diff --git a/map-chat/.gitignore b/map-chat/.gitignore new file mode 100644 index 0000000000..47f53f7772 --- /dev/null +++ b/map-chat/.gitignore @@ -0,0 +1,50 @@ +# Created by .gitignore support plugin (hsz.mobi) +### JetBrains template +# Covers JetBrains IDEs: IntelliJ, RubyMine, PhpStorm, AppCode, PyCharm + +*.iml + +## Directory-based project format: +.idea/ +# if you remove the above rule, at least ignore the following: + +# User-specific stuff: +# .idea/workspace.xml +# .idea/tasks.xml +# .idea/dictionaries + +# Sensitive or high-churn files: +# .idea/dataSources.ids +# .idea/dataSources.xml +# .idea/sqlDataSources.xml +# .idea/dynamic.xml +# .idea/uiDesigner.xml + +# Gradle: +# .idea/gradle.xml +# .idea/libraries + +# Mongo Explorer plugin: +# .idea/mongoSettings.xml + +## File-based project format: +*.ipr +*.iws + +## Plugin-specific files: + +# IntelliJ +out/ + +# mpeltonen/sbt-idea plugin +.idea_modules/ + +# JIRA plugin +atlassian-ide-plugin.xml + +# Crashlytics plugin (for Android Studio and IntelliJ) +com_crashlytics_export_strings.xml +crashlytics.properties +crashlytics-build.properties + + diff --git a/map-chat/favicons/android-chrome-36x36.png b/map-chat/favicons/android-chrome-36x36.png new file mode 100644 index 0000000000..ee5cc4b041 Binary files /dev/null and b/map-chat/favicons/android-chrome-36x36.png differ diff --git a/map-chat/favicons/android-chrome-48x48.png b/map-chat/favicons/android-chrome-48x48.png new file mode 100644 index 0000000000..e7244eeea5 Binary files /dev/null and b/map-chat/favicons/android-chrome-48x48.png differ diff --git a/map-chat/favicons/android-chrome-72x72.png b/map-chat/favicons/android-chrome-72x72.png new file mode 100644 index 0000000000..da709733b0 Binary files /dev/null and b/map-chat/favicons/android-chrome-72x72.png differ diff --git a/map-chat/favicons/android-chrome-96x96.png b/map-chat/favicons/android-chrome-96x96.png new file mode 100644 index 0000000000..2924de4af0 Binary files /dev/null and b/map-chat/favicons/android-chrome-96x96.png differ diff --git a/map-chat/favicons/apple-touch-icon-114x114.png b/map-chat/favicons/apple-touch-icon-114x114.png new file mode 100644 index 0000000000..3715d78c34 Binary files /dev/null and b/map-chat/favicons/apple-touch-icon-114x114.png differ diff --git a/map-chat/favicons/apple-touch-icon-120x120.png b/map-chat/favicons/apple-touch-icon-120x120.png new file mode 100644 index 0000000000..383c0dc2c8 Binary files /dev/null and b/map-chat/favicons/apple-touch-icon-120x120.png differ diff --git a/map-chat/favicons/apple-touch-icon-57x57.png b/map-chat/favicons/apple-touch-icon-57x57.png new file mode 100644 index 0000000000..8826d85675 Binary files /dev/null and b/map-chat/favicons/apple-touch-icon-57x57.png differ diff --git a/map-chat/favicons/apple-touch-icon-60x60.png b/map-chat/favicons/apple-touch-icon-60x60.png new file mode 100644 index 0000000000..cb82e88ef8 Binary files /dev/null and b/map-chat/favicons/apple-touch-icon-60x60.png differ diff --git a/map-chat/favicons/apple-touch-icon-72x72.png b/map-chat/favicons/apple-touch-icon-72x72.png new file mode 100644 index 0000000000..da709733b0 Binary files /dev/null and b/map-chat/favicons/apple-touch-icon-72x72.png differ diff --git a/map-chat/favicons/apple-touch-icon-76x76.png b/map-chat/favicons/apple-touch-icon-76x76.png new file mode 100644 index 0000000000..9e120ac46c Binary files /dev/null and b/map-chat/favicons/apple-touch-icon-76x76.png differ diff --git a/map-chat/favicons/apple-touch-icon-precomposed.png b/map-chat/favicons/apple-touch-icon-precomposed.png new file mode 100644 index 0000000000..9594e5b7eb Binary files /dev/null and b/map-chat/favicons/apple-touch-icon-precomposed.png differ diff --git a/map-chat/favicons/apple-touch-icon.png b/map-chat/favicons/apple-touch-icon.png new file mode 100644 index 0000000000..383c0dc2c8 Binary files /dev/null and b/map-chat/favicons/apple-touch-icon.png differ diff --git a/map-chat/favicons/browserconfig.xml b/map-chat/favicons/browserconfig.xml new file mode 100644 index 0000000000..55f0d33ba7 --- /dev/null +++ b/map-chat/favicons/browserconfig.xml @@ -0,0 +1,11 @@ + + + + + + + + #da532c + + + diff --git a/map-chat/favicons/favicon-16x16.png b/map-chat/favicons/favicon-16x16.png new file mode 100644 index 0000000000..a7fae9722d Binary files /dev/null and b/map-chat/favicons/favicon-16x16.png differ diff --git a/map-chat/favicons/favicon-32x32.png b/map-chat/favicons/favicon-32x32.png new file mode 100644 index 0000000000..a9e633a723 Binary files /dev/null and b/map-chat/favicons/favicon-32x32.png differ diff --git a/map-chat/favicons/favicon-96x96.png b/map-chat/favicons/favicon-96x96.png new file mode 100644 index 0000000000..2924de4af0 Binary files /dev/null and b/map-chat/favicons/favicon-96x96.png differ diff --git a/map-chat/favicons/favicon.ico b/map-chat/favicons/favicon.ico new file mode 100644 index 0000000000..c7f81750b6 Binary files /dev/null and b/map-chat/favicons/favicon.ico differ diff --git a/map-chat/favicons/manifest.json b/map-chat/favicons/manifest.json new file mode 100644 index 0000000000..2d54beb133 --- /dev/null +++ b/map-chat/favicons/manifest.json @@ -0,0 +1,29 @@ +{ + "name": "My app", + "icons": [ + { + "src": "\/android-chrome-36x36.png", + "sizes": "36x36", + "type": "image\/png", + "density": "0.75" + }, + { + "src": "\/android-chrome-48x48.png", + "sizes": "48x48", + "type": "image\/png", + "density": "1.0" + }, + { + "src": "\/android-chrome-72x72.png", + "sizes": "72x72", + "type": "image\/png", + "density": "1.5" + }, + { + "src": "\/android-chrome-96x96.png", + "sizes": "96x96", + "type": "image\/png", + "density": "2.0" + } + ] +} diff --git a/map-chat/favicons/mstile-150x150.png b/map-chat/favicons/mstile-150x150.png new file mode 100644 index 0000000000..02db7ab03a Binary files /dev/null and b/map-chat/favicons/mstile-150x150.png differ diff --git a/map-chat/favicons/mstile-310x150.png b/map-chat/favicons/mstile-310x150.png new file mode 100644 index 0000000000..e6e815e8af Binary files /dev/null and b/map-chat/favicons/mstile-310x150.png differ diff --git a/map-chat/favicons/mstile-70x70.png b/map-chat/favicons/mstile-70x70.png new file mode 100644 index 0000000000..630031aafd Binary files /dev/null and b/map-chat/favicons/mstile-70x70.png differ diff --git a/map-chat/images/blue_marker.png b/map-chat/images/blue_marker.png new file mode 100644 index 0000000000..a7f31c1f39 Binary files /dev/null and b/map-chat/images/blue_marker.png differ diff --git a/map-chat/images/grey_marker.png b/map-chat/images/grey_marker.png new file mode 100644 index 0000000000..20343a36a8 Binary files /dev/null and b/map-chat/images/grey_marker.png differ diff --git a/map-chat/images/twitter_icon_small.png b/map-chat/images/twitter_icon_small.png new file mode 100644 index 0000000000..1c1d2978e7 Binary files /dev/null and b/map-chat/images/twitter_icon_small.png differ diff --git a/map-chat/index.html b/map-chat/index.html new file mode 100644 index 0000000000..fecc68290f --- /dev/null +++ b/map-chat/index.html @@ -0,0 +1,123 @@ + + + MapChat + + + + + + + + + + + + + + + + + + + + + + + +
+ Translation +
+
+ + + +
+ +
+ + + + Fork me on GitHub + + +
+
+ + + +
+
+ + + +
+
+ +
+ +
+
+ +
+
+ +
+ + + +
+ +
+ + + +
+ + + + + + + + + + + + + + + + diff --git a/map-chat/javascript/browserMqtt.js b/map-chat/javascript/browserMqtt.js new file mode 100644 index 0000000000..5b5472a0cd --- /dev/null +++ b/map-chat/javascript/browserMqtt.js @@ -0,0 +1,11108 @@ +(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.mqtt = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o to + * + * @param {String} topic - topic to publish to + * @param {String, Buffer} message - message to publish + * @param {Object} [opts] - publish options, includes: + * {Number} qos - qos level to publish on + * {Boolean} retain - whether or not to retain the message + * @param {Function} [callback] - function(err){} + * called when publish succeeds or fails + * @returns {MqttClient} this - for chaining + * @api public + * + * @example client.publish('topic', 'message'); + * @example + * client.publish('topic', 'message', {qos: 1, retain: true}); + * @example client.publish('topic', 'message', console.log); + */ +MqttClient.prototype.publish = function (topic, message, opts, callback) { + var packet; + + // .publish(topic, payload, cb); + if ('function' === typeof opts) { + callback = opts; + opts = null; + } + + // Default opts + if (!opts) { + opts = {qos: 0, retain: false}; + } + + if (this._checkDisconnecting(callback)) { + return this; + } + + callback = callback || nop; + + packet = { + cmd: 'publish', + topic: topic, + payload: message, + qos: opts.qos, + retain: opts.retain, + messageId: this._nextId() + }; + + switch (opts.qos) { + case 1: + case 2: + // Add to callbacks + this.outgoing[packet.messageId] = callback; + this._sendPacket(packet); + break; + default: + this._sendPacket(packet, callback); + break; + } + + return this; +}; + +/** + * subscribe - subscribe to + * + * @param {String, Array, Object} topic - topic(s) to subscribe to, supports objects in the form {'topic': qos} + * @param {Object} [opts] - optional subscription options, includes: + * {Number} qos - subscribe qos level + * @param {Function} [callback] - function(err, granted){} where: + * {Error} err - subscription error (none at the moment!) + * {Array} granted - array of {topic: 't', qos: 0} + * @returns {MqttClient} this - for chaining + * @api public + * @example client.subscribe('topic'); + * @example client.subscribe('topic', {qos: 1}); + * @example client.subscribe({'topic': 0, 'topic2': 1}, console.log); + * @example client.subscribe('topic', console.log); + */ +MqttClient.prototype.subscribe = function () { + var packet, + args = Array.prototype.slice.call(arguments), + subs = [], + obj = args.shift(), + callback = args.pop() || nop, + opts = args.pop(); + + if ('string' === typeof obj) { + obj = [obj]; + } + + if (this._checkDisconnecting(callback)) { + return this; + } + + if ('function' !== typeof callback) { + opts = callback; + callback = nop; + } + + if (!opts) { + opts = { qos: 0 }; + } + + if (Array.isArray(obj)) { + obj.forEach(function (topic) { + subs.push({ + topic: topic, + qos: opts.qos + }); + }); + } else { + Object + .keys(obj) + .forEach(function (k) { + subs.push({ + topic: k, + qos: obj[k] + }); + }); + } + + packet = { + cmd: 'subscribe', + subscriptions: subs, + qos: 1, + retain: false, + dup: false, + messageId: this._nextId() + }; + + this.outgoing[packet.messageId] = callback; + + this._sendPacket(packet); + + return this; +}; + +/** + * unsubscribe - unsubscribe from topic(s) + * + * @param {String, Array} topic - topics to unsubscribe from + * @param {Function} [callback] - callback fired on unsuback + * @returns {MqttClient} this - for chaining + * @api public + * @example client.unsubscribe('topic'); + * @example client.unsubscribe('topic', console.log); + */ +MqttClient.prototype.unsubscribe = function (topic, callback) { + var packet = { + cmd: 'unsubscribe', + qos: 1, + messageId: this._nextId() + }; + + callback = callback || nop; + + if (this._checkDisconnecting(callback)) { + return this; + } + + if ('string' === typeof topic) { + packet.unsubscriptions = [topic]; + } else if ('object' === typeof topic && topic.length) { + packet.unsubscriptions = topic; + } + + this.outgoing[packet.messageId] = callback; + + this._sendPacket(packet); + + return this; +}; + +/** + * end - close connection + * + * @returns {MqttClient} this - for chaining + * @api public + */ +MqttClient.prototype.end = function (cb) { + var that = this; + + function closeStores () { + that.incomingStore.close(function () { + that.outgoingStore.close(cb); + }); + } + + function finish () { + that._cleanUp(false, closeStores); + } + + if (this.disconnecting) { + return true; + } + + this.disconnecting = true; + + if (0 < Object.keys(this.outgoing).length) { + // wait 10ms, just to be sure we received all of it + this.once('outgoingEmpty', setTimeout.bind(null, finish, 10)); + } else { + finish(); + } + + return this; +}; + +/** + * _reconnect - implement reconnection + * @api privateish + */ +MqttClient.prototype._reconnect = function () { + this.emit('reconnect'); + this._setupStream(); +}; + +/** + * _setupReconnect - setup reconnect timer + */ +MqttClient.prototype._setupReconnect = function () { + var that = this; + + if (!that.disconnecting && !that.reconnectTimer && (0 < that.options.reconnectPeriod)) { + this.emit('offline'); + that.reconnectTimer = setInterval(function () { + that._reconnect(); + }, that.options.reconnectPeriod); + } +}; + +/** + * _clearReconnect - clear the reconnect timer + */ +MqttClient.prototype._clearReconnect = function () { + if (this.reconnectTimer) { + clearInterval(this.reconnectTimer); + this.reconnectTimer = false; + } +}; + + +/** + * _cleanUp - clean up on connection end + * @api private + */ +MqttClient.prototype._cleanUp = function (forced, done) { + if (done) { + this.stream.on('close', done); + } + + if (forced) { + this.stream.destroy(); + } else { + this._sendPacket( + { cmd: 'disconnect' }, + setImmediate.bind( + null, + this.stream.end.bind(this.stream) + ) + ); + } + + this._clearReconnect(); + + if (null !== this.pingTimer) { + clearInterval(this.pingTimer); + this.pingTimer = null; + } +}; + +/** + * _sendPacket - send or queue a packet + * @param {String} type - packet type (see `protocol`) + * @param {Object} packet - packet options + * @param {Function} cb - callback when the packet is sent + * @api private + */ +MqttClient.prototype._sendPacket = function (packet, cb) { + if (!this.connected) { + return this.queue.push({ packet: packet, cb: cb }); + } + + switch (packet.qos) { + case 2: + case 1: + storeAndSend(this, packet, cb); + break; + /** + * no need of case here since it will be caught by default + * and jshint comply that before default it must be a break + * anyway it will result in -1 evaluation + */ + case 0: + /* falls through */ + default: + sendPacket(this, packet, cb); + break; + } +}; + +/** + * _setupPingTimer - setup the ping timer + * + * @api private + */ +MqttClient.prototype._setupPingTimer = function () { + var that = this; + + if (!this.pingTimer && this.options.keepalive) { + this.pingResp = true; + this.pingTimer = setInterval(function () { + that._checkPing(); + }, this.options.keepalive * 1000); + } +}; + +/** + * _checkPing - check if a pingresp has come back, and ping the server again + * + * @api private + */ +MqttClient.prototype._checkPing = function () { + if (this.pingResp) { + this.pingResp = false; + this._sendPacket({ cmd: 'pingreq' }); + } else { + // do a forced cleanup since socket will be in bad shape + this._cleanUp(true); + } +}; + +/** + * _handlePingresp - handle a pingresp + * + * @api private + */ +MqttClient.prototype._handlePingresp = function () { + this.pingResp = true; +}; + +/** + * _handleConnack + * + * @param {Object} packet + * @api private + */ + +MqttClient.prototype._handleConnack = function (packet) { + var rc = packet.returnCode, + // TODO: move to protocol + errors = [ + '', + 'Unacceptable protocol version', + 'Identifier rejected', + 'Server unavailable', + 'Bad username or password', + 'Not authorized' + ]; + + if (0 === rc) { + this.emit('connect'); + } else if (0 < rc) { + this.emit('error', + new Error('Connection refused: ' + errors[rc])); + } +}; + +/** + * _handlePublish + * + * @param {Object} packet + * @api private + */ +/* +those late 2 case should be rewrite to comply with coding style: + +case 1: +case 0: + // do not wait sending a puback + // no callback passed + if (1 === qos) { + this._sendPacket({ + cmd: 'puback', + messageId: mid + }); + } + // emit the message event for both qos 1 and 0 + this.emit('message', topic, message, packet); + this.handleMessage(packet, done); + break; +default: + // do nothing but every switch mus have a default + // log or throw an error about unknown qos + break; + +for now i just suppressed the warnings +*/ +MqttClient.prototype._handlePublish = function (packet, done) { + var topic = packet.topic.toString(), + message = packet.payload, + qos = packet.qos, + mid = packet.messageId, + that = this; + + switch (qos) { + case 2: + this.incomingStore.put(packet, function () { + that._sendPacket({cmd: 'pubrec', messageId: mid}, done); + }); + break; + case 1: + // do not wait sending a puback + // no callback passed + this._sendPacket({ + cmd: 'puback', + messageId: mid + }); + /* falls through */ + case 0: + // emit the message event for both qos 1 and 0 + this.emit('message', topic, message, packet); + this.handleMessage(packet, done); + break; + default: + // do nothing + // log or throw an error about unknown qos + break; + } +}; + +/** + * Handle messages with backpressure support, one at a time. + * Override at will. + * + * @param Packet packet the packet + * @param Function callback call when finished + * @api public + */ +MqttClient.prototype.handleMessage = function (packet, callback) { + callback(); +}; + +/** + * _handleAck + * + * @param {Object} packet + * @api private + */ + +MqttClient.prototype._handleAck = function (packet) { + var mid = packet.messageId, + type = packet.cmd, + response = null, + cb = this.outgoing[mid], + that = this; + + if (!cb) { + // Server sent an ack in error, ignore it. + return; + } + + // Process + switch (type) { + case 'pubcomp': + // same thing as puback for QoS 2 + case 'puback': + // Callback - we're done + delete this.outgoing[mid]; + this.outgoingStore.del(packet, cb); + break; + case 'pubrec': + response = { + cmd: 'pubrel', + qos: 2, + messageId: mid + }; + + this._sendPacket(response); + break; + case 'suback': + delete this.outgoing[mid]; + this.outgoingStore.del(packet, function (err, original) { + var i, + origSubs = original.subscriptions, + granted = packet.granted; + + if (err) { + // missing packet, what should we do? + return that.emit('error', err); + } + + for (i = 0; i < granted.length; i += 1) { + origSubs[i].qos = granted[i]; + } + + cb(null, origSubs); + }); + break; + case 'unsuback': + delete this.outgoing[mid]; + this.outgoingStore.del(packet, cb); + break; + default: + that.emit('error', new Error('unrecognized packet type')); + } + + if (this.disconnecting && + 0 === Object.keys(this.outgoing).length) { + this.emit('outgoingEmpty'); + } +}; + +/** + * _handlePubrel + * + * @param {Object} packet + * @api private + */ + +MqttClient.prototype._handlePubrel = function (packet, callback) { + var mid = packet.messageId, + that = this; + + that.incomingStore.get(packet, function (err, pub) { + if (err) { + return that.emit('error', err); + } + + if ('pubrel' !== pub.cmd) { + that.emit('message', pub.topic, pub.payload, pub); + that.incomingStore.put(packet); + } + + that._sendPacket({cmd: 'pubcomp', messageId: mid}, callback); + }); +}; + +/** + * _nextId + */ +MqttClient.prototype._nextId = function () { + var id = this.nextId++; + // Ensure 16 bit unsigned int: + if (65535 === id) { + this.nextId = 1; + } + return id; +}; + +module.exports = MqttClient; + +}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) +},{"./store":5,"_process":45,"end-of-stream":7,"events":42,"inherits":10,"mqtt-packet":13,"readable-stream":26}],2:[function(require,module,exports){ +'use strict'; +var net = require('net'); + +/* + variables port and host can be removed since + you have all required information in opts object +*/ +function buildBuilder (client, opts) { + var port, host; + opts.port = opts.port || 1883; + opts.hostname = opts.hostname || opts.host || 'localhost'; + + port = opts.port; + host = opts.hostname; + + return net.createConnection(port, host); +} + +module.exports = buildBuilder; + +},{"net":36}],3:[function(require,module,exports){ +'use strict'; +var tls = require('tls'); + +function buildBuilder (mqttClient, opts) { + var connection; + opts.port = opts.port || 8883; + opts.host = opts.hostname || opts.host || 'localhost'; + + /** + * this should be further investigated + * the result is opts.rejectUnauthorized = opts.rejectUnauthorized + * do you want to check for undefined and set it to false default ? + */ + /*jshint ignore:start */ + opts.rejectUnauthorized = !(false === opts.rejectUnauthorized); + /*jshint ignore:end */ + + connection = tls.connect(opts); + /*eslint no-use-before-define: [2, "nofunc"]*/ + connection.on('secureConnect', function () { + if (opts.rejectUnauthorized && !connection.authorized) { + connection.emit('error', new Error('TLS not authorized')); + } else { + connection.removeListener('error', handleTLSerrors); + } + }); + + /* + * to comply with strict rules, a function must be + * declared before it can be used + * so i moved it has to be moved before its first call + * later on maybe we can move all of them to the top of the file + * for now i just suppressed the warning + */ + /*jshint latedef:false*/ + function handleTLSerrors (err) { + // How can I get verify this error is a tls error? + if (opts.rejectUnauthorized) { + mqttClient.emit('error', err); + } + + // close this connection to match the behaviour of net + // otherwise all we get is an error from the connection + // and close event doesn't fire. This is a work around + // to enable the reconnect code to work the same as with + // net.createConnection + connection.end(); + } + /*jshint latedef:false*/ + + connection.on('error', handleTLSerrors); + return connection; +} + +module.exports = buildBuilder; + +},{"tls":36}],4:[function(require,module,exports){ +(function (process){ +'use strict'; + +var websocket = require('websocket-stream'), + _URL = require('url'); + +function buildBuilder (client, opts) { + var host = opts.hostname || 'localhost', + port = String(opts.port || 80), + path = opts.path || '/', + url = opts.protocol + '://' + host + ':' + port + path, + ws = websocket(url, { + protocol: 'mqttv3.1' + }); + + return ws; +} + +function buildBuilderBrowser (mqttClient, opts) { + var url, + parsed = _URL.parse(document.URL); + + if (!opts.protocol) { + if ('https:' === parsed.protocol) { + opts.protocol = 'wss'; + } else { + opts.protocol = 'ws'; + } + } + + if (!opts.hostname) { + opts.hostnme = opts.host; + } + + if (!opts.hostname) { + opts.hostname = parsed.hostname; + if (!opts.port) { + opts.port = parsed.port; + } + } + + if (!opts.port) { + if ('wss' === opts.protocol) { + opts.port = 443; + } else { + opts.port = 80; + } + } + + if (!opts.path) { + opts.path = '/'; + } + + url = opts.protocol + '://' + opts.hostname + ':' + opts.port + opts.path; + + return websocket(url, 'mqttv3.1'); +} + +if ('browser' !== process.title) { + module.exports = buildBuilder; +} else { + module.exports = buildBuilderBrowser; +} + +}).call(this,require('_process')) +},{"_process":45,"url":63,"websocket-stream":34}],5:[function(require,module,exports){ +'use strict'; +var PassThrough = require('readable-stream').PassThrough, + streamsOpts = { objectMode: true }; + +/** + * In-memory implementation of the message store + * This can actually be saved into files. + * + */ +function Store () { + if (!(this instanceof Store)) { + return new Store(); + } + + this._inflights = {}; +} + +/** + * Adds a packet to the store, a packet is + * anything that has a messageId property. + * + */ +Store.prototype.put = function (packet, cb) { + this._inflights[packet.messageId] = packet; + + if (cb) { + cb(); + } + + return this; +}; + +/** + * Creates a stream with all the packets in the store + * + */ +Store.prototype.createStream = function () { + var stream = new PassThrough(streamsOpts), + ids = Object.keys(this._inflights), + i = 0; + + for (i = 0; i < ids.length; i++) { + stream.write(this._inflights[ids[i]]); + } + + stream.end(); + + return stream; +}; + +/** + * deletes a packet from the store. + */ +Store.prototype.del = function (packet, cb) { + packet = this._inflights[packet.messageId]; + if (packet) { + delete this._inflights[packet.messageId]; + cb(null, packet); + } else if (cb) { + cb(new Error('missing packet')); + } + + return this; +}; + +/** + * get a packet from the store. + */ +Store.prototype.get = function (packet, cb) { + packet = this._inflights[packet.messageId]; + if (packet) { + cb(null, packet); + } else if (cb) { + cb(new Error('missing packet')); + } + + return this; +}; + +/** + * Close the store + */ +Store.prototype.close = function (cb) { + this._inflights = null; + if (cb) { + cb(); + } +}; + +module.exports = Store; + +},{"readable-stream":26}],6:[function(require,module,exports){ +(function (process){ +'use strict'; +var MqttClient = require('../client'), + url = require('url'), + xtend = require('xtend'), + protocols = {}, + protocolList = []; + +if ('browser' !== process.title) { + protocols.mqtt = require('./tcp'); + protocols.tcp = require('./tcp'); + protocols.ssl = require('./tls'); + protocols.tls = require('./tls'); + protocols.mqtts = require('./tls'); +} + +protocols.ws = require('./ws'); +protocols.wss = require('./ws'); + +protocolList = [ + 'mqtt', + 'mqtts', + 'ws', + 'wss' +]; + + +/** + * Parse the auth attribute and merge username and password in the options object. + * + * @param {Object} [opts] option object + */ +function parseAuthOptions (opts) { + var matches; + if (opts.auth) { + matches = opts.auth.match(/^(.+):(.+)$/); + if (matches) { + opts.username = matches[1]; + opts.password = matches[2]; + } else { + opts.username = opts.auth; + } + } +} + +/** + * connect - connect to an MQTT broker. + * + * @param {String} [brokerUrl] - url of the broker, optional + * @param {Object} opts - see MqttClient#constructor + */ +function connect (brokerUrl, opts) { + + if (('object' === typeof brokerUrl) && !opts) { + opts = brokerUrl; + brokerUrl = null; + } + + opts = opts || {}; + + if (brokerUrl) { + opts = xtend(url.parse(brokerUrl, true), opts); + opts.protocol = opts.protocol.replace(/\:$/, ''); + } + + // merge in the auth options if supplied + parseAuthOptions(opts); + + // support clientId passed in the query string of the url + if (opts.query && 'string' === typeof opts.query.clientId) { + opts.clientId = opts.query.clientId; + } + + if (opts.cert && opts.key) { + if (opts.protocol) { + if (-1 === ['mqtts', 'wss'].indexOf(opts.protocol)) { + /* + * jshint and eslint + * complains that break from default cannot be reached after throw + * it is a foced exit from a control structure + * maybe add a check after switch to see if it went through default + * and then throw the error + */ + /*jshint -W027*/ + /*eslint no-unreachable:1*/ + switch (opts.protocol) { + case 'mqtt': + opts.protocol = 'mqtts'; + break; + case 'ws': + opts.protocol = 'wss'; + break; + default: + throw new Error('Unknown protocol for secure conenction: "' + opts.protocol + '"!'); + break; + } + /*eslint no-unreachable:0*/ + /*jshint +W027*/ + } + } else { + // don't know what protocol he want to use, mqtts or wss + throw new Error('Missing secure protocol key'); + } + } + + if (!protocols[opts.protocol]) { + opts.protocol = protocolList.filter(function (key) { + return 'function' === typeof protocols[key]; + })[0]; + } + + if (false === opts.clean && !opts.clientId) { + throw new Error('Missing clientId for unclean clients'); + } + + + function wrapper (client) { + if (opts.servers) { + if (!client._reconnectCount || client._reconnectCount === opts.servers.length) { + client._reconnectCount = 0; + } + + opts.host = opts.servers[client._reconnectCount].host; + opts.port = opts.servers[client._reconnectCount].port; + + client._reconnectCount++; + } + + return protocols[opts.protocol](client, opts); + } + + return new MqttClient(wrapper, opts); +} + +module.exports = connect; +module.exports.connect = connect; + +}).call(this,require('_process')) +},{"../client":1,"./tcp":2,"./tls":3,"./ws":4,"_process":45,"url":63,"xtend":35}],7:[function(require,module,exports){ +var once = require('once'); + +var noop = function() {}; + +var isRequest = function(stream) { + return stream.setHeader && typeof stream.abort === 'function'; +}; + +var isChildProcess = function(stream) { + return stream.stdio && Array.isArray(stream.stdio) && stream.stdio.length === 3 +}; + +var eos = function(stream, opts, callback) { + if (typeof opts === 'function') return eos(stream, null, opts); + if (!opts) opts = {}; + + callback = once(callback || noop); + + var ws = stream._writableState; + var rs = stream._readableState; + var readable = opts.readable || (opts.readable !== false && stream.readable); + var writable = opts.writable || (opts.writable !== false && stream.writable); + + var onlegacyfinish = function() { + if (!stream.writable) onfinish(); + }; + + var onfinish = function() { + writable = false; + if (!readable) callback(); + }; + + var onend = function() { + readable = false; + if (!writable) callback(); + }; + + var onexit = function(exitCode) { + callback(exitCode ? new Error('exited with error code: ' + exitCode) : null); + }; + + var onclose = function() { + if (readable && !(rs && rs.ended)) return callback(new Error('premature close')); + if (writable && !(ws && ws.ended)) return callback(new Error('premature close')); + }; + + var onrequest = function() { + stream.req.on('finish', onfinish); + }; + + if (isRequest(stream)) { + stream.on('complete', onfinish); + stream.on('abort', onclose); + if (stream.req) onrequest(); + else stream.on('request', onrequest); + } else if (writable && !ws) { // legacy streams + stream.on('end', onlegacyfinish); + stream.on('close', onlegacyfinish); + } + + if (isChildProcess(stream)) stream.on('exit', onexit); + + stream.on('end', onend); + stream.on('finish', onfinish); + if (opts.error !== false) stream.on('error', callback); + stream.on('close', onclose); + + return function() { + stream.removeListener('complete', onfinish); + stream.removeListener('abort', onclose); + stream.removeListener('request', onrequest); + if (stream.req) stream.req.removeListener('finish', onfinish); + stream.removeListener('end', onlegacyfinish); + stream.removeListener('close', onlegacyfinish); + stream.removeListener('finish', onfinish); + stream.removeListener('exit', onexit); + stream.removeListener('end', onend); + stream.removeListener('error', callback); + stream.removeListener('close', onclose); + }; +}; + +module.exports = eos; +},{"once":9}],8:[function(require,module,exports){ +// Returns a wrapper function that returns a wrapped callback +// The wrapper function should do some stuff, and return a +// presumably different callback function. +// This makes sure that own properties are retained, so that +// decorations and such are not lost along the way. +module.exports = wrappy +function wrappy (fn, cb) { + if (fn && cb) return wrappy(fn)(cb) + + if (typeof fn !== 'function') + throw new TypeError('need wrapper function') + + Object.keys(fn).forEach(function (k) { + wrapper[k] = fn[k] + }) + + return wrapper + + function wrapper() { + var args = new Array(arguments.length) + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i] + } + var ret = fn.apply(this, args) + var cb = args[args.length-1] + if (typeof ret === 'function' && ret !== cb) { + Object.keys(cb).forEach(function (k) { + ret[k] = cb[k] + }) + } + return ret + } +} + +},{}],9:[function(require,module,exports){ +var wrappy = require('wrappy') +module.exports = wrappy(once) + +once.proto = once(function () { + Object.defineProperty(Function.prototype, 'once', { + value: function () { + return once(this) + }, + configurable: true + }) +}) + +function once (fn) { + var f = function () { + if (f.called) return f.value + f.called = true + return f.value = fn.apply(this, arguments) + } + f.called = false + return f +} + +},{"wrappy":8}],10:[function(require,module,exports){ +if (typeof Object.create === 'function') { + // implementation from standard node.js 'util' module + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + ctor.prototype = Object.create(superCtor.prototype, { + constructor: { + value: ctor, + enumerable: false, + writable: true, + configurable: true + } + }); + }; +} else { + // old school shim for old browsers + module.exports = function inherits(ctor, superCtor) { + ctor.super_ = superCtor + var TempCtor = function () {} + TempCtor.prototype = superCtor.prototype + ctor.prototype = new TempCtor() + ctor.prototype.constructor = ctor + } +} + +},{}],11:[function(require,module,exports){ +/* Protocol - protocol constants */ + +/* Command code => mnemonic */ +module.exports.types = { + 0: 'reserved', + 1: 'connect', + 2: 'connack', + 3: 'publish', + 4: 'puback', + 5: 'pubrec', + 6: 'pubrel', + 7: 'pubcomp', + 8: 'subscribe', + 9: 'suback', + 10: 'unsubscribe', + 11: 'unsuback', + 12: 'pingreq', + 13: 'pingresp', + 14: 'disconnect', + 15: 'reserved' +}; + +/* Mnemonic => Command code */ +module.exports.codes = {} +for(var k in module.exports.types) { + var v = module.exports.types[k]; + module.exports.codes[v] = k; +} + +/* Header */ +module.exports.CMD_SHIFT = 4; +module.exports.CMD_MASK = 0xF0; +module.exports.DUP_MASK = 0x08; +module.exports.QOS_MASK = 0x03; +module.exports.QOS_SHIFT = 1; +module.exports.RETAIN_MASK = 0x01; + +/* Length */ +module.exports.LENGTH_MASK = 0x7F; +module.exports.LENGTH_FIN_MASK = 0x80; + +/* Connack */ +module.exports.SESSIONPRESENT_MASK = 0x01; + +/* Connect */ +module.exports.USERNAME_MASK = 0x80; +module.exports.PASSWORD_MASK = 0x40; +module.exports.WILL_RETAIN_MASK = 0x20; +module.exports.WILL_QOS_MASK = 0x18; +module.exports.WILL_QOS_SHIFT = 3; +module.exports.WILL_FLAG_MASK = 0x04; +module.exports.CLEAN_SESSION_MASK = 0x02; + +},{}],12:[function(require,module,exports){ +(function (Buffer){ + +'use strict'; + +var protocol = require('./constants') + , empty = new Buffer(0) + +function generate(packet) { + + switch(packet.cmd) { + case 'connect': + return connect(packet) + case 'connack': + return connack(packet) + case 'publish': + return publish(packet) + case 'puback': + case 'pubrec': + case 'pubrel': + case 'pubcomp': + case 'unsuback': + return confirmation(packet) + case 'subscribe': + return subscribe(packet) + case 'suback': + return suback(packet) + case 'unsubscribe': + return unsubscribe(packet) + case 'pingreq': + case 'pingresp': + case 'disconnect': + return emptyPacket(packet) + default: + throw new Error('unknown command') + } +} + +function connect(opts) { + var opts = opts || {} + , protocolId = opts.protocolId || 'MQTT' + , protocolVersion = opts.protocolVersion || 4 + , will = opts.will + , clean = opts.clean + , keepalive = opts.keepalive || 0 + , clientId = opts.clientId + , username = opts.username + , password = opts.password + + if (clean === undefined) { + clean = true + } + + var length = 0 + + // Must be a string and non-falsy + if(!protocolId || + (typeof protocolId !== "string" && !Buffer.isBuffer(protocolId))) { + throw new Error('Invalid protocol id') + } else { + length += protocolId.length + 2 + } + + // Must be a 1 byte number + if (!protocolVersion || + 'number' !== typeof protocolVersion || + protocolVersion > 255 || + protocolVersion < 0) { + + throw new Error('Invalid protocol version') + } else { + length += 1 + } + + // Must be a non-falsy string + if(!clientId || + (typeof clientId !== "string" && !Buffer.isBuffer(clientId))) { + throw new Error('Invalid client id') + } else { + length += clientId.length + 2 + } + + // Must be a two byte number + if ('number' !== typeof keepalive || + keepalive < 0 || + keepalive > 65535) { + throw new Error('Invalid keepalive') + } else { + length += 2 + } + + // Connect flags + length += 1 + + // If will exists... + if (will) { + // It must be an object + if ('object' !== typeof will) { + throw new Error('Invalid will') + } + // It must have topic typeof string + if (!will.topic || 'string' !== typeof will.topic) { + throw new Error('Invalid will topic') + } else { + length += will.topic.length + 2 + } + + // Payload + if (will.payload && will.payload) { + if (will.payload.length >= 0) { + if ('string' === typeof will.payload) { + length += Buffer.byteLength(will.payload) + 2 + } else { + length += will.payload.length + 2 + } + } else { + throw new Error('Invalid will payload') + } + } else { + length += 2 + } + } + + // Username + if (username) { + if (username.length) { + length += username.length + 2 + } else { + throw new Error('Invalid username') + } + } + + // Password + if (password) { + if (password.length) { + length += password.length + 2 + } else { + throw new Error('Invalid password') + } + } + + var buffer = new Buffer(1 + calcLengthLength(length) + length) + , pos = 0 + + // Generate header + buffer.writeUInt8(protocol.codes['connect'] << protocol.CMD_SHIFT, pos++) + + // Generate length + pos += writeLength(buffer, pos, length) + + // Generate protocol ID + pos += writeStringOrBuffer(buffer, pos, protocolId) + buffer.writeUInt8(protocolVersion, pos++) + + // Connect flags + var flags = 0 + flags |= username ? protocol.USERNAME_MASK : 0 + flags |= password ? protocol.PASSWORD_MASK : 0 + flags |= (will && will.retain) ? protocol.WILL_RETAIN_MASK : 0 + flags |= (will && will.qos) ? + will.qos << protocol.WILL_QOS_SHIFT : 0 + flags |= will ? protocol.WILL_FLAG_MASK : 0 + flags |= clean ? protocol.CLEAN_SESSION_MASK : 0 + + buffer.writeUInt8(flags, pos++) + + // Keepalive + pos += writeNumber(buffer, pos, keepalive) + + // Client ID + pos += writeStringOrBuffer(buffer, pos, clientId) + + // Will + if (will) { + pos += writeString(buffer, pos, will.topic) + pos += writeStringOrBuffer(buffer, pos, will.payload) + } + + // Username and password + if (username) + pos += writeStringOrBuffer(buffer, pos, username) + + if (password) + pos += writeStringOrBuffer(buffer, pos, password) + + return buffer +} + +function connack(opts) { + var opts = opts || {} + , rc = opts.returnCode; + + // Check return code + if ('number' !== typeof rc) + throw new Error('Invalid return code'); + + var buffer = new Buffer(4) + , pos = 0; + + buffer.writeUInt8(protocol.codes['connack'] << protocol.CMD_SHIFT, pos++); + pos += writeLength(buffer, pos, 2); + buffer.writeUInt8(opts.sessionPresent && protocol.SESSIONPRESENT_MASK || 0, pos++); + buffer.writeUInt8(rc, pos++); + + return buffer; +} + +function publish(opts) { + var opts = opts || {} + , dup = opts.dup ? protocol.DUP_MASK : 0 + , qos = opts.qos + , retain = opts.retain ? protocol.RETAIN_MASK : 0 + , topic = opts.topic + , payload = opts.payload || empty + , id = opts.messageId; + + var length = 0; + + // Topic must be a non-empty string or Buffer + if (typeof topic === "string") + length += Buffer.byteLength(topic) + 2; + else if (Buffer.isBuffer(topic)) + length += topic.length + 2; + else + throw new Error('Invalid topic'); + + // get the payload length + if (!Buffer.isBuffer(payload)) { + length += Buffer.byteLength(payload); + } else { + length += payload.length; + } + + // Message id must a number if qos > 0 + if (qos && 'number' !== typeof id) { + throw new Error('Invalid message id') + } else if (qos) { + length += 2; + } + + var buffer = new Buffer(1 + calcLengthLength(length) + length) + , pos = 0; + + // Header + buffer[pos++] = + protocol.codes['publish'] << protocol.CMD_SHIFT | + dup | + qos << protocol.QOS_SHIFT | + retain; + + // Remaining length + pos += writeLength(buffer, pos, length); + + // Topic + pos += writeStringOrBuffer(buffer, pos, topic); + + // Message ID + if (qos > 0) { + pos += writeNumber(buffer, pos, id); + } + + // Payload + if (!Buffer.isBuffer(payload)) { + writeStringNoPos(buffer, pos, payload); + } else { + writeBuffer(buffer, pos, payload); + } + + return buffer; +} + +/* Puback, pubrec, pubrel and pubcomp */ +function confirmation(opts) { + var opts = opts || {} + , type = opts.cmd || 'puback' + , id = opts.messageId + , dup = (opts.dup && type === 'pubrel') ? protocol.DUP_MASK : 0 + , qos = 0 + + if (type === 'pubrel') + qos = 1 + else if (type === 'pubcomp') + qos = 2 + + // Check message ID + if ('number' !== typeof id) + throw new Error('Invalid message id'); + + var buffer = new Buffer(4) + , pos = 0; + + // Header + buffer[pos++] = + protocol.codes[type] << protocol.CMD_SHIFT | + dup | + qos << protocol.QOS_SHIFT; + + // Length + pos += writeLength(buffer, pos, 2); + + // Message ID + pos += writeNumber(buffer, pos, id); + + return buffer; +} + +function subscribe(opts) { + var opts = opts || {} + , dup = opts.dup ? protocol.DUP_MASK : 0 + , qos = opts.qos || 0 + , id = opts.messageId + , subs = opts.subscriptions; + + var length = 0; + + // Check mid + if ('number' !== typeof id) { + throw new Error('Invalid message id'); + } else { + length += 2; + } + // Check subscriptions + if ('object' === typeof subs && subs.length) { + for (var i = 0; i < subs.length; i += 1) { + var topic = subs[i].topic + , qos = subs[i].qos; + + if ('string' !== typeof topic) { + throw new Error('Invalid subscriptions - invalid topic'); + } + if ('number' !== typeof qos) { + throw new Error('Invalid subscriptions - invalid qos'); + } + + length += Buffer.byteLength(topic) + 2 + 1; + } + } else { + throw new Error('Invalid subscriptions'); + } + + var buffer = new Buffer(1 + calcLengthLength(length) + length) + , pos = 0; + + // Generate header + buffer.writeUInt8( + protocol.codes['subscribe'] << protocol.CMD_SHIFT | + dup | + 1 << protocol.QOS_SHIFT, pos++); + + // Generate length + pos += writeLength(buffer, pos, length); + + // Generate message ID + pos += writeNumber(buffer, pos, id); + + // Generate subs + for (var i = 0; i < subs.length; i++) { + var sub = subs[i] + , topic = sub.topic + , qos = sub.qos; + + // Write topic string + pos += writeString(buffer, pos, topic); + // Write qos + buffer.writeUInt8(qos, pos++); + } + + return buffer; +} + +function suback(opts) { + var opts = opts || {} + , id = opts.messageId + , granted = opts.granted; + + var length = 0; + + // Check message id + if ('number' !== typeof id) { + throw new Error('Invalid message id'); + } else { + length += 2; + } + // Check granted qos vector + if ('object' === typeof granted && granted.length) { + for (var i = 0; i < granted.length; i += 1) { + if ('number' !== typeof granted[i]) { + throw new Error('Invalid qos vector'); + } + length += 1; + } + } else { + throw new Error('Invalid qos vector'); + } + + var buffer = new Buffer(1 + calcLengthLength(length) + length) + , pos = 0; + + // Header + buffer.writeUInt8(protocol.codes['suback'] << protocol.CMD_SHIFT, pos++); + + // Length + pos += writeLength(buffer, pos, length); + + // Message ID + pos += writeNumber(buffer, pos, id); + + // Subscriptions + for (var i = 0; i < granted.length; i++) { + buffer.writeUInt8(granted[i], pos++); + } + + return buffer; +} + +function unsubscribe(opts) { + var opts = opts || {} + , id = opts.messageId + , dup = opts.dup ? protocol.DUP_MASK : 0 + , unsubs = opts.unsubscriptions; + + var length = 0; + + // Check message id + if ('number' !== typeof id) { + throw new Error('Invalid message id'); + } else { + length += 2; + } + // Check unsubs + if ('object' === typeof unsubs && unsubs.length) { + for (var i = 0; i < unsubs.length; i += 1) { + if ('string' !== typeof unsubs[i]) { + throw new Error('Invalid unsubscriptions'); + } + length += Buffer.byteLength(unsubs[i]) + 2; + } + } else { + throw new Error('Invalid unsubscriptions'); + } + + var buffer = new Buffer(1 + calcLengthLength(length) + length) + , pos = 0; + + // Header + buffer[pos++] = + protocol.codes['unsubscribe'] << protocol.CMD_SHIFT | + dup | + 1 << protocol.QOS_SHIFT; + + // Length + pos += writeLength(buffer, pos, length); + + // Message ID + pos += writeNumber(buffer, pos, id); + + // Unsubs + for (var i = 0; i < unsubs.length; i++) { + pos += writeString(buffer, pos, unsubs[i]); + } + + return buffer; +} + +function emptyPacket(opts) { + var buf = new Buffer(2); + buf[0] = protocol.codes[opts.cmd] << 4; + buf[1] = 0; + return buf; +} + +/** + * calcLengthLength - calculate the length of the remaining + * length field + * + * @api private + */ +function calcLengthLength(length) { + if (length >= 0 && length < 128) { + return 1 + } else if (length >= 128 && length < 16384) { + return 2 + } else if (length >= 16384 && length < 2097152) { + return 3 + } else if (length >= 2097152 && length < 268435456) { + return 4 + } else { + return 0 + } +} + +/** + * writeLength - write an MQTT style length field to the buffer + * + * @param buffer - destination + * @param pos - offset + * @param length - length (>0) + * @returns number of bytes written + * + * @api private + */ + +function writeLength(buffer, pos, length) { + var digit = 0 + , origPos = pos + + do { + digit = length % 128 | 0 + length = length / 128 | 0 + if (length > 0) { + digit = digit | 0x80 + } + buffer.writeUInt8(digit, pos++) + } while (length > 0) + + return pos - origPos +} + +/** + * writeString - write a utf8 string to the buffer + * + * @param buffer - destination + * @param pos - offset + * @param string - string to write + * @return number of bytes written + * + * @api private + */ + +function writeString(buffer, pos, string) { + var strlen = Buffer.byteLength(string) + writeNumber(buffer, pos, strlen) + + writeStringNoPos(buffer, pos + 2, string) + + return strlen + 2 +} + +function writeStringNoPos(buffer, pos, string) { + buffer.write(string, pos) +} + +/** + * write_buffer - write buffer to buffer + * + * @param buffer - dest buffer + * @param pos - offset + * @param src - source buffer + * @return number of bytes written + * + * @api private + */ + +function writeBuffer(buffer, pos, src) { + src.copy(buffer, pos) + return src.length +} + +/** + * writeNumber - write a two byte number to the buffer + * + * @param buffer - destination + * @param pos - offset + * @param number - number to write + * @return number of bytes written + * + * @api private + */ +function writeNumber(buffer, pos, number) { + buffer.writeUInt8(number >> 8, pos) + buffer.writeUInt8(number & 0x00FF, pos + 1) + + return 2 +} + +/** + * writeStringOrBuffer - write a String or Buffer with the its length prefix + * + * @param buffer - destination + * @param pos - offset + * @param toWrite - String or Buffer + * @return number of bytes written + */ +function writeStringOrBuffer(buffer, pos, toWrite) { + var written = 0 + + if (toWrite && typeof toWrite === 'string') { + written += writeString(buffer, pos + written, toWrite) + } else if (toWrite) { + written += writeNumber(buffer, pos + written, toWrite.length) + written += writeBuffer(buffer, pos + written, toWrite) + } else { + written += writeNumber(buffer, pos + written, 0) + } + + return written +} + +module.exports = generate + +}).call(this,require("buffer").Buffer) +},{"./constants":11,"buffer":38}],13:[function(require,module,exports){ + +'use strict'; + +exports.parser = require('./parser') +exports.generate = require('./generate') + +},{"./generate":12,"./parser":16}],14:[function(require,module,exports){ +(function (Buffer){ +var DuplexStream = require('readable-stream/duplex') + , util = require('util') + +function BufferList (callback) { + if (!(this instanceof BufferList)) + return new BufferList(callback) + + this._bufs = [] + this.length = 0 + + if (typeof callback == 'function') { + this._callback = callback + + var piper = function (err) { + if (this._callback) { + this._callback(err) + this._callback = null + } + }.bind(this) + + this.on('pipe', function (src) { + src.on('error', piper) + }) + this.on('unpipe', function (src) { + src.removeListener('error', piper) + }) + } + else if (Buffer.isBuffer(callback)) + this.append(callback) + else if (Array.isArray(callback)) { + callback.forEach(function (b) { + Buffer.isBuffer(b) && this.append(b) + }.bind(this)) + } + + DuplexStream.call(this) +} + +util.inherits(BufferList, DuplexStream) + +BufferList.prototype._offset = function (offset) { + var tot = 0, i = 0, _t + for (; i < this._bufs.length; i++) { + _t = tot + this._bufs[i].length + if (offset < _t) + return [ i, offset - tot ] + tot = _t + } +} + +BufferList.prototype.append = function (buf) { + var isBuffer = Buffer.isBuffer(buf) || + buf instanceof BufferList + + this._bufs.push(isBuffer ? buf : new Buffer(buf)) + this.length += buf.length + return this +} + +BufferList.prototype._write = function (buf, encoding, callback) { + this.append(buf) + if (callback) + callback() +} + +BufferList.prototype._read = function (size) { + if (!this.length) + return this.push(null) + size = Math.min(size, this.length) + this.push(this.slice(0, size)) + this.consume(size) +} + +BufferList.prototype.end = function (chunk) { + DuplexStream.prototype.end.call(this, chunk) + + if (this._callback) { + this._callback(null, this.slice()) + this._callback = null + } +} + +BufferList.prototype.get = function (index) { + return this.slice(index, index + 1)[0] +} + +BufferList.prototype.slice = function (start, end) { + return this.copy(null, 0, start, end) +} + +BufferList.prototype.copy = function (dst, dstStart, srcStart, srcEnd) { + if (typeof srcStart != 'number' || srcStart < 0) + srcStart = 0 + if (typeof srcEnd != 'number' || srcEnd > this.length) + srcEnd = this.length + if (srcStart >= this.length) + return dst || new Buffer(0) + if (srcEnd <= 0) + return dst || new Buffer(0) + + var copy = !!dst + , off = this._offset(srcStart) + , len = srcEnd - srcStart + , bytes = len + , bufoff = (copy && dstStart) || 0 + , start = off[1] + , l + , i + + // copy/slice everything + if (srcStart === 0 && srcEnd == this.length) { + if (!copy) // slice, just return a full concat + return Buffer.concat(this._bufs) + + // copy, need to copy individual buffers + for (i = 0; i < this._bufs.length; i++) { + this._bufs[i].copy(dst, bufoff) + bufoff += this._bufs[i].length + } + + return dst + } + + // easy, cheap case where it's a subset of one of the buffers + if (bytes <= this._bufs[off[0]].length - start) { + return copy + ? this._bufs[off[0]].copy(dst, dstStart, start, start + bytes) + : this._bufs[off[0]].slice(start, start + bytes) + } + + if (!copy) // a slice, we need something to copy in to + dst = new Buffer(len) + + for (i = off[0]; i < this._bufs.length; i++) { + l = this._bufs[i].length - start + + if (bytes > l) { + this._bufs[i].copy(dst, bufoff, start) + } else { + this._bufs[i].copy(dst, bufoff, start, start + bytes) + break + } + + bufoff += l + bytes -= l + + if (start) + start = 0 + } + + return dst +} + +BufferList.prototype.toString = function (encoding, start, end) { + return this.slice(start, end).toString(encoding) +} + +BufferList.prototype.consume = function (bytes) { + while (this._bufs.length) { + if (bytes > this._bufs[0].length) { + bytes -= this._bufs[0].length + this.length -= this._bufs[0].length + this._bufs.shift() + } else { + this._bufs[0] = this._bufs[0].slice(bytes) + this.length -= bytes + break + } + } + return this +} + +BufferList.prototype.duplicate = function () { + var i = 0 + , copy = new BufferList() + + for (; i < this._bufs.length; i++) + copy.append(this._bufs[i]) + + return copy +} + +BufferList.prototype.destroy = function () { + this._bufs.length = 0; + this.length = 0; + this.push(null); +} + +;(function () { + var methods = { + 'readDoubleBE' : 8 + , 'readDoubleLE' : 8 + , 'readFloatBE' : 4 + , 'readFloatLE' : 4 + , 'readInt32BE' : 4 + , 'readInt32LE' : 4 + , 'readUInt32BE' : 4 + , 'readUInt32LE' : 4 + , 'readInt16BE' : 2 + , 'readInt16LE' : 2 + , 'readUInt16BE' : 2 + , 'readUInt16LE' : 2 + , 'readInt8' : 1 + , 'readUInt8' : 1 + } + + for (var m in methods) { + (function (m) { + BufferList.prototype[m] = function (offset) { + return this.slice(offset, offset + methods[m])[m](0) + } + }(m)) + } +}()) + +module.exports = BufferList + +}).call(this,require("buffer").Buffer) +},{"buffer":38,"readable-stream/duplex":17,"util":65}],15:[function(require,module,exports){ + +function Packet() { + this.cmd = null + this.retain = false + this.qos = 0 + this.dup = false + this.length = -1 + this.topic = null + this.payload = null +} + +module.exports = Packet + +},{}],16:[function(require,module,exports){ + +var bl = require('bl') + , inherits = require('inherits') + , EE = require('events').EventEmitter + , Packet = require('./packet') + , constants = require('./constants') + +function Parser() { + if (!(this instanceof Parser)) { + return new Parser() + } + + this._list = bl() + this._newPacket() + + this._states = [ + '_parseHeader' + , '_parseLength' + , '_parsePayload' + , '_newPacket' + ] + this._stateCounter = 0 +} + +inherits(Parser, EE) + +Parser.prototype._newPacket = function () { + if (this.packet) { + this._list.consume(this.packet.length) + this.emit('packet', this.packet) + } + + this.packet = new Packet() + + return true +} + +Parser.prototype.parse = function (buf) { + this._list.append(buf) + + while ((this.packet.length != -1 || this._list.length > 0) && + this[this._states[this._stateCounter]]()) { + this._stateCounter++ + + if (this._stateCounter >= this._states.length) { + this._stateCounter = 0 + } + } + + return this._list.length +} + +Parser.prototype._parseHeader = function () { + + // there is at least one byte in the buffer + var zero = this._list.readUInt8(0) + this.packet.cmd = constants.types[zero >> constants.CMD_SHIFT] + this.packet.retain = (zero & constants.RETAIN_MASK) !== 0 + this.packet.qos = (zero >> constants.QOS_SHIFT) & constants.QOS_MASK + this.packet.dup = (zero & constants.DUP_MASK) !== 0 + + this._list.consume(1) + + return true +} + + +Parser.prototype._parseLength = function () { + // there is at least one byte in the list + var bytes = 0 + , mul = 1 + , length = 0 + , result = true + , current + + while (bytes < 5) { + current = this._list.readUInt8(bytes++) + length += mul * (current & constants.LENGTH_MASK) + mul *= 0x80 + + if ((current & constants.LENGTH_FIN_MASK) === 0) { + break + } + + if (this._list.length <= bytes) { + result = false + break + } + } + + if (result) { + this.packet.length = length + this._list.consume(bytes) + } + + return result +} + +Parser.prototype._parsePayload = function () { + var result = false + + // Do we have a payload? Do we have enough data to complete the payload? + // PINGs have no payload + if (this.packet.length === 0 || this._list.length >= this.packet.length) { + + this._pos = 0 + + switch (this.packet.cmd) { + case 'connect': + this._parseConnect() + break + case 'connack': + this._parseConnack() + break + case 'publish': + this._parsePublish() + break + case 'puback': + case 'pubrec': + case 'pubrel': + case 'pubcomp': + this._parseMessageId() + break + case 'subscribe': + this._parseSubscribe() + break + case 'suback': + this._parseSuback() + break + case 'unsubscribe': + this._parseUnsubscribe() + break + case 'unsuback': + this._parseUnsuback() + break + case 'pingreq': + case 'pingresp': + case 'disconnect': + // these are empty, nothing to do + break + default: + this.emit('error', new Error('not supported')) + } + + result = true + } + + return result +} + +Parser.prototype._parseConnect = function () { + var protocolId // constants id + , clientId // Client id + , topic // Will topic + , payload // Will payload + , password // Password + , username // Username + , flags = {} + , packet = this.packet + + // Parse constants id + protocolId = this._parseString() + if (protocolId === null) + return this.emit('error', new Error('cannot parse protocol id')) + + packet.protocolId = protocolId + + // Parse constants version number + if(this._pos > this._list.length) + return this.emit('error', new Error('packet too short')) + + packet.protocolVersion = this._list.readUInt8(this._pos) + this._pos++ + + // Parse connect flags + flags.username = (this._list.readUInt8(this._pos) & constants.USERNAME_MASK) + flags.password = (this._list.readUInt8(this._pos) & constants.PASSWORD_MASK) + flags.will = (this._list.readUInt8(this._pos) & constants.WILL_FLAG_MASK) + + if (flags.will) { + packet.will = {} + packet.will.retain = (this._list.readUInt8(this._pos) & constants.WILL_RETAIN_MASK) !== 0 + packet.will.qos = (this._list.readUInt8(this._pos) & + constants.WILL_QOS_MASK) >> constants.WILL_QOS_SHIFT + } + + packet.clean = (this._list.readUInt8(this._pos) & constants.CLEAN_SESSION_MASK) !== 0 + this._pos++ + + // Parse keepalive + packet.keepalive = this._parseNum() + if(packet.keepalive === -1) + return this.emit('error', new Error('packet too short')) + + // Parse client ID + clientId = this._parseString() + if(clientId === null) + return this.emit('error', new Error('packet too short')) + packet.clientId = clientId + + if (flags.will) { + // Parse will topic + topic = this._parseString() + if (topic === null) + return this.emit('error', new Error('cannot parse will topic')) + packet.will.topic = topic + + // Parse will payload + payload = this._parseBuffer() + if (payload === null) + return this.emit('error', new Error('cannot parse will payload')) + packet.will.payload = payload + } + + // Parse username + if (flags.username) { + username = this._parseString() + if(username === null) + return this.emit('error', new Error('cannot parse username')) + packet.username = username + } + + // Parse password + if(flags.password) { + password = this._parseBuffer() + if(password === null) + return this.emit('error', new Error('cannot parse username')) + packet.password = password + } + + return packet +} + +Parser.prototype._parseConnack = function () { + var packet = this.packet + packet.sessionPresent = !!(this._list.readUInt8(this._pos++) & constants.SESSIONPRESENT_MASK) + packet.returnCode = this._list.readUInt8(this._pos) + if(packet.returnCode === -1) + return this.emit('error', new Error('cannot parse return code')) +} + +Parser.prototype._parsePublish = function () { + var packet = this.packet + packet.topic = this._parseString() + + if(packet.topic === null) + return this.emit('error', new Error('cannot parse topic')) + + // Parse message ID + if (packet.qos > 0) { + if (!this._parseMessageId()) { return } + } + + packet.payload = this._list.slice(this._pos, packet.length) +} + +Parser.prototype._parseSubscribe = function() { + var packet = this.packet + , topic + , qos + + if (packet.qos != 1) { + return this.emit('error', new Error('wrong subscribe header')) + } + + packet.subscriptions = [] + + if (!this._parseMessageId()) { return } + + while (this._pos < packet.length) { + + // Parse topic + topic = this._parseString() + if (topic === null) + return this.emit('error', new Error('Parse error - cannot parse topic')) + + qos = this._list.readUInt8(this._pos++) + + // Push pair to subscriptions + packet.subscriptions.push({ topic: topic, qos: qos }); + } +} + +Parser.prototype._parseSuback = function() { + this.packet.granted = [] + + if (!this._parseMessageId()) { return } + + // Parse granted QoSes + while (this._pos < this.packet.length) { + this.packet.granted.push(this._list.readUInt8(this._pos++)); + } +} + +Parser.prototype._parseUnsubscribe = function() { + var packet = this.packet + + packet.unsubscriptions = [] + + // Parse message ID + if (!this._parseMessageId()) { return } + + while (this._pos < packet.length) { + var topic; + + // Parse topic + topic = this._parseString() + if (topic === null) + return this.emit('error', new Error('cannot parse topic')) + + // Push topic to unsubscriptions + packet.unsubscriptions.push(topic); + } +} + +Parser.prototype._parseUnsuback = function() { + if (!this._parseMessageId()) + return this.emit('error', new Error('cannot parse message id')) +} + +Parser.prototype._parseMessageId = function() { + var packet = this.packet + + packet.messageId = this._parseNum() + + if(packet.messageId === null) { + this.emit('error', new Error('cannot parse message id')) + return false + } + + return true +} + +Parser.prototype._parseString = function(maybeBuffer) { + var length = this._parseNum() + , result + + if(length === -1 || length + this._pos > this._list.length) + return null + + result = this._list.toString('utf8', this._pos, this._pos + length) + + this._pos += length + + return result +} + +Parser.prototype._parseBuffer = function() { + var length = this._parseNum() + , result + + if(length === -1 || length + this._pos > this._list.length) + return null + + result = this._list.slice(this._pos, this._pos + length) + + this._pos += length + + return result +} + +Parser.prototype._parseNum = function() { + if(2 > this._pos + this._list.length) return -1 + + var result = this._list.readUInt16BE(this._pos) + this._pos += 2 + return result +} + +module.exports = Parser + +},{"./constants":11,"./packet":15,"bl":14,"events":42,"inherits":10}],17:[function(require,module,exports){ +module.exports = require("./lib/_stream_duplex.js") + +},{"./lib/_stream_duplex.js":18}],18:[function(require,module,exports){ +(function (process){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// a duplex stream is just a stream that is both readable and writable. +// Since JS doesn't have multiple prototypal inheritance, this class +// prototypally inherits from Readable, and then parasitically from +// Writable. + +module.exports = Duplex; + +/**/ +var objectKeys = Object.keys || function (obj) { + var keys = []; + for (var key in obj) keys.push(key); + return keys; +} +/**/ + + +/**/ +var util = require('core-util-is'); +util.inherits = require('inherits'); +/**/ + +var Readable = require('./_stream_readable'); +var Writable = require('./_stream_writable'); + +util.inherits(Duplex, Readable); + +forEach(objectKeys(Writable.prototype), function(method) { + if (!Duplex.prototype[method]) + Duplex.prototype[method] = Writable.prototype[method]; +}); + +function Duplex(options) { + if (!(this instanceof Duplex)) + return new Duplex(options); + + Readable.call(this, options); + Writable.call(this, options); + + if (options && options.readable === false) + this.readable = false; + + if (options && options.writable === false) + this.writable = false; + + this.allowHalfOpen = true; + if (options && options.allowHalfOpen === false) + this.allowHalfOpen = false; + + this.once('end', onend); +} + +// the no-half-open enforcer +function onend() { + // if we allow half-open state, or if the writable side ended, + // then we're ok. + if (this.allowHalfOpen || this._writableState.ended) + return; + + // no more data can be written. + // But allow more writes to happen in this tick. + process.nextTick(this.end.bind(this)); +} + +function forEach (xs, f) { + for (var i = 0, l = xs.length; i < l; i++) { + f(xs[i], i); + } +} + +}).call(this,require('_process')) +},{"./_stream_readable":20,"./_stream_writable":22,"_process":45,"core-util-is":23,"inherits":10}],19:[function(require,module,exports){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// a passthrough stream. +// basically just the most minimal sort of Transform stream. +// Every written chunk gets output as-is. + +module.exports = PassThrough; + +var Transform = require('./_stream_transform'); + +/**/ +var util = require('core-util-is'); +util.inherits = require('inherits'); +/**/ + +util.inherits(PassThrough, Transform); + +function PassThrough(options) { + if (!(this instanceof PassThrough)) + return new PassThrough(options); + + Transform.call(this, options); +} + +PassThrough.prototype._transform = function(chunk, encoding, cb) { + cb(null, chunk); +}; + +},{"./_stream_transform":21,"core-util-is":23,"inherits":10}],20:[function(require,module,exports){ +(function (process){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +module.exports = Readable; + +/**/ +var isArray = require('isarray'); +/**/ + + +/**/ +var Buffer = require('buffer').Buffer; +/**/ + +Readable.ReadableState = ReadableState; + +var EE = require('events').EventEmitter; + +/**/ +if (!EE.listenerCount) EE.listenerCount = function(emitter, type) { + return emitter.listeners(type).length; +}; +/**/ + +var Stream = require('stream'); + +/**/ +var util = require('core-util-is'); +util.inherits = require('inherits'); +/**/ + +var StringDecoder; + +util.inherits(Readable, Stream); + +function ReadableState(options, stream) { + options = options || {}; + + // the point at which it stops calling _read() to fill the buffer + // Note: 0 is a valid value, means "don't call _read preemptively ever" + var hwm = options.highWaterMark; + this.highWaterMark = (hwm || hwm === 0) ? hwm : 16 * 1024; + + // cast to ints. + this.highWaterMark = ~~this.highWaterMark; + + this.buffer = []; + this.length = 0; + this.pipes = null; + this.pipesCount = 0; + this.flowing = false; + this.ended = false; + this.endEmitted = false; + this.reading = false; + + // In streams that never have any data, and do push(null) right away, + // the consumer can miss the 'end' event if they do some I/O before + // consuming the stream. So, we don't emit('end') until some reading + // happens. + this.calledRead = false; + + // a flag to be able to tell if the onwrite cb is called immediately, + // or on a later tick. We set this to true at first, becuase any + // actions that shouldn't happen until "later" should generally also + // not happen before the first write call. + this.sync = true; + + // whenever we return null, then we set a flag to say + // that we're awaiting a 'readable' event emission. + this.needReadable = false; + this.emittedReadable = false; + this.readableListening = false; + + + // object stream flag. Used to make read(n) ignore n and to + // make all the buffer merging and length checks go away + this.objectMode = !!options.objectMode; + + // Crypto is kind of old and crusty. Historically, its default string + // encoding is 'binary' so we have to make this configurable. + // Everything else in the universe uses 'utf8', though. + this.defaultEncoding = options.defaultEncoding || 'utf8'; + + // when piping, we only care about 'readable' events that happen + // after read()ing all the bytes and not getting any pushback. + this.ranOut = false; + + // the number of writers that are awaiting a drain event in .pipe()s + this.awaitDrain = 0; + + // if true, a maybeReadMore has been scheduled + this.readingMore = false; + + this.decoder = null; + this.encoding = null; + if (options.encoding) { + if (!StringDecoder) + StringDecoder = require('string_decoder/').StringDecoder; + this.decoder = new StringDecoder(options.encoding); + this.encoding = options.encoding; + } +} + +function Readable(options) { + if (!(this instanceof Readable)) + return new Readable(options); + + this._readableState = new ReadableState(options, this); + + // legacy + this.readable = true; + + Stream.call(this); +} + +// Manually shove something into the read() buffer. +// This returns true if the highWaterMark has not been hit yet, +// similar to how Writable.write() returns true if you should +// write() some more. +Readable.prototype.push = function(chunk, encoding) { + var state = this._readableState; + + if (typeof chunk === 'string' && !state.objectMode) { + encoding = encoding || state.defaultEncoding; + if (encoding !== state.encoding) { + chunk = new Buffer(chunk, encoding); + encoding = ''; + } + } + + return readableAddChunk(this, state, chunk, encoding, false); +}; + +// Unshift should *always* be something directly out of read() +Readable.prototype.unshift = function(chunk) { + var state = this._readableState; + return readableAddChunk(this, state, chunk, '', true); +}; + +function readableAddChunk(stream, state, chunk, encoding, addToFront) { + var er = chunkInvalid(state, chunk); + if (er) { + stream.emit('error', er); + } else if (chunk === null || chunk === undefined) { + state.reading = false; + if (!state.ended) + onEofChunk(stream, state); + } else if (state.objectMode || chunk && chunk.length > 0) { + if (state.ended && !addToFront) { + var e = new Error('stream.push() after EOF'); + stream.emit('error', e); + } else if (state.endEmitted && addToFront) { + var e = new Error('stream.unshift() after end event'); + stream.emit('error', e); + } else { + if (state.decoder && !addToFront && !encoding) + chunk = state.decoder.write(chunk); + + // update the buffer info. + state.length += state.objectMode ? 1 : chunk.length; + if (addToFront) { + state.buffer.unshift(chunk); + } else { + state.reading = false; + state.buffer.push(chunk); + } + + if (state.needReadable) + emitReadable(stream); + + maybeReadMore(stream, state); + } + } else if (!addToFront) { + state.reading = false; + } + + return needMoreData(state); +} + + + +// if it's past the high water mark, we can push in some more. +// Also, if we have no data yet, we can stand some +// more bytes. This is to work around cases where hwm=0, +// such as the repl. Also, if the push() triggered a +// readable event, and the user called read(largeNumber) such that +// needReadable was set, then we ought to push more, so that another +// 'readable' event will be triggered. +function needMoreData(state) { + return !state.ended && + (state.needReadable || + state.length < state.highWaterMark || + state.length === 0); +} + +// backwards compatibility. +Readable.prototype.setEncoding = function(enc) { + if (!StringDecoder) + StringDecoder = require('string_decoder/').StringDecoder; + this._readableState.decoder = new StringDecoder(enc); + this._readableState.encoding = enc; +}; + +// Don't raise the hwm > 128MB +var MAX_HWM = 0x800000; +function roundUpToNextPowerOf2(n) { + if (n >= MAX_HWM) { + n = MAX_HWM; + } else { + // Get the next highest power of 2 + n--; + for (var p = 1; p < 32; p <<= 1) n |= n >> p; + n++; + } + return n; +} + +function howMuchToRead(n, state) { + if (state.length === 0 && state.ended) + return 0; + + if (state.objectMode) + return n === 0 ? 0 : 1; + + if (n === null || isNaN(n)) { + // only flow one buffer at a time + if (state.flowing && state.buffer.length) + return state.buffer[0].length; + else + return state.length; + } + + if (n <= 0) + return 0; + + // If we're asking for more than the target buffer level, + // then raise the water mark. Bump up to the next highest + // power of 2, to prevent increasing it excessively in tiny + // amounts. + if (n > state.highWaterMark) + state.highWaterMark = roundUpToNextPowerOf2(n); + + // don't have that much. return null, unless we've ended. + if (n > state.length) { + if (!state.ended) { + state.needReadable = true; + return 0; + } else + return state.length; + } + + return n; +} + +// you can override either this method, or the async _read(n) below. +Readable.prototype.read = function(n) { + var state = this._readableState; + state.calledRead = true; + var nOrig = n; + var ret; + + if (typeof n !== 'number' || n > 0) + state.emittedReadable = false; + + // if we're doing read(0) to trigger a readable event, but we + // already have a bunch of data in the buffer, then just trigger + // the 'readable' event and move on. + if (n === 0 && + state.needReadable && + (state.length >= state.highWaterMark || state.ended)) { + emitReadable(this); + return null; + } + + n = howMuchToRead(n, state); + + // if we've ended, and we're now clear, then finish it up. + if (n === 0 && state.ended) { + ret = null; + + // In cases where the decoder did not receive enough data + // to produce a full chunk, then immediately received an + // EOF, state.buffer will contain [, ]. + // howMuchToRead will see this and coerce the amount to + // read to zero (because it's looking at the length of the + // first in state.buffer), and we'll end up here. + // + // This can only happen via state.decoder -- no other venue + // exists for pushing a zero-length chunk into state.buffer + // and triggering this behavior. In this case, we return our + // remaining data and end the stream, if appropriate. + if (state.length > 0 && state.decoder) { + ret = fromList(n, state); + state.length -= ret.length; + } + + if (state.length === 0) + endReadable(this); + + return ret; + } + + // All the actual chunk generation logic needs to be + // *below* the call to _read. The reason is that in certain + // synthetic stream cases, such as passthrough streams, _read + // may be a completely synchronous operation which may change + // the state of the read buffer, providing enough data when + // before there was *not* enough. + // + // So, the steps are: + // 1. Figure out what the state of things will be after we do + // a read from the buffer. + // + // 2. If that resulting state will trigger a _read, then call _read. + // Note that this may be asynchronous, or synchronous. Yes, it is + // deeply ugly to write APIs this way, but that still doesn't mean + // that the Readable class should behave improperly, as streams are + // designed to be sync/async agnostic. + // Take note if the _read call is sync or async (ie, if the read call + // has returned yet), so that we know whether or not it's safe to emit + // 'readable' etc. + // + // 3. Actually pull the requested chunks out of the buffer and return. + + // if we need a readable event, then we need to do some reading. + var doRead = state.needReadable; + + // if we currently have less than the highWaterMark, then also read some + if (state.length - n <= state.highWaterMark) + doRead = true; + + // however, if we've ended, then there's no point, and if we're already + // reading, then it's unnecessary. + if (state.ended || state.reading) + doRead = false; + + if (doRead) { + state.reading = true; + state.sync = true; + // if the length is currently zero, then we *need* a readable event. + if (state.length === 0) + state.needReadable = true; + // call internal read method + this._read(state.highWaterMark); + state.sync = false; + } + + // If _read called its callback synchronously, then `reading` + // will be false, and we need to re-evaluate how much data we + // can return to the user. + if (doRead && !state.reading) + n = howMuchToRead(nOrig, state); + + if (n > 0) + ret = fromList(n, state); + else + ret = null; + + if (ret === null) { + state.needReadable = true; + n = 0; + } + + state.length -= n; + + // If we have nothing in the buffer, then we want to know + // as soon as we *do* get something into the buffer. + if (state.length === 0 && !state.ended) + state.needReadable = true; + + // If we happened to read() exactly the remaining amount in the + // buffer, and the EOF has been seen at this point, then make sure + // that we emit 'end' on the very next tick. + if (state.ended && !state.endEmitted && state.length === 0) + endReadable(this); + + return ret; +}; + +function chunkInvalid(state, chunk) { + var er = null; + if (!Buffer.isBuffer(chunk) && + 'string' !== typeof chunk && + chunk !== null && + chunk !== undefined && + !state.objectMode) { + er = new TypeError('Invalid non-string/buffer chunk'); + } + return er; +} + + +function onEofChunk(stream, state) { + if (state.decoder && !state.ended) { + var chunk = state.decoder.end(); + if (chunk && chunk.length) { + state.buffer.push(chunk); + state.length += state.objectMode ? 1 : chunk.length; + } + } + state.ended = true; + + // if we've ended and we have some data left, then emit + // 'readable' now to make sure it gets picked up. + if (state.length > 0) + emitReadable(stream); + else + endReadable(stream); +} + +// Don't emit readable right away in sync mode, because this can trigger +// another read() call => stack overflow. This way, it might trigger +// a nextTick recursion warning, but that's not so bad. +function emitReadable(stream) { + var state = stream._readableState; + state.needReadable = false; + if (state.emittedReadable) + return; + + state.emittedReadable = true; + if (state.sync) + process.nextTick(function() { + emitReadable_(stream); + }); + else + emitReadable_(stream); +} + +function emitReadable_(stream) { + stream.emit('readable'); +} + + +// at this point, the user has presumably seen the 'readable' event, +// and called read() to consume some data. that may have triggered +// in turn another _read(n) call, in which case reading = true if +// it's in progress. +// However, if we're not ended, or reading, and the length < hwm, +// then go ahead and try to read some more preemptively. +function maybeReadMore(stream, state) { + if (!state.readingMore) { + state.readingMore = true; + process.nextTick(function() { + maybeReadMore_(stream, state); + }); + } +} + +function maybeReadMore_(stream, state) { + var len = state.length; + while (!state.reading && !state.flowing && !state.ended && + state.length < state.highWaterMark) { + stream.read(0); + if (len === state.length) + // didn't get any data, stop spinning. + break; + else + len = state.length; + } + state.readingMore = false; +} + +// abstract method. to be overridden in specific implementation classes. +// call cb(er, data) where data is <= n in length. +// for virtual (non-string, non-buffer) streams, "length" is somewhat +// arbitrary, and perhaps not very meaningful. +Readable.prototype._read = function(n) { + this.emit('error', new Error('not implemented')); +}; + +Readable.prototype.pipe = function(dest, pipeOpts) { + var src = this; + var state = this._readableState; + + switch (state.pipesCount) { + case 0: + state.pipes = dest; + break; + case 1: + state.pipes = [state.pipes, dest]; + break; + default: + state.pipes.push(dest); + break; + } + state.pipesCount += 1; + + var doEnd = (!pipeOpts || pipeOpts.end !== false) && + dest !== process.stdout && + dest !== process.stderr; + + var endFn = doEnd ? onend : cleanup; + if (state.endEmitted) + process.nextTick(endFn); + else + src.once('end', endFn); + + dest.on('unpipe', onunpipe); + function onunpipe(readable) { + if (readable !== src) return; + cleanup(); + } + + function onend() { + dest.end(); + } + + // when the dest drains, it reduces the awaitDrain counter + // on the source. This would be more elegant with a .once() + // handler in flow(), but adding and removing repeatedly is + // too slow. + var ondrain = pipeOnDrain(src); + dest.on('drain', ondrain); + + function cleanup() { + // cleanup event handlers once the pipe is broken + dest.removeListener('close', onclose); + dest.removeListener('finish', onfinish); + dest.removeListener('drain', ondrain); + dest.removeListener('error', onerror); + dest.removeListener('unpipe', onunpipe); + src.removeListener('end', onend); + src.removeListener('end', cleanup); + + // if the reader is waiting for a drain event from this + // specific writer, then it would cause it to never start + // flowing again. + // So, if this is awaiting a drain, then we just call it now. + // If we don't know, then assume that we are waiting for one. + if (!dest._writableState || dest._writableState.needDrain) + ondrain(); + } + + // if the dest has an error, then stop piping into it. + // however, don't suppress the throwing behavior for this. + function onerror(er) { + unpipe(); + dest.removeListener('error', onerror); + if (EE.listenerCount(dest, 'error') === 0) + dest.emit('error', er); + } + // This is a brutally ugly hack to make sure that our error handler + // is attached before any userland ones. NEVER DO THIS. + if (!dest._events || !dest._events.error) + dest.on('error', onerror); + else if (isArray(dest._events.error)) + dest._events.error.unshift(onerror); + else + dest._events.error = [onerror, dest._events.error]; + + + + // Both close and finish should trigger unpipe, but only once. + function onclose() { + dest.removeListener('finish', onfinish); + unpipe(); + } + dest.once('close', onclose); + function onfinish() { + dest.removeListener('close', onclose); + unpipe(); + } + dest.once('finish', onfinish); + + function unpipe() { + src.unpipe(dest); + } + + // tell the dest that it's being piped to + dest.emit('pipe', src); + + // start the flow if it hasn't been started already. + if (!state.flowing) { + // the handler that waits for readable events after all + // the data gets sucked out in flow. + // This would be easier to follow with a .once() handler + // in flow(), but that is too slow. + this.on('readable', pipeOnReadable); + + state.flowing = true; + process.nextTick(function() { + flow(src); + }); + } + + return dest; +}; + +function pipeOnDrain(src) { + return function() { + var dest = this; + var state = src._readableState; + state.awaitDrain--; + if (state.awaitDrain === 0) + flow(src); + }; +} + +function flow(src) { + var state = src._readableState; + var chunk; + state.awaitDrain = 0; + + function write(dest, i, list) { + var written = dest.write(chunk); + if (false === written) { + state.awaitDrain++; + } + } + + while (state.pipesCount && null !== (chunk = src.read())) { + + if (state.pipesCount === 1) + write(state.pipes, 0, null); + else + forEach(state.pipes, write); + + src.emit('data', chunk); + + // if anyone needs a drain, then we have to wait for that. + if (state.awaitDrain > 0) + return; + } + + // if every destination was unpiped, either before entering this + // function, or in the while loop, then stop flowing. + // + // NB: This is a pretty rare edge case. + if (state.pipesCount === 0) { + state.flowing = false; + + // if there were data event listeners added, then switch to old mode. + if (EE.listenerCount(src, 'data') > 0) + emitDataEvents(src); + return; + } + + // at this point, no one needed a drain, so we just ran out of data + // on the next readable event, start it over again. + state.ranOut = true; +} + +function pipeOnReadable() { + if (this._readableState.ranOut) { + this._readableState.ranOut = false; + flow(this); + } +} + + +Readable.prototype.unpipe = function(dest) { + var state = this._readableState; + + // if we're not piping anywhere, then do nothing. + if (state.pipesCount === 0) + return this; + + // just one destination. most common case. + if (state.pipesCount === 1) { + // passed in one, but it's not the right one. + if (dest && dest !== state.pipes) + return this; + + if (!dest) + dest = state.pipes; + + // got a match. + state.pipes = null; + state.pipesCount = 0; + this.removeListener('readable', pipeOnReadable); + state.flowing = false; + if (dest) + dest.emit('unpipe', this); + return this; + } + + // slow case. multiple pipe destinations. + + if (!dest) { + // remove all. + var dests = state.pipes; + var len = state.pipesCount; + state.pipes = null; + state.pipesCount = 0; + this.removeListener('readable', pipeOnReadable); + state.flowing = false; + + for (var i = 0; i < len; i++) + dests[i].emit('unpipe', this); + return this; + } + + // try to find the right one. + var i = indexOf(state.pipes, dest); + if (i === -1) + return this; + + state.pipes.splice(i, 1); + state.pipesCount -= 1; + if (state.pipesCount === 1) + state.pipes = state.pipes[0]; + + dest.emit('unpipe', this); + + return this; +}; + +// set up data events if they are asked for +// Ensure readable listeners eventually get something +Readable.prototype.on = function(ev, fn) { + var res = Stream.prototype.on.call(this, ev, fn); + + if (ev === 'data' && !this._readableState.flowing) + emitDataEvents(this); + + if (ev === 'readable' && this.readable) { + var state = this._readableState; + if (!state.readableListening) { + state.readableListening = true; + state.emittedReadable = false; + state.needReadable = true; + if (!state.reading) { + this.read(0); + } else if (state.length) { + emitReadable(this, state); + } + } + } + + return res; +}; +Readable.prototype.addListener = Readable.prototype.on; + +// pause() and resume() are remnants of the legacy readable stream API +// If the user uses them, then switch into old mode. +Readable.prototype.resume = function() { + emitDataEvents(this); + this.read(0); + this.emit('resume'); +}; + +Readable.prototype.pause = function() { + emitDataEvents(this, true); + this.emit('pause'); +}; + +function emitDataEvents(stream, startPaused) { + var state = stream._readableState; + + if (state.flowing) { + // https://github.com/isaacs/readable-stream/issues/16 + throw new Error('Cannot switch to old mode now.'); + } + + var paused = startPaused || false; + var readable = false; + + // convert to an old-style stream. + stream.readable = true; + stream.pipe = Stream.prototype.pipe; + stream.on = stream.addListener = Stream.prototype.on; + + stream.on('readable', function() { + readable = true; + + var c; + while (!paused && (null !== (c = stream.read()))) + stream.emit('data', c); + + if (c === null) { + readable = false; + stream._readableState.needReadable = true; + } + }); + + stream.pause = function() { + paused = true; + this.emit('pause'); + }; + + stream.resume = function() { + paused = false; + if (readable) + process.nextTick(function() { + stream.emit('readable'); + }); + else + this.read(0); + this.emit('resume'); + }; + + // now make it start, just in case it hadn't already. + stream.emit('readable'); +} + +// wrap an old-style stream as the async data source. +// This is *not* part of the readable stream interface. +// It is an ugly unfortunate mess of history. +Readable.prototype.wrap = function(stream) { + var state = this._readableState; + var paused = false; + + var self = this; + stream.on('end', function() { + if (state.decoder && !state.ended) { + var chunk = state.decoder.end(); + if (chunk && chunk.length) + self.push(chunk); + } + + self.push(null); + }); + + stream.on('data', function(chunk) { + if (state.decoder) + chunk = state.decoder.write(chunk); + + // don't skip over falsy values in objectMode + //if (state.objectMode && util.isNullOrUndefined(chunk)) + if (state.objectMode && (chunk === null || chunk === undefined)) + return; + else if (!state.objectMode && (!chunk || !chunk.length)) + return; + + var ret = self.push(chunk); + if (!ret) { + paused = true; + stream.pause(); + } + }); + + // proxy all the other methods. + // important when wrapping filters and duplexes. + for (var i in stream) { + if (typeof stream[i] === 'function' && + typeof this[i] === 'undefined') { + this[i] = function(method) { return function() { + return stream[method].apply(stream, arguments); + }}(i); + } + } + + // proxy certain important events. + var events = ['error', 'close', 'destroy', 'pause', 'resume']; + forEach(events, function(ev) { + stream.on(ev, self.emit.bind(self, ev)); + }); + + // when we try to consume some more bytes, simply unpause the + // underlying stream. + self._read = function(n) { + if (paused) { + paused = false; + stream.resume(); + } + }; + + return self; +}; + + + +// exposed for testing purposes only. +Readable._fromList = fromList; + +// Pluck off n bytes from an array of buffers. +// Length is the combined lengths of all the buffers in the list. +function fromList(n, state) { + var list = state.buffer; + var length = state.length; + var stringMode = !!state.decoder; + var objectMode = !!state.objectMode; + var ret; + + // nothing in the list, definitely empty. + if (list.length === 0) + return null; + + if (length === 0) + ret = null; + else if (objectMode) + ret = list.shift(); + else if (!n || n >= length) { + // read it all, truncate the array. + if (stringMode) + ret = list.join(''); + else + ret = Buffer.concat(list, length); + list.length = 0; + } else { + // read just some of it. + if (n < list[0].length) { + // just take a part of the first list item. + // slice is the same for buffers and strings. + var buf = list[0]; + ret = buf.slice(0, n); + list[0] = buf.slice(n); + } else if (n === list[0].length) { + // first list is a perfect match + ret = list.shift(); + } else { + // complex case. + // we have enough to cover it, but it spans past the first buffer. + if (stringMode) + ret = ''; + else + ret = new Buffer(n); + + var c = 0; + for (var i = 0, l = list.length; i < l && c < n; i++) { + var buf = list[0]; + var cpy = Math.min(n - c, buf.length); + + if (stringMode) + ret += buf.slice(0, cpy); + else + buf.copy(ret, c, 0, cpy); + + if (cpy < buf.length) + list[0] = buf.slice(cpy); + else + list.shift(); + + c += cpy; + } + } + } + + return ret; +} + +function endReadable(stream) { + var state = stream._readableState; + + // If we get here before consuming all the bytes, then that is a + // bug in node. Should never happen. + if (state.length > 0) + throw new Error('endReadable called on non-empty stream'); + + if (!state.endEmitted && state.calledRead) { + state.ended = true; + process.nextTick(function() { + // Check that we didn't get one last unshift. + if (!state.endEmitted && state.length === 0) { + state.endEmitted = true; + stream.readable = false; + stream.emit('end'); + } + }); + } +} + +function forEach (xs, f) { + for (var i = 0, l = xs.length; i < l; i++) { + f(xs[i], i); + } +} + +function indexOf (xs, x) { + for (var i = 0, l = xs.length; i < l; i++) { + if (xs[i] === x) return i; + } + return -1; +} + +}).call(this,require('_process')) +},{"_process":45,"buffer":38,"core-util-is":23,"events":42,"inherits":10,"isarray":24,"stream":61,"string_decoder/":25}],21:[function(require,module,exports){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + + +// a transform stream is a readable/writable stream where you do +// something with the data. Sometimes it's called a "filter", +// but that's not a great name for it, since that implies a thing where +// some bits pass through, and others are simply ignored. (That would +// be a valid example of a transform, of course.) +// +// While the output is causally related to the input, it's not a +// necessarily symmetric or synchronous transformation. For example, +// a zlib stream might take multiple plain-text writes(), and then +// emit a single compressed chunk some time in the future. +// +// Here's how this works: +// +// The Transform stream has all the aspects of the readable and writable +// stream classes. When you write(chunk), that calls _write(chunk,cb) +// internally, and returns false if there's a lot of pending writes +// buffered up. When you call read(), that calls _read(n) until +// there's enough pending readable data buffered up. +// +// In a transform stream, the written data is placed in a buffer. When +// _read(n) is called, it transforms the queued up data, calling the +// buffered _write cb's as it consumes chunks. If consuming a single +// written chunk would result in multiple output chunks, then the first +// outputted bit calls the readcb, and subsequent chunks just go into +// the read buffer, and will cause it to emit 'readable' if necessary. +// +// This way, back-pressure is actually determined by the reading side, +// since _read has to be called to start processing a new chunk. However, +// a pathological inflate type of transform can cause excessive buffering +// here. For example, imagine a stream where every byte of input is +// interpreted as an integer from 0-255, and then results in that many +// bytes of output. Writing the 4 bytes {ff,ff,ff,ff} would result in +// 1kb of data being output. In this case, you could write a very small +// amount of input, and end up with a very large amount of output. In +// such a pathological inflating mechanism, there'd be no way to tell +// the system to stop doing the transform. A single 4MB write could +// cause the system to run out of memory. +// +// However, even in such a pathological case, only a single written chunk +// would be consumed, and then the rest would wait (un-transformed) until +// the results of the previous transformed chunk were consumed. + +module.exports = Transform; + +var Duplex = require('./_stream_duplex'); + +/**/ +var util = require('core-util-is'); +util.inherits = require('inherits'); +/**/ + +util.inherits(Transform, Duplex); + + +function TransformState(options, stream) { + this.afterTransform = function(er, data) { + return afterTransform(stream, er, data); + }; + + this.needTransform = false; + this.transforming = false; + this.writecb = null; + this.writechunk = null; +} + +function afterTransform(stream, er, data) { + var ts = stream._transformState; + ts.transforming = false; + + var cb = ts.writecb; + + if (!cb) + return stream.emit('error', new Error('no writecb in Transform class')); + + ts.writechunk = null; + ts.writecb = null; + + if (data !== null && data !== undefined) + stream.push(data); + + if (cb) + cb(er); + + var rs = stream._readableState; + rs.reading = false; + if (rs.needReadable || rs.length < rs.highWaterMark) { + stream._read(rs.highWaterMark); + } +} + + +function Transform(options) { + if (!(this instanceof Transform)) + return new Transform(options); + + Duplex.call(this, options); + + var ts = this._transformState = new TransformState(options, this); + + // when the writable side finishes, then flush out anything remaining. + var stream = this; + + // start out asking for a readable event once data is transformed. + this._readableState.needReadable = true; + + // we have implemented the _read method, and done the other things + // that Readable wants before the first _read call, so unset the + // sync guard flag. + this._readableState.sync = false; + + this.once('finish', function() { + if ('function' === typeof this._flush) + this._flush(function(er) { + done(stream, er); + }); + else + done(stream); + }); +} + +Transform.prototype.push = function(chunk, encoding) { + this._transformState.needTransform = false; + return Duplex.prototype.push.call(this, chunk, encoding); +}; + +// This is the part where you do stuff! +// override this function in implementation classes. +// 'chunk' is an input chunk. +// +// Call `push(newChunk)` to pass along transformed output +// to the readable side. You may call 'push' zero or more times. +// +// Call `cb(err)` when you are done with this chunk. If you pass +// an error, then that'll put the hurt on the whole operation. If you +// never call cb(), then you'll never get another chunk. +Transform.prototype._transform = function(chunk, encoding, cb) { + throw new Error('not implemented'); +}; + +Transform.prototype._write = function(chunk, encoding, cb) { + var ts = this._transformState; + ts.writecb = cb; + ts.writechunk = chunk; + ts.writeencoding = encoding; + if (!ts.transforming) { + var rs = this._readableState; + if (ts.needTransform || + rs.needReadable || + rs.length < rs.highWaterMark) + this._read(rs.highWaterMark); + } +}; + +// Doesn't matter what the args are here. +// _transform does all the work. +// That we got here means that the readable side wants more data. +Transform.prototype._read = function(n) { + var ts = this._transformState; + + if (ts.writechunk !== null && ts.writecb && !ts.transforming) { + ts.transforming = true; + this._transform(ts.writechunk, ts.writeencoding, ts.afterTransform); + } else { + // mark that we need a transform, so that any data that comes in + // will get processed, now that we've asked for it. + ts.needTransform = true; + } +}; + + +function done(stream, er) { + if (er) + return stream.emit('error', er); + + // if there's nothing in the write buffer, then that means + // that nothing more will ever be provided + var ws = stream._writableState; + var rs = stream._readableState; + var ts = stream._transformState; + + if (ws.length) + throw new Error('calling transform done when ws.length != 0'); + + if (ts.transforming) + throw new Error('calling transform done when still transforming'); + + return stream.push(null); +} + +},{"./_stream_duplex":18,"core-util-is":23,"inherits":10}],22:[function(require,module,exports){ +(function (process){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// A bit simpler than readable streams. +// Implement an async ._write(chunk, cb), and it'll handle all +// the drain event emission and buffering. + +module.exports = Writable; + +/**/ +var Buffer = require('buffer').Buffer; +/**/ + +Writable.WritableState = WritableState; + + +/**/ +var util = require('core-util-is'); +util.inherits = require('inherits'); +/**/ + +var Stream = require('stream'); + +util.inherits(Writable, Stream); + +function WriteReq(chunk, encoding, cb) { + this.chunk = chunk; + this.encoding = encoding; + this.callback = cb; +} + +function WritableState(options, stream) { + options = options || {}; + + // the point at which write() starts returning false + // Note: 0 is a valid value, means that we always return false if + // the entire buffer is not flushed immediately on write() + var hwm = options.highWaterMark; + this.highWaterMark = (hwm || hwm === 0) ? hwm : 16 * 1024; + + // object stream flag to indicate whether or not this stream + // contains buffers or objects. + this.objectMode = !!options.objectMode; + + // cast to ints. + this.highWaterMark = ~~this.highWaterMark; + + this.needDrain = false; + // at the start of calling end() + this.ending = false; + // when end() has been called, and returned + this.ended = false; + // when 'finish' is emitted + this.finished = false; + + // should we decode strings into buffers before passing to _write? + // this is here so that some node-core streams can optimize string + // handling at a lower level. + var noDecode = options.decodeStrings === false; + this.decodeStrings = !noDecode; + + // Crypto is kind of old and crusty. Historically, its default string + // encoding is 'binary' so we have to make this configurable. + // Everything else in the universe uses 'utf8', though. + this.defaultEncoding = options.defaultEncoding || 'utf8'; + + // not an actual buffer we keep track of, but a measurement + // of how much we're waiting to get pushed to some underlying + // socket or file. + this.length = 0; + + // a flag to see when we're in the middle of a write. + this.writing = false; + + // a flag to be able to tell if the onwrite cb is called immediately, + // or on a later tick. We set this to true at first, becuase any + // actions that shouldn't happen until "later" should generally also + // not happen before the first write call. + this.sync = true; + + // a flag to know if we're processing previously buffered items, which + // may call the _write() callback in the same tick, so that we don't + // end up in an overlapped onwrite situation. + this.bufferProcessing = false; + + // the callback that's passed to _write(chunk,cb) + this.onwrite = function(er) { + onwrite(stream, er); + }; + + // the callback that the user supplies to write(chunk,encoding,cb) + this.writecb = null; + + // the amount that is being written when _write is called. + this.writelen = 0; + + this.buffer = []; + + // True if the error was already emitted and should not be thrown again + this.errorEmitted = false; +} + +function Writable(options) { + var Duplex = require('./_stream_duplex'); + + // Writable ctor is applied to Duplexes, though they're not + // instanceof Writable, they're instanceof Readable. + if (!(this instanceof Writable) && !(this instanceof Duplex)) + return new Writable(options); + + this._writableState = new WritableState(options, this); + + // legacy. + this.writable = true; + + Stream.call(this); +} + +// Otherwise people can pipe Writable streams, which is just wrong. +Writable.prototype.pipe = function() { + this.emit('error', new Error('Cannot pipe. Not readable.')); +}; + + +function writeAfterEnd(stream, state, cb) { + var er = new Error('write after end'); + // TODO: defer error events consistently everywhere, not just the cb + stream.emit('error', er); + process.nextTick(function() { + cb(er); + }); +} + +// If we get something that is not a buffer, string, null, or undefined, +// and we're not in objectMode, then that's an error. +// Otherwise stream chunks are all considered to be of length=1, and the +// watermarks determine how many objects to keep in the buffer, rather than +// how many bytes or characters. +function validChunk(stream, state, chunk, cb) { + var valid = true; + if (!Buffer.isBuffer(chunk) && + 'string' !== typeof chunk && + chunk !== null && + chunk !== undefined && + !state.objectMode) { + var er = new TypeError('Invalid non-string/buffer chunk'); + stream.emit('error', er); + process.nextTick(function() { + cb(er); + }); + valid = false; + } + return valid; +} + +Writable.prototype.write = function(chunk, encoding, cb) { + var state = this._writableState; + var ret = false; + + if (typeof encoding === 'function') { + cb = encoding; + encoding = null; + } + + if (Buffer.isBuffer(chunk)) + encoding = 'buffer'; + else if (!encoding) + encoding = state.defaultEncoding; + + if (typeof cb !== 'function') + cb = function() {}; + + if (state.ended) + writeAfterEnd(this, state, cb); + else if (validChunk(this, state, chunk, cb)) + ret = writeOrBuffer(this, state, chunk, encoding, cb); + + return ret; +}; + +function decodeChunk(state, chunk, encoding) { + if (!state.objectMode && + state.decodeStrings !== false && + typeof chunk === 'string') { + chunk = new Buffer(chunk, encoding); + } + return chunk; +} + +// if we're already writing something, then just put this +// in the queue, and wait our turn. Otherwise, call _write +// If we return false, then we need a drain event, so set that flag. +function writeOrBuffer(stream, state, chunk, encoding, cb) { + chunk = decodeChunk(state, chunk, encoding); + if (Buffer.isBuffer(chunk)) + encoding = 'buffer'; + var len = state.objectMode ? 1 : chunk.length; + + state.length += len; + + var ret = state.length < state.highWaterMark; + // we must ensure that previous needDrain will not be reset to false. + if (!ret) + state.needDrain = true; + + if (state.writing) + state.buffer.push(new WriteReq(chunk, encoding, cb)); + else + doWrite(stream, state, len, chunk, encoding, cb); + + return ret; +} + +function doWrite(stream, state, len, chunk, encoding, cb) { + state.writelen = len; + state.writecb = cb; + state.writing = true; + state.sync = true; + stream._write(chunk, encoding, state.onwrite); + state.sync = false; +} + +function onwriteError(stream, state, sync, er, cb) { + if (sync) + process.nextTick(function() { + cb(er); + }); + else + cb(er); + + stream._writableState.errorEmitted = true; + stream.emit('error', er); +} + +function onwriteStateUpdate(state) { + state.writing = false; + state.writecb = null; + state.length -= state.writelen; + state.writelen = 0; +} + +function onwrite(stream, er) { + var state = stream._writableState; + var sync = state.sync; + var cb = state.writecb; + + onwriteStateUpdate(state); + + if (er) + onwriteError(stream, state, sync, er, cb); + else { + // Check if we're actually ready to finish, but don't emit yet + var finished = needFinish(stream, state); + + if (!finished && !state.bufferProcessing && state.buffer.length) + clearBuffer(stream, state); + + if (sync) { + process.nextTick(function() { + afterWrite(stream, state, finished, cb); + }); + } else { + afterWrite(stream, state, finished, cb); + } + } +} + +function afterWrite(stream, state, finished, cb) { + if (!finished) + onwriteDrain(stream, state); + cb(); + if (finished) + finishMaybe(stream, state); +} + +// Must force callback to be called on nextTick, so that we don't +// emit 'drain' before the write() consumer gets the 'false' return +// value, and has a chance to attach a 'drain' listener. +function onwriteDrain(stream, state) { + if (state.length === 0 && state.needDrain) { + state.needDrain = false; + stream.emit('drain'); + } +} + + +// if there's something in the buffer waiting, then process it +function clearBuffer(stream, state) { + state.bufferProcessing = true; + + for (var c = 0; c < state.buffer.length; c++) { + var entry = state.buffer[c]; + var chunk = entry.chunk; + var encoding = entry.encoding; + var cb = entry.callback; + var len = state.objectMode ? 1 : chunk.length; + + doWrite(stream, state, len, chunk, encoding, cb); + + // if we didn't call the onwrite immediately, then + // it means that we need to wait until it does. + // also, that means that the chunk and cb are currently + // being processed, so move the buffer counter past them. + if (state.writing) { + c++; + break; + } + } + + state.bufferProcessing = false; + if (c < state.buffer.length) + state.buffer = state.buffer.slice(c); + else + state.buffer.length = 0; +} + +Writable.prototype._write = function(chunk, encoding, cb) { + cb(new Error('not implemented')); +}; + +Writable.prototype.end = function(chunk, encoding, cb) { + var state = this._writableState; + + if (typeof chunk === 'function') { + cb = chunk; + chunk = null; + encoding = null; + } else if (typeof encoding === 'function') { + cb = encoding; + encoding = null; + } + + if (typeof chunk !== 'undefined' && chunk !== null) + this.write(chunk, encoding); + + // ignore unnecessary end() calls. + if (!state.ending && !state.finished) + endWritable(this, state, cb); +}; + + +function needFinish(stream, state) { + return (state.ending && + state.length === 0 && + !state.finished && + !state.writing); +} + +function finishMaybe(stream, state) { + var need = needFinish(stream, state); + if (need) { + state.finished = true; + stream.emit('finish'); + } + return need; +} + +function endWritable(stream, state, cb) { + state.ending = true; + finishMaybe(stream, state); + if (cb) { + if (state.finished) + process.nextTick(cb); + else + stream.once('finish', cb); + } + state.ended = true; +} + +}).call(this,require('_process')) +},{"./_stream_duplex":18,"_process":45,"buffer":38,"core-util-is":23,"inherits":10,"stream":61}],23:[function(require,module,exports){ +(function (Buffer){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// NOTE: These type checking functions intentionally don't use `instanceof` +// because it is fragile and can be easily faked with `Object.create()`. +function isArray(ar) { + return Array.isArray(ar); +} +exports.isArray = isArray; + +function isBoolean(arg) { + return typeof arg === 'boolean'; +} +exports.isBoolean = isBoolean; + +function isNull(arg) { + return arg === null; +} +exports.isNull = isNull; + +function isNullOrUndefined(arg) { + return arg == null; +} +exports.isNullOrUndefined = isNullOrUndefined; + +function isNumber(arg) { + return typeof arg === 'number'; +} +exports.isNumber = isNumber; + +function isString(arg) { + return typeof arg === 'string'; +} +exports.isString = isString; + +function isSymbol(arg) { + return typeof arg === 'symbol'; +} +exports.isSymbol = isSymbol; + +function isUndefined(arg) { + return arg === void 0; +} +exports.isUndefined = isUndefined; + +function isRegExp(re) { + return isObject(re) && objectToString(re) === '[object RegExp]'; +} +exports.isRegExp = isRegExp; + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} +exports.isObject = isObject; + +function isDate(d) { + return isObject(d) && objectToString(d) === '[object Date]'; +} +exports.isDate = isDate; + +function isError(e) { + return isObject(e) && + (objectToString(e) === '[object Error]' || e instanceof Error); +} +exports.isError = isError; + +function isFunction(arg) { + return typeof arg === 'function'; +} +exports.isFunction = isFunction; + +function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; +} +exports.isPrimitive = isPrimitive; + +function isBuffer(arg) { + return Buffer.isBuffer(arg); +} +exports.isBuffer = isBuffer; + +function objectToString(o) { + return Object.prototype.toString.call(o); +} +}).call(this,require("buffer").Buffer) +},{"buffer":38}],24:[function(require,module,exports){ +module.exports = Array.isArray || function (arr) { + return Object.prototype.toString.call(arr) == '[object Array]'; +}; + +},{}],25:[function(require,module,exports){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +var Buffer = require('buffer').Buffer; + +var isBufferEncoding = Buffer.isEncoding + || function(encoding) { + switch (encoding && encoding.toLowerCase()) { + case 'hex': case 'utf8': case 'utf-8': case 'ascii': case 'binary': case 'base64': case 'ucs2': case 'ucs-2': case 'utf16le': case 'utf-16le': case 'raw': return true; + default: return false; + } + } + + +function assertEncoding(encoding) { + if (encoding && !isBufferEncoding(encoding)) { + throw new Error('Unknown encoding: ' + encoding); + } +} + +// StringDecoder provides an interface for efficiently splitting a series of +// buffers into a series of JS strings without breaking apart multi-byte +// characters. CESU-8 is handled as part of the UTF-8 encoding. +// +// @TODO Handling all encodings inside a single object makes it very difficult +// to reason about this code, so it should be split up in the future. +// @TODO There should be a utf8-strict encoding that rejects invalid UTF-8 code +// points as used by CESU-8. +var StringDecoder = exports.StringDecoder = function(encoding) { + this.encoding = (encoding || 'utf8').toLowerCase().replace(/[-_]/, ''); + assertEncoding(encoding); + switch (this.encoding) { + case 'utf8': + // CESU-8 represents each of Surrogate Pair by 3-bytes + this.surrogateSize = 3; + break; + case 'ucs2': + case 'utf16le': + // UTF-16 represents each of Surrogate Pair by 2-bytes + this.surrogateSize = 2; + this.detectIncompleteChar = utf16DetectIncompleteChar; + break; + case 'base64': + // Base-64 stores 3 bytes in 4 chars, and pads the remainder. + this.surrogateSize = 3; + this.detectIncompleteChar = base64DetectIncompleteChar; + break; + default: + this.write = passThroughWrite; + return; + } + + // Enough space to store all bytes of a single character. UTF-8 needs 4 + // bytes, but CESU-8 may require up to 6 (3 bytes per surrogate). + this.charBuffer = new Buffer(6); + // Number of bytes received for the current incomplete multi-byte character. + this.charReceived = 0; + // Number of bytes expected for the current incomplete multi-byte character. + this.charLength = 0; +}; + + +// write decodes the given buffer and returns it as JS string that is +// guaranteed to not contain any partial multi-byte characters. Any partial +// character found at the end of the buffer is buffered up, and will be +// returned when calling write again with the remaining bytes. +// +// Note: Converting a Buffer containing an orphan surrogate to a String +// currently works, but converting a String to a Buffer (via `new Buffer`, or +// Buffer#write) will replace incomplete surrogates with the unicode +// replacement character. See https://codereview.chromium.org/121173009/ . +StringDecoder.prototype.write = function(buffer) { + var charStr = ''; + // if our last write ended with an incomplete multibyte character + while (this.charLength) { + // determine how many remaining bytes this buffer has to offer for this char + var available = (buffer.length >= this.charLength - this.charReceived) ? + this.charLength - this.charReceived : + buffer.length; + + // add the new bytes to the char buffer + buffer.copy(this.charBuffer, this.charReceived, 0, available); + this.charReceived += available; + + if (this.charReceived < this.charLength) { + // still not enough chars in this buffer? wait for more ... + return ''; + } + + // remove bytes belonging to the current character from the buffer + buffer = buffer.slice(available, buffer.length); + + // get the character that was split + charStr = this.charBuffer.slice(0, this.charLength).toString(this.encoding); + + // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character + var charCode = charStr.charCodeAt(charStr.length - 1); + if (charCode >= 0xD800 && charCode <= 0xDBFF) { + this.charLength += this.surrogateSize; + charStr = ''; + continue; + } + this.charReceived = this.charLength = 0; + + // if there are no more bytes in this buffer, just emit our char + if (buffer.length === 0) { + return charStr; + } + break; + } + + // determine and set charLength / charReceived + this.detectIncompleteChar(buffer); + + var end = buffer.length; + if (this.charLength) { + // buffer the incomplete character bytes we got + buffer.copy(this.charBuffer, 0, buffer.length - this.charReceived, end); + end -= this.charReceived; + } + + charStr += buffer.toString(this.encoding, 0, end); + + var end = charStr.length - 1; + var charCode = charStr.charCodeAt(end); + // CESU-8: lead surrogate (D800-DBFF) is also the incomplete character + if (charCode >= 0xD800 && charCode <= 0xDBFF) { + var size = this.surrogateSize; + this.charLength += size; + this.charReceived += size; + this.charBuffer.copy(this.charBuffer, size, 0, size); + buffer.copy(this.charBuffer, 0, 0, size); + return charStr.substring(0, end); + } + + // or just emit the charStr + return charStr; +}; + +// detectIncompleteChar determines if there is an incomplete UTF-8 character at +// the end of the given buffer. If so, it sets this.charLength to the byte +// length that character, and sets this.charReceived to the number of bytes +// that are available for this character. +StringDecoder.prototype.detectIncompleteChar = function(buffer) { + // determine how many bytes we have to check at the end of this buffer + var i = (buffer.length >= 3) ? 3 : buffer.length; + + // Figure out if one of the last i bytes of our buffer announces an + // incomplete char. + for (; i > 0; i--) { + var c = buffer[buffer.length - i]; + + // See http://en.wikipedia.org/wiki/UTF-8#Description + + // 110XXXXX + if (i == 1 && c >> 5 == 0x06) { + this.charLength = 2; + break; + } + + // 1110XXXX + if (i <= 2 && c >> 4 == 0x0E) { + this.charLength = 3; + break; + } + + // 11110XXX + if (i <= 3 && c >> 3 == 0x1E) { + this.charLength = 4; + break; + } + } + this.charReceived = i; +}; + +StringDecoder.prototype.end = function(buffer) { + var res = ''; + if (buffer && buffer.length) + res = this.write(buffer); + + if (this.charReceived) { + var cr = this.charReceived; + var buf = this.charBuffer; + var enc = this.encoding; + res += buf.slice(0, cr).toString(enc); + } + + return res; +}; + +function passThroughWrite(buffer) { + return buffer.toString(this.encoding); +} + +function utf16DetectIncompleteChar(buffer) { + this.charReceived = buffer.length % 2; + this.charLength = this.charReceived ? 2 : 0; +} + +function base64DetectIncompleteChar(buffer) { + this.charReceived = buffer.length % 3; + this.charLength = this.charReceived ? 3 : 0; +} + +},{"buffer":38}],26:[function(require,module,exports){ +var Stream = require('stream'); // hack to fix a circular dependency issue when used with browserify +exports = module.exports = require('./lib/_stream_readable.js'); +exports.Stream = Stream; +exports.Readable = exports; +exports.Writable = require('./lib/_stream_writable.js'); +exports.Duplex = require('./lib/_stream_duplex.js'); +exports.Transform = require('./lib/_stream_transform.js'); +exports.PassThrough = require('./lib/_stream_passthrough.js'); + +},{"./lib/_stream_duplex.js":18,"./lib/_stream_passthrough.js":19,"./lib/_stream_readable.js":20,"./lib/_stream_transform.js":21,"./lib/_stream_writable.js":22,"stream":61}],27:[function(require,module,exports){ +module.exports = require("./lib/_stream_transform.js") + +},{"./lib/_stream_transform.js":21}],28:[function(require,module,exports){ +(function (process,Buffer){ +var stream = require('readable-stream') +var eos = require('end-of-stream') +var util = require('util') + +var SIGNAL_FLUSH = new Buffer([0]) + +var onuncork = function(self, fn) { + if (self._corked) self.once('uncork', fn) + else fn() +} + +var destroyer = function(self, end) { + return function(err) { + if (err) self.destroy(err.message === 'premature close' ? null : err) + else if (end && !self._ended) self.end() + } +} + +var end = function(ws, fn) { + if (!ws) return fn() + if (ws._writableState && ws._writableState.finished) return fn() + if (ws._writableState) return ws.end(fn) + ws.end() + fn() +} + +var toStreams2 = function(rs) { + return new (stream.Readable)({objectMode:true, highWaterMark:16}).wrap(rs) +} + +var Duplexify = function(writable, readable, opts) { + if (!(this instanceof Duplexify)) return new Duplexify(writable, readable, opts) + stream.Duplex.call(this, opts) + + this._writable = null + this._readable = null + this._readable2 = null + + this._forwardDestroy = !opts || opts.destroy !== false + this._forwardEnd = !opts || opts.end !== false + this._corked = 1 // start corked + this._ondrain = null + this._drained = false + this._forwarding = false + this._unwrite = null + this._unread = null + this._ended = false + + this.destroyed = false + + if (writable) this.setWritable(writable) + if (readable) this.setReadable(readable) +} + +util.inherits(Duplexify, stream.Duplex) + +Duplexify.obj = function(writable, readable, opts) { + if (!opts) opts = {} + opts.objectMode = true + opts.highWaterMark = 16 + return new Duplexify(writable, readable, opts) +} + +Duplexify.prototype.cork = function() { + if (++this._corked === 1) this.emit('cork') +} + +Duplexify.prototype.uncork = function() { + if (this._corked && --this._corked === 0) this.emit('uncork') +} + +Duplexify.prototype.setWritable = function(writable) { + if (this._unwrite) this._unwrite() + + if (this.destroyed) { + if (writable && writable.destroy) writable.destroy() + return + } + + if (writable === null || writable === false) { + this.end() + return + } + + var self = this + var unend = eos(writable, {writable:true, readable:false}, destroyer(this, this._forwardEnd)) + + var ondrain = function() { + var ondrain = self._ondrain + self._ondrain = null + if (ondrain) ondrain() + } + + var clear = function() { + self._writable.removeListener('drain', ondrain) + unend() + } + + if (this._unwrite) process.nextTick(ondrain) // force a drain on stream reset to avoid livelocks + + this._writable = writable + this._writable.on('drain', ondrain) + this._unwrite = clear + + this.uncork() // always uncork setWritable +} + +Duplexify.prototype.setReadable = function(readable) { + if (this._unread) this._unread() + + if (this.destroyed) { + if (readable && readable.destroy) readable.destroy() + return + } + + if (readable === null || readable === false) { + this.push(null) + this.resume() + return + } + + var self = this + var unend = eos(readable, {writable:false, readable:true}, destroyer(this)) + + var onreadable = function() { + self._forward() + } + + var onend = function() { + self.push(null) + } + + var clear = function() { + self._readable2.removeListener('readable', onreadable) + self._readable2.removeListener('end', onend) + unend() + } + + this._drained = true + this._readable = readable + this._readable2 = readable._readableState ? readable : toStreams2(readable) + this._readable2.on('readable', onreadable) + this._readable2.on('end', onend) + this._unread = clear + + this._forward() +} + +Duplexify.prototype._read = function() { + this._drained = true + this._forward() +} + +Duplexify.prototype._forward = function() { + if (this._forwarding || !this._readable2 || !this._drained) return + this._forwarding = true + + var data + while ((data = this._readable2.read()) !== null) { + this._drained = this.push(data) + } + + this._forwarding = false +} + +Duplexify.prototype.destroy = function(err) { + if (this.destroyed) return + this.destroyed = true + + var self = this + process.nextTick(function() { + self._destroy(err) + }) +} + +Duplexify.prototype._destroy = function(err) { + if (err) { + var ondrain = this._ondrain + this._ondrain = null + if (ondrain) ondrain(err) + else this.emit('error', err) + } + + if (this._forwardDestroy) { + if (this._readable && this._readable.destroy) this._readable.destroy() + if (this._writable && this._writable.destroy) this._writable.destroy() + } + + this.emit('close') +} + +Duplexify.prototype._write = function(data, enc, cb) { + if (this.destroyed) return cb() + if (this._corked) return onuncork(this, this._write.bind(this, data, enc, cb)) + if (data === SIGNAL_FLUSH) return this._finish(cb) + if (!this._writable) return cb() + + if (this._writable.write(data) === false) this._ondrain = cb + else cb() +} + + +Duplexify.prototype._finish = function(cb) { + var self = this + this.emit('preend') + onuncork(this, function() { + end(self._forwardEnd && self._writable, function() { + self.emit('prefinish') + onuncork(self, cb) + }) + }) +} + +Duplexify.prototype.end = function(data, enc, cb) { + if (typeof data === 'function') return this.end(null, null, data) + if (typeof enc === 'function') return this.end(data, null, enc) + this._ended = true + if (data) this.write(data) + if (!this._writableState.ending) this.write(SIGNAL_FLUSH) + return stream.Writable.prototype.end.call(this, cb) +} + +module.exports = Duplexify +}).call(this,require('_process'),require("buffer").Buffer) +},{"_process":45,"buffer":38,"end-of-stream":29,"readable-stream":26,"util":65}],29:[function(require,module,exports){ +var once = require('once'); + +var noop = function() {}; + +var isRequest = function(stream) { + return stream.setHeader && typeof stream.abort === 'function'; +}; + +var eos = function(stream, opts, callback) { + if (typeof opts === 'function') return eos(stream, null, opts); + if (!opts) opts = {}; + + callback = once(callback || noop); + + var ws = stream._writableState; + var rs = stream._readableState; + var readable = opts.readable || (opts.readable !== false && stream.readable); + var writable = opts.writable || (opts.writable !== false && stream.writable); + + var onlegacyfinish = function() { + if (!stream.writable) onfinish(); + }; + + var onfinish = function() { + writable = false; + if (!readable) callback(); + }; + + var onend = function() { + readable = false; + if (!writable) callback(); + }; + + var onclose = function() { + if (readable && !(rs && rs.ended)) return callback(new Error('premature close')); + if (writable && !(ws && ws.ended)) return callback(new Error('premature close')); + }; + + var onrequest = function() { + stream.req.on('finish', onfinish); + }; + + if (isRequest(stream)) { + stream.on('complete', onfinish); + stream.on('abort', onclose); + if (stream.req) onrequest(); + else stream.on('request', onrequest); + } else if (writable && !ws) { // legacy streams + stream.on('end', onlegacyfinish); + stream.on('close', onlegacyfinish); + } + + stream.on('end', onend); + stream.on('finish', onfinish); + if (opts.error !== false) stream.on('error', callback); + stream.on('close', onclose); + + return function() { + stream.removeListener('complete', onfinish); + stream.removeListener('abort', onclose); + stream.removeListener('request', onrequest); + if (stream.req) stream.req.removeListener('finish', onfinish); + stream.removeListener('end', onlegacyfinish); + stream.removeListener('close', onlegacyfinish); + stream.removeListener('finish', onfinish); + stream.removeListener('end', onend); + stream.removeListener('error', callback); + stream.removeListener('close', onclose); + }; +}; + +module.exports = eos; +},{"once":31}],30:[function(require,module,exports){ +arguments[4][8][0].apply(exports,arguments) +},{"dup":8}],31:[function(require,module,exports){ +arguments[4][9][0].apply(exports,arguments) +},{"dup":9,"wrappy":30}],32:[function(require,module,exports){ +(function (process){ +var Transform = require('readable-stream/transform') + , inherits = require('util').inherits + , xtend = require('xtend') + +function DestroyableTransform(opts) { + Transform.call(this, opts) + this._destroyed = false +} + +inherits(DestroyableTransform, Transform) + +DestroyableTransform.prototype.destroy = function(err) { + if (this._destroyed) return + this._destroyed = true + + var self = this + process.nextTick(function() { + if (err) + self.emit('error', err) + self.emit('close') + }) +} + +// a noop _transform function +function noop (chunk, enc, callback) { + callback(null, chunk) +} + + +// create a new export function, used by both the main export and +// the .ctor export, contains common logic for dealing with arguments +function through2 (construct) { + return function (options, transform, flush) { + if (typeof options == 'function') { + flush = transform + transform = options + options = {} + } + + if (typeof transform != 'function') + transform = noop + + if (typeof flush != 'function') + flush = null + + return construct(options, transform, flush) + } +} + + +// main export, just make me a transform stream! +module.exports = through2(function (options, transform, flush) { + var t2 = new DestroyableTransform(options) + + t2._transform = transform + + if (flush) + t2._flush = flush + + return t2 +}) + + +// make me a reusable prototype that I can `new`, or implicitly `new` +// with a constructor call +module.exports.ctor = through2(function (options, transform, flush) { + function Through2 (override) { + if (!(this instanceof Through2)) + return new Through2(override) + + this.options = xtend(options, override) + + DestroyableTransform.call(this, this.options) + } + + inherits(Through2, DestroyableTransform) + + Through2.prototype._transform = transform + + if (flush) + Through2.prototype._flush = flush + + return Through2 +}) + + +module.exports.obj = through2(function (options, transform, flush) { + var t2 = new DestroyableTransform(xtend({ objectMode: true, highWaterMark: 16 }, options)) + + t2._transform = transform + + if (flush) + t2._flush = flush + + return t2 +}) + +}).call(this,require('_process')) +},{"_process":45,"readable-stream/transform":27,"util":65,"xtend":35}],33:[function(require,module,exports){ + +/** + * Module dependencies. + */ + +var global = (function() { return this; })(); + +/** + * WebSocket constructor. + */ + +var WebSocket = global.WebSocket || global.MozWebSocket; + +/** + * Module exports. + */ + +module.exports = WebSocket ? ws : null; + +/** + * WebSocket constructor. + * + * The third `opts` options object gets ignored in web browsers, since it's + * non-standard, and throws a TypeError if passed to the constructor. + * See: https://github.com/einaros/ws/issues/227 + * + * @param {String} uri + * @param {Array} protocols (optional) + * @param {Object) opts (optional) + * @api public + */ + +function ws(uri, protocols, opts) { + var instance; + if (protocols) { + instance = new WebSocket(uri, protocols); + } else { + instance = new WebSocket(uri); + } + return instance; +} + +if (WebSocket) ws.prototype = WebSocket.prototype; + +},{}],34:[function(require,module,exports){ +(function (process,Buffer){ +var through = require('through2') +var duplexify = require('duplexify') +var WS = require('ws') + +module.exports = WebSocketStream + +function WebSocketStream(target, protocols) { + var stream, socket + var socketWrite = process.title === 'browser' ? socketWriteBrowser : socketWriteNode + var proxy = through(socketWrite, socketEnd) + + // use existing WebSocket object that was passed in + if (typeof target === 'object') { + socket = target + // otherwise make a new one + } else { + socket = new WS(target, protocols) + socket.binaryType = 'arraybuffer' + } + + // was already open when passed in + if (socket.readyState === 1) { + stream = proxy + } else { + stream = duplexify() + socket.addEventListener("open", onready) + } + + stream.socket = socket + + socket.addEventListener("close", onclose) + socket.addEventListener("error", onerror) + socket.addEventListener("message", onmessage) + + proxy.on('close', destroy) + + function socketWriteNode(chunk, enc, next) { + socket.send(chunk, next) + } + + function socketWriteBrowser(chunk, enc, next) { + try { + socket.send(chunk) + } catch(err) { + return next(err) + } + + next() + } + + function socketEnd(done) { + socket.close() + done() + } + + function onready() { + stream.setReadable(proxy) + stream.setWritable(proxy) + stream.emit('connect') + } + + function onclose() { + stream.end(); + stream.destroy() + } + + function onerror(err) { + stream.destroy(err) + } + + function onmessage(event) { + var data = event.data + if (data instanceof ArrayBuffer) data = new Buffer(new Uint8Array(data)) + proxy.push(data) + } + + function destroy() { + socket.close() + } + + return stream +} + +}).call(this,require('_process'),require("buffer").Buffer) +},{"_process":45,"buffer":38,"duplexify":28,"through2":32,"ws":33}],35:[function(require,module,exports){ +module.exports = extend + +function extend() { + var target = {} + + for (var i = 0; i < arguments.length; i++) { + var source = arguments[i] + + for (var key in source) { + if (source.hasOwnProperty(key)) { + target[key] = source[key] + } + } + } + + return target +} + +},{}],36:[function(require,module,exports){ + +},{}],37:[function(require,module,exports){ +arguments[4][36][0].apply(exports,arguments) +},{"dup":36}],38:[function(require,module,exports){ +/*! + * The buffer module from node.js, for the browser. + * + * @author Feross Aboukhadijeh + * @license MIT + */ + +var base64 = require('base64-js') +var ieee754 = require('ieee754') +var isArray = require('is-array') + +exports.Buffer = Buffer +exports.SlowBuffer = SlowBuffer +exports.INSPECT_MAX_BYTES = 50 +Buffer.poolSize = 8192 // not used by this implementation + +var kMaxLength = 0x3fffffff +var rootParent = {} + +/** + * If `Buffer.TYPED_ARRAY_SUPPORT`: + * === true Use Uint8Array implementation (fastest) + * === false Use Object implementation (most compatible, even IE6) + * + * Browsers that support typed arrays are IE 10+, Firefox 4+, Chrome 7+, Safari 5.1+, + * Opera 11.6+, iOS 4.2+. + * + * Note: + * + * - Implementation must support adding new properties to `Uint8Array` instances. + * Firefox 4-29 lacked support, fixed in Firefox 30+. + * See: https://bugzilla.mozilla.org/show_bug.cgi?id=695438. + * + * - Chrome 9-10 is missing the `TypedArray.prototype.subarray` function. + * + * - IE10 has a broken `TypedArray.prototype.subarray` function which returns arrays of + * incorrect length in some situations. + * + * We detect these buggy browsers and set `Buffer.TYPED_ARRAY_SUPPORT` to `false` so they will + * get the Object implementation, which is slower but will work correctly. + */ +Buffer.TYPED_ARRAY_SUPPORT = (function () { + try { + var buf = new ArrayBuffer(0) + var arr = new Uint8Array(buf) + arr.foo = function () { return 42 } + return arr.foo() === 42 && // typed array instances can be augmented + typeof arr.subarray === 'function' && // chrome 9-10 lack `subarray` + new Uint8Array(1).subarray(1, 1).byteLength === 0 // ie10 has broken `subarray` + } catch (e) { + return false + } +})() + +/** + * Class: Buffer + * ============= + * + * The Buffer constructor returns instances of `Uint8Array` that are augmented + * with function properties for all the node `Buffer` API functions. We use + * `Uint8Array` so that square bracket notation works as expected -- it returns + * a single octet. + * + * By augmenting the instances, we can avoid modifying the `Uint8Array` + * prototype. + */ +function Buffer (arg) { + if (!(this instanceof Buffer)) { + // Avoid going through an ArgumentsAdaptorTrampoline in the common case. + if (arguments.length > 1) return new Buffer(arg, arguments[1]) + return new Buffer(arg) + } + + this.length = 0 + this.parent = undefined + + // Common case. + if (typeof arg === 'number') { + return fromNumber(this, arg) + } + + // Slightly less common case. + if (typeof arg === 'string') { + return fromString(this, arg, arguments.length > 1 ? arguments[1] : 'utf8') + } + + // Unusual. + return fromObject(this, arg) +} + +function fromNumber (that, length) { + that = allocate(that, length < 0 ? 0 : checked(length) | 0) + if (!Buffer.TYPED_ARRAY_SUPPORT) { + for (var i = 0; i < length; i++) { + that[i] = 0 + } + } + return that +} + +function fromString (that, string, encoding) { + if (typeof encoding !== 'string' || encoding === '') encoding = 'utf8' + + // Assumption: byteLength() return value is always < kMaxLength. + var length = byteLength(string, encoding) | 0 + that = allocate(that, length) + + that.write(string, encoding) + return that +} + +function fromObject (that, object) { + if (Buffer.isBuffer(object)) return fromBuffer(that, object) + + if (isArray(object)) return fromArray(that, object) + + if (object == null) { + throw new TypeError('must start with number, buffer, array or string') + } + + if (typeof ArrayBuffer !== 'undefined' && object.buffer instanceof ArrayBuffer) { + return fromTypedArray(that, object) + } + + if (object.length) return fromArrayLike(that, object) + + return fromJsonObject(that, object) +} + +function fromBuffer (that, buffer) { + var length = checked(buffer.length) | 0 + that = allocate(that, length) + buffer.copy(that, 0, 0, length) + return that +} + +function fromArray (that, array) { + var length = checked(array.length) | 0 + that = allocate(that, length) + for (var i = 0; i < length; i += 1) { + that[i] = array[i] & 255 + } + return that +} + +// Duplicate of fromArray() to keep fromArray() monomorphic. +function fromTypedArray (that, array) { + var length = checked(array.length) | 0 + that = allocate(that, length) + // Truncating the elements is probably not what people expect from typed + // arrays with BYTES_PER_ELEMENT > 1 but it's compatible with the behavior + // of the old Buffer constructor. + for (var i = 0; i < length; i += 1) { + that[i] = array[i] & 255 + } + return that +} + +function fromArrayLike (that, array) { + var length = checked(array.length) | 0 + that = allocate(that, length) + for (var i = 0; i < length; i += 1) { + that[i] = array[i] & 255 + } + return that +} + +// Deserialize { type: 'Buffer', data: [1,2,3,...] } into a Buffer object. +// Returns a zero-length buffer for inputs that don't conform to the spec. +function fromJsonObject (that, object) { + var array + var length = 0 + + if (object.type === 'Buffer' && isArray(object.data)) { + array = object.data + length = checked(array.length) | 0 + } + that = allocate(that, length) + + for (var i = 0; i < length; i += 1) { + that[i] = array[i] & 255 + } + return that +} + +function allocate (that, length) { + if (Buffer.TYPED_ARRAY_SUPPORT) { + // Return an augmented `Uint8Array` instance, for best performance + that = Buffer._augment(new Uint8Array(length)) + } else { + // Fallback: Return an object instance of the Buffer class + that.length = length + that._isBuffer = true + } + + var fromPool = length !== 0 && length <= Buffer.poolSize >>> 1 + if (fromPool) that.parent = rootParent + + return that +} + +function checked (length) { + // Note: cannot use `length < kMaxLength` here because that fails when + // length is NaN (which is otherwise coerced to zero.) + if (length >= kMaxLength) { + throw new RangeError('Attempt to allocate Buffer larger than maximum ' + + 'size: 0x' + kMaxLength.toString(16) + ' bytes') + } + return length | 0 +} + +function SlowBuffer (subject, encoding) { + if (!(this instanceof SlowBuffer)) return new SlowBuffer(subject, encoding) + + var buf = new Buffer(subject, encoding) + delete buf.parent + return buf +} + +Buffer.isBuffer = function isBuffer (b) { + return !!(b != null && b._isBuffer) +} + +Buffer.compare = function compare (a, b) { + if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) { + throw new TypeError('Arguments must be Buffers') + } + + if (a === b) return 0 + + var x = a.length + var y = b.length + + var i = 0 + var len = Math.min(x, y) + while (i < len) { + if (a[i] !== b[i]) break + + ++i + } + + if (i !== len) { + x = a[i] + y = b[i] + } + + if (x < y) return -1 + if (y < x) return 1 + return 0 +} + +Buffer.isEncoding = function isEncoding (encoding) { + switch (String(encoding).toLowerCase()) { + case 'hex': + case 'utf8': + case 'utf-8': + case 'ascii': + case 'binary': + case 'base64': + case 'raw': + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return true + default: + return false + } +} + +Buffer.concat = function concat (list, length) { + if (!isArray(list)) throw new TypeError('list argument must be an Array of Buffers.') + + if (list.length === 0) { + return new Buffer(0) + } else if (list.length === 1) { + return list[0] + } + + var i + if (length === undefined) { + length = 0 + for (i = 0; i < list.length; i++) { + length += list[i].length + } + } + + var buf = new Buffer(length) + var pos = 0 + for (i = 0; i < list.length; i++) { + var item = list[i] + item.copy(buf, pos) + pos += item.length + } + return buf +} + +function byteLength (string, encoding) { + if (typeof string !== 'string') string = String(string) + + if (string.length === 0) return 0 + + switch (encoding || 'utf8') { + case 'ascii': + case 'binary': + case 'raw': + return string.length + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return string.length * 2 + case 'hex': + return string.length >>> 1 + case 'utf8': + case 'utf-8': + return utf8ToBytes(string).length + case 'base64': + return base64ToBytes(string).length + default: + return string.length + } +} +Buffer.byteLength = byteLength + +// pre-set for values that may exist in the future +Buffer.prototype.length = undefined +Buffer.prototype.parent = undefined + +// toString(encoding, start=0, end=buffer.length) +Buffer.prototype.toString = function toString (encoding, start, end) { + var loweredCase = false + + start = start | 0 + end = end === undefined || end === Infinity ? this.length : end | 0 + + if (!encoding) encoding = 'utf8' + if (start < 0) start = 0 + if (end > this.length) end = this.length + if (end <= start) return '' + + while (true) { + switch (encoding) { + case 'hex': + return hexSlice(this, start, end) + + case 'utf8': + case 'utf-8': + return utf8Slice(this, start, end) + + case 'ascii': + return asciiSlice(this, start, end) + + case 'binary': + return binarySlice(this, start, end) + + case 'base64': + return base64Slice(this, start, end) + + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return utf16leSlice(this, start, end) + + default: + if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding) + encoding = (encoding + '').toLowerCase() + loweredCase = true + } + } +} + +Buffer.prototype.equals = function equals (b) { + if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer') + if (this === b) return true + return Buffer.compare(this, b) === 0 +} + +Buffer.prototype.inspect = function inspect () { + var str = '' + var max = exports.INSPECT_MAX_BYTES + if (this.length > 0) { + str = this.toString('hex', 0, max).match(/.{2}/g).join(' ') + if (this.length > max) str += ' ... ' + } + return '' +} + +Buffer.prototype.compare = function compare (b) { + if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer') + if (this === b) return 0 + return Buffer.compare(this, b) +} + +Buffer.prototype.indexOf = function indexOf (val, byteOffset) { + if (byteOffset > 0x7fffffff) byteOffset = 0x7fffffff + else if (byteOffset < -0x80000000) byteOffset = -0x80000000 + byteOffset >>= 0 + + if (this.length === 0) return -1 + if (byteOffset >= this.length) return -1 + + // Negative offsets start from the end of the buffer + if (byteOffset < 0) byteOffset = Math.max(this.length + byteOffset, 0) + + if (typeof val === 'string') { + if (val.length === 0) return -1 // special case: looking for empty string always fails + return String.prototype.indexOf.call(this, val, byteOffset) + } + if (Buffer.isBuffer(val)) { + return arrayIndexOf(this, val, byteOffset) + } + if (typeof val === 'number') { + if (Buffer.TYPED_ARRAY_SUPPORT && Uint8Array.prototype.indexOf === 'function') { + return Uint8Array.prototype.indexOf.call(this, val, byteOffset) + } + return arrayIndexOf(this, [ val ], byteOffset) + } + + function arrayIndexOf (arr, val, byteOffset) { + var foundIndex = -1 + for (var i = 0; byteOffset + i < arr.length; i++) { + if (arr[byteOffset + i] === val[foundIndex === -1 ? 0 : i - foundIndex]) { + if (foundIndex === -1) foundIndex = i + if (i - foundIndex + 1 === val.length) return byteOffset + foundIndex + } else { + foundIndex = -1 + } + } + return -1 + } + + throw new TypeError('val must be string, number or Buffer') +} + +// `get` will be removed in Node 0.13+ +Buffer.prototype.get = function get (offset) { + console.log('.get() is deprecated. Access using array indexes instead.') + return this.readUInt8(offset) +} + +// `set` will be removed in Node 0.13+ +Buffer.prototype.set = function set (v, offset) { + console.log('.set() is deprecated. Access using array indexes instead.') + return this.writeUInt8(v, offset) +} + +function hexWrite (buf, string, offset, length) { + offset = Number(offset) || 0 + var remaining = buf.length - offset + if (!length) { + length = remaining + } else { + length = Number(length) + if (length > remaining) { + length = remaining + } + } + + // must be an even number of digits + var strLen = string.length + if (strLen % 2 !== 0) throw new Error('Invalid hex string') + + if (length > strLen / 2) { + length = strLen / 2 + } + for (var i = 0; i < length; i++) { + var parsed = parseInt(string.substr(i * 2, 2), 16) + if (isNaN(parsed)) throw new Error('Invalid hex string') + buf[offset + i] = parsed + } + return i +} + +function utf8Write (buf, string, offset, length) { + return blitBuffer(utf8ToBytes(string, buf.length - offset), buf, offset, length) +} + +function asciiWrite (buf, string, offset, length) { + return blitBuffer(asciiToBytes(string), buf, offset, length) +} + +function binaryWrite (buf, string, offset, length) { + return asciiWrite(buf, string, offset, length) +} + +function base64Write (buf, string, offset, length) { + return blitBuffer(base64ToBytes(string), buf, offset, length) +} + +function ucs2Write (buf, string, offset, length) { + return blitBuffer(utf16leToBytes(string, buf.length - offset), buf, offset, length) +} + +Buffer.prototype.write = function write (string, offset, length, encoding) { + // Buffer#write(string) + if (offset === undefined) { + encoding = 'utf8' + length = this.length + offset = 0 + // Buffer#write(string, encoding) + } else if (length === undefined && typeof offset === 'string') { + encoding = offset + length = this.length + offset = 0 + // Buffer#write(string, offset[, length][, encoding]) + } else if (isFinite(offset)) { + offset = offset | 0 + if (isFinite(length)) { + length = length | 0 + if (encoding === undefined) encoding = 'utf8' + } else { + encoding = length + length = undefined + } + // legacy write(string, encoding, offset, length) - remove in v0.13 + } else { + var swap = encoding + encoding = offset + offset = length | 0 + length = swap + } + + var remaining = this.length - offset + if (length === undefined || length > remaining) length = remaining + + if ((string.length > 0 && (length < 0 || offset < 0)) || offset > this.length) { + throw new RangeError('attempt to write outside buffer bounds') + } + + if (!encoding) encoding = 'utf8' + + var loweredCase = false + for (;;) { + switch (encoding) { + case 'hex': + return hexWrite(this, string, offset, length) + + case 'utf8': + case 'utf-8': + return utf8Write(this, string, offset, length) + + case 'ascii': + return asciiWrite(this, string, offset, length) + + case 'binary': + return binaryWrite(this, string, offset, length) + + case 'base64': + // Warning: maxLength not taken into account in base64Write + return base64Write(this, string, offset, length) + + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return ucs2Write(this, string, offset, length) + + default: + if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding) + encoding = ('' + encoding).toLowerCase() + loweredCase = true + } + } +} + +Buffer.prototype.toJSON = function toJSON () { + return { + type: 'Buffer', + data: Array.prototype.slice.call(this._arr || this, 0) + } +} + +function base64Slice (buf, start, end) { + if (start === 0 && end === buf.length) { + return base64.fromByteArray(buf) + } else { + return base64.fromByteArray(buf.slice(start, end)) + } +} + +function utf8Slice (buf, start, end) { + var res = '' + var tmp = '' + end = Math.min(buf.length, end) + + for (var i = start; i < end; i++) { + if (buf[i] <= 0x7F) { + res += decodeUtf8Char(tmp) + String.fromCharCode(buf[i]) + tmp = '' + } else { + tmp += '%' + buf[i].toString(16) + } + } + + return res + decodeUtf8Char(tmp) +} + +function asciiSlice (buf, start, end) { + var ret = '' + end = Math.min(buf.length, end) + + for (var i = start; i < end; i++) { + ret += String.fromCharCode(buf[i] & 0x7F) + } + return ret +} + +function binarySlice (buf, start, end) { + var ret = '' + end = Math.min(buf.length, end) + + for (var i = start; i < end; i++) { + ret += String.fromCharCode(buf[i]) + } + return ret +} + +function hexSlice (buf, start, end) { + var len = buf.length + + if (!start || start < 0) start = 0 + if (!end || end < 0 || end > len) end = len + + var out = '' + for (var i = start; i < end; i++) { + out += toHex(buf[i]) + } + return out +} + +function utf16leSlice (buf, start, end) { + var bytes = buf.slice(start, end) + var res = '' + for (var i = 0; i < bytes.length; i += 2) { + res += String.fromCharCode(bytes[i] + bytes[i + 1] * 256) + } + return res +} + +Buffer.prototype.slice = function slice (start, end) { + var len = this.length + start = ~~start + end = end === undefined ? len : ~~end + + if (start < 0) { + start += len + if (start < 0) start = 0 + } else if (start > len) { + start = len + } + + if (end < 0) { + end += len + if (end < 0) end = 0 + } else if (end > len) { + end = len + } + + if (end < start) end = start + + var newBuf + if (Buffer.TYPED_ARRAY_SUPPORT) { + newBuf = Buffer._augment(this.subarray(start, end)) + } else { + var sliceLen = end - start + newBuf = new Buffer(sliceLen, undefined) + for (var i = 0; i < sliceLen; i++) { + newBuf[i] = this[i + start] + } + } + + if (newBuf.length) newBuf.parent = this.parent || this + + return newBuf +} + +/* + * Need to make sure that buffer isn't trying to write out of bounds. + */ +function checkOffset (offset, ext, length) { + if ((offset % 1) !== 0 || offset < 0) throw new RangeError('offset is not uint') + if (offset + ext > length) throw new RangeError('Trying to access beyond buffer length') +} + +Buffer.prototype.readUIntLE = function readUIntLE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkOffset(offset, byteLength, this.length) + + var val = this[offset] + var mul = 1 + var i = 0 + while (++i < byteLength && (mul *= 0x100)) { + val += this[offset + i] * mul + } + + return val +} + +Buffer.prototype.readUIntBE = function readUIntBE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) { + checkOffset(offset, byteLength, this.length) + } + + var val = this[offset + --byteLength] + var mul = 1 + while (byteLength > 0 && (mul *= 0x100)) { + val += this[offset + --byteLength] * mul + } + + return val +} + +Buffer.prototype.readUInt8 = function readUInt8 (offset, noAssert) { + if (!noAssert) checkOffset(offset, 1, this.length) + return this[offset] +} + +Buffer.prototype.readUInt16LE = function readUInt16LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + return this[offset] | (this[offset + 1] << 8) +} + +Buffer.prototype.readUInt16BE = function readUInt16BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + return (this[offset] << 8) | this[offset + 1] +} + +Buffer.prototype.readUInt32LE = function readUInt32LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return ((this[offset]) | + (this[offset + 1] << 8) | + (this[offset + 2] << 16)) + + (this[offset + 3] * 0x1000000) +} + +Buffer.prototype.readUInt32BE = function readUInt32BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return (this[offset] * 0x1000000) + + ((this[offset + 1] << 16) | + (this[offset + 2] << 8) | + this[offset + 3]) +} + +Buffer.prototype.readIntLE = function readIntLE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkOffset(offset, byteLength, this.length) + + var val = this[offset] + var mul = 1 + var i = 0 + while (++i < byteLength && (mul *= 0x100)) { + val += this[offset + i] * mul + } + mul *= 0x80 + + if (val >= mul) val -= Math.pow(2, 8 * byteLength) + + return val +} + +Buffer.prototype.readIntBE = function readIntBE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkOffset(offset, byteLength, this.length) + + var i = byteLength + var mul = 1 + var val = this[offset + --i] + while (i > 0 && (mul *= 0x100)) { + val += this[offset + --i] * mul + } + mul *= 0x80 + + if (val >= mul) val -= Math.pow(2, 8 * byteLength) + + return val +} + +Buffer.prototype.readInt8 = function readInt8 (offset, noAssert) { + if (!noAssert) checkOffset(offset, 1, this.length) + if (!(this[offset] & 0x80)) return (this[offset]) + return ((0xff - this[offset] + 1) * -1) +} + +Buffer.prototype.readInt16LE = function readInt16LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + var val = this[offset] | (this[offset + 1] << 8) + return (val & 0x8000) ? val | 0xFFFF0000 : val +} + +Buffer.prototype.readInt16BE = function readInt16BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + var val = this[offset + 1] | (this[offset] << 8) + return (val & 0x8000) ? val | 0xFFFF0000 : val +} + +Buffer.prototype.readInt32LE = function readInt32LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return (this[offset]) | + (this[offset + 1] << 8) | + (this[offset + 2] << 16) | + (this[offset + 3] << 24) +} + +Buffer.prototype.readInt32BE = function readInt32BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return (this[offset] << 24) | + (this[offset + 1] << 16) | + (this[offset + 2] << 8) | + (this[offset + 3]) +} + +Buffer.prototype.readFloatLE = function readFloatLE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + return ieee754.read(this, offset, true, 23, 4) +} + +Buffer.prototype.readFloatBE = function readFloatBE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + return ieee754.read(this, offset, false, 23, 4) +} + +Buffer.prototype.readDoubleLE = function readDoubleLE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 8, this.length) + return ieee754.read(this, offset, true, 52, 8) +} + +Buffer.prototype.readDoubleBE = function readDoubleBE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 8, this.length) + return ieee754.read(this, offset, false, 52, 8) +} + +function checkInt (buf, value, offset, ext, max, min) { + if (!Buffer.isBuffer(buf)) throw new TypeError('buffer must be a Buffer instance') + if (value > max || value < min) throw new RangeError('value is out of bounds') + if (offset + ext > buf.length) throw new RangeError('index out of range') +} + +Buffer.prototype.writeUIntLE = function writeUIntLE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkInt(this, value, offset, byteLength, Math.pow(2, 8 * byteLength), 0) + + var mul = 1 + var i = 0 + this[offset] = value & 0xFF + while (++i < byteLength && (mul *= 0x100)) { + this[offset + i] = (value / mul) & 0xFF + } + + return offset + byteLength +} + +Buffer.prototype.writeUIntBE = function writeUIntBE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkInt(this, value, offset, byteLength, Math.pow(2, 8 * byteLength), 0) + + var i = byteLength - 1 + var mul = 1 + this[offset + i] = value & 0xFF + while (--i >= 0 && (mul *= 0x100)) { + this[offset + i] = (value / mul) & 0xFF + } + + return offset + byteLength +} + +Buffer.prototype.writeUInt8 = function writeUInt8 (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 1, 0xff, 0) + if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value) + this[offset] = value + return offset + 1 +} + +function objectWriteUInt16 (buf, value, offset, littleEndian) { + if (value < 0) value = 0xffff + value + 1 + for (var i = 0, j = Math.min(buf.length - offset, 2); i < j; i++) { + buf[offset + i] = (value & (0xff << (8 * (littleEndian ? i : 1 - i)))) >>> + (littleEndian ? i : 1 - i) * 8 + } +} + +Buffer.prototype.writeUInt16LE = function writeUInt16LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = value + this[offset + 1] = (value >>> 8) + } else { + objectWriteUInt16(this, value, offset, true) + } + return offset + 2 +} + +Buffer.prototype.writeUInt16BE = function writeUInt16BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 8) + this[offset + 1] = value + } else { + objectWriteUInt16(this, value, offset, false) + } + return offset + 2 +} + +function objectWriteUInt32 (buf, value, offset, littleEndian) { + if (value < 0) value = 0xffffffff + value + 1 + for (var i = 0, j = Math.min(buf.length - offset, 4); i < j; i++) { + buf[offset + i] = (value >>> (littleEndian ? i : 3 - i) * 8) & 0xff + } +} + +Buffer.prototype.writeUInt32LE = function writeUInt32LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset + 3] = (value >>> 24) + this[offset + 2] = (value >>> 16) + this[offset + 1] = (value >>> 8) + this[offset] = value + } else { + objectWriteUInt32(this, value, offset, true) + } + return offset + 4 +} + +Buffer.prototype.writeUInt32BE = function writeUInt32BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 24) + this[offset + 1] = (value >>> 16) + this[offset + 2] = (value >>> 8) + this[offset + 3] = value + } else { + objectWriteUInt32(this, value, offset, false) + } + return offset + 4 +} + +Buffer.prototype.writeIntLE = function writeIntLE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) { + var limit = Math.pow(2, 8 * byteLength - 1) + + checkInt(this, value, offset, byteLength, limit - 1, -limit) + } + + var i = 0 + var mul = 1 + var sub = value < 0 ? 1 : 0 + this[offset] = value & 0xFF + while (++i < byteLength && (mul *= 0x100)) { + this[offset + i] = ((value / mul) >> 0) - sub & 0xFF + } + + return offset + byteLength +} + +Buffer.prototype.writeIntBE = function writeIntBE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) { + var limit = Math.pow(2, 8 * byteLength - 1) + + checkInt(this, value, offset, byteLength, limit - 1, -limit) + } + + var i = byteLength - 1 + var mul = 1 + var sub = value < 0 ? 1 : 0 + this[offset + i] = value & 0xFF + while (--i >= 0 && (mul *= 0x100)) { + this[offset + i] = ((value / mul) >> 0) - sub & 0xFF + } + + return offset + byteLength +} + +Buffer.prototype.writeInt8 = function writeInt8 (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 1, 0x7f, -0x80) + if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value) + if (value < 0) value = 0xff + value + 1 + this[offset] = value + return offset + 1 +} + +Buffer.prototype.writeInt16LE = function writeInt16LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = value + this[offset + 1] = (value >>> 8) + } else { + objectWriteUInt16(this, value, offset, true) + } + return offset + 2 +} + +Buffer.prototype.writeInt16BE = function writeInt16BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 8) + this[offset + 1] = value + } else { + objectWriteUInt16(this, value, offset, false) + } + return offset + 2 +} + +Buffer.prototype.writeInt32LE = function writeInt32LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = value + this[offset + 1] = (value >>> 8) + this[offset + 2] = (value >>> 16) + this[offset + 3] = (value >>> 24) + } else { + objectWriteUInt32(this, value, offset, true) + } + return offset + 4 +} + +Buffer.prototype.writeInt32BE = function writeInt32BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000) + if (value < 0) value = 0xffffffff + value + 1 + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 24) + this[offset + 1] = (value >>> 16) + this[offset + 2] = (value >>> 8) + this[offset + 3] = value + } else { + objectWriteUInt32(this, value, offset, false) + } + return offset + 4 +} + +function checkIEEE754 (buf, value, offset, ext, max, min) { + if (value > max || value < min) throw new RangeError('value is out of bounds') + if (offset + ext > buf.length) throw new RangeError('index out of range') + if (offset < 0) throw new RangeError('index out of range') +} + +function writeFloat (buf, value, offset, littleEndian, noAssert) { + if (!noAssert) { + checkIEEE754(buf, value, offset, 4, 3.4028234663852886e+38, -3.4028234663852886e+38) + } + ieee754.write(buf, value, offset, littleEndian, 23, 4) + return offset + 4 +} + +Buffer.prototype.writeFloatLE = function writeFloatLE (value, offset, noAssert) { + return writeFloat(this, value, offset, true, noAssert) +} + +Buffer.prototype.writeFloatBE = function writeFloatBE (value, offset, noAssert) { + return writeFloat(this, value, offset, false, noAssert) +} + +function writeDouble (buf, value, offset, littleEndian, noAssert) { + if (!noAssert) { + checkIEEE754(buf, value, offset, 8, 1.7976931348623157E+308, -1.7976931348623157E+308) + } + ieee754.write(buf, value, offset, littleEndian, 52, 8) + return offset + 8 +} + +Buffer.prototype.writeDoubleLE = function writeDoubleLE (value, offset, noAssert) { + return writeDouble(this, value, offset, true, noAssert) +} + +Buffer.prototype.writeDoubleBE = function writeDoubleBE (value, offset, noAssert) { + return writeDouble(this, value, offset, false, noAssert) +} + +// copy(targetBuffer, targetStart=0, sourceStart=0, sourceEnd=buffer.length) +Buffer.prototype.copy = function copy (target, targetStart, start, end) { + if (!start) start = 0 + if (!end && end !== 0) end = this.length + if (targetStart >= target.length) targetStart = target.length + if (!targetStart) targetStart = 0 + if (end > 0 && end < start) end = start + + // Copy 0 bytes; we're done + if (end === start) return 0 + if (target.length === 0 || this.length === 0) return 0 + + // Fatal error conditions + if (targetStart < 0) { + throw new RangeError('targetStart out of bounds') + } + if (start < 0 || start >= this.length) throw new RangeError('sourceStart out of bounds') + if (end < 0) throw new RangeError('sourceEnd out of bounds') + + // Are we oob? + if (end > this.length) end = this.length + if (target.length - targetStart < end - start) { + end = target.length - targetStart + start + } + + var len = end - start + + if (len < 1000 || !Buffer.TYPED_ARRAY_SUPPORT) { + for (var i = 0; i < len; i++) { + target[i + targetStart] = this[i + start] + } + } else { + target._set(this.subarray(start, start + len), targetStart) + } + + return len +} + +// fill(value, start=0, end=buffer.length) +Buffer.prototype.fill = function fill (value, start, end) { + if (!value) value = 0 + if (!start) start = 0 + if (!end) end = this.length + + if (end < start) throw new RangeError('end < start') + + // Fill 0 bytes; we're done + if (end === start) return + if (this.length === 0) return + + if (start < 0 || start >= this.length) throw new RangeError('start out of bounds') + if (end < 0 || end > this.length) throw new RangeError('end out of bounds') + + var i + if (typeof value === 'number') { + for (i = start; i < end; i++) { + this[i] = value + } + } else { + var bytes = utf8ToBytes(value.toString()) + var len = bytes.length + for (i = start; i < end; i++) { + this[i] = bytes[i % len] + } + } + + return this +} + +/** + * Creates a new `ArrayBuffer` with the *copied* memory of the buffer instance. + * Added in Node 0.12. Only available in browsers that support ArrayBuffer. + */ +Buffer.prototype.toArrayBuffer = function toArrayBuffer () { + if (typeof Uint8Array !== 'undefined') { + if (Buffer.TYPED_ARRAY_SUPPORT) { + return (new Buffer(this)).buffer + } else { + var buf = new Uint8Array(this.length) + for (var i = 0, len = buf.length; i < len; i += 1) { + buf[i] = this[i] + } + return buf.buffer + } + } else { + throw new TypeError('Buffer.toArrayBuffer not supported in this browser') + } +} + +// HELPER FUNCTIONS +// ================ + +var BP = Buffer.prototype + +/** + * Augment a Uint8Array *instance* (not the Uint8Array class!) with Buffer methods + */ +Buffer._augment = function _augment (arr) { + arr.constructor = Buffer + arr._isBuffer = true + + // save reference to original Uint8Array set method before overwriting + arr._set = arr.set + + // deprecated, will be removed in node 0.13+ + arr.get = BP.get + arr.set = BP.set + + arr.write = BP.write + arr.toString = BP.toString + arr.toLocaleString = BP.toString + arr.toJSON = BP.toJSON + arr.equals = BP.equals + arr.compare = BP.compare + arr.indexOf = BP.indexOf + arr.copy = BP.copy + arr.slice = BP.slice + arr.readUIntLE = BP.readUIntLE + arr.readUIntBE = BP.readUIntBE + arr.readUInt8 = BP.readUInt8 + arr.readUInt16LE = BP.readUInt16LE + arr.readUInt16BE = BP.readUInt16BE + arr.readUInt32LE = BP.readUInt32LE + arr.readUInt32BE = BP.readUInt32BE + arr.readIntLE = BP.readIntLE + arr.readIntBE = BP.readIntBE + arr.readInt8 = BP.readInt8 + arr.readInt16LE = BP.readInt16LE + arr.readInt16BE = BP.readInt16BE + arr.readInt32LE = BP.readInt32LE + arr.readInt32BE = BP.readInt32BE + arr.readFloatLE = BP.readFloatLE + arr.readFloatBE = BP.readFloatBE + arr.readDoubleLE = BP.readDoubleLE + arr.readDoubleBE = BP.readDoubleBE + arr.writeUInt8 = BP.writeUInt8 + arr.writeUIntLE = BP.writeUIntLE + arr.writeUIntBE = BP.writeUIntBE + arr.writeUInt16LE = BP.writeUInt16LE + arr.writeUInt16BE = BP.writeUInt16BE + arr.writeUInt32LE = BP.writeUInt32LE + arr.writeUInt32BE = BP.writeUInt32BE + arr.writeIntLE = BP.writeIntLE + arr.writeIntBE = BP.writeIntBE + arr.writeInt8 = BP.writeInt8 + arr.writeInt16LE = BP.writeInt16LE + arr.writeInt16BE = BP.writeInt16BE + arr.writeInt32LE = BP.writeInt32LE + arr.writeInt32BE = BP.writeInt32BE + arr.writeFloatLE = BP.writeFloatLE + arr.writeFloatBE = BP.writeFloatBE + arr.writeDoubleLE = BP.writeDoubleLE + arr.writeDoubleBE = BP.writeDoubleBE + arr.fill = BP.fill + arr.inspect = BP.inspect + arr.toArrayBuffer = BP.toArrayBuffer + + return arr +} + +var INVALID_BASE64_RE = /[^+\/0-9A-z\-]/g + +function base64clean (str) { + // Node strips out invalid characters like \n and \t from the string, base64-js does not + str = stringtrim(str).replace(INVALID_BASE64_RE, '') + // Node converts strings with length < 2 to '' + if (str.length < 2) return '' + // Node allows for non-padded base64 strings (missing trailing ===), base64-js does not + while (str.length % 4 !== 0) { + str = str + '=' + } + return str +} + +function stringtrim (str) { + if (str.trim) return str.trim() + return str.replace(/^\s+|\s+$/g, '') +} + +function toHex (n) { + if (n < 16) return '0' + n.toString(16) + return n.toString(16) +} + +function utf8ToBytes (string, units) { + units = units || Infinity + var codePoint + var length = string.length + var leadSurrogate = null + var bytes = [] + var i = 0 + + for (; i < length; i++) { + codePoint = string.charCodeAt(i) + + // is surrogate component + if (codePoint > 0xD7FF && codePoint < 0xE000) { + // last char was a lead + if (leadSurrogate) { + // 2 leads in a row + if (codePoint < 0xDC00) { + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + leadSurrogate = codePoint + continue + } else { + // valid surrogate pair + codePoint = leadSurrogate - 0xD800 << 10 | codePoint - 0xDC00 | 0x10000 + leadSurrogate = null + } + } else { + // no lead yet + + if (codePoint > 0xDBFF) { + // unexpected trail + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + continue + } else if (i + 1 === length) { + // unpaired lead + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + continue + } else { + // valid lead + leadSurrogate = codePoint + continue + } + } + } else if (leadSurrogate) { + // valid bmp char, but last char was a lead + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + leadSurrogate = null + } + + // encode utf8 + if (codePoint < 0x80) { + if ((units -= 1) < 0) break + bytes.push(codePoint) + } else if (codePoint < 0x800) { + if ((units -= 2) < 0) break + bytes.push( + codePoint >> 0x6 | 0xC0, + codePoint & 0x3F | 0x80 + ) + } else if (codePoint < 0x10000) { + if ((units -= 3) < 0) break + bytes.push( + codePoint >> 0xC | 0xE0, + codePoint >> 0x6 & 0x3F | 0x80, + codePoint & 0x3F | 0x80 + ) + } else if (codePoint < 0x200000) { + if ((units -= 4) < 0) break + bytes.push( + codePoint >> 0x12 | 0xF0, + codePoint >> 0xC & 0x3F | 0x80, + codePoint >> 0x6 & 0x3F | 0x80, + codePoint & 0x3F | 0x80 + ) + } else { + throw new Error('Invalid code point') + } + } + + return bytes +} + +function asciiToBytes (str) { + var byteArray = [] + for (var i = 0; i < str.length; i++) { + // Node's code seems to be doing this and not & 0x7F.. + byteArray.push(str.charCodeAt(i) & 0xFF) + } + return byteArray +} + +function utf16leToBytes (str, units) { + var c, hi, lo + var byteArray = [] + for (var i = 0; i < str.length; i++) { + if ((units -= 2) < 0) break + + c = str.charCodeAt(i) + hi = c >> 8 + lo = c % 256 + byteArray.push(lo) + byteArray.push(hi) + } + + return byteArray +} + +function base64ToBytes (str) { + return base64.toByteArray(base64clean(str)) +} + +function blitBuffer (src, dst, offset, length) { + for (var i = 0; i < length; i++) { + if ((i + offset >= dst.length) || (i >= src.length)) break + dst[i + offset] = src[i] + } + return i +} + +function decodeUtf8Char (str) { + try { + return decodeURIComponent(str) + } catch (err) { + return String.fromCharCode(0xFFFD) // UTF 8 invalid char + } +} + +},{"base64-js":39,"ieee754":40,"is-array":41}],39:[function(require,module,exports){ +var lookup = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; + +;(function (exports) { + 'use strict'; + + var Arr = (typeof Uint8Array !== 'undefined') + ? Uint8Array + : Array + + var PLUS = '+'.charCodeAt(0) + var SLASH = '/'.charCodeAt(0) + var NUMBER = '0'.charCodeAt(0) + var LOWER = 'a'.charCodeAt(0) + var UPPER = 'A'.charCodeAt(0) + var PLUS_URL_SAFE = '-'.charCodeAt(0) + var SLASH_URL_SAFE = '_'.charCodeAt(0) + + function decode (elt) { + var code = elt.charCodeAt(0) + if (code === PLUS || + code === PLUS_URL_SAFE) + return 62 // '+' + if (code === SLASH || + code === SLASH_URL_SAFE) + return 63 // '/' + if (code < NUMBER) + return -1 //no match + if (code < NUMBER + 10) + return code - NUMBER + 26 + 26 + if (code < UPPER + 26) + return code - UPPER + if (code < LOWER + 26) + return code - LOWER + 26 + } + + function b64ToByteArray (b64) { + var i, j, l, tmp, placeHolders, arr + + if (b64.length % 4 > 0) { + throw new Error('Invalid string. Length must be a multiple of 4') + } + + // the number of equal signs (place holders) + // if there are two placeholders, than the two characters before it + // represent one byte + // if there is only one, then the three characters before it represent 2 bytes + // this is just a cheap hack to not do indexOf twice + var len = b64.length + placeHolders = '=' === b64.charAt(len - 2) ? 2 : '=' === b64.charAt(len - 1) ? 1 : 0 + + // base64 is 4/3 + up to two characters of the original data + arr = new Arr(b64.length * 3 / 4 - placeHolders) + + // if there are placeholders, only get up to the last complete 4 chars + l = placeHolders > 0 ? b64.length - 4 : b64.length + + var L = 0 + + function push (v) { + arr[L++] = v + } + + for (i = 0, j = 0; i < l; i += 4, j += 3) { + tmp = (decode(b64.charAt(i)) << 18) | (decode(b64.charAt(i + 1)) << 12) | (decode(b64.charAt(i + 2)) << 6) | decode(b64.charAt(i + 3)) + push((tmp & 0xFF0000) >> 16) + push((tmp & 0xFF00) >> 8) + push(tmp & 0xFF) + } + + if (placeHolders === 2) { + tmp = (decode(b64.charAt(i)) << 2) | (decode(b64.charAt(i + 1)) >> 4) + push(tmp & 0xFF) + } else if (placeHolders === 1) { + tmp = (decode(b64.charAt(i)) << 10) | (decode(b64.charAt(i + 1)) << 4) | (decode(b64.charAt(i + 2)) >> 2) + push((tmp >> 8) & 0xFF) + push(tmp & 0xFF) + } + + return arr + } + + function uint8ToBase64 (uint8) { + var i, + extraBytes = uint8.length % 3, // if we have 1 byte left, pad 2 bytes + output = "", + temp, length + + function encode (num) { + return lookup.charAt(num) + } + + function tripletToBase64 (num) { + return encode(num >> 18 & 0x3F) + encode(num >> 12 & 0x3F) + encode(num >> 6 & 0x3F) + encode(num & 0x3F) + } + + // go through the array every three bytes, we'll deal with trailing stuff later + for (i = 0, length = uint8.length - extraBytes; i < length; i += 3) { + temp = (uint8[i] << 16) + (uint8[i + 1] << 8) + (uint8[i + 2]) + output += tripletToBase64(temp) + } + + // pad the end with zeros, but make sure to not forget the extra bytes + switch (extraBytes) { + case 1: + temp = uint8[uint8.length - 1] + output += encode(temp >> 2) + output += encode((temp << 4) & 0x3F) + output += '==' + break + case 2: + temp = (uint8[uint8.length - 2] << 8) + (uint8[uint8.length - 1]) + output += encode(temp >> 10) + output += encode((temp >> 4) & 0x3F) + output += encode((temp << 2) & 0x3F) + output += '=' + break + } + + return output + } + + exports.toByteArray = b64ToByteArray + exports.fromByteArray = uint8ToBase64 +}(typeof exports === 'undefined' ? (this.base64js = {}) : exports)) + +},{}],40:[function(require,module,exports){ +exports.read = function(buffer, offset, isLE, mLen, nBytes) { + var e, m, + eLen = nBytes * 8 - mLen - 1, + eMax = (1 << eLen) - 1, + eBias = eMax >> 1, + nBits = -7, + i = isLE ? (nBytes - 1) : 0, + d = isLE ? -1 : 1, + s = buffer[offset + i]; + + i += d; + + e = s & ((1 << (-nBits)) - 1); + s >>= (-nBits); + nBits += eLen; + for (; nBits > 0; e = e * 256 + buffer[offset + i], i += d, nBits -= 8); + + m = e & ((1 << (-nBits)) - 1); + e >>= (-nBits); + nBits += mLen; + for (; nBits > 0; m = m * 256 + buffer[offset + i], i += d, nBits -= 8); + + if (e === 0) { + e = 1 - eBias; + } else if (e === eMax) { + return m ? NaN : ((s ? -1 : 1) * Infinity); + } else { + m = m + Math.pow(2, mLen); + e = e - eBias; + } + return (s ? -1 : 1) * m * Math.pow(2, e - mLen); +}; + +exports.write = function(buffer, value, offset, isLE, mLen, nBytes) { + var e, m, c, + eLen = nBytes * 8 - mLen - 1, + eMax = (1 << eLen) - 1, + eBias = eMax >> 1, + rt = (mLen === 23 ? Math.pow(2, -24) - Math.pow(2, -77) : 0), + i = isLE ? 0 : (nBytes - 1), + d = isLE ? 1 : -1, + s = value < 0 || (value === 0 && 1 / value < 0) ? 1 : 0; + + value = Math.abs(value); + + if (isNaN(value) || value === Infinity) { + m = isNaN(value) ? 1 : 0; + e = eMax; + } else { + e = Math.floor(Math.log(value) / Math.LN2); + if (value * (c = Math.pow(2, -e)) < 1) { + e--; + c *= 2; + } + if (e + eBias >= 1) { + value += rt / c; + } else { + value += rt * Math.pow(2, 1 - eBias); + } + if (value * c >= 2) { + e++; + c /= 2; + } + + if (e + eBias >= eMax) { + m = 0; + e = eMax; + } else if (e + eBias >= 1) { + m = (value * c - 1) * Math.pow(2, mLen); + e = e + eBias; + } else { + m = value * Math.pow(2, eBias - 1) * Math.pow(2, mLen); + e = 0; + } + } + + for (; mLen >= 8; buffer[offset + i] = m & 0xff, i += d, m /= 256, mLen -= 8); + + e = (e << mLen) | m; + eLen += mLen; + for (; eLen > 0; buffer[offset + i] = e & 0xff, i += d, e /= 256, eLen -= 8); + + buffer[offset + i - d] |= s * 128; +}; + +},{}],41:[function(require,module,exports){ + +/** + * isArray + */ + +var isArray = Array.isArray; + +/** + * toString + */ + +var str = Object.prototype.toString; + +/** + * Whether or not the given `val` + * is an array. + * + * example: + * + * isArray([]); + * // > true + * isArray(arguments); + * // > false + * isArray(''); + * // > false + * + * @param {mixed} val + * @return {bool} + */ + +module.exports = isArray || function (val) { + return !! val && '[object Array]' == str.call(val); +}; + +},{}],42:[function(require,module,exports){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +function EventEmitter() { + this._events = this._events || {}; + this._maxListeners = this._maxListeners || undefined; +} +module.exports = EventEmitter; + +// Backwards-compat with node 0.10.x +EventEmitter.EventEmitter = EventEmitter; + +EventEmitter.prototype._events = undefined; +EventEmitter.prototype._maxListeners = undefined; + +// By default EventEmitters will print a warning if more than 10 listeners are +// added to it. This is a useful default which helps finding memory leaks. +EventEmitter.defaultMaxListeners = 10; + +// Obviously not all Emitters should be limited to 10. This function allows +// that to be increased. Set to zero for unlimited. +EventEmitter.prototype.setMaxListeners = function(n) { + if (!isNumber(n) || n < 0 || isNaN(n)) + throw TypeError('n must be a positive number'); + this._maxListeners = n; + return this; +}; + +EventEmitter.prototype.emit = function(type) { + var er, handler, len, args, i, listeners; + + if (!this._events) + this._events = {}; + + // If there is no 'error' event listener then throw. + if (type === 'error') { + if (!this._events.error || + (isObject(this._events.error) && !this._events.error.length)) { + er = arguments[1]; + if (er instanceof Error) { + throw er; // Unhandled 'error' event + } + throw TypeError('Uncaught, unspecified "error" event.'); + } + } + + handler = this._events[type]; + + if (isUndefined(handler)) + return false; + + if (isFunction(handler)) { + switch (arguments.length) { + // fast cases + case 1: + handler.call(this); + break; + case 2: + handler.call(this, arguments[1]); + break; + case 3: + handler.call(this, arguments[1], arguments[2]); + break; + // slower + default: + len = arguments.length; + args = new Array(len - 1); + for (i = 1; i < len; i++) + args[i - 1] = arguments[i]; + handler.apply(this, args); + } + } else if (isObject(handler)) { + len = arguments.length; + args = new Array(len - 1); + for (i = 1; i < len; i++) + args[i - 1] = arguments[i]; + + listeners = handler.slice(); + len = listeners.length; + for (i = 0; i < len; i++) + listeners[i].apply(this, args); + } + + return true; +}; + +EventEmitter.prototype.addListener = function(type, listener) { + var m; + + if (!isFunction(listener)) + throw TypeError('listener must be a function'); + + if (!this._events) + this._events = {}; + + // To avoid recursion in the case that type === "newListener"! Before + // adding it to the listeners, first emit "newListener". + if (this._events.newListener) + this.emit('newListener', type, + isFunction(listener.listener) ? + listener.listener : listener); + + if (!this._events[type]) + // Optimize the case of one listener. Don't need the extra array object. + this._events[type] = listener; + else if (isObject(this._events[type])) + // If we've already got an array, just append. + this._events[type].push(listener); + else + // Adding the second element, need to change to array. + this._events[type] = [this._events[type], listener]; + + // Check for listener leak + if (isObject(this._events[type]) && !this._events[type].warned) { + var m; + if (!isUndefined(this._maxListeners)) { + m = this._maxListeners; + } else { + m = EventEmitter.defaultMaxListeners; + } + + if (m && m > 0 && this._events[type].length > m) { + this._events[type].warned = true; + console.error('(node) warning: possible EventEmitter memory ' + + 'leak detected. %d listeners added. ' + + 'Use emitter.setMaxListeners() to increase limit.', + this._events[type].length); + if (typeof console.trace === 'function') { + // not supported in IE 10 + console.trace(); + } + } + } + + return this; +}; + +EventEmitter.prototype.on = EventEmitter.prototype.addListener; + +EventEmitter.prototype.once = function(type, listener) { + if (!isFunction(listener)) + throw TypeError('listener must be a function'); + + var fired = false; + + function g() { + this.removeListener(type, g); + + if (!fired) { + fired = true; + listener.apply(this, arguments); + } + } + + g.listener = listener; + this.on(type, g); + + return this; +}; + +// emits a 'removeListener' event iff the listener was removed +EventEmitter.prototype.removeListener = function(type, listener) { + var list, position, length, i; + + if (!isFunction(listener)) + throw TypeError('listener must be a function'); + + if (!this._events || !this._events[type]) + return this; + + list = this._events[type]; + length = list.length; + position = -1; + + if (list === listener || + (isFunction(list.listener) && list.listener === listener)) { + delete this._events[type]; + if (this._events.removeListener) + this.emit('removeListener', type, listener); + + } else if (isObject(list)) { + for (i = length; i-- > 0;) { + if (list[i] === listener || + (list[i].listener && list[i].listener === listener)) { + position = i; + break; + } + } + + if (position < 0) + return this; + + if (list.length === 1) { + list.length = 0; + delete this._events[type]; + } else { + list.splice(position, 1); + } + + if (this._events.removeListener) + this.emit('removeListener', type, listener); + } + + return this; +}; + +EventEmitter.prototype.removeAllListeners = function(type) { + var key, listeners; + + if (!this._events) + return this; + + // not listening for removeListener, no need to emit + if (!this._events.removeListener) { + if (arguments.length === 0) + this._events = {}; + else if (this._events[type]) + delete this._events[type]; + return this; + } + + // emit removeListener for all listeners on all events + if (arguments.length === 0) { + for (key in this._events) { + if (key === 'removeListener') continue; + this.removeAllListeners(key); + } + this.removeAllListeners('removeListener'); + this._events = {}; + return this; + } + + listeners = this._events[type]; + + if (isFunction(listeners)) { + this.removeListener(type, listeners); + } else { + // LIFO order + while (listeners.length) + this.removeListener(type, listeners[listeners.length - 1]); + } + delete this._events[type]; + + return this; +}; + +EventEmitter.prototype.listeners = function(type) { + var ret; + if (!this._events || !this._events[type]) + ret = []; + else if (isFunction(this._events[type])) + ret = [this._events[type]]; + else + ret = this._events[type].slice(); + return ret; +}; + +EventEmitter.listenerCount = function(emitter, type) { + var ret; + if (!emitter._events || !emitter._events[type]) + ret = 0; + else if (isFunction(emitter._events[type])) + ret = 1; + else + ret = emitter._events[type].length; + return ret; +}; + +function isFunction(arg) { + return typeof arg === 'function'; +} + +function isNumber(arg) { + return typeof arg === 'number'; +} + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} + +function isUndefined(arg) { + return arg === void 0; +} + +},{}],43:[function(require,module,exports){ +arguments[4][10][0].apply(exports,arguments) +},{"dup":10}],44:[function(require,module,exports){ +arguments[4][24][0].apply(exports,arguments) +},{"dup":24}],45:[function(require,module,exports){ +// shim for using process in browser + +var process = module.exports = {}; +var queue = []; +var draining = false; + +function drainQueue() { + if (draining) { + return; + } + draining = true; + var currentQueue; + var len = queue.length; + while(len) { + currentQueue = queue; + queue = []; + var i = -1; + while (++i < len) { + currentQueue[i](); + } + len = queue.length; + } + draining = false; +} +process.nextTick = function (fun) { + queue.push(fun); + if (!draining) { + setTimeout(drainQueue, 0); + } +}; + +process.title = 'browser'; +process.browser = true; +process.env = {}; +process.argv = []; +process.version = ''; // empty string to avoid regexp issues +process.versions = {}; + +function noop() {} + +process.on = noop; +process.addListener = noop; +process.once = noop; +process.off = noop; +process.removeListener = noop; +process.removeAllListeners = noop; +process.emit = noop; + +process.binding = function (name) { + throw new Error('process.binding is not supported'); +}; + +// TODO(shtylman) +process.cwd = function () { return '/' }; +process.chdir = function (dir) { + throw new Error('process.chdir is not supported'); +}; +process.umask = function() { return 0; }; + +},{}],46:[function(require,module,exports){ +(function (global){ +/*! http://mths.be/punycode v1.2.4 by @mathias */ +;(function(root) { + + /** Detect free variables */ + var freeExports = typeof exports == 'object' && exports; + var freeModule = typeof module == 'object' && module && + module.exports == freeExports && module; + var freeGlobal = typeof global == 'object' && global; + if (freeGlobal.global === freeGlobal || freeGlobal.window === freeGlobal) { + root = freeGlobal; + } + + /** + * The `punycode` object. + * @name punycode + * @type Object + */ + var punycode, + + /** Highest positive signed 32-bit float value */ + maxInt = 2147483647, // aka. 0x7FFFFFFF or 2^31-1 + + /** Bootstring parameters */ + base = 36, + tMin = 1, + tMax = 26, + skew = 38, + damp = 700, + initialBias = 72, + initialN = 128, // 0x80 + delimiter = '-', // '\x2D' + + /** Regular expressions */ + regexPunycode = /^xn--/, + regexNonASCII = /[^ -~]/, // unprintable ASCII chars + non-ASCII chars + regexSeparators = /\x2E|\u3002|\uFF0E|\uFF61/g, // RFC 3490 separators + + /** Error messages */ + errors = { + 'overflow': 'Overflow: input needs wider integers to process', + 'not-basic': 'Illegal input >= 0x80 (not a basic code point)', + 'invalid-input': 'Invalid input' + }, + + /** Convenience shortcuts */ + baseMinusTMin = base - tMin, + floor = Math.floor, + stringFromCharCode = String.fromCharCode, + + /** Temporary variable */ + key; + + /*--------------------------------------------------------------------------*/ + + /** + * A generic error utility function. + * @private + * @param {String} type The error type. + * @returns {Error} Throws a `RangeError` with the applicable error message. + */ + function error(type) { + throw RangeError(errors[type]); + } + + /** + * A generic `Array#map` utility function. + * @private + * @param {Array} array The array to iterate over. + * @param {Function} callback The function that gets called for every array + * item. + * @returns {Array} A new array of values returned by the callback function. + */ + function map(array, fn) { + var length = array.length; + while (length--) { + array[length] = fn(array[length]); + } + return array; + } + + /** + * A simple `Array#map`-like wrapper to work with domain name strings. + * @private + * @param {String} domain The domain name. + * @param {Function} callback The function that gets called for every + * character. + * @returns {Array} A new string of characters returned by the callback + * function. + */ + function mapDomain(string, fn) { + return map(string.split(regexSeparators), fn).join('.'); + } + + /** + * Creates an array containing the numeric code points of each Unicode + * character in the string. While JavaScript uses UCS-2 internally, + * this function will convert a pair of surrogate halves (each of which + * UCS-2 exposes as separate characters) into a single code point, + * matching UTF-16. + * @see `punycode.ucs2.encode` + * @see + * @memberOf punycode.ucs2 + * @name decode + * @param {String} string The Unicode input string (UCS-2). + * @returns {Array} The new array of code points. + */ + function ucs2decode(string) { + var output = [], + counter = 0, + length = string.length, + value, + extra; + while (counter < length) { + value = string.charCodeAt(counter++); + if (value >= 0xD800 && value <= 0xDBFF && counter < length) { + // high surrogate, and there is a next character + extra = string.charCodeAt(counter++); + if ((extra & 0xFC00) == 0xDC00) { // low surrogate + output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000); + } else { + // unmatched surrogate; only append this code unit, in case the next + // code unit is the high surrogate of a surrogate pair + output.push(value); + counter--; + } + } else { + output.push(value); + } + } + return output; + } + + /** + * Creates a string based on an array of numeric code points. + * @see `punycode.ucs2.decode` + * @memberOf punycode.ucs2 + * @name encode + * @param {Array} codePoints The array of numeric code points. + * @returns {String} The new Unicode string (UCS-2). + */ + function ucs2encode(array) { + return map(array, function(value) { + var output = ''; + if (value > 0xFFFF) { + value -= 0x10000; + output += stringFromCharCode(value >>> 10 & 0x3FF | 0xD800); + value = 0xDC00 | value & 0x3FF; + } + output += stringFromCharCode(value); + return output; + }).join(''); + } + + /** + * Converts a basic code point into a digit/integer. + * @see `digitToBasic()` + * @private + * @param {Number} codePoint The basic numeric code point value. + * @returns {Number} The numeric value of a basic code point (for use in + * representing integers) in the range `0` to `base - 1`, or `base` if + * the code point does not represent a value. + */ + function basicToDigit(codePoint) { + if (codePoint - 48 < 10) { + return codePoint - 22; + } + if (codePoint - 65 < 26) { + return codePoint - 65; + } + if (codePoint - 97 < 26) { + return codePoint - 97; + } + return base; + } + + /** + * Converts a digit/integer into a basic code point. + * @see `basicToDigit()` + * @private + * @param {Number} digit The numeric value of a basic code point. + * @returns {Number} The basic code point whose value (when used for + * representing integers) is `digit`, which needs to be in the range + * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is + * used; else, the lowercase form is used. The behavior is undefined + * if `flag` is non-zero and `digit` has no uppercase form. + */ + function digitToBasic(digit, flag) { + // 0..25 map to ASCII a..z or A..Z + // 26..35 map to ASCII 0..9 + return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5); + } + + /** + * Bias adaptation function as per section 3.4 of RFC 3492. + * http://tools.ietf.org/html/rfc3492#section-3.4 + * @private + */ + function adapt(delta, numPoints, firstTime) { + var k = 0; + delta = firstTime ? floor(delta / damp) : delta >> 1; + delta += floor(delta / numPoints); + for (/* no initialization */; delta > baseMinusTMin * tMax >> 1; k += base) { + delta = floor(delta / baseMinusTMin); + } + return floor(k + (baseMinusTMin + 1) * delta / (delta + skew)); + } + + /** + * Converts a Punycode string of ASCII-only symbols to a string of Unicode + * symbols. + * @memberOf punycode + * @param {String} input The Punycode string of ASCII-only symbols. + * @returns {String} The resulting string of Unicode symbols. + */ + function decode(input) { + // Don't use UCS-2 + var output = [], + inputLength = input.length, + out, + i = 0, + n = initialN, + bias = initialBias, + basic, + j, + index, + oldi, + w, + k, + digit, + t, + /** Cached calculation results */ + baseMinusT; + + // Handle the basic code points: let `basic` be the number of input code + // points before the last delimiter, or `0` if there is none, then copy + // the first basic code points to the output. + + basic = input.lastIndexOf(delimiter); + if (basic < 0) { + basic = 0; + } + + for (j = 0; j < basic; ++j) { + // if it's not a basic code point + if (input.charCodeAt(j) >= 0x80) { + error('not-basic'); + } + output.push(input.charCodeAt(j)); + } + + // Main decoding loop: start just after the last delimiter if any basic code + // points were copied; start at the beginning otherwise. + + for (index = basic > 0 ? basic + 1 : 0; index < inputLength; /* no final expression */) { + + // `index` is the index of the next character to be consumed. + // Decode a generalized variable-length integer into `delta`, + // which gets added to `i`. The overflow checking is easier + // if we increase `i` as we go, then subtract off its starting + // value at the end to obtain `delta`. + for (oldi = i, w = 1, k = base; /* no condition */; k += base) { + + if (index >= inputLength) { + error('invalid-input'); + } + + digit = basicToDigit(input.charCodeAt(index++)); + + if (digit >= base || digit > floor((maxInt - i) / w)) { + error('overflow'); + } + + i += digit * w; + t = k <= bias ? tMin : (k >= bias + tMax ? tMax : k - bias); + + if (digit < t) { + break; + } + + baseMinusT = base - t; + if (w > floor(maxInt / baseMinusT)) { + error('overflow'); + } + + w *= baseMinusT; + + } + + out = output.length + 1; + bias = adapt(i - oldi, out, oldi == 0); + + // `i` was supposed to wrap around from `out` to `0`, + // incrementing `n` each time, so we'll fix that now: + if (floor(i / out) > maxInt - n) { + error('overflow'); + } + + n += floor(i / out); + i %= out; + + // Insert `n` at position `i` of the output + output.splice(i++, 0, n); + + } + + return ucs2encode(output); + } + + /** + * Converts a string of Unicode symbols to a Punycode string of ASCII-only + * symbols. + * @memberOf punycode + * @param {String} input The string of Unicode symbols. + * @returns {String} The resulting Punycode string of ASCII-only symbols. + */ + function encode(input) { + var n, + delta, + handledCPCount, + basicLength, + bias, + j, + m, + q, + k, + t, + currentValue, + output = [], + /** `inputLength` will hold the number of code points in `input`. */ + inputLength, + /** Cached calculation results */ + handledCPCountPlusOne, + baseMinusT, + qMinusT; + + // Convert the input in UCS-2 to Unicode + input = ucs2decode(input); + + // Cache the length + inputLength = input.length; + + // Initialize the state + n = initialN; + delta = 0; + bias = initialBias; + + // Handle the basic code points + for (j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue < 0x80) { + output.push(stringFromCharCode(currentValue)); + } + } + + handledCPCount = basicLength = output.length; + + // `handledCPCount` is the number of code points that have been handled; + // `basicLength` is the number of basic code points. + + // Finish the basic string - if it is not empty - with a delimiter + if (basicLength) { + output.push(delimiter); + } + + // Main encoding loop: + while (handledCPCount < inputLength) { + + // All non-basic code points < n have been handled already. Find the next + // larger one: + for (m = maxInt, j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue >= n && currentValue < m) { + m = currentValue; + } + } + + // Increase `delta` enough to advance the decoder's state to , + // but guard against overflow + handledCPCountPlusOne = handledCPCount + 1; + if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) { + error('overflow'); + } + + delta += (m - n) * handledCPCountPlusOne; + n = m; + + for (j = 0; j < inputLength; ++j) { + currentValue = input[j]; + + if (currentValue < n && ++delta > maxInt) { + error('overflow'); + } + + if (currentValue == n) { + // Represent delta as a generalized variable-length integer + for (q = delta, k = base; /* no condition */; k += base) { + t = k <= bias ? tMin : (k >= bias + tMax ? tMax : k - bias); + if (q < t) { + break; + } + qMinusT = q - t; + baseMinusT = base - t; + output.push( + stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0)) + ); + q = floor(qMinusT / baseMinusT); + } + + output.push(stringFromCharCode(digitToBasic(q, 0))); + bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength); + delta = 0; + ++handledCPCount; + } + } + + ++delta; + ++n; + + } + return output.join(''); + } + + /** + * Converts a Punycode string representing a domain name to Unicode. Only the + * Punycoded parts of the domain name will be converted, i.e. it doesn't + * matter if you call it on a string that has already been converted to + * Unicode. + * @memberOf punycode + * @param {String} domain The Punycode domain name to convert to Unicode. + * @returns {String} The Unicode representation of the given Punycode + * string. + */ + function toUnicode(domain) { + return mapDomain(domain, function(string) { + return regexPunycode.test(string) + ? decode(string.slice(4).toLowerCase()) + : string; + }); + } + + /** + * Converts a Unicode string representing a domain name to Punycode. Only the + * non-ASCII parts of the domain name will be converted, i.e. it doesn't + * matter if you call it with a domain that's already in ASCII. + * @memberOf punycode + * @param {String} domain The domain name to convert, as a Unicode string. + * @returns {String} The Punycode representation of the given domain name. + */ + function toASCII(domain) { + return mapDomain(domain, function(string) { + return regexNonASCII.test(string) + ? 'xn--' + encode(string) + : string; + }); + } + + /*--------------------------------------------------------------------------*/ + + /** Define the public API */ + punycode = { + /** + * A string representing the current Punycode.js version number. + * @memberOf punycode + * @type String + */ + 'version': '1.2.4', + /** + * An object of methods to convert from JavaScript's internal character + * representation (UCS-2) to Unicode code points, and back. + * @see + * @memberOf punycode + * @type Object + */ + 'ucs2': { + 'decode': ucs2decode, + 'encode': ucs2encode + }, + 'decode': decode, + 'encode': encode, + 'toASCII': toASCII, + 'toUnicode': toUnicode + }; + + /** Expose `punycode` */ + // Some AMD build optimizers, like r.js, check for specific condition patterns + // like the following: + if ( + typeof define == 'function' && + typeof define.amd == 'object' && + define.amd + ) { + define('punycode', function() { + return punycode; + }); + } else if (freeExports && !freeExports.nodeType) { + if (freeModule) { // in Node.js or RingoJS v0.8.0+ + freeModule.exports = punycode; + } else { // in Narwhal or RingoJS v0.7.0- + for (key in punycode) { + punycode.hasOwnProperty(key) && (freeExports[key] = punycode[key]); + } + } + } else { // in Rhino or a web browser + root.punycode = punycode; + } + +}(this)); + +}).call(this,typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) +},{}],47:[function(require,module,exports){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +'use strict'; + +// If obj.hasOwnProperty has been overridden, then calling +// obj.hasOwnProperty(prop) will break. +// See: https://github.com/joyent/node/issues/1707 +function hasOwnProperty(obj, prop) { + return Object.prototype.hasOwnProperty.call(obj, prop); +} + +module.exports = function(qs, sep, eq, options) { + sep = sep || '&'; + eq = eq || '='; + var obj = {}; + + if (typeof qs !== 'string' || qs.length === 0) { + return obj; + } + + var regexp = /\+/g; + qs = qs.split(sep); + + var maxKeys = 1000; + if (options && typeof options.maxKeys === 'number') { + maxKeys = options.maxKeys; + } + + var len = qs.length; + // maxKeys <= 0 means that we should not limit keys count + if (maxKeys > 0 && len > maxKeys) { + len = maxKeys; + } + + for (var i = 0; i < len; ++i) { + var x = qs[i].replace(regexp, '%20'), + idx = x.indexOf(eq), + kstr, vstr, k, v; + + if (idx >= 0) { + kstr = x.substr(0, idx); + vstr = x.substr(idx + 1); + } else { + kstr = x; + vstr = ''; + } + + k = decodeURIComponent(kstr); + v = decodeURIComponent(vstr); + + if (!hasOwnProperty(obj, k)) { + obj[k] = v; + } else if (isArray(obj[k])) { + obj[k].push(v); + } else { + obj[k] = [obj[k], v]; + } + } + + return obj; +}; + +var isArray = Array.isArray || function (xs) { + return Object.prototype.toString.call(xs) === '[object Array]'; +}; + +},{}],48:[function(require,module,exports){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +'use strict'; + +var stringifyPrimitive = function(v) { + switch (typeof v) { + case 'string': + return v; + + case 'boolean': + return v ? 'true' : 'false'; + + case 'number': + return isFinite(v) ? v : ''; + + default: + return ''; + } +}; + +module.exports = function(obj, sep, eq, name) { + sep = sep || '&'; + eq = eq || '='; + if (obj === null) { + obj = undefined; + } + + if (typeof obj === 'object') { + return map(objectKeys(obj), function(k) { + var ks = encodeURIComponent(stringifyPrimitive(k)) + eq; + if (isArray(obj[k])) { + return map(obj[k], function(v) { + return ks + encodeURIComponent(stringifyPrimitive(v)); + }).join(sep); + } else { + return ks + encodeURIComponent(stringifyPrimitive(obj[k])); + } + }).join(sep); + + } + + if (!name) return ''; + return encodeURIComponent(stringifyPrimitive(name)) + eq + + encodeURIComponent(stringifyPrimitive(obj)); +}; + +var isArray = Array.isArray || function (xs) { + return Object.prototype.toString.call(xs) === '[object Array]'; +}; + +function map (xs, f) { + if (xs.map) return xs.map(f); + var res = []; + for (var i = 0; i < xs.length; i++) { + res.push(f(xs[i], i)); + } + return res; +} + +var objectKeys = Object.keys || function (obj) { + var res = []; + for (var key in obj) { + if (Object.prototype.hasOwnProperty.call(obj, key)) res.push(key); + } + return res; +}; + +},{}],49:[function(require,module,exports){ +'use strict'; + +exports.decode = exports.parse = require('./decode'); +exports.encode = exports.stringify = require('./encode'); + +},{"./decode":47,"./encode":48}],50:[function(require,module,exports){ +arguments[4][17][0].apply(exports,arguments) +},{"./lib/_stream_duplex.js":51,"dup":17}],51:[function(require,module,exports){ +arguments[4][18][0].apply(exports,arguments) +},{"./_stream_readable":53,"./_stream_writable":55,"_process":45,"core-util-is":56,"dup":18,"inherits":43}],52:[function(require,module,exports){ +arguments[4][19][0].apply(exports,arguments) +},{"./_stream_transform":54,"core-util-is":56,"dup":19,"inherits":43}],53:[function(require,module,exports){ +(function (process){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +module.exports = Readable; + +/**/ +var isArray = require('isarray'); +/**/ + + +/**/ +var Buffer = require('buffer').Buffer; +/**/ + +Readable.ReadableState = ReadableState; + +var EE = require('events').EventEmitter; + +/**/ +if (!EE.listenerCount) EE.listenerCount = function(emitter, type) { + return emitter.listeners(type).length; +}; +/**/ + +var Stream = require('stream'); + +/**/ +var util = require('core-util-is'); +util.inherits = require('inherits'); +/**/ + +var StringDecoder; + + +/**/ +var debug = require('util'); +if (debug && debug.debuglog) { + debug = debug.debuglog('stream'); +} else { + debug = function () {}; +} +/**/ + + +util.inherits(Readable, Stream); + +function ReadableState(options, stream) { + var Duplex = require('./_stream_duplex'); + + options = options || {}; + + // the point at which it stops calling _read() to fill the buffer + // Note: 0 is a valid value, means "don't call _read preemptively ever" + var hwm = options.highWaterMark; + var defaultHwm = options.objectMode ? 16 : 16 * 1024; + this.highWaterMark = (hwm || hwm === 0) ? hwm : defaultHwm; + + // cast to ints. + this.highWaterMark = ~~this.highWaterMark; + + this.buffer = []; + this.length = 0; + this.pipes = null; + this.pipesCount = 0; + this.flowing = null; + this.ended = false; + this.endEmitted = false; + this.reading = false; + + // a flag to be able to tell if the onwrite cb is called immediately, + // or on a later tick. We set this to true at first, because any + // actions that shouldn't happen until "later" should generally also + // not happen before the first write call. + this.sync = true; + + // whenever we return null, then we set a flag to say + // that we're awaiting a 'readable' event emission. + this.needReadable = false; + this.emittedReadable = false; + this.readableListening = false; + + + // object stream flag. Used to make read(n) ignore n and to + // make all the buffer merging and length checks go away + this.objectMode = !!options.objectMode; + + if (stream instanceof Duplex) + this.objectMode = this.objectMode || !!options.readableObjectMode; + + // Crypto is kind of old and crusty. Historically, its default string + // encoding is 'binary' so we have to make this configurable. + // Everything else in the universe uses 'utf8', though. + this.defaultEncoding = options.defaultEncoding || 'utf8'; + + // when piping, we only care about 'readable' events that happen + // after read()ing all the bytes and not getting any pushback. + this.ranOut = false; + + // the number of writers that are awaiting a drain event in .pipe()s + this.awaitDrain = 0; + + // if true, a maybeReadMore has been scheduled + this.readingMore = false; + + this.decoder = null; + this.encoding = null; + if (options.encoding) { + if (!StringDecoder) + StringDecoder = require('string_decoder/').StringDecoder; + this.decoder = new StringDecoder(options.encoding); + this.encoding = options.encoding; + } +} + +function Readable(options) { + var Duplex = require('./_stream_duplex'); + + if (!(this instanceof Readable)) + return new Readable(options); + + this._readableState = new ReadableState(options, this); + + // legacy + this.readable = true; + + Stream.call(this); +} + +// Manually shove something into the read() buffer. +// This returns true if the highWaterMark has not been hit yet, +// similar to how Writable.write() returns true if you should +// write() some more. +Readable.prototype.push = function(chunk, encoding) { + var state = this._readableState; + + if (util.isString(chunk) && !state.objectMode) { + encoding = encoding || state.defaultEncoding; + if (encoding !== state.encoding) { + chunk = new Buffer(chunk, encoding); + encoding = ''; + } + } + + return readableAddChunk(this, state, chunk, encoding, false); +}; + +// Unshift should *always* be something directly out of read() +Readable.prototype.unshift = function(chunk) { + var state = this._readableState; + return readableAddChunk(this, state, chunk, '', true); +}; + +function readableAddChunk(stream, state, chunk, encoding, addToFront) { + var er = chunkInvalid(state, chunk); + if (er) { + stream.emit('error', er); + } else if (util.isNullOrUndefined(chunk)) { + state.reading = false; + if (!state.ended) + onEofChunk(stream, state); + } else if (state.objectMode || chunk && chunk.length > 0) { + if (state.ended && !addToFront) { + var e = new Error('stream.push() after EOF'); + stream.emit('error', e); + } else if (state.endEmitted && addToFront) { + var e = new Error('stream.unshift() after end event'); + stream.emit('error', e); + } else { + if (state.decoder && !addToFront && !encoding) + chunk = state.decoder.write(chunk); + + if (!addToFront) + state.reading = false; + + // if we want the data now, just emit it. + if (state.flowing && state.length === 0 && !state.sync) { + stream.emit('data', chunk); + stream.read(0); + } else { + // update the buffer info. + state.length += state.objectMode ? 1 : chunk.length; + if (addToFront) + state.buffer.unshift(chunk); + else + state.buffer.push(chunk); + + if (state.needReadable) + emitReadable(stream); + } + + maybeReadMore(stream, state); + } + } else if (!addToFront) { + state.reading = false; + } + + return needMoreData(state); +} + + + +// if it's past the high water mark, we can push in some more. +// Also, if we have no data yet, we can stand some +// more bytes. This is to work around cases where hwm=0, +// such as the repl. Also, if the push() triggered a +// readable event, and the user called read(largeNumber) such that +// needReadable was set, then we ought to push more, so that another +// 'readable' event will be triggered. +function needMoreData(state) { + return !state.ended && + (state.needReadable || + state.length < state.highWaterMark || + state.length === 0); +} + +// backwards compatibility. +Readable.prototype.setEncoding = function(enc) { + if (!StringDecoder) + StringDecoder = require('string_decoder/').StringDecoder; + this._readableState.decoder = new StringDecoder(enc); + this._readableState.encoding = enc; + return this; +}; + +// Don't raise the hwm > 128MB +var MAX_HWM = 0x800000; +function roundUpToNextPowerOf2(n) { + if (n >= MAX_HWM) { + n = MAX_HWM; + } else { + // Get the next highest power of 2 + n--; + for (var p = 1; p < 32; p <<= 1) n |= n >> p; + n++; + } + return n; +} + +function howMuchToRead(n, state) { + if (state.length === 0 && state.ended) + return 0; + + if (state.objectMode) + return n === 0 ? 0 : 1; + + if (isNaN(n) || util.isNull(n)) { + // only flow one buffer at a time + if (state.flowing && state.buffer.length) + return state.buffer[0].length; + else + return state.length; + } + + if (n <= 0) + return 0; + + // If we're asking for more than the target buffer level, + // then raise the water mark. Bump up to the next highest + // power of 2, to prevent increasing it excessively in tiny + // amounts. + if (n > state.highWaterMark) + state.highWaterMark = roundUpToNextPowerOf2(n); + + // don't have that much. return null, unless we've ended. + if (n > state.length) { + if (!state.ended) { + state.needReadable = true; + return 0; + } else + return state.length; + } + + return n; +} + +// you can override either this method, or the async _read(n) below. +Readable.prototype.read = function(n) { + debug('read', n); + var state = this._readableState; + var nOrig = n; + + if (!util.isNumber(n) || n > 0) + state.emittedReadable = false; + + // if we're doing read(0) to trigger a readable event, but we + // already have a bunch of data in the buffer, then just trigger + // the 'readable' event and move on. + if (n === 0 && + state.needReadable && + (state.length >= state.highWaterMark || state.ended)) { + debug('read: emitReadable', state.length, state.ended); + if (state.length === 0 && state.ended) + endReadable(this); + else + emitReadable(this); + return null; + } + + n = howMuchToRead(n, state); + + // if we've ended, and we're now clear, then finish it up. + if (n === 0 && state.ended) { + if (state.length === 0) + endReadable(this); + return null; + } + + // All the actual chunk generation logic needs to be + // *below* the call to _read. The reason is that in certain + // synthetic stream cases, such as passthrough streams, _read + // may be a completely synchronous operation which may change + // the state of the read buffer, providing enough data when + // before there was *not* enough. + // + // So, the steps are: + // 1. Figure out what the state of things will be after we do + // a read from the buffer. + // + // 2. If that resulting state will trigger a _read, then call _read. + // Note that this may be asynchronous, or synchronous. Yes, it is + // deeply ugly to write APIs this way, but that still doesn't mean + // that the Readable class should behave improperly, as streams are + // designed to be sync/async agnostic. + // Take note if the _read call is sync or async (ie, if the read call + // has returned yet), so that we know whether or not it's safe to emit + // 'readable' etc. + // + // 3. Actually pull the requested chunks out of the buffer and return. + + // if we need a readable event, then we need to do some reading. + var doRead = state.needReadable; + debug('need readable', doRead); + + // if we currently have less than the highWaterMark, then also read some + if (state.length === 0 || state.length - n < state.highWaterMark) { + doRead = true; + debug('length less than watermark', doRead); + } + + // however, if we've ended, then there's no point, and if we're already + // reading, then it's unnecessary. + if (state.ended || state.reading) { + doRead = false; + debug('reading or ended', doRead); + } + + if (doRead) { + debug('do read'); + state.reading = true; + state.sync = true; + // if the length is currently zero, then we *need* a readable event. + if (state.length === 0) + state.needReadable = true; + // call internal read method + this._read(state.highWaterMark); + state.sync = false; + } + + // If _read pushed data synchronously, then `reading` will be false, + // and we need to re-evaluate how much data we can return to the user. + if (doRead && !state.reading) + n = howMuchToRead(nOrig, state); + + var ret; + if (n > 0) + ret = fromList(n, state); + else + ret = null; + + if (util.isNull(ret)) { + state.needReadable = true; + n = 0; + } + + state.length -= n; + + // If we have nothing in the buffer, then we want to know + // as soon as we *do* get something into the buffer. + if (state.length === 0 && !state.ended) + state.needReadable = true; + + // If we tried to read() past the EOF, then emit end on the next tick. + if (nOrig !== n && state.ended && state.length === 0) + endReadable(this); + + if (!util.isNull(ret)) + this.emit('data', ret); + + return ret; +}; + +function chunkInvalid(state, chunk) { + var er = null; + if (!util.isBuffer(chunk) && + !util.isString(chunk) && + !util.isNullOrUndefined(chunk) && + !state.objectMode) { + er = new TypeError('Invalid non-string/buffer chunk'); + } + return er; +} + + +function onEofChunk(stream, state) { + if (state.decoder && !state.ended) { + var chunk = state.decoder.end(); + if (chunk && chunk.length) { + state.buffer.push(chunk); + state.length += state.objectMode ? 1 : chunk.length; + } + } + state.ended = true; + + // emit 'readable' now to make sure it gets picked up. + emitReadable(stream); +} + +// Don't emit readable right away in sync mode, because this can trigger +// another read() call => stack overflow. This way, it might trigger +// a nextTick recursion warning, but that's not so bad. +function emitReadable(stream) { + var state = stream._readableState; + state.needReadable = false; + if (!state.emittedReadable) { + debug('emitReadable', state.flowing); + state.emittedReadable = true; + if (state.sync) + process.nextTick(function() { + emitReadable_(stream); + }); + else + emitReadable_(stream); + } +} + +function emitReadable_(stream) { + debug('emit readable'); + stream.emit('readable'); + flow(stream); +} + + +// at this point, the user has presumably seen the 'readable' event, +// and called read() to consume some data. that may have triggered +// in turn another _read(n) call, in which case reading = true if +// it's in progress. +// However, if we're not ended, or reading, and the length < hwm, +// then go ahead and try to read some more preemptively. +function maybeReadMore(stream, state) { + if (!state.readingMore) { + state.readingMore = true; + process.nextTick(function() { + maybeReadMore_(stream, state); + }); + } +} + +function maybeReadMore_(stream, state) { + var len = state.length; + while (!state.reading && !state.flowing && !state.ended && + state.length < state.highWaterMark) { + debug('maybeReadMore read 0'); + stream.read(0); + if (len === state.length) + // didn't get any data, stop spinning. + break; + else + len = state.length; + } + state.readingMore = false; +} + +// abstract method. to be overridden in specific implementation classes. +// call cb(er, data) where data is <= n in length. +// for virtual (non-string, non-buffer) streams, "length" is somewhat +// arbitrary, and perhaps not very meaningful. +Readable.prototype._read = function(n) { + this.emit('error', new Error('not implemented')); +}; + +Readable.prototype.pipe = function(dest, pipeOpts) { + var src = this; + var state = this._readableState; + + switch (state.pipesCount) { + case 0: + state.pipes = dest; + break; + case 1: + state.pipes = [state.pipes, dest]; + break; + default: + state.pipes.push(dest); + break; + } + state.pipesCount += 1; + debug('pipe count=%d opts=%j', state.pipesCount, pipeOpts); + + var doEnd = (!pipeOpts || pipeOpts.end !== false) && + dest !== process.stdout && + dest !== process.stderr; + + var endFn = doEnd ? onend : cleanup; + if (state.endEmitted) + process.nextTick(endFn); + else + src.once('end', endFn); + + dest.on('unpipe', onunpipe); + function onunpipe(readable) { + debug('onunpipe'); + if (readable === src) { + cleanup(); + } + } + + function onend() { + debug('onend'); + dest.end(); + } + + // when the dest drains, it reduces the awaitDrain counter + // on the source. This would be more elegant with a .once() + // handler in flow(), but adding and removing repeatedly is + // too slow. + var ondrain = pipeOnDrain(src); + dest.on('drain', ondrain); + + function cleanup() { + debug('cleanup'); + // cleanup event handlers once the pipe is broken + dest.removeListener('close', onclose); + dest.removeListener('finish', onfinish); + dest.removeListener('drain', ondrain); + dest.removeListener('error', onerror); + dest.removeListener('unpipe', onunpipe); + src.removeListener('end', onend); + src.removeListener('end', cleanup); + src.removeListener('data', ondata); + + // if the reader is waiting for a drain event from this + // specific writer, then it would cause it to never start + // flowing again. + // So, if this is awaiting a drain, then we just call it now. + // If we don't know, then assume that we are waiting for one. + if (state.awaitDrain && + (!dest._writableState || dest._writableState.needDrain)) + ondrain(); + } + + src.on('data', ondata); + function ondata(chunk) { + debug('ondata'); + var ret = dest.write(chunk); + if (false === ret) { + debug('false write response, pause', + src._readableState.awaitDrain); + src._readableState.awaitDrain++; + src.pause(); + } + } + + // if the dest has an error, then stop piping into it. + // however, don't suppress the throwing behavior for this. + function onerror(er) { + debug('onerror', er); + unpipe(); + dest.removeListener('error', onerror); + if (EE.listenerCount(dest, 'error') === 0) + dest.emit('error', er); + } + // This is a brutally ugly hack to make sure that our error handler + // is attached before any userland ones. NEVER DO THIS. + if (!dest._events || !dest._events.error) + dest.on('error', onerror); + else if (isArray(dest._events.error)) + dest._events.error.unshift(onerror); + else + dest._events.error = [onerror, dest._events.error]; + + + + // Both close and finish should trigger unpipe, but only once. + function onclose() { + dest.removeListener('finish', onfinish); + unpipe(); + } + dest.once('close', onclose); + function onfinish() { + debug('onfinish'); + dest.removeListener('close', onclose); + unpipe(); + } + dest.once('finish', onfinish); + + function unpipe() { + debug('unpipe'); + src.unpipe(dest); + } + + // tell the dest that it's being piped to + dest.emit('pipe', src); + + // start the flow if it hasn't been started already. + if (!state.flowing) { + debug('pipe resume'); + src.resume(); + } + + return dest; +}; + +function pipeOnDrain(src) { + return function() { + var state = src._readableState; + debug('pipeOnDrain', state.awaitDrain); + if (state.awaitDrain) + state.awaitDrain--; + if (state.awaitDrain === 0 && EE.listenerCount(src, 'data')) { + state.flowing = true; + flow(src); + } + }; +} + + +Readable.prototype.unpipe = function(dest) { + var state = this._readableState; + + // if we're not piping anywhere, then do nothing. + if (state.pipesCount === 0) + return this; + + // just one destination. most common case. + if (state.pipesCount === 1) { + // passed in one, but it's not the right one. + if (dest && dest !== state.pipes) + return this; + + if (!dest) + dest = state.pipes; + + // got a match. + state.pipes = null; + state.pipesCount = 0; + state.flowing = false; + if (dest) + dest.emit('unpipe', this); + return this; + } + + // slow case. multiple pipe destinations. + + if (!dest) { + // remove all. + var dests = state.pipes; + var len = state.pipesCount; + state.pipes = null; + state.pipesCount = 0; + state.flowing = false; + + for (var i = 0; i < len; i++) + dests[i].emit('unpipe', this); + return this; + } + + // try to find the right one. + var i = indexOf(state.pipes, dest); + if (i === -1) + return this; + + state.pipes.splice(i, 1); + state.pipesCount -= 1; + if (state.pipesCount === 1) + state.pipes = state.pipes[0]; + + dest.emit('unpipe', this); + + return this; +}; + +// set up data events if they are asked for +// Ensure readable listeners eventually get something +Readable.prototype.on = function(ev, fn) { + var res = Stream.prototype.on.call(this, ev, fn); + + // If listening to data, and it has not explicitly been paused, + // then call resume to start the flow of data on the next tick. + if (ev === 'data' && false !== this._readableState.flowing) { + this.resume(); + } + + if (ev === 'readable' && this.readable) { + var state = this._readableState; + if (!state.readableListening) { + state.readableListening = true; + state.emittedReadable = false; + state.needReadable = true; + if (!state.reading) { + var self = this; + process.nextTick(function() { + debug('readable nexttick read 0'); + self.read(0); + }); + } else if (state.length) { + emitReadable(this, state); + } + } + } + + return res; +}; +Readable.prototype.addListener = Readable.prototype.on; + +// pause() and resume() are remnants of the legacy readable stream API +// If the user uses them, then switch into old mode. +Readable.prototype.resume = function() { + var state = this._readableState; + if (!state.flowing) { + debug('resume'); + state.flowing = true; + if (!state.reading) { + debug('resume read 0'); + this.read(0); + } + resume(this, state); + } + return this; +}; + +function resume(stream, state) { + if (!state.resumeScheduled) { + state.resumeScheduled = true; + process.nextTick(function() { + resume_(stream, state); + }); + } +} + +function resume_(stream, state) { + state.resumeScheduled = false; + stream.emit('resume'); + flow(stream); + if (state.flowing && !state.reading) + stream.read(0); +} + +Readable.prototype.pause = function() { + debug('call pause flowing=%j', this._readableState.flowing); + if (false !== this._readableState.flowing) { + debug('pause'); + this._readableState.flowing = false; + this.emit('pause'); + } + return this; +}; + +function flow(stream) { + var state = stream._readableState; + debug('flow', state.flowing); + if (state.flowing) { + do { + var chunk = stream.read(); + } while (null !== chunk && state.flowing); + } +} + +// wrap an old-style stream as the async data source. +// This is *not* part of the readable stream interface. +// It is an ugly unfortunate mess of history. +Readable.prototype.wrap = function(stream) { + var state = this._readableState; + var paused = false; + + var self = this; + stream.on('end', function() { + debug('wrapped end'); + if (state.decoder && !state.ended) { + var chunk = state.decoder.end(); + if (chunk && chunk.length) + self.push(chunk); + } + + self.push(null); + }); + + stream.on('data', function(chunk) { + debug('wrapped data'); + if (state.decoder) + chunk = state.decoder.write(chunk); + if (!chunk || !state.objectMode && !chunk.length) + return; + + var ret = self.push(chunk); + if (!ret) { + paused = true; + stream.pause(); + } + }); + + // proxy all the other methods. + // important when wrapping filters and duplexes. + for (var i in stream) { + if (util.isFunction(stream[i]) && util.isUndefined(this[i])) { + this[i] = function(method) { return function() { + return stream[method].apply(stream, arguments); + }}(i); + } + } + + // proxy certain important events. + var events = ['error', 'close', 'destroy', 'pause', 'resume']; + forEach(events, function(ev) { + stream.on(ev, self.emit.bind(self, ev)); + }); + + // when we try to consume some more bytes, simply unpause the + // underlying stream. + self._read = function(n) { + debug('wrapped _read', n); + if (paused) { + paused = false; + stream.resume(); + } + }; + + return self; +}; + + + +// exposed for testing purposes only. +Readable._fromList = fromList; + +// Pluck off n bytes from an array of buffers. +// Length is the combined lengths of all the buffers in the list. +function fromList(n, state) { + var list = state.buffer; + var length = state.length; + var stringMode = !!state.decoder; + var objectMode = !!state.objectMode; + var ret; + + // nothing in the list, definitely empty. + if (list.length === 0) + return null; + + if (length === 0) + ret = null; + else if (objectMode) + ret = list.shift(); + else if (!n || n >= length) { + // read it all, truncate the array. + if (stringMode) + ret = list.join(''); + else + ret = Buffer.concat(list, length); + list.length = 0; + } else { + // read just some of it. + if (n < list[0].length) { + // just take a part of the first list item. + // slice is the same for buffers and strings. + var buf = list[0]; + ret = buf.slice(0, n); + list[0] = buf.slice(n); + } else if (n === list[0].length) { + // first list is a perfect match + ret = list.shift(); + } else { + // complex case. + // we have enough to cover it, but it spans past the first buffer. + if (stringMode) + ret = ''; + else + ret = new Buffer(n); + + var c = 0; + for (var i = 0, l = list.length; i < l && c < n; i++) { + var buf = list[0]; + var cpy = Math.min(n - c, buf.length); + + if (stringMode) + ret += buf.slice(0, cpy); + else + buf.copy(ret, c, 0, cpy); + + if (cpy < buf.length) + list[0] = buf.slice(cpy); + else + list.shift(); + + c += cpy; + } + } + } + + return ret; +} + +function endReadable(stream) { + var state = stream._readableState; + + // If we get here before consuming all the bytes, then that is a + // bug in node. Should never happen. + if (state.length > 0) + throw new Error('endReadable called on non-empty stream'); + + if (!state.endEmitted) { + state.ended = true; + process.nextTick(function() { + // Check that we didn't get one last unshift. + if (!state.endEmitted && state.length === 0) { + state.endEmitted = true; + stream.readable = false; + stream.emit('end'); + } + }); + } +} + +function forEach (xs, f) { + for (var i = 0, l = xs.length; i < l; i++) { + f(xs[i], i); + } +} + +function indexOf (xs, x) { + for (var i = 0, l = xs.length; i < l; i++) { + if (xs[i] === x) return i; + } + return -1; +} + +}).call(this,require('_process')) +},{"./_stream_duplex":51,"_process":45,"buffer":38,"core-util-is":56,"events":42,"inherits":43,"isarray":44,"stream":61,"string_decoder/":62,"util":37}],54:[function(require,module,exports){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + + +// a transform stream is a readable/writable stream where you do +// something with the data. Sometimes it's called a "filter", +// but that's not a great name for it, since that implies a thing where +// some bits pass through, and others are simply ignored. (That would +// be a valid example of a transform, of course.) +// +// While the output is causally related to the input, it's not a +// necessarily symmetric or synchronous transformation. For example, +// a zlib stream might take multiple plain-text writes(), and then +// emit a single compressed chunk some time in the future. +// +// Here's how this works: +// +// The Transform stream has all the aspects of the readable and writable +// stream classes. When you write(chunk), that calls _write(chunk,cb) +// internally, and returns false if there's a lot of pending writes +// buffered up. When you call read(), that calls _read(n) until +// there's enough pending readable data buffered up. +// +// In a transform stream, the written data is placed in a buffer. When +// _read(n) is called, it transforms the queued up data, calling the +// buffered _write cb's as it consumes chunks. If consuming a single +// written chunk would result in multiple output chunks, then the first +// outputted bit calls the readcb, and subsequent chunks just go into +// the read buffer, and will cause it to emit 'readable' if necessary. +// +// This way, back-pressure is actually determined by the reading side, +// since _read has to be called to start processing a new chunk. However, +// a pathological inflate type of transform can cause excessive buffering +// here. For example, imagine a stream where every byte of input is +// interpreted as an integer from 0-255, and then results in that many +// bytes of output. Writing the 4 bytes {ff,ff,ff,ff} would result in +// 1kb of data being output. In this case, you could write a very small +// amount of input, and end up with a very large amount of output. In +// such a pathological inflating mechanism, there'd be no way to tell +// the system to stop doing the transform. A single 4MB write could +// cause the system to run out of memory. +// +// However, even in such a pathological case, only a single written chunk +// would be consumed, and then the rest would wait (un-transformed) until +// the results of the previous transformed chunk were consumed. + +module.exports = Transform; + +var Duplex = require('./_stream_duplex'); + +/**/ +var util = require('core-util-is'); +util.inherits = require('inherits'); +/**/ + +util.inherits(Transform, Duplex); + + +function TransformState(options, stream) { + this.afterTransform = function(er, data) { + return afterTransform(stream, er, data); + }; + + this.needTransform = false; + this.transforming = false; + this.writecb = null; + this.writechunk = null; +} + +function afterTransform(stream, er, data) { + var ts = stream._transformState; + ts.transforming = false; + + var cb = ts.writecb; + + if (!cb) + return stream.emit('error', new Error('no writecb in Transform class')); + + ts.writechunk = null; + ts.writecb = null; + + if (!util.isNullOrUndefined(data)) + stream.push(data); + + if (cb) + cb(er); + + var rs = stream._readableState; + rs.reading = false; + if (rs.needReadable || rs.length < rs.highWaterMark) { + stream._read(rs.highWaterMark); + } +} + + +function Transform(options) { + if (!(this instanceof Transform)) + return new Transform(options); + + Duplex.call(this, options); + + this._transformState = new TransformState(options, this); + + // when the writable side finishes, then flush out anything remaining. + var stream = this; + + // start out asking for a readable event once data is transformed. + this._readableState.needReadable = true; + + // we have implemented the _read method, and done the other things + // that Readable wants before the first _read call, so unset the + // sync guard flag. + this._readableState.sync = false; + + this.once('prefinish', function() { + if (util.isFunction(this._flush)) + this._flush(function(er) { + done(stream, er); + }); + else + done(stream); + }); +} + +Transform.prototype.push = function(chunk, encoding) { + this._transformState.needTransform = false; + return Duplex.prototype.push.call(this, chunk, encoding); +}; + +// This is the part where you do stuff! +// override this function in implementation classes. +// 'chunk' is an input chunk. +// +// Call `push(newChunk)` to pass along transformed output +// to the readable side. You may call 'push' zero or more times. +// +// Call `cb(err)` when you are done with this chunk. If you pass +// an error, then that'll put the hurt on the whole operation. If you +// never call cb(), then you'll never get another chunk. +Transform.prototype._transform = function(chunk, encoding, cb) { + throw new Error('not implemented'); +}; + +Transform.prototype._write = function(chunk, encoding, cb) { + var ts = this._transformState; + ts.writecb = cb; + ts.writechunk = chunk; + ts.writeencoding = encoding; + if (!ts.transforming) { + var rs = this._readableState; + if (ts.needTransform || + rs.needReadable || + rs.length < rs.highWaterMark) + this._read(rs.highWaterMark); + } +}; + +// Doesn't matter what the args are here. +// _transform does all the work. +// That we got here means that the readable side wants more data. +Transform.prototype._read = function(n) { + var ts = this._transformState; + + if (!util.isNull(ts.writechunk) && ts.writecb && !ts.transforming) { + ts.transforming = true; + this._transform(ts.writechunk, ts.writeencoding, ts.afterTransform); + } else { + // mark that we need a transform, so that any data that comes in + // will get processed, now that we've asked for it. + ts.needTransform = true; + } +}; + + +function done(stream, er) { + if (er) + return stream.emit('error', er); + + // if there's nothing in the write buffer, then that means + // that nothing more will ever be provided + var ws = stream._writableState; + var ts = stream._transformState; + + if (ws.length) + throw new Error('calling transform done when ws.length != 0'); + + if (ts.transforming) + throw new Error('calling transform done when still transforming'); + + return stream.push(null); +} + +},{"./_stream_duplex":51,"core-util-is":56,"inherits":43}],55:[function(require,module,exports){ +(function (process){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +// A bit simpler than readable streams. +// Implement an async ._write(chunk, cb), and it'll handle all +// the drain event emission and buffering. + +module.exports = Writable; + +/**/ +var Buffer = require('buffer').Buffer; +/**/ + +Writable.WritableState = WritableState; + + +/**/ +var util = require('core-util-is'); +util.inherits = require('inherits'); +/**/ + +var Stream = require('stream'); + +util.inherits(Writable, Stream); + +function WriteReq(chunk, encoding, cb) { + this.chunk = chunk; + this.encoding = encoding; + this.callback = cb; +} + +function WritableState(options, stream) { + var Duplex = require('./_stream_duplex'); + + options = options || {}; + + // the point at which write() starts returning false + // Note: 0 is a valid value, means that we always return false if + // the entire buffer is not flushed immediately on write() + var hwm = options.highWaterMark; + var defaultHwm = options.objectMode ? 16 : 16 * 1024; + this.highWaterMark = (hwm || hwm === 0) ? hwm : defaultHwm; + + // object stream flag to indicate whether or not this stream + // contains buffers or objects. + this.objectMode = !!options.objectMode; + + if (stream instanceof Duplex) + this.objectMode = this.objectMode || !!options.writableObjectMode; + + // cast to ints. + this.highWaterMark = ~~this.highWaterMark; + + this.needDrain = false; + // at the start of calling end() + this.ending = false; + // when end() has been called, and returned + this.ended = false; + // when 'finish' is emitted + this.finished = false; + + // should we decode strings into buffers before passing to _write? + // this is here so that some node-core streams can optimize string + // handling at a lower level. + var noDecode = options.decodeStrings === false; + this.decodeStrings = !noDecode; + + // Crypto is kind of old and crusty. Historically, its default string + // encoding is 'binary' so we have to make this configurable. + // Everything else in the universe uses 'utf8', though. + this.defaultEncoding = options.defaultEncoding || 'utf8'; + + // not an actual buffer we keep track of, but a measurement + // of how much we're waiting to get pushed to some underlying + // socket or file. + this.length = 0; + + // a flag to see when we're in the middle of a write. + this.writing = false; + + // when true all writes will be buffered until .uncork() call + this.corked = 0; + + // a flag to be able to tell if the onwrite cb is called immediately, + // or on a later tick. We set this to true at first, because any + // actions that shouldn't happen until "later" should generally also + // not happen before the first write call. + this.sync = true; + + // a flag to know if we're processing previously buffered items, which + // may call the _write() callback in the same tick, so that we don't + // end up in an overlapped onwrite situation. + this.bufferProcessing = false; + + // the callback that's passed to _write(chunk,cb) + this.onwrite = function(er) { + onwrite(stream, er); + }; + + // the callback that the user supplies to write(chunk,encoding,cb) + this.writecb = null; + + // the amount that is being written when _write is called. + this.writelen = 0; + + this.buffer = []; + + // number of pending user-supplied write callbacks + // this must be 0 before 'finish' can be emitted + this.pendingcb = 0; + + // emit prefinish if the only thing we're waiting for is _write cbs + // This is relevant for synchronous Transform streams + this.prefinished = false; + + // True if the error was already emitted and should not be thrown again + this.errorEmitted = false; +} + +function Writable(options) { + var Duplex = require('./_stream_duplex'); + + // Writable ctor is applied to Duplexes, though they're not + // instanceof Writable, they're instanceof Readable. + if (!(this instanceof Writable) && !(this instanceof Duplex)) + return new Writable(options); + + this._writableState = new WritableState(options, this); + + // legacy. + this.writable = true; + + Stream.call(this); +} + +// Otherwise people can pipe Writable streams, which is just wrong. +Writable.prototype.pipe = function() { + this.emit('error', new Error('Cannot pipe. Not readable.')); +}; + + +function writeAfterEnd(stream, state, cb) { + var er = new Error('write after end'); + // TODO: defer error events consistently everywhere, not just the cb + stream.emit('error', er); + process.nextTick(function() { + cb(er); + }); +} + +// If we get something that is not a buffer, string, null, or undefined, +// and we're not in objectMode, then that's an error. +// Otherwise stream chunks are all considered to be of length=1, and the +// watermarks determine how many objects to keep in the buffer, rather than +// how many bytes or characters. +function validChunk(stream, state, chunk, cb) { + var valid = true; + if (!util.isBuffer(chunk) && + !util.isString(chunk) && + !util.isNullOrUndefined(chunk) && + !state.objectMode) { + var er = new TypeError('Invalid non-string/buffer chunk'); + stream.emit('error', er); + process.nextTick(function() { + cb(er); + }); + valid = false; + } + return valid; +} + +Writable.prototype.write = function(chunk, encoding, cb) { + var state = this._writableState; + var ret = false; + + if (util.isFunction(encoding)) { + cb = encoding; + encoding = null; + } + + if (util.isBuffer(chunk)) + encoding = 'buffer'; + else if (!encoding) + encoding = state.defaultEncoding; + + if (!util.isFunction(cb)) + cb = function() {}; + + if (state.ended) + writeAfterEnd(this, state, cb); + else if (validChunk(this, state, chunk, cb)) { + state.pendingcb++; + ret = writeOrBuffer(this, state, chunk, encoding, cb); + } + + return ret; +}; + +Writable.prototype.cork = function() { + var state = this._writableState; + + state.corked++; +}; + +Writable.prototype.uncork = function() { + var state = this._writableState; + + if (state.corked) { + state.corked--; + + if (!state.writing && + !state.corked && + !state.finished && + !state.bufferProcessing && + state.buffer.length) + clearBuffer(this, state); + } +}; + +function decodeChunk(state, chunk, encoding) { + if (!state.objectMode && + state.decodeStrings !== false && + util.isString(chunk)) { + chunk = new Buffer(chunk, encoding); + } + return chunk; +} + +// if we're already writing something, then just put this +// in the queue, and wait our turn. Otherwise, call _write +// If we return false, then we need a drain event, so set that flag. +function writeOrBuffer(stream, state, chunk, encoding, cb) { + chunk = decodeChunk(state, chunk, encoding); + if (util.isBuffer(chunk)) + encoding = 'buffer'; + var len = state.objectMode ? 1 : chunk.length; + + state.length += len; + + var ret = state.length < state.highWaterMark; + // we must ensure that previous needDrain will not be reset to false. + if (!ret) + state.needDrain = true; + + if (state.writing || state.corked) + state.buffer.push(new WriteReq(chunk, encoding, cb)); + else + doWrite(stream, state, false, len, chunk, encoding, cb); + + return ret; +} + +function doWrite(stream, state, writev, len, chunk, encoding, cb) { + state.writelen = len; + state.writecb = cb; + state.writing = true; + state.sync = true; + if (writev) + stream._writev(chunk, state.onwrite); + else + stream._write(chunk, encoding, state.onwrite); + state.sync = false; +} + +function onwriteError(stream, state, sync, er, cb) { + if (sync) + process.nextTick(function() { + state.pendingcb--; + cb(er); + }); + else { + state.pendingcb--; + cb(er); + } + + stream._writableState.errorEmitted = true; + stream.emit('error', er); +} + +function onwriteStateUpdate(state) { + state.writing = false; + state.writecb = null; + state.length -= state.writelen; + state.writelen = 0; +} + +function onwrite(stream, er) { + var state = stream._writableState; + var sync = state.sync; + var cb = state.writecb; + + onwriteStateUpdate(state); + + if (er) + onwriteError(stream, state, sync, er, cb); + else { + // Check if we're actually ready to finish, but don't emit yet + var finished = needFinish(stream, state); + + if (!finished && + !state.corked && + !state.bufferProcessing && + state.buffer.length) { + clearBuffer(stream, state); + } + + if (sync) { + process.nextTick(function() { + afterWrite(stream, state, finished, cb); + }); + } else { + afterWrite(stream, state, finished, cb); + } + } +} + +function afterWrite(stream, state, finished, cb) { + if (!finished) + onwriteDrain(stream, state); + state.pendingcb--; + cb(); + finishMaybe(stream, state); +} + +// Must force callback to be called on nextTick, so that we don't +// emit 'drain' before the write() consumer gets the 'false' return +// value, and has a chance to attach a 'drain' listener. +function onwriteDrain(stream, state) { + if (state.length === 0 && state.needDrain) { + state.needDrain = false; + stream.emit('drain'); + } +} + + +// if there's something in the buffer waiting, then process it +function clearBuffer(stream, state) { + state.bufferProcessing = true; + + if (stream._writev && state.buffer.length > 1) { + // Fast case, write everything using _writev() + var cbs = []; + for (var c = 0; c < state.buffer.length; c++) + cbs.push(state.buffer[c].callback); + + // count the one we are adding, as well. + // TODO(isaacs) clean this up + state.pendingcb++; + doWrite(stream, state, true, state.length, state.buffer, '', function(err) { + for (var i = 0; i < cbs.length; i++) { + state.pendingcb--; + cbs[i](err); + } + }); + + // Clear buffer + state.buffer = []; + } else { + // Slow case, write chunks one-by-one + for (var c = 0; c < state.buffer.length; c++) { + var entry = state.buffer[c]; + var chunk = entry.chunk; + var encoding = entry.encoding; + var cb = entry.callback; + var len = state.objectMode ? 1 : chunk.length; + + doWrite(stream, state, false, len, chunk, encoding, cb); + + // if we didn't call the onwrite immediately, then + // it means that we need to wait until it does. + // also, that means that the chunk and cb are currently + // being processed, so move the buffer counter past them. + if (state.writing) { + c++; + break; + } + } + + if (c < state.buffer.length) + state.buffer = state.buffer.slice(c); + else + state.buffer.length = 0; + } + + state.bufferProcessing = false; +} + +Writable.prototype._write = function(chunk, encoding, cb) { + cb(new Error('not implemented')); + +}; + +Writable.prototype._writev = null; + +Writable.prototype.end = function(chunk, encoding, cb) { + var state = this._writableState; + + if (util.isFunction(chunk)) { + cb = chunk; + chunk = null; + encoding = null; + } else if (util.isFunction(encoding)) { + cb = encoding; + encoding = null; + } + + if (!util.isNullOrUndefined(chunk)) + this.write(chunk, encoding); + + // .end() fully uncorks + if (state.corked) { + state.corked = 1; + this.uncork(); + } + + // ignore unnecessary end() calls. + if (!state.ending && !state.finished) + endWritable(this, state, cb); +}; + + +function needFinish(stream, state) { + return (state.ending && + state.length === 0 && + !state.finished && + !state.writing); +} + +function prefinish(stream, state) { + if (!state.prefinished) { + state.prefinished = true; + stream.emit('prefinish'); + } +} + +function finishMaybe(stream, state) { + var need = needFinish(stream, state); + if (need) { + if (state.pendingcb === 0) { + prefinish(stream, state); + state.finished = true; + stream.emit('finish'); + } else + prefinish(stream, state); + } + return need; +} + +function endWritable(stream, state, cb) { + state.ending = true; + finishMaybe(stream, state); + if (cb) { + if (state.finished) + process.nextTick(cb); + else + stream.once('finish', cb); + } + state.ended = true; +} + +}).call(this,require('_process')) +},{"./_stream_duplex":51,"_process":45,"buffer":38,"core-util-is":56,"inherits":43,"stream":61}],56:[function(require,module,exports){ +arguments[4][23][0].apply(exports,arguments) +},{"buffer":38,"dup":23}],57:[function(require,module,exports){ +module.exports = require("./lib/_stream_passthrough.js") + +},{"./lib/_stream_passthrough.js":52}],58:[function(require,module,exports){ +exports = module.exports = require('./lib/_stream_readable.js'); +exports.Stream = require('stream'); +exports.Readable = exports; +exports.Writable = require('./lib/_stream_writable.js'); +exports.Duplex = require('./lib/_stream_duplex.js'); +exports.Transform = require('./lib/_stream_transform.js'); +exports.PassThrough = require('./lib/_stream_passthrough.js'); + +},{"./lib/_stream_duplex.js":51,"./lib/_stream_passthrough.js":52,"./lib/_stream_readable.js":53,"./lib/_stream_transform.js":54,"./lib/_stream_writable.js":55,"stream":61}],59:[function(require,module,exports){ +arguments[4][27][0].apply(exports,arguments) +},{"./lib/_stream_transform.js":54,"dup":27}],60:[function(require,module,exports){ +module.exports = require("./lib/_stream_writable.js") + +},{"./lib/_stream_writable.js":55}],61:[function(require,module,exports){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +module.exports = Stream; + +var EE = require('events').EventEmitter; +var inherits = require('inherits'); + +inherits(Stream, EE); +Stream.Readable = require('readable-stream/readable.js'); +Stream.Writable = require('readable-stream/writable.js'); +Stream.Duplex = require('readable-stream/duplex.js'); +Stream.Transform = require('readable-stream/transform.js'); +Stream.PassThrough = require('readable-stream/passthrough.js'); + +// Backwards-compat with node 0.4.x +Stream.Stream = Stream; + + + +// old-style streams. Note that the pipe method (the only relevant +// part of this class) is overridden in the Readable class. + +function Stream() { + EE.call(this); +} + +Stream.prototype.pipe = function(dest, options) { + var source = this; + + function ondata(chunk) { + if (dest.writable) { + if (false === dest.write(chunk) && source.pause) { + source.pause(); + } + } + } + + source.on('data', ondata); + + function ondrain() { + if (source.readable && source.resume) { + source.resume(); + } + } + + dest.on('drain', ondrain); + + // If the 'end' option is not supplied, dest.end() will be called when + // source gets the 'end' or 'close' events. Only dest.end() once. + if (!dest._isStdio && (!options || options.end !== false)) { + source.on('end', onend); + source.on('close', onclose); + } + + var didOnEnd = false; + function onend() { + if (didOnEnd) return; + didOnEnd = true; + + dest.end(); + } + + + function onclose() { + if (didOnEnd) return; + didOnEnd = true; + + if (typeof dest.destroy === 'function') dest.destroy(); + } + + // don't leave dangling pipes when there are errors. + function onerror(er) { + cleanup(); + if (EE.listenerCount(this, 'error') === 0) { + throw er; // Unhandled stream error in pipe. + } + } + + source.on('error', onerror); + dest.on('error', onerror); + + // remove all the event listeners that were added. + function cleanup() { + source.removeListener('data', ondata); + dest.removeListener('drain', ondrain); + + source.removeListener('end', onend); + source.removeListener('close', onclose); + + source.removeListener('error', onerror); + dest.removeListener('error', onerror); + + source.removeListener('end', cleanup); + source.removeListener('close', cleanup); + + dest.removeListener('close', cleanup); + } + + source.on('end', cleanup); + source.on('close', cleanup); + + dest.on('close', cleanup); + + dest.emit('pipe', source); + + // Allow for unix-like usage: A.pipe(B).pipe(C) + return dest; +}; + +},{"events":42,"inherits":43,"readable-stream/duplex.js":50,"readable-stream/passthrough.js":57,"readable-stream/readable.js":58,"readable-stream/transform.js":59,"readable-stream/writable.js":60}],62:[function(require,module,exports){ +arguments[4][25][0].apply(exports,arguments) +},{"buffer":38,"dup":25}],63:[function(require,module,exports){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +var punycode = require('punycode'); + +exports.parse = urlParse; +exports.resolve = urlResolve; +exports.resolveObject = urlResolveObject; +exports.format = urlFormat; + +exports.Url = Url; + +function Url() { + this.protocol = null; + this.slashes = null; + this.auth = null; + this.host = null; + this.port = null; + this.hostname = null; + this.hash = null; + this.search = null; + this.query = null; + this.pathname = null; + this.path = null; + this.href = null; +} + +// Reference: RFC 3986, RFC 1808, RFC 2396 + +// define these here so at least they only have to be +// compiled once on the first module load. +var protocolPattern = /^([a-z0-9.+-]+:)/i, + portPattern = /:[0-9]*$/, + + // RFC 2396: characters reserved for delimiting URLs. + // We actually just auto-escape these. + delims = ['<', '>', '"', '`', ' ', '\r', '\n', '\t'], + + // RFC 2396: characters not allowed for various reasons. + unwise = ['{', '}', '|', '\\', '^', '`'].concat(delims), + + // Allowed by RFCs, but cause of XSS attacks. Always escape these. + autoEscape = ['\''].concat(unwise), + // Characters that are never ever allowed in a hostname. + // Note that any invalid chars are also handled, but these + // are the ones that are *expected* to be seen, so we fast-path + // them. + nonHostChars = ['%', '/', '?', ';', '#'].concat(autoEscape), + hostEndingChars = ['/', '?', '#'], + hostnameMaxLen = 255, + hostnamePartPattern = /^[a-z0-9A-Z_-]{0,63}$/, + hostnamePartStart = /^([a-z0-9A-Z_-]{0,63})(.*)$/, + // protocols that can allow "unsafe" and "unwise" chars. + unsafeProtocol = { + 'javascript': true, + 'javascript:': true + }, + // protocols that never have a hostname. + hostlessProtocol = { + 'javascript': true, + 'javascript:': true + }, + // protocols that always contain a // bit. + slashedProtocol = { + 'http': true, + 'https': true, + 'ftp': true, + 'gopher': true, + 'file': true, + 'http:': true, + 'https:': true, + 'ftp:': true, + 'gopher:': true, + 'file:': true + }, + querystring = require('querystring'); + +function urlParse(url, parseQueryString, slashesDenoteHost) { + if (url && isObject(url) && url instanceof Url) return url; + + var u = new Url; + u.parse(url, parseQueryString, slashesDenoteHost); + return u; +} + +Url.prototype.parse = function(url, parseQueryString, slashesDenoteHost) { + if (!isString(url)) { + throw new TypeError("Parameter 'url' must be a string, not " + typeof url); + } + + var rest = url; + + // trim before proceeding. + // This is to support parse stuff like " http://foo.com \n" + rest = rest.trim(); + + var proto = protocolPattern.exec(rest); + if (proto) { + proto = proto[0]; + var lowerProto = proto.toLowerCase(); + this.protocol = lowerProto; + rest = rest.substr(proto.length); + } + + // figure out if it's got a host + // user@server is *always* interpreted as a hostname, and url + // resolution will treat //foo/bar as host=foo,path=bar because that's + // how the browser resolves relative URLs. + if (slashesDenoteHost || proto || rest.match(/^\/\/[^@\/]+@[^@\/]+/)) { + var slashes = rest.substr(0, 2) === '//'; + if (slashes && !(proto && hostlessProtocol[proto])) { + rest = rest.substr(2); + this.slashes = true; + } + } + + if (!hostlessProtocol[proto] && + (slashes || (proto && !slashedProtocol[proto]))) { + + // there's a hostname. + // the first instance of /, ?, ;, or # ends the host. + // + // If there is an @ in the hostname, then non-host chars *are* allowed + // to the left of the last @ sign, unless some host-ending character + // comes *before* the @-sign. + // URLs are obnoxious. + // + // ex: + // http://a@b@c/ => user:a@b host:c + // http://a@b?@c => user:a host:c path:/?@c + + // v0.12 TODO(isaacs): This is not quite how Chrome does things. + // Review our test case against browsers more comprehensively. + + // find the first instance of any hostEndingChars + var hostEnd = -1; + for (var i = 0; i < hostEndingChars.length; i++) { + var hec = rest.indexOf(hostEndingChars[i]); + if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) + hostEnd = hec; + } + + // at this point, either we have an explicit point where the + // auth portion cannot go past, or the last @ char is the decider. + var auth, atSign; + if (hostEnd === -1) { + // atSign can be anywhere. + atSign = rest.lastIndexOf('@'); + } else { + // atSign must be in auth portion. + // http://a@b/c@d => host:b auth:a path:/c@d + atSign = rest.lastIndexOf('@', hostEnd); + } + + // Now we have a portion which is definitely the auth. + // Pull that off. + if (atSign !== -1) { + auth = rest.slice(0, atSign); + rest = rest.slice(atSign + 1); + this.auth = decodeURIComponent(auth); + } + + // the host is the remaining to the left of the first non-host char + hostEnd = -1; + for (var i = 0; i < nonHostChars.length; i++) { + var hec = rest.indexOf(nonHostChars[i]); + if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) + hostEnd = hec; + } + // if we still have not hit it, then the entire thing is a host. + if (hostEnd === -1) + hostEnd = rest.length; + + this.host = rest.slice(0, hostEnd); + rest = rest.slice(hostEnd); + + // pull out port. + this.parseHost(); + + // we've indicated that there is a hostname, + // so even if it's empty, it has to be present. + this.hostname = this.hostname || ''; + + // if hostname begins with [ and ends with ] + // assume that it's an IPv6 address. + var ipv6Hostname = this.hostname[0] === '[' && + this.hostname[this.hostname.length - 1] === ']'; + + // validate a little. + if (!ipv6Hostname) { + var hostparts = this.hostname.split(/\./); + for (var i = 0, l = hostparts.length; i < l; i++) { + var part = hostparts[i]; + if (!part) continue; + if (!part.match(hostnamePartPattern)) { + var newpart = ''; + for (var j = 0, k = part.length; j < k; j++) { + if (part.charCodeAt(j) > 127) { + // we replace non-ASCII char with a temporary placeholder + // we need this to make sure size of hostname is not + // broken by replacing non-ASCII by nothing + newpart += 'x'; + } else { + newpart += part[j]; + } + } + // we test again with ASCII char only + if (!newpart.match(hostnamePartPattern)) { + var validParts = hostparts.slice(0, i); + var notHost = hostparts.slice(i + 1); + var bit = part.match(hostnamePartStart); + if (bit) { + validParts.push(bit[1]); + notHost.unshift(bit[2]); + } + if (notHost.length) { + rest = '/' + notHost.join('.') + rest; + } + this.hostname = validParts.join('.'); + break; + } + } + } + } + + if (this.hostname.length > hostnameMaxLen) { + this.hostname = ''; + } else { + // hostnames are always lower case. + this.hostname = this.hostname.toLowerCase(); + } + + if (!ipv6Hostname) { + // IDNA Support: Returns a puny coded representation of "domain". + // It only converts the part of the domain name that + // has non ASCII characters. I.e. it dosent matter if + // you call it with a domain that already is in ASCII. + var domainArray = this.hostname.split('.'); + var newOut = []; + for (var i = 0; i < domainArray.length; ++i) { + var s = domainArray[i]; + newOut.push(s.match(/[^A-Za-z0-9_-]/) ? + 'xn--' + punycode.encode(s) : s); + } + this.hostname = newOut.join('.'); + } + + var p = this.port ? ':' + this.port : ''; + var h = this.hostname || ''; + this.host = h + p; + this.href += this.host; + + // strip [ and ] from the hostname + // the host field still retains them, though + if (ipv6Hostname) { + this.hostname = this.hostname.substr(1, this.hostname.length - 2); + if (rest[0] !== '/') { + rest = '/' + rest; + } + } + } + + // now rest is set to the post-host stuff. + // chop off any delim chars. + if (!unsafeProtocol[lowerProto]) { + + // First, make 100% sure that any "autoEscape" chars get + // escaped, even if encodeURIComponent doesn't think they + // need to be. + for (var i = 0, l = autoEscape.length; i < l; i++) { + var ae = autoEscape[i]; + var esc = encodeURIComponent(ae); + if (esc === ae) { + esc = escape(ae); + } + rest = rest.split(ae).join(esc); + } + } + + + // chop off from the tail first. + var hash = rest.indexOf('#'); + if (hash !== -1) { + // got a fragment string. + this.hash = rest.substr(hash); + rest = rest.slice(0, hash); + } + var qm = rest.indexOf('?'); + if (qm !== -1) { + this.search = rest.substr(qm); + this.query = rest.substr(qm + 1); + if (parseQueryString) { + this.query = querystring.parse(this.query); + } + rest = rest.slice(0, qm); + } else if (parseQueryString) { + // no query string, but parseQueryString still requested + this.search = ''; + this.query = {}; + } + if (rest) this.pathname = rest; + if (slashedProtocol[lowerProto] && + this.hostname && !this.pathname) { + this.pathname = '/'; + } + + //to support http.request + if (this.pathname || this.search) { + var p = this.pathname || ''; + var s = this.search || ''; + this.path = p + s; + } + + // finally, reconstruct the href based on what has been validated. + this.href = this.format(); + return this; +}; + +// format a parsed object into a url string +function urlFormat(obj) { + // ensure it's an object, and not a string url. + // If it's an obj, this is a no-op. + // this way, you can call url_format() on strings + // to clean up potentially wonky urls. + if (isString(obj)) obj = urlParse(obj); + if (!(obj instanceof Url)) return Url.prototype.format.call(obj); + return obj.format(); +} + +Url.prototype.format = function() { + var auth = this.auth || ''; + if (auth) { + auth = encodeURIComponent(auth); + auth = auth.replace(/%3A/i, ':'); + auth += '@'; + } + + var protocol = this.protocol || '', + pathname = this.pathname || '', + hash = this.hash || '', + host = false, + query = ''; + + if (this.host) { + host = auth + this.host; + } else if (this.hostname) { + host = auth + (this.hostname.indexOf(':') === -1 ? + this.hostname : + '[' + this.hostname + ']'); + if (this.port) { + host += ':' + this.port; + } + } + + if (this.query && + isObject(this.query) && + Object.keys(this.query).length) { + query = querystring.stringify(this.query); + } + + var search = this.search || (query && ('?' + query)) || ''; + + if (protocol && protocol.substr(-1) !== ':') protocol += ':'; + + // only the slashedProtocols get the //. Not mailto:, xmpp:, etc. + // unless they had them to begin with. + if (this.slashes || + (!protocol || slashedProtocol[protocol]) && host !== false) { + host = '//' + (host || ''); + if (pathname && pathname.charAt(0) !== '/') pathname = '/' + pathname; + } else if (!host) { + host = ''; + } + + if (hash && hash.charAt(0) !== '#') hash = '#' + hash; + if (search && search.charAt(0) !== '?') search = '?' + search; + + pathname = pathname.replace(/[?#]/g, function(match) { + return encodeURIComponent(match); + }); + search = search.replace('#', '%23'); + + return protocol + host + pathname + search + hash; +}; + +function urlResolve(source, relative) { + return urlParse(source, false, true).resolve(relative); +} + +Url.prototype.resolve = function(relative) { + return this.resolveObject(urlParse(relative, false, true)).format(); +}; + +function urlResolveObject(source, relative) { + if (!source) return relative; + return urlParse(source, false, true).resolveObject(relative); +} + +Url.prototype.resolveObject = function(relative) { + if (isString(relative)) { + var rel = new Url(); + rel.parse(relative, false, true); + relative = rel; + } + + var result = new Url(); + Object.keys(this).forEach(function(k) { + result[k] = this[k]; + }, this); + + // hash is always overridden, no matter what. + // even href="" will remove it. + result.hash = relative.hash; + + // if the relative url is empty, then there's nothing left to do here. + if (relative.href === '') { + result.href = result.format(); + return result; + } + + // hrefs like //foo/bar always cut to the protocol. + if (relative.slashes && !relative.protocol) { + // take everything except the protocol from relative + Object.keys(relative).forEach(function(k) { + if (k !== 'protocol') + result[k] = relative[k]; + }); + + //urlParse appends trailing / to urls like http://www.example.com + if (slashedProtocol[result.protocol] && + result.hostname && !result.pathname) { + result.path = result.pathname = '/'; + } + + result.href = result.format(); + return result; + } + + if (relative.protocol && relative.protocol !== result.protocol) { + // if it's a known url protocol, then changing + // the protocol does weird things + // first, if it's not file:, then we MUST have a host, + // and if there was a path + // to begin with, then we MUST have a path. + // if it is file:, then the host is dropped, + // because that's known to be hostless. + // anything else is assumed to be absolute. + if (!slashedProtocol[relative.protocol]) { + Object.keys(relative).forEach(function(k) { + result[k] = relative[k]; + }); + result.href = result.format(); + return result; + } + + result.protocol = relative.protocol; + if (!relative.host && !hostlessProtocol[relative.protocol]) { + var relPath = (relative.pathname || '').split('/'); + while (relPath.length && !(relative.host = relPath.shift())); + if (!relative.host) relative.host = ''; + if (!relative.hostname) relative.hostname = ''; + if (relPath[0] !== '') relPath.unshift(''); + if (relPath.length < 2) relPath.unshift(''); + result.pathname = relPath.join('/'); + } else { + result.pathname = relative.pathname; + } + result.search = relative.search; + result.query = relative.query; + result.host = relative.host || ''; + result.auth = relative.auth; + result.hostname = relative.hostname || relative.host; + result.port = relative.port; + // to support http.request + if (result.pathname || result.search) { + var p = result.pathname || ''; + var s = result.search || ''; + result.path = p + s; + } + result.slashes = result.slashes || relative.slashes; + result.href = result.format(); + return result; + } + + var isSourceAbs = (result.pathname && result.pathname.charAt(0) === '/'), + isRelAbs = ( + relative.host || + relative.pathname && relative.pathname.charAt(0) === '/' + ), + mustEndAbs = (isRelAbs || isSourceAbs || + (result.host && relative.pathname)), + removeAllDots = mustEndAbs, + srcPath = result.pathname && result.pathname.split('/') || [], + relPath = relative.pathname && relative.pathname.split('/') || [], + psychotic = result.protocol && !slashedProtocol[result.protocol]; + + // if the url is a non-slashed url, then relative + // links like ../.. should be able + // to crawl up to the hostname, as well. This is strange. + // result.protocol has already been set by now. + // Later on, put the first path part into the host field. + if (psychotic) { + result.hostname = ''; + result.port = null; + if (result.host) { + if (srcPath[0] === '') srcPath[0] = result.host; + else srcPath.unshift(result.host); + } + result.host = ''; + if (relative.protocol) { + relative.hostname = null; + relative.port = null; + if (relative.host) { + if (relPath[0] === '') relPath[0] = relative.host; + else relPath.unshift(relative.host); + } + relative.host = null; + } + mustEndAbs = mustEndAbs && (relPath[0] === '' || srcPath[0] === ''); + } + + if (isRelAbs) { + // it's absolute. + result.host = (relative.host || relative.host === '') ? + relative.host : result.host; + result.hostname = (relative.hostname || relative.hostname === '') ? + relative.hostname : result.hostname; + result.search = relative.search; + result.query = relative.query; + srcPath = relPath; + // fall through to the dot-handling below. + } else if (relPath.length) { + // it's relative + // throw away the existing file, and take the new path instead. + if (!srcPath) srcPath = []; + srcPath.pop(); + srcPath = srcPath.concat(relPath); + result.search = relative.search; + result.query = relative.query; + } else if (!isNullOrUndefined(relative.search)) { + // just pull out the search. + // like href='?foo'. + // Put this after the other two cases because it simplifies the booleans + if (psychotic) { + result.hostname = result.host = srcPath.shift(); + //occationaly the auth can get stuck only in host + //this especialy happens in cases like + //url.resolveObject('mailto:local1@domain1', 'local2@domain2') + var authInHost = result.host && result.host.indexOf('@') > 0 ? + result.host.split('@') : false; + if (authInHost) { + result.auth = authInHost.shift(); + result.host = result.hostname = authInHost.shift(); + } + } + result.search = relative.search; + result.query = relative.query; + //to support http.request + if (!isNull(result.pathname) || !isNull(result.search)) { + result.path = (result.pathname ? result.pathname : '') + + (result.search ? result.search : ''); + } + result.href = result.format(); + return result; + } + + if (!srcPath.length) { + // no path at all. easy. + // we've already handled the other stuff above. + result.pathname = null; + //to support http.request + if (result.search) { + result.path = '/' + result.search; + } else { + result.path = null; + } + result.href = result.format(); + return result; + } + + // if a url ENDs in . or .., then it must get a trailing slash. + // however, if it ends in anything else non-slashy, + // then it must NOT get a trailing slash. + var last = srcPath.slice(-1)[0]; + var hasTrailingSlash = ( + (result.host || relative.host) && (last === '.' || last === '..') || + last === ''); + + // strip single dots, resolve double dots to parent dir + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = srcPath.length; i >= 0; i--) { + last = srcPath[i]; + if (last == '.') { + srcPath.splice(i, 1); + } else if (last === '..') { + srcPath.splice(i, 1); + up++; + } else if (up) { + srcPath.splice(i, 1); + up--; + } + } + + // if the path is allowed to go above the root, restore leading ..s + if (!mustEndAbs && !removeAllDots) { + for (; up--; up) { + srcPath.unshift('..'); + } + } + + if (mustEndAbs && srcPath[0] !== '' && + (!srcPath[0] || srcPath[0].charAt(0) !== '/')) { + srcPath.unshift(''); + } + + if (hasTrailingSlash && (srcPath.join('/').substr(-1) !== '/')) { + srcPath.push(''); + } + + var isAbsolute = srcPath[0] === '' || + (srcPath[0] && srcPath[0].charAt(0) === '/'); + + // put the host back + if (psychotic) { + result.hostname = result.host = isAbsolute ? '' : + srcPath.length ? srcPath.shift() : ''; + //occationaly the auth can get stuck only in host + //this especialy happens in cases like + //url.resolveObject('mailto:local1@domain1', 'local2@domain2') + var authInHost = result.host && result.host.indexOf('@') > 0 ? + result.host.split('@') : false; + if (authInHost) { + result.auth = authInHost.shift(); + result.host = result.hostname = authInHost.shift(); + } + } + + mustEndAbs = mustEndAbs || (result.host && srcPath.length); + + if (mustEndAbs && !isAbsolute) { + srcPath.unshift(''); + } + + if (!srcPath.length) { + result.pathname = null; + result.path = null; + } else { + result.pathname = srcPath.join('/'); + } + + //to support request.http + if (!isNull(result.pathname) || !isNull(result.search)) { + result.path = (result.pathname ? result.pathname : '') + + (result.search ? result.search : ''); + } + result.auth = relative.auth || result.auth; + result.slashes = result.slashes || relative.slashes; + result.href = result.format(); + return result; +}; + +Url.prototype.parseHost = function() { + var host = this.host; + var port = portPattern.exec(host); + if (port) { + port = port[0]; + if (port !== ':') { + this.port = port.substr(1); + } + host = host.substr(0, host.length - port.length); + } + if (host) this.hostname = host; +}; + +function isString(arg) { + return typeof arg === "string"; +} + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} + +function isNull(arg) { + return arg === null; +} +function isNullOrUndefined(arg) { + return arg == null; +} + +},{"punycode":46,"querystring":49}],64:[function(require,module,exports){ +module.exports = function isBuffer(arg) { + return arg && typeof arg === 'object' + && typeof arg.copy === 'function' + && typeof arg.fill === 'function' + && typeof arg.readUInt8 === 'function'; +} +},{}],65:[function(require,module,exports){ +(function (process,global){ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +var formatRegExp = /%[sdj%]/g; +exports.format = function(f) { + if (!isString(f)) { + var objects = []; + for (var i = 0; i < arguments.length; i++) { + objects.push(inspect(arguments[i])); + } + return objects.join(' '); + } + + var i = 1; + var args = arguments; + var len = args.length; + var str = String(f).replace(formatRegExp, function(x) { + if (x === '%%') return '%'; + if (i >= len) return x; + switch (x) { + case '%s': return String(args[i++]); + case '%d': return Number(args[i++]); + case '%j': + try { + return JSON.stringify(args[i++]); + } catch (_) { + return '[Circular]'; + } + default: + return x; + } + }); + for (var x = args[i]; i < len; x = args[++i]) { + if (isNull(x) || !isObject(x)) { + str += ' ' + x; + } else { + str += ' ' + inspect(x); + } + } + return str; +}; + + +// Mark that a method should not be used. +// Returns a modified function which warns once by default. +// If --no-deprecation is set, then it is a no-op. +exports.deprecate = function(fn, msg) { + // Allow for deprecating things in the process of starting up. + if (isUndefined(global.process)) { + return function() { + return exports.deprecate(fn, msg).apply(this, arguments); + }; + } + + if (process.noDeprecation === true) { + return fn; + } + + var warned = false; + function deprecated() { + if (!warned) { + if (process.throwDeprecation) { + throw new Error(msg); + } else if (process.traceDeprecation) { + console.trace(msg); + } else { + console.error(msg); + } + warned = true; + } + return fn.apply(this, arguments); + } + + return deprecated; +}; + + +var debugs = {}; +var debugEnviron; +exports.debuglog = function(set) { + if (isUndefined(debugEnviron)) + debugEnviron = process.env.NODE_DEBUG || ''; + set = set.toUpperCase(); + if (!debugs[set]) { + if (new RegExp('\\b' + set + '\\b', 'i').test(debugEnviron)) { + var pid = process.pid; + debugs[set] = function() { + var msg = exports.format.apply(exports, arguments); + console.error('%s %d: %s', set, pid, msg); + }; + } else { + debugs[set] = function() {}; + } + } + return debugs[set]; +}; + + +/** + * Echos the value of a value. Trys to print the value out + * in the best way possible given the different types. + * + * @param {Object} obj The object to print out. + * @param {Object} opts Optional options object that alters the output. + */ +/* legacy: obj, showHidden, depth, colors*/ +function inspect(obj, opts) { + // default options + var ctx = { + seen: [], + stylize: stylizeNoColor + }; + // legacy... + if (arguments.length >= 3) ctx.depth = arguments[2]; + if (arguments.length >= 4) ctx.colors = arguments[3]; + if (isBoolean(opts)) { + // legacy... + ctx.showHidden = opts; + } else if (opts) { + // got an "options" object + exports._extend(ctx, opts); + } + // set default options + if (isUndefined(ctx.showHidden)) ctx.showHidden = false; + if (isUndefined(ctx.depth)) ctx.depth = 2; + if (isUndefined(ctx.colors)) ctx.colors = false; + if (isUndefined(ctx.customInspect)) ctx.customInspect = true; + if (ctx.colors) ctx.stylize = stylizeWithColor; + return formatValue(ctx, obj, ctx.depth); +} +exports.inspect = inspect; + + +// http://en.wikipedia.org/wiki/ANSI_escape_code#graphics +inspect.colors = { + 'bold' : [1, 22], + 'italic' : [3, 23], + 'underline' : [4, 24], + 'inverse' : [7, 27], + 'white' : [37, 39], + 'grey' : [90, 39], + 'black' : [30, 39], + 'blue' : [34, 39], + 'cyan' : [36, 39], + 'green' : [32, 39], + 'magenta' : [35, 39], + 'red' : [31, 39], + 'yellow' : [33, 39] +}; + +// Don't use 'blue' not visible on cmd.exe +inspect.styles = { + 'special': 'cyan', + 'number': 'yellow', + 'boolean': 'yellow', + 'undefined': 'grey', + 'null': 'bold', + 'string': 'green', + 'date': 'magenta', + // "name": intentionally not styling + 'regexp': 'red' +}; + + +function stylizeWithColor(str, styleType) { + var style = inspect.styles[styleType]; + + if (style) { + return '\u001b[' + inspect.colors[style][0] + 'm' + str + + '\u001b[' + inspect.colors[style][1] + 'm'; + } else { + return str; + } +} + + +function stylizeNoColor(str, styleType) { + return str; +} + + +function arrayToHash(array) { + var hash = {}; + + array.forEach(function(val, idx) { + hash[val] = true; + }); + + return hash; +} + + +function formatValue(ctx, value, recurseTimes) { + // Provide a hook for user-specified inspect functions. + // Check that value is an object with an inspect function on it + if (ctx.customInspect && + value && + isFunction(value.inspect) && + // Filter out the util module, it's inspect function is special + value.inspect !== exports.inspect && + // Also filter out any prototype objects using the circular check. + !(value.constructor && value.constructor.prototype === value)) { + var ret = value.inspect(recurseTimes, ctx); + if (!isString(ret)) { + ret = formatValue(ctx, ret, recurseTimes); + } + return ret; + } + + // Primitive types cannot have properties + var primitive = formatPrimitive(ctx, value); + if (primitive) { + return primitive; + } + + // Look up the keys of the object. + var keys = Object.keys(value); + var visibleKeys = arrayToHash(keys); + + if (ctx.showHidden) { + keys = Object.getOwnPropertyNames(value); + } + + // IE doesn't make error fields non-enumerable + // http://msdn.microsoft.com/en-us/library/ie/dww52sbt(v=vs.94).aspx + if (isError(value) + && (keys.indexOf('message') >= 0 || keys.indexOf('description') >= 0)) { + return formatError(value); + } + + // Some type of object without properties can be shortcutted. + if (keys.length === 0) { + if (isFunction(value)) { + var name = value.name ? ': ' + value.name : ''; + return ctx.stylize('[Function' + name + ']', 'special'); + } + if (isRegExp(value)) { + return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); + } + if (isDate(value)) { + return ctx.stylize(Date.prototype.toString.call(value), 'date'); + } + if (isError(value)) { + return formatError(value); + } + } + + var base = '', array = false, braces = ['{', '}']; + + // Make Array say that they are Array + if (isArray(value)) { + array = true; + braces = ['[', ']']; + } + + // Make functions say that they are functions + if (isFunction(value)) { + var n = value.name ? ': ' + value.name : ''; + base = ' [Function' + n + ']'; + } + + // Make RegExps say that they are RegExps + if (isRegExp(value)) { + base = ' ' + RegExp.prototype.toString.call(value); + } + + // Make dates with properties first say the date + if (isDate(value)) { + base = ' ' + Date.prototype.toUTCString.call(value); + } + + // Make error with message first say the error + if (isError(value)) { + base = ' ' + formatError(value); + } + + if (keys.length === 0 && (!array || value.length == 0)) { + return braces[0] + base + braces[1]; + } + + if (recurseTimes < 0) { + if (isRegExp(value)) { + return ctx.stylize(RegExp.prototype.toString.call(value), 'regexp'); + } else { + return ctx.stylize('[Object]', 'special'); + } + } + + ctx.seen.push(value); + + var output; + if (array) { + output = formatArray(ctx, value, recurseTimes, visibleKeys, keys); + } else { + output = keys.map(function(key) { + return formatProperty(ctx, value, recurseTimes, visibleKeys, key, array); + }); + } + + ctx.seen.pop(); + + return reduceToSingleString(output, base, braces); +} + + +function formatPrimitive(ctx, value) { + if (isUndefined(value)) + return ctx.stylize('undefined', 'undefined'); + if (isString(value)) { + var simple = '\'' + JSON.stringify(value).replace(/^"|"$/g, '') + .replace(/'/g, "\\'") + .replace(/\\"/g, '"') + '\''; + return ctx.stylize(simple, 'string'); + } + if (isNumber(value)) + return ctx.stylize('' + value, 'number'); + if (isBoolean(value)) + return ctx.stylize('' + value, 'boolean'); + // For some reason typeof null is "object", so special case here. + if (isNull(value)) + return ctx.stylize('null', 'null'); +} + + +function formatError(value) { + return '[' + Error.prototype.toString.call(value) + ']'; +} + + +function formatArray(ctx, value, recurseTimes, visibleKeys, keys) { + var output = []; + for (var i = 0, l = value.length; i < l; ++i) { + if (hasOwnProperty(value, String(i))) { + output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, + String(i), true)); + } else { + output.push(''); + } + } + keys.forEach(function(key) { + if (!key.match(/^\d+$/)) { + output.push(formatProperty(ctx, value, recurseTimes, visibleKeys, + key, true)); + } + }); + return output; +} + + +function formatProperty(ctx, value, recurseTimes, visibleKeys, key, array) { + var name, str, desc; + desc = Object.getOwnPropertyDescriptor(value, key) || { value: value[key] }; + if (desc.get) { + if (desc.set) { + str = ctx.stylize('[Getter/Setter]', 'special'); + } else { + str = ctx.stylize('[Getter]', 'special'); + } + } else { + if (desc.set) { + str = ctx.stylize('[Setter]', 'special'); + } + } + if (!hasOwnProperty(visibleKeys, key)) { + name = '[' + key + ']'; + } + if (!str) { + if (ctx.seen.indexOf(desc.value) < 0) { + if (isNull(recurseTimes)) { + str = formatValue(ctx, desc.value, null); + } else { + str = formatValue(ctx, desc.value, recurseTimes - 1); + } + if (str.indexOf('\n') > -1) { + if (array) { + str = str.split('\n').map(function(line) { + return ' ' + line; + }).join('\n').substr(2); + } else { + str = '\n' + str.split('\n').map(function(line) { + return ' ' + line; + }).join('\n'); + } + } + } else { + str = ctx.stylize('[Circular]', 'special'); + } + } + if (isUndefined(name)) { + if (array && key.match(/^\d+$/)) { + return str; + } + name = JSON.stringify('' + key); + if (name.match(/^"([a-zA-Z_][a-zA-Z_0-9]*)"$/)) { + name = name.substr(1, name.length - 2); + name = ctx.stylize(name, 'name'); + } else { + name = name.replace(/'/g, "\\'") + .replace(/\\"/g, '"') + .replace(/(^"|"$)/g, "'"); + name = ctx.stylize(name, 'string'); + } + } + + return name + ': ' + str; +} + + +function reduceToSingleString(output, base, braces) { + var numLinesEst = 0; + var length = output.reduce(function(prev, cur) { + numLinesEst++; + if (cur.indexOf('\n') >= 0) numLinesEst++; + return prev + cur.replace(/\u001b\[\d\d?m/g, '').length + 1; + }, 0); + + if (length > 60) { + return braces[0] + + (base === '' ? '' : base + '\n ') + + ' ' + + output.join(',\n ') + + ' ' + + braces[1]; + } + + return braces[0] + base + ' ' + output.join(', ') + ' ' + braces[1]; +} + + +// NOTE: These type checking functions intentionally don't use `instanceof` +// because it is fragile and can be easily faked with `Object.create()`. +function isArray(ar) { + return Array.isArray(ar); +} +exports.isArray = isArray; + +function isBoolean(arg) { + return typeof arg === 'boolean'; +} +exports.isBoolean = isBoolean; + +function isNull(arg) { + return arg === null; +} +exports.isNull = isNull; + +function isNullOrUndefined(arg) { + return arg == null; +} +exports.isNullOrUndefined = isNullOrUndefined; + +function isNumber(arg) { + return typeof arg === 'number'; +} +exports.isNumber = isNumber; + +function isString(arg) { + return typeof arg === 'string'; +} +exports.isString = isString; + +function isSymbol(arg) { + return typeof arg === 'symbol'; +} +exports.isSymbol = isSymbol; + +function isUndefined(arg) { + return arg === void 0; +} +exports.isUndefined = isUndefined; + +function isRegExp(re) { + return isObject(re) && objectToString(re) === '[object RegExp]'; +} +exports.isRegExp = isRegExp; + +function isObject(arg) { + return typeof arg === 'object' && arg !== null; +} +exports.isObject = isObject; + +function isDate(d) { + return isObject(d) && objectToString(d) === '[object Date]'; +} +exports.isDate = isDate; + +function isError(e) { + return isObject(e) && + (objectToString(e) === '[object Error]' || e instanceof Error); +} +exports.isError = isError; + +function isFunction(arg) { + return typeof arg === 'function'; +} +exports.isFunction = isFunction; + +function isPrimitive(arg) { + return arg === null || + typeof arg === 'boolean' || + typeof arg === 'number' || + typeof arg === 'string' || + typeof arg === 'symbol' || // ES6 symbol + typeof arg === 'undefined'; +} +exports.isPrimitive = isPrimitive; + +exports.isBuffer = require('./support/isBuffer'); + +function objectToString(o) { + return Object.prototype.toString.call(o); +} + + +function pad(n) { + return n < 10 ? '0' + n.toString(10) : n.toString(10); +} + + +var months = ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', + 'Oct', 'Nov', 'Dec']; + +// 26 Feb 16:19:34 +function timestamp() { + var d = new Date(); + var time = [pad(d.getHours()), + pad(d.getMinutes()), + pad(d.getSeconds())].join(':'); + return [d.getDate(), months[d.getMonth()], time].join(' '); +} + + +// log is just a thin wrapper to console.log that prepends a timestamp +exports.log = function() { + console.log('%s - %s', timestamp(), exports.format.apply(exports, arguments)); +}; + + +/** + * Inherit the prototype methods from one constructor into another. + * + * The Function.prototype.inherits from lang.js rewritten as a standalone + * function (not on Function.prototype). NOTE: If this file is to be loaded + * during bootstrapping this function needs to be rewritten using some native + * functions as prototype setup using normal JavaScript does not work as + * expected during bootstrapping (see mirror.js in r114903). + * + * @param {function} ctor Constructor function which needs to inherit the + * prototype. + * @param {function} superCtor Constructor function to inherit prototype from. + */ +exports.inherits = require('inherits'); + +exports._extend = function(origin, add) { + // Don't do anything if add isn't an object + if (!add || !isObject(add)) return origin; + + var keys = Object.keys(add); + var i = keys.length; + while (i--) { + origin[keys[i]] = add[keys[i]]; + } + return origin; +}; + +function hasOwnProperty(obj, prop) { + return Object.prototype.hasOwnProperty.call(obj, prop); +} + +}).call(this,require('_process'),typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : {}) +},{"./support/isBuffer":64,"_process":45,"inherits":43}]},{},[6])(6) +}); \ No newline at end of file diff --git a/map-chat/javascript/html-sanitizer-minified.js b/map-chat/javascript/html-sanitizer-minified.js new file mode 100644 index 0000000000..3b27417248 --- /dev/null +++ b/map-chat/javascript/html-sanitizer-minified.js @@ -0,0 +1,25 @@ +(function(){var o=null,q={e:{NONE:0,URI:1,URI_FRAGMENT:11,SCRIPT:2,STYLE:3,ID:4,IDREF:5,IDREFS:6,GLOBAL_NAME:7,LOCAL_NAME:8,CLASSES:9,FRAME_TARGET:10},k:{"*::class":9,"*::dir":0,"*::id":4,"*::lang":0,"*::onclick":2,"*::ondblclick":2,"*::onkeydown":2,"*::onkeypress":2,"*::onkeyup":2,"*::onload":2,"*::onmousedown":2,"*::onmousemove":2,"*::onmouseout":2,"*::onmouseover":2,"*::onmouseup":2,"*::onscroll":2,"*::style":3,"*::title":0,"a::accesskey":0,"a::coords":0,"a::href":1,"a::hreflang":0,"a::name":7,"a::onblur":2, +"a::onfocus":2,"a::rel":0,"a::rev":0,"a::shape":0,"a::tabindex":0,"a::target":10,"a::type":0,"area::accesskey":0,"area::alt":0,"area::coords":0,"area::href":1,"area::nohref":0,"area::onblur":2,"area::onfocus":2,"area::shape":0,"area::tabindex":0,"area::target":10,"bdo::dir":0,"blockquote::cite":1,"br::clear":0,"button::accesskey":0,"button::disabled":0,"button::name":8,"button::onblur":2,"button::onfocus":2,"button::tabindex":0,"button::type":0,"button::value":0,"canvas::height":0,"canvas::width":0, +"caption::align":0,"col::align":0,"col::char":0,"col::charoff":0,"col::span":0,"col::valign":0,"col::width":0,"colgroup::align":0,"colgroup::char":0,"colgroup::charoff":0,"colgroup::span":0,"colgroup::valign":0,"colgroup::width":0,"del::cite":1,"del::datetime":0,"dir::compact":0,"div::align":0,"dl::compact":0,"font::color":0,"font::face":0,"font::size":0,"form::accept":0,"form::action":1,"form::autocomplete":0,"form::enctype":0,"form::method":0,"form::name":7,"form::onreset":2,"form::onsubmit":2, +"form::target":10,"h1::align":0,"h2::align":0,"h3::align":0,"h4::align":0,"h5::align":0,"h6::align":0,"hr::align":0,"hr::noshade":0,"hr::size":0,"hr::width":0,"iframe::align":0,"iframe::frameborder":0,"iframe::height":0,"iframe::marginheight":0,"iframe::marginwidth":0,"iframe::width":0,"img::align":0,"img::alt":0,"img::border":0,"img::height":0,"img::hspace":0,"img::ismap":0,"img::name":7,"img::src":1,"img::usemap":11,"img::vspace":0,"img::width":0,"input::accept":0,"input::accesskey":0,"input::align":0, +"input::alt":0,"input::autocomplete":0,"input::checked":0,"input::disabled":0,"input::ismap":0,"input::maxlength":0,"input::name":8,"input::onblur":2,"input::onchange":2,"input::onfocus":2,"input::onselect":2,"input::readonly":0,"input::size":0,"input::src":1,"input::tabindex":0,"input::type":0,"input::usemap":11,"input::value":0,"ins::cite":1,"ins::datetime":0,"label::accesskey":0,"label::for":5,"label::onblur":2,"label::onfocus":2,"legend::accesskey":0,"legend::align":0,"li::type":0,"li::value":0, +"map::name":7,"menu::compact":0,"ol::compact":0,"ol::start":0,"ol::type":0,"optgroup::disabled":0,"optgroup::label":0,"option::disabled":0,"option::label":0,"option::selected":0,"option::value":0,"p::align":0,"pre::width":0,"q::cite":1,"select::disabled":0,"select::multiple":0,"select::name":8,"select::onblur":2,"select::onchange":2,"select::onfocus":2,"select::size":0,"select::tabindex":0,"table::align":0,"table::bgcolor":0,"table::border":0,"table::cellpadding":0,"table::cellspacing":0,"table::frame":0, +"table::rules":0,"table::summary":0,"table::width":0,"tbody::align":0,"tbody::char":0,"tbody::charoff":0,"tbody::valign":0,"td::abbr":0,"td::align":0,"td::axis":0,"td::bgcolor":0,"td::char":0,"td::charoff":0,"td::colspan":0,"td::headers":6,"td::height":0,"td::nowrap":0,"td::rowspan":0,"td::scope":0,"td::valign":0,"td::width":0,"textarea::accesskey":0,"textarea::cols":0,"textarea::disabled":0,"textarea::name":8,"textarea::onblur":2,"textarea::onchange":2,"textarea::onfocus":2,"textarea::onselect":2, +"textarea::readonly":0,"textarea::rows":0,"textarea::tabindex":0,"tfoot::align":0,"tfoot::char":0,"tfoot::charoff":0,"tfoot::valign":0,"th::abbr":0,"th::align":0,"th::axis":0,"th::bgcolor":0,"th::char":0,"th::charoff":0,"th::colspan":0,"th::headers":6,"th::height":0,"th::nowrap":0,"th::rowspan":0,"th::scope":0,"th::valign":0,"th::width":0,"thead::align":0,"thead::char":0,"thead::charoff":0,"thead::valign":0,"tr::align":0,"tr::bgcolor":0,"tr::char":0,"tr::charoff":0,"tr::valign":0,"ul::compact":0, +"ul::type":0},d:{OPTIONAL_ENDTAG:1,EMPTY:2,CDATA:4,RCDATA:8,UNSAFE:16,FOLDABLE:32,SCRIPT:64,STYLE:128},f:{a:0,abbr:0,acronym:0,address:0,applet:16,area:2,article:16,aside:16,audio:16,b:0,base:18,basefont:18,bdi:16,bdo:0,big:0,blockquote:0,body:49,br:2,button:0,canvas:0,caption:0,center:0,cite:0,code:0,col:2,colgroup:1,data:16,datalist:16,dd:1,del:0,details:16,dfn:0,dir:0,div:0,dl:0,dt:1,em:0,fieldset:0,figcaption:16,figure:16,font:0,footer:16,form:0,frame:18,frameset:16,h1:0,h2:0,h3:0,h4:0,h5:0,h6:0, +head:49,header:16,hgroup:16,hr:2,html:49,i:0,iframe:4,img:2,input:2,ins:0,isindex:18,kbd:0,label:0,legend:0,li:1,link:18,map:0,mark:16,menu:0,meta:18,meter:16,nav:0,nobr:0,noembed:4,noframes:20,noscript:20,object:16,ol:0,optgroup:0,option:1,output:16,p:1,param:18,pre:0,progress:16,q:0,s:0,samp:0,script:84,section:16,select:0,small:0,span:0,strike:0,strong:0,style:148,sub:0,summary:16,sup:0,table:0,tbody:1,td:1,textarea:8,tfoot:1,th:1,thead:1,time:16,title:24,tr:1,tt:0,u:0,ul:0,"var":0,video:16},A:{NOT_LOADED:0, +SAME_DOCUMENT:1,NEW_DOCUMENT:2},w:{"a::href":2,"area::href":2,"blockquote::cite":0,"body::background":1,"del::cite":0,"form::action":2,"img::src":1,"input::src":1,"ins::cite":0,"q::cite":0},z:{UNSANDBOXED:2,SANDBOXED:1,DATA:0},v:{"a::href":2,"area::href":2,"blockquote::cite":2,"body::background":1,"del::cite":2,"form::action":2,"img::src":1,"input::src":1,"ins::cite":2,"q::cite":2}};q.ATTRIBS=q.k;q.ELEMENTS=q.f;q.URIEFFECTS=q.w;q.LOADERTYPES=q.v;q.atype=q.e;q.eflags=q.d;q.ltypes=q.z;q.ueffects=q.A; +"undefined"!==typeof window&&(window.html4=q);var R=function(h){function S(a,d){var b;b=d.toLowerCase();if(w.hasOwnProperty(b))b=w[b];else{var e=b.match(T);b=e?String.fromCharCode(parseInt(e[1],10)):(e=b.match(U))?String.fromCharCode(parseInt(e[1],16)):""}return b}function x(a){return a.replace(V,S)}function y(a){return(""+a).replace(W,"&").replace(B,"<").replace(C,">").replace(X,""")}function D(a){return a.replace(Y,"&$1").replace(B,"<").replace(C,">")}function E(a){var d={l:a.l||a.cdata,m:a.m||a.comment,n:a.n||a.endDoc, +h:a.h||a.endTag,c:a.c||a.pcdata,r:a.r||a.rcdata,t:a.t||a.startDoc,j:a.j||a.startTag};return function(a,e){var c;var k=/(<\/|<\!--|<[!?]|[&<>])/g;c=a+"";if(Z)c=c.split(k);else{for(var f=[],g=0,h;(h=k.exec(c))!==o;)f.push(c.substring(g,h.index)),f.push(h[0]),g=h.index+h[0].length;f.push(c.substring(g));c=f}F(d,c,0,{g:!1,o:!1},e)}}function m(a,d,b,e,c){return function(){F(a,d,b,e,c)}}function F(a,d,b,e,c){try{a.t&&0==b&&a.t(c);for(var k,f,g,l=d.length;b"===d[b+1])b+=2,g=k[1].toLowerCase(),a.h&&a.h(g,c,n,m(a,d,b,e,c));else{var r=d,s=b,t=a,p=c,A=n,z=e,v=G(r,s);v?(t.h&&t.h(v.name,p,A,m(t,r,s,z,p)),b=v.next):b=r.length}else a.c&&a.c("</",c,n,m(a,d,b,e,c));break;case "<":if(k=/^([\w:]+)\s*\/?/.exec(i))if(k[0].length===i.length&&">"===d[b+1]){b+=2;g=k[1].toLowerCase();a.j&&a.j(g,[],c,n,m(a,d,b,e,c)); +var w=h.f[g];w&H&&(b=I(d,{name:g,next:b,d:w},a,c,n,e))}else{var r=d,s=a,t=c,p=n,A=e,u=G(r,b);u?(s.j&&s.j(u.name,u.B,t,p,m(s,r,u.next,A,t)),b=u.d&H?I(r,u,s,t,p,A):u.next):b=r.length}else a.c&&a.c("<",c,n,m(a,d,b,e,c));break;case "<\!--":if(!e.o){for(f=b+1;f"===d[f]&&/--$/.test(d[f-1]));f++);if(f"!==d[f];f++);f"!==d[f];f++);f":a.c&&a.c(">",c,n,m(a,d,b,e,c));break;case "":break;default:a.c&&a.c(j,c,n,m(a,d,b,e,c))}}a.n&&a.n(c)}catch(y){if(y!==n)throw y;}}function I(a,d,b,e,c,k){var f=a.length;z.hasOwnProperty(d.name)||(z[d.name]=RegExp("^"+d.name+"(?:[\\s\\/]|$)","i"));for(var g= +z[d.name],l=d.next,j=d.next+1;j"!==a[k];k++)c+=a[k];if(!(f<=k)){for(var g=[];""!==c;)if(b=aa.exec(c))if(b[4]&&!b[5]||b[6]&&!b[7]){for(var b= +b[4]||b[6],l=!1,c=[c,a[k++]];k"===a[k])break}else 0<=a[k].indexOf(b)&&(l=!0);c.push(a[k])}if(f<=k)break;c=c.join("")}else{var l=b[1].toLowerCase(),j;if(b[2]){j=b[3];var i=j.charCodeAt(0);if(34===i||39===i)j=j.substr(1,j.length-2);j=x(j.replace(ba,""))}else j=l;g.push(l,j);c=c.substr(b[0].length)}else c=c.replace(/^[\s\S][^a-z\s]*/,"");e.B=g;e.next=k+1;return e}}function J(a){function d(a,b){e||b.push(a)}var b,e;return E({startDoc:function(){b=[];e=!1},startTag:function(c,d,f){if(!e&& +h.f.hasOwnProperty(c)){var g=h.f[c];if(!(g&h.d.FOLDABLE))if(d=a(c,d)){g&h.d.EMPTY||b.push(c);f.push("<",c);c=0;for(g=d.length;c")}else e=!(g&h.d.EMPTY)}},endTag:function(a,d){if(e)e=!1;else if(h.f.hasOwnProperty(a)){var f=h.f[a];if(!(f&(h.d.EMPTY|h.d.FOLDABLE))){if(f&h.d.OPTIONAL_ENDTAG)for(f=b.length;0<=--f;){var g=b[f];if(g===a)break;if(!(h.f[g]&h.d.OPTIONAL_ENDTAG))return}else for(f=b.length;0<=--f&&b[f]!==a;); +if(!(0>f)){for(var i=b.length;--i>f;)g=b[i],h.f[g]&h.d.OPTIONAL_ENDTAG||d.push("");b.length=f;d.push("")}}}},pcdata:d,rcdata:d,cdata:d,endDoc:function(a){for(;b.length;b.length--)a.push("")}})}function K(a,d,b,e,c){if(!c)return o;var h=(""+a).match(ca);return h&&(!h[1]||da.test(h[1]))?c(a,d,b,e):o}function p(a,d,b,e,c){b||a(d+" removed",{C:"removed",tagName:d});if(e!==c){var h="changed";e&&!c?h="removed":!e&&c&&(h="added");a(d+"."+b+" "+h,{C:h,tagName:d,G:b,oldValue:e, +newValue:c})}}function L(a,d,b){d=d+"::"+b;if(a.hasOwnProperty(d))return a[d];d="*::"+b;if(a.hasOwnProperty(d))return a[d]}function M(a,d,b,e,c){for(var i=0;i",amp:"&",nbsp:"\u00a0",quot:'"',apos:"'"},T=/^#(\d+)$/,U=/^#x([0-9A-Fa-f]+)$/,ba=/\0/g,V=/&(#[0-9]+|#[xX][0-9A-Fa-f]+|\w+);/g, +$=/^(#[0-9]+|#[xX][0-9A-Fa-f]+|\w+);/,W=/&/g,Y=/&([^a-z#]|#(?:[^0-9x]|x(?:[^0-9a-f]|$)|$)|$)/gi,B=/[<]/g,C=/>/g,X=/\"/g,aa=/^\s*([-.:\w]+)(?:\s*(=)\s*((")[^"]*("|$)|(')[^']*('|$)|(?=[a-z][-\w]*\s*=)|[^"'\s]*))?/i,Z=3==="a,b".split(/(,)/).length,H=h.d.CDATA|h.d.RCDATA,n={},z={},ca=/^(?:([^:/?# ]+):)?/,da=/^(?:https?|mailto)$/i,i={};i.I=i.escapeAttrib=y;i.J=i.makeHtmlSanitizer=J;i.K=i.makeSaxParser=E;i.L=i.makeTagPolicy=P;i.M=i.normalizeRCData=D;i.N=i.sanitize=function(a,d,b,e){return Q(a,P(d,b,e))}; +i.O=i.sanitizeAttribs=M;i.P=i.sanitizeWithPolicy=Q;i.Q=i.unescapeEntities=x;return i}(q),ea=R.sanitize;"undefined"!==typeof window&&(window.html=R,window.html_sanitize=ea);})(); diff --git a/map-chat/javascript/main.js b/map-chat/javascript/main.js new file mode 100644 index 0000000000..62378faca0 --- /dev/null +++ b/map-chat/javascript/main.js @@ -0,0 +1,85 @@ + +var eb; +var retryCount = 10; + +// Support dynamic topic registration by #word +var urlHashTopic = location.hash ? location.hash.substring(1).toLowerCase() : null; +var topic = urlHashTopic ? urlHashTopic : "main"; + +function initialiseEventBus(){ + window.client = mqtt.connect('ws://test.mosca.io'); // you add a ws:// url here + client.subscribe("mqtt/demo"); + + client.on("message", function(topic, payload) { + //alert([topic, payload].join(": ")); + //client.end(); + displayMessageOnMap(payload); + }); + + client.publish("mqtt/demo", "hello world!"); + /*eb = new vertx.EventBus("http://localhost:8080/chat"); + + eb.onopen = function () { + subscribe(topic); + }; + + eb.onclose = function(){ + if (retryCount) { + retryCount--; + console.log('Connection lost, scheduling reconnect'); + setTimeout(initialiseEventBus, 1000); + } else{ + Materialize.toast('Connection lost, please refresh :( ', 10000); + } + };*/ +} + +function sendMessage(topic, input) { + if (input.val()) { + publish(topic, input.val()); + input.val(''); + } +} + +function publish(address, message) { + if (window.client) { + var json = createMessage(message); + window.client.publish(address, json); + } +} + +$( document ).ready(function() { + if(!Modernizr.websockets || !Modernizr.geolocation){ + Materialize.toast('Browser not supported :(', 10000); + } + + $("#side-nav-button").sideNav(); + + var input = $("#input"); + input.keyup(function (e) { + if (e.keyCode == 13) { + sendMessage(topic, input); + } + }); + input.focus(); + + $("#send-button").click(function(){ + sendMessage(topic, input); + }); + + $("#notification_lever").change(function() { + advanced = !advanced; + Materialize.toast(advanced ? 'Notifications On' : 'Notifications Off', 3000); + }); + + $("#accurate_location_lever").change(function() { + shareAccurateLocation = !shareAccurateLocation; + Materialize.toast(shareAccurateLocation ? 'Sharing Your Accurate Location' : 'Sharing Your Fuzzy Location', 3000); + }); + + if (topic != "main"){ + Materialize.toast("Private chat map - "+topic, 5000); + } + + Materialize.toast("New: Click a user dot to mute it!", 7000); +}); diff --git a/map-chat/javascript/map.js b/map-chat/javascript/map.js new file mode 100644 index 0000000000..9839cccbdd --- /dev/null +++ b/map-chat/javascript/map.js @@ -0,0 +1,262 @@ + +var mySessionId; +var map; +var userLocation; +var fuzzyUserLocation; +var markersMap = {}; +var markerImage; +var advanced = false; +var infoWindowZIndex = 100; +var shareAccurateLocation = false; + +var isLowResolution = window.screen.width < 768; +var defaultZoom = isLowResolution ? 2 : 3; +var minZoom = isLowResolution ? 1 : 3; + +var locationOptions = { + enableHighAccuracy: true, + timeout: 10000, + maximumAge: 10000 +}; + +var entityMap = { + "&": "&", + "<": "<", + ">": ">", + '"': '"', + "#": "#", + "'": ''', + "/": '/', + "卐": 'I am a dick ', + "卍": 'I am a dick ' +}; + +function initialize() { + + var defaultLatLng = new google.maps.LatLng(32.078043, 34.774177); // Add the coordinates + + markerImage = { + url: 'images/blue_marker.png', + scaledSize: new google.maps.Size(30, 30) + }; + + disabledMarkerImage = { + url: 'images/grey_marker.png', + scaledSize: new google.maps.Size(30, 30) + }; + + + var mapOptions = { + center: defaultLatLng, + zoom: defaultZoom, // The initial zoom level when your map loads (0-20) + minZoom: minZoom, // Minimum zoom level allowed (0-20) + maxZoom: 18, // Maximum soom level allowed (0-20) + zoomControl:false, // Set to true if using zoomControlOptions below, or false to remove all zoom controls. + mapTypeId: google.maps.MapTypeId.ROADMAP, // Set the type of Map + scrollwheel: true, // Enable Mouse Scroll zooming + + // All of the below are set to true by default, so simply remove if set to true: + panControl:false, // Set to false to disable + mapTypeControl:false, // Disable Map/Satellite switch + scaleControl:false, // Set to false to hide scale + streetViewControl:false, // Set to disable to hide street view + overviewMapControl:false, // Set to false to remove overview control + rotateControl:false // Set to false to disable rotate control + }; + var mapDiv = document.getElementById('map-canvas'); + map = new google.maps.Map(mapDiv, mapOptions); + + navigator.geolocation.getCurrentPosition(onFirstPosition, onPositionError, locationOptions); +} + +function onFirstPosition(position){ + setUserLocation(position.coords.latitude, position.coords.longitude); + initialiseEventBus(); + map.panTo(userLocation); +} + +function onPositionUpdate(position) { + if (markersMap[mySessionId]) { //update user marker position + setUserLocation(position.coords.latitude, position.coords.longitude); + var userMarker = markersMap[mySessionId].marker; + userMarker.setPosition(shareAccurateLocation ? userLocation : fuzzyUserLocation); + } +} + +function onPositionError(err) { + // try fallback location provider ipinfo.io or generate random location + $.getJSON("http://ipinfo.io", onFallbackLocationProviderResponse, useRandomLocation); +} + +function onFallbackLocationProviderResponse(ipinfo){ + console.log("Found location ["+ipinfo.loc+"] by ipinfo.io"); + var latLong = ipinfo.loc.split(","); + onFirstPosition({ + "coords" : { + latitude : parseFloat(latLong[0]), + longitude : parseFloat(latLong[1]) + } + }); +} + +function useRandomLocation(err) { + Materialize.toast('User location problem, using random location :P', 7000); + // These ranges cover only the center of the map + var lat = (90 * Math.random() - 22.5).toFixed(3); + var lng = (180 * Math.random() - 90).toFixed(3); + onFirstPosition({ + "coords" : { + latitude : parseFloat(lat), + longitude : parseFloat(lng) + } + }); +} + +function setUserLocation(lat, lng){ + userLocation = new google.maps.LatLng(lat, lng); + fuzzyUserLocation = new google.maps.LatLng(Math.round(lat * 100) / 100, Math.round(lng * 100) / 100); +} + +function createMessage(text){ + return { + lat: shareAccurateLocation ? userLocation.lat() : fuzzyUserLocation.lat(), + lng: shareAccurateLocation ? userLocation.lng() : fuzzyUserLocation.lng(), + text: text + }; +} + +function displayMessageOnMap(msg){ + var newPosition = new google.maps.LatLng(msg.lat,msg.lng); + var msgSessionId = msg.sessionId; + + // xss prevention hack + msg.text = html_sanitize(msg.text); + + msg.text = String(msg.text).replace(/[&<>"#'\/卐卍]/g, function (s) { + return entityMap[s]; + }); + +// msg.text = msg.text ? embedTweet(msg.text) : ""; + msg.text = msg.text.replace(/#(\S*)/g,'#$1'); + + // linkify + msg.text = msg.text.replace(/(\b(https?|ftp|file)://[-A-Z0-9+&@#\/%?=~_|!:,.;]*[-A-Z0-9+&@#\/%=~_|])/ig, + "$1"); + + if(markersMap[msgSessionId]){ // update existing marker + var existingMarker = markersMap[msgSessionId].marker; + var existingInfoWindow = markersMap[msgSessionId].infoWindow; + var existingTimeoutId = markersMap[msgSessionId].timeoutId; + + existingMarker.setPosition(newPosition); + existingInfoWindow.setContent(msg.text); + existingInfoWindow.setZIndex(infoWindowZIndex); + infoWindowZIndex++; + if (msg.text && !markersMap[msgSessionId].disabled) { + if (existingTimeoutId){ + clearTimeout(existingTimeoutId); + } + markersMap[msgSessionId].timeoutId = + setTimeout(function() { existingInfoWindow.close() }, 10000); + existingInfoWindow.open(map, existingMarker); + } + } else { // new marker + var infoWindow = new google.maps.InfoWindow({ + content: msg.text, + maxWidth: 400, + disableAutoPan: true, + zIndex: infoWindowZIndex + }); + infoWindowZIndex++; + + var marker = new google.maps.Marker({ + position: newPosition, + map: map, + draggable: false, + icon: markerImage, + title: "Click to mute/un-mute User "+msgSessionId + }); + + marker.addListener('click',function() { + if (markersMap[msgSessionId].disabled) { + markersMap[msgSessionId].disabled = false; + marker.setIcon(markerImage); + } else{ + markersMap[msgSessionId].disabled = true; + marker.setIcon(disabledMarkerImage); + infoWindow.close(); + } + }); + + if (msg.text) { + infoWindow.open(map, marker); + } + + var timeoutId = setTimeout(function() { infoWindow.close() }, 10000); + markersMap[msgSessionId] = { + marker: marker, + infoWindow: infoWindow, + timeoutId: timeoutId, + disabled: false + } + } + + if (advanced){ + runAdvancedOptions(msg); + } +} + +function embedTweet(text) { + var tweetText = "Someone wrote " + text + " on "; + var tweetUrl = "https:\/\/twitter.com\/share?url=http://idoco.github.io/map-chat&text=" + tweetText; + var width = 500, height = 300; + var left = (screen.width / 2) - (width / 2); + var top = (screen.height / 2) - (height / 2); + return " " + + " <\/a> " + text; +} + +function clearMessageFromMap(){ + for (var markerSessionId in markersMap) { + if (markersMap.hasOwnProperty(markerSessionId)) { + markersMap[markerSessionId].infoWindow.close(); + } + } +} + +function changeZoom(factor){ + map.setZoom(map.getZoom() + factor); +} + +function runAdvancedOptions(msg){ + if (msg.sessionId == mySessionId){ + return; + } + + if (Notification.permission !== "granted"){ + Notification.requestPermission(); + } + + new Notification('Incoming MapChat', { + icon: 'favicons/apple-touch-icon-120x120.png', + body: msg.text ? "Incoming message: "+msg.text : "New user" + }); +} + +// This should be displayed when the app is opened from a mobile facebook app WebView (Until a better solution is found) +if (window.navigator.userAgent.indexOf("FBAV") > 0) { + document.write( + "
" + + "
" + + "
" + + "This page will not work inside the facebook app, " + + "please open it in the native browser." + + "
" + + "
" + + "
" + ); +} else { + google.maps.event.addDomListener(window, 'load', initialize); +} diff --git a/map-chat/javascript/modernizr.custom.js b/map-chat/javascript/modernizr.custom.js new file mode 100644 index 0000000000..a102e9bcf0 --- /dev/null +++ b/map-chat/javascript/modernizr.custom.js @@ -0,0 +1,4 @@ +/* Modernizr 2.8.3 (Custom Build) | MIT & BSD + * Build: http://modernizr.com/download/#-websockets-geolocation-shiv-cssclasses-domprefixes-load + */ +;window.Modernizr=function(a,b,c){function x(a){j.cssText=a}function y(a,b){return x(prefixes.join(a+";")+(b||""))}function z(a,b){return typeof a===b}function A(a,b){return!!~(""+a).indexOf(b)}function B(a,b,d){for(var e in a){var f=b[a[e]];if(f!==c)return d===!1?a[e]:z(f,"function")?f.bind(d||b):f}return!1}var d="2.8.3",e={},f=!0,g=b.documentElement,h="modernizr",i=b.createElement(h),j=i.style,k,l={}.toString,m="Webkit Moz O ms",n=m.split(" "),o=m.toLowerCase().split(" "),p={},q={},r={},s=[],t=s.slice,u,v={}.hasOwnProperty,w;!z(v,"undefined")&&!z(v.call,"undefined")?w=function(a,b){return v.call(a,b)}:w=function(a,b){return b in a&&z(a.constructor.prototype[b],"undefined")},Function.prototype.bind||(Function.prototype.bind=function(b){var c=this;if(typeof c!="function")throw new TypeError;var d=t.call(arguments,1),e=function(){if(this instanceof e){var a=function(){};a.prototype=c.prototype;var f=new a,g=c.apply(f,d.concat(t.call(arguments)));return Object(g)===g?g:f}return c.apply(b,d.concat(t.call(arguments)))};return e}),p.geolocation=function(){return"geolocation"in navigator},p.websockets=function(){return"WebSocket"in a||"MozWebSocket"in a};for(var C in p)w(p,C)&&(u=C.toLowerCase(),e[u]=p[C](),s.push((e[u]?"":"no-")+u));return e.addTest=function(a,b){if(typeof a=="object")for(var d in a)w(a,d)&&e.addTest(d,a[d]);else{a=a.toLowerCase();if(e[a]!==c)return e;b=typeof b=="function"?b():b,typeof f!="undefined"&&f&&(g.className+=" "+(b?"":"no-")+a),e[a]=b}return e},x(""),i=k=null,function(a,b){function l(a,b){var c=a.createElement("p"),d=a.getElementsByTagName("head")[0]||a.documentElement;return c.innerHTML="x",d.insertBefore(c.lastChild,d.firstChild)}function m(){var a=s.elements;return typeof a=="string"?a.split(" "):a}function n(a){var b=j[a[h]];return b||(b={},i++,a[h]=i,j[i]=b),b}function o(a,c,d){c||(c=b);if(k)return c.createElement(a);d||(d=n(c));var g;return d.cache[a]?g=d.cache[a].cloneNode():f.test(a)?g=(d.cache[a]=d.createElem(a)).cloneNode():g=d.createElem(a),g.canHaveChildren&&!e.test(a)&&!g.tagUrn?d.frag.appendChild(g):g}function p(a,c){a||(a=b);if(k)return a.createDocumentFragment();c=c||n(a);var d=c.frag.cloneNode(),e=0,f=m(),g=f.length;for(;e",g="hidden"in a,k=a.childNodes.length==1||function(){b.createElement("a");var a=b.createDocumentFragment();return typeof a.cloneNode=="undefined"||typeof a.createDocumentFragment=="undefined"||typeof a.createElement=="undefined"}()}catch(c){g=!0,k=!0}})();var s={elements:d.elements||"abbr article aside audio bdi canvas data datalist details dialog figcaption figure footer header hgroup main mark meter nav output progress section summary template time video",version:c,shivCSS:d.shivCSS!==!1,supportsUnknownElements:k,shivMethods:d.shivMethods!==!1,type:"default",shivDocument:r,createElement:o,createDocumentFragment:p};a.html5=s,r(b)}(this,b),e._version=d,e._domPrefixes=o,e._cssomPrefixes=n,g.className=g.className.replace(/(^|\s)no-js(\s|$)/,"$1$2")+(f?" js "+s.join(" "):""),e}(this,this.document),function(a,b,c){function d(a){return"[object Function]"==o.call(a)}function e(a){return"string"==typeof a}function f(){}function g(a){return!a||"loaded"==a||"complete"==a||"uninitialized"==a}function h(){var a=p.shift();q=1,a?a.t?m(function(){("c"==a.t?B.injectCss:B.injectJs)(a.s,0,a.a,a.x,a.e,1)},0):(a(),h()):q=0}function i(a,c,d,e,f,i,j){function k(b){if(!o&&g(l.readyState)&&(u.r=o=1,!q&&h(),l.onload=l.onreadystatechange=null,b)){"img"!=a&&m(function(){t.removeChild(l)},50);for(var d in y[c])y[c].hasOwnProperty(d)&&y[c][d].onload()}}var j=j||B.errorTimeout,l=b.createElement(a),o=0,r=0,u={t:d,s:c,e:f,a:i,x:j};1===y[c]&&(r=1,y[c]=[]),"object"==a?l.data=c:(l.src=c,l.type=a),l.width=l.height="0",l.onerror=l.onload=l.onreadystatechange=function(){k.call(this,r)},p.splice(e,0,u),"img"!=a&&(r||2===y[c]?(t.insertBefore(l,s?null:n),m(k,j)):y[c].push(l))}function j(a,b,c,d,f){return q=0,b=b||"j",e(a)?i("c"==b?v:u,a,b,this.i++,c,d,f):(p.splice(this.i++,0,a),1==p.length&&h()),this}function k(){var a=B;return a.loader={load:j,i:0},a}var l=b.documentElement,m=a.setTimeout,n=b.getElementsByTagName("script")[0],o={}.toString,p=[],q=0,r="MozAppearance"in l.style,s=r&&!!b.createRange().compareNode,t=s?l:n.parentNode,l=a.opera&&"[object Opera]"==o.call(a.opera),l=!!b.attachEvent&&!l,u=r?"object":l?"script":"img",v=l?"script":u,w=Array.isArray||function(a){return"[object Array]"==o.call(a)},x=[],y={},z={timeout:function(a,b){return b.length&&(a.timeout=b[0]),a}},A,B;B=function(a){function b(a){var a=a.split("!"),b=x.length,c=a.pop(),d=a.length,c={url:c,origUrl:c,prefixes:a},e,f,g;for(f=0;f