09473-7596-48c7-bbf4-beccee70d845", + "layerType": "data", + "palette": { "name": "default", "type": "palette" }, + "seriesType": "area", + "splitAccessor": "6677e92c-5874-49c1-979e-c16c0d3838cd", + "xAccessor": "46082fb5-9abc-42a0-8e4d-8a8d40a66ddf", + "yConfig": [ + { + "axisMode": "left", + "color": "#00bfb3", + "forAccessor": "307be273-94a6-41ab-b93b-0debde733492" + } + ] + }, + { + "accessors": ["62125b6d-3199-420b-9d3b-46f159e15d7f"], + "collapseFn": "sum", + "layerId": "dfd1702f-213e-4fa2-98e3-5106657c62e7", + "layerType": "data", + "palette": { "name": "negative", "type": "palette" }, + "seriesType": "line", + "splitAccessor": "f0953a4e-8498-4b22-a63a-d24e4a069ed3", + "xAccessor": "5c33dcdb-21de-4bdc-b564-ba82ed037d11", + "yConfig": [ + { + "axisMode": "left", + "color": "#bd271e", + "forAccessor": "62125b6d-3199-420b-9d3b-46f159e15d7f" + } + ] + } + ], + "legend": { + "isVisible": true, + "maxLines": 1, + "position": "top", + "shouldTruncate": true, + "showSingleSeries": true + }, + "preferredSeriesType": "bar_stacked", + "tickLabelsVisibilitySettings": { + "x": true, + "yLeft": true, + "yRight": true + }, + "valueLabels": "hide", + "xTitle": "", + "yLeftExtent": { "mode": "full" }, + "yLeftScale": "linear", + "yRightExtent": { "mode": "full" }, + "yRightScale": "linear", + "yTitle": "" + } + }, + "title": "vis with several missing fields", + "visualizationType": "lnsXY" + }, + "coreMigrationVersion": "8.7.0", + "created_at": "2023-02-07T14:58:51.333Z", + "id": "eee2b040-a6f7-11ed-8332-9375ae88137b", + "migrationVersion": { "lens": "8.6.0" }, + "references": [ + { + "id": "metrics-*", + "name": "indexpattern-datasource-layer-dfd1702f-213e-4fa2-98e3-5106657c62e7", + "type": "index-pattern" + }, + { + "id": "metrics-*", + "name": "indexpattern-datasource-layer-dff09473-7596-48c7-bbf4-beccee70d845", + "type": "index-pattern" + } + ], + "type": "lens", + "updated_at": "2023-02-07T14:58:51.333Z", + "version": "WzM0MiwxXQ==" +} + { "attributes": { "description": "", @@ -5,23 +270,23 @@ "searchSourceJSON": "{\"query\":{\"query\":\"\",\"language\":\"kuery\"},\"filter\":[]}" }, "optionsJSON": "{\"useMargins\":true,\"syncColors\":false,\"syncCursor\":true,\"syncTooltips\":false,\"hidePanelTitles\":false}", - "panelsJSON": "[{\"version\":\"8.7.0\",\"type\":\"lens\",\"gridData\":{\"x\":0,\"y\":0,\"w\":24,\"h\":15,\"i\":\"7d75b51d-19fc-4dba-8174-b82e2905745d\"},\"panelIndex\":\"7d75b51d-19fc-4dba-8174-b82e2905745d\",\"embeddableConfig\":{\"attributes\":{\"title\":\"\",\"visualizationType\":\"lnsMetric\",\"type\":\"lens\",\"references\":[{\"type\":\"index-pattern\",\"id\":\"logstash-*\",\"name\":\"indexpattern-datasource-layer-78c0d2e4-4bb8-49e7-ae98-cbe5851bb959\"}],\"state\":{\"visualization\":{\"layerId\":\"78c0d2e4-4bb8-49e7-ae98-cbe5851bb959\",\"layerType\":\"data\",\"metricAccessor\":\"8630dc6f-828f-4a7d-8283-821cf6b54e4f\"},\"query\":{\"query\":\"\",\"language\":\"kuery\"},\"filters\":[],\"datasourceStates\":{\"formBased\":{\"layers\":{\"78c0d2e4-4bb8-49e7-ae98-cbe5851bb959\":{\"columns\":{\"8630dc6f-828f-4a7d-8283-821cf6b54e4f\":{\"label\":\"Median of missing field\",\"dataType\":\"number\",\"operationType\":\"median\",\"sourceField\":\"missing field\",\"isBucketed\":false,\"scale\":\"ratio\",\"params\":{\"emptyAsNull\":true}}},\"columnOrder\":[\"8630dc6f-828f-4a7d-8283-821cf6b54e4f\"],\"incompleteColumns\":{},\"sampling\":1}}},\"textBased\":{\"layers\":{}}},\"internalReferences\":[],\"adHocDataViews\":{}}},\"enhancements\":{}}}]", + "panelsJSON": "[{\"version\":\"8.7.0\",\"type\":\"lens\",\"gridData\":{\"x\":0,\"y\":0,\"w\":24,\"h\":15,\"i\":\"4373fcf6-6f6d-470f-b06c-92ebac15210b\"},\"panelIndex\":\"4373fcf6-6f6d-470f-b06c-92ebac15210b\",\"embeddableConfig\":{\"enhancements\":{}},\"panelRefName\":\"panel_4373fcf6-6f6d-470f-b06c-92ebac15210b\"}]", "timeRestore": false, - "title": "Dashboard with missing field Lens", + "title": "dashboard containing vis with missing fields", "version": 1 }, "coreMigrationVersion": "8.7.0", - "created_at": "2023-01-28T17:47:28.069Z", - "id": "d4cc9840-9f33-11ed-896f-1111cbb8731e", + "created_at": "2023-02-07T14:59:20.822Z", + "id": "00768160-a6f8-11ed-8332-9375ae88137b", "migrationVersion": { "dashboard": "8.7.0" }, "references": [ { - "id": "logstash-*", - "name": "7d75b51d-19fc-4dba-8174-b82e2905745d:indexpattern-datasource-layer-78c0d2e4-4bb8-49e7-ae98-cbe5851bb959", - "type": "index-pattern" + "id": "eee2b040-a6f7-11ed-8332-9375ae88137b", + "name": "4373fcf6-6f6d-470f-b06c-92ebac15210b:panel_4373fcf6-6f6d-470f-b06c-92ebac15210b", + "type": "lens" } ], "type": "dashboard", - "updated_at": "2023-01-28T17:47:28.069Z", - "version": "WzM0OCwxXQ==" + "updated_at": "2023-02-07T14:59:20.822Z", + "version": "WzM5MCwxXQ==" } diff --git a/x-pack/test/functional/page_objects/lens_page.ts b/x-pack/test/functional/page_objects/lens_page.ts index 3843b5561e1f7..0742e3cba9bb4 100644 --- a/x-pack/test/functional/page_objects/lens_page.ts +++ b/x-pack/test/functional/page_objects/lens_page.ts @@ -1602,6 +1602,9 @@ export function LensPageProvider({ getService, getPageObjects }: FtrProviderCont /** * Applicable both on the embeddable and in the editor. In both scenarios, a popover containing user messages (errors, warnings) is shown. + * + * If you're going to use this many times in your test consider retrieving all the messages in one go using getMessageListTexts + * and running your own assertions for performance reasons. */ async assertMessageListContains(assertText: string, severity: 'warning' | 'error') { await testSubjects.click('lens-message-list-trigger'); @@ -1622,6 +1625,22 @@ export function LensPageProvider({ getService, getPageObjects }: FtrProviderCont } }, + async getMessageListTexts(severity: 'warning' | 'error') { + await testSubjects.click('lens-message-list-trigger'); + + const messageSelector = `lens-message-list-${severity}`; + + await testSubjects.existOrFail(messageSelector); + + const messageEls = await testSubjects.findAll(messageSelector); + + const messages = await Promise.all(messageEls.map((el) => el.getVisibleText())); + + await testSubjects.click('lens-message-list-trigger'); + + return messages; + }, + async getPaletteColorStops() { const stops = await find.allByCssSelector( `[data-test-subj^="lnsPalettePanel_dynamicColoring_range_value_"]` From 375a0138c7062a3342e0168fca7f3fbb31cdd8e9 Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 12:36:39 -0500 Subject: [PATCH 37/60] skip failing test suite (#148314) --- .../functional/apps/dashboard/group3/reporting/download_csv.ts | 1 + 1 file changed, 1 insertion(+) diff --git a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts index 114460975a769..5093a11bf3bd2 100644 --- a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts +++ b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts @@ -69,6 +69,7 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { // Failing: See https://github.com/elastic/kibana/issues/150561 // Failing: See https://github.com/elastic/kibana/issues/150562 + // Failing: See https://github.com/elastic/kibana/issues/148314 describe.skip('Download CSV', () => { before('initialize tests', async () => { log.debug('ReportingPage:initTests'); From 974516f0503433f36b6e7820553f0db995c47875 Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 12:37:18 -0500 Subject: [PATCH 38/60] skip failing test suite (#150566) --- .../apis/uptime/rest/uptime_zip_url_deprecation.ts | 1 + 1 file changed, 1 insertion(+) diff --git a/x-pack/test/api_integration/apis/uptime/rest/uptime_zip_url_deprecation.ts b/x-pack/test/api_integration/apis/uptime/rest/uptime_zip_url_deprecation.ts index 9070def93704a..a2fda06d05ae9 100644 --- a/x-pack/test/api_integration/apis/uptime/rest/uptime_zip_url_deprecation.ts +++ b/x-pack/test/api_integration/apis/uptime/rest/uptime_zip_url_deprecation.ts @@ -66,6 +66,7 @@ export default function (providerContext: FtrProviderContext) { }); // Failing: See https://github.com/elastic/kibana/issues/150565 + // Failing: See https://github.com/elastic/kibana/issues/150566 describe.skip('UptimeZipUrlDeprecation', () => { let agentPolicyId: string; From c071df891fa27ed45a5a2874a4e0b5ec51c583ff Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 12:38:25 -0500 Subject: [PATCH 39/60] skip failing test suite (#150563) --- .../functional/apps/dashboard/group3/reporting/download_csv.ts | 1 + 1 file changed, 1 insertion(+) diff --git a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts index 5093a11bf3bd2..c04eb2310cbb1 100644 --- a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts +++ b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts @@ -70,6 +70,7 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { // Failing: See https://github.com/elastic/kibana/issues/150561 // Failing: See https://github.com/elastic/kibana/issues/150562 // Failing: See https://github.com/elastic/kibana/issues/148314 + // Failing: See https://github.com/elastic/kibana/issues/150563 describe.skip('Download CSV', () => { before('initialize tests', async () => { log.debug('ReportingPage:initTests'); From 33993773356edba7ae9db3d5118f91a764d68723 Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 12:39:07 -0500 Subject: [PATCH 40/60] skip failing test suite (#150561) --- .../functional/apps/dashboard/group3/reporting/download_csv.ts | 1 + 1 file changed, 1 insertion(+) diff --git a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts index c04eb2310cbb1..3ce3f9a7b9f36 100644 --- a/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts +++ b/x-pack/test/functional/apps/dashboard/group3/reporting/download_csv.ts @@ -71,6 +71,7 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { // Failing: See https://github.com/elastic/kibana/issues/150562 // Failing: See https://github.com/elastic/kibana/issues/148314 // Failing: See https://github.com/elastic/kibana/issues/150563 + // Failing: See https://github.com/elastic/kibana/issues/150561 describe.skip('Download CSV', () => { before('initialize tests', async () => { log.debug('ReportingPage:initTests'); From b952f68f5806a8e53a6daf6bd89ad3a515732c99 Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 12:42:33 -0500 Subject: [PATCH 41/60] skip failing test suite (#150557) --- .../functional/apps/ml/stack_management_jobs/export_jobs.ts | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/x-pack/test/functional/apps/ml/stack_management_jobs/export_jobs.ts b/x-pack/test/functional/apps/ml/stack_management_jobs/export_jobs.ts index 69ecc7f446b58..6ec33c155a813 100644 --- a/x-pack/test/functional/apps/ml/stack_management_jobs/export_jobs.ts +++ b/x-pack/test/functional/apps/ml/stack_management_jobs/export_jobs.ts @@ -251,7 +251,8 @@ export default function ({ getService }: FtrProviderContext) { const esArchiver = getService('esArchiver'); const ml = getService('ml'); - describe('export jobs', function () { + // Failing: See https://github.com/elastic/kibana/issues/150557 + describe.skip('export jobs', function () { this.tags(['ml']); before(async () => { await ml.api.cleanMlIndices(); From c6a92e333301a72e89027c9af25b84c2523e2e10 Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 13:51:09 -0500 Subject: [PATCH 42/60] skip failing test suite (#132865) --- test/functional/apps/dashboard/group1/embeddable_rendering.ts | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/test/functional/apps/dashboard/group1/embeddable_rendering.ts b/test/functional/apps/dashboard/group1/embeddable_rendering.ts index c0d5a47dbeb27..a52d8f49694f6 100644 --- a/test/functional/apps/dashboard/group1/embeddable_rendering.ts +++ b/test/functional/apps/dashboard/group1/embeddable_rendering.ts @@ -99,7 +99,8 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { await dashboardExpect.vegaTextsDoNotExist(['5,000']); }; - describe('dashboard embeddable rendering', function describeIndexTests() { + // Failing: See https://github.com/elastic/kibana/issues/132865 + describe.skip('dashboard embeddable rendering', function describeIndexTests() { before(async () => { await security.testUser.setRoles(['kibana_admin', 'animals', 'test_logstash_reader']); await kibanaServer.savedObjects.cleanStandardList(); From 049833d6fc32b5c8b310756c5af513ce17968578 Mon Sep 17 00:00:00 2001 From: Zacqary Adam Xeper Date: Wed, 8 Feb 2023 12:58:03 -0600 Subject: [PATCH 43/60] [RAM] Fix flaky event log alerts test (#150468) ## Summary Closes #150071 Updates expected event numbers to reduce flakiness. Passes the flaky test runner: https://buildkite.com/elastic/kibana-flaky-test-suite-runner/builds/1882 --- .../tests/alerting/group4/event_log_alerts.ts | 13 ++++++------- 1 file changed, 6 insertions(+), 7 deletions(-) diff --git a/x-pack/test/alerting_api_integration/spaces_only/tests/alerting/group4/event_log_alerts.ts b/x-pack/test/alerting_api_integration/spaces_only/tests/alerting/group4/event_log_alerts.ts index f76877dd28511..a7f954bad78e2 100644 --- a/x-pack/test/alerting_api_integration/spaces_only/tests/alerting/group4/event_log_alerts.ts +++ b/x-pack/test/alerting_api_integration/spaces_only/tests/alerting/group4/event_log_alerts.ts @@ -16,8 +16,7 @@ export default function eventLogAlertTests({ getService }: FtrProviderContext) { const supertest = getService('supertest'); const retry = getService('retry'); - // FLAKY: https://github.com/elastic/kibana/issues/150071 - describe.skip('eventLog alerts', () => { + describe('eventLog alerts', () => { const objectRemover = new ObjectRemover(supertest); after(() => objectRemover.removeAll()); @@ -57,9 +56,9 @@ export default function eventLogAlertTests({ getService }: FtrProviderContext) { provider: 'alerting', actions: new Map([ // make sure the counts of the # of events per type are as expected - ['execute', { gte: 9 }], + ['execute', { gte: 12 }], ['new-instance', { equal: 2 }], - ['active-instance', { gte: 4 }], + ['active-instance', { gte: 8 }], ['recovered-instance', { equal: 2 }], ]), }); @@ -73,11 +72,12 @@ export default function eventLogAlertTests({ getService }: FtrProviderContext) { // Verify unique executionId generated per `action:execute` grouping const eventExecutionIdSet = new Set(); const totalUniqueExecutionIds = new Set(); - let totalExecutionEventCount = 0; + const totalExecutionEventCount = events.filter( + (event) => event?.event?.action === 'execute' + ).length; events.forEach((event) => { totalUniqueExecutionIds.add(event?.kibana?.alert?.rule?.execution?.uuid); if (event?.event?.action === 'execute') { - totalExecutionEventCount += 1; eventExecutionIdSet.add(event?.kibana?.alert?.rule?.execution?.uuid); expect(eventExecutionIdSet.size).to.equal(1); eventExecutionIdSet.clear(); @@ -85,7 +85,6 @@ export default function eventLogAlertTests({ getService }: FtrProviderContext) { eventExecutionIdSet.add(event?.kibana?.alert?.rule?.execution?.uuid); } }); - // Ensure every execution actually had a unique id from the others expect(totalUniqueExecutionIds.size).to.equal(totalExecutionEventCount); From 52936a979426a65cde81b92c5383bf41dd3443ee Mon Sep 17 00:00:00 2001 From: Zacqary Adam Xeper Date: Wed, 8 Feb 2023 13:10:43 -0600 Subject: [PATCH 44/60] [RAM] Fix flaky alertsList test (#150122) ## Summary Closes #131535 Fixes the flaky alertsList test --------- Co-authored-by: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> --- .../apps/triggers_actions_ui/alerts_list.ts | 8 ++++---- 1 file changed, 4 insertions(+), 4 deletions(-) diff --git a/x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/alerts_list.ts b/x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/alerts_list.ts index 8c336a960638b..94c38f790ee8e 100644 --- a/x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/alerts_list.ts +++ b/x-pack/test/functional_with_es_ssl/apps/triggers_actions_ui/alerts_list.ts @@ -27,11 +27,11 @@ export default ({ getPageObjects, getService }: FtrProviderContext) => { const objectRemover = new ObjectRemover(supertest); async function refreshAlertsList() { + await testSubjects.click('logsTab'); await testSubjects.click('rulesTab'); } - // FLAKY: https://github.com/elastic/kibana/issues/131535 - describe.skip('rules list', function () { + describe('rules list', function () { const assertRulesLength = async (length: number) => { return await retry.try(async () => { const rules = await pageObjects.triggersActionsUI.getAlertsList(); @@ -495,7 +495,7 @@ export default ({ getPageObjects, getService }: FtrProviderContext) => { params: { level: 'info', message: 'gfghfhg' }, frequency: { summary: false, - notifyWhen: 'onActionGroupChange', + notify_when: 'onActionGroupChange', throttle: null, }, }, @@ -676,7 +676,7 @@ export default ({ getPageObjects, getService }: FtrProviderContext) => { params: { level: 'info', message: 'gfghfhg' }, frequency: { summary: false, - notifyWhen: 'onActionGroupChange', + notify_when: 'onActionGroupChange', throttle: null, }, }, From fdc1a781dd73dad69e437916c0ae463c3af5f3d0 Mon Sep 17 00:00:00 2001 From: Saarika Bhasi <55930906+saarikabhasi@users.noreply.github.com> Date: Wed, 8 Feb 2023 14:44:09 -0500 Subject: [PATCH 45/60] [EnterpriseSearch] Engines schema table (#150501) ## Summary 1. Initial changes to show Engines Schema Table 2. Added `Schema` back to Nav ### Screenshot #### Schema table Schema table ### Checklist - [x] Any text added follows [EUI's writing guidelines](https://elastic.github.io/eui/#/guidelines/writing), uses sentence case text and includes [i18n support](https://github.com/elastic/kibana/blob/main/packages/kbn-i18n/README.md) - [x] [Unit or functional tests](https://www.elastic.co/guide/en/kibana/master/development-tests.html) were updated or added to match the most common scenarios --- .../enterprise_search/common/types/engines.ts | 4 ++ .../components/engine/engine_schema.tsx | 62 +++++++++++++++++++ .../components/engine/engine_view.tsx | 2 + .../engine/engine_view_logic.test.ts | 5 ++ .../components/engine/engine_view_logic.ts | 33 ++++++++++ .../applications/shared/layout/nav.test.tsx | 10 +-- .../public/applications/shared/layout/nav.tsx | 20 +++--- 7 files changed, 121 insertions(+), 15 deletions(-) create mode 100644 x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_schema.tsx diff --git a/x-pack/plugins/enterprise_search/common/types/engines.ts b/x-pack/plugins/enterprise_search/common/types/engines.ts index 8a0ef6d216a20..ae230a2531c0c 100644 --- a/x-pack/plugins/enterprise_search/common/types/engines.ts +++ b/x-pack/plugins/enterprise_search/common/types/engines.ts @@ -44,3 +44,7 @@ export interface EnterpriseSearchEngineFieldCapabilities { name: string; updated: string; } +export interface EnterpriseSearchSchemaField { + field_name: string; + field_type: string[]; +} diff --git a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_schema.tsx b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_schema.tsx new file mode 100644 index 0000000000000..b64c144f78dcf --- /dev/null +++ b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_schema.tsx @@ -0,0 +1,62 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import React, { useEffect } from 'react'; + +import { useActions, useValues } from 'kea'; + +import { EuiBasicTable, EuiBasicTableColumn } from '@elastic/eui'; +import { i18n } from '@kbn/i18n'; + +import { EnterpriseSearchSchemaField } from '../../../../../common/types/engines'; +import { EngineViewTabs } from '../../routes'; +import { EnterpriseSearchEnginesPageTemplate } from '../layout/engines_page_template'; + +import { EngineIndicesLogic } from './engine_indices_logic'; + +import { EngineViewLogic } from './engine_view_logic'; + +export const EngineSchema: React.FC = () => { + const { engineName } = useValues(EngineIndicesLogic); + const { isLoadingEngineSchema, schemaFields } = useValues(EngineViewLogic); + const { fetchEngineSchema } = useActions(EngineViewLogic); + const columns: Array> = [ + { + field: 'field_name', + name: i18n.translate('xpack.enterpriseSearch.content.engine.schema.field_name.columnTitle', { + defaultMessage: 'Field name', + }), + }, + { + field: 'field_type', + name: i18n.translate('xpack.enterpriseSearch.content.engine.schema.field_type.columnTitle', { + defaultMessage: 'Field Type', + }), + }, + ]; + + useEffect(() => { + fetchEngineSchema({ engineName }); + }, [engineName]); + return ( + + <> + + + + ); +}; diff --git a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view.tsx b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view.tsx index 0c65e8008f74e..f62096ac756b9 100644 --- a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view.tsx +++ b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view.tsx @@ -22,6 +22,7 @@ import { EngineAPI } from './engine_api/engine_api'; import { EngineError } from './engine_error'; import { EngineIndices } from './engine_indices'; import { EngineOverview } from './engine_overview'; +import { EngineSchema } from './engine_schema'; import { EngineViewHeaderActions } from './engine_view_header_actions'; import { EngineViewLogic } from './engine_view_logic'; import { EngineHeaderDocsAction } from './header_docs_action'; @@ -73,6 +74,7 @@ export const EngineView: React.FC = () => { component={EngineOverview} /> + ( diff --git a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view_logic.test.ts b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view_logic.test.ts index 48d85c9f0c6ac..b4ade46b24b26 100644 --- a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view_logic.test.ts +++ b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view_logic.test.ts @@ -23,6 +23,11 @@ const DEFAULT_VALUES: EngineViewValues = { fetchEngineApiStatus: Status.IDLE, isDeleteModalVisible: false, isLoadingEngine: true, + engineSchemaData: undefined, + fetchEngineSchemaApiError: undefined, + fetchEngineSchemaApiStatus: Status.IDLE, + isLoadingEngineSchema: true, + schemaFields: [], }; describe('EngineViewLogic', () => { diff --git a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view_logic.ts b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view_logic.ts index 96d5387a85fc0..172eb16f59215 100644 --- a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view_logic.ts +++ b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/engine/engine_view_logic.ts @@ -8,6 +8,7 @@ import { kea, MakeLogicType } from 'kea'; import { Status } from '../../../../../common/types/api'; +import { EnterpriseSearchSchemaField } from '../../../../../common/types/engines'; import { KibanaLogic } from '../../../shared/kibana'; @@ -15,6 +16,7 @@ import { FetchEngineApiLogic, FetchEngineApiLogicActions, } from '../../api/engines/fetch_engine_api_logic'; +import { FetchEngineFieldCapabilitiesApiLogic } from '../../api/engines/fetch_engine_field_capabilities_api_logic'; import { ENGINES_PATH } from '../../routes'; @@ -26,16 +28,22 @@ export interface EngineViewActions { closeDeleteEngineModal(): void; deleteSuccess: EnginesListActions['deleteSuccess']; fetchEngine: FetchEngineApiLogicActions['makeRequest']; + fetchEngineSchema: FetchEngineApiLogicActions['makeRequest']; openDeleteEngineModal(): void; } export interface EngineViewValues { engineData: typeof FetchEngineApiLogic.values.data; engineName: typeof EngineNameLogic.values.engineName; + engineSchemaData: typeof FetchEngineFieldCapabilitiesApiLogic.values.data; fetchEngineApiError?: typeof FetchEngineApiLogic.values.error; fetchEngineApiStatus: typeof FetchEngineApiLogic.values.status; + fetchEngineSchemaApiError?: typeof FetchEngineFieldCapabilitiesApiLogic.values.error; + fetchEngineSchemaApiStatus: typeof FetchEngineFieldCapabilitiesApiLogic.values.status; isDeleteModalVisible: boolean; isLoadingEngine: boolean; + isLoadingEngineSchema: boolean; + schemaFields: EnterpriseSearchSchemaField[]; } export const EngineViewLogic = kea>({ @@ -47,6 +55,8 @@ export const EngineViewLogic = kea ({ @@ -80,5 +96,22 @@ export const EngineViewLogic = kea [selectors.fetchEngineSchemaApiStatus], + (status: EngineViewValues['fetchEngineSchemaApiStatus']) => + [Status.LOADING, Status.IDLE].includes(status), + ], + schemaFields: [ + () => [selectors.engineSchemaData], + (data) => + Object.entries(data?.field_capabilities?.fields ?? {}) + .map(([name]) => + Object.entries({ + field_name: name, + field_type: [...Object.keys(data?.field_capabilities?.fields[name])], + }) + ) + .map((fields) => Object.fromEntries(fields)), + ], }), }); diff --git a/x-pack/plugins/enterprise_search/public/applications/shared/layout/nav.test.tsx b/x-pack/plugins/enterprise_search/public/applications/shared/layout/nav.test.tsx index fac9d911be6c8..7bb55a4ac8b2d 100644 --- a/x-pack/plugins/enterprise_search/public/applications/shared/layout/nav.test.tsx +++ b/x-pack/plugins/enterprise_search/public/applications/shared/layout/nav.test.tsx @@ -468,11 +468,11 @@ describe('useEnterpriseSearchEngineNav', () => { id: 'enterpriseSearchEngineIndices', name: 'Indices', }, - // { - // href: `/app/enterprise_search/content/engines/${engineName}/schema`, - // id: 'enterpriseSearchEngineSchema', - // name: 'Schema', - // }, + { + href: `/app/enterprise_search/content/engines/${engineName}/schema`, + id: 'enterpriseSearchEngineSchema', + name: 'Schema', + }, // { // href: `/app/enterprise_search/content/engines/${engineName}/preview`, // id: 'enterpriseSearchEnginePreview', diff --git a/x-pack/plugins/enterprise_search/public/applications/shared/layout/nav.tsx b/x-pack/plugins/enterprise_search/public/applications/shared/layout/nav.tsx index 3d81f5d9d7c34..db5cc82d166b4 100644 --- a/x-pack/plugins/enterprise_search/public/applications/shared/layout/nav.tsx +++ b/x-pack/plugins/enterprise_search/public/applications/shared/layout/nav.tsx @@ -271,16 +271,16 @@ export const useEnterpriseSearchEngineNav = (engineName?: string, isEmptyState?: to: `${enginePath}/${EngineViewTabs.INDICES}`, }), }, - // { - // id: 'enterpriseSearchEngineSchema', - // name: i18n.translate('xpack.enterpriseSearch.nav.engine.schemaTitle', { - // defaultMessage: 'Schema', - // }), - // ...generateNavLink({ - // shouldNotCreateHref: true, - // to: `${enginePath}/${EngineViewTabs.SCHEMA}`, - // }), - // }, + { + id: 'enterpriseSearchEngineSchema', + name: i18n.translate('xpack.enterpriseSearch.nav.engine.schemaTitle', { + defaultMessage: 'Schema', + }), + ...generateNavLink({ + shouldNotCreateHref: true, + to: `${enginePath}/${EngineViewTabs.SCHEMA}`, + }), + }, // Hidden until Preview page is available // { // id: 'enterpriseSearchEnginePreview', From 820500f3d93dd01200c193dce8992f9ff17b3823 Mon Sep 17 00:00:00 2001 From: Kevin Delemme Date: Wed, 8 Feb 2023 15:01:34 -0500 Subject: [PATCH 46/60] feat(slo): remove internal data (#150573) --- .../slo_mappings_template.ts | 17 --- .../apm_transaction_duration.test.ts.snap | 110 ------------------ .../apm_transaction_error_rate.test.ts.snap | 110 ------------------ .../__snapshots__/kql_custom.test.ts.snap | 110 ------------------ .../transform_generator.ts | 57 +-------- 5 files changed, 1 insertion(+), 403 deletions(-) diff --git a/x-pack/plugins/observability/server/assets/component_templates/slo_mappings_template.ts b/x-pack/plugins/observability/server/assets/component_templates/slo_mappings_template.ts index faf415a3d91e8..5b5340e75a232 100644 --- a/x-pack/plugins/observability/server/assets/component_templates/slo_mappings_template.ts +++ b/x-pack/plugins/observability/server/assets/component_templates/slo_mappings_template.ts @@ -35,23 +35,6 @@ export const getSLOMappingsTemplate = (name: string) => ({ context: { type: 'flattened', }, - _internal: { - properties: { - name: { type: 'keyword', ignore_above: 256 }, - budgeting_method: { type: 'keyword' }, - objective: { - properties: { - target: { type: 'double' }, - }, - }, - time_window: { - properties: { - duration: { type: 'keyword' }, - is_rolling: { type: 'boolean' }, - }, - }, - }, - }, }, }, }, diff --git a/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/apm_transaction_duration.test.ts.snap b/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/apm_transaction_duration.test.ts.snap index 3802416f29ff5..1b8a2e6336e91 100644 --- a/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/apm_transaction_duration.test.ts.snap +++ b/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/apm_transaction_duration.test.ts.snap @@ -73,31 +73,6 @@ Object { "fixed_interval": "2m", }, }, - "slo._internal.budgeting_method": Object { - "terms": Object { - "field": "slo._internal.budgeting_method", - }, - }, - "slo._internal.name": Object { - "terms": Object { - "field": "slo._internal.name", - }, - }, - "slo._internal.objective.target": Object { - "terms": Object { - "field": "slo._internal.objective.target", - }, - }, - "slo._internal.time_window.duration": Object { - "terms": Object { - "field": "slo._internal.time_window.duration", - }, - }, - "slo._internal.time_window.is_rolling": Object { - "terms": Object { - "field": "slo._internal.time_window.is_rolling", - }, - }, "slo.id": Object { "terms": Object { "field": "slo.id", @@ -154,36 +129,6 @@ Object { }, }, "runtime_mappings": Object { - "slo._internal.budgeting_method": Object { - "script": Object { - "source": "emit('timeslices')", - }, - "type": "keyword", - }, - "slo._internal.name": Object { - "script": Object { - "source": "emit('irrelevant')", - }, - "type": "keyword", - }, - "slo._internal.objective.target": Object { - "script": Object { - "source": "emit(0.98)", - }, - "type": "double", - }, - "slo._internal.time_window.duration": Object { - "script": Object { - "source": "emit('7d')", - }, - "type": "keyword", - }, - "slo._internal.time_window.is_rolling": Object { - "script": Object { - "source": "emit(true)", - }, - "type": "boolean", - }, "slo.id": Object { "script": Object { "source": Any, @@ -251,31 +196,6 @@ Object { "fixed_interval": "1m", }, }, - "slo._internal.budgeting_method": Object { - "terms": Object { - "field": "slo._internal.budgeting_method", - }, - }, - "slo._internal.name": Object { - "terms": Object { - "field": "slo._internal.name", - }, - }, - "slo._internal.objective.target": Object { - "terms": Object { - "field": "slo._internal.objective.target", - }, - }, - "slo._internal.time_window.duration": Object { - "terms": Object { - "field": "slo._internal.time_window.duration", - }, - }, - "slo._internal.time_window.is_rolling": Object { - "terms": Object { - "field": "slo._internal.time_window.is_rolling", - }, - }, "slo.id": Object { "terms": Object { "field": "slo.id", @@ -332,36 +252,6 @@ Object { }, }, "runtime_mappings": Object { - "slo._internal.budgeting_method": Object { - "script": Object { - "source": "emit('occurrences')", - }, - "type": "keyword", - }, - "slo._internal.name": Object { - "script": Object { - "source": "emit('irrelevant')", - }, - "type": "keyword", - }, - "slo._internal.objective.target": Object { - "script": Object { - "source": "emit(0.999)", - }, - "type": "double", - }, - "slo._internal.time_window.duration": Object { - "script": Object { - "source": "emit('7d')", - }, - "type": "keyword", - }, - "slo._internal.time_window.is_rolling": Object { - "script": Object { - "source": "emit(true)", - }, - "type": "boolean", - }, "slo.id": Object { "script": Object { "source": Any, diff --git a/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/apm_transaction_error_rate.test.ts.snap b/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/apm_transaction_error_rate.test.ts.snap index 3a87b3031fdc0..76657144e11f0 100644 --- a/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/apm_transaction_error_rate.test.ts.snap +++ b/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/apm_transaction_error_rate.test.ts.snap @@ -78,31 +78,6 @@ Object { "fixed_interval": "2m", }, }, - "slo._internal.budgeting_method": Object { - "terms": Object { - "field": "slo._internal.budgeting_method", - }, - }, - "slo._internal.name": Object { - "terms": Object { - "field": "slo._internal.name", - }, - }, - "slo._internal.objective.target": Object { - "terms": Object { - "field": "slo._internal.objective.target", - }, - }, - "slo._internal.time_window.duration": Object { - "terms": Object { - "field": "slo._internal.time_window.duration", - }, - }, - "slo._internal.time_window.is_rolling": Object { - "terms": Object { - "field": "slo._internal.time_window.is_rolling", - }, - }, "slo.id": Object { "terms": Object { "field": "slo.id", @@ -159,36 +134,6 @@ Object { }, }, "runtime_mappings": Object { - "slo._internal.budgeting_method": Object { - "script": Object { - "source": "emit('timeslices')", - }, - "type": "keyword", - }, - "slo._internal.name": Object { - "script": Object { - "source": "emit('irrelevant')", - }, - "type": "keyword", - }, - "slo._internal.objective.target": Object { - "script": Object { - "source": "emit(0.98)", - }, - "type": "double", - }, - "slo._internal.time_window.duration": Object { - "script": Object { - "source": "emit('7d')", - }, - "type": "keyword", - }, - "slo._internal.time_window.is_rolling": Object { - "script": Object { - "source": "emit(true)", - }, - "type": "boolean", - }, "slo.id": Object { "script": Object { "source": Any, @@ -261,31 +206,6 @@ Object { "fixed_interval": "1m", }, }, - "slo._internal.budgeting_method": Object { - "terms": Object { - "field": "slo._internal.budgeting_method", - }, - }, - "slo._internal.name": Object { - "terms": Object { - "field": "slo._internal.name", - }, - }, - "slo._internal.objective.target": Object { - "terms": Object { - "field": "slo._internal.objective.target", - }, - }, - "slo._internal.time_window.duration": Object { - "terms": Object { - "field": "slo._internal.time_window.duration", - }, - }, - "slo._internal.time_window.is_rolling": Object { - "terms": Object { - "field": "slo._internal.time_window.is_rolling", - }, - }, "slo.id": Object { "terms": Object { "field": "slo.id", @@ -342,36 +262,6 @@ Object { }, }, "runtime_mappings": Object { - "slo._internal.budgeting_method": Object { - "script": Object { - "source": "emit('occurrences')", - }, - "type": "keyword", - }, - "slo._internal.name": Object { - "script": Object { - "source": "emit('irrelevant')", - }, - "type": "keyword", - }, - "slo._internal.objective.target": Object { - "script": Object { - "source": "emit(0.999)", - }, - "type": "double", - }, - "slo._internal.time_window.duration": Object { - "script": Object { - "source": "emit('7d')", - }, - "type": "keyword", - }, - "slo._internal.time_window.is_rolling": Object { - "script": Object { - "source": "emit(true)", - }, - "type": "boolean", - }, "slo.id": Object { "script": Object { "source": Any, diff --git a/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/kql_custom.test.ts.snap b/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/kql_custom.test.ts.snap index f984620b8eefb..fbfa14ecfb56b 100644 --- a/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/kql_custom.test.ts.snap +++ b/x-pack/plugins/observability/server/services/slo/transform_generators/__snapshots__/kql_custom.test.ts.snap @@ -150,31 +150,6 @@ Object { "fixed_interval": "2m", }, }, - "slo._internal.budgeting_method": Object { - "terms": Object { - "field": "slo._internal.budgeting_method", - }, - }, - "slo._internal.name": Object { - "terms": Object { - "field": "slo._internal.name", - }, - }, - "slo._internal.objective.target": Object { - "terms": Object { - "field": "slo._internal.objective.target", - }, - }, - "slo._internal.time_window.duration": Object { - "terms": Object { - "field": "slo._internal.time_window.duration", - }, - }, - "slo._internal.time_window.is_rolling": Object { - "terms": Object { - "field": "slo._internal.time_window.is_rolling", - }, - }, "slo.id": Object { "terms": Object { "field": "slo.id", @@ -205,36 +180,6 @@ Object { }, }, "runtime_mappings": Object { - "slo._internal.budgeting_method": Object { - "script": Object { - "source": "emit('timeslices')", - }, - "type": "keyword", - }, - "slo._internal.name": Object { - "script": Object { - "source": "emit('irrelevant')", - }, - "type": "keyword", - }, - "slo._internal.objective.target": Object { - "script": Object { - "source": "emit(0.98)", - }, - "type": "double", - }, - "slo._internal.time_window.duration": Object { - "script": Object { - "source": "emit('7d')", - }, - "type": "keyword", - }, - "slo._internal.time_window.is_rolling": Object { - "script": Object { - "source": "emit(true)", - }, - "type": "boolean", - }, "slo.id": Object { "script": Object { "source": Any, @@ -300,31 +245,6 @@ Object { "fixed_interval": "1m", }, }, - "slo._internal.budgeting_method": Object { - "terms": Object { - "field": "slo._internal.budgeting_method", - }, - }, - "slo._internal.name": Object { - "terms": Object { - "field": "slo._internal.name", - }, - }, - "slo._internal.objective.target": Object { - "terms": Object { - "field": "slo._internal.objective.target", - }, - }, - "slo._internal.time_window.duration": Object { - "terms": Object { - "field": "slo._internal.time_window.duration", - }, - }, - "slo._internal.time_window.is_rolling": Object { - "terms": Object { - "field": "slo._internal.time_window.is_rolling", - }, - }, "slo.id": Object { "terms": Object { "field": "slo.id", @@ -355,36 +275,6 @@ Object { }, }, "runtime_mappings": Object { - "slo._internal.budgeting_method": Object { - "script": Object { - "source": "emit('occurrences')", - }, - "type": "keyword", - }, - "slo._internal.name": Object { - "script": Object { - "source": "emit('irrelevant')", - }, - "type": "keyword", - }, - "slo._internal.objective.target": Object { - "script": Object { - "source": "emit(0.999)", - }, - "type": "double", - }, - "slo._internal.time_window.duration": Object { - "script": Object { - "source": "emit('7d')", - }, - "type": "keyword", - }, - "slo._internal.time_window.is_rolling": Object { - "script": Object { - "source": "emit(true)", - }, - "type": "boolean", - }, "slo.id": Object { "script": Object { "source": Any, diff --git a/x-pack/plugins/observability/server/services/slo/transform_generators/transform_generator.ts b/x-pack/plugins/observability/server/services/slo/transform_generators/transform_generator.ts index a62c81b165dbe..da88c48d5479c 100644 --- a/x-pack/plugins/observability/server/services/slo/transform_generators/transform_generator.ts +++ b/x-pack/plugins/observability/server/services/slo/transform_generators/transform_generator.ts @@ -7,7 +7,7 @@ import { MappingRuntimeFieldType } from '@elastic/elasticsearch/lib/api/types'; import { TransformPutTransformRequest } from '@elastic/elasticsearch/lib/api/typesWithBodyKey'; -import { calendarAlignedTimeWindowSchema, timeslicesBudgetingMethodSchema } from '@kbn/slo-schema'; +import { timeslicesBudgetingMethodSchema } from '@kbn/slo-schema'; import { TransformSettings } from '../../../assets/transform_templates/slo_transform_template'; import { SLO } from '../../../domain/models'; @@ -29,36 +29,6 @@ export abstract class TransformGenerator { source: `emit(${slo.revision})`, }, }, - 'slo._internal.name': { - type: 'keyword' as MappingRuntimeFieldType, - script: { - source: `emit('${slo.name}')`, - }, - }, - 'slo._internal.budgeting_method': { - type: 'keyword' as MappingRuntimeFieldType, - script: { - source: `emit('${slo.budgetingMethod}')`, - }, - }, - 'slo._internal.objective.target': { - type: 'double' as MappingRuntimeFieldType, - script: { - source: `emit(${slo.objective.target})`, - }, - }, - 'slo._internal.time_window.duration': { - type: 'keyword' as MappingRuntimeFieldType, - script: { - source: `emit('${slo.timeWindow.duration.format()}')`, - }, - }, - 'slo._internal.time_window.is_rolling': { - type: 'boolean' as MappingRuntimeFieldType, - script: { - source: calendarAlignedTimeWindowSchema.is(slo.timeWindow) ? `emit(false)` : `emit(true)`, - }, - }, }; } @@ -79,31 +49,6 @@ export abstract class TransformGenerator { field: 'slo.revision', }, }, - 'slo._internal.name': { - terms: { - field: 'slo._internal.name', - }, - }, - 'slo._internal.budgeting_method': { - terms: { - field: 'slo._internal.budgeting_method', - }, - }, - 'slo._internal.objective.target': { - terms: { - field: 'slo._internal.objective.target', - }, - }, - 'slo._internal.time_window.duration': { - terms: { - field: 'slo._internal.time_window.duration', - }, - }, - 'slo._internal.time_window.is_rolling': { - terms: { - field: 'slo._internal.time_window.is_rolling', - }, - }, // Field used in the destination index, using @timestamp as per mapping definition '@timestamp': { date_histogram: { From 375a86334912aaa0e8b6324dad10713cde4a7c2d Mon Sep 17 00:00:00 2001 From: Jonathan Buttner <56361221+jonathan-buttner@users.noreply.github.com> Date: Wed, 8 Feb 2023 15:02:32 -0500 Subject: [PATCH 47/60] [Cases] Refactor integration helper functions (#149640) This PR refactors the cases integration test API helper functions so that splitting up the `utils.ts` file will be easier in the future because it will all be hidden under the `api/index.ts` import. That way moving functions out of the `index.ts` file into their own will not require a ton of test files to be updated. --- .../apis/cases/bulk_get_user_profiles.ts | 4 +- .../test/api_integration/apis/cases/index.ts | 2 +- .../api_integration/apis/cases/privileges.ts | 2 +- .../apis/cases/suggest_user_profiles.ts | 4 +- .../security_solution/cases_privileges.ts | 2 +- .../common/lib/api/attachments.ts | 260 +++++++++++ .../common/lib/api/case.ts | 61 +++ .../common/lib/api/configuration.ts | 77 ++++ .../common/lib/{ => api}/connectors.ts | 21 +- .../common/lib/api/helpers.ts | 29 ++ .../common/lib/{utils.ts => api/index.ts} | 407 +----------------- .../common/lib/api/omit.ts | 51 +++ .../common/lib/{ => api}/user_actions.ts | 7 +- .../common/lib/{ => api}/user_profiles.ts | 10 +- .../common/lib/attachments.ts | 38 -- .../common/lib/authentication/index.ts | 2 +- .../tests/basic/cases/assignees.ts | 7 +- .../tests/basic/cases/push_case.ts | 6 +- .../tests/basic/configure/get_connectors.ts | 2 +- .../basic/internal/suggest_user_profiles.ts | 3 +- .../alerts/get_alerts_attached_to_case.ts | 2 +- .../tests/common/alerts/get_cases.ts | 2 +- .../external_references.ts | 4 +- .../persistable_state.ts | 4 +- .../tests/common/cases/delete_cases.ts | 4 +- .../tests/common/cases/find_cases.ts | 2 +- .../tests/common/cases/get_case.ts | 2 +- .../tests/common/cases/import_export.ts | 4 +- .../tests/common/cases/migrations.ts | 2 +- .../tests/common/cases/patch_cases.ts | 4 +- .../tests/common/cases/post_case.ts | 4 +- .../common/cases/reporters/get_reporters.ts | 2 +- .../tests/common/cases/resolve_case.ts | 2 +- .../tests/common/cases/status/get_status.ts | 2 +- .../tests/common/cases/tags/get_tags.ts | 2 +- .../common/client/update_alert_status.ts | 2 +- .../tests/common/comments/delete_comment.ts | 2 +- .../tests/common/comments/find_comments.ts | 2 +- .../tests/common/comments/get_all_comments.ts | 2 +- .../tests/common/comments/get_comment.ts | 2 +- .../tests/common/comments/migrations.ts | 2 +- .../tests/common/comments/patch_comment.ts | 2 +- .../tests/common/comments/post_comment.ts | 4 +- .../tests/common/configure/get_configure.ts | 2 +- .../tests/common/configure/migrations.ts | 2 +- .../tests/common/configure/patch_configure.ts | 2 +- .../tests/common/configure/post_configure.ts | 2 +- .../internal/bulk_create_attachments.ts | 4 +- .../common/internal/bulk_get_attachments.ts | 4 +- .../tests/common/internal/bulk_get_cases.ts | 2 +- .../tests/common/internal/get_connectors.ts | 4 +- .../common/internal/user_actions_get_users.ts | 12 +- .../tests/common/metrics/get_case_metrics.ts | 2 +- .../metrics/get_case_metrics_actions.ts | 2 +- .../common/metrics/get_case_metrics_alerts.ts | 2 +- .../metrics/get_case_metrics_connectors.ts | 2 +- .../tests/common/metrics/get_cases_metrics.ts | 2 +- .../common/user_actions/find_user_actions.ts | 5 +- .../user_actions/get_all_user_actions.ts | 4 +- .../user_actions/get_user_action_stats.ts | 4 +- .../tests/common/user_actions/migrations.ts | 3 +- .../tests/no_public_base_url/push.ts | 6 +- .../tests/trial/cases/assignees.ts | 8 +- .../tests/trial/cases/find_cases.ts | 9 +- .../tests/trial/cases/push_case.ts | 7 +- .../cases/user_actions/find_user_actions.ts | 6 +- .../user_actions/get_all_user_actions.ts | 8 +- .../tests/trial/configure/get_configure.ts | 4 +- .../tests/trial/configure/get_connectors.ts | 2 +- .../tests/trial/configure/patch_configure.ts | 4 +- .../tests/trial/configure/post_configure.ts | 4 +- .../tests/trial/delete_sub_privilege.ts | 2 +- .../tests/trial/internal/get_connectors.ts | 8 +- .../trial/internal/get_user_action_stats.ts | 9 +- .../trial/internal/suggest_user_profiles.ts | 2 +- .../trial/internal/user_actions_get_users.ts | 11 +- .../tests/trial/user_profiles/get_current.ts | 6 +- .../tests/common/alerts/get_cases.ts | 2 +- .../tests/common/cases/delete_cases.ts | 2 +- .../tests/common/cases/find_cases.ts | 2 +- .../tests/common/cases/get_case.ts | 2 +- .../tests/common/cases/patch_cases.ts | 2 +- .../tests/common/cases/post_case.ts | 2 +- .../common/cases/reporters/get_reporters.ts | 2 +- .../tests/common/cases/status/get_status.ts | 2 +- .../tests/common/cases/tags/get_tags.ts | 2 +- .../tests/common/comments/delete_comment.ts | 2 +- .../tests/common/comments/find_comments.ts | 2 +- .../tests/common/comments/get_all_comments.ts | 2 +- .../tests/common/comments/get_comment.ts | 2 +- .../tests/common/comments/patch_comment.ts | 2 +- .../tests/common/comments/post_comment.ts | 2 +- .../tests/common/configure/get_configure.ts | 2 +- .../tests/common/configure/patch_configure.ts | 2 +- .../tests/common/configure/post_configure.ts | 2 +- .../internal/bulk_create_attachments.ts | 2 +- .../common/internal/suggest_user_profiles.ts | 2 +- .../tests/common/metrics/get_cases_metrics.ts | 2 +- .../user_actions/get_all_user_actions.ts | 4 +- .../tests/trial/cases/push_case.ts | 7 +- .../tests/trial/configure/get_configure.ts | 4 +- .../tests/trial/configure/get_connectors.ts | 5 +- .../tests/trial/configure/patch_configure.ts | 4 +- .../tests/trial/configure/post_configure.ts | 4 +- x-pack/test/functional/services/cases/api.ts | 4 +- .../apps/cases/group2/attachment_framework.ts | 2 +- 106 files changed, 666 insertions(+), 621 deletions(-) create mode 100644 x-pack/test/cases_api_integration/common/lib/api/attachments.ts create mode 100644 x-pack/test/cases_api_integration/common/lib/api/case.ts create mode 100644 x-pack/test/cases_api_integration/common/lib/api/configuration.ts rename x-pack/test/cases_api_integration/common/lib/{ => api}/connectors.ts (92%) create mode 100644 x-pack/test/cases_api_integration/common/lib/api/helpers.ts rename x-pack/test/cases_api_integration/common/lib/{utils.ts => api/index.ts} (64%) create mode 100644 x-pack/test/cases_api_integration/common/lib/api/omit.ts rename x-pack/test/cases_api_integration/common/lib/{ => api}/user_actions.ts (93%) rename x-pack/test/cases_api_integration/common/lib/{ => api}/user_profiles.ts (94%) delete mode 100644 x-pack/test/cases_api_integration/common/lib/attachments.ts diff --git a/x-pack/test/api_integration/apis/cases/bulk_get_user_profiles.ts b/x-pack/test/api_integration/apis/cases/bulk_get_user_profiles.ts index 8de4b3dc32a0c..2d64da015d188 100644 --- a/x-pack/test/api_integration/apis/cases/bulk_get_user_profiles.ts +++ b/x-pack/test/api_integration/apis/cases/bulk_get_user_profiles.ts @@ -11,11 +11,11 @@ import { APP_ID as SECURITY_SOLUTION_APP_ID } from '@kbn/security-solution-plugi import { observabilityFeatureId as OBSERVABILITY_APP_ID } from '@kbn/observability-plugin/common'; import { FtrProviderContext } from '../../ftr_provider_context'; -import { deleteAllCaseItems } from '../../../cases_api_integration/common/lib/utils'; +import { deleteAllCaseItems } from '../../../cases_api_integration/common/lib/api'; import { bulkGetUserProfiles, suggestUserProfiles, -} from '../../../cases_api_integration/common/lib/user_profiles'; +} from '../../../cases_api_integration/common/lib/api/user_profiles'; import { casesAllUser, casesReadUser, diff --git a/x-pack/test/api_integration/apis/cases/index.ts b/x-pack/test/api_integration/apis/cases/index.ts index 5b9d9d1bfe918..f12e43b34d784 100644 --- a/x-pack/test/api_integration/apis/cases/index.ts +++ b/x-pack/test/api_integration/apis/cases/index.ts @@ -10,7 +10,7 @@ import { deleteUsersAndRoles, } from '../../../cases_api_integration/common/lib/authentication'; -import { loginUsers } from '../../../cases_api_integration/common/lib/user_profiles'; +import { loginUsers } from '../../../cases_api_integration/common/lib/api/user_profiles'; import { casesAllUser, obsCasesAllUser, secAllUser, users } from './common/users'; import { roles } from './common/roles'; import { FtrProviderContext } from '../../ftr_provider_context'; diff --git a/x-pack/test/api_integration/apis/cases/privileges.ts b/x-pack/test/api_integration/apis/cases/privileges.ts index f2e2732a93935..96a8970adeeee 100644 --- a/x-pack/test/api_integration/apis/cases/privileges.ts +++ b/x-pack/test/api_integration/apis/cases/privileges.ts @@ -16,7 +16,7 @@ import { deleteAllCaseItems, deleteCases, getCase, -} from '../../../cases_api_integration/common/lib/utils'; +} from '../../../cases_api_integration/common/lib/api'; import { casesAllUser, casesNoDeleteUser, diff --git a/x-pack/test/api_integration/apis/cases/suggest_user_profiles.ts b/x-pack/test/api_integration/apis/cases/suggest_user_profiles.ts index dca999ab68902..015dad2e71e03 100644 --- a/x-pack/test/api_integration/apis/cases/suggest_user_profiles.ts +++ b/x-pack/test/api_integration/apis/cases/suggest_user_profiles.ts @@ -11,8 +11,8 @@ import { APP_ID as SECURITY_SOLUTION_APP_ID } from '@kbn/security-solution-plugi import { observabilityFeatureId as OBSERVABILITY_APP_ID } from '@kbn/observability-plugin/common'; import { FtrProviderContext } from '../../ftr_provider_context'; -import { deleteAllCaseItems } from '../../../cases_api_integration/common/lib/utils'; -import { suggestUserProfiles } from '../../../cases_api_integration/common/lib/user_profiles'; +import { deleteAllCaseItems } from '../../../cases_api_integration/common/lib/api'; +import { suggestUserProfiles } from '../../../cases_api_integration/common/lib/api/user_profiles'; import { casesAllUser, casesOnlyDeleteUser, diff --git a/x-pack/test/api_integration_basic/apis/security_solution/cases_privileges.ts b/x-pack/test/api_integration_basic/apis/security_solution/cases_privileges.ts index 3058fc3b66c6d..a39796f1f4448 100644 --- a/x-pack/test/api_integration_basic/apis/security_solution/cases_privileges.ts +++ b/x-pack/test/api_integration_basic/apis/security_solution/cases_privileges.ts @@ -19,7 +19,7 @@ import { createCase, deleteAllCaseItems, getCase, -} from '../../../cases_api_integration/common/lib/utils'; +} from '../../../cases_api_integration/common/lib/api'; import { getPostCaseRequest } from '../../../cases_api_integration/common/lib/mock'; const secAll: Role = { diff --git a/x-pack/test/cases_api_integration/common/lib/api/attachments.ts b/x-pack/test/cases_api_integration/common/lib/api/attachments.ts new file mode 100644 index 0000000000000..4408f2f2b38a1 --- /dev/null +++ b/x-pack/test/cases_api_integration/common/lib/api/attachments.ts @@ -0,0 +1,260 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import type SuperTest from 'supertest'; +import { CASES_INTERNAL_URL, CASES_URL } from '@kbn/cases-plugin/common/constants'; +import { + AllCommentsResponse, + BulkCreateCommentRequest, + BulkGetAttachmentsResponse, + CaseResponse, + CommentPatchRequest, + CommentRequest, + CommentResponse, + CommentType, +} from '@kbn/cases-plugin/common/api'; +import { User } from '../authentication/types'; +import { superUser } from '../authentication/users'; +import { getSpaceUrlPrefix, setupAuth } from './helpers'; +import { createCase } from './case'; +import { postCaseReq } from '../mock'; + +export const bulkGetAttachments = async ({ + supertest, + attachmentIds, + caseId, + expectedHttpCode = 200, + auth = { user: superUser, space: null }, +}: { + supertest: SuperTest.SuperTest; + attachmentIds: string[]; + caseId: string; + auth?: { user: User; space: string | null }; + expectedHttpCode?: number; +}): Promise => { + const { body: comments } = await supertest + .post(`${getSpaceUrlPrefix(auth.space)}${CASES_INTERNAL_URL}/${caseId}/attachments/_bulk_get`) + .send({ ids: attachmentIds }) + .set('kbn-xsrf', 'abc') + .auth(auth.user.username, auth.user.password) + .expect(expectedHttpCode); + + return comments; +}; + +export const createComment = async ({ + supertest, + caseId, + params, + auth = { user: superUser, space: null }, + expectedHttpCode = 200, + headers = {}, +}: { + supertest: SuperTest.SuperTest; + caseId: string; + params: CommentRequest; + auth?: { user: User; space: string | null } | null; + expectedHttpCode?: number; + headers?: Record; +}): Promise => { + const apiCall = supertest.post( + `${getSpaceUrlPrefix(auth?.space)}${CASES_URL}/${caseId}/comments` + ); + + setupAuth({ apiCall, headers, auth }); + + const { body: theCase } = await apiCall + .set('kbn-xsrf', 'true') + .set(headers) + .send(params) + .expect(expectedHttpCode); + + return theCase; +}; + +export const bulkCreateAttachments = async ({ + supertest, + caseId, + params, + auth = { user: superUser, space: null }, + expectedHttpCode = 200, +}: { + supertest: SuperTest.SuperTest; + caseId: string; + params: BulkCreateCommentRequest; + auth?: { user: User; space: string | null }; + expectedHttpCode?: number; +}): Promise => { + const { body: theCase } = await supertest + .post( + `${getSpaceUrlPrefix(auth.space)}${CASES_INTERNAL_URL}/${caseId}/attachments/_bulk_create` + ) + .auth(auth.user.username, auth.user.password) + .set('kbn-xsrf', 'true') + .send(params) + .expect(expectedHttpCode); + + return theCase; +}; + +export const createCaseAndBulkCreateAttachments = async ({ + supertest, + numberOfAttachments = 3, + auth = { user: superUser, space: null }, + expectedHttpCode = 200, +}: { + supertest: SuperTest.SuperTest; + numberOfAttachments?: number; + auth?: { user: User; space: string | null }; + expectedHttpCode?: number; +}): Promise<{ theCase: CaseResponse; attachments: BulkCreateCommentRequest }> => { + const postedCase = await createCase(supertest, postCaseReq); + const attachments = getAttachments(numberOfAttachments); + const patchedCase = await bulkCreateAttachments({ + supertest, + caseId: postedCase.id, + params: attachments, + }); + + return { theCase: patchedCase, attachments }; +}; + +export const getAttachments = (numberOfAttachments: number): BulkCreateCommentRequest => { + return [...Array(numberOfAttachments)].map((index) => { + if (index % 0) { + return { + type: CommentType.user, + comment: `Test ${index + 1}`, + owner: 'securitySolutionFixture', + }; + } + + return { + type: CommentType.alert, + alertId: `test-id-${index + 1}`, + index: `test-index-${index + 1}`, + rule: { + id: `rule-test-id-${index + 1}`, + name: `Test ${index + 1}`, + }, + owner: 'securitySolutionFixture', + }; + }); +}; + +export const deleteComment = async ({ + supertest, + caseId, + commentId, + expectedHttpCode = 204, + auth = { user: superUser, space: null }, +}: { + supertest: SuperTest.SuperTest; + caseId: string; + commentId: string; + expectedHttpCode?: number; + auth?: { user: User; space: string | null }; +}): Promise<{} | Error> => { + const { body: comment } = await supertest + .delete(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}/${caseId}/comments/${commentId}`) + .set('kbn-xsrf', 'true') + .auth(auth.user.username, auth.user.password) + .expect(expectedHttpCode) + .send(); + + return comment; +}; + +export const deleteAllComments = async ({ + supertest, + caseId, + expectedHttpCode = 204, + auth = { user: superUser, space: null }, +}: { + supertest: SuperTest.SuperTest; + caseId: string; + expectedHttpCode?: number; + auth?: { user: User; space: string | null }; +}): Promise<{} | Error> => { + const { body: comment } = await supertest + .delete(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}/${caseId}/comments`) + .set('kbn-xsrf', 'true') + .auth(auth.user.username, auth.user.password) + .expect(expectedHttpCode) + .send(); + + return comment; +}; + +export const getAllComments = async ({ + supertest, + caseId, + expectedHttpCode = 200, + auth = { user: superUser, space: null }, +}: { + supertest: SuperTest.SuperTest; + caseId: string; + auth?: { user: User; space: string | null }; + expectedHttpCode?: number; +}): Promise => { + const { body: comments } = await supertest + .get(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}/${caseId}/comments`) + .auth(auth.user.username, auth.user.password) + .expect(expectedHttpCode); + + return comments; +}; + +export const getComment = async ({ + supertest, + caseId, + commentId, + expectedHttpCode = 200, + auth = { user: superUser, space: null }, +}: { + supertest: SuperTest.SuperTest; + caseId: string; + commentId: string; + expectedHttpCode?: number; + auth?: { user: User; space: string | null }; +}): Promise => { + const { body: comment } = await supertest + .get(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}/${caseId}/comments/${commentId}`) + .auth(auth.user.username, auth.user.password) + .expect(expectedHttpCode); + + return comment; +}; + +export const updateComment = async ({ + supertest, + caseId, + req, + expectedHttpCode = 200, + auth = { user: superUser, space: null }, + headers = {}, +}: { + supertest: SuperTest.SuperTest; + caseId: string; + req: CommentPatchRequest; + expectedHttpCode?: number; + auth?: { user: User; space: string | null } | null; + headers?: Record; +}): Promise => { + const apiCall = supertest.patch( + `${getSpaceUrlPrefix(auth?.space)}${CASES_URL}/${caseId}/comments` + ); + + setupAuth({ apiCall, headers, auth }); + const { body: res } = await apiCall + .set('kbn-xsrf', 'true') + .set(headers) + .send(req) + .expect(expectedHttpCode); + + return res; +}; diff --git a/x-pack/test/cases_api_integration/common/lib/api/case.ts b/x-pack/test/cases_api_integration/common/lib/api/case.ts new file mode 100644 index 0000000000000..9485ea3a797b7 --- /dev/null +++ b/x-pack/test/cases_api_integration/common/lib/api/case.ts @@ -0,0 +1,61 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { CASES_URL } from '@kbn/cases-plugin/common'; +import { CasePostRequest, CaseResponse } from '@kbn/cases-plugin/common/api'; +import type SuperTest from 'supertest'; +import { User } from '../authentication/types'; + +import { superUser } from '../authentication/users'; +import { getSpaceUrlPrefix, setupAuth } from './helpers'; + +export const createCase = async ( + supertest: SuperTest.SuperTest, + params: CasePostRequest, + expectedHttpCode: number = 200, + auth: { user: User; space: string | null } | null = { user: superUser, space: null }, + headers: Record = {} +): Promise => { + const apiCall = supertest.post(`${getSpaceUrlPrefix(auth?.space)}${CASES_URL}`); + + setupAuth({ apiCall, headers, auth }); + + const { body: theCase } = await apiCall + .set('kbn-xsrf', 'true') + .set(headers) + .send(params) + .expect(expectedHttpCode); + + return theCase; +}; + +/** + * Sends a delete request for the specified case IDs. + */ +export const deleteCases = async ({ + supertest, + caseIDs, + expectedHttpCode = 204, + auth = { user: superUser, space: null }, +}: { + supertest: SuperTest.SuperTest; + caseIDs: string[]; + expectedHttpCode?: number; + auth?: { user: User; space: string | null }; +}) => { + const { body } = await supertest + .delete(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}`) + .auth(auth.user.username, auth.user.password) + // we need to json stringify here because just passing in the array of case IDs will cause a 400 with Kibana + // not being able to parse the array correctly. The format ids=["1", "2"] seems to work, which stringify outputs. + .query({ ids: JSON.stringify(caseIDs) }) + .set('kbn-xsrf', 'true') + .send() + .expect(expectedHttpCode); + + return body; +}; diff --git a/x-pack/test/cases_api_integration/common/lib/api/configuration.ts b/x-pack/test/cases_api_integration/common/lib/api/configuration.ts new file mode 100644 index 0000000000000..2378eaf9845fa --- /dev/null +++ b/x-pack/test/cases_api_integration/common/lib/api/configuration.ts @@ -0,0 +1,77 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { + CaseConnector, + CasesConfigureRequest, + CasesConfigureResponse, + ConnectorTypes, +} from '@kbn/cases-plugin/common/api'; +import { CASE_CONFIGURE_URL } from '@kbn/cases-plugin/common/constants'; +import type SuperTest from 'supertest'; +import { User } from '../authentication/types'; + +import { superUser } from '../authentication/users'; +import { getSpaceUrlPrefix, setupAuth } from './helpers'; + +type ConfigRequestParams = Partial & { + overrides?: Record; +}; + +export const getConfigurationRequest = ({ + id = 'none', + name = 'none', + type = ConnectorTypes.none, + fields = null, + overrides, +}: ConfigRequestParams = {}): CasesConfigureRequest => { + return { + connector: { + id, + name, + type, + fields, + } as CaseConnector, + closure_type: 'close-by-user', + owner: 'securitySolutionFixture', + ...overrides, + }; +}; + +export const getConfigurationOutput = ( + update = false, + overwrite = {} +): Partial => { + return { + ...getConfigurationRequest(), + error: null, + mappings: [], + created_by: { email: null, full_name: null, username: 'elastic' }, + updated_by: update ? { email: null, full_name: null, username: 'elastic' } : null, + ...overwrite, + }; +}; + +export const createConfiguration = async ( + supertest: SuperTest.SuperTest, + req: CasesConfigureRequest = getConfigurationRequest(), + expectedHttpCode: number = 200, + auth: { user: User; space: string | null } | null = { user: superUser, space: null }, + headers: Record = {} +): Promise => { + const apiCall = supertest.post(`${getSpaceUrlPrefix(auth?.space)}${CASE_CONFIGURE_URL}`); + + setupAuth({ apiCall, headers, auth }); + + const { body: configuration } = await apiCall + .set('kbn-xsrf', 'true') + .set(headers) + .send(req) + .expect(expectedHttpCode); + + return configuration; +}; diff --git a/x-pack/test/cases_api_integration/common/lib/connectors.ts b/x-pack/test/cases_api_integration/common/lib/api/connectors.ts similarity index 92% rename from x-pack/test/cases_api_integration/common/lib/connectors.ts rename to x-pack/test/cases_api_integration/common/lib/api/connectors.ts index 3d0d7b31bc7d1..2c7bfe944a334 100644 --- a/x-pack/test/cases_api_integration/common/lib/connectors.ts +++ b/x-pack/test/cases_api_integration/common/lib/api/connectors.ts @@ -20,18 +20,15 @@ import { getCaseConnectorsUrl, } from '@kbn/cases-plugin/common/api'; import { ActionResult, FindActionResult } from '@kbn/actions-plugin/server/types'; -import { User } from './authentication/types'; -import { superUser } from './authentication/users'; -import { getPostCaseRequest } from './mock'; -import { ObjectRemover as ActionsRemover } from '../../../alerting_api_integration/common/lib'; -import { getServiceNowServer } from '../../../alerting_api_integration/common/plugins/actions_simulators/server/plugin'; -import { RecordingServiceNowSimulator } from '../../../alerting_api_integration/common/plugins/actions_simulators/server/servicenow_simulation'; -import { - createConfiguration, - getConfigurationRequest, - createCase, - getSpaceUrlPrefix, -} from './utils'; +import { User } from '../authentication/types'; +import { superUser } from '../authentication/users'; +import { getPostCaseRequest } from '../mock'; +import { ObjectRemover as ActionsRemover } from '../../../../alerting_api_integration/common/lib'; +import { getServiceNowServer } from '../../../../alerting_api_integration/common/plugins/actions_simulators/server/plugin'; +import { RecordingServiceNowSimulator } from '../../../../alerting_api_integration/common/plugins/actions_simulators/server/servicenow_simulation'; +import { createConfiguration, getConfigurationRequest } from './configuration'; +import { createCase } from './case'; +import { getSpaceUrlPrefix } from './helpers'; export const getResilientConnector = () => ({ name: 'Resilient Connector', diff --git a/x-pack/test/cases_api_integration/common/lib/api/helpers.ts b/x-pack/test/cases_api_integration/common/lib/api/helpers.ts new file mode 100644 index 0000000000000..fce92a616de61 --- /dev/null +++ b/x-pack/test/cases_api_integration/common/lib/api/helpers.ts @@ -0,0 +1,29 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import type SuperTest from 'supertest'; +import { User } from '../authentication/types'; + +export const getSpaceUrlPrefix = (spaceId: string | undefined | null) => { + return spaceId && spaceId !== 'default' ? `/s/${spaceId}` : ``; +}; + +export const setupAuth = ({ + apiCall, + headers, + auth, +}: { + apiCall: SuperTest.Test; + headers: Record; + auth?: { user: User; space: string | null } | null; +}): SuperTest.Test => { + if (!Object.hasOwn(headers, 'Cookie') && auth != null) { + return apiCall.auth(auth.user.username, auth.user.password); + } + + return apiCall; +}; diff --git a/x-pack/test/cases_api_integration/common/lib/utils.ts b/x-pack/test/cases_api_integration/common/lib/api/index.ts similarity index 64% rename from x-pack/test/cases_api_integration/common/lib/utils.ts rename to x-pack/test/cases_api_integration/common/lib/api/index.ts index 4067fc12f7515..1c9534c84d04b 100644 --- a/x-pack/test/cases_api_integration/common/lib/utils.ts +++ b/x-pack/test/cases_api_integration/common/lib/api/index.ts @@ -5,8 +5,6 @@ * 2.0. */ -import { omit } from 'lodash'; - import expect from '@kbn/expect'; import type * as estypes from '@elastic/elasticsearch/lib/api/typesWithBodyKey'; import type { TransportResult } from '@elastic/elasticsearch'; @@ -23,20 +21,12 @@ import { CASE_TAGS_URL, } from '@kbn/cases-plugin/common/constants'; import { - CasesConfigureRequest, CasesConfigureResponse, - CaseConnector, - ConnectorTypes, - CasePostRequest, CaseResponse, CaseStatuses, CasesResponse, CasesFindResponse, - CommentRequest, - CommentResponse, CasesPatchRequest, - AllCommentsResponse, - CommentPatchRequest, CasesConfigurePatch, CasesStatusResponse, CasesConfigurationsResponse, @@ -45,8 +35,6 @@ import { CasesByAlertId, CaseResolveResponse, SingleCaseMetricsResponse, - BulkCreateCommentRequest, - CommentType, CasesMetricsResponse, CasesBulkGetResponse, } from '@kbn/cases-plugin/common/api'; @@ -55,9 +43,18 @@ import { ActionResult } from '@kbn/actions-plugin/server/types'; import { ESCasesConfigureAttributes } from '@kbn/cases-plugin/server/services/configure/types'; import { ESCaseAttributes } from '@kbn/cases-plugin/server/services/cases/types'; import type { SavedObjectsRawDocSource } from '@kbn/core/server'; -import { User } from './authentication/types'; -import { superUser } from './authentication/users'; -import { postCaseReq } from './mock'; +import { User } from '../authentication/types'; +import { superUser } from '../authentication/users'; +import { getSpaceUrlPrefix, setupAuth } from './helpers'; + +export * from './attachments'; +export * from './case'; +export * from './connectors'; +export * from './user_actions'; +export * from './user_profiles'; +export * from './omit'; +export * from './configuration'; +export { getSpaceUrlPrefix } from './helpers'; function toArray(input: T | T[]): T[] { if (Array.isArray(input)) { @@ -162,44 +159,6 @@ export const deleteCaseAction = async ( await supertest.delete(`/api/actions/connector/${id}`).set('kbn-xsrf', 'foo'); }; -type ConfigRequestParams = Partial & { - overrides?: Record; -}; - -export const getConfigurationRequest = ({ - id = 'none', - name = 'none', - type = ConnectorTypes.none, - fields = null, - overrides, -}: ConfigRequestParams = {}): CasesConfigureRequest => { - return { - connector: { - id, - name, - type, - fields, - } as CaseConnector, - closure_type: 'close-by-user', - owner: 'securitySolutionFixture', - ...overrides, - }; -}; - -export const getConfigurationOutput = ( - update = false, - overwrite = {} -): Partial => { - return { - ...getConfigurationRequest(), - error: null, - mappings: [], - created_by: { email: null, full_name: null, username: 'elastic' }, - updated_by: update ? { email: null, full_name: null, username: 'elastic' } : null, - ...overwrite, - }; -}; - export const getMappings = () => [ { source: 'title', @@ -218,48 +177,6 @@ export const getMappings = () => [ }, ]; -interface CommonSavedObjectAttributes { - id?: string | null; - created_at?: string | null; - updated_at?: string | null; - version?: string | null; - [key: string]: unknown; -} - -const savedObjectCommonAttributes = ['created_at', 'updated_at', 'version', 'id']; - -export const removeServerGeneratedPropertiesFromObject = ( - object: T, - keys: K[] -): Omit => { - return omit(object, keys); -}; -export const removeServerGeneratedPropertiesFromSavedObject = < - T extends CommonSavedObjectAttributes ->( - attributes: T, - keys: Array = [] -): Omit => { - return removeServerGeneratedPropertiesFromObject(attributes, [ - ...savedObjectCommonAttributes, - ...keys, - ]); -}; - -export const removeServerGeneratedPropertiesFromCase = ( - theCase: CaseResponse -): Partial => { - return removeServerGeneratedPropertiesFromSavedObject(theCase, ['closed_at']); -}; - -export const removeServerGeneratedPropertiesFromComments = ( - comments: CommentResponse[] | undefined -): Array> | undefined => { - return comments?.map((comment) => { - return removeServerGeneratedPropertiesFromSavedObject(comment, []); - }); -}; - export const deleteAllCaseItems = async (es: Client) => { await Promise.all([ deleteCasesByESQuery(es), @@ -345,10 +262,6 @@ export function getActionsSpace(space: string | null) { return space ?? 'default'; } -export const getSpaceUrlPrefix = (spaceId: string | undefined | null) => { - return spaceId && spaceId !== 'default' ? `/s/${spaceId}` : ``; -}; - interface OwnerEntity { owner: string; } @@ -445,124 +358,6 @@ export const getCaseSavedObjectsFromES = async ({ es }: { es: Client }) => { return configure; }; -export const createCase = async ( - supertest: SuperTest.SuperTest, - params: CasePostRequest, - expectedHttpCode: number = 200, - auth: { user: User; space: string | null } | null = { user: superUser, space: null }, - headers: Record = {} -): Promise => { - const apiCall = supertest.post(`${getSpaceUrlPrefix(auth?.space)}${CASES_URL}`); - - setupAuth({ apiCall, headers, auth }); - - const { body: theCase } = await apiCall - .set('kbn-xsrf', 'true') - .set(headers) - .send(params) - .expect(expectedHttpCode); - - return theCase; -}; - -const setupAuth = ({ - apiCall, - headers, - auth, -}: { - apiCall: SuperTest.Test; - headers: Record; - auth?: { user: User; space: string | null } | null; -}): SuperTest.Test => { - if (!Object.hasOwn(headers, 'Cookie') && auth != null) { - return apiCall.auth(auth.user.username, auth.user.password); - } - - return apiCall; -}; - -/** - * Sends a delete request for the specified case IDs. - */ -export const deleteCases = async ({ - supertest, - caseIDs, - expectedHttpCode = 204, - auth = { user: superUser, space: null }, -}: { - supertest: SuperTest.SuperTest; - caseIDs: string[]; - expectedHttpCode?: number; - auth?: { user: User; space: string | null }; -}) => { - const { body } = await supertest - .delete(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}`) - .auth(auth.user.username, auth.user.password) - // we need to json stringify here because just passing in the array of case IDs will cause a 400 with Kibana - // not being able to parse the array correctly. The format ids=["1", "2"] seems to work, which stringify outputs. - .query({ ids: JSON.stringify(caseIDs) }) - .set('kbn-xsrf', 'true') - .send() - .expect(expectedHttpCode); - - return body; -}; - -export const createComment = async ({ - supertest, - caseId, - params, - auth = { user: superUser, space: null }, - expectedHttpCode = 200, - headers = {}, -}: { - supertest: SuperTest.SuperTest; - caseId: string; - params: CommentRequest; - auth?: { user: User; space: string | null } | null; - expectedHttpCode?: number; - headers?: Record; -}): Promise => { - const apiCall = supertest.post( - `${getSpaceUrlPrefix(auth?.space)}${CASES_URL}/${caseId}/comments` - ); - - setupAuth({ apiCall, headers, auth }); - - const { body: theCase } = await apiCall - .set('kbn-xsrf', 'true') - .set(headers) - .send(params) - .expect(expectedHttpCode); - - return theCase; -}; - -export const bulkCreateAttachments = async ({ - supertest, - caseId, - params, - auth = { user: superUser, space: null }, - expectedHttpCode = 200, -}: { - supertest: SuperTest.SuperTest; - caseId: string; - params: BulkCreateCommentRequest; - auth?: { user: User; space: string | null }; - expectedHttpCode?: number; -}): Promise => { - const { body: theCase } = await supertest - .post( - `${getSpaceUrlPrefix(auth.space)}${CASES_INTERNAL_URL}/${caseId}/attachments/_bulk_create` - ) - .auth(auth.user.username, auth.user.password) - .set('kbn-xsrf', 'true') - .send(params) - .expect(expectedHttpCode); - - return theCase; -}; - export const updateCase = async ({ supertest, params, @@ -589,119 +384,6 @@ export const updateCase = async ({ return cases; }; -export const deleteComment = async ({ - supertest, - caseId, - commentId, - expectedHttpCode = 204, - auth = { user: superUser, space: null }, -}: { - supertest: SuperTest.SuperTest; - caseId: string; - commentId: string; - expectedHttpCode?: number; - auth?: { user: User; space: string | null }; -}): Promise<{} | Error> => { - const { body: comment } = await supertest - .delete(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}/${caseId}/comments/${commentId}`) - .set('kbn-xsrf', 'true') - .auth(auth.user.username, auth.user.password) - .expect(expectedHttpCode) - .send(); - - return comment; -}; - -export const deleteAllComments = async ({ - supertest, - caseId, - expectedHttpCode = 204, - auth = { user: superUser, space: null }, -}: { - supertest: SuperTest.SuperTest; - caseId: string; - expectedHttpCode?: number; - auth?: { user: User; space: string | null }; -}): Promise<{} | Error> => { - const { body: comment } = await supertest - .delete(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}/${caseId}/comments`) - .set('kbn-xsrf', 'true') - .auth(auth.user.username, auth.user.password) - .expect(expectedHttpCode) - .send(); - - return comment; -}; - -export const getAllComments = async ({ - supertest, - caseId, - expectedHttpCode = 200, - auth = { user: superUser, space: null }, -}: { - supertest: SuperTest.SuperTest; - caseId: string; - auth?: { user: User; space: string | null }; - expectedHttpCode?: number; -}): Promise => { - const { body: comments } = await supertest - .get(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}/${caseId}/comments`) - .auth(auth.user.username, auth.user.password) - .expect(expectedHttpCode); - - return comments; -}; - -export const getComment = async ({ - supertest, - caseId, - commentId, - expectedHttpCode = 200, - auth = { user: superUser, space: null }, -}: { - supertest: SuperTest.SuperTest; - caseId: string; - commentId: string; - expectedHttpCode?: number; - auth?: { user: User; space: string | null }; -}): Promise => { - const { body: comment } = await supertest - .get(`${getSpaceUrlPrefix(auth.space)}${CASES_URL}/${caseId}/comments/${commentId}`) - .auth(auth.user.username, auth.user.password) - .expect(expectedHttpCode); - - return comment; -}; - -export const updateComment = async ({ - supertest, - caseId, - req, - expectedHttpCode = 200, - auth = { user: superUser, space: null }, - headers = {}, -}: { - supertest: SuperTest.SuperTest; - caseId: string; - req: CommentPatchRequest; - expectedHttpCode?: number; - auth?: { user: User; space: string | null } | null; - headers?: Record; -}): Promise => { - const apiCall = supertest.patch( - `${getSpaceUrlPrefix(auth?.space)}${CASES_URL}/${caseId}/comments` - ); - - setupAuth({ apiCall, headers, auth }); - const { body: res } = await apiCall - .set('kbn-xsrf', 'true') - .set(headers) - .send(req) - .expect(expectedHttpCode); - - return res; -}; - export const getConfiguration = async ({ supertest, query = { owner: 'securitySolutionFixture' }, @@ -723,26 +405,6 @@ export const getConfiguration = async ({ return configuration; }; -export const createConfiguration = async ( - supertest: SuperTest.SuperTest, - req: CasesConfigureRequest = getConfigurationRequest(), - expectedHttpCode: number = 200, - auth: { user: User; space: string | null } | null = { user: superUser, space: null }, - headers: Record = {} -): Promise => { - const apiCall = supertest.post(`${getSpaceUrlPrefix(auth?.space)}${CASE_CONFIGURE_URL}`); - - setupAuth({ apiCall, headers, auth }); - - const { body: configuration } = await apiCall - .set('kbn-xsrf', 'true') - .set(headers) - .send(req) - .expect(expectedHttpCode); - - return configuration; -}; - export type CreateConnectorResponse = Omit & { connector_type_id: string; }; @@ -1007,51 +669,6 @@ export const extractWarningValueFromWarningHeader = (warningHeader: string) => { return warningValue; }; -export const getAttachments = (numberOfAttachments: number): BulkCreateCommentRequest => { - return [...Array(numberOfAttachments)].map((index) => { - if (index % 0) { - return { - type: CommentType.user, - comment: `Test ${index + 1}`, - owner: 'securitySolutionFixture', - }; - } - - return { - type: CommentType.alert, - alertId: `test-id-${index + 1}`, - index: `test-index-${index + 1}`, - rule: { - id: `rule-test-id-${index + 1}`, - name: `Test ${index + 1}`, - }, - owner: 'securitySolutionFixture', - }; - }); -}; - -export const createCaseAndBulkCreateAttachments = async ({ - supertest, - numberOfAttachments = 3, - auth = { user: superUser, space: null }, - expectedHttpCode = 200, -}: { - supertest: SuperTest.SuperTest; - numberOfAttachments?: number; - auth?: { user: User; space: string | null }; - expectedHttpCode?: number; -}): Promise<{ theCase: CaseResponse; attachments: BulkCreateCommentRequest }> => { - const postedCase = await createCase(supertest, postCaseReq); - const attachments = getAttachments(numberOfAttachments); - const patchedCase = await bulkCreateAttachments({ - supertest, - caseId: postedCase.id, - params: attachments, - }); - - return { theCase: patchedCase, attachments }; -}; - export const delay = (ms: number) => new Promise((resolve) => setTimeout(resolve, ms)); export const calculateDuration = (closedAt: string | null, createdAt: string | null): number => { diff --git a/x-pack/test/cases_api_integration/common/lib/api/omit.ts b/x-pack/test/cases_api_integration/common/lib/api/omit.ts new file mode 100644 index 0000000000000..0b069f409157b --- /dev/null +++ b/x-pack/test/cases_api_integration/common/lib/api/omit.ts @@ -0,0 +1,51 @@ +/* + * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one + * or more contributor license agreements. Licensed under the Elastic License + * 2.0; you may not use this file except in compliance with the Elastic License + * 2.0. + */ + +import { CaseResponse, CommentResponse } from '@kbn/cases-plugin/common/api'; +import { omit } from 'lodash'; + +interface CommonSavedObjectAttributes { + id?: string | null; + created_at?: string | null; + updated_at?: string | null; + version?: string | null; + [key: string]: unknown; +} + +const savedObjectCommonAttributes = ['created_at', 'updated_at', 'version', 'id']; + +export const removeServerGeneratedPropertiesFromObject = ( + object: T, + keys: K[] +): Omit => { + return omit(object, keys); +}; +export const removeServerGeneratedPropertiesFromSavedObject = < + T extends CommonSavedObjectAttributes +>( + attributes: T, + keys: Array = [] +): Omit => { + return removeServerGeneratedPropertiesFromObject(attributes, [ + ...savedObjectCommonAttributes, + ...keys, + ]); +}; + +export const removeServerGeneratedPropertiesFromCase = ( + theCase: CaseResponse +): Partial => { + return removeServerGeneratedPropertiesFromSavedObject(theCase, ['closed_at']); +}; + +export const removeServerGeneratedPropertiesFromComments = ( + comments: CommentResponse[] | undefined +): Array> | undefined => { + return comments?.map((comment) => { + return removeServerGeneratedPropertiesFromSavedObject(comment, []); + }); +}; diff --git a/x-pack/test/cases_api_integration/common/lib/user_actions.ts b/x-pack/test/cases_api_integration/common/lib/api/user_actions.ts similarity index 93% rename from x-pack/test/cases_api_integration/common/lib/user_actions.ts rename to x-pack/test/cases_api_integration/common/lib/api/user_actions.ts index ebe1525ead4a0..1f583a5412119 100644 --- a/x-pack/test/cases_api_integration/common/lib/user_actions.ts +++ b/x-pack/test/cases_api_integration/common/lib/api/user_actions.ts @@ -18,10 +18,11 @@ import { getCaseUsersUrl, } from '@kbn/cases-plugin/common/api'; import type SuperTest from 'supertest'; -import { User } from './authentication/types'; +import { User } from '../authentication/types'; -import { superUser } from './authentication/users'; -import { getSpaceUrlPrefix, removeServerGeneratedPropertiesFromObject } from './utils'; +import { superUser } from '../authentication/users'; +import { getSpaceUrlPrefix } from './helpers'; +import { removeServerGeneratedPropertiesFromObject } from './omit'; export const removeServerGeneratedPropertiesFromUserAction = ( attributes: CaseUserActionDeprecatedResponse diff --git a/x-pack/test/cases_api_integration/common/lib/user_profiles.ts b/x-pack/test/cases_api_integration/common/lib/api/user_profiles.ts similarity index 94% rename from x-pack/test/cases_api_integration/common/lib/user_profiles.ts rename to x-pack/test/cases_api_integration/common/lib/api/user_profiles.ts index 0c0a717809d30..7cf75968d865b 100644 --- a/x-pack/test/cases_api_integration/common/lib/user_profiles.ts +++ b/x-pack/test/cases_api_integration/common/lib/api/user_profiles.ts @@ -12,11 +12,11 @@ import { UserProfileBulkGetParams, UserProfileServiceStart } from '@kbn/security import { INTERNAL_SUGGEST_USER_PROFILES_URL } from '@kbn/cases-plugin/common/constants'; import { SuggestUserProfilesRequest } from '@kbn/cases-plugin/common/api'; import { UserProfileService } from '@kbn/cases-plugin/server/services'; -import { superUser } from './authentication/users'; -import { User } from './authentication/types'; -import { getSpaceUrlPrefix } from './utils'; -import { FtrProviderContext as CommonFtrProviderContext } from '../ftr_provider_context'; -import { getUserInfo } from './authentication'; +import { superUser } from '../authentication/users'; +import { User } from '../authentication/types'; +import { getSpaceUrlPrefix } from './helpers'; +import { FtrProviderContext as CommonFtrProviderContext } from '../../ftr_provider_context'; +import { getUserInfo } from '../authentication'; type BulkGetUserProfilesParams = Omit & { uids: string[] }; diff --git a/x-pack/test/cases_api_integration/common/lib/attachments.ts b/x-pack/test/cases_api_integration/common/lib/attachments.ts deleted file mode 100644 index 129ede6fc21cc..0000000000000 --- a/x-pack/test/cases_api_integration/common/lib/attachments.ts +++ /dev/null @@ -1,38 +0,0 @@ -/* - * Copyright Elasticsearch B.V. and/or licensed to Elasticsearch B.V. under one - * or more contributor license agreements. Licensed under the Elastic License - * 2.0; you may not use this file except in compliance with the Elastic License - * 2.0. - */ - -import type SuperTest from 'supertest'; -import { - BulkGetAttachmentsResponse, - getCaseBulkGetAttachmentsUrl, -} from '@kbn/cases-plugin/common/api'; -import { User } from './authentication/types'; -import { superUser } from './authentication/users'; -import { getSpaceUrlPrefix } from './utils'; - -export const bulkGetAttachments = async ({ - supertest, - attachmentIds, - caseId, - expectedHttpCode = 200, - auth = { user: superUser, space: null }, -}: { - supertest: SuperTest.SuperTest; - attachmentIds: string[]; - caseId: string; - auth?: { user: User; space: string | null }; - expectedHttpCode?: number; -}): Promise => { - const { body: comments } = await supertest - .post(`${getSpaceUrlPrefix(auth.space)}${getCaseBulkGetAttachmentsUrl(caseId)}`) - .send({ ids: attachmentIds }) - .set('kbn-xsrf', 'abc') - .auth(auth.user.username, auth.user.password) - .expect(expectedHttpCode); - - return comments; -}; diff --git a/x-pack/test/cases_api_integration/common/lib/authentication/index.ts b/x-pack/test/cases_api_integration/common/lib/authentication/index.ts index 65e82a2e4fbf3..d425eae5a373c 100644 --- a/x-pack/test/cases_api_integration/common/lib/authentication/index.ts +++ b/x-pack/test/cases_api_integration/common/lib/authentication/index.ts @@ -10,7 +10,7 @@ import { Role, User, UserInfo } from './types'; import { obsOnly, secOnly, secOnlyNoDelete, secOnlyRead, users } from './users'; import { roles } from './roles'; import { spaces } from './spaces'; -import { loginUsers } from '../user_profiles'; +import { loginUsers } from '../api'; export const getUserInfo = (user: User): UserInfo => ({ username: user.username, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/cases/assignees.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/cases/assignees.ts index 12be90df3afa5..916371af5bb3c 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/cases/assignees.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/cases/assignees.ts @@ -7,12 +7,7 @@ import { FtrProviderContext } from '../../../../../common/ftr_provider_context'; import { getPostCaseRequest } from '../../../../common/lib/mock'; -import { - createCase, - updateCase, - findCases, - deleteAllCaseItems, -} from '../../../../common/lib/utils'; +import { createCase, updateCase, findCases, deleteAllCaseItems } from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/cases/push_case.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/cases/push_case.ts index 536863dc95d0a..ae37c59183078 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/cases/push_case.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/cases/push_case.ts @@ -18,9 +18,9 @@ import { createConfiguration, createCase, pushCase, -} from '../../../../common/lib/utils'; - -import { getServiceNowConnector, createConnector } from '../../../../common/lib/connectors'; + createConnector, + getServiceNowConnector, +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/configure/get_connectors.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/configure/get_connectors.ts index f91826f431d86..9b6ec3fe667e2 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/configure/get_connectors.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/configure/get_connectors.ts @@ -8,7 +8,7 @@ import expect from '@kbn/expect'; import { FtrProviderContext } from '../../../../../common/ftr_provider_context'; -import { getCaseConnectors } from '../../../../common/lib/connectors'; +import { getCaseConnectors } from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/internal/suggest_user_profiles.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/internal/suggest_user_profiles.ts index 231bacdfce397..3dd75d32039bb 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/internal/suggest_user_profiles.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/basic/internal/suggest_user_profiles.ts @@ -6,8 +6,7 @@ */ import { FtrProviderContext } from '../../../../../common/ftr_provider_context'; -import { deleteAllCaseItems } from '../../../../common/lib/utils'; -import { suggestUserProfiles } from '../../../../common/lib/user_profiles'; +import { deleteAllCaseItems, suggestUserProfiles } from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/alerts/get_alerts_attached_to_case.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/alerts/get_alerts_attached_to_case.ts index d7b4e82c017db..2b2d22e5154c6 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/alerts/get_alerts_attached_to_case.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/alerts/get_alerts_attached_to_case.ts @@ -14,7 +14,7 @@ import { createComment, deleteAllCaseItems, getAlertsAttachedToCase, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { globalRead, noKibanaPrivileges, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/alerts/get_cases.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/alerts/get_cases.ts index d0a5f45dae851..ba3ad76740d29 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/alerts/get_cases.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/alerts/get_cases.ts @@ -20,7 +20,7 @@ import { createComment, getCasesByAlert, deleteAllCaseItems, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { validateCasesFromAlertIDResponse } from '../../../../common/lib/validation'; import { globalRead, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/attachments_framework/external_references.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/attachments_framework/external_references.ts index 5a36f2a30d39a..56ede2f7390ca 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/attachments_framework/external_references.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/attachments_framework/external_references.ts @@ -30,8 +30,8 @@ import { updateComment, getSOFromKibanaIndex, getReferenceFromEsResponse, -} from '../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../common/lib/user_actions'; + getCaseUserActions, +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/attachments_framework/persistable_state.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/attachments_framework/persistable_state.ts index b13258cb1704f..0eef2b98c61e4 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/attachments_framework/persistable_state.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/attachments_framework/persistable_state.ts @@ -30,8 +30,8 @@ import { getReferenceFromEsResponse, bulkCreateAttachments, updateComment, -} from '../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../common/lib/user_actions'; + getCaseUserActions, +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/delete_cases.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/delete_cases.ts index 87a3321a4f70e..957f304b8e829 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/delete_cases.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/delete_cases.ts @@ -19,8 +19,8 @@ import { getComment, getCase, superUserSpace1Auth, -} from '../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../common/lib/user_actions'; + getCaseUserActions, +} from '../../../../common/lib/api'; import { secOnly, secOnlyRead, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/find_cases.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/find_cases.ts index 743929b1b1182..712ec4722d500 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/find_cases.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/find_cases.ts @@ -30,7 +30,7 @@ import { createCase, updateCase, createComment, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { obsOnly, secOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/get_case.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/get_case.ts index d11cf527da983..c64de25aa6551 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/get_case.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/get_case.ts @@ -25,7 +25,7 @@ import { removeServerGeneratedPropertiesFromCase, removeServerGeneratedPropertiesFromSavedObject, extractWarningValueFromWarningHeader, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { secOnly, obsOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/import_export.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/import_export.ts index 7d57edba432e7..1a3dd08e369d0 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/import_export.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/import_export.ts @@ -35,8 +35,8 @@ import { createCase, createComment, findCases, -} from '../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../common/lib/user_actions'; + getCaseUserActions, +} from '../../../../common/lib/api'; import { getPostCaseRequest, postCommentUserReq } from '../../../../common/lib/mock'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/migrations.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/migrations.ts index 107371491ff38..a63e1b3be5c67 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/migrations.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/migrations.ts @@ -15,7 +15,7 @@ import { getCase, getCaseSavedObjectsFromES, resolveCase, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { superUser } from '../../../../common/lib/authentication/users'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/patch_cases.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/patch_cases.ts index 4c74c802a663c..ea30095f8b832 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/patch_cases.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/patch_cases.ts @@ -35,11 +35,9 @@ import { superUserSpace1Auth, delay, calculateDuration, -} from '../../../../common/lib/utils'; -import { getCaseUserActions, removeServerGeneratedPropertiesFromUserAction, -} from '../../../../common/lib/user_actions'; +} from '../../../../common/lib/api'; import { createSignalsIndex, deleteSignalsIndex, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/post_case.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/post_case.ts index 481942f695368..40425a0b14307 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/post_case.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/post_case.ts @@ -19,11 +19,9 @@ import { deleteCasesByESQuery, createCase, removeServerGeneratedPropertiesFromCase, -} from '../../../../common/lib/utils'; -import { getCaseUserActions, removeServerGeneratedPropertiesFromUserAction, -} from '../../../../common/lib/user_actions'; +} from '../../../../common/lib/api'; import { secOnly, secOnlyRead, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/reporters/get_reporters.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/reporters/get_reporters.ts index 902b83c66563d..87b9edeb30aad 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/reporters/get_reporters.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/reporters/get_reporters.ts @@ -9,7 +9,7 @@ import expect from '@kbn/expect'; import { FtrProviderContext } from '../../../../../common/ftr_provider_context'; import { defaultUser, getPostCaseRequest } from '../../../../../common/lib/mock'; -import { createCase, deleteCasesByESQuery, getReporters } from '../../../../../common/lib/utils'; +import { createCase, deleteCasesByESQuery, getReporters } from '../../../../../common/lib/api'; import { secOnly, obsOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/resolve_case.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/resolve_case.ts index 1f681f225938d..c4b84fecc1932 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/resolve_case.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/resolve_case.ts @@ -24,7 +24,7 @@ import { createComment, removeServerGeneratedPropertiesFromCase, removeServerGeneratedPropertiesFromSavedObject, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { secOnly, obsOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/status/get_status.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/status/get_status.ts index 4b7a11166ed16..7e3b49473cb5b 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/status/get_status.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/status/get_status.ts @@ -18,7 +18,7 @@ import { deleteAllCaseItems, superUserSpace1Auth, extractWarningValueFromWarningHeader, -} from '../../../../../common/lib/utils'; +} from '../../../../../common/lib/api'; import { globalRead, noKibanaPrivileges, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/tags/get_tags.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/tags/get_tags.ts index 689f961386755..78622f0ff3cde 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/tags/get_tags.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/cases/tags/get_tags.ts @@ -8,7 +8,7 @@ import expect from '@kbn/expect'; import { FtrProviderContext } from '../../../../../common/ftr_provider_context'; -import { deleteCasesByESQuery, createCase, getTags } from '../../../../../common/lib/utils'; +import { deleteCasesByESQuery, createCase, getTags } from '../../../../../common/lib/api'; import { getPostCaseRequest } from '../../../../../common/lib/mock'; import { secOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/client/update_alert_status.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/client/update_alert_status.ts index b7af123f9091a..6926b3e088ad1 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/client/update_alert_status.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/client/update_alert_status.ts @@ -15,7 +15,7 @@ import { createComment, deleteAllCaseItems, getSignalsWithES, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/delete_comment.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/delete_comment.ts index 9827b16e9f972..68a52c13ecbf0 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/delete_comment.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/delete_comment.ts @@ -19,7 +19,7 @@ import { deleteComment, deleteAllComments, superUserSpace1Auth, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { globalRead, noKibanaPrivileges, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/find_comments.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/find_comments.ts index 76b0901c3ee8c..7132972fb5b96 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/find_comments.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/find_comments.ts @@ -26,7 +26,7 @@ import { getSpaceUrlPrefix, createCase, superUserSpace1Auth, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { obsOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/get_all_comments.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/get_all_comments.ts index 321cd3e7d8196..95cf136089ca6 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/get_all_comments.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/get_all_comments.ts @@ -17,7 +17,7 @@ import { getAllComments, superUserSpace1Auth, extractWarningValueFromWarningHeader, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { globalRead, noKibanaPrivileges, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/get_comment.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/get_comment.ts index 55417ecc3f9cd..afbf91aeb1356 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/get_comment.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/get_comment.ts @@ -15,7 +15,7 @@ import { createComment, getComment, superUserSpace1Auth, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { globalRead, noKibanaPrivileges, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/migrations.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/migrations.ts index 9cbefbd2ee03d..af66682af5155 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/migrations.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/migrations.ts @@ -9,7 +9,7 @@ import expect from '@kbn/expect'; import { CASES_URL, SECURITY_SOLUTION_OWNER } from '@kbn/cases-plugin/common/constants'; import { CommentResponseAlertsType } from '@kbn/cases-plugin/common/api'; import { FtrProviderContext } from '../../../../../common/ftr_provider_context'; -import { deleteAllCaseItems, getComment } from '../../../../common/lib/utils'; +import { deleteAllCaseItems, getComment } from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default function createGetTests({ getService }: FtrProviderContext) { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/patch_comment.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/patch_comment.ts index 549e2547f84a0..c682896af4442 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/patch_comment.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/patch_comment.ts @@ -30,7 +30,7 @@ import { createComment, updateComment, superUserSpace1Auth, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { globalRead, noKibanaPrivileges, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/post_comment.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/post_comment.ts index c969a3791d6fc..69274e7a836f1 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/post_comment.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/comments/post_comment.ts @@ -34,11 +34,9 @@ import { removeServerGeneratedPropertiesFromSavedObject, superUserSpace1Auth, updateCase, -} from '../../../../common/lib/utils'; -import { getCaseUserActions, removeServerGeneratedPropertiesFromUserAction, -} from '../../../../common/lib/user_actions'; +} from '../../../../common/lib/api'; import { createSignalsIndex, deleteSignalsIndex, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/get_configure.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/get_configure.ts index 279936ebbef46..94e414fa23f45 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/get_configure.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/get_configure.ts @@ -16,7 +16,7 @@ import { createConfiguration, getConfigurationRequest, ensureSavedObjectIsAuthorized, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { obsOnly, secOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/migrations.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/migrations.ts index 6f489d99b52f3..722ff315ca044 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/migrations.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/migrations.ts @@ -12,7 +12,7 @@ import { getConfiguration, getConfigureSavedObjectsFromES, getConnectorMappingsFromES, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default function ({ getService }: FtrProviderContext) { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/patch_configure.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/patch_configure.ts index d2fa0d950e774..523b32a299187 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/patch_configure.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/patch_configure.ts @@ -18,7 +18,7 @@ import { updateConfiguration, getConfigurationRequest, getConfiguration, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { secOnly, obsOnlyRead, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/post_configure.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/post_configure.ts index 43cb5b21c978d..9bb99f1968af4 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/post_configure.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/configure/post_configure.ts @@ -18,7 +18,7 @@ import { createConfiguration, getConfiguration, ensureSavedObjectIsAuthorized, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { secOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_create_attachments.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_create_attachments.ts index bdecb88b1758f..27a7c54e68ecf 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_create_attachments.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_create_attachments.ts @@ -33,11 +33,9 @@ import { createCaseAndBulkCreateAttachments, bulkCreateAttachments, updateCase, -} from '../../../../common/lib/utils'; -import { getCaseUserActions, removeServerGeneratedPropertiesFromUserAction, -} from '../../../../common/lib/user_actions'; +} from '../../../../common/lib/api'; import { createSignalsIndex, deleteSignalsIndex, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_get_attachments.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_get_attachments.ts index 2f15c221c3ace..c5751ebf99a19 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_get_attachments.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_get_attachments.ts @@ -29,8 +29,8 @@ import { createComment, bulkCreateAttachments, ensureSavedObjectIsAuthorized, -} from '../../../../common/lib/utils'; -import { bulkGetAttachments } from '../../../../common/lib/attachments'; + bulkGetAttachments, +} from '../../../../common/lib/api'; import { globalRead, noKibanaPrivileges, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_get_cases.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_get_cases.ts index b2d8a8d5ee8cd..9c273eecd22eb 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_get_cases.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/bulk_get_cases.ts @@ -16,7 +16,7 @@ import { createCase, createComment, ensureSavedObjectIsAuthorized, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { secOnly, obsOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/get_connectors.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/get_connectors.ts index 8d3642b005642..1bf28cc0b1956 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/get_connectors.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/get_connectors.ts @@ -8,9 +8,9 @@ import expect from '@kbn/expect'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; -import { createCase, deleteAllCaseItems } from '../../../../common/lib/utils'; +import { createCase, deleteAllCaseItems } from '../../../../common/lib/api'; import { getPostCaseRequest } from '../../../../common/lib/mock'; -import { getConnectors } from '../../../../common/lib/connectors'; +import { getConnectors } from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/user_actions_get_users.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/user_actions_get_users.ts index 703d8d4e49637..a746bfbe8a14b 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/user_actions_get_users.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/internal/user_actions_get_users.ts @@ -10,10 +10,16 @@ import { Cookie } from 'tough-cookie'; import { UserProfile } from '@kbn/security-plugin/common'; import { securitySolutionOnlyAllSpacesRole } from '../../../../common/lib/authentication/roles'; import { getPostCaseRequest } from '../../../../common/lib/mock'; -import { createCase, deleteAllCaseItems, getCase, updateCase } from '../../../../common/lib/utils'; +import { + createCase, + deleteAllCaseItems, + getCase, + updateCase, + getCaseUsers, + loginUsers, + bulkGetUserProfiles, +} from '../../../../common/lib/api'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; -import { getCaseUsers } from '../../../../common/lib/user_actions'; -import { loginUsers, bulkGetUserProfiles } from '../../../../common/lib/user_profiles'; import { createUsersAndRoles, deleteUsersAndRoles } from '../../../../common/lib/authentication'; import { obsOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics.ts index d08a00ab4f088..1bafcfc84eb7b 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics.ts @@ -8,7 +8,7 @@ import expect from '@kbn/expect'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; -import { createCase, deleteAllCaseItems, getCaseMetrics } from '../../../../common/lib/utils'; +import { createCase, deleteAllCaseItems, getCaseMetrics } from '../../../../common/lib/api'; import { secOnly, obsOnly, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_actions.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_actions.ts index 7817149a3936c..f850ed1d472f1 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_actions.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_actions.ts @@ -14,7 +14,7 @@ import { createComment, deleteAllCaseItems, getCaseMetrics, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_alerts.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_alerts.ts index 060b7dda22dea..b270121ee947b 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_alerts.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_alerts.ts @@ -14,7 +14,7 @@ import { createComment, deleteAllCaseItems, getCaseMetrics, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { arraysToEqual } from '../../../../common/lib/validation'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_connectors.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_connectors.ts index ca99f5fb8a871..e42d2019033f1 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_connectors.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_case_metrics_connectors.ts @@ -16,7 +16,7 @@ import { deleteAllCaseItems, getCaseMetrics, updateCase, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_cases_metrics.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_cases_metrics.ts index 4a053de2515ba..c191cfc9e6d88 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_cases_metrics.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/metrics/get_cases_metrics.ts @@ -23,7 +23,7 @@ import { deleteAllCaseItems, getCasesMetrics, updateCase, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { getPostCaseRequest } from '../../../../common/lib/mock'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/find_user_actions.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/find_user_actions.ts index b117025a19303..ea7b41be84d89 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/find_user_actions.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/find_user_actions.ts @@ -24,7 +24,6 @@ import { secOnlyRead, superUser, } from '../../../../common/lib/authentication/users'; -import { findCaseUserActions, getCaseUserActions } from '../../../../common/lib/user_actions'; import { getPostCaseRequest, persistableStateAttachment, @@ -39,7 +38,9 @@ import { updateCase, createComment, bulkCreateAttachments, -} from '../../../../common/lib/utils'; + findCaseUserActions, + getCaseUserActions, +} from '../../../../common/lib/api'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/get_all_user_actions.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/get_all_user_actions.ts index d5bcc0152cddf..fc8ab00e63c64 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/get_all_user_actions.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/get_all_user_actions.ts @@ -28,8 +28,8 @@ import { updateComment, deleteComment, extractWarningValueFromWarningHeader, -} from '../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../common/lib/user_actions'; + getCaseUserActions, +} from '../../../../common/lib/api'; import { globalRead, noKibanaPrivileges, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/get_user_action_stats.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/get_user_action_stats.ts index 0f004820ad52b..8448f22b7f9e0 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/get_user_action_stats.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/get_user_action_stats.ts @@ -24,7 +24,6 @@ import { obsOnly, obsOnlyRead, } from '../../../../common/lib/authentication/users'; -import { getCaseUserActionStats } from '../../../../common/lib/user_actions'; import { getPostCaseRequest, persistableStateAttachment, @@ -42,7 +41,8 @@ import { deleteAllCaseItems, updateCase, superUserSpace1Auth, -} from '../../../../common/lib/utils'; + getCaseUserActionStats, +} from '../../../../common/lib/api'; const getCaseUpdateData = (id: string, version: string) => ({ status: CaseStatuses.open, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/migrations.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/migrations.ts index 5d80154752710..d43b7151aeef7 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/migrations.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/common/user_actions/migrations.ts @@ -13,8 +13,7 @@ import { CommentType, } from '@kbn/cases-plugin/common/api'; import { FtrProviderContext } from '../../../../../common/ftr_provider_context'; -import { deleteAllCaseItems } from '../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../common/lib/user_actions'; +import { deleteAllCaseItems, getCaseUserActions } from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default function createGetTests({ getService }: FtrProviderContext) { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/no_public_base_url/push.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/no_public_base_url/push.ts index 715029434324a..0efcf35e32837 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/no_public_base_url/push.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/no_public_base_url/push.ts @@ -18,11 +18,13 @@ import { import { FtrProviderContext } from '../../../common/ftr_provider_context'; import { ObjectRemover as ActionsRemover } from '../../../../alerting_api_integration/common/lib'; -import { pushCase, deleteAllCaseItems, bulkCreateAttachments } from '../../../common/lib/utils'; import { + pushCase, + deleteAllCaseItems, + bulkCreateAttachments, createCaseWithConnector, getRecordingServiceNowSimulatorServer, -} from '../../../common/lib/connectors'; +} from '../../../common/lib/api'; import { RecordingServiceNowSimulator } from '../../../../alerting_api_integration/common/plugins/actions_simulators/server/servicenow_simulation'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/assignees.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/assignees.ts index 574a843a858d7..35fa1e5acd75e 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/assignees.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/assignees.ts @@ -14,12 +14,12 @@ import { findCases, updateCase, deleteAllCaseItems, -} from '../../../../common/lib/utils'; - -import { generateFakeAssignees, suggestUserProfiles } from '../../../../common/lib/user_profiles'; + generateFakeAssignees, + suggestUserProfiles, + bulkGetUserProfiles, +} from '../../../../common/lib/api'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; -import { bulkGetUserProfiles } from '../../../../common/lib/user_profiles'; import { superUser } from '../../../../common/lib/authentication/users'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/find_cases.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/find_cases.ts index 655d629d8aa55..f80cd6742ab86 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/find_cases.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/find_cases.ts @@ -12,9 +12,14 @@ import { UserProfile } from '@kbn/security-plugin/common'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; import { findCasesResp, getPostCaseRequest } from '../../../../common/lib/mock'; -import { findCases, createCase, deleteAllCaseItems } from '../../../../common/lib/utils'; +import { + findCases, + createCase, + deleteAllCaseItems, + suggestUserProfiles, + loginUsers, +} from '../../../../common/lib/api'; import { secOnlySpacesAll, superUser } from '../../../../common/lib/authentication/users'; -import { suggestUserProfiles, loginUsers } from '../../../../common/lib/user_profiles'; import { getUserInfo } from '../../../../common/lib/authentication'; import { createUsersAndRoles, deleteUsersAndRoles } from '../../../../common/lib/authentication'; import { securitySolutionOnlyAllSpacesRole } from '../../../../common/lib/authentication/roles'; diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/push_case.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/push_case.ts index a50c11ff41407..b2ff62a9811a9 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/push_case.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/push_case.ts @@ -42,14 +42,14 @@ import { calculateDuration, getComment, bulkCreateAttachments, -} from '../../../../common/lib/utils'; -import { + loginUsers, + setupSuperUserProfile, getServiceNowConnector, createCaseWithConnector, getRecordingServiceNowSimulatorServer, getServiceNowSimulationServer, createConnector, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; import { globalRead, noKibanaPrivileges, @@ -60,7 +60,6 @@ import { superUser, } from '../../../../common/lib/authentication/users'; import { RecordingServiceNowSimulator } from '../../../../../alerting_api_integration/common/plugins/actions_simulators/server/servicenow_simulation'; -import { loginUsers, setupSuperUserProfile } from '../../../../common/lib/user_profiles'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/user_actions/find_user_actions.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/user_actions/find_user_actions.ts index 83103aebc9d39..2351dcd192cd9 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/user_actions/find_user_actions.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/user_actions/find_user_actions.ts @@ -14,12 +14,10 @@ import { createCase, updateCase, pushCase, -} from '../../../../../common/lib/utils'; -import { createCaseWithConnector, getServiceNowSimulationServer, -} from '../../../../../common/lib/connectors'; -import { findCaseUserActions } from '../../../../../common/lib/user_actions'; + findCaseUserActions, +} from '../../../../../common/lib/api'; import { ObjectRemover as ActionsRemover } from '../../../../../../alerting_api_integration/common/lib'; import { FtrProviderContext } from '../../../../../common/ftr_provider_context'; diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/user_actions/get_all_user_actions.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/user_actions/get_all_user_actions.ts index a39584861c7a7..6356733a027b8 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/user_actions/get_all_user_actions.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/cases/user_actions/get_all_user_actions.ts @@ -24,15 +24,13 @@ import { pushCase, updateCase, updateConfiguration, -} from '../../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../../common/lib/user_actions'; -import { createCaseWithConnector, getServiceNowSimulationServer, -} from '../../../../../common/lib/connectors'; + getCaseUserActions, +} from '../../../../../common/lib/api'; import { ObjectRemover as ActionsRemover } from '../../../../../../alerting_api_integration/common/lib'; -import { setupSuperUserProfile } from '../../../../../common/lib/user_profiles'; +import { setupSuperUserProfile } from '../../../../../common/lib/api/user_profiles'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/get_configure.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/get_configure.ts index 8b29db8e0f9b6..16638a4e61ecb 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/get_configure.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/get_configure.ts @@ -17,12 +17,10 @@ import { getConfigurationRequest, removeServerGeneratedPropertiesFromSavedObject, getConfigurationOutput, -} from '../../../../common/lib/utils'; -import { getServiceNowConnector, getServiceNowSimulationServer, createConnector, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/get_connectors.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/get_connectors.ts index 32dc2173b4ec7..bd24b8852b716 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/get_connectors.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/get_connectors.ts @@ -19,7 +19,7 @@ import { getEmailConnector, getCaseConnectors, getCasesWebhookConnector, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/patch_configure.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/patch_configure.ts index 0bec95a51b745..7fb89ed913e04 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/patch_configure.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/patch_configure.ts @@ -18,12 +18,10 @@ import { deleteConfiguration, createConfiguration, updateConfiguration, -} from '../../../../common/lib/utils'; -import { getServiceNowConnector, createConnector, getServiceNowSimulationServer, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/post_configure.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/post_configure.ts index 561008b71bd14..cfe8d0412ee4d 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/post_configure.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/configure/post_configure.ts @@ -17,12 +17,10 @@ import { getConfigurationOutput, deleteConfiguration, createConfiguration, -} from '../../../../common/lib/utils'; -import { getServiceNowConnector, getServiceNowSimulationServer, createConnector, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/delete_sub_privilege.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/delete_sub_privilege.ts index 922452c6b008f..75388fe0bfe19 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/delete_sub_privilege.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/delete_sub_privilege.ts @@ -21,7 +21,7 @@ import { getSpaceUrlPrefix, updateComment, deleteAllComments, -} from '../../../common/lib/utils'; +} from '../../../common/lib/api'; import { superUser, secOnlyDelete, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/get_connectors.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/get_connectors.ts index 83be12a31a432..4987ab5b307ec 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/get_connectors.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/get_connectors.ts @@ -33,17 +33,15 @@ import { deleteAllCaseItems, pushCase, updateCase, -} from '../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../common/lib/user_actions'; -import { getPostCaseRequest, postCommentUserReq } from '../../../../common/lib/mock'; -import { createCaseWithConnector, createConnector, getConnectors, getJiraConnector, getServiceNowConnector, getServiceNowSimulationServer, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; +import { getCaseUserActions } from '../../../../common/lib/api/user_actions'; +import { getPostCaseRequest, postCommentUserReq } from '../../../../common/lib/mock'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/get_user_action_stats.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/get_user_action_stats.ts index 370cd2a98149b..b90e6212f63bf 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/get_user_action_stats.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/get_user_action_stats.ts @@ -11,15 +11,18 @@ import expect from '@kbn/expect'; import { ConnectorTypes } from '@kbn/cases-plugin/common/api'; import { ObjectRemover as ActionsRemover } from '../../../../../alerting_api_integration/common/lib'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; -import { createCase, deleteAllCaseItems, pushCase, updateCase } from '../../../../common/lib/utils'; import { postCaseReq } from '../../../../common/lib/mock'; import { createCaseWithConnector, createConnector, getJiraConnector, getServiceNowSimulationServer, -} from '../../../../common/lib/connectors'; -import { getCaseUserActionStats } from '../../../../common/lib/user_actions'; + getCaseUserActionStats, + createCase, + deleteAllCaseItems, + pushCase, + updateCase, +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/suggest_user_profiles.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/suggest_user_profiles.ts index f5feab6f04557..db3f529863f01 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/suggest_user_profiles.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/suggest_user_profiles.ts @@ -6,7 +6,7 @@ */ import expect from '@kbn/expect'; -import { loginUsers, suggestUserProfiles } from '../../../../common/lib/user_profiles'; +import { loginUsers, suggestUserProfiles } from '../../../../common/lib/api'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; import { superUser, diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/user_actions_get_users.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/user_actions_get_users.ts index 766c4e9f35c77..142081d4a5190 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/user_actions_get_users.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/internal/user_actions_get_users.ts @@ -10,10 +10,15 @@ import { Cookie } from 'tough-cookie'; import { UserProfile } from '@kbn/security-plugin/common'; import { securitySolutionOnlyAllSpacesRole } from '../../../../common/lib/authentication/roles'; import { getPostCaseRequest } from '../../../../common/lib/mock'; -import { createCase, deleteAllCaseItems, updateCase } from '../../../../common/lib/utils'; +import { + createCase, + deleteAllCaseItems, + updateCase, + getCaseUsers, + loginUsers, + bulkGetUserProfiles, +} from '../../../../common/lib/api'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; -import { getCaseUsers } from '../../../../common/lib/user_actions'; -import { loginUsers, bulkGetUserProfiles } from '../../../../common/lib/user_profiles'; import { createUsersAndRoles, deleteUsersAndRoles } from '../../../../common/lib/authentication'; import { secOnlySpacesAll, superUser } from '../../../../common/lib/authentication/users'; diff --git a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/user_profiles/get_current.ts b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/user_profiles/get_current.ts index 5b97eeb6ed9d0..17b0947c0fcf0 100644 --- a/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/user_profiles/get_current.ts +++ b/x-pack/test/cases_api_integration/security_and_spaces/tests/trial/user_profiles/get_current.ts @@ -8,7 +8,7 @@ import expect from '@kbn/expect'; import { CaseStatuses, CommentType } from '@kbn/cases-plugin/common'; import { CreateCaseUserAction, User } from '@kbn/cases-plugin/common/api'; -import { setupSuperUserProfile } from '../../../../common/lib/user_profiles'; +import { setupSuperUserProfile } from '../../../../common/lib/api/user_profiles'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; import { superUser } from '../../../../common/lib/authentication/users'; import { @@ -21,8 +21,8 @@ import { updateComment, getConfigurationRequest, updateConfiguration, -} from '../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../common/lib/user_actions'; +} from '../../../../common/lib/api'; +import { getCaseUserActions } from '../../../../common/lib/api/user_actions'; import { getPostCaseRequest, postCommentUserReq } from '../../../../common/lib/mock'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/alerts/get_cases.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/alerts/get_cases.ts index be0a698a6b525..370500373ca82 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/alerts/get_cases.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/alerts/get_cases.ts @@ -15,7 +15,7 @@ import { getCasesByAlert, deleteAllCaseItems, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { validateCasesFromAlertIDResponse } from '../../../../common/lib/validation'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/delete_cases.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/delete_cases.ts index d94cea06e5713..29a1e2035b970 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/delete_cases.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/delete_cases.ts @@ -15,7 +15,7 @@ import { deleteCases, getCase, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/find_cases.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/find_cases.ts index 723e2330bdd93..cc332b9646092 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/find_cases.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/find_cases.ts @@ -14,7 +14,7 @@ import { findCases, createCase, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/get_case.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/get_case.ts index 0df628f93b28b..0a2fcc16771ed 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/get_case.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/get_case.ts @@ -15,7 +15,7 @@ import { getCase, removeServerGeneratedPropertiesFromCase, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/patch_cases.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/patch_cases.ts index ccf22279ec197..6b64d9eab2ec2 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/patch_cases.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/patch_cases.ts @@ -15,7 +15,7 @@ import { updateCase, removeServerGeneratedPropertiesFromCase, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/post_case.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/post_case.ts index f78816dd7ba1d..e4117fa77218a 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/post_case.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/post_case.ts @@ -14,7 +14,7 @@ import { createCase, removeServerGeneratedPropertiesFromCase, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/reporters/get_reporters.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/reporters/get_reporters.ts index 983983f5d3b3e..d5e70278467df 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/reporters/get_reporters.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/reporters/get_reporters.ts @@ -14,7 +14,7 @@ import { deleteCasesByESQuery, getAuthWithSuperUser, getReporters, -} from '../../../../../common/lib/utils'; +} from '../../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/status/get_status.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/status/get_status.ts index b48543d3699f6..e8a8ef6147f6f 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/status/get_status.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/status/get_status.ts @@ -16,7 +16,7 @@ import { getAllCasesStatuses, deleteAllCaseItems, getAuthWithSuperUser, -} from '../../../../../common/lib/utils'; +} from '../../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/tags/get_tags.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/tags/get_tags.ts index 41074cd252735..11aa99bb61b7e 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/tags/get_tags.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/cases/tags/get_tags.ts @@ -13,7 +13,7 @@ import { createCase, getTags, getAuthWithSuperUser, -} from '../../../../../common/lib/utils'; +} from '../../../../../common/lib/api'; import { getPostCaseRequest } from '../../../../../common/lib/mock'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/delete_comment.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/delete_comment.ts index e43c41809eb3a..258ca0e09f96d 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/delete_comment.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/delete_comment.ts @@ -17,7 +17,7 @@ import { createComment, deleteComment, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/find_comments.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/find_comments.ts index 5bc9fd400de77..8a5ddc05d083b 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/find_comments.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/find_comments.ts @@ -18,7 +18,7 @@ import { getSpaceUrlPrefix, createCase, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/get_all_comments.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/get_all_comments.ts index 9eba39d0a8545..344a85c1be59d 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/get_all_comments.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/get_all_comments.ts @@ -15,7 +15,7 @@ import { createComment, getAllComments, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/get_comment.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/get_comment.ts index ebffac50e131a..5d1b6d2115907 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/get_comment.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/get_comment.ts @@ -15,7 +15,7 @@ import { createComment, getComment, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/patch_comment.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/patch_comment.ts index 395fa81dcb968..ff30df54f6efe 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/patch_comment.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/patch_comment.ts @@ -18,7 +18,7 @@ import { createComment, updateComment, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/post_comment.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/post_comment.ts index 1eccb0dba8759..12793cb83fed9 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/post_comment.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/comments/post_comment.ts @@ -16,7 +16,7 @@ import { removeServerGeneratedPropertiesFromSavedObject, getAuthWithSuperUser, deleteAllCaseItems, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/get_configure.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/get_configure.ts index b1873d912890d..b2ec6ce070fa3 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/get_configure.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/get_configure.ts @@ -17,7 +17,7 @@ import { createConfiguration, getConfigurationRequest, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/patch_configure.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/patch_configure.ts index c681718d50cb5..fd6610f2ba3b8 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/patch_configure.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/patch_configure.ts @@ -16,7 +16,7 @@ import { createConfiguration, updateConfiguration, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { nullUser } from '../../../../common/lib/mock'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/post_configure.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/post_configure.ts index a3e7a8f58e24a..22efa11896089 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/post_configure.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/configure/post_configure.ts @@ -15,7 +15,7 @@ import { deleteConfiguration, createConfiguration, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; import { nullUser } from '../../../../common/lib/mock'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/internal/bulk_create_attachments.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/internal/bulk_create_attachments.ts index c39aa4bf1aae3..b4df80ef5ff1c 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/internal/bulk_create_attachments.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/internal/bulk_create_attachments.ts @@ -16,7 +16,7 @@ import { getAuthWithSuperUser, bulkCreateAttachments, deleteAllCaseItems, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/internal/suggest_user_profiles.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/internal/suggest_user_profiles.ts index c10c7a6b63997..3fe457a1201e3 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/internal/suggest_user_profiles.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/internal/suggest_user_profiles.ts @@ -6,7 +6,7 @@ */ import expect from '@kbn/expect'; -import { suggestUserProfiles } from '../../../../common/lib/user_profiles'; +import { suggestUserProfiles } from '../../../../common/lib/api'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/metrics/get_cases_metrics.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/metrics/get_cases_metrics.ts index 9ce6119060fe1..574fdcaa2be9c 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/metrics/get_cases_metrics.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/metrics/get_cases_metrics.ts @@ -12,7 +12,7 @@ import { deleteAllCaseItems, getAuthWithSuperUser, getCasesMetrics, -} from '../../../../common/lib/utils'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/common/user_actions/get_all_user_actions.ts b/x-pack/test/cases_api_integration/spaces_only/tests/common/user_actions/get_all_user_actions.ts index 6e7b73fe1b588..6c551c7c985f0 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/common/user_actions/get_all_user_actions.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/common/user_actions/get_all_user_actions.ts @@ -9,8 +9,8 @@ import expect from '@kbn/expect'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; import { getPostCaseRequest } from '../../../../common/lib/mock'; -import { deleteAllCaseItems, createCase, getAuthWithSuperUser } from '../../../../common/lib/utils'; -import { getCaseUserActions } from '../../../../common/lib/user_actions'; +import { deleteAllCaseItems, createCase, getAuthWithSuperUser } from '../../../../common/lib/api'; +import { getCaseUserActions } from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/trial/cases/push_case.ts b/x-pack/test/cases_api_integration/spaces_only/tests/trial/cases/push_case.ts index 5d97cea038d5f..078119a457a93 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/trial/cases/push_case.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/trial/cases/push_case.ts @@ -12,12 +12,13 @@ import { FtrProviderContext } from '../../../../common/ftr_provider_context'; import { ObjectRemover as ActionsRemover } from '../../../../../alerting_api_integration/common/lib'; import { nullUser } from '../../../../common/lib/mock'; -import { pushCase, deleteAllCaseItems, getAuthWithSuperUser } from '../../../../common/lib/utils'; - import { + pushCase, + deleteAllCaseItems, + getAuthWithSuperUser, createCaseWithConnector, getServiceNowSimulationServer, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/get_configure.ts b/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/get_configure.ts index 025e7ba08308f..56d4f02d29e57 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/get_configure.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/get_configure.ts @@ -18,12 +18,10 @@ import { removeServerGeneratedPropertiesFromSavedObject, getConfigurationOutput, getAuthWithSuperUser, -} from '../../../../common/lib/utils'; -import { getServiceNowConnector, createConnector, getServiceNowSimulationServer, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; import { nullUser } from '../../../../common/lib/mock'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/get_connectors.ts b/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/get_connectors.ts index 2d5269baaf270..c7b6f03d3526e 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/get_connectors.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/get_connectors.ts @@ -9,8 +9,9 @@ import expect from '@kbn/expect'; import { FtrProviderContext } from '../../../../common/ftr_provider_context'; import { ObjectRemover as ActionsRemover } from '../../../../../alerting_api_integration/common/lib'; -import { getAuthWithSuperUser, getActionsSpace } from '../../../../common/lib/utils'; import { + getAuthWithSuperUser, + getActionsSpace, getServiceNowConnector, getServiceNowSIRConnector, getEmailConnector, @@ -20,7 +21,7 @@ import { getJiraConnector, createConnector, getResilientConnector, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; // eslint-disable-next-line import/no-default-export export default ({ getService }: FtrProviderContext): void => { diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/patch_configure.ts b/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/patch_configure.ts index 54423a3195672..4c08356f6353b 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/patch_configure.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/patch_configure.ts @@ -20,12 +20,10 @@ import { updateConfiguration, getAuthWithSuperUser, getActionsSpace, -} from '../../../../common/lib/utils'; -import { getServiceNowConnector, createConnector, getServiceNowSimulationServer, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; import { nullUser } from '../../../../common/lib/mock'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/post_configure.ts b/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/post_configure.ts index 97e80e790312e..c40c54f234ab1 100644 --- a/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/post_configure.ts +++ b/x-pack/test/cases_api_integration/spaces_only/tests/trial/configure/post_configure.ts @@ -19,12 +19,10 @@ import { createConfiguration, getAuthWithSuperUser, getActionsSpace, -} from '../../../../common/lib/utils'; -import { getServiceNowConnector, createConnector, getServiceNowSimulationServer, -} from '../../../../common/lib/connectors'; +} from '../../../../common/lib/api'; import { nullUser } from '../../../../common/lib/mock'; // eslint-disable-next-line import/no-default-export diff --git a/x-pack/test/functional/services/cases/api.ts b/x-pack/test/functional/services/cases/api.ts index 1b461e60e7e2b..bd2c39139dfb2 100644 --- a/x-pack/test/functional/services/cases/api.ts +++ b/x-pack/test/functional/services/cases/api.ts @@ -13,11 +13,11 @@ import { createComment, updateCase, getCase, -} from '../../../cases_api_integration/common/lib/utils'; +} from '../../../cases_api_integration/common/lib/api'; import { loginUsers, suggestUserProfiles, -} from '../../../cases_api_integration/common/lib/user_profiles'; +} from '../../../cases_api_integration/common/lib/api/user_profiles'; import { User } from '../../../cases_api_integration/common/lib/authentication/types'; import { FtrProviderContext } from '../../ftr_provider_context'; diff --git a/x-pack/test/functional_with_es_ssl/apps/cases/group2/attachment_framework.ts b/x-pack/test/functional_with_es_ssl/apps/cases/group2/attachment_framework.ts index 4e271da9e28d8..bb8d4b7b86664 100644 --- a/x-pack/test/functional_with_es_ssl/apps/cases/group2/attachment_framework.ts +++ b/x-pack/test/functional_with_es_ssl/apps/cases/group2/attachment_framework.ts @@ -17,7 +17,7 @@ import { deleteAllCaseItems, findCases, getCase, -} from '../../../../cases_api_integration/common/lib/utils'; +} from '../../../../cases_api_integration/common/lib/api'; import { FtrProviderContext } from '../../../ftr_provider_context'; const createLogStashDataView = async ( From 065dbe759cac6cf7beeef0e98539548f78cc4572 Mon Sep 17 00:00:00 2001 From: Spencer Date: Wed, 8 Feb 2023 13:28:47 -0700 Subject: [PATCH 48/60] [serverless] split serverless config files (#150616) We are currently expecting serverless environments to be broken up into several different envs, this config structure allows us to customize the config based on that environment without major modifications to the config loading system. --- .gitignore | 6 +++++- config/README.md | 13 +++++++++++++ config/kibana.serverless.yml | 9 --------- config/serverless.es.yml | 0 config/serverless.oblt.yml | 0 config/serverless.security.yml | 0 config/serverless.yml | 0 package.json | 4 +++- src/cli/serve/serve.js | 35 +++++++++++++++++++++++++++++----- 9 files changed, 51 insertions(+), 16 deletions(-) create mode 100644 config/README.md delete mode 100644 config/kibana.serverless.yml create mode 100644 config/serverless.es.yml create mode 100644 config/serverless.oblt.yml create mode 100644 config/serverless.security.yml create mode 100644 config/serverless.yml diff --git a/.gitignore b/.gitignore index 545a2f8112019..d5747c2cad7e7 100644 --- a/.gitignore +++ b/.gitignore @@ -50,7 +50,11 @@ disabledPlugins webpackstats.json /config/* !/config/kibana.yml -!/config/kibana.serverless.yml +!/config/README.md +!/config/serverless.yml +!/config/serverless.es.yml +!/config/serverless.oblt.yml +!/config/serverless.security.yml !/config/node.options coverage selenium diff --git a/config/README.md b/config/README.md new file mode 100644 index 0000000000000..b5cad71cb0813 --- /dev/null +++ b/config/README.md @@ -0,0 +1,13 @@ +as work on serverless picks up we will add config values to these files that +define how Kibana will run in "serverless" modes. To start Kibana locally with +this configuration, pass `--serverless={mode}` or run `yarn serverless-{mode}` + +valid modes are currently: `es`, `oblt`, and `security` + +configuration is applied in the following order, later values override + 1. kibana.yml + 2. serverless.yml + 3. serverless.{mode}.yml + 4. kibana.dev.yml + 5. serverless.dev.yml + 6. serverless.{mode}.dev.yml diff --git a/config/kibana.serverless.yml b/config/kibana.serverless.yml deleted file mode 100644 index e5c235f1ab872..0000000000000 --- a/config/kibana.serverless.yml +++ /dev/null @@ -1,9 +0,0 @@ -# as work on serverless picks up we will add config values to this file that -# define how Kibana will run in "serverless" mode. To start Kibana locally with -# this configuration, pass `--serverless` or run `yarn start-serverless` - -# configuration is applied in the following order, later values override -# 1. kibana.yml -# 2. kibana.serverless.yml (when --serverless is passed) -# 3. kibana.dev.yml -# 4. kibana.serverless.dev.yml (when --serverless is passed) diff --git a/config/serverless.es.yml b/config/serverless.es.yml new file mode 100644 index 0000000000000..e69de29bb2d1d diff --git a/config/serverless.oblt.yml b/config/serverless.oblt.yml new file mode 100644 index 0000000000000..e69de29bb2d1d diff --git a/config/serverless.security.yml b/config/serverless.security.yml new file mode 100644 index 0000000000000..e69de29bb2d1d diff --git a/config/serverless.yml b/config/serverless.yml new file mode 100644 index 0000000000000..e69de29bb2d1d diff --git a/package.json b/package.json index e10addc6cec12..add9d7712690b 100644 --- a/package.json +++ b/package.json @@ -54,9 +54,11 @@ "lint:es": "node scripts/eslint", "lint:style": "node scripts/stylelint", "makelogs": "node scripts/makelogs", + "serverless-es": "node scripts/kibana --dev --serverless=es", + "serverless-oblt": "node scripts/kibana --dev --serverless=oblt", + "serverless-security": "node scripts/kibana --dev --serverless=security", "spec_to_console": "node scripts/spec_to_console", "start": "node scripts/kibana --dev", - "start-serverless": "node scripts/kibana --dev --serverless", "storybook": "node scripts/storybook", "test:ftr": "node scripts/functional_tests", "test:ftr:runner": "node scripts/functional_test_runner", diff --git a/src/cli/serve/serve.js b/src/cli/serve/serve.js index dcb44a3fddb67..4a875d6955428 100644 --- a/src/cli/serve/serve.js +++ b/src/cli/serve/serve.js @@ -16,6 +16,28 @@ import { getConfigPath, getConfigDirectory } from '@kbn/utils'; import { isKibanaDistributable } from '@kbn/repo-info'; import { readKeystore } from '../keystore/read_keystore'; +/** @typedef {'es' | 'oblt' | 'security'} ServerlessProjectMode */ +/** @type {ServerlessProjectMode[]} */ +const VALID_SERVERLESS_PROJECT_MODE = ['es', 'oblt', 'security']; + +/** + * @param {Record} opts + * @returns {ServerlessProjectMode | null} + */ +function getServerlessProjectMode(opts) { + if (!opts.serverless) { + return null; + } + + if (VALID_SERVERLESS_PROJECT_MODE.includes(opts.serverless)) { + return opts.serverless; + } + + throw new Error( + `invalid --serverless value, must be one of ${VALID_SERVERLESS_PROJECT_MODE.join(', ')}` + ); +} + function canRequire(path) { try { require.resolve(path); @@ -212,7 +234,7 @@ export default function (program) { '--run-examples', 'Adds plugin paths for all the Kibana example plugins and runs with no base path' ) - .option('--serverless', 'Start Kibana with serverless configuration overrides'); + .option('--serverless ', 'Start Kibana in a serverless project mode'); } if (DEV_MODE_SUPPORTED) { @@ -237,17 +259,20 @@ export default function (program) { command.action(async function (opts) { const unknownOptions = this.getUnknownOptions(); const configs = [getConfigPath(), ...getEnvConfigs(), ...(opts.config || [])]; + const serverlessMode = getServerlessProjectMode(opts); // we "unshift" .serverless. config so that it only overrides defaults - if (opts.serverless) { - maybeAddConfig('kibana.serverless.yml', configs, 'unshift'); + if (serverlessMode) { + maybeAddConfig(`serverless.yml`, configs, 'push'); + maybeAddConfig(`serverless.${serverlessMode}.yml`, configs, 'unshift'); } // .dev. configs are "pushed" so that they override all other config files if (opts.dev && opts.devConfig !== false) { maybeAddConfig('kibana.dev.yml', configs, 'push'); - if (opts.serverless) { - maybeAddConfig('kibana.serverless.dev.yml', configs, 'push'); + if (serverlessMode) { + maybeAddConfig(`serverless.dev.yml`, configs, 'push'); + maybeAddConfig(`serverless.${serverlessMode}.dev.yml`, configs, 'push'); } } From c127d86d34803620afb52fe39f4a7936238fd5b0 Mon Sep 17 00:00:00 2001 From: Xavier Mouligneau Date: Wed, 8 Feb 2023 15:34:04 -0500 Subject: [PATCH 49/60] [RAM] bring back api integration tests (#150625) ## Summary Bring back api integration tests --- .../group2/tests/alerting/index.ts | 28 +++++++++---------- 1 file changed, 14 insertions(+), 14 deletions(-) diff --git a/x-pack/test/alerting_api_integration/security_and_spaces/group2/tests/alerting/index.ts b/x-pack/test/alerting_api_integration/security_and_spaces/group2/tests/alerting/index.ts index bcaefee55b1e5..ea009fc24bbc6 100644 --- a/x-pack/test/alerting_api_integration/security_and_spaces/group2/tests/alerting/index.ts +++ b/x-pack/test/alerting_api_integration/security_and_spaces/group2/tests/alerting/index.ts @@ -32,21 +32,21 @@ export default function alertingTests({ loadTestFile, getService }: FtrProviderC await tearDown(getService); }); - // loadTestFile(require.resolve('./mute_all')); - // loadTestFile(require.resolve('./mute_instance')); - // loadTestFile(require.resolve('./unmute_all')); - // loadTestFile(require.resolve('./unmute_instance')); - // loadTestFile(require.resolve('./update')); - // loadTestFile(require.resolve('./update_api_key')); + loadTestFile(require.resolve('./mute_all')); + loadTestFile(require.resolve('./mute_instance')); + loadTestFile(require.resolve('./unmute_all')); + loadTestFile(require.resolve('./unmute_instance')); + loadTestFile(require.resolve('./update')); + loadTestFile(require.resolve('./update_api_key')); loadTestFile(require.resolve('./alerts')); - // loadTestFile(require.resolve('./event_log')); - // loadTestFile(require.resolve('./mustache_templates')); - // loadTestFile(require.resolve('./health')); - // loadTestFile(require.resolve('./excluded')); - // loadTestFile(require.resolve('./snooze')); - // loadTestFile(require.resolve('./global_execution_log')); - // loadTestFile(require.resolve('./get_global_execution_kpi')); - // loadTestFile(require.resolve('./get_action_error_log')); + loadTestFile(require.resolve('./event_log')); + loadTestFile(require.resolve('./mustache_templates')); + loadTestFile(require.resolve('./health')); + loadTestFile(require.resolve('./excluded')); + loadTestFile(require.resolve('./snooze')); + loadTestFile(require.resolve('./global_execution_log')); + loadTestFile(require.resolve('./get_global_execution_kpi')); + loadTestFile(require.resolve('./get_action_error_log')); }); }); } From 4b21579e5d32b9a7e8ed3b6ee80ba21b146f48bb Mon Sep 17 00:00:00 2001 From: Sander Philipse <94373878+sphilipse@users.noreply.github.com> Date: Wed, 8 Feb 2023 22:11:02 +0100 Subject: [PATCH 50/60] [Enterprise Search] Update copy for sync rules (#150575) ## Summary Updates some copy for connector sync rules. --- .../search_index/connector/sync_rules/connector_rules.tsx | 8 +++++--- .../connector/sync_rules/editable_basic_rules_table.tsx | 2 +- .../connector/sync_rules/sync_rules_callouts.tsx | 8 ++++---- 3 files changed, 10 insertions(+), 8 deletions(-) diff --git a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/connector_rules.tsx b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/connector_rules.tsx index 685db26dbbd07..1ef84d54a13dd 100644 --- a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/connector_rules.tsx +++ b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/connector_rules.tsx @@ -80,7 +80,7 @@ export const ConnectorSyncRules: React.FC = () => { {i18n.translate('xpack.enterpriseSearch.index.connector.syncRules.description', { defaultMessage: `Include or exclude high level items, file types and (file or folder) paths to synchronize from {indexName}. Everything is included by default. Each document is - tested against the reules below and the first rule that matches will be applied.`, + tested against the rules below and the first rule that matches will be applied.`, values: { indexName, }, @@ -142,7 +142,8 @@ export const ConnectorSyncRules: React.FC = () => { {i18n.translate( 'xpack.enterpriseSearch.content.index.connector.syncRules.basicRulesDescription', { - defaultMessage: 'These filters apply to documents in post-processing.', + defaultMessage: + 'These rules apply to documents during the integration filtering phase.', } )}

    @@ -174,7 +175,8 @@ export const ConnectorSyncRules: React.FC = () => { {i18n.translate( 'xpack.enterpriseSearch.content.index.connector.syncRules.advancedFiltersDescription', { - defaultMessage: 'These filters apply to documents at the data source.', + defaultMessage: + 'These rules apply before the data is obtained from the data source.', } )}

    diff --git a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/editable_basic_rules_table.tsx b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/editable_basic_rules_table.tsx index 55b5be00b86c5..b153c6b345431 100644 --- a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/editable_basic_rules_table.tsx +++ b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/editable_basic_rules_table.tsx @@ -79,7 +79,7 @@ export const SyncRulesTable: React.FC = () => { {i18n.translate('xpack.enterpriseSearch.content.index.connector.syncRules.description', { defaultMessage: - 'Add a sync rule to customize what data is synchronized from {indexName}. Everything is included by default, and documents are validated against the configured set of indexing rules starting from the top listed down.', + 'Add a sync rule to customize what data is synchronized from {indexName}. Everything is included by default, and documents are validated against the configured set of sync rules in the listed order.', values: { indexName }, })} diff --git a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/sync_rules_callouts.tsx b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/sync_rules_callouts.tsx index 8cadc7c74ab39..fe28ea499964e 100644 --- a/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/sync_rules_callouts.tsx +++ b/x-pack/plugins/enterprise_search/public/applications/enterprise_search_content/components/search_index/connector/sync_rules/sync_rules_callouts.tsx @@ -51,7 +51,7 @@ export const SyncRulesStateCallouts: React.FC = ({ 'xpack.enterpriseSearch.index.connector.syncRules.validatingDescription', { defaultMessage: - 'Draft rules need to be validated before they can take effect. This may take a few minutes.', + 'Draft rules need to be validated before they can be activated. This may take a few minutes.', } )} @@ -90,7 +90,7 @@ export const SyncRulesStateCallouts: React.FC = ({ 'xpack.enterpriseSearch.index.connector.syncRules.invalidDescription', { defaultMessage: - 'Draft rules did not validate. Edit the draft rules before they can take effect.', + 'Draft rules did not validate. Edit the draft rules before they can be activated.', } )} @@ -128,7 +128,7 @@ export const SyncRulesStateCallouts: React.FC = ({ {i18n.translate( 'xpack.enterpriseSearch.index.connector.syncRules.validatedDescription', { - defaultMessage: 'Apply draft rules to take effect on the next sync.', + defaultMessage: 'Activate draft rules to take effect on the next sync.', } )} @@ -145,7 +145,7 @@ export const SyncRulesStateCallouts: React.FC = ({ {i18n.translate( 'xpack.enterpriseSearch.index.connector.syncRules.successCallout.applyDraftRulesTitle', { - defaultMessage: 'Apply draft rules', + defaultMessage: 'Activate draft rules', } )} From b39875837d57c59905a5d42338d93e0954edc163 Mon Sep 17 00:00:00 2001 From: Tiago Costa Date: Wed, 8 Feb 2023 21:15:26 +0000 Subject: [PATCH 51/60] chore(NA): bump version to 8.8.0 (#150567) Usually bump from 8.7.0 to 8.8.0 Co-authored-by: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> --- package.json | 2 +- x-pack/package.json | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/package.json b/package.json index add9d7712690b..6970b18973042 100644 --- a/package.json +++ b/package.json @@ -11,7 +11,7 @@ "dashboarding" ], "private": true, - "version": "8.7.0", + "version": "8.8.0", "branch": "main", "types": "./kibana.d.ts", "tsdocMetadata": "./build/tsdoc-metadata.json", diff --git a/x-pack/package.json b/x-pack/package.json index 9dc04d2f20c6b..a296abae2111e 100644 --- a/x-pack/package.json +++ b/x-pack/package.json @@ -1,6 +1,6 @@ { "name": "x-pack", - "version": "8.7.0", + "version": "8.8.0", "author": "Elastic", "private": true, "license": "Elastic-License", From e5a9fc30dda7cd48c3505c7f77fc591994e109f0 Mon Sep 17 00:00:00 2001 From: Tiago Costa Date: Wed, 8 Feb 2023 21:15:44 +0000 Subject: [PATCH 52/60] chore(NA): update versions after v8.8.0 bump (#150570) This PR is a simple update of our versions file after the recent bumps --------- Co-authored-by: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> --- versions.json | 8 +++++++- 1 file changed, 7 insertions(+), 1 deletion(-) diff --git a/versions.json b/versions.json index 00dd9ac949eeb..91bf9e9b16fc4 100644 --- a/versions.json +++ b/versions.json @@ -2,11 +2,17 @@ "notice": "This file is not maintained outside of the main branch and should only be used for tooling.", "versions": [ { - "version": "8.7.0", + "version": "8.8.0", "branch": "main", "currentMajor": true, "currentMinor": true }, + { + "version": "8.7.0", + "branch": "8.7", + "currentMajor": true, + "previousMinor": true + }, { "version": "8.6.2", "branch": "8.6", From 2e95c7a218ec37cc15d111dfc3fa112eb0217741 Mon Sep 17 00:00:00 2001 From: Rickyanto Ang Date: Wed, 8 Feb 2023 13:17:15 -0800 Subject: [PATCH 53/60] [Cloud Posture][FTR]Functional Test for Findings Group By (#149300) ## Summary Added new FTR test for Findings group by on Findings page ### Checklist - Added new service (page object) with action / assertion methods needed for this test - Followed the test steps listed on the Testrail url mentioned on the ticket --- .../public/pages/findings/findings.test.tsx | 2 +- .../latest_findings_container.tsx | 2 +- .../latest_findings/latest_findings_table.tsx | 2 +- .../findings_by_resource_container.tsx | 2 +- .../findings_by_resource_table.tsx | 6 +- .../resource_findings_container.tsx | 2 +- .../layout/findings_group_by_selector.tsx | 2 + .../public/pages/findings/test_subjects.ts | 10 +++ .../page_objects/findings_page.ts | 86 ++++++++++++------- .../pages/findings.ts | 86 +++++++++++++++---- 10 files changed, 142 insertions(+), 58 deletions(-) diff --git a/x-pack/plugins/cloud_security_posture/public/pages/findings/findings.test.tsx b/x-pack/plugins/cloud_security_posture/public/pages/findings/findings.test.tsx index 02f2ec8ffee73..1112c0f46bc3a 100644 --- a/x-pack/plugins/cloud_security_posture/public/pages/findings/findings.test.tsx +++ b/x-pack/plugins/cloud_security_posture/public/pages/findings/findings.test.tsx @@ -177,7 +177,7 @@ describe('', () => { renderFindingsPage(); expectIdsInDoc({ - be: [TEST_SUBJECTS.FINDINGS_CONTAINER], + be: [TEST_SUBJECTS.LATEST_FINDINGS_CONTAINER], notToBe: [ NO_FINDINGS_STATUS_TEST_SUBJ.INDEX_TIMEOUT, NO_FINDINGS_STATUS_TEST_SUBJ.NO_AGENTS_DEPLOYED, diff --git a/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings/latest_findings_container.tsx b/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings/latest_findings_container.tsx index 66b11d05f3db2..d5cea85a03410 100644 --- a/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings/latest_findings_container.tsx +++ b/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings/latest_findings_container.tsx @@ -90,7 +90,7 @@ export const LatestFindingsContainer = ({ dataView }: FindingsBaseProps) => { }; return ( -
    +
    { diff --git a/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings/latest_findings_table.tsx b/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings/latest_findings_table.tsx index 34f29fa6473a2..96ee0f5319d67 100644 --- a/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings/latest_findings_table.tsx +++ b/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings/latest_findings_table.tsx @@ -98,7 +98,7 @@ const FindingsTableComponent = ({ <> { }; return ( -
    +
    { diff --git a/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings_by_resource/findings_by_resource_table.tsx b/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings_by_resource/findings_by_resource_table.tsx index fb7ce817246a9..84c89d086a5f6 100644 --- a/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings_by_resource/findings_by_resource_table.tsx +++ b/x-pack/plugins/cloud_security_posture/public/pages/findings/latest_findings_by_resource/findings_by_resource_table.tsx @@ -64,7 +64,10 @@ const FindingsByResourceTableComponent = ({ const columns = useMemo( () => [ - getNonSortableColumn(findingsByResourceColumns.resource_id), + { + ...getNonSortableColumn(findingsByResourceColumns.resource_id), + ['data-test-subj']: TEST_SUBJECTS.FINDINGS_BY_RESOURCE_TABLE_RESOURCE_ID_COLUMN, + }, createColumnWithFilters( getNonSortableColumn(findingsByResourceColumns['resource.sub_type']), { onAddFilter } @@ -102,6 +105,7 @@ const FindingsByResourceTableComponent = ({ return ( { }); }; return ( -
    +
    { diff --git a/x-pack/plugins/cloud_security_posture/public/pages/findings/layout/findings_group_by_selector.tsx b/x-pack/plugins/cloud_security_posture/public/pages/findings/layout/findings_group_by_selector.tsx index efbda89eb3e4d..d997dce43b2b5 100644 --- a/x-pack/plugins/cloud_security_posture/public/pages/findings/layout/findings_group_by_selector.tsx +++ b/x-pack/plugins/cloud_security_posture/public/pages/findings/layout/findings_group_by_selector.tsx @@ -12,6 +12,7 @@ import { i18n } from '@kbn/i18n'; import { INTERNAL_FEATURE_FLAGS } from '../../../../common/constants'; import type { FindingsGroupByKind } from '../types'; import { findingsNavigation } from '../../../common/navigation/constants'; +import * as TEST_SUBJECTS from '../test_subjects'; const getGroupByOptions = (): Array> => [ { @@ -56,6 +57,7 @@ export const FindingsGroupBySelector = ({ type }: Props) => { return (
    } singleSelection={{ asPlainText: true }} options={groupByOptions} diff --git a/x-pack/plugins/cloud_security_posture/public/pages/findings/test_subjects.ts b/x-pack/plugins/cloud_security_posture/public/pages/findings/test_subjects.ts index 153811865c5c3..d7a2e89fad9fb 100644 --- a/x-pack/plugins/cloud_security_posture/public/pages/findings/test_subjects.ts +++ b/x-pack/plugins/cloud_security_posture/public/pages/findings/test_subjects.ts @@ -9,10 +9,19 @@ export const FINDINGS_TABLE = 'findings_table'; export const FINDINGS_BY_RESOURCE_TABLE_NO_FINDINGS_EMPTY_STATE = 'findings-by-resource-table-no-findings-empty-state'; export const FINDINGS_CONTAINER = 'findings_container'; +export const FINDINGS_BY_RESOURCE_CONTAINER = 'findings_by_resource_container'; +export const FINDINGS_BY_RESOURCE_TABLE_RESOURCE_ID_COLUMN = + 'findings_by_resource_table_resource_id_column'; +export const FINDINGS_BY_RESOURCE_TABLE = 'findings_by_resource_table'; + export const LATEST_FINDINGS_TABLE_NO_FINDINGS_EMPTY_STATE = 'latest-findings-table-no-findings-empty-state'; export const getFindingsByResourceTableRowTestId = (id: string) => `findings_resource_table_row_${id}`; +export const LATEST_FINDINGS_CONTAINER = 'latest_findings_container'; +export const LATEST_FINDINGS_TABLE = 'latest_findings_table'; + +export const FINDINGS_GROUP_BY_SELECTOR = 'findings_group_by_selector'; export const getFindingsTableRowTestId = (id: string) => `findings_table_row_${id}`; export const getFindingsTableCellTestId = (columnId: string, rowId: string) => @@ -21,6 +30,7 @@ export const getFindingsTableCellTestId = (columnId: string, rowId: string) => export const FINDINGS_TABLE_CELL_ADD_FILTER = 'findings_table_cell_add_filter'; export const FINDINGS_TABLE_CELL_ADD_NEGATED_FILTER = 'findings_table_cell_add_negated_filter'; +export const RESOURCES_FINDINGS_CONTAINER = 'resources_findings_container'; export const RESOURCES_FINDINGS_TABLE_EMPTY_STATE = 'resource_findings_table_empty_state'; export const RESOURCES_FINDINGS_TABLE = 'resource_findings_table'; export const getResourceFindingsTableRowTestId = (id: string) => diff --git a/x-pack/test/cloud_security_posture_functional/page_objects/findings_page.ts b/x-pack/test/cloud_security_posture_functional/page_objects/findings_page.ts index 70c90e0cf323f..fd06d58e37081 100644 --- a/x-pack/test/cloud_security_posture_functional/page_objects/findings_page.ts +++ b/x-pack/test/cloud_security_posture_functional/page_objects/findings_page.ts @@ -52,50 +52,52 @@ export function FindingsPageProvider({ getService, getPageObjects }: FtrProvider testSubjects.click(type === 'failed' ? 'distribution_bar_failed' : 'distribution_bar_passed'), }; - const table = { - getElement: () => testSubjects.find('findings_table'), + const createTableObject = (tableTestSubject: string) => ({ + getElement() { + return testSubjects.find(tableTestSubject); + }, - getHeaders: async () => { - const element = await table.getElement(); + async getHeaders() { + const element = await this.getElement(); return await element.findAllByCssSelector('thead tr :is(th,td)'); }, - getColumnIndex: async (columnName: string) => { - const headers = await table.getHeaders(); + async getColumnIndex(columnName: string) { + const headers = await this.getHeaders(); const texts = await Promise.all(headers.map((header) => header.getVisibleText())); const columnIndex = texts.findIndex((i) => i === columnName); expect(columnIndex).to.be.greaterThan(-1); return columnIndex + 1; }, - getColumnHeaderCell: async (columnName: string) => { - const headers = await table.getHeaders(); + async getColumnHeaderCell(columnName: string) { + const headers = await this.getHeaders(); const headerIndexes = await Promise.all(headers.map((header) => header.getVisibleText())); const columnIndex = headerIndexes.findIndex((i) => i === columnName); return headers[columnIndex]; }, - getRowsCount: async () => { - const element = await table.getElement(); + async getRowsCount() { + const element = await this.getElement(); const rows = await element.findAllByCssSelector('tbody tr'); return rows.length; }, - getFindingsCount: async (type: 'passed' | 'failed') => { - const element = await table.getElement(); + async getFindingsCount(type: 'passed' | 'failed') { + const element = await this.getElement(); const items = await element.findAllByCssSelector(`span[data-test-subj="${type}_finding"]`); return items.length; }, - getRowIndexForValue: async (columnName: string, value: string) => { - const values = await table.getColumnValues(columnName); + async getRowIndexForValue(columnName: string, value: string) { + const values = await this.getColumnValues(columnName); const rowIndex = values.indexOf(value); expect(rowIndex).to.be.greaterThan(-1); return rowIndex + 1; }, - getFilterElementButton: async (rowIndex: number, columnIndex: number, negated = false) => { - const tableElement = await table.getElement(); + async getFilterElementButton(rowIndex: number, columnIndex: number, negated = false) { + const tableElement = await this.getElement(); const button = negated ? 'findings_table_cell_add_negated_filter' : 'findings_table_cell_add_filter'; @@ -103,17 +105,17 @@ export function FindingsPageProvider({ getService, getPageObjects }: FtrProvider return tableElement.findByCssSelector(selector); }, - addCellFilter: async (columnName: string, cellValue: string, negated = false) => { - const columnIndex = await table.getColumnIndex(columnName); - const rowIndex = await table.getRowIndexForValue(columnName, cellValue); - const filterElement = await table.getFilterElementButton(rowIndex, columnIndex, negated); + async addCellFilter(columnName: string, cellValue: string, negated = false) { + const columnIndex = await this.getColumnIndex(columnName); + const rowIndex = await this.getRowIndexForValue(columnName, cellValue); + const filterElement = await this.getFilterElementButton(rowIndex, columnIndex, negated); await filterElement.click(); }, - getColumnValues: async (columnName: string) => { + async getColumnValues(columnName: string) { const elementsWithNoFilterCell = ['CIS Section', '@timestamp']; - const tableElement = await table.getElement(); - const columnIndex = await table.getColumnIndex(columnName); + const tableElement = await this.getElement(); + const columnIndex = await this.getColumnIndex(columnName); const selector = elementsWithNoFilterCell.includes(columnName) ? `tbody tr td:nth-child(${columnIndex})` : `tbody tr td:nth-child(${columnIndex}) div[data-test-subj="filter_cell_value"]`; @@ -122,13 +124,13 @@ export function FindingsPageProvider({ getService, getPageObjects }: FtrProvider return await Promise.all(columnCells.map((cell) => cell.getVisibleText())); }, - hasColumnValue: async (columnName: string, value: string) => { - const values = await table.getColumnValues(columnName); + async hasColumnValue(columnName: string, value: string) { + const values = await this.getColumnValues(columnName); return values.includes(value); }, - toggleColumnSort: async (columnName: string, direction: 'asc' | 'desc') => { - const element = await table.getColumnHeaderCell(columnName); + async toggleColumnSort(columnName: string, direction: 'asc' | 'desc') { + const element = await this.getColumnHeaderCell(columnName); const currentSort = await element.getAttribute('aria-sort'); if (currentSort === 'none') { // a click is needed to focus on Eui column header @@ -136,7 +138,7 @@ export function FindingsPageProvider({ getService, getPageObjects }: FtrProvider // default is ascending if (direction === 'desc') { - const nonStaleElement = await table.getColumnHeaderCell(columnName); + const nonStaleElement = await this.getColumnHeaderCell(columnName); await nonStaleElement.click(); } } @@ -145,13 +147,13 @@ export function FindingsPageProvider({ getService, getPageObjects }: FtrProvider (currentSort === 'descending' && direction === 'asc') ) { // Without getting the element again, the click throws an error (stale element reference) - const nonStaleElement = await table.getColumnHeaderCell(columnName); + const nonStaleElement = await this.getColumnHeaderCell(columnName); await nonStaleElement.click(); } }, - }; + }); - const navigateToFindingsPage = async () => { + const navigateToLatestFindingsPage = async () => { await PageObjects.common.navigateToUrl( 'securitySolution', // Defined in Security Solution plugin 'cloud_security_posture/findings', @@ -159,9 +161,27 @@ export function FindingsPageProvider({ getService, getPageObjects }: FtrProvider ); }; + const latestFindingsTable = createTableObject('latest_findings_table'); + const resourceFindingsTable = createTableObject('resource_findings_table'); + const findingsByResourceTable = { + ...createTableObject('findings_by_resource_table'), + async clickResourceIdLink(resourceId: string, sectionName: string) { + const table = await this.getElement(); + const row = await table.findByCssSelector( + `[data-test-subj="findings_resource_table_row_${resourceId}/${sectionName}"]` + ); + const link = await row.findByCssSelector( + '[data-test-subj="findings_by_resource_table_resource_id_column"' + ); + await link.click(); + }, + }; + return { - navigateToFindingsPage, - table, + navigateToLatestFindingsPage, + latestFindingsTable, + resourceFindingsTable, + findingsByResourceTable, index, distributionBar, }; diff --git a/x-pack/test/cloud_security_posture_functional/pages/findings.ts b/x-pack/test/cloud_security_posture_functional/pages/findings.ts index afba99a5542ed..6a1222ef1e099 100644 --- a/x-pack/test/cloud_security_posture_functional/pages/findings.ts +++ b/x-pack/test/cloud_security_posture_functional/pages/findings.ts @@ -13,6 +13,7 @@ import type { FtrProviderContext } from '../ftr_provider_context'; export default function ({ getPageObjects, getService }: FtrProviderContext) { const queryBar = getService('queryBar'); const filterBar = getService('filterBar'); + const comboBox = getService('comboBox'); const retry = getService('retry'); const pageObjects = getPageObjects(['common', 'findings']); const chance = new Chance(); @@ -26,6 +27,12 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { rule: { name: 'Upper case rule name', section: 'Upper case section', + benchmark: { + id: 'cis_k8s', + name: 'CIS Kubernetes V1.23', + version: 'v1.0.0', + }, + type: 'process', }, cluster_id: 'Upper case cluster id', }, @@ -35,6 +42,12 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { rule: { name: 'lower case rule name', section: 'Another upper case section', + benchmark: { + id: 'cis_k8s', + name: 'CIS Kubernetes V1.23', + version: 'v1.0.0', + }, + type: 'process', }, cluster_id: 'Another Upper case cluster id', }, @@ -44,6 +57,12 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { rule: { name: 'Another upper case rule name', section: 'lower case section', + benchmark: { + id: 'cis_k8s', + name: 'CIS Kubernetes V1.23', + version: 'v1.0.0', + }, + type: 'process', }, cluster_id: 'lower case cluster id', }, @@ -53,6 +72,12 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { rule: { name: 'some lower case rule name', section: 'another lower case section', + benchmark: { + id: 'cis_k8s', + name: 'CIS Kubernetes V1.23', + version: 'v1.0.0', + }, + type: 'process', }, cluster_id: 'another lower case cluster id', }, @@ -61,21 +86,30 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { const ruleName1 = data[0].rule.name; const ruleName2 = data[1].rule.name; + const resourceId1 = data[0].resource.id; + const ruleSection1 = data[0].rule.section; + + const benchMarkName = data[0].rule.benchmark.name; + describe('Findings Page', () => { let findings: typeof pageObjects.findings; - let table: typeof pageObjects.findings.table; - let distributionBar: typeof pageObjects.findings.distributionBar; + let latestFindingsTable: typeof findings.latestFindingsTable; + let findingsByResourceTable: typeof findings.findingsByResourceTable; + let resourceFindingsTable: typeof findings.resourceFindingsTable; + let distributionBar: typeof findings.distributionBar; before(async () => { findings = pageObjects.findings; - table = pageObjects.findings.table; - distributionBar = pageObjects.findings.distributionBar; + latestFindingsTable = findings.latestFindingsTable; + findingsByResourceTable = findings.findingsByResourceTable; + resourceFindingsTable = findings.resourceFindingsTable; + distributionBar = findings.distributionBar; await findings.index.add(data); - await findings.navigateToFindingsPage(); + await findings.navigateToLatestFindingsPage(); await retry.waitFor( 'Findings table to be loaded', - async () => (await table.getRowsCount()) === data.length + async () => (await latestFindingsTable.getRowsCount()) === data.length ); }); @@ -88,44 +122,44 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { await filterBar.addFilter({ field: 'rule.name', operation: 'is', value: ruleName1 }); expect(await filterBar.hasFilter('rule.name', ruleName1)).to.be(true); - expect(await table.hasColumnValue('Rule Name', ruleName1)).to.be(true); + expect(await latestFindingsTable.hasColumnValue('Rule Name', ruleName1)).to.be(true); }); it('remove filter', async () => { await filterBar.removeFilter('rule.name'); expect(await filterBar.hasFilter('rule.name', ruleName1)).to.be(false); - expect(await table.getRowsCount()).to.be(data.length); + expect(await latestFindingsTable.getRowsCount()).to.be(data.length); }); it('set search query', async () => { await queryBar.setQuery(ruleName1); await queryBar.submitQuery(); - expect(await table.hasColumnValue('Rule Name', ruleName1)).to.be(true); - expect(await table.hasColumnValue('Rule Name', ruleName2)).to.be(false); + expect(await latestFindingsTable.hasColumnValue('Rule Name', ruleName1)).to.be(true); + expect(await latestFindingsTable.hasColumnValue('Rule Name', ruleName2)).to.be(false); await queryBar.setQuery(''); await queryBar.submitQuery(); - expect(await table.getRowsCount()).to.be(data.length); + expect(await latestFindingsTable.getRowsCount()).to.be(data.length); }); }); describe('Table Filters', () => { it('add cell value filter', async () => { - await table.addCellFilter('Rule Name', ruleName1, false); + await latestFindingsTable.addCellFilter('Rule Name', ruleName1, false); expect(await filterBar.hasFilter('rule.name', ruleName1)).to.be(true); - expect(await table.hasColumnValue('Rule Name', ruleName1)).to.be(true); + expect(await latestFindingsTable.hasColumnValue('Rule Name', ruleName1)).to.be(true); }); it('add negated cell value filter', async () => { - await table.addCellFilter('Rule Name', ruleName1, true); + await latestFindingsTable.addCellFilter('Rule Name', ruleName1, true); expect(await filterBar.hasFilter('rule.name', ruleName1, true, false, true)).to.be(true); - expect(await table.hasColumnValue('Rule Name', ruleName1)).to.be(false); - expect(await table.hasColumnValue('Rule Name', ruleName2)).to.be(true); + expect(await latestFindingsTable.hasColumnValue('Rule Name', ruleName1)).to.be(false); + expect(await latestFindingsTable.hasColumnValue('Rule Name', ruleName2)).to.be(true); await filterBar.removeFilter('rule.name'); }); @@ -155,8 +189,8 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { ['Resource Type', 'desc', sortByAlphabeticalOrder], ]; for (const [columnName, dir, sortingMethod] of testCases) { - await table.toggleColumnSort(columnName, dir); - const values = (await table.getColumnValues(columnName)).filter(Boolean); + await latestFindingsTable.toggleColumnSort(columnName, dir); + const values = (await latestFindingsTable.getColumnValues(columnName)).filter(Boolean); expect(values).to.not.be.empty(); const sorted = values @@ -173,11 +207,25 @@ export default function ({ getPageObjects, getService }: FtrProviderContext) { await distributionBar.filterBy(type); const items = data.filter(({ result }) => result.evaluation === type); - expect(await table.getFindingsCount(type)).to.eql(items.length); + expect(await latestFindingsTable.getFindingsCount(type)).to.eql(items.length); await filterBar.removeFilter('result.evaluation'); }); }); }); + + describe('GroupBy', () => { + it('groups findings by resource', async () => { + await comboBox.set('findings_group_by_selector', 'Resource'); + expect( + await findingsByResourceTable.hasColumnValue('Applicable Benchmark', benchMarkName) + ).to.be(true); + }); + + it('navigates to resource findings page from resource id link', async () => { + await findingsByResourceTable.clickResourceIdLink(resourceId1, ruleSection1); + expect(await resourceFindingsTable.hasColumnValue('Rule Name', ruleName1)).to.be(true); + }); + }); }); } From 52210bf04697fef85057ee5b70c8a6ab924ae4af Mon Sep 17 00:00:00 2001 From: Tiago Costa Date: Wed, 8 Feb 2023 21:22:43 +0000 Subject: [PATCH 54/60] chore(NA): adds 8.7 into backportrc (#150569) It adds 8.7 into the .backportrc config file Co-authored-by: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> --- .backportrc.json | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/.backportrc.json b/.backportrc.json index dbf40e472325e..1054205fccf4c 100644 --- a/.backportrc.json +++ b/.backportrc.json @@ -3,6 +3,7 @@ "repoName": "kibana", "targetBranchChoices": [ "main", + "8.7", "8.6", "8.5", "8.4", @@ -43,7 +44,7 @@ "backport" ], "branchLabelMapping": { - "^v8.7.0$": "main", + "^v8.8.0$": "main", "^v(\\d+).(\\d+).\\d+$": "$1.$2" }, "autoMerge": true, From 4446adb2ee866e08b97b5eb36133b4c701fa726d Mon Sep 17 00:00:00 2001 From: Nathan Reese Date: Wed, 8 Feb 2023 14:44:43 -0700 Subject: [PATCH 55/60] =?UTF-8?q?unskip=20flaky=20test=20test/functional/a?= =?UTF-8?q?pps/dashboard/group1/embeddable=5Frendering=C2=B7ts=20(#150596)?= MIME-Version: 1.0 Content-Type: text/plain; charset=UTF-8 Content-Transfer-Encoding: 8bit Fixes https://github.com/elastic/kibana/issues/132865 flaky test runner https://buildkite.com/elastic/kibana-flaky-test-suite-runner/builds/1891 PR fixes flaky test by ensuring window._echDebugStateFlag flag is set before any panel renders. --------- Co-authored-by: kibanamachine <42973632+kibanamachine@users.noreply.github.com> --- .../dashboard/group1/embeddable_rendering.ts | 15 +++-- .../services/visualizations/elastic_chart.ts | 30 +++++++-- .../services/visualizations/pie_chart.ts | 66 +++++++++---------- 3 files changed, 65 insertions(+), 46 deletions(-) diff --git a/test/functional/apps/dashboard/group1/embeddable_rendering.ts b/test/functional/apps/dashboard/group1/embeddable_rendering.ts index a52d8f49694f6..d2da02ff1459d 100644 --- a/test/functional/apps/dashboard/group1/embeddable_rendering.ts +++ b/test/functional/apps/dashboard/group1/embeddable_rendering.ts @@ -27,6 +27,7 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { const security = getService('security'); const dashboardExpect = getService('dashboardExpect'); const dashboardAddPanel = getService('dashboardAddPanel'); + const queryBar = getService('queryBar'); const PageObjects = getPageObjects([ 'common', 'dashboard', @@ -99,8 +100,7 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { await dashboardExpect.vegaTextsDoNotExist(['5,000']); }; - // Failing: See https://github.com/elastic/kibana/issues/132865 - describe.skip('dashboard embeddable rendering', function describeIndexTests() { + describe('dashboard embeddable rendering', function describeIndexTests() { before(async () => { await security.testUser.setRoles(['kibana_admin', 'animals', 'test_logstash_reader']); await kibanaServer.savedObjects.cleanStandardList(); @@ -130,8 +130,6 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { }); it('adding visualizations', async () => { - await elasticChart.setNewChartUiDebugFlag(true); - visNames = await dashboardAddPanel.addEveryVisualization('"Rendering Test"'); expect(visNames.length).to.be.equal(24); await dashboardExpect.visualizationsArePresent(visNames); @@ -162,7 +160,6 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { it('initial render test', async () => { await PageObjects.header.waitUntilLoadingHasFinished(); await PageObjects.dashboard.waitForRenderComplete(); - await elasticChart.setNewChartUiDebugFlag(); await expectAllDataRenders(); }); @@ -181,8 +178,14 @@ export default function ({ getService, getPageObjects }: FtrProviderContext) { const alert = await browser.getAlert(); await alert?.accept(); + // setNewChartUiDebugFlag required because window._echDebugStateFlag flag is reset after refresh + await elasticChart.setNewChartUiDebugFlag(true); + await PageObjects.header.waitUntilLoadingHasFinished(); - await elasticChart.setNewChartUiDebugFlag(); + await PageObjects.dashboard.waitForRenderComplete(); + + // call query refresh to guarantee all panels are rendered after window._echDebugStateFlag is set + await queryBar.clickQuerySubmitButton(); await PageObjects.dashboard.waitForRenderComplete(); await expectAllDataRenders(); }); diff --git a/test/functional/services/visualizations/elastic_chart.ts b/test/functional/services/visualizations/elastic_chart.ts index a78af785792bc..d87a7a0d3d061 100644 --- a/test/functional/services/visualizations/elastic_chart.ts +++ b/test/functional/services/visualizations/elastic_chart.ts @@ -111,17 +111,33 @@ export class ElasticChartService extends FtrService { dataTestSubj?: string, match: number = 0, timeout: number | undefined = undefined - ): Promise { + ): Promise { const chart = await this.getChart(dataTestSubj, timeout, match); - try { - const visContainer = await chart.findByCssSelector('.echChartStatus'); - const debugDataString: string | undefined = await visContainer.getAttribute( - 'data-ech-debug-state' + return await this.getChartDebugDataFromChart(chart); + } + + /** + * used to get chart data from `@elastic/charts` + * requires `window._echDebugStateFlag` to be true + */ + public async getChartDebugDataFromChart(chart: WebElementWrapper): Promise { + const visContainer = await chart.findByCssSelector('.echChartStatus'); + const debugDataString: string | undefined = await visContainer.getAttribute( + 'data-ech-debug-state' + ); + this.log.debug('data-ech-debug-state: ', debugDataString); + + if (debugDataString === undefined) { + throw Error( + `Elastic charts debugState not found, ensure 'setNewChartUiDebugFlag' is called before DOM rendering starts.` ); - return debugDataString ? JSON.parse(debugDataString) : null; + } + + try { + return JSON.parse(debugDataString); } catch (error) { - throw Error('Elastic charts debugState not found'); + throw Error('Unable to parse Elastic charts debugState'); } } diff --git a/test/functional/services/visualizations/pie_chart.ts b/test/functional/services/visualizations/pie_chart.ts index 462b892b29444..7dbac7f6a2e5c 100644 --- a/test/functional/services/visualizations/pie_chart.ts +++ b/test/functional/services/visualizations/pie_chart.ts @@ -8,6 +8,7 @@ import expect from '@kbn/expect'; import { isNil } from 'lodash'; +import { DebugState } from '@elastic/charts'; import { FtrService } from '../../ftr_provider_context'; const partitionVisChartSelector = 'partitionVisChart'; @@ -20,6 +21,7 @@ export class PieChartService extends FtrService { private readonly testSubjects = this.ctx.getService('testSubjects'); private readonly find = this.ctx.getService('find'); private readonly panelActions = this.ctx.getService('dashboardPanelActions'); + private readonly elasticChart = this.ctx.getService('elasticChart'); private readonly defaultFindTimeout = this.config.get('timeouts.find'); private readonly visChart = this.ctx.getPageObject('visChart'); @@ -28,9 +30,9 @@ export class PieChartService extends FtrService { async clickOnPieSlice(name?: string) { this.log.debug(`PieChart.clickOnPieSlice(${name})`); if (await this.visChart.isNewLibraryChart(partitionVisChartSelector)) { - const slices = - (await this.visChart.getEsChartDebugState(partitionVisChartSelector))?.partition?.[0] - ?.partitions ?? []; + const slices = this.getSlices( + await this.visChart.getEsChartDebugState(partitionVisChartSelector) + ); let sliceLabel = name || slices[0].name; if (name === 'Other') { sliceLabel = '__other__'; @@ -89,9 +91,9 @@ export class PieChartService extends FtrService { async getPieSliceStyle(name: string) { this.log.debug(`VisualizePage.getPieSliceStyle(${name})`); if (await this.visChart.isNewLibraryChart(partitionVisChartSelector)) { - const slices = - (await this.visChart.getEsChartDebugState(partitionVisChartSelector))?.partition?.[0] - ?.partitions ?? []; + const slices = this.getSlices( + await this.visChart.getEsChartDebugState(partitionVisChartSelector) + ); const selectedSlice = slices.filter((slice) => { return slice.name.toString() === name.replace(',', ''); }); @@ -103,9 +105,9 @@ export class PieChartService extends FtrService { async getAllPieSlicesColors() { const slicesColors = []; - const slices = - (await this.visChart.getEsChartDebugState(partitionVisChartSelector))?.partition?.[0] - ?.partitions ?? []; + const slices = this.getSlices( + await this.visChart.getEsChartDebugState(partitionVisChartSelector) + ); for (const slice of slices) { slicesColors.push(slice.color); } @@ -115,9 +117,9 @@ export class PieChartService extends FtrService { async getAllPieSliceColor(name: string) { this.log.debug(`VisualizePage.getAllPieSliceColor(${name})`); if (await this.visChart.isNewLibraryChart(partitionVisChartSelector)) { - const slices = - (await this.visChart.getEsChartDebugState(partitionVisChartSelector))?.partition?.[0] - ?.partitions ?? []; + const slices = this.getSlices( + await this.visChart.getEsChartDebugState(partitionVisChartSelector) + ); const selectedSlice = slices.filter((slice) => { return slice.name.toString() === name.replace(',', ''); }); @@ -155,9 +157,9 @@ export class PieChartService extends FtrService { async getPieChartLabels(isNewLibrary: boolean = true) { if (isNewLibrary) { - const slices = - (await this.visChart.getEsChartDebugState(partitionVisChartSelector))?.partition?.[0] - ?.partitions ?? []; + const slices = this.getSlices( + await this.visChart.getEsChartDebugState(partitionVisChartSelector) + ); return slices.map((slice) => { if (slice.name === '__missing__') { return 'Missing'; @@ -181,9 +183,9 @@ export class PieChartService extends FtrService { async getPieChartValues(isNewLibrary: boolean = true) { this.log.debug('PieChart.getPieChartValues'); if (isNewLibrary) { - const slices = - (await this.visChart.getEsChartDebugState(partitionVisChartSelector))?.partition?.[0] - ?.partitions ?? []; + const slices = this.getSlices( + await this.visChart.getEsChartDebugState(partitionVisChartSelector) + ); return slices.map((slice) => { return slice.value; }); @@ -197,9 +199,9 @@ export class PieChartService extends FtrService { async getPieSliceCount(isNewLibrary: boolean = true) { this.log.debug('PieChart.getPieSliceCount'); if (isNewLibrary) { - const slices = - (await this.visChart.getEsChartDebugState(partitionVisChartSelector))?.partition?.[0] - ?.partitions ?? []; + const slices = this.getSlices( + await this.visChart.getEsChartDebugState(partitionVisChartSelector) + ); return slices?.length; } const slices = await this.find.allByCssSelector('svg > g > g.arcs > path.slice'); @@ -214,23 +216,21 @@ export class PieChartService extends FtrService { this.log.debug(`Found ${charts.length} charts`); for (const chart of charts) { await chart.moveMouseTo(); - const visContainer = await chart.findByCssSelector('.echChartStatus'); - const debugDataString: string | undefined = await visContainer.getAttribute( - 'data-ech-debug-state' - ); - if (debugDataString) { - const parsedData = JSON.parse(debugDataString); - const partition = parsedData?.partition?.[0] ?? []; - pieSlices += partition.partitions.length; - } + const pieChartData = await this.elasticChart.getChartDebugDataFromChart(chart); + const slices = this.getSlices(pieChartData); + pieSlices += slices.length; } return pieSlices; } + getSlices(pieChartData: DebugState) { + return pieChartData?.partition?.[0]?.partitions ?? []; + } + async expectPieSliceCountEsCharts(expectedCount: number) { - const slices = - (await this.visChart.getEsChartDebugState(partitionVisChartSelector))?.partition?.[0] - ?.partitions ?? []; + const slices = this.getSlices( + await this.visChart.getEsChartDebugState(partitionVisChartSelector) + ); expect(slices.length).to.be(expectedCount); } From 8a687f233bbb441b70dda5f9226492fee37d9a00 Mon Sep 17 00:00:00 2001 From: Tiago Costa Date: Wed, 8 Feb 2023 22:04:54 +0000 Subject: [PATCH 56/60] fix(NA): saved objects actions integration tests --- .../saved_objects/migrations/actions/actions.test.ts | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts b/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts index 2314e654607bc..1b06c05cca727 100644 --- a/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts +++ b/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts @@ -1093,7 +1093,7 @@ describe('migration actions', () => { left: { error: expect.any(errors.ResponseError), message: expect.stringContaining( - '[timeout_exception] Timed out waiting for completion of [Task' + '[timeout_exception] Timed out waiting for completion of task' ), type: 'wait_for_task_completion_timeout', }, @@ -1394,7 +1394,7 @@ describe('migration actions', () => { left: { error: expect.any(errors.ResponseError), message: expect.stringContaining( - '[timeout_exception] Timed out waiting for completion of [Task' + '[timeout_exception] Timed out waiting for completion of task' ), type: 'wait_for_task_completion_timeout', }, From 2846b8c27cf7da5a9e5c8152177376fdb8d2cffe Mon Sep 17 00:00:00 2001 From: christineweng <18648970+christineweng@users.noreply.github.com> Date: Wed, 8 Feb 2023 16:40:49 -0600 Subject: [PATCH 57/60] [Security Solution][Bug] Alerts type discrepancy and ui improvements (#150504) This PR addresses the following: #### Bug fix https://github.com/elastic/kibana/issues/150278 described a discrepancy between total alert count in alert by type chart and everywhere else on alerts page. This is due to `event.type` being a multi-select, if an alert has 3 event types (i.e. creation, info, denied), it is counted 3 times on alert by type graph. This logic is now updated to categorize an alert once - if `denied` event type exists, such event count => `Prevention` - total alert count - prevention count => `Detection`. #### UI improvements - Top alerts chart no longer shows `Other` when number of grouping is less than 10 per https://github.com/elastic/kibana/pull/150242#issuecomment-1419628829 ![image](https://user-images.githubusercontent.com/18648970/217382166-073d2da9-f49d-4bf7-9a08-3795d5948e33.png) - Changed `EmptyDonutChart`'s background based on dark/light mode Before -> After ![image](https://user-images.githubusercontent.com/18648970/217382463-1ef44127-1cdf-4a70-85f2-8c78a612c485.png) - Loading spinner for donut chart was not showing, it is now fixed ![image](https://user-images.githubusercontent.com/18648970/217382665-93e093e3-119a-4be4-a313-072ef118eec7.png) --------- Co-authored-by: kibanamachine <42973632+kibanamachine@users.noreply.github.com> --- .../components/charts/donutchart_empty.tsx | 3 +- .../alerts_by_type_panel/columns.tsx | 4 +- .../alerts_by_type_panel/helpers.tsx | 49 +++++++++++-------- .../alerts_by_type_panel/translations.ts | 14 ++++++ .../helpers.test.tsx | 2 +- .../alerts_progress_bar_panel/helpers.tsx | 14 +++--- .../alerts_progress_bar_panel/mock_data.ts | 1 - .../severity_level_chart.tsx | 18 +++---- 8 files changed, 63 insertions(+), 42 deletions(-) diff --git a/x-pack/plugins/security_solution/public/common/components/charts/donutchart_empty.tsx b/x-pack/plugins/security_solution/public/common/components/charts/donutchart_empty.tsx index a378f94bfbe1e..e59a685133ba5 100644 --- a/x-pack/plugins/security_solution/public/common/components/charts/donutchart_empty.tsx +++ b/x-pack/plugins/security_solution/public/common/components/charts/donutchart_empty.tsx @@ -6,6 +6,7 @@ */ import React from 'react'; import styled from 'styled-components'; +import { useEuiBackgroundColor } from '@elastic/eui'; interface DonutChartEmptyProps { size?: number; @@ -29,7 +30,7 @@ const SmallRing = styled.div` ${({ size }) => ` height: ${size}px; width: ${size}px; - background-color: white; + background-color: ${useEuiBackgroundColor('plain')}; display: inline-block; vertical-align: middle;`} `; diff --git a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/columns.tsx b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/columns.tsx index f1479ae58f945..6b23f82ad917a 100644 --- a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/columns.tsx +++ b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/columns.tsx @@ -12,7 +12,7 @@ import type { AlertsTypeData, AlertType } from './types'; import { DefaultDraggable } from '../../../../common/components/draggables'; import { FormattedCount } from '../../../../common/components/formatted_number'; import { ALERTS_HEADERS_RULE_NAME } from '../../alerts_table/translations'; -import { ALERT_TYPE_COLOR } from './helpers'; +import { ALERT_TYPE_COLOR, ALERT_TYPE_LABEL } from './helpers'; import { COUNT_TABLE_TITLE } from '../alerts_count_panel/translations'; import * as i18n from './translations'; @@ -46,7 +46,7 @@ export const getAlertsTypeTableColumns = (): Array - {type} + {ALERT_TYPE_LABEL[type as AlertType]} ); diff --git a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/helpers.tsx b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/helpers.tsx index 94246f6932178..55cc705cf78bb 100644 --- a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/helpers.tsx +++ b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/helpers.tsx @@ -8,11 +8,16 @@ import { has } from 'lodash'; import type { AlertType, AlertsByTypeAgg, AlertsTypeData } from './types'; import type { AlertSearchResponse } from '../../../containers/detection_engine/alerts/types'; import type { SummaryChartsData, SummaryChartsAgg } from '../alerts_summary_charts_panel/types'; +import { DETECTION, PREVENTION } from './translations'; export const ALERT_TYPE_COLOR = { Detection: '#D36086', Prevention: '#54B399', }; +export const ALERT_TYPE_LABEL = { + Detection: DETECTION, + Prevention: PREVENTION, +}; export const parseAlertsTypeData = ( response: AlertSearchResponse<{}, AlertsByTypeAgg> @@ -22,40 +27,44 @@ export const parseAlertsTypeData = ( ? [] : rulesBuckets.flatMap((rule) => { const events = rule.ruleByEventType?.buckets ?? []; - return getAggregateAlerts(rule.key, events); + return getAlertType(rule.key, rule.doc_count, events); }); }; -const getAggregateAlerts = ( +const getAlertType = ( ruleName: string, + ruleCount: number, ruleEvents: Array<{ key: string; doc_count: number }> ): AlertsTypeData[] => { - let preventions = 0; - let detections = 0; - - ruleEvents.map((eventBucket) => { - return eventBucket.key === 'denied' - ? (preventions += eventBucket.doc_count) - : (detections += eventBucket.doc_count); - }); + const preventions = ruleEvents.find((bucket) => bucket.key === 'denied'); + if (!preventions) { + return [ + { + rule: ruleName, + type: 'Detection' as AlertType, + value: ruleCount, + color: ALERT_TYPE_COLOR.Detection, + }, + ]; + } const ret = []; - if (detections > 0) { + if (preventions.doc_count < ruleCount) { ret.push({ rule: ruleName, type: 'Detection' as AlertType, - value: detections, + value: ruleCount - preventions.doc_count, color: ALERT_TYPE_COLOR.Detection, }); } - if (preventions > 0) { - ret.push({ - rule: ruleName, - type: 'Prevention' as AlertType, - value: preventions, - color: ALERT_TYPE_COLOR.Prevention, - }); - } + + ret.push({ + rule: ruleName, + type: 'Prevention' as AlertType, + value: preventions.doc_count, + color: ALERT_TYPE_COLOR.Prevention, + }); + return ret; }; diff --git a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/translations.ts b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/translations.ts index 462ff3ea2774b..5f1c6c4ada642 100644 --- a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/translations.ts +++ b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_by_type_panel/translations.ts @@ -33,3 +33,17 @@ export const DETECTIONS = i18n.translate( defaultMessage: 'Detections', } ); + +export const PREVENTION = i18n.translate( + 'xpack.securitySolution.detectionEngine.alerts.alertsByType.prevention', + { + defaultMessage: 'Prevention', + } +); + +export const DETECTION = i18n.translate( + 'xpack.securitySolution.detectionEngine.alerts.alertsByType.detection', + { + defaultMessage: 'Detection', + } +); diff --git a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/helpers.test.tsx b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/helpers.test.tsx index 06c7cc0ce7e16..cea8c44d0be60 100644 --- a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/helpers.test.tsx +++ b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/helpers.test.tsx @@ -17,7 +17,7 @@ describe('parse progress bar data', () => { expect(res).toEqual(mock.parsedAlerts); }); - test('parse severity without data', () => { + test('parse alerts without data', () => { const res = parseAlertsGroupingData( mock.mockAlertsEmptyData as AlertSearchResponse<{}, AlertsByGroupingAgg> ); diff --git a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/helpers.tsx b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/helpers.tsx index a441f41094c5d..a05fe64a80837 100644 --- a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/helpers.tsx +++ b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/helpers.tsx @@ -33,12 +33,14 @@ export const parseAlertsGroupingData = ( }; }); - topAlerts.push({ - key: 'Other', - value: other, - percentage: Math.round((other / total) * 1000) / 10, - label: i18n.OTHER, - }); + if (other > 0) { + topAlerts.push({ + key: 'Other', + value: other, + percentage: Math.round((other / total) * 1000) / 10, + label: i18n.OTHER, + }); + } return topAlerts; }; diff --git a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/mock_data.ts b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/mock_data.ts index 6eed4866333bc..1965ef1cfe162 100644 --- a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/mock_data.ts +++ b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/alerts_progress_bar_panel/mock_data.ts @@ -97,5 +97,4 @@ export const parsedAlerts = [ { key: 'Host-v5biklvcy8', value: 234, label: 'Host-v5biklvcy8', percentage: 41.1 }, { key: 'Host-5y1uprxfv2', value: 186, label: 'Host-5y1uprxfv2', percentage: 32.6 }, { key: 'Host-ssf1mhgy5c', value: 150, label: 'Host-ssf1mhgy5c', percentage: 26.3 }, - { key: 'Other', value: 0, label: 'Other', percentage: 0 }, ]; diff --git a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/severity_level_panel/severity_level_chart.tsx b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/severity_level_panel/severity_level_chart.tsx index 1ef5a9dd53f28..395357ff7b1b0 100644 --- a/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/severity_level_panel/severity_level_chart.tsx +++ b/x-pack/plugins/security_solution/public/detections/components/alerts_kpis/severity_level_panel/severity_level_chart.tsx @@ -4,9 +4,10 @@ * 2.0; you may not use this file except in compliance with the Elastic License * 2.0. */ -import React, { useCallback, useMemo, useEffect, useState } from 'react'; +import React, { useCallback, useMemo } from 'react'; import { isEmpty } from 'lodash/fp'; import { ALERT_SEVERITY } from '@kbn/rule-data-utils'; +import styled from 'styled-components'; import { EuiFlexGroup, EuiFlexItem, EuiInMemoryTable, EuiLoadingSpinner } from '@elastic/eui'; import type { SortOrder } from '@elastic/elasticsearch/lib/api/typesWithBodyKey'; import type { ShapeTreeNode, ElementClickListener } from '@elastic/charts'; @@ -17,10 +18,12 @@ import { ChartLabel } from '../../../../overview/components/detection_response/a import { getSeverityTableColumns } from './columns'; import { getSeverityColor } from './helpers'; import { TOTAL_COUNT_OF_ALERTS } from '../../alerts_table/translations'; -import { showInitialLoadingSpinner } from '../alerts_histogram_panel/helpers'; const DONUT_HEIGHT = 150; +const StyledEuiLoadingSpinner = styled(EuiLoadingSpinner)` + margin: auto; +`; export interface SeverityLevelProps { data: SeverityData[]; isLoading: boolean; @@ -32,7 +35,6 @@ export const SeverityLevelChart: React.FC = ({ isLoading, addFilter, }) => { - const [isInitialLoading, setIsInitialLoading] = useState(true); const columns = useMemo(() => getSeverityTableColumns(), []); const count = useMemo(() => { @@ -71,12 +73,6 @@ export const SeverityLevelChart: React.FC = ({ [addFilter] ); - useEffect(() => { - if (!showInitialLoadingSpinner({ isInitialLoading, isLoadingAlerts: isLoading })) { - setIsInitialLoading(false); - } - }, [isInitialLoading, isLoading, setIsInitialLoading]); - return ( @@ -89,8 +85,8 @@ export const SeverityLevelChart: React.FC = ({ /> - {isInitialLoading ? ( - + {isLoading ? ( + ) : ( Date: Wed, 8 Feb 2023 17:29:13 -0600 Subject: [PATCH 58/60] skip failing integration suite --- .../saved_objects/migrations/actions/actions.test.ts | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts b/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts index 1b06c05cca727..212c3bd826a45 100644 --- a/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts +++ b/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts @@ -57,7 +57,8 @@ const { startES } = createTestServers({ }); let esServer: TestElasticsearchUtils; -describe('migration actions', () => { +// FAILING: https://github.com/elastic/kibana/issues/150642 +describe.skip('migration actions', () => { let client: ElasticsearchClient; beforeAll(async () => { From 89a0ef851738aaa619a06f2033c97d93f03daa95 Mon Sep 17 00:00:00 2001 From: spalger Date: Wed, 8 Feb 2023 17:32:06 -0600 Subject: [PATCH 59/60] Revert "skip failing integration suite" This reverts commit 1dc283a8690bff61674adea76c030dd93d098cfc. --- .../saved_objects/migrations/actions/actions.test.ts | 3 +-- 1 file changed, 1 insertion(+), 2 deletions(-) diff --git a/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts b/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts index 212c3bd826a45..1b06c05cca727 100644 --- a/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts +++ b/src/core/server/integration_tests/saved_objects/migrations/actions/actions.test.ts @@ -57,8 +57,7 @@ const { startES } = createTestServers({ }); let esServer: TestElasticsearchUtils; -// FAILING: https://github.com/elastic/kibana/issues/150642 -describe.skip('migration actions', () => { +describe('migration actions', () => { let client: ElasticsearchClient; beforeAll(async () => { From 26c8d714cd9aaabba2d21dfef60aaf1953893f15 Mon Sep 17 00:00:00 2001 From: Kibana Machine <42973632+kibanamachine@users.noreply.github.com> Date: Wed, 8 Feb 2023 19:56:59 -0500 Subject: [PATCH 60/60] skip failing test suite (#149844) --- .../test/fleet_api_integration/apis/epm/install_prerelease.ts | 3 ++- 1 file changed, 2 insertions(+), 1 deletion(-) diff --git a/x-pack/test/fleet_api_integration/apis/epm/install_prerelease.ts b/x-pack/test/fleet_api_integration/apis/epm/install_prerelease.ts index 3231b9d9a438a..7e8a6c4f441a2 100644 --- a/x-pack/test/fleet_api_integration/apis/epm/install_prerelease.ts +++ b/x-pack/test/fleet_api_integration/apis/epm/install_prerelease.ts @@ -22,7 +22,8 @@ export default function (providerContext: FtrProviderContext) { await supertest.delete(`/api/fleet/epm/packages/${pkg}/${version}`).set('kbn-xsrf', 'xxxx'); }; - describe('installs package that has a prerelease version', async () => { + // Failing: See https://github.com/elastic/kibana/issues/149844 + describe.skip('installs package that has a prerelease version', async () => { skipIfNoDockerRegistry(providerContext); setupFleetAndAgents(providerContext);