diff --git a/.all-contributorsrc b/.all-contributorsrc index 97f002330..4edcedb7a 100644 --- a/.all-contributorsrc +++ b/.all-contributorsrc @@ -139,6 +139,15 @@ "contributions": [ "code" ] + }, + { + "login": "widoagus17", + "name": "widoagus17", + "avatar_url": "https://avatars.githubusercontent.com/u/87120968?v=4", + "profile": "https://github.com/widoagus17", + "contributions": [ + "code" + ] } ], "contributorsPerLine": 7, diff --git a/.github/workflows/phpcs.yml b/.github/workflows/phpcs.yml index 5af7ccf2c..67fa4c0df 100644 --- a/.github/workflows/phpcs.yml +++ b/.github/workflows/phpcs.yml @@ -1,6 +1,6 @@ -name: Check & fix styling +name: Fix styling -on: +on: pull_request: branches: - dev @@ -9,7 +9,8 @@ on: jobs: php-cs-fixer: runs-on: ubuntu-latest - + # Check if contains [ci skip] will be skip github action + if: "!contains(github.event.head_commit.message, '[ci skip]')" steps: - name: Checkout code uses: actions/checkout@v2 @@ -24,4 +25,4 @@ jobs: - name: Commit changes uses: stefanzweifel/git-auto-commit-action@v4 with: - commit_message: Fix styling + commit_message: "Fix styling" \ No newline at end of file diff --git a/.gitignore b/.gitignore index e6d0fd4ff..f27e30323 100755 --- a/.gitignore +++ b/.gitignore @@ -23,4 +23,4 @@ copy_public.sh **/.DS_Store public/error_log composer.lock -.php-cs-fixer.cache \ No newline at end of file +.php-cs-fixer.cache diff --git a/README.md b/README.md index 47ce66fc7..beebecdda 100644 --- a/README.md +++ b/README.md @@ -51,6 +51,7 @@ Berikut adalah teman-teman luar biasa yang telah berkontribusi langsung mengemba
Afila
💻 +
widoagus17
💻 @@ -62,5 +63,5 @@ Berikut adalah teman-teman luar biasa yang telah berkontribusi langsung mengemba Daftar kontributor sesuai spesifikasi [all-contributors](https://github.com/all-contributors/all-contributors), menggunakan @all-contributors Bot. -[![All Contributors](https://img.shields.io/badge/all_contributors-14-orange.svg?style=flat-square)](#contributors-) +[![All Contributors](https://img.shields.io/badge/all_contributors-16-orange.svg?style=flat-square)](#contributors-) diff --git a/app/Http/Controllers/Api/LaporanApbdesController.php b/app/Http/Controllers/Api/LaporanApbdesController.php index 54b6787cd..85a8b28b4 100644 --- a/app/Http/Controllers/Api/LaporanApbdesController.php +++ b/app/Http/Controllers/Api/LaporanApbdesController.php @@ -37,16 +37,6 @@ class LaporanApbdesController extends Controller { - /** - * Create a new AuthController instance. - * - * @return void - */ - public function __construct() - { - $this->middleware('auth:api'); - } - /** * Tambah / Ubah Data Apbdes Sesuai OpenSID * diff --git a/app/Http/Controllers/Api/LaporanPendudukController.php b/app/Http/Controllers/Api/LaporanPendudukController.php index e973607ae..1b69812dd 100644 --- a/app/Http/Controllers/Api/LaporanPendudukController.php +++ b/app/Http/Controllers/Api/LaporanPendudukController.php @@ -37,16 +37,6 @@ class LaporanPendudukController extends Controller { - /** - * Create a new AuthController instance. - * - * @return void - */ - public function __construct() - { - $this->middleware('auth:api'); - } - /** * Tambah / Ubah Data Laporan Penduduk Dari OpenSID * diff --git a/app/Http/Controllers/Api/PembangunanController.php b/app/Http/Controllers/Api/PembangunanController.php new file mode 100644 index 000000000..88c7a469b --- /dev/null +++ b/app/Http/Controllers/Api/PembangunanController.php @@ -0,0 +1,125 @@ +file('file'); + $file->storeAs('temp', $name = $file->getClientOriginalName()); + + // Temporary path file + $path = storage_path("app/temp/{$name}"); + $extract = storage_path('app/public/pembangunan/'); + + // Ekstrak file + $zip = new ZipArchive(); + $zip->open($path); + $zip->extractTo($extract); + $zip->close(); + + // Proses impor data pembangunan + (new SinkronPembangunan()) + ->queue($extract . $filecsv = Str::replaceLast('zip', 'csv', $name)); + } catch (\Exception $e) { + report($e); + return response()->json([ + "message" => "Proses Sinkronisasi Data gagal. Error : " . $e->getMessage(), + "status" => "danger" + ]); + } + + // Hapus folder temp ketika sudah selesai + Storage::deleteDirectory('temp'); + // Hapus file excell temp ketika sudah selesai + Storage::disk('public')->delete('pembangunan/' . $filecsv); + + return response()->json([ + "message" => "Proses Sinkronisasi Data Pembangunan OpenSID sedang berjalan", + "status" => "success" + ]); + } + + public function storeDokumentasi(PembangunanDokumentasiRequest $request) + { + try { + // Upload file zip temporary. + $file = $request->file('file'); + $file->storeAs('temp', $name = $file->getClientOriginalName()); + + // Temporary path file + $path = storage_path("app/temp/{$name}"); + $extract = storage_path('app/public/pembangunan/'); + + // Ekstrak file + $zip = new ZipArchive(); + $zip->open($path); + $zip->extractTo($extract); + $zip->close(); + + // Proses impor data dokumentasi pembangunan + (new SinkronPembangunanDokumentasi()) + ->queue($extract . $filecsv = Str::replaceLast('zip', 'csv', $name)); + } catch (\Exception $e) { + report($e); + return back()->with('error', 'Import data gagal.'); + } + + // Hapus folder temp ketika sudah selesai + Storage::deleteDirectory('temp'); + // Hapus file excell temp ketika sudah selesai + Storage::disk('public')->delete('pembangunan/' . $filecsv); + + return response()->json([ + "message" => "Proses Sinkronisasi Data Pembangunan OpenSID sedang berjalan", + "status" => "success" + ]); + } +} diff --git a/app/Http/Controllers/Api/PendudukController.php b/app/Http/Controllers/Api/PendudukController.php index 3e26baa19..ce096916b 100644 --- a/app/Http/Controllers/Api/PendudukController.php +++ b/app/Http/Controllers/Api/PendudukController.php @@ -42,16 +42,6 @@ class PendudukController extends Controller { - /** - * Create a new AuthController instance. - * - * @return void - */ - public function __construct() - { - $this->middleware('auth:api'); - } - /** * Hapus Data Penduduk Sesuai OpenSID * diff --git a/app/Http/Controllers/Api/PesanController.php b/app/Http/Controllers/Api/PesanController.php index dc6c8ed76..5a51ea079 100644 --- a/app/Http/Controllers/Api/PesanController.php +++ b/app/Http/Controllers/Api/PesanController.php @@ -44,11 +44,6 @@ class PesanController extends Controller { - public function __construct() - { - $this->middleware('auth:api'); - } - public function store(PesanRequest $request) { $desa = DataDesa::where('desa_id', '=', $request->kode_desa)->first(); diff --git a/app/Http/Controllers/Api/ProfilDesaController.php b/app/Http/Controllers/Api/ProfilDesaController.php index a480403a5..9c35a0665 100644 --- a/app/Http/Controllers/Api/ProfilDesaController.php +++ b/app/Http/Controllers/Api/ProfilDesaController.php @@ -37,16 +37,12 @@ class ProfilDesaController extends Controller { - public function __construct() - { - $this->middleware('auth:api'); - } - public function store(ProfilDesaRequest $request) { DataDesa::where('desa_id', $request->kode_desa)->update([ 'website' => $request->website, - 'sebutan_desa' => $request->sebutan_desa + 'sebutan_desa' => $request->sebutan_desa, + 'path' => $request->path ]); return response()->json([ diff --git a/app/Http/Controllers/Api/ProgamBantuanController.php b/app/Http/Controllers/Api/ProgamBantuanController.php new file mode 100644 index 000000000..ac649259d --- /dev/null +++ b/app/Http/Controllers/Api/ProgamBantuanController.php @@ -0,0 +1,115 @@ +file('file'); + $file->storeAs('temp', $name = $file->getClientOriginalName()); + + // Temporary path file + $path = storage_path("app/temp/{$name}"); + $extract = storage_path('app/public/bantuan/'); + + // Ekstrak file + $zip = new ZipArchive(); + $zip->open($path); + $zip->extractTo($extract); + $zip->close(); + + (new SinkronBantuan()) + ->queue($extract . $csvName = Str::replaceLast('zip', 'csv', $name)); + } catch (\Exception $e) { + report($e); + return response()->json([ + "status" => "danger", + "message" => $e->getMessage(), + ]); + } + + // Hapus folder temp ketika sudah selesai + Storage::deleteDirectory('temp'); + // Hapus file excell temp ketika sudah selesai + Storage::disk('public')->delete('bantuan' . $csvName); + + return response()->json([ + "message" => "Data Bantuan Sedang di Sinkronkan", + "status" => "success" + ]); + } + + public function storePeserta(ProgramBantuanRequest $request) + { + try { + // Upload file zip temporary. + $file = $request->file('file'); + $file->storeAs('temp', $name = $file->getClientOriginalName()); + // Temporary path file + $path = storage_path("app/temp/{$name}"); + $extract = storage_path('app/public/bantuan/'); + // Ekstrak file + $zip = new ZipArchive(); + $zip->open($path); + $zip->extractTo($extract); + $zip->close(); + // Proses impor excell + (new SinkronPesertaBantuan()) + ->queue($extract . $csvName = Str::replaceLast('zip', 'csv', $name)); + } catch (\Exception $e) { + report($e); + return response()->json([ + "status" => "danger", + "message" => $e->getMessage(), + ]); + } + // Hapus folder temp ketika sudah selesai + Storage::deleteDirectory('temp'); + // Hapus file excell temp ketika sudah selesai + Storage::disk('public')->delete('bantuan/' . $csvName); + return response()->json([ + "status" => "success", + "message" => "Data Bantuan Sedang di Sinkronkan", + ]); + } +} diff --git a/app/Http/Controllers/Auth/ChangeDefaultController.php b/app/Http/Controllers/Auth/ChangeDefaultController.php new file mode 100644 index 000000000..6ae518394 --- /dev/null +++ b/app/Http/Controllers/Auth/ChangeDefaultController.php @@ -0,0 +1,64 @@ +user()->update(['email' => $request->email, 'password' => $request->password]); + return redirect()->route('dashboard'); + } +} diff --git a/app/Http/Controllers/Auth/LoginController.php b/app/Http/Controllers/Auth/LoginController.php index f139066d8..363ad3f13 100755 --- a/app/Http/Controllers/Auth/LoginController.php +++ b/app/Http/Controllers/Auth/LoginController.php @@ -34,6 +34,7 @@ use App\Http\Controllers\Controller; use App\Providers\RouteServiceProvider; use Illuminate\Foundation\Auth\AuthenticatesUsers; +use Illuminate\Support\Facades\Hash; class LoginController extends Controller { @@ -71,6 +72,12 @@ public function __construct() public function redirectTo() { + // check password + $cek_password = Hash::check('password', auth()->user()->password); + if ($cek_password && (bool) env('APP_DEMO') == false) { + $this->redirectTo = 'changedefault'; + } + switch (auth()->user()->roles()->first()->name) { case 'kontributor-artikel': $this->redirectTo = 'informasi/artikel'; diff --git a/app/Http/Controllers/Data/DataDesaController.php b/app/Http/Controllers/Data/DataDesaController.php index f4ee5cc96..393f2ae1f 100755 --- a/app/Http/Controllers/Data/DataDesaController.php +++ b/app/Http/Controllers/Data/DataDesaController.php @@ -68,6 +68,7 @@ public function getDataDesa() if ($this->profil->kecamatan_id) { $data['edit_url'] = route('data.data-desa.edit', $row->id); } + $data['peta'] = route('data.data-desa.peta', $row->id); $data['delete_url'] = route('data.data-desa.destroy', $row->id); return view('forms.aksi', $data); @@ -78,6 +79,13 @@ public function getDataDesa() ->rawColumns(['website', 'aksi'])->make(); } + public function getDataDesaAjax(Request $request) + { + if ($request->ajax()) { + return response()->json(['data'=> DataDesa::get()]); + } + } + /** * Show the form for creating a new resource. * @@ -245,4 +253,25 @@ public function getDesaKecamatan() return redirect()->route('data.data-desa.index')->with('success', 'Data Desa berhasil ditambahkan'); } + + public function peta($id) + { + $desa = DataDesa::findOrFail($id); + $page_title = 'Desa'; + $page_description = 'Peta Desa : ' . $desa->nama; + + return view('data.data_desa.peta', compact('page_title', 'page_description', 'desa')); + } + + public function getAjaxPetaDesa(Request $request) + { + if (request()->ajax()) { + $data = DataDesa::all(); + return response()->json([ + 'status' => 'success', + 'message' => 'Proses sinkronisasi identitas desa sudah selesai', + 'data' => $data + ]); + } + } } diff --git a/app/Http/Controllers/Data/DataPembangunanController.php b/app/Http/Controllers/Data/DataPembangunanController.php new file mode 100644 index 000000000..723d2cb40 --- /dev/null +++ b/app/Http/Controllers/Data/DataPembangunanController.php @@ -0,0 +1,89 @@ +ajax()) { + $desa = $request->input('desa'); + + $pembangunan = Pembangunan::when($desa, function ($q) use ($desa) { + return $desa === 'Semua' + ? $q : $q->where('desa_id', $desa); + }) + ->with('dokumentasi'); + + return DataTables::of($pembangunan) + ->addColumn('aksi', function ($row) { + $data['detail_url'] = route('data.pembangunan.rincian', ['id' => $row->id,'desa_id' => $row->desa_id]); + return view('forms.aksi', $data); + })->make(); + } + } + + public function rincian($id, $desa_id) + { + $page_title = 'Pembangunan'; + $page_description = 'Rincian Pembangunan'; + $pembangunan = Pembangunan::where('id', $id)->where('desa_id', $desa_id)->first(); + + return view('data.pembangunan.rincian', compact('page_title', 'page_description', 'pembangunan')); + } + + public function getrinciandata($id, $desa_id) + { + if (request()->ajax()) { + $pembangunanDokumentasi = PembangunanDokumentasi::where('desa_id', $desa_id)->where('id_pembangunan', $id)->get(); + return DataTables::of($pembangunanDokumentasi) + ->addIndexColumn() + ->make(); + } + } +} diff --git a/app/Http/Controllers/Data/DataUmumController.php b/app/Http/Controllers/Data/DataUmumController.php index f48d23ea9..439c58835 100644 --- a/app/Http/Controllers/Data/DataUmumController.php +++ b/app/Http/Controllers/Data/DataUmumController.php @@ -98,7 +98,7 @@ public function update(Request $request, $id) public function getDataUmumAjax(Request $request) { if ($request->ajax()) { - return response()->json(['data'=> DataUmum::first()]); + return response()->json(['data'=> DataUmum::with('profil')->first()]); } } } diff --git a/app/Http/Controllers/Data/ProgramBantuanController.php b/app/Http/Controllers/Data/ProgramBantuanController.php old mode 100755 new mode 100644 index 04ea41ce9..3845aa6bb --- a/app/Http/Controllers/Data/ProgramBantuanController.php +++ b/app/Http/Controllers/Data/ProgramBantuanController.php @@ -32,9 +32,13 @@ namespace App\Http\Controllers\Data; use App\Http\Controllers\Controller; +use App\Imports\SinkronBantuan; +use App\Imports\SinkronPesertaBantuan; +use App\Models\DataDesa; use App\Models\PesertaProgram; use App\Models\Program; use Illuminate\Http\Request; +use Illuminate\Support\Str; use Yajra\DataTables\Facades\DataTables; class ProgramBantuanController extends Controller @@ -43,17 +47,16 @@ public function index() { $page_title = 'Program Bantuan'; $page_description = 'Daftar Program Bantuan'; + $list_desa = DataDesa::all(); - return view('data.program_bantuan.index', compact('page_title', 'page_description')); + return view('data.program_bantuan.index', compact('page_title', 'page_description', 'list_desa')); } - public function getaProgramBantuan() + public function getaProgramBantuan(Request $request) { - return DataTables::of(Program::all()) + return DataTables::of(Program::when(!empty($request->input('desa')), fn ($q) => $q->where('desa_id', $request->desa))->with('desa')) ->addColumn('aksi', function ($row) { - $data['detail_url'] = route('data.program-bantuan.show', $row->id); - $data['edit_url'] = route('data.program-bantuan.edit', $row->id); - $data['delete_url'] = route('data.program-bantuan.destroy', $row->id); + $data['detail_url'] = route('data.program-bantuan.show', [$row->id, $row->desa_id]); return view('forms.aksi', $data); }) @@ -67,113 +70,57 @@ public function getaProgramBantuan() ->rawColumns(['aksi'])->make(); } - public function create() + public function show($id, $desa_id) { - $page_title = 'Tambah'; - $page_description = 'Tambah Program Bantuan Baru'; - - return view('data.program_bantuan.create', compact('page_title', 'page_description')); - } - - public function store(Request $request) - { - request()->validate([ - 'sasaran' => 'required', - 'nama' => 'required', - 'start_date' => 'required|date', - 'end_date' => 'required|date', - ]); - - try { - Program::create($request->all()); - } catch (\Exception $e) { - report($e); - return back()->withInput()->with('error', 'Data gagal disimpan!'); - } - - return redirect()->route('data.program-bantuan.index')->with('success', 'Data berhasil disimpan!'); - } - - public function show($id) - { - $program = Program::findOrFail($id); + $program = Program::with('desa')->findOrFail($id); $page_title = 'Detail Program'; $page_description = 'Program Bantuan ' . $program->nama; $sasaran = [1 => 'Penduduk/Perorangan', 2 => 'Keluarga-KK']; - $peserta = PesertaProgram::where('program_id', $id)->get(); + $peserta = PesertaProgram::where('program_id', $id)->where('desa_id', $desa_id)->get(); return view('data.program_bantuan.show', compact('page_title', 'page_description', 'program', 'sasaran', 'peserta')); } - public function update(Request $request, $id) - { - request()->validate([ - 'sasaran' => 'required', - 'nama' => 'required', - 'start_date' => 'required|date', - 'end_date' => 'required|date', - ]); - - try { - $program = Program::findOrFail($id); - $program->fill($request->all()); - $program->update(); - } catch (\Exception $e) { - report($e); - return back()->withInput()->with('error', 'Data gagal disimpan!'); - } - - return redirect()->route('data.program-bantuan.index')->with('success', 'Data berhasil disimpan!'); - } - - public function edit($id) - { - $program = Program::findOrFail($id); - $page_title = 'Edit Program'; - $page_description = 'Program Bantuan ' . $program->nama; - $sasaran = [1 => 'Penduduk/Perorangan', 2 => 'Keluarga-KK']; - $peserta = PesertaProgram::where('program_id', $id)->get(); - - return view('data.program_bantuan.edit', compact('page_title', 'page_description', 'program', 'sasaran', 'peserta')); - } - - public function destroy($id) + public function import() { - try { - Program::findOrFail($id)->delete(); - PesertaProgram::where('program_id', $id)->delete(); - } catch (\Exception $e) { - report($e); - return back()->withInput()->with('error', 'Data gagal dihapus!'); - } - - return redirect()->route('data.program-bantuan.index')->with('success', 'Data berhasil dihapus!'); - } - - public function createPeserta($id) - { - $program = Program::findOrFail($id); - $page_title = 'Tambah Peserta'; - $page_description = 'Program Bantuan ' . $program->nama; - $sasaran = [1 => 'Penduduk/Perorangan', 2 => 'Keluarga-KK']; + $page_title = 'Impor'; + $page_description = 'Impor Data Program Bantuan'; - return view('data.program_bantuan.add_peserta', compact('page_title', 'page_description', 'program', 'sasaran')); + return view('data.program_bantuan.import', compact('page_title', 'page_description')); } - public function add_peserta(Request $request) + public function do_import(Request $request) { - request()->validate([ - 'peserta' => 'required', - 'tanggal_lahir' => 'date', + $this->validate($request, [ + 'file' => 'file|mimes:zip|max:51200', ]); try { - PesertaProgram::create($request->all()); + // Upload file zip temporary. + $file = $request->file('file'); + $file->storeAs('temp', $name = $file->getClientOriginalName()); + + // Temporary path file + $path = storage_path("app/temp/{$name}"); + $extract = storage_path('app/public/bantuan/'); + + // Ekstrak file + $zip = new \ZipArchive(); + $zip->open($path); + $zip->extractTo($extract); + $zip->close(); + + glob($extract.'*.csv'); + + (new SinkronBantuan()) + ->queue($extract . Str::replaceLast('zip', 'csv', $name)); + (new SinkronPesertaBantuan()) + ->queue($extract . Str::replaceLast('zip', 'csv', 'peserta_'.$name)); } catch (\Exception $e) { report($e); - return back()->withInput()->with('error', 'Data gagal disimpan!'); + return back()->with('error', 'Import data gagal. '. $e->getMessage()); } - return redirect()->route('data.program-bantuan.show', $request->input('program_id'))->with('success', 'Data berhasil disimpan!'); + return redirect()->route('data.program-bantuan.index')->with('success', 'Import data sukses.'); } } diff --git a/app/Http/Controllers/Page/PageController.php b/app/Http/Controllers/Page/PageController.php index 975435abd..bbaa7d08e 100644 --- a/app/Http/Controllers/Page/PageController.php +++ b/app/Http/Controllers/Page/PageController.php @@ -58,7 +58,6 @@ public function index() public function beritaDesa() { $this->data = $this->getFeeds(); - $feeds = collect($this->data)->sortByDesc('date')->take(config('setting.jumlah_artikel_desa') ?? 30)->paginate(config('setting.artikel_desa_perhalaman') ?? 10); $feeds->all(); @@ -88,7 +87,7 @@ private function getFeeds() 'feed_link' => $item->get_feed()->get_permalink(), 'feed_title' => $item->get_feed()->get_title(), 'link' => $item->get_link(), - 'date' => \Carbon\Carbon::parse($item->get_date('U'))->translatedFormat('d F Y'), + 'date' => \Carbon\Carbon::parse($item->get_date('U')), 'author' => $item->get_author()->get_name() ?? 'Administrator', 'title' => $item->get_title(), 'image' => get_tag_image($item->get_description()), diff --git a/app/Http/Controllers/Page/ProfilController.php b/app/Http/Controllers/Page/ProfilController.php index 542616856..06f788050 100644 --- a/app/Http/Controllers/Page/ProfilController.php +++ b/app/Http/Controllers/Page/ProfilController.php @@ -34,6 +34,7 @@ use App\Facades\Counter; use App\Http\Controllers\Controller; use App\Models\DataDesa; +use App\Models\DataUmum; use App\Models\Profil; use Illuminate\Support\Facades\DB; @@ -59,13 +60,15 @@ public function LetakGeografis() { Counter::count('profil.letak-geografis'); - $profil = Profil::with(['dataDesa'])->first(); + $profil = Profil::with(['dataDesa'])->first(); + $wilayah_desa = DataDesa::whereNotNull('path')->get(); + $data_umum = DataUmum::first(); $page_title = 'Letak Geografis'; if (isset($profil)) { $page_description = $this->browser_title; } - return view('pages.profil.letakgeografis', compact('page_title', 'page_description', 'profil')); + return view('pages.profil.letakgeografis', compact('page_title', 'page_description', 'profil', 'wilayah_desa', 'data_umum')); } public function StrukturPemerintahan() diff --git a/app/Http/Controllers/User/UserController.php b/app/Http/Controllers/User/UserController.php index 4dd6bd7b5..4a3ac6bdb 100755 --- a/app/Http/Controllers/User/UserController.php +++ b/app/Http/Controllers/User/UserController.php @@ -37,7 +37,7 @@ use App\Models\User; use Illuminate\Http\Request; use Illuminate\Http\Response; -use Illuminate\Support\Facades\File; +use Illuminate\Support\Facades\Storage; use Spatie\Permission\Models\Role; use Yajra\DataTables\DataTables; @@ -89,12 +89,10 @@ public function store(UserRequest $request) $roles = $request->input('role') ? $request->input('role') : []; $user->assignRole($roles); - flash()->success(trans('message.user.create-success')); - return redirect()->route('setting.user.index'); + return redirect()->route('setting.user.index')->with('success', 'User berhasil ditambahkan!'); } catch (\Exception $e) { report($e); - flash()->error(trans('message.user.create-error')); - return back()->withInput(); + return back()->withInput()->with('error', $e->getMessage()); } } @@ -136,25 +134,22 @@ public function edit($id) public function update(UserUpdateRequest $request, $id) { try { - $user_find = User::findOrFail($id); + $user = User::findOrFail($id); - $user = $user_find->update($request->all()); + $user->update($request->all()); if ($request->hasFile('image')) { - $path = public_path('uploads/user/'); - File::delete($path . $user_find->image); $user->uploadImage($request->image); } + if (! empty($request->role)) { $roles = $request->input('role') ? $request->input('role') : []; - $user_find->syncRoles($roles); + $user->syncRoles($roles); } - flash()->success(trans('message.user.update-success')); - return redirect()->route('setting.user.index'); + return redirect()->route('setting.user.index')->with('success', 'User berhasil diperbarui!'); } catch (\Exception $e) { report($e); - flash()->error(trans('message.user.update-error')); - return back()->withInput(); + return back()->withInput()->with('error', $e->getMessage()); } } diff --git a/app/Http/Requests/ChangeRequest.php b/app/Http/Requests/ChangeRequest.php new file mode 100644 index 000000000..6cf0b5d0d --- /dev/null +++ b/app/Http/Requests/ChangeRequest.php @@ -0,0 +1,61 @@ + 'required|unique:users,email', + 'password' => 'required', + 'password_confirmation' => 'required_with:password|same:password|min:6' + ]; + } +} diff --git a/app/Http/Requests/PembangunanDokumentasiRequest.php b/app/Http/Requests/PembangunanDokumentasiRequest.php new file mode 100644 index 000000000..562e1cb93 --- /dev/null +++ b/app/Http/Requests/PembangunanDokumentasiRequest.php @@ -0,0 +1,61 @@ + 'file|mimes:zip|max:5120', + "desa_id" => ['required', 'string', new CekDesa()], + ]; + } +} diff --git a/app/Http/Requests/PembangunanRequest.php b/app/Http/Requests/PembangunanRequest.php new file mode 100644 index 000000000..772a34f7c --- /dev/null +++ b/app/Http/Requests/PembangunanRequest.php @@ -0,0 +1,61 @@ + 'file|mimes:zip|max:5120', + "desa_id" => ['required', 'string', new CekDesa()], + ]; + } +} diff --git a/app/Http/Requests/ProfilDesaRequest.php b/app/Http/Requests/ProfilDesaRequest.php index 45568e704..bd92a4ef3 100644 --- a/app/Http/Requests/ProfilDesaRequest.php +++ b/app/Http/Requests/ProfilDesaRequest.php @@ -55,7 +55,8 @@ public function rules() return [ "kode_desa" => "present|string|exists:das_data_desa,desa_id", "sebutan_desa" => "required|string", - "website" => "sometimes|url" + "website" => "sometimes|required|string", + "path" => "required|string" ]; } } diff --git a/app/Http/Requests/ProgramBantuanRequest.php b/app/Http/Requests/ProgramBantuanRequest.php new file mode 100644 index 000000000..d9631ce14 --- /dev/null +++ b/app/Http/Requests/ProgramBantuanRequest.php @@ -0,0 +1,61 @@ + 'file|mimes:zip|max:5120', + "desa_id" => ['required', 'string', new CekDesa()], + ]; + } +} diff --git a/app/Imports/SinkronBantuan.php b/app/Imports/SinkronBantuan.php new file mode 100644 index 000000000..121b59c33 --- /dev/null +++ b/app/Imports/SinkronBantuan.php @@ -0,0 +1,77 @@ + $value['desa_id'], + 'id' => $value['id'], + 'nama' => $value['nama'], + 'sasaran' => $value['sasaran'], + 'status' => $value['status'], + 'start_date' => $value['sdate'], + 'end_date' => $value['edate'], + 'description' => $value['ndesc'], + ]; + + Program::updateOrCreate([ + 'desa_id' => $insert['desa_id'], + 'id' => $insert['id'] + ], $insert); + } + } +} diff --git a/app/Imports/SinkronPembangunan.php b/app/Imports/SinkronPembangunan.php new file mode 100644 index 000000000..31c1f472c --- /dev/null +++ b/app/Imports/SinkronPembangunan.php @@ -0,0 +1,89 @@ + $value['desa_id'], + "id" => $value['id'], + "sumber_dana" => $value['sumber_dana'], + "lokasi" => $value['lokasi'], + "keterangan" => $value['keterangan'], + "judul" => $value['judul'], + "volume" => $value['volume'], + "tahun_anggaran" => $value['tahun_anggaran'], + "pelaksana_kegiatan" => $value['pelaksana_kegiatan'], + "status" => $value['status'], + "anggaran" => $value['anggaran'], + "perubahan_anggaran" => $value['perubahan_anggaran'], + "sumber_biaya_pemerintah" => $value['sumber_biaya_pemerintah'], + "sumber_biaya_provinsi" => $value['sumber_biaya_provinsi'], + "sumber_biaya_kab_kota" => $value['sumber_biaya_kab_kota'], + "sumber_biaya_swadaya" => $value['sumber_biaya_swadaya'], + "sumber_biaya_jumlah" => $value['sumber_biaya_jumlah'], + "manfaat" => $value['manfaat'], + "waktu" => $value['waktu'], + "foto" => $value['foto'], + ]; + + Pembangunan::updateOrCreate([ + 'desa_id' => $insert['desa_id'], + 'id' => $insert['id'] + ], $insert); + } + } +} diff --git a/app/Imports/SinkronPembangunanDokumentasi.php b/app/Imports/SinkronPembangunanDokumentasi.php new file mode 100644 index 000000000..dc0eaa45d --- /dev/null +++ b/app/Imports/SinkronPembangunanDokumentasi.php @@ -0,0 +1,78 @@ + $value['desa_id'], + "id" => $value['id'], + "id_pembangunan" => $value['id_pembangunan'], + "gambar" => $value['gambar'], + "persentase" => $value['persentase'], + "keterangan" => $value['keterangan'], + "created_at" => $value['created_at'], + "updated_at" => $value['updated_at'], + ]; + + PembangunanDokumentasi::updateOrCreate([ + 'desa_id' => $insert['desa_id'], + 'id' => $insert['id'], + 'id_pembangunan' => $insert['id_pembangunan'] + ], $insert); + } + } +} diff --git a/app/Imports/SinkronPesertaBantuan.php b/app/Imports/SinkronPesertaBantuan.php new file mode 100644 index 000000000..74640dddf --- /dev/null +++ b/app/Imports/SinkronPesertaBantuan.php @@ -0,0 +1,111 @@ +exists()) { + Log::debug("Sinkronisasi Peserta Bantuan Gagal. Nomor NIK {$value['kartu_nik']} tidak terdaftar."); + DB::rollBack(); // rollback data yang sudah masuk karena ada data yang bermasalah + Storage::deleteDirectory('temp'); // Hapus folder temp ketika gagal + throw new Exception("Nomor NIK {$value['kartu_nik']} tidak terdaftar."); + } + } else { + // cek kk penduduk + if (!Penduduk::where('nik', $value['kartu_nik'])->whereHas('keluarga')->exists()) { + Log::debug("Sinkronisasi Peserta Bantuan Gagal. Nomor KK dari NIK {$value['kartu_nik']} tidak terdaftar."); + DB::rollBack(); // rollback data yang sudah masuk karena ada data yang bermasalah + Storage::deleteDirectory('temp'); // Hapus folder temp ketika gagal + throw new Exception("Nomor KK dari NIK {$value['kartu_nik']} tidak terdaftar."); + } + } + + $insert = [ + 'desa_id' => $value['desa_id'], + 'id' => $value['id'], + 'peserta' => $value['peserta'], + 'program_id' => $value['program_id'], + 'no_id_kartu' => $value['no_id_kartu'], + 'kartu_nik' => $value['kartu_nik'], + 'kartu_nama' => $value['kartu_nama'], + 'sasaran' => $value['sasaran'], + 'kartu_tempat_lahir' => $value['kartu_tempat_lahir'], + 'kartu_tanggal_lahir' => $value['kartu_tanggal_lahir'], + 'kartu_alamat' => $value['kartu_alamat'], + 'kartu_peserta' => $value['kartu_peserta'], + ]; + + PesertaProgram::updateOrCreate([ + 'desa_id' => $insert['desa_id'], + 'program_id' => $insert['program_id'], + 'kartu_nik' => $insert['kartu_nik'], + ], $insert); + } + + DB::commit(); // commit data dan simpan ke dalam database + // Hapus folder temp ketika sudah selesai + Storage::deleteDirectory('temp'); + } +} diff --git a/app/Models/DataDesa.php b/app/Models/DataDesa.php index caa6a6d3c..db7991ae6 100755 --- a/app/Models/DataDesa.php +++ b/app/Models/DataDesa.php @@ -42,6 +42,7 @@ class DataDesa extends Model 'nama', 'website', 'luas_wilayah', + 'path' ]; /** @@ -53,7 +54,7 @@ public function getWebsiteUrlFeedAttribute() { $desa = [ 'desa_id' => $this->desa_id, - 'nama' => 'Desa ' . $this->nama, + 'nama' => ucwords($this->sebutan_desa . ' ' . $this->nama), 'website' => $this->website . 'index.php/feed' ]; return $desa; diff --git a/app/Models/DataUmum.php b/app/Models/DataUmum.php index 5d3986502..db8ef48ee 100755 --- a/app/Models/DataUmum.php +++ b/app/Models/DataUmum.php @@ -61,6 +61,7 @@ class DataUmum extends Model 'jml_pasar', 'jml_balai_pertemuan', 'embed_peta', + 'path' ]; protected $appends = ['luas_wilayah_dari_data_desa']; diff --git a/app/Models/Pembangunan.php b/app/Models/Pembangunan.php new file mode 100644 index 000000000..15225b106 --- /dev/null +++ b/app/Models/Pembangunan.php @@ -0,0 +1,46 @@ +hasOne(PembangunanDokumentasi::class, 'id', 'id_pembangunan'); + } +} diff --git a/app/Models/PembangunanDokumentasi.php b/app/Models/PembangunanDokumentasi.php new file mode 100644 index 000000000..12f626b70 --- /dev/null +++ b/app/Models/PembangunanDokumentasi.php @@ -0,0 +1,41 @@ +hasMany(PesertaProgram::class, 'program_id', 'id'); } + + public function desa() + { + return $this->hasOne(DataDesa::class, 'desa_id', 'desa_id'); + } } diff --git a/app/Models/User.php b/app/Models/User.php index 53d8d2a62..f93bce659 100755 --- a/app/Models/User.php +++ b/app/Models/User.php @@ -107,7 +107,7 @@ public static function datatables() public function uploadImage($image) { $extension = $image->getClientOriginalExtension(); - $path = public_path('uploads/user/'); + $path = storage_path('app/public/user/'); if (! file_exists($path)) { File::makeDirectory($path, 0777, true); diff --git a/app/Providers/AppServiceProvider.php b/app/Providers/AppServiceProvider.php index 00ed329fb..445ba0a3a 100755 --- a/app/Providers/AppServiceProvider.php +++ b/app/Providers/AppServiceProvider.php @@ -34,6 +34,7 @@ use App\Models\DataDesa; use App\Models\DataUmum; use App\Models\Penduduk; +use Illuminate\Support\Facades\Blade; use Illuminate\Support\Facades\Cache; use Illuminate\Support\Facades\DB; use Illuminate\Support\Facades\Schema; @@ -53,6 +54,7 @@ public function boot() Schema::defaultStringLength(191); $this->penduduk(); $this->config(); + $this->blade(); } protected function penduduk() @@ -165,6 +167,13 @@ protected function config() ]); } + protected function blade() + { + Blade::directive('selected', function ($condition) { + return ""; + }); + } + /** * Register any application services. * diff --git a/catatan_rilis.md b/catatan_rilis.md index 0ab33d7e1..ced892a86 100644 --- a/catatan_rilis.md +++ b/catatan_rilis.md @@ -1,32 +1,26 @@ -#### [v22.05.01] +#### [v22.06.01] -Di rilis v22.05.01, menyediakan komunikasi pesan dengan Opensid. Rilis ini juga berisi perbaikan lain yang diminta Komunitas OpenDK. - -Terima kasih pada [totoprayogo1916] yang terus berkontribusi. Terima kasih pula pada [wongjapan] yang baru mulai berkontribusi. +Di rilis v22.06.01, menyediakan [untuk diisi] Rilis ini juga berisi perbaikan lain yang diminta Komunitas OpenDK. +Terima kasih pada widoagus17 yang baru mulai berkontribusi. #### Penambahan Fitur -1. [#354](https://github.com/OpenSID/OpenDK/issues/354) Tambahkan tombol list/show data penduduk dapat diperluas hingga 500 baris. -2. [#355](https://github.com/OpenSID/OpenDK/issues/355) Perjelas status kehamilan pada tampilan detail data penduduk. -3. [#356](https://github.com/OpenSID/OpenDK/issues/356) Sediakan tombol kembali pada form detail data penduduk. -4. [#332](https://github.com/OpenSID/OpenDK/issues/332) Tambahkan fitur akfif/non-aktifkan FAQ di web. -6. [#139](https://github.com/OpenSID/OpenDK/issues/139) Tambahkan jumlah karakter pada isian tipologi sejarah. -7. [#294](https://github.com/OpenSID/OpenDK/issues/294) Ambil data tingkat pendidikan dari data penduduk hasil sinkronisasi penduduk. -8. [#313](https://github.com/OpenSID/OpenDK/issues/313) Sediakan group pengguna kontributor berita/artikel kecamatan. -9. [#310](https://github.com/OpenSID/OpenDK/issues/310) Tambahkan sinkronisasi profil desa OpenSID ke OpenDK. -10. [#218](https://github.com/OpenSID/OpenDK/issues/218) Sediakan kotak pesan untuk komunikasi dengan desa. -11. [#352](https://github.com/OpenSID/OpenDK/issues/352) Tambahkan Scrollbar Pada Menu List Nama Desa +1. [#302](https://github.com/OpenSID/OpenDK/issues/302) Pengaturan peta kecamatan yang sesuai perda setempat pada data kecamatan. +2. [#333](https://github.com/OpenSID/OpenDK/issues/333) Sinkronisasi Data Pembangunan OpenSID ke OpenDK. +3. [#384](https://github.com/OpenSID/OpenDK/issues/384) Sediakan ganti password saat selesai login jika menggunakan password masih default. +4. [#368](https://github.com/OpenSID/OpenDK/issues/368) Sinkronisasi Data Program Bantuan OpenSID ke OpenDK. +5. [#368](https://github.com/OpenSID/OpenDK/issues/368) Sediakan impor data Bantuan dari OpenSID. + #### Perbaikan BUG -1. [#353](https://github.com/OpenSID/OpenDK/issues/353) Perbaiki sikronisasi data penduduk OpenSID ke OpenDK. -2. [#370](https://github.com/OpenSID/OpenDK/issues/370) Perbaiki XHRrequest return 404 pada halaman ubah data umum. -3. [#374](https://github.com/OpenSID/OpenDK/pull/374) Sesuaikan format angka pada statistik. -4. [#361](https://github.com/OpenSID/OpenDK/issues/361) Perbaiki error migrasi 2022_03_09_134418_create_permission_tables. -5. [#365](https://github.com/OpenSID/OpenDK/issues/365) Perbaiki table das_setting tidak ada saat composer install. -6. [#385](https://github.com/OpenSID/OpenDK/issues/385) Perbaiki link demo OpenDK. -7. [#395](https://github.com/OpenSID/OpenDK/issues/395) Perbaiki nama desa yang terpotong karena terlalu panjang di menu desa. -8. [#394](https://github.com/OpenSID/OpenDK/issues/394) Perbaiki form upload file hilang pada module event ketika gagal upload. +1. [#401](https://github.com/OpenSID/OpenDK/issues/401) Perbaiki tidak bisa ubah gambar slider. +2. [#391](https://github.com/OpenSID/OpenDK/issues/391) Perbaiki gagal upload foto profil user. +3. [#402](https://github.com/OpenSID/OpenDK/issues/402) Perbaiki artikel baru tidak tampil dan sesuaikan urutannya. +4. [#400](https://github.com/OpenSID/OpenDK/issues/400) Perbaiki select data penyakit tidak sesuai dengan inputan pada form ubah data modul Epidemi Penyakit. +5. [#412](https://github.com/OpenSID/OpenDK/issues/412) Perbaiki error contoh data website demo saat intalasi awal. + #### TEKNIS -1. Perbaiki error jquery(...).validate not function. +1. [#72](https://github.com/OpenSID/OpenDK/issues/72) Amankan route api penduduk dengan middleware. +2. Sesuaikan sebutan desa yang tidak muncul. diff --git a/config/app.php b/config/app.php index 8e2ea3dff..a767a321e 100644 --- a/config/app.php +++ b/config/app.php @@ -37,7 +37,7 @@ |-------------------------------------------------------------------------- */ - 'version' => 'v22.05.01', + 'version' => 'v22.06.01', /* |-------------------------------------------------------------------------- diff --git a/database/migrations/2022_04_17_225617_create_table_das_pembangunan.php b/database/migrations/2022_04_17_225617_create_table_das_pembangunan.php new file mode 100644 index 000000000..bd9f3bc5e --- /dev/null +++ b/database/migrations/2022_04_17_225617_create_table_das_pembangunan.php @@ -0,0 +1,81 @@ +integer('id', false); + $table->char('desa_id', 13); + $table->string('lokasi', 255)->nullable(); + $table->string('sumber_dana', 255)->nullable(); + $table->string('judul', 255)->nullable(); + $table->string('slug', 255)->nullable(); + $table->string('keterangan', 255)->nullable(); + $table->string('volume', 255)->nullable(); + $table->year('tahun_anggaran')->nullable(); + $table->string('pelaksana_kegiatan', 255)->nullable(); + $table->tinyInteger('status')->nullable(); + $table->string('foto', 255)->nullable(); + $table->float('anggaran', 65, 2)->nullable(); + $table->float('perubahan_anggaran', 65, 2)->nullable(); + $table->float('sumber_biaya_pemerintah', 65, 2)->nullable(); + $table->float('sumber_biaya_provinsi', 65, 2)->nullable(); + $table->float('sumber_biaya_kab_kota', 65, 2)->nullable(); + $table->float('sumber_biaya_swadaya', 65, 2)->nullable(); + $table->float('sumber_biaya_jumlah', 65, 2)->nullable(); + $table->string('manfaat', 100)->nullable(); + $table->integer('waktu')->nullable(); + $table->timestamps(); + $table->unique(['id', 'desa_id']); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::dropIfExists('das_pembangunan'); + } +} diff --git a/database/migrations/2022_04_18_070823_create_table_das_pembangunan_dokumentasi.php b/database/migrations/2022_04_18_070823_create_table_das_pembangunan_dokumentasi.php new file mode 100644 index 000000000..d8e20e90f --- /dev/null +++ b/database/migrations/2022_04_18_070823_create_table_das_pembangunan_dokumentasi.php @@ -0,0 +1,66 @@ +integer('id'); + $table->integer('id_pembangunan'); + $table->char('desa_id', 13); + $table->string('gambar', 255)->nullable(); + $table->string('persentase', 255)->nullable(); + $table->string('keterangan', 255)->nullable(); + $table->timestamps(); + $table->unique(['id', 'desa_id', 'id_pembangunan']); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::dropIfExists('table_das_pembangunan_dokumentasi'); + } +} diff --git a/database/migrations/2022_04_19_074746_create_role_api.php b/database/migrations/2022_04_19_074746_create_role_api.php new file mode 100644 index 000000000..aa8cc21ed --- /dev/null +++ b/database/migrations/2022_04_19_074746_create_role_api.php @@ -0,0 +1,72 @@ + 'view', 'guard_name' => 'api']); + Permission::create(['name' => 'create', 'guard_name' => 'api']); + Permission::create(['name' => 'edit', 'guard_name' => 'api']); + Permission::create(['name' => 'delete', 'guard_name' => 'api']); + + $role = [ + ['name' =>'admin-desa', 'guard_name' => 'api'], + ['name' =>'admin-kecamatan', 'guard_name' => 'api'], + ['name' =>'admin-puskesmas', 'guard_name' => 'api'], + ['name' =>'admin-pendidikan', 'guard_name' => 'api'], + ['name' =>'admin-komplain', 'guard_name' => 'api'], + ['name' =>'administrator-website', 'guard_name' => 'api'], + ]; + foreach ($role as $value) { + Role::create($value)->givePermissionTo(['view', 'create', 'edit', 'delete']); + } + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + } +} diff --git a/database/migrations/2022_04_20_105732_tambahkan_kolom_programbantuan.php b/database/migrations/2022_04_20_105732_tambahkan_kolom_programbantuan.php new file mode 100644 index 000000000..330601b75 --- /dev/null +++ b/database/migrations/2022_04_20_105732_tambahkan_kolom_programbantuan.php @@ -0,0 +1,63 @@ +Char('desa_id', 13)->after('sasaran')->nullable(); + $table->tinyInteger('status', false, 1)->after('sasaran')->nullable(); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::table('das_program', function (Blueprint $table) { + $table->dropColumn('desa_id'); + $table->dropColumn('status'); + }); + } +} diff --git a/database/migrations/2022_04_20_115358_alter_programbantuan.php b/database/migrations/2022_04_20_115358_alter_programbantuan.php new file mode 100644 index 000000000..db223692c --- /dev/null +++ b/database/migrations/2022_04_20_115358_alter_programbantuan.php @@ -0,0 +1,65 @@ +text('description')->nullable()->change(); + $table->integer('id')->nullable(false)->unsigned()->change(); + $table->dropPrimary('id'); + $table->unique(['id', 'desa_id']); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::table('das_program', function (Blueprint $table) { + $table->string('description', 200)->nullable()->change(); + $table->integer('id', true)->nullable(false)->change(); + }); + } +} diff --git a/database/migrations/2022_04_20_122309_add_kolom_daspesertabantuan.php b/database/migrations/2022_04_20_122309_add_kolom_daspesertabantuan.php new file mode 100644 index 000000000..f46a8668c --- /dev/null +++ b/database/migrations/2022_04_20_122309_add_kolom_daspesertabantuan.php @@ -0,0 +1,61 @@ +Char('desa_id', 13)->after('kartu_peserta')->nullable(false); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::table('das_peserta_program', function (Blueprint $table) { + $table->dropColumn('desa_id'); + }); + } +} diff --git a/database/migrations/2022_04_21_224806_data_umum_path.php b/database/migrations/2022_04_21_224806_data_umum_path.php new file mode 100644 index 000000000..d7f5cb1e3 --- /dev/null +++ b/database/migrations/2022_04_21_224806_data_umum_path.php @@ -0,0 +1,61 @@ +json('path')->after('embed_peta')->nullable(); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::table('das_data_umum', function (Blueprint $table) { + $table->dropColumn('path'); + }); + } +} diff --git a/database/migrations/2022_04_22_230021_add_path_desa.php b/database/migrations/2022_04_22_230021_add_path_desa.php new file mode 100644 index 000000000..dabeea34f --- /dev/null +++ b/database/migrations/2022_04_22_230021_add_path_desa.php @@ -0,0 +1,61 @@ +json('path')->after('website')->nullable(); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::table('das_data_desa', function (Blueprint $table) { + $table->dropColumn('path'); + }); + } +} diff --git a/database/migrations/2022_05_15_121032_default_sebutan_desa.php b/database/migrations/2022_05_15_121032_default_sebutan_desa.php new file mode 100644 index 000000000..b0a9d8aaa --- /dev/null +++ b/database/migrations/2022_05_15_121032_default_sebutan_desa.php @@ -0,0 +1,65 @@ +update(['sebutan_desa' => 'desa']); + + Schema::table('das_data_desa', function (Blueprint $table) { + $table->string('sebutan_desa')->default('desa')->change(); + }); + } + + /** + * Reverse the migrations. + * + * @return void + */ + public function down() + { + Schema::table('das_data_desa', function (Blueprint $table) { + $table->string('sebutan_desa')->default(null)->change(); + }); + } +} diff --git a/database/seeds/Demo/DemoDasDataDesaTableSeeder.php b/database/seeds/Demo/DemoDasDataDesaTableSeeder.php index bbce18a6b..fab4bb54a 100644 --- a/database/seeds/Demo/DemoDasDataDesaTableSeeder.php +++ b/database/seeds/Demo/DemoDasDataDesaTableSeeder.php @@ -44,6 +44,8 @@ class DemoDasDataDesaTableSeeder extends Seeder */ public function run() { + DB::statement('SET FOREIGN_KEY_CHECKS=0;'); + $profil = Profil::first(); DB::table('das_data_desa')->truncate(); @@ -176,5 +178,7 @@ public function run() 'website' => '', ], ]); + + DB::statement('SET FOREIGN_KEY_CHECKS=1;'); } } diff --git a/helpers/general_helper.php b/helpers/general_helper.php index fbd72c767..ba09dfe1f 100755 --- a/helpers/general_helper.php +++ b/helpers/general_helper.php @@ -317,6 +317,17 @@ function is_user($url = null, $sex = 1) return is_img($url, $default); } +function avatar($foto) +{ + if ($foto) { + $foto = 'storage/user/' . $foto; + } + + $default = 'bower_components/admin-lte/dist/img/user2-160x160.jpg'; + + return is_img($foto, $default); +} + if (! function_exists('divnum')) { function divnum($numerator, $denominator) { diff --git a/public/js/leaflet/L.Control.Locate.css b/public/js/leaflet/L.Control.Locate.css new file mode 100644 index 000000000..aa71a0c52 --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.css @@ -0,0 +1,76 @@ +/* Compatible with Leaflet 0.7 */ +.leaflet-control-locate a { + cursor: pointer; +} +.leaflet-control-locate a .leaflet-control-locate-location-arrow { + display: inline-block; + width: 16px; + height: 16px; + margin: 7px; + background-color: black; + -webkit-mask-image: url("../location-arrow-solid.svg"); + mask-image: url("../location-arrow-solid.svg"); + -webkit-mask-repeat: no-repeat; + mask-repeat: no-repeat; + -webkit-mask-position: center; + mask-position: center; +} +.leaflet-control-locate a .leaflet-control-locate-spinner { + display: inline-block; + width: 16px; + height: 16px; + margin: 7px; + background-color: black; + -webkit-mask-image: url("../spinner-solid.svg"); + mask-image: url("../spinner-solid.svg"); + -webkit-mask-repeat: no-repeat; + mask-repeat: no-repeat; + -webkit-mask-position: center; + mask-position: center; + animation: leaflet-control-locate-spin 2s linear infinite; +} +.leaflet-control-locate.active a .leaflet-control-locate-location-arrow { + background-color: #2074b6; +} +.leaflet-control-locate.following a .leaflet-control-locate-location-arrow { + background-color: #fc8428; +} + +.leaflet-touch .leaflet-bar .leaflet-locate-text-active { + width: 100%; + max-width: 200px; + text-overflow: ellipsis; + white-space: nowrap; + overflow: hidden; + padding: 0 10px; +} +.leaflet-touch .leaflet-bar .leaflet-locate-text-active .leaflet-locate-icon { + padding: 0 5px 0 0; +} + +.leaflet-control-locate-location circle { + animation: leaflet-control-locate-throb 4s ease infinite; +} + +@keyframes leaflet-control-locate-throb { + 0% { + stroke-width: 1; + } + 50% { + stroke-width: 3; + transform: scale(0.8, 0.8); + } + 100% { + stroke-width: 1; + } +} +@keyframes leaflet-control-locate-spin { + 0% { + transform: rotate(0deg); + } + 100% { + transform: rotate(360deg); + } +} + +/*# sourceMappingURL=L.Control.Locate.css.map */ diff --git a/public/js/leaflet/L.Control.Locate.css.map b/public/js/leaflet/L.Control.Locate.css.map new file mode 100644 index 000000000..a63832b06 --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.css.map @@ -0,0 +1,7 @@ +{ +"version": 3, +"mappings": "AAAA,iCAAiC;AAE/B,yBAAE;EACA,SAAS,EAAE,KAAK;EAChB,KAAK,EAAE,IAAI;EACX,MAAM,EAAE,OAAO;;AAGf,gCAAE;EACA,KAAK,EAAE,OAAO;;AAEhB,0CAAc;EACZ,KAAK,EAAE,OAAO;;;AAKpB,uCAAwC;EACtC,SAAS,EAAE,6CAA6C;;;AAG1D,uCAWC;EAVC,EAAG;IACD,YAAY,EAAE,CAAC;;EAEjB,GAAI;IACF,YAAY,EAAE,CAAC;IACf,SAAS,EAAE,eAAe;;EAE5B,IAAK;IACH,YAAY,EAAE,CAAC", +"sources": ["../src/L.Control.Locate.scss"], +"names": [], +"file": "L.Control.Locate.css" +} diff --git a/public/js/leaflet/L.Control.Locate.mapbox.css b/public/js/leaflet/L.Control.Locate.mapbox.css new file mode 100644 index 000000000..f6170e0e1 --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.mapbox.css @@ -0,0 +1,83 @@ +/* Compatible with Leaflet 0.7 */ +.leaflet-control-locate a { + cursor: pointer; +} +.leaflet-control-locate a .leaflet-control-locate-location-arrow { + display: inline-block; + width: 16px; + height: 16px; + margin: 7px; + background-color: black; + -webkit-mask-image: url("../location-arrow-solid.svg"); + mask-image: url("../location-arrow-solid.svg"); + -webkit-mask-repeat: no-repeat; + mask-repeat: no-repeat; + -webkit-mask-position: center; + mask-position: center; +} +.leaflet-control-locate a .leaflet-control-locate-spinner { + display: inline-block; + width: 16px; + height: 16px; + margin: 7px; + background-color: black; + -webkit-mask-image: url("../spinner-solid.svg"); + mask-image: url("../spinner-solid.svg"); + -webkit-mask-repeat: no-repeat; + mask-repeat: no-repeat; + -webkit-mask-position: center; + mask-position: center; + animation: leaflet-control-locate-spin 2s linear infinite; +} +.leaflet-control-locate.active a .leaflet-control-locate-location-arrow { + background-color: #2074b6; +} +.leaflet-control-locate.following a .leaflet-control-locate-location-arrow { + background-color: #fc8428; +} + +.leaflet-touch .leaflet-bar .leaflet-locate-text-active { + width: 100%; + max-width: 200px; + text-overflow: ellipsis; + white-space: nowrap; + overflow: hidden; + padding: 0 10px; +} +.leaflet-touch .leaflet-bar .leaflet-locate-text-active .leaflet-locate-icon { + padding: 0 5px 0 0; +} + +.leaflet-control-locate-location circle { + animation: leaflet-control-locate-throb 4s ease infinite; +} + +@keyframes leaflet-control-locate-throb { + 0% { + stroke-width: 1; + } + 50% { + stroke-width: 3; + transform: scale(0.8, 0.8); + } + 100% { + stroke-width: 1; + } +} +@keyframes leaflet-control-locate-spin { + 0% { + transform: rotate(0deg); + } + 100% { + transform: rotate(360deg); + } +} +/* Mapbox specific adjustments */ +.leaflet-control-locate a { + padding: 3px 0 0 8px; +} +.leaflet-control-locate.requesting a { + padding: 3px 0 0 4px; +} + +/*# sourceMappingURL=L.Control.Locate.mapbox.css.map */ diff --git a/public/js/leaflet/L.Control.Locate.mapbox.css.map b/public/js/leaflet/L.Control.Locate.mapbox.css.map new file mode 100644 index 000000000..16e8ed86c --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.mapbox.css.map @@ -0,0 +1,7 @@ +{ +"version": 3, +"mappings": "AAAA,iCAAiC;AAE/B,yBAAE;EACA,SAAS,EAAE,KAAK;EAChB,KAAK,EAAE,IAAI;EACX,MAAM,EAAE,OAAO;;AAGf,gCAAE;EACA,KAAK,EAAE,OAAO;;AAEhB,0CAAc;EACZ,KAAK,EAAE,OAAO;;;AAKpB,uCAAwC;EACtC,SAAS,EAAE,6CAA6C;;;AAG1D,uCAWC;EAVC,EAAG;IACD,YAAY,EAAE,CAAC;;EAEjB,GAAI;IACF,YAAY,EAAE,CAAC;IACf,SAAS,EAAE,eAAe;;EAE5B,IAAK;IACH,YAAY,EAAE,CAAC;;;AC5BnB,iCAAiC;AAG/B,yBAAE;EACC,OAAO,EAAE,WAAW;;AAGrB,oCAAE;EACA,OAAO,EAAE,WAAW", +"sources": ["../src/L.Control.Locate.scss","../src/L.Control.Locate.mapbox.scss"], +"names": [], +"file": "L.Control.Locate.mapbox.css" +} diff --git a/public/js/leaflet/L.Control.Locate.mapbox.min.css b/public/js/leaflet/L.Control.Locate.mapbox.min.css new file mode 100644 index 000000000..612fbd1ed --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.mapbox.min.css @@ -0,0 +1 @@ +.leaflet-control-locate a{cursor:pointer}.leaflet-control-locate a .leaflet-control-locate-location-arrow{display:inline-block;width:16px;height:16px;margin:7px;background-color:#000;-webkit-mask-image:url("../location-arrow-solid.svg");mask-image:url("../location-arrow-solid.svg");-webkit-mask-repeat:no-repeat;mask-repeat:no-repeat;-webkit-mask-position:center;mask-position:center}.leaflet-control-locate a .leaflet-control-locate-spinner{display:inline-block;width:16px;height:16px;margin:7px;background-color:#000;-webkit-mask-image:url("../spinner-solid.svg");mask-image:url("../spinner-solid.svg");-webkit-mask-repeat:no-repeat;mask-repeat:no-repeat;-webkit-mask-position:center;mask-position:center;animation:leaflet-control-locate-spin 2s linear infinite}.leaflet-control-locate.active a .leaflet-control-locate-location-arrow{background-color:#2074b6}.leaflet-control-locate.following a .leaflet-control-locate-location-arrow{background-color:#fc8428}.leaflet-touch .leaflet-bar .leaflet-locate-text-active{width:100%;max-width:200px;text-overflow:ellipsis;white-space:nowrap;overflow:hidden;padding:0 10px}.leaflet-touch .leaflet-bar .leaflet-locate-text-active .leaflet-locate-icon{padding:0 5px 0 0}.leaflet-control-locate-location circle{animation:leaflet-control-locate-throb 4s ease infinite}@keyframes leaflet-control-locate-throb{0%{stroke-width:1}50%{stroke-width:3;transform:scale(0.8, 0.8)}100%{stroke-width:1}}@keyframes leaflet-control-locate-spin{0%{transform:rotate(0deg)}100%{transform:rotate(360deg)}}.leaflet-control-locate a{padding:3px 0 0 8px}.leaflet-control-locate.requesting a{padding:3px 0 0 4px}/*# sourceMappingURL=L.Control.Locate.mapbox.min.css.map */ diff --git a/public/js/leaflet/L.Control.Locate.mapbox.min.css.map b/public/js/leaflet/L.Control.Locate.mapbox.min.css.map new file mode 100644 index 000000000..8d3dc118a --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.mapbox.min.css.map @@ -0,0 +1 @@ +{"version":3,"sourceRoot":"","sources":["../src/L.Control.Locate.scss","../src/L.Control.Locate.mapbox.scss"],"names":[],"mappings":"AAEE,0BACE,eAEA,iEACE,qBACA,WACA,YACA,WACA,sBACA,sDACA,8CACA,8BACA,sBACA,6BACA,qBAGF,0DACE,qBACA,WACA,YACA,WACA,sBACA,+CACA,uCACA,8BACA,sBACA,6BACA,qBACA,yDAIJ,wEACE,yBAGF,2EACE,yBAIJ,wDACE,WACA,gBACA,uBACA,mBACA,gBACA,eAEA,6EACE,kBAIJ,wCACE,wDAGF,wCACE,GACE,eAGF,IACE,eACA,0BAGF,KACE,gBAIJ,uCACE,GACE,uBAGF,KACE,0BC7EF,0BACG,oBAGD,qCACE","file":"L.Control.Locate.mapbox.min.css"} \ No newline at end of file diff --git a/public/js/leaflet/L.Control.Locate.min.css b/public/js/leaflet/L.Control.Locate.min.css new file mode 100644 index 000000000..c98a75b14 --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.min.css @@ -0,0 +1 @@ +.leaflet-control-locate a{cursor:pointer}.leaflet-control-locate a .leaflet-control-locate-location-arrow{display:inline-block;width:16px;height:16px;margin:7px;background-color:#000;-webkit-mask-image:url("../location-arrow-solid.svg");mask-image:url("../location-arrow-solid.svg");-webkit-mask-repeat:no-repeat;mask-repeat:no-repeat;-webkit-mask-position:center;mask-position:center}.leaflet-control-locate a .leaflet-control-locate-spinner{display:inline-block;width:16px;height:16px;margin:7px;background-color:#000;-webkit-mask-image:url("../spinner-solid.svg");mask-image:url("../spinner-solid.svg");-webkit-mask-repeat:no-repeat;mask-repeat:no-repeat;-webkit-mask-position:center;mask-position:center;animation:leaflet-control-locate-spin 2s linear infinite}.leaflet-control-locate.active a .leaflet-control-locate-location-arrow{background-color:#2074b6}.leaflet-control-locate.following a .leaflet-control-locate-location-arrow{background-color:#fc8428}.leaflet-touch .leaflet-bar .leaflet-locate-text-active{width:100%;max-width:200px;text-overflow:ellipsis;white-space:nowrap;overflow:hidden;padding:0 10px}.leaflet-touch .leaflet-bar .leaflet-locate-text-active .leaflet-locate-icon{padding:0 5px 0 0}.leaflet-control-locate-location circle{animation:leaflet-control-locate-throb 4s ease infinite}@keyframes leaflet-control-locate-throb{0%{stroke-width:1}50%{stroke-width:3;transform:scale(0.8, 0.8)}100%{stroke-width:1}}@keyframes leaflet-control-locate-spin{0%{transform:rotate(0deg)}100%{transform:rotate(360deg)}}/*# sourceMappingURL=L.Control.Locate.min.css.map */ diff --git a/public/js/leaflet/L.Control.Locate.min.css.map b/public/js/leaflet/L.Control.Locate.min.css.map new file mode 100644 index 000000000..89602d3ec --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.min.css.map @@ -0,0 +1 @@ +{"version":3,"sourceRoot":"","sources":["../src/L.Control.Locate.scss"],"names":[],"mappings":"AAEE,0BACE,eAEA,iEACE,qBACA,WACA,YACA,WACA,sBACA,sDACA,8CACA,8BACA,sBACA,6BACA,qBAGF,0DACE,qBACA,WACA,YACA,WACA,sBACA,+CACA,uCACA,8BACA,sBACA,6BACA,qBACA,yDAIJ,wEACE,yBAGF,2EACE,yBAIJ,wDACE,WACA,gBACA,uBACA,mBACA,gBACA,eAEA,6EACE,kBAIJ,wCACE,wDAGF,wCACE,GACE,eAGF,IACE,eACA,0BAGF,KACE,gBAIJ,uCACE,GACE,uBAGF,KACE","file":"L.Control.Locate.min.css"} \ No newline at end of file diff --git a/public/js/leaflet/L.Control.Locate.min.js b/public/js/leaflet/L.Control.Locate.min.js new file mode 100644 index 000000000..c5a6c01cb --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.min.js @@ -0,0 +1,5 @@ +/*! Version: 0.76.0 +Copyright (c) 2016 Dominik Moritz */ + +!function(t,i){"function"==typeof define&&define.amd?define(["leaflet"],t):"object"==typeof exports&&(void 0!==i&&i.L?module.exports=t(L):module.exports=t(require("leaflet"))),void 0!==i&&i.L&&(i.L.Control.Locate=t(L))}(function(l){const s=(i,s,t)=>{(t=t.split(" ")).forEach(function(t){l.DomUtil[i].call(this,s,t)})},i=(t,i)=>s("addClass",t,i),o=(t,i)=>s("removeClass",t,i),t=l.Marker.extend({initialize(t,i){l.Util.setOptions(this,i),this._latlng=t,this.createIcon()},createIcon(){var t=this.options;let i="";void 0!==t.color&&(i+=`stroke:${t.color};`),void 0!==t.weight&&(i+=`stroke-width:${t.weight};`),void 0!==t.fillColor&&(i+=`fill:${t.fillColor};`),void 0!==t.fillOpacity&&(i+=`fill-opacity:${t.fillOpacity};`),void 0!==t.opacity&&(i+=`opacity:${t.opacity};`);t=this._getIconSVG(t,i);this._locationIcon=l.divIcon({className:t.className,html:t.svg,iconSize:[t.w,t.h]}),this.setIcon(this._locationIcon)},_getIconSVG(t,i){var s=t.radius,o=s+t.weight,t=2*o;return{className:"leaflet-control-locate-location",svg:``+'',w:t,h:t}},setStyle(t){l.Util.setOptions(this,t),this.createIcon()}});var e=t.extend({initialize(t,i,s){l.Util.setOptions(this,s),this._latlng=t,this._heading=i,this.createIcon()},setHeading(t){this._heading=t},_getIconSVG(t,i){var s=t.radius,o=t.width+t.weight,s=2*(s+t.depth+t.weight),t=`M0,0 l${t.width/2},${t.depth} l-${o},0 z`;return{className:"leaflet-control-locate-heading",svg:``+'',w:o,h:s}}}),e=l.Control.extend({options:{position:"topleft",layer:void 0,setView:"untilPanOrZoom",keepCurrentZoomLevel:!1,initialZoomLevel:!1,getLocationBounds(t){return t.bounds},flyTo:!1,clickBehavior:{inView:"stop",outOfView:"setView",inViewNotFollowing:"inView"},returnToPrevBounds:!1,cacheLocation:!0,drawCircle:!0,drawMarker:!0,showCompass:!0,markerClass:t,compassClass:e,circleStyle:{className:"leaflet-control-locate-circle",color:"#136AEC",fillColor:"#136AEC",fillOpacity:.15,weight:0},markerStyle:{className:"leaflet-control-locate-marker",color:"#fff",fillColor:"#2A93EE",fillOpacity:1,weight:3,opacity:1,radius:9},compassStyle:{fillColor:"#2A93EE",fillOpacity:1,weight:0,color:"#fff",opacity:1,radius:9,width:9,depth:6},followCircleStyle:{},followMarkerStyle:{},followCompassStyle:{},icon:"leaflet-control-locate-location-arrow",iconLoading:"leaflet-control-locate-spinner",iconElementTag:"span",textElementTag:"small",circlePadding:[0,0],metric:!0,createButtonCallback(t,i){const s=l.DomUtil.create("a","leaflet-bar-part leaflet-bar-part-single",t);s.title=i.strings.title,s.role="button",s.href="#";const o=l.DomUtil.create(i.iconElementTag,i.icon,s);if(void 0!==i.strings.text){const e=l.DomUtil.create(i.textElementTag,"leaflet-locate-text",s);e.textContent=i.strings.text,s.classList.add("leaflet-locate-text-active"),s.parentNode.style.display="flex",0new l.Control.Locate(t),e},window); +//# sourceMappingURL=L.Control.Locate.min.js.map \ No newline at end of file diff --git a/public/js/leaflet/L.Control.Locate.min.js.map b/public/js/leaflet/L.Control.Locate.min.js.map new file mode 100644 index 000000000..32312583c --- /dev/null +++ b/public/js/leaflet/L.Control.Locate.min.js.map @@ -0,0 +1 @@ +{"version":3,"file":"L.Control.Locate.min.js","sources":["../src/L.Control.Locate.js"],"names":["factory","window","define","amd","exports","L","module","require","Control","Locate","LDomUtilApplyClassesMethod","method","element","classNames","split","forEach","className","DomUtil","call","this","addClasses","el","names","removeClasses","LocationMarker","Marker","extend","initialize","latlng","options","Util","setOptions","_latlng","createIcon","opt","style","undefined","color","weight","fillColor","fillOpacity","opacity","icon","_getIconSVG","_locationIcon","divIcon","html","svg","iconSize","w","h","setIcon","r","radius","s","s2","setStyle","CompassMarker","heading","_heading","setHeading","width","depth","path","LocateControl","position","layer","setView","keepCurrentZoomLevel","initialZoomLevel","getLocationBounds","locationEvent","bounds","flyTo","clickBehavior","inView","outOfView","inViewNotFollowing","returnToPrevBounds","cacheLocation","drawCircle","drawMarker","showCompass","markerClass","compassClass","circleStyle","markerStyle","compassStyle","followCircleStyle","followMarkerStyle","followCompassStyle","iconLoading","iconElementTag","textElementTag","circlePadding","metric","createButtonCallback","container","link","create","title","strings","role","href","text","textContent","classList","add","parentNode","display","length","onLocationError","err","control","alert","message","onLocationOutsideMapBounds","stop","outsideMapBoundsMsg","showPopup","metersUnit","feetUnit","popup","locateOptions","maxZoom","Infinity","watch","i","onAdd","map","_container","_map","_layer","LayerGroup","addTo","_event","_compassHeading","_prevBounds","linkAndIcon","_link","_icon","DomEvent","on","ev","stopPropagation","preventDefault","_onClick","_resetVariables","_unload","_justClicked","wasFollowing","_isFollowing","_userPanned","_userZoomed","_active","behaviors","behavior","getBounds","contains","f","flyToBounds","fitBounds","bind","start","_updateContainerStyle","_activate","_drawMarker","_deactivate","_cleanClasses","_removeMarker","stopFollowing","locate","fire","_onLocationFound","_onLocationError","_onDrag","_onZoom","_onZoomEnd","oriAbs","_this","deviceorientation","_onDeviceOrientation","DeviceOrientationEvent","requestPermission","then","permissionState","stopLocate","off","_isOutsideMapBounds","latitude","longitude","panTo","_ignoreEvent","padding","requestAnimFrame","_drawCompass","cStyle","_compass","setLatLng","removeFrom","accuracy","mStyle","_circle","setRadius","circle","distance","unit","toFixed","_marker","t","getPopupText","template","bindPopup","_popup","clearLayers","_setCompassHeading","angle","isNaN","parseFloat","isFinite","Math","round","_onCompassNeedsCalibration","e","webkitCompassHeading","absolute","alpha","code","lat","lng","pad","getLatLng","maxBounds","_setClasses","state","removeClass"],"mappings":";;;CAMC,SAAUA,EAASC,GAKM,mBAAXC,QAAyBA,OAAOC,IACvCD,OAAO,CAAC,WAAYF,GAGM,iBAAZI,eACQ,IAAXH,GAA0BA,EAAOI,EACxCC,OAAOF,QAAUJ,EAAQK,GAEzBC,OAAOF,QAAUJ,EAAQO,QAAQ,kBAKnB,IAAXN,GAA0BA,EAAOI,IACxCJ,EAAOI,EAAEG,QAAQC,OAAST,EAAQK,IAnB1C,CAqBG,SAAUA,GACT,MAAMK,EAA6B,CAACC,EAAQC,EAASC,MACjDA,EAAaA,EAAWC,MAAM,MACnBC,QAAQ,SAASC,GACxBX,EAAEY,QAAQN,GAAQO,KAAKC,KAAMP,EAASI,MAIxCI,EAAa,CAACC,EAAIC,IAAUZ,EAA2B,WAAYW,EAAIC,GACvEC,EAAgB,CAACF,EAAIC,IAAUZ,EAA2B,cAAeW,EAAIC,GAK7EE,EAAiBnB,EAAEoB,OAAOC,OAAO,CACnCC,WAAWC,EAAQC,GACfxB,EAAEyB,KAAKC,WAAWZ,KAAMU,GACxBV,KAAKa,QAAUJ,EACfT,KAAKc,cAMTA,aACI,IAAMC,EAAMf,KAAKU,QAEjB,IAAIM,EAAQ,QAEMC,IAAdF,EAAIG,QACJF,aAAmBD,EAAIG,eAERD,IAAfF,EAAII,SACJH,mBAAyBD,EAAII,gBAEXF,IAAlBF,EAAIK,YACJJ,WAAiBD,EAAIK,mBAEDH,IAApBF,EAAIM,cACJL,mBAAyBD,EAAIM,qBAEbJ,IAAhBF,EAAIO,UACJN,cAAoBD,EAAIO,YAGtBC,EAAOvB,KAAKwB,YAAYT,EAAKC,GAEnChB,KAAKyB,cAAgBvC,EAAEwC,QAAQ,CAC3B7B,UAAW0B,EAAK1B,UAChB8B,KAAMJ,EAAKK,IACXC,SAAU,CAACN,EAAKO,EAAEP,EAAKQ,KAG3B/B,KAAKgC,QAAQhC,KAAKyB,gBAQtBD,YAAYd,EAASM,GACjB,IAAMiB,EAAIvB,EAAQwB,OAEZC,EAAIF,EADAvB,EAAQS,OAEZiB,EAAS,EAAJD,EAIX,MAAO,CACHtC,UAAW,kCACX+B,sDAL0DQ,cAAeA,8BAA+BD,MAAMA,KAAKC,KAAMA,MAC7H,cAAcH,EAAE,YAAYjB,EAAM,aAK9Bc,EAAGM,EACHL,EAAGK,IAIXC,SAASrB,GACL9B,EAAEyB,KAAKC,WAAWZ,KAAMgB,GACxBhB,KAAKc,gBAIb,IAAMwB,EAAgBjC,EAAeE,OAAO,CACxCC,WAAWC,EAAQ8B,EAAS7B,GACxBxB,EAAEyB,KAAKC,WAAWZ,KAAMU,GACxBV,KAAKa,QAAUJ,EACfT,KAAKwC,SAAWD,EAChBvC,KAAKc,cAGT2B,WAAWF,GACPvC,KAAKwC,SAAWD,GAMpBf,YAAYd,EAASM,GACjB,IAAMiB,EAAIvB,EAAQwB,OACZJ,EAAKpB,EAAQgC,MAAQhC,EAAQS,OAC7BY,EAAuC,GAAlCE,EAAEvB,EAAQiC,MAAQjC,EAAQS,QAC/ByB,WAAgBlC,EAAQgC,MAAM,KAAKhC,EAAQiC,WAAWb,QAK5D,MAAO,CACHjC,UAAW,iCACX+B,sDAL0DE,cAAcC,8BAA8BD,EAAE,OAAOA,KAAKC,kCADlF/B,KAAKwC,mBAE3C,YAAYI,EAAK,YAAY5B,EAAM,aAK/Bc,EAAAA,EACAC,EAAAA,MAMNc,EAAgB3D,EAAEG,QAAQkB,OAAO,CACnCG,QAAS,CAELoC,SAAU,UAEVC,WAAO9B,EAkBP+B,QAAS,iBAETC,sBAAsB,EAE7BC,kBAAkB,EAWXC,kBAAkBC,GACd,OAAOA,EAAcC,QAGzBC,OAAO,EAQPC,cAAe,CAEXC,OAAQ,OAERC,UAAW,UAKXC,mBAAoB,UAOxBC,oBAAoB,EAKpBC,eAAe,EAEfC,YAAY,EAEZC,YAAY,EAEZC,aAAa,EAEbC,YAAa3D,EAEb4D,aAAc3B,EAEd4B,YAAa,CACTrE,UAAa,gCACbqB,MAAa,UACbE,UAAa,UACbC,YAAa,IACbF,OAAa,GAGjBgD,YAAa,CACTtE,UAAa,gCACbqB,MAAa,OACbE,UAAa,UACbC,YAAa,EACbF,OAAa,EACbG,QAAa,EACbY,OAAa,GAGjBkC,aAAc,CACVhD,UAAa,UACbC,YAAa,EACbF,OAAa,EACbD,MAAa,OACbI,QAAa,EACbY,OAAa,EACbQ,MAAa,EACbC,MAAa,GAMjB0B,kBAAmB,GACnBC,kBAAmB,GAInBC,mBAAoB,GAEpBhD,KAAM,wCACNiD,YAAa,iCAEbC,eAAgB,OAEhBC,eAAgB,QAEhBC,cAAe,CAAC,EAAG,GAEnBC,QAAQ,EAMRC,qBAAqBC,EAAWpE,GAC5B,MAAMqE,EAAO7F,EAAEY,QAAQkF,OAAO,IAAK,2CAA4CF,GAC/EC,EAAKE,MAAQvE,EAAQwE,QAAQD,MAC7BF,EAAKI,KAAO,SACZJ,EAAKK,KAAO,IACZ,MAAM7D,EAAOrC,EAAEY,QAAQkF,OAAOtE,EAAQ+D,eAAgB/D,EAAQa,KAAMwD,GAEpE,QAA6B9D,IAAzBP,EAAQwE,QAAQG,KAAoB,CACpC,MAAMA,EAAOnG,EAAEY,QAAQkF,OAAOtE,EAAQgE,eAAgB,sBAAuBK,GAC7EM,EAAKC,YAAc5E,EAAQwE,QAAQG,KACzCN,EAAKQ,UAAUC,IAAI,8BACbT,EAAKU,WAAWzE,MAAM0E,QAAU,OACN,EAAtBhF,EAAQa,KAAKoE,QACbpE,EAAKgE,UAAUC,IAAI,uBAI3B,MAAO,CAAET,KAAAA,EAAMxD,KAAAA,IAGnBqE,gBAAgBC,EAAKC,GACjBC,MAAMF,EAAIG,UAMdC,2BAA2BH,GACvBA,EAAQI,OACRH,MAAMD,EAAQpF,QAAQwE,QAAQiB,sBAGlCC,WAAW,EACXlB,QAAS,CACLD,MAAO,qBACPoB,WAAY,SACZC,SAAU,OACVC,MAAO,mDACPJ,oBAAqB,sDAGzBK,cAAe,CACXC,QAASC,EAAAA,EACTC,OAAO,EACP3D,SAAS,IAKjBxC,WAAWE,GAEP,IAAK,MAAMkG,KAAKlG,EACmB,iBAApBV,KAAKU,QAAQkG,GACpB1H,EAAEqB,OAAOP,KAAKU,QAAQkG,GAAIlG,EAAQkG,IAElC5G,KAAKU,QAAQkG,GAAKlG,EAAQkG,GAKlC5G,KAAKU,QAAQ4D,kBAAoBpF,EAAEqB,OAAO,GAAIP,KAAKU,QAAQyD,YAAanE,KAAKU,QAAQ4D,mBACrFtE,KAAKU,QAAQ2D,kBAAoBnF,EAAEqB,OAAO,GAAIP,KAAKU,QAAQwD,YAAalE,KAAKU,QAAQ2D,mBACrFrE,KAAKU,QAAQ6D,mBAAqBrF,EAAEqB,OAAO,GAAIP,KAAKU,QAAQ0D,aAAcpE,KAAKU,QAAQ6D,qBAM3FsC,MAAMC,GACF,IAAMhC,EAAY5F,EAAEY,QAAQkF,OAAO,MACnC,sDACAhF,KAAK+G,WAAajC,EAClB9E,KAAKgH,KAAOF,EACZ9G,KAAKiH,OAASjH,KAAKU,QAAQqC,OAAS,IAAI7D,EAAEgI,WAC1ClH,KAAKiH,OAAOE,MAAML,GAClB9G,KAAKoH,YAASnG,EACdjB,KAAKqH,gBAAkB,KACvBrH,KAAKsH,YAAc,KAEbC,EAAcvH,KAAKU,QAAQmE,qBAAqBC,EAAW9E,KAAKU,SAmBtE,OAlBAV,KAAKwH,MAAQD,EAAYxC,KACzB/E,KAAKyH,MAAQF,EAAYhG,KAEzBrC,EAAEwI,SAASC,GACT3H,KAAKwH,MACL,QACA,SAAUI,GACR1I,EAAEwI,SAASG,gBAAgBD,GAC3B1I,EAAEwI,SAASI,eAAeF,GAC1B5H,KAAK+H,YAEP/H,MACA2H,GAAG3H,KAAKwH,MAAO,WAAYtI,EAAEwI,SAASG,iBAExC7H,KAAKgI,kBAELhI,KAAKgH,KAAKW,GAAG,SAAU3H,KAAKiI,QAASjI,MAE9B8E,GAMXiD,WACI/H,KAAKkI,cAAe,EACpB,IAAMC,EAAgBnI,KAAKoI,eAI3B,GAHApI,KAAKqI,aAAc,EACnBrI,KAAKsI,aAAc,EAEftI,KAAKuI,UAAYvI,KAAKoH,OAEtBpH,KAAKkG,YACF,GAAIlG,KAAKuI,QAAS,CACrB,IAAMC,EAAYxI,KAAKU,QAAQ6C,cAC/B,IAAIkF,EAAWD,EAAU/E,UAUzB,OATIzD,KAAKgH,KAAK0B,YAAYC,SAAS3I,KAAKoH,OAAO3G,UAC3CgI,EAAWN,EAAeK,EAAUhF,OAASgF,EAAU9E,oBAIvD8E,EAAUC,KACVA,EAAWD,EAAUC,IAGjBA,GACJ,IAAK,UACDzI,KAAKgD,UACL,MACJ,IAAK,OAED,GADAhD,KAAKkG,OACDlG,KAAKU,QAAQiD,mBAAoB,CACjC,MAAMiF,EAAI5I,KAAKU,QAAQ4C,MAAQtD,KAAKgH,KAAK6B,YAAc7I,KAAKgH,KAAK8B,UACjEF,EAAEG,KAAK/I,KAAKgH,KAAZ4B,CAAkB5I,KAAKsH,oBAK/BtH,KAAKU,QAAQiD,qBACf3D,KAAKsH,YAActH,KAAKgH,KAAK0B,aAE/B1I,KAAKgJ,QAGThJ,KAAKiJ,yBAQTD,QACIhJ,KAAKkJ,YAEDlJ,KAAKoH,SACLpH,KAAKmJ,YAAYnJ,KAAKgH,MAGlBhH,KAAKU,QAAQsC,SACbhD,KAAKgD,WAGbhD,KAAKiJ,yBAST/C,OACIlG,KAAKoJ,cAELpJ,KAAKqJ,gBACLrJ,KAAKgI,kBAELhI,KAAKsJ,iBAMTC,gBACIvJ,KAAKqI,aAAc,EACnBrI,KAAKiJ,wBACLjJ,KAAKmJ,eAYTD,YACI,IAAKlJ,KAAKuI,UACNvI,KAAKgH,KAAKwC,OAAOxJ,KAAKU,QAAQ8F,eAC9BxG,KAAKgH,KAAKyC,KAAK,iBAAkBzJ,MACjCA,KAAKuI,SAAU,EAGfvI,KAAKgH,KAAKW,GAAG,gBAAiB3H,KAAK0J,iBAAkB1J,MACrDA,KAAKgH,KAAKW,GAAG,gBAAiB3H,KAAK2J,iBAAkB3J,MACrDA,KAAKgH,KAAKW,GAAG,YAAa3H,KAAK4J,QAAS5J,MACxCA,KAAKgH,KAAKW,GAAG,YAAa3H,KAAK6J,QAAS7J,MACxCA,KAAKgH,KAAKW,GAAG,UAAW3H,KAAK8J,WAAY9J,MACrCA,KAAKU,QAAQqD,aAAa,CAC1B,MAAMgG,EAAS,gCAAiCjL,OAChD,GAAIiL,GAAW,wBAAyBjL,OAAS,CAC7C,MAAMkL,EAAQhK,KACRiK,EAAoB,WACtB/K,EAAEwI,SAASC,GAAG7I,OAAQiL,EAAS,4BAA8B,oBAAqBC,EAAME,qBAAsBF,IAE9GG,wBAA8E,mBAA7CA,uBAAuBC,kBACxDD,uBAAuBC,oBAAoBC,KAAK,SAAUC,GAC9B,YAApBA,GACAL,MAIRA,OAYpBb,cACIpJ,KAAKgH,KAAKuD,aACVvK,KAAKgH,KAAKyC,KAAK,mBAAoBzJ,MACnCA,KAAKuI,SAAU,EAEVvI,KAAKU,QAAQkD,gBACd5D,KAAKoH,YAASnG,GAIlBjB,KAAKgH,KAAKwD,IAAI,gBAAiBxK,KAAK0J,iBAAkB1J,MACtDA,KAAKgH,KAAKwD,IAAI,gBAAiBxK,KAAK2J,iBAAkB3J,MACtDA,KAAKgH,KAAKwD,IAAI,YAAaxK,KAAK4J,QAAS5J,MACzCA,KAAKgH,KAAKwD,IAAI,YAAaxK,KAAK6J,QAAS7J,MACzCA,KAAKgH,KAAKwD,IAAI,UAAWxK,KAAK8J,WAAY9J,MACtCA,KAAKU,QAAQqD,cACb/D,KAAKqH,gBAAkB,KACnB,gCAAiCvI,OACjCI,EAAEwI,SAAS8C,IAAI1L,OAAQ,4BAA6BkB,KAAKkK,qBAAsBlK,MACxE,wBAAyBlB,QAChCI,EAAEwI,SAAS8C,IAAI1L,OAAQ,oBAAqBkB,KAAKkK,qBAAsBlK,QAQnFgD,UAEY,IAWY4F,EAZZ5I,KAAKmJ,cACDnJ,KAAKyK,uBACLzK,KAAKoH,YAASnG,EACdjB,KAAKU,QAAQuF,2BAA2BjG,OAEpCA,KAAKkI,eAAkD,IAAlClI,KAAKU,QAAQwC,kBACtB0F,EAAI5I,KAAKU,QAAQ4C,MAAQtD,KAAKgH,KAAK1D,MAAQtD,KAAKgH,KAAKhE,SACvD+F,KAAK/I,KAAKgH,KAAZ4B,CAAkB,CAAC5I,KAAKoH,OAAOsD,SAAU1K,KAAKoH,OAAOuD,WAAY3K,KAAKU,QAAQwC,kBAC/ElD,KAAKU,QAAQuC,sBACR2F,EAAI5I,KAAKU,QAAQ4C,MAAQtD,KAAKgH,KAAK1D,MAAQtD,KAAKgH,KAAK4D,OACvD7B,KAAK/I,KAAKgH,KAAZ4B,CAAkB,CAAC5I,KAAKoH,OAAOsD,SAAU1K,KAAKoH,OAAOuD,aAEzD/B,EAAI5I,KAAKU,QAAQ4C,MAAQtD,KAAKgH,KAAK6B,YAAc7I,KAAKgH,KAAK8B,UAE/D9I,KAAK6K,cAAe,EACpBjC,EAAEG,KAAK/I,KAAKgH,KAAZ4B,CAAkB5I,KAAKU,QAAQyC,kBAAkBnD,KAAKoH,QAAS,CAC3D0D,QAAS9K,KAAKU,QAAQiE,cACtB8B,QAASzG,KAAKU,QAAQwC,kBAAoBlD,KAAKU,QAAQ8F,cAAcC,UAEzEvH,EAAEyB,KAAKoK,iBAAiB,WAEpB/K,KAAK6K,cAAe,GACrB7K,QASvBgL,eACI,IAIMvK,EAGIwK,EAPLjL,KAAKoH,SAIJ3G,EAAST,KAAKoH,OAAO3G,OAEvBT,KAAKU,QAAQqD,aAAetD,GAAmC,OAAzBT,KAAKqH,kBACrC4D,EAASjL,KAAKoI,eAAiBpI,KAAKU,QAAQ6D,mBAAqBvE,KAAKU,QAAQ0D,aAC/EpE,KAAKkL,UAGNlL,KAAKkL,SAASC,UAAU1K,GACxBT,KAAKkL,SAASzI,WAAWzC,KAAKqH,iBAE1BrH,KAAKkL,SAAS7I,UACdrC,KAAKkL,SAAS7I,SAAS4I,IAN3BjL,KAAKkL,SAAW,IAAIlL,KAAKU,QAAQuD,aAAaxD,EAAQT,KAAKqH,gBAAiB4D,GAAQ9D,MAAMnH,KAAKiH,UAWnGjH,KAAKkL,UAAclL,KAAKU,QAAQqD,aAAwC,OAAzB/D,KAAKqH,kBACpDrH,KAAKkL,SAASE,WAAWpL,KAAKiH,QAC9BjH,KAAKkL,SAAW,QASxB/B,mBACiClI,IAAzBjB,KAAKoH,OAAOiE,WACZrL,KAAKoH,OAAOiE,SAAW,GAG3B,MAAMnJ,EAASlC,KAAKoH,OAAOiE,SAC3B,IAyBUC,EAzBJ7K,EAAST,KAAKoH,OAAO3G,OAGvBT,KAAKU,QAAQmD,aACP7C,EAAQhB,KAAKoI,eAAiBpI,KAAKU,QAAQ2D,kBAAoBrE,KAAKU,QAAQwD,YAE7ElE,KAAKuL,QAGNvL,KAAKuL,QAAQJ,UAAU1K,GAAQ+K,UAAUtJ,GAAQG,SAASrB,GAF1DhB,KAAKuL,QAAUrM,EAAEuM,OAAOhL,EAAQyB,EAAQlB,GAAOmG,MAAMnH,KAAKiH,SAMlE,IAAIyE,EACAC,EAGAA,EAFA3L,KAAKU,QAAQkE,QACb8G,EAAWxJ,EAAO0J,QAAQ,GAClB5L,KAAKU,QAAQwE,QAAQmB,aAE7BqF,GAAqB,UAATxJ,GAAoB0J,QAAQ,GACjC5L,KAAKU,QAAQwE,QAAQoB,UAI5BtG,KAAKU,QAAQoD,aACPwH,EAAStL,KAAKoI,eAAiBpI,KAAKU,QAAQ4D,kBAAoBtE,KAAKU,QAAQyD,YAC9EnE,KAAK6L,SAGN7L,KAAK6L,QAAQV,UAAU1K,GAEnBT,KAAK6L,QAAQxJ,UACbrC,KAAK6L,QAAQxJ,SAASiJ,IAL1BtL,KAAK6L,QAAU,IAAI7L,KAAKU,QAAQsD,YAAYvD,EAAQ6K,GAAQnE,MAAMnH,KAAKiH,SAU/EjH,KAAKgL,eAEL,MAAMc,EAAI9L,KAAKU,QAAQwE,QAAQqB,MAC/B,SAASwF,IACL,MAAiB,iBAAND,EACA5M,EAAEyB,KAAKqL,SAASF,EAAG,CAACJ,SAAAA,EAAUC,KAAAA,IACjB,mBAANG,EACPA,EAAE,CAACJ,SAAAA,EAAUC,KAAAA,IAEbG,EAGX9L,KAAKU,QAAQ0F,WAAa0F,GAAK9L,KAAK6L,SACpC7L,KAAK6L,QACAI,UAAUF,KACVG,OAAOf,UAAU1K,GAEtBT,KAAKU,QAAQ0F,WAAa0F,GAAK9L,KAAKkL,UACpClL,KAAKkL,SACAe,UAAUF,KACVG,OAAOf,UAAU1K,IAO9B6I,gBACItJ,KAAKiH,OAAOkF,cACZnM,KAAK6L,aAAU5K,EACfjB,KAAKuL,aAAUtK,GAOnBgH,UACIjI,KAAKkG,OACLlG,KAAKgH,KAAKwD,IAAI,SAAUxK,KAAKiI,QAASjI,OAM1CoM,mBAAmBC,IACVC,MAAMC,WAAWF,KAAWG,SAASH,IACtCA,EAAQI,KAAKC,MAAML,GAEnBrM,KAAKqH,gBAAkBgF,EACvBnN,EAAEyB,KAAKoK,iBAAiB/K,KAAKgL,aAAchL,OAE3CA,KAAKqH,gBAAkB,MAO/BsF,6BACI3M,KAAKoM,sBAMTlC,qBAAqB0C,GACZ5M,KAAKuI,UAINqE,EAAEC,qBAEF7M,KAAKoM,mBAAmBQ,EAAEC,sBACnBD,EAAEE,UAAYF,EAAEG,OAEvB/M,KAAKoM,mBAAmB,IAAMQ,EAAEG,SAOxCpD,iBAAiB9D,GAEG,GAAZA,EAAImH,MAAahN,KAAKU,QAAQ8F,cAAcG,QAIhD3G,KAAKkG,OACLlG,KAAKU,QAAQkF,gBAAgBC,EAAK7F,QAMtC0J,iBAAiBkD,GAEb,KAAI5M,KAAKoH,QACJpH,KAAKoH,OAAO3G,OAAOwM,MAAQL,EAAEnM,OAAOwM,KACpCjN,KAAKoH,OAAO3G,OAAOyM,MAAQN,EAAEnM,OAAOyM,KAChClN,KAAKoH,OAAOiE,WAAauB,EAAEvB,WAI/BrL,KAAKuI,QAAV,CAUA,OALAvI,KAAKoH,OAASwF,EAEd5M,KAAKmJ,cACLnJ,KAAKiJ,wBAEGjJ,KAAKU,QAAQsC,SACjB,IAAK,OACGhD,KAAKkI,cACLlI,KAAKgD,UAET,MACJ,IAAK,WACIhD,KAAKqI,aACNrI,KAAKgD,UAET,MACJ,IAAK,iBACIhD,KAAKqI,aAAgBrI,KAAKsI,aAC3BtI,KAAKgD,UAET,MACJ,IAAK,SACDhD,KAAKgD,UAObhD,KAAKkI,cAAe,IAMxB0B,UAEQ5J,KAAKoH,SAAWpH,KAAK6K,eACrB7K,KAAKqI,aAAc,EACnBrI,KAAKiJ,wBACLjJ,KAAKmJ,gBAObU,UAEQ7J,KAAKoH,SAAWpH,KAAK6K,eACrB7K,KAAKsI,aAAc,EACnBtI,KAAKiJ,wBACLjJ,KAAKmJ,gBAObW,aACQ9J,KAAKoH,QACLpH,KAAKgL,eAGLhL,KAAKoH,SAAWpH,KAAK6K,cAEjB7K,KAAK6L,UAAY7L,KAAKgH,KAAK0B,YAAYyE,KAAK,IAAIxE,SAAS3I,KAAK6L,QAAQuB,eACtEpN,KAAKqI,aAAc,EACnBrI,KAAKiJ,wBACLjJ,KAAKmJ,gBAQjBf,eACI,QAAKpI,KAAKuI,UAImB,WAAzBvI,KAAKU,QAAQsC,UAEmB,aAAzBhD,KAAKU,QAAQsC,SACZhD,KAAKqI,YACmB,mBAAzBrI,KAAKU,QAAQsC,SACZhD,KAAKqI,cAAgBrI,KAAKsI,iBAD/B,KAQXmC,sBACI,YAAoBxJ,IAAhBjB,KAAKoH,SAGFpH,KAAKgH,KAAKtG,QAAQ2M,YACpBrN,KAAKgH,KAAKtG,QAAQ2M,UAAU1E,SAAS3I,KAAKoH,OAAO3G,UAM1DwI,wBACSjJ,KAAK+G,aAIN/G,KAAKuI,UAAYvI,KAAKoH,OAEtBpH,KAAKsN,YAAY,cACVtN,KAAKoI,eACZpI,KAAKsN,YAAY,aACVtN,KAAKuI,QACZvI,KAAKsN,YAAY,UAEjBtN,KAAKqJ,kBAObiE,YAAYC,GACK,cAATA,GACAnN,EAAcJ,KAAK+G,WAAY,oBAC/B9G,EAAWD,KAAK+G,WAAY,cAE5B3G,EAAcJ,KAAKyH,MAAOzH,KAAKU,QAAQa,MACvCtB,EAAWD,KAAKyH,MAAOzH,KAAKU,QAAQ8D,cACpB,UAAT+I,GACPnN,EAAcJ,KAAK+G,WAAY,wBAC/B9G,EAAWD,KAAK+G,WAAY,UAE5B3G,EAAcJ,KAAKyH,MAAOzH,KAAKU,QAAQ8D,aACvCvE,EAAWD,KAAKyH,MAAOzH,KAAKU,QAAQa,OACpB,aAATgM,IACPnN,EAAcJ,KAAK+G,WAAY,cAC/B9G,EAAWD,KAAK+G,WAAY,oBAE5B3G,EAAcJ,KAAKyH,MAAOzH,KAAKU,QAAQ8D,aACvCvE,EAAWD,KAAKyH,MAAOzH,KAAKU,QAAQa,QAO5C8H,gBACInK,EAAEY,QAAQ0N,YAAYxN,KAAK+G,WAAY,cACvC7H,EAAEY,QAAQ0N,YAAYxN,KAAK+G,WAAY,UACvC7H,EAAEY,QAAQ0N,YAAYxN,KAAK+G,WAAY,aAEvC3G,EAAcJ,KAAKyH,MAAOzH,KAAKU,QAAQ8D,aACvCvE,EAAWD,KAAKyH,MAAOzH,KAAKU,QAAQa,OAMxCyG,kBAEIhI,KAAKuI,SAAU,EAIfvI,KAAKkI,cAAe,EAGpBlI,KAAKqI,aAAc,EAGnBrI,KAAKsI,aAAc,KAM3B,OAFApJ,EAAE4G,QAAQ0D,OAAS,GAAa,IAAItK,EAAEG,QAAQC,OAAOoB,GAE9CmC,GACR/D"} \ No newline at end of file diff --git a/public/js/leaflet/MarkerCluster.Default.css b/public/js/leaflet/MarkerCluster.Default.css new file mode 100644 index 000000000..bbc8c9fb0 --- /dev/null +++ b/public/js/leaflet/MarkerCluster.Default.css @@ -0,0 +1,60 @@ +.marker-cluster-small { + background-color: rgba(181, 226, 140, 0.6); + } +.marker-cluster-small div { + background-color: rgba(110, 204, 57, 0.6); + } + +.marker-cluster-medium { + background-color: rgba(241, 211, 87, 0.6); + } +.marker-cluster-medium div { + background-color: rgba(240, 194, 12, 0.6); + } + +.marker-cluster-large { + background-color: rgba(253, 156, 115, 0.6); + } +.marker-cluster-large div { + background-color: rgba(241, 128, 23, 0.6); + } + + /* IE 6-8 fallback colors */ +.leaflet-oldie .marker-cluster-small { + background-color: rgb(181, 226, 140); + } +.leaflet-oldie .marker-cluster-small div { + background-color: rgb(110, 204, 57); + } + +.leaflet-oldie .marker-cluster-medium { + background-color: rgb(241, 211, 87); + } +.leaflet-oldie .marker-cluster-medium div { + background-color: rgb(240, 194, 12); + } + +.leaflet-oldie .marker-cluster-large { + background-color: rgb(253, 156, 115); + } +.leaflet-oldie .marker-cluster-large div { + background-color: rgb(241, 128, 23); +} + +.marker-cluster { + background-clip: padding-box; + border-radius: 20px; + } +.marker-cluster div { + width: 30px; + height: 30px; + margin-left: 5px; + margin-top: 5px; + + text-align: center; + border-radius: 15px; + font: 12px "Helvetica Neue", Arial, Helvetica, sans-serif; + } +.marker-cluster span { + line-height: 30px; + } \ No newline at end of file diff --git a/public/js/leaflet/MarkerCluster.css b/public/js/leaflet/MarkerCluster.css new file mode 100644 index 000000000..c60d71b7a --- /dev/null +++ b/public/js/leaflet/MarkerCluster.css @@ -0,0 +1,14 @@ +.leaflet-cluster-anim .leaflet-marker-icon, .leaflet-cluster-anim .leaflet-marker-shadow { + -webkit-transition: -webkit-transform 0.3s ease-out, opacity 0.3s ease-in; + -moz-transition: -moz-transform 0.3s ease-out, opacity 0.3s ease-in; + -o-transition: -o-transform 0.3s ease-out, opacity 0.3s ease-in; + transition: transform 0.3s ease-out, opacity 0.3s ease-in; +} + +.leaflet-cluster-spider-leg { + /* stroke-dashoffset (duration and function) should match with leaflet-marker-icon transform in order to track it exactly */ + -webkit-transition: -webkit-stroke-dashoffset 0.3s ease-out, -webkit-stroke-opacity 0.3s ease-in; + -moz-transition: -moz-stroke-dashoffset 0.3s ease-out, -moz-stroke-opacity 0.3s ease-in; + -o-transition: -o-stroke-dashoffset 0.3s ease-out, -o-stroke-opacity 0.3s ease-in; + transition: stroke-dashoffset 0.3s ease-out, stroke-opacity 0.3s ease-in; +} diff --git a/public/js/leaflet/images/gpx.png b/public/js/leaflet/images/gpx.png new file mode 100644 index 000000000..ac5e3e8ee Binary files /dev/null and b/public/js/leaflet/images/gpx.png differ diff --git a/public/js/leaflet/images/layers-2x.png b/public/js/leaflet/images/layers-2x.png new file mode 100644 index 000000000..200c333dc Binary files /dev/null and b/public/js/leaflet/images/layers-2x.png differ diff --git a/public/js/leaflet/images/layers.png b/public/js/leaflet/images/layers.png new file mode 100644 index 000000000..1a72e5784 Binary files /dev/null and b/public/js/leaflet/images/layers.png differ diff --git a/public/js/leaflet/images/marker-icon-2x.png b/public/js/leaflet/images/marker-icon-2x.png new file mode 100644 index 000000000..e4abba3b5 Binary files /dev/null and b/public/js/leaflet/images/marker-icon-2x.png differ diff --git a/public/js/leaflet/images/marker-icon.png b/public/js/leaflet/images/marker-icon.png new file mode 100644 index 000000000..950edf246 Binary files /dev/null and b/public/js/leaflet/images/marker-icon.png differ diff --git a/public/js/leaflet/images/marker-shadow.png b/public/js/leaflet/images/marker-shadow.png new file mode 100644 index 000000000..9fd297953 Binary files /dev/null and b/public/js/leaflet/images/marker-shadow.png differ diff --git a/public/js/leaflet/images/spritesheet-2x.png b/public/js/leaflet/images/spritesheet-2x.png new file mode 100644 index 000000000..c45231aff Binary files /dev/null and b/public/js/leaflet/images/spritesheet-2x.png differ diff --git a/public/js/leaflet/images/spritesheet.png b/public/js/leaflet/images/spritesheet.png new file mode 100644 index 000000000..97d71c680 Binary files /dev/null and b/public/js/leaflet/images/spritesheet.png differ diff --git a/public/js/leaflet/images/spritesheet.svg b/public/js/leaflet/images/spritesheet.svg new file mode 100644 index 000000000..3c00f3031 --- /dev/null +++ b/public/js/leaflet/images/spritesheet.svg @@ -0,0 +1,156 @@ + + + + + + image/svg+xml + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/public/js/leaflet/leaflet-geoman.css b/public/js/leaflet/leaflet-geoman.css new file mode 100644 index 000000000..0ce3e1c52 --- /dev/null +++ b/public/js/leaflet/leaflet-geoman.css @@ -0,0 +1,242 @@ +.marker-icon, +.marker-icon:focus { + background-color: #ffffff; + border: 1px solid #3388ff; + border-radius: 50%; + margin: -8px 0 0 -8px !important; + width: 14px !important; + height: 14px !important; + outline: 0; + transition: opacity ease 0.3s; +} + +.marker-icon-middle, +.marker-icon-middle:focus { + opacity: 0.7; + margin: -6px 0 0 -6px !important; + width: 10px !important; + height: 10px !important; +} + +.leaflet-pm-draggable { + cursor: move !important; +} + +.cursor-marker { + cursor: crosshair; + pointer-events: none; + opacity: 0; +} + +.cursor-marker.visible { + opacity: 1 !important; +} + +.leaflet-pm-invalid { + stroke: red; + transition: fill ease 0s, stroke ease 0s; +} + +.rect-style-marker, +.rect-start-marker { + opacity: 0; +} + +.rect-style-marker.visible, +.rect-start-marker.visible { + opacity: 1 !important; +} + +.vertexmarker-disabled { + opacity: 0.7; +} + +.leaflet-pm-toolbar { +} + +.leaflet-pm-toolbar .leaflet-buttons-control-button { + padding: 5px; + box-sizing: border-box; + position: relative; + z-index: 3; +} + +.leaflet-pm-toolbar + .leaflet-pm-actions-container + a.leaflet-pm-action:first-child:not(.pos-right), +.leaflet-pm-toolbar + .leaflet-pm-actions-container + a.leaflet-pm-action:last-child.pos-right { + border-radius: 0; +} + +.leaflet-pm-toolbar .button-container a.leaflet-buttons-control-button { + border-radius: 0; +} + +.leaflet-pm-toolbar + .button-container:last-child + a.leaflet-buttons-control-button { + border-radius: 0 0 2px 2px; +} + +.leaflet-pm-toolbar + .button-container:first-child + a.leaflet-buttons-control-button { + border-radius: 2px 2px 0 0; +} + +.leaflet-pm-toolbar + .button-container:last-child + a.leaflet-buttons-control-button { + border-bottom: none; +} + +.leaflet-pm-toolbar .control-fa-icon { + font-size: 19px; + line-height: 24px; +} + +.leaflet-pm-toolbar .control-icon { + width: 100%; + height: 100%; + box-sizing: border-box; + background-size: contain; + background-repeat: no-repeat; + background-position: center center; +} + +.leaflet-pm-toolbar .leaflet-pm-icon-marker { + background-image: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0iVVRGLTgiPz4KPHN2ZyB3aWR0aD0iMjRweCIgaGVpZ2h0PSIyNHB4IiB2aWV3Qm94PSIwIDAgMjQgMjQiIHZlcnNpb249IjEuMSIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiB4bWxuczp4bGluaz0iaHR0cDovL3d3dy53My5vcmcvMTk5OS94bGluayI+CiAgICA8IS0tIEdlbmVyYXRvcjogU2tldGNoIDUyLjUgKDY3NDY5KSAtIGh0dHA6Ly93d3cuYm9oZW1pYW5jb2RpbmcuY29tL3NrZXRjaCAtLT4KICAgIDx0aXRsZT5BdG9tcy9JY29ucy9Ub29scy9NYXJrZXI8L3RpdGxlPgogICAgPGRlc2M+Q3JlYXRlZCB3aXRoIFNrZXRjaC48L2Rlc2M+CiAgICA8ZGVmcz4KICAgICAgICA8cGF0aCBkPSJNMTUuNSwyNC44NzgyOTU5IEMxNS4yOTA5MjAxLDI0Ljg3NzIyMTkgMTUuMTc0NDg1NywyNC44NDY3ODE3IDE0LjY1OTA4NjYsMjQuMjM1NDE2MyBDMTAuMjE5Njk1NSwxOS40MTE4MDU0IDgsMTUuNTAxNDM5MiA4LDEyLjUwNDMxNzcgQzgsOC4zNTk3OTc0NiAxMS4zNTc4NjQ0LDUgMTUuNSw1IEMxOS42NDIxMzU2LDUgMjMsOC4zNTk3OTc0NiAyMywxMi41MDQzMTc3IEMyMywxNyAxOC4yODc4MjE3LDIxLjkyNjgzNzggMTYuMzMzNjYwMSwyNC4yNDQwMTg2IEMxNS44MjI0NjIyLDI0Ljg1MDE4MDIgMTUuNzA5MDc5OSwyNC44NzkzNjk5IDE1LjUsMjQuODc4Mjk1OSBaIE0xNS41LDE1LjUzMjY5NDggQzE3LjI3NTIwMSwxNS41MzI2OTQ4IDE4LjcxNDI4NTcsMTQuMTE4MDAwNCAxOC43MTQyODU3LDEyLjM3Mjg4NjQgQzE4LjcxNDI4NTcsMTAuNjI3NzcyMyAxNy4yNzUyMDEsOS4yMTMwNzc5MiAxNS41LDkuMjEzMDc3OTIgQzEzLjcyNDc5OSw5LjIxMzA3NzkyIDEyLjI4NTcxNDMsMTAuNjI3NzcyMyAxMi4yODU3MTQzLDEyLjM3Mjg4NjQgQzEyLjI4NTcxNDMsMTQuMTE4MDAwNCAxMy43MjQ3OTksMTUuNTMyNjk0OCAxNS41LDE1LjUzMjY5NDggWiIgaWQ9InBhdGgtMSI+PC9wYXRoPgogICAgPC9kZWZzPgogICAgPGcgaWQ9IlN5bWJvbHMiIHN0cm9rZT0ibm9uZSIgc3Ryb2tlLXdpZHRoPSIxIiBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiPgogICAgICAgIDxnIGlkPSJBdG9tcy9JY29ucy9Ub29scy9NYXJrZXIiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0zLjAwMDAwMCwgLTMuMDAwMDAwKSI+CiAgICAgICAgICAgIDxtYXNrIGlkPSJtYXNrLTIiIGZpbGw9IndoaXRlIj4KICAgICAgICAgICAgICAgIDx1c2UgeGxpbms6aHJlZj0iI3BhdGgtMSI+PC91c2U+CiAgICAgICAgICAgIDwvbWFzaz4KICAgICAgICAgICAgPHVzZSBpZD0iTWFzayIgZmlsbD0iIzVCNUI1QiIgZmlsbC1ydWxlPSJub256ZXJvIiB4bGluazpocmVmPSIjcGF0aC0xIj48L3VzZT4KICAgICAgICA8L2c+CiAgICA8L2c+Cjwvc3ZnPg==); +} +.leaflet-pm-toolbar .leaflet-pm-icon-polygon { + background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHhtbG5zOnhsaW5rPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5L3hsaW5rIiB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgPGRlZnM+CiAgICA8cGF0aCBpZD0icG9seWdvbi1hIiBkPSJNMTkuNDIwNjg5Miw5LjE2NTA5NzI1IEMxOS4xNTIzNjgxLDguNjY5OTI5MTQgMTksOC4xMDI3NTgzMSAxOSw3LjUgQzE5LDUuNTY3MDAzMzggMjAuNTY3MDAzNCw0IDIyLjUsNCBDMjQuNDMyOTk2Niw0IDI2LDUuNTY3MDAzMzggMjYsNy41IEMyNiw5LjI2MzIzNTk1IDI0LjY5NjE0NzEsMTAuNzIxOTQwNyAyMywxMC45NjQ1NTU2IEwyMywxOS4wMzU0NDQ0IEMyNC42OTYxNDcxLDE5LjI3ODA1OTMgMjYsMjAuNzM2NzY0IDI2LDIyLjUgQzI2LDI0LjQzMjk5NjYgMjQuNDMyOTk2NiwyNiAyMi41LDI2IEMyMC43MzY3NjQsMjYgMTkuMjc4MDU5MywyNC42OTYxNDcxIDE5LjAzNTQ0NDQsMjMgTDEwLjk2NDU1NTYsMjMgQzEwLjcyMTk0MDcsMjQuNjk2MTQ3MSA5LjI2MzIzNTk1LDI2IDcuNSwyNiBDNS41NjcwMDMzOCwyNiA0LDI0LjQzMjk5NjYgNCwyMi41IEM0LDIwLjU2NzAwMzQgNS41NjcwMDMzOCwxOSA3LjUsMTkgQzguMTAyNzU4MzEsMTkgOC42Njk5MjkxNCwxOS4xNTIzNjgxIDkuMTY1MDk3MjUsMTkuNDIwNjg5MiBMMTkuNDIwNjg5Miw5LjE2NTA5NzI1IFogTTIwLjgzNDkwNzMsMTAuNTc5MzA2MyBMMTAuNTc5MzEwOCwyMC44MzQ5MDI3IEMxMC42MDg2NzMxLDIwLjg4OTA4ODggMTAuNjM2NjQ2OSwyMC45NDQxMzcyIDEwLjY2MzE4NDQsMjEgTDE5LjMzNjgxNTYsMjEgQzE5LjY4MjU3NzUsMjAuMjcyMTU0IDIwLjI3MjE1NCwxOS42ODI1Nzc1IDIxLDE5LjMzNjgxNTYgTDIxLDEwLjY2MzE4NDQgQzIwLjk0NDEzNzIsMTAuNjM2NjQ2OSAyMC44ODkwODg4LDEwLjYwODY3MzEgMjAuODM0OTAyNywxMC41NzkzMTA4IFogTTIyLjUsOSBDMjMuMzI4NDI3MSw5IDI0LDguMzI4NDI3MTIgMjQsNy41IEMyNCw2LjY3MTU3Mjg4IDIzLjMyODQyNzEsNiAyMi41LDYgQzIxLjY3MTU3MjksNiAyMSw2LjY3MTU3Mjg4IDIxLDcuNSBDMjEsOC4zMjg0MjcxMiAyMS42NzE1NzI5LDkgMjIuNSw5IFogTTIyLjUsMjQgQzIzLjMyODQyNzEsMjQgMjQsMjMuMzI4NDI3MSAyNCwyMi41IEMyNCwyMS42NzE1NzI5IDIzLjMyODQyNzEsMjEgMjIuNSwyMSBDMjEuNjcxNTcyOSwyMSAyMSwyMS42NzE1NzI5IDIxLDIyLjUgQzIxLDIzLjMyODQyNzEgMjEuNjcxNTcyOSwyNCAyMi41LDI0IFogTTcuNSwyNCBDOC4zMjg0MjcxMiwyNCA5LDIzLjMyODQyNzEgOSwyMi41IEM5LDIxLjY3MTU3MjkgOC4zMjg0MjcxMiwyMSA3LjUsMjEgQzYuNjcxNTcyODgsMjEgNiwyMS42NzE1NzI5IDYsMjIuNSBDNiwyMy4zMjg0MjcxIDYuNjcxNTcyODgsMjQgNy41LDI0IFoiLz4KICA8L2RlZnM+CiAgPGcgZmlsbD0ibm9uZSIgZmlsbC1ydWxlPSJldmVub2RkIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMyAtMykiPgogICAgPG1hc2sgaWQ9InBvbHlnb24tYiIgZmlsbD0iI2ZmZiI+CiAgICAgIDx1c2UgeGxpbms6aHJlZj0iI3BvbHlnb24tYSIvPgogICAgPC9tYXNrPgogICAgPHVzZSBmaWxsPSIjNUI1QjVCIiBmaWxsLXJ1bGU9Im5vbnplcm8iIHhsaW5rOmhyZWY9IiNwb2x5Z29uLWEiLz4KICAgIDxnIGZpbGw9IiM1QjVCNUIiIG1hc2s9InVybCgjcG9seWdvbi1iKSI+CiAgICAgIDxyZWN0IHdpZHRoPSIzMCIgaGVpZ2h0PSIzMCIvPgogICAgPC9nPgogIDwvZz4KPC9zdmc+Cg==); +} +.leaflet-pm-toolbar .leaflet-pm-icon-polyline { + background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHhtbG5zOnhsaW5rPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5L3hsaW5rIiB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgPGRlZnM+CiAgICA8cGF0aCBpZD0ibGluZS1hIiBkPSJNOS4xNjUwOTcyNSwxOS40MjA2ODkyIEwxOC40MjA2ODkyLDEwLjE2NTA5NzMgQzE4LjE1MjM2ODEsOS42Njk5MjkxNCAxOCw5LjEwMjc1ODMxIDE4LDguNSBDMTgsNi41NjcwMDMzOCAxOS41NjcwMDM0LDUgMjEuNSw1IEMyMy40MzI5OTY2LDUgMjUsNi41NjcwMDMzOCAyNSw4LjUgQzI1LDEwLjQzMjk5NjYgMjMuNDMyOTk2NiwxMiAyMS41LDEyIEMyMC44OTcyNDE3LDEyIDIwLjMzMDA3MDksMTEuODQ3NjMxOSAxOS44MzQ5MDI3LDExLjU3OTMxMDggTDEwLjU3OTMxMDgsMjAuODM0OTAyNyBDMTAuODQ3NjMxOSwyMS4zMzAwNzA5IDExLDIxLjg5NzI0MTcgMTEsMjIuNSBDMTEsMjQuNDMyOTk2NiA5LjQzMjk5NjYyLDI2IDcuNSwyNiBDNS41NjcwMDMzOCwyNiA0LDI0LjQzMjk5NjYgNCwyMi41IEM0LDIwLjU2NzAwMzQgNS41NjcwMDMzOCwxOSA3LjUsMTkgQzguMTAyNzU4MzEsMTkgOC42Njk5MjkxNCwxOS4xNTIzNjgxIDkuMTY1MDk3MjUsMTkuNDIwNjg5MiBaIE0yMS41LDEwIEMyMi4zMjg0MjcxLDEwIDIzLDkuMzI4NDI3MTIgMjMsOC41IEMyMyw3LjY3MTU3Mjg4IDIyLjMyODQyNzEsNyAyMS41LDcgQzIwLjY3MTU3MjksNyAyMCw3LjY3MTU3Mjg4IDIwLDguNSBDMjAsOS4zMjg0MjcxMiAyMC42NzE1NzI5LDEwIDIxLjUsMTAgWiBNNy41LDI0IEM4LjMyODQyNzEyLDI0IDksMjMuMzI4NDI3MSA5LDIyLjUgQzksMjEuNjcxNTcyOSA4LjMyODQyNzEyLDIxIDcuNSwyMSBDNi42NzE1NzI4OCwyMSA2LDIxLjY3MTU3MjkgNiwyMi41IEM2LDIzLjMyODQyNzEgNi42NzE1NzI4OCwyNCA3LjUsMjQgWiIvPgogIDwvZGVmcz4KICA8ZyBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0zIC0zKSI+CiAgICA8bWFzayBpZD0ibGluZS1iIiBmaWxsPSIjZmZmIj4KICAgICAgPHVzZSB4bGluazpocmVmPSIjbGluZS1hIi8+CiAgICA8L21hc2s+CiAgICA8dXNlIGZpbGw9IiM1QjVCNUIiIGZpbGwtcnVsZT0ibm9uemVybyIgeGxpbms6aHJlZj0iI2xpbmUtYSIvPgogICAgPGcgZmlsbD0iIzVCNUI1QiIgbWFzaz0idXJsKCNsaW5lLWIpIj4KICAgICAgPHJlY3Qgd2lkdGg9IjMwIiBoZWlnaHQ9IjMwIi8+CiAgICA8L2c+CiAgPC9nPgo8L3N2Zz4K); +} +.leaflet-pm-toolbar .leaflet-pm-icon-circle { + background-image: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0iVVRGLTgiPz4KPHN2ZyB3aWR0aD0iMjRweCIgaGVpZ2h0PSIyNHB4IiB2aWV3Qm94PSIwIDAgMjQgMjQiIHZlcnNpb249IjEuMSIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiB4bWxuczp4bGluaz0iaHR0cDovL3d3dy53My5vcmcvMTk5OS94bGluayI+CiAgICA8IS0tIEdlbmVyYXRvcjogU2tldGNoIDUyLjUgKDY3NDY5KSAtIGh0dHA6Ly93d3cuYm9oZW1pYW5jb2RpbmcuY29tL3NrZXRjaCAtLT4KICAgIDx0aXRsZT5BdG9tcy9JY29ucy9Ub29scy9DaXJjbGU8L3RpdGxlPgogICAgPGRlc2M+Q3JlYXRlZCB3aXRoIFNrZXRjaC48L2Rlc2M+CiAgICA8ZGVmcz4KICAgICAgICA8cGF0aCBkPSJNMTguMjg5Nzc1MSw2Ljc4NjAyMjc1IEMxOC44OTI0MTMxLDYuMjk0NjQ5ODEgMTkuNjYxNzk3LDYgMjAuNSw2IEMyMi40MzI5OTY2LDYgMjQsNy41NjcwMDMzOCAyNCw5LjUgQzI0LDEwLjMzODIwMyAyMy43MDUzNTAyLDExLjEwNzU4NjkgMjMuMjEzOTc3MiwxMS43MTAyMjQ5IEMyMy43MTk1OTksMTIuODcxMjA1MyAyNCwxNC4xNTI4NTcxIDI0LDE1LjUgQzI0LDIwLjc0NjcwNTEgMTkuNzQ2NzA1MSwyNSAxNC41LDI1IEM5LjI1MzI5NDg4LDI1IDUsMjAuNzQ2NzA1MSA1LDE1LjUgQzUsMTAuMjUzMjk0OSA5LjI1MzI5NDg4LDYgMTQuNSw2IEMxNS44NDcxNDI5LDYgMTcuMTI4Nzk0Nyw2LjI4MDQwMDk4IDE4LjI4OTc3NTEsNi43ODYwMjI3NSBaIE0xNy4xNTA0MjI4LDguNDgxNzU4NiBDMTYuMzI2MzU4MSw4LjE3MDM5MjM2IDE1LjQzMzA3NzcsOCAxNC41LDggQzEwLjM1Nzg2NDQsOCA3LDExLjM1Nzg2NDQgNywxNS41IEM3LDE5LjY0MjEzNTYgMTAuMzU3ODY0NCwyMyAxNC41LDIzIEMxOC42NDIxMzU2LDIzIDIyLDE5LjY0MjEzNTYgMjIsMTUuNSBDMjIsMTQuNTY2OTIyMyAyMS44Mjk2MDc2LDEzLjY3MzY0MTkgMjEuNTE4MjQxNCwxMi44NDk1NzcyIEMyMS4xOTYwMzgzLDEyLjk0NzM5NjggMjAuODU0MTYyMiwxMyAyMC41LDEzIEMxOC41NjcwMDM0LDEzIDE3LDExLjQzMjk5NjYgMTcsOS41IEMxNyw5LjE0NTgzNzc4IDE3LjA1MjYwMzIsOC44MDM5NjE2OSAxNy4xNTA0MjI4LDguNDgxNzU4NiBaIE0xNC41LDE3IEMxMy42NzE1NzI5LDE3IDEzLDE2LjMyODQyNzEgMTMsMTUuNSBDMTMsMTQuNjcxNTcyOSAxMy42NzE1NzI5LDE0IDE0LjUsMTQgQzE1LjMyODQyNzEsMTQgMTYsMTQuNjcxNTcyOSAxNiwxNS41IEMxNiwxNi4zMjg0MjcxIDE1LjMyODQyNzEsMTcgMTQuNSwxNyBaIE0yMC41LDExIEMyMS4zMjg0MjcxLDExIDIyLDEwLjMyODQyNzEgMjIsOS41IEMyMiw4LjY3MTU3Mjg4IDIxLjMyODQyNzEsOCAyMC41LDggQzE5LjY3MTU3MjksOCAxOSw4LjY3MTU3Mjg4IDE5LDkuNSBDMTksMTAuMzI4NDI3MSAxOS42NzE1NzI5LDExIDIwLjUsMTEgWiIgaWQ9InBhdGgtMSI+PC9wYXRoPgogICAgPC9kZWZzPgogICAgPGcgaWQ9IlN5bWJvbHMiIHN0cm9rZT0ibm9uZSIgc3Ryb2tlLXdpZHRoPSIxIiBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiPgogICAgICAgIDxnIGlkPSJBdG9tcy9JY29ucy9Ub29scy9DaXJjbGUiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0zLjAwMDAwMCwgLTMuMDAwMDAwKSI+CiAgICAgICAgICAgIDxtYXNrIGlkPSJtYXNrLTIiIGZpbGw9IndoaXRlIj4KICAgICAgICAgICAgICAgIDx1c2UgeGxpbms6aHJlZj0iI3BhdGgtMSI+PC91c2U+CiAgICAgICAgICAgIDwvbWFzaz4KICAgICAgICAgICAgPHVzZSBpZD0iTWFzayIgZmlsbD0iIzVCNUI1QiIgZmlsbC1ydWxlPSJub256ZXJvIiB4bGluazpocmVmPSIjcGF0aC0xIj48L3VzZT4KICAgICAgICAgICAgPGcgaWQ9IkF0b21zL0NvbG9yL0dyZXkiIG1hc2s9InVybCgjbWFzay0yKSIgZmlsbD0iIzVCNUI1QiI+CiAgICAgICAgICAgICAgICA8cmVjdCBpZD0iUmVjdGFuZ2xlIiB4PSIwIiB5PSIwIiB3aWR0aD0iMzAiIGhlaWdodD0iMzAiPjwvcmVjdD4KICAgICAgICAgICAgPC9nPgogICAgICAgIDwvZz4KICAgIDwvZz4KPC9zdmc+); +} +.leaflet-pm-toolbar .leaflet-pm-icon-circle-marker { + background-image: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0iVVRGLTgiPz4KCjxzdmcgdmlld0JveD0iMCAwIDEwMCAxMDAiIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyIgc3Ryb2tlPSIjNUI1QjVCIiBzdHJva2Utd2lkdGg9IjgiCiAgICAgZmlsbD0ibm9uZSI+CjxjaXJjbGUgY3g9IjUwIiBjeT0iNTAiIHI9IjM1Ii8+CiAgPGNpcmNsZSBjeD0iNTAiIGN5PSI1MCIgcj0iMyIgZmlsbD0iIzVCNUI1QiIvPgo8L3N2Zz4=); +} +.leaflet-pm-toolbar .leaflet-pm-icon-rectangle { + background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHhtbG5zOnhsaW5rPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5L3hsaW5rIiB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgPGRlZnM+CiAgICA8cGF0aCBpZD0icmVjdGFuZ2xlLWEiIGQ9Ik0yMywxMC45NjQ1NTU2IEwyMywxOS4wMzU0NDQ0IEMyNC42OTYxNDcxLDE5LjI3ODA1OTMgMjYsMjAuNzM2NzY0IDI2LDIyLjUgQzI2LDI0LjQzMjk5NjYgMjQuNDMyOTk2NiwyNiAyMi41LDI2IEMyMC43MzY3NjQsMjYgMTkuMjc4MDU5MywyNC42OTYxNDcxIDE5LjAzNTQ0NDQsMjMgTDEwLjk2NDU1NTYsMjMgQzEwLjcyMTk0MDcsMjQuNjk2MTQ3MSA5LjI2MzIzNTk1LDI2IDcuNSwyNiBDNS41NjcwMDMzOCwyNiA0LDI0LjQzMjk5NjYgNCwyMi41IEM0LDIwLjczNjc2NCA1LjMwMzg1MjkzLDE5LjI3ODA1OTMgNywxOS4wMzU0NDQ0IEw3LDEwLjk2NDU1NTYgQzUuMzAzODUyOTMsMTAuNzIxOTQwNyA0LDkuMjYzMjM1OTUgNCw3LjUgQzQsNS41NjcwMDMzOCA1LjU2NzAwMzM4LDQgNy41LDQgQzkuMjYzMjM1OTUsNCAxMC43MjE5NDA3LDUuMzAzODUyOTMgMTAuOTY0NTU1Niw3IEwxOS4wMzU0NDQ0LDcgQzE5LjI3ODA1OTMsNS4zMDM4NTI5MyAyMC43MzY3NjQsNCAyMi41LDQgQzI0LjQzMjk5NjYsNCAyNiw1LjU2NzAwMzM4IDI2LDcuNSBDMjYsOS4yNjMyMzU5NSAyNC42OTYxNDcxLDEwLjcyMTk0MDcgMjMsMTAuOTY0NTU1NiBaIE0yMSwxMC42NjMxODQ0IEMyMC4yNzIxNTQsMTAuMzE3NDIyNSAxOS42ODI1Nzc1LDkuNzI3ODQ1OTggMTkuMzM2ODE1Niw5IEwxMC42NjMxODQ0LDkgQzEwLjMxNzQyMjUsOS43Mjc4NDU5OCA5LjcyNzg0NTk4LDEwLjMxNzQyMjUgOSwxMC42NjMxODQ0IEw5LDE5LjMzNjgxNTYgQzkuNzI3ODQ1OTgsMTkuNjgyNTc3NSAxMC4zMTc0MjI1LDIwLjI3MjE1NCAxMC42NjMxODQ0LDIxIEwxOS4zMzY4MTU2LDIxIEMxOS42ODI1Nzc1LDIwLjI3MjE1NCAyMC4yNzIxNTQsMTkuNjgyNTc3NSAyMSwxOS4zMzY4MTU2IEwyMSwxMC42NjMxODQ0IFogTTcuNSw5IEM4LjMyODQyNzEyLDkgOSw4LjMyODQyNzEyIDksNy41IEM5LDYuNjcxNTcyODggOC4zMjg0MjcxMiw2IDcuNSw2IEM2LjY3MTU3Mjg4LDYgNiw2LjY3MTU3Mjg4IDYsNy41IEM2LDguMzI4NDI3MTIgNi42NzE1NzI4OCw5IDcuNSw5IFogTTIyLjUsOSBDMjMuMzI4NDI3MSw5IDI0LDguMzI4NDI3MTIgMjQsNy41IEMyNCw2LjY3MTU3Mjg4IDIzLjMyODQyNzEsNiAyMi41LDYgQzIxLjY3MTU3MjksNiAyMSw2LjY3MTU3Mjg4IDIxLDcuNSBDMjEsOC4zMjg0MjcxMiAyMS42NzE1NzI5LDkgMjIuNSw5IFogTTIyLjUsMjQgQzIzLjMyODQyNzEsMjQgMjQsMjMuMzI4NDI3MSAyNCwyMi41IEMyNCwyMS42NzE1NzI5IDIzLjMyODQyNzEsMjEgMjIuNSwyMSBDMjEuNjcxNTcyOSwyMSAyMSwyMS42NzE1NzI5IDIxLDIyLjUgQzIxLDIzLjMyODQyNzEgMjEuNjcxNTcyOSwyNCAyMi41LDI0IFogTTcuNSwyNCBDOC4zMjg0MjcxMiwyNCA5LDIzLjMyODQyNzEgOSwyMi41IEM5LDIxLjY3MTU3MjkgOC4zMjg0MjcxMiwyMSA3LjUsMjEgQzYuNjcxNTcyODgsMjEgNiwyMS42NzE1NzI5IDYsMjIuNSBDNiwyMy4zMjg0MjcxIDYuNjcxNTcyODgsMjQgNy41LDI0IFoiLz4KICA8L2RlZnM+CiAgPGcgZmlsbD0ibm9uZSIgZmlsbC1ydWxlPSJldmVub2RkIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMyAtMykiPgogICAgPG1hc2sgaWQ9InJlY3RhbmdsZS1iIiBmaWxsPSIjZmZmIj4KICAgICAgPHVzZSB4bGluazpocmVmPSIjcmVjdGFuZ2xlLWEiLz4KICAgIDwvbWFzaz4KICAgIDx1c2UgZmlsbD0iIzVCNUI1QiIgZmlsbC1ydWxlPSJub256ZXJvIiB4bGluazpocmVmPSIjcmVjdGFuZ2xlLWEiLz4KICAgIDxnIGZpbGw9IiM1QjVCNUIiIG1hc2s9InVybCgjcmVjdGFuZ2xlLWIpIj4KICAgICAgPHJlY3Qgd2lkdGg9IjMwIiBoZWlnaHQ9IjMwIi8+CiAgICA8L2c+CiAgPC9nPgo8L3N2Zz4K); +} +.leaflet-pm-toolbar .leaflet-pm-icon-delete { + background-image: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0iVVRGLTgiPz4KPHN2ZyB3aWR0aD0iMjRweCIgaGVpZ2h0PSIyNHB4IiB2aWV3Qm94PSIwIDAgMjQgMjQiIHZlcnNpb249IjEuMSIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiB4bWxuczp4bGluaz0iaHR0cDovL3d3dy53My5vcmcvMTk5OS94bGluayI+CiAgICA8IS0tIEdlbmVyYXRvcjogU2tldGNoIDUyLjUgKDY3NDY5KSAtIGh0dHA6Ly93d3cuYm9oZW1pYW5jb2RpbmcuY29tL3NrZXRjaCAtLT4KICAgIDx0aXRsZT5BdG9tcy9JY29ucy9Ub29scy9FcmFzZXI8L3RpdGxlPgogICAgPGRlc2M+Q3JlYXRlZCB3aXRoIFNrZXRjaC48L2Rlc2M+CiAgICA8ZGVmcz4KICAgICAgICA8cGF0aCBkPSJNMTcuNzg3NDIxOSwxOC40ODEyNTUyIEwxMS42NDgwMDc5LDEzLjM0OTgxODQgTDYuNDA0NjYwMDksMTkuMzgxNjAwMSBMMTAuNTUzOTE1NiwyMi45ODg0OTI5IEwxMy44NjkzNCwyMi45ODg0OTI5IEwxNy43ODc0MjE5LDE4LjQ4MTI1NTIgWiBNMTYuNTA3NDI1MiwyMi45ODg0OTI5IEwyNi4wMDAwMDAyLDIyLjk4ODQ5MjkgTDI2LjAwMDAwMDIsMjQuOTg4NDkyOSBMMTAuMDAwMDAwMiwyNC45ODg0OTI5IEw5LjgwNzA4MzEzLDI0Ljk4ODQ5MjkgTDUuMDkyNTQyMDQsMjAuODkxMDE5MiBDNC4yNTg5MTI4NSwyMC4xNjYzNTY0IDQuMTcwNTc4MTQsMTguOTAzMTExMiA0Ljg5NTI0MDkzLDE4LjA2OTQ4MiBMMTYuMDQ4MjQ0NCw1LjIzOTQxOTE2IEMxNi43NzI5MDcyLDQuNDA1Nzg5OTggMTguMDM2MTUyNSw0LjMxNzQ1NTI2IDE4Ljg2OTc4MTYsNS4wNDIxMTgwNiBMMjQuOTA3NDU4MywxMC4yOTA1OTAzIEMyNS43NDEwODc1LDExLjAxNTI1MzEgMjUuODI5NDIyMiwxMi4yNzg0OTgzIDI1LjEwNDc1OTQsMTMuMTEyMTI3NSBMMTYuNTA3NDI1MiwyMi45ODg0OTI5IFoiIGlkPSJwYXRoLTEiPjwvcGF0aD4KICAgIDwvZGVmcz4KICAgIDxnIGlkPSJTeW1ib2xzIiBzdHJva2U9Im5vbmUiIHN0cm9rZS13aWR0aD0iMSIgZmlsbD0ibm9uZSIgZmlsbC1ydWxlPSJldmVub2RkIj4KICAgICAgICA8ZyBpZD0iQXRvbXMvSWNvbnMvVG9vbHMvRXJhc2VyIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMy4wMDAwMDAsIC0zLjAwMDAwMCkiPgogICAgICAgICAgICA8bWFzayBpZD0ibWFzay0yIiBmaWxsPSJ3aGl0ZSI+CiAgICAgICAgICAgICAgICA8dXNlIHhsaW5rOmhyZWY9IiNwYXRoLTEiPjwvdXNlPgogICAgICAgICAgICA8L21hc2s+CiAgICAgICAgICAgIDx1c2UgaWQ9IkNvbWJpbmVkLVNoYXBlIiBmaWxsPSIjNUI1QjVCIiBmaWxsLXJ1bGU9Im5vbnplcm8iIHhsaW5rOmhyZWY9IiNwYXRoLTEiPjwvdXNlPgogICAgICAgIDwvZz4KICAgIDwvZz4KPC9zdmc+); +} +.leaflet-pm-toolbar .leaflet-pm-icon-edit { + background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHhtbG5zOnhsaW5rPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5L3hsaW5rIiB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgPGRlZnM+CiAgICA8cGF0aCBpZD0iZWRpdF9hbmNob3ItYSIgZD0iTTEzLjUsMTEgQzExLjU2NzAwMzQsMTEgMTAsOS40MzI5OTY2MiAxMCw3LjUgQzEwLDUuNTY3MDAzMzggMTEuNTY3MDAzNCw0IDEzLjUsNCBDMTUuNDMyOTk2Niw0IDE3LDUuNTY3MDAzMzggMTcsNy41IEMxNyw5LjQzMjk5NjYyIDE1LjQzMjk5NjYsMTEgMTMuNSwxMSBaIE0xMy41LDkgQzE0LjMyODQyNzEsOSAxNSw4LjMyODQyNzEyIDE1LDcuNSBDMTUsNi42NzE1NzI4OCAxNC4zMjg0MjcxLDYgMTMuNSw2IEMxMi42NzE1NzI5LDYgMTIsNi42NzE1NzI4OCAxMiw3LjUgQzEyLDguMzI4NDI3MTIgMTIuNjcxNTcyOSw5IDEzLjUsOSBaIE0xMi4wMDAyODg5LDcuNTI5NzM4OTMgQzEyLjAxMjU5ODMsOC4xNjI3MzY3MiAxMi40MTcwMTk3LDguNjk5NjY0MyAxMi45ODA3MTExLDguOTA3Njc5NjYgTDMsMTUgTDMsMTMgTDEyLjAwMDI4ODksNy41Mjk3Mzg5MyBaIE0xNC4yMTcyNzIyLDYuMTgyMjg0NzIgTDE5LjQ1MzEyNSwzIEwyMi42NTg5MzU1LDMgTDE0Ljk4OTEwMiw3LjY4MTczODg1IEMxNC45OTYyOTcxLDcuNjIyMTY0NTkgMTUsNy41NjE1MTQ3MiAxNSw3LjUgQzE1LDYuOTMxMzgzODEgMTQuNjgzNjA5OCw2LjQzNjY2NDUgMTQuMjE3MjcyMiw2LjE4MjI4NDcyIFogTTIzLjQ0MzQwNDIsMTkuMjg1MTczNiBMMjAuMTI4Mjc5OSwxOS4yODUxNzM2IEwyMS44NzI5OTgzLDIzLjUzNDk1MjUgQzIxLjk5NDUyOTYsMjMuODI5NTc3MyAyMS44NTU2NTQ2LDI0LjE1OTkyMDkgMjEuNTc3ODczNCwyNC4yODQ5MjA4IEwyMC4wNDE0Njc1LDI0Ljk1NDUxNDIgQzE5Ljc1NTA2MTMsMjUuMDc5NTE0MSAxOS40MzM4NzM4LDI0LjkzNjY3MDQgMTkuMzEyMzQyNiwyNC42NTA5NTE4IEwxNy42NTQ0MzY3LDIwLjYxNTQ1NDEgTDE0Ljk0NjE4NzMsMjMuNDAxMDE1MSBDMTQuNTg1MjgxMSwyMy43NzIxNzExIDE0LDIzLjQ4NjA0NjMgMTQsMjIuOTk5MjY1MyBMMTQsOS41NzE4MzUzMyBDMTQsOS4wNTkzMzU2MSAxNC42MjI1MzExLDguODA5NDkyIDE0Ljk0NjE1Niw5LjE3MDA4NTU1IEwyMy44MzQwMjkyLDE4LjMxMjAxNzkgQzI0LjE5MjUyOTEsMTguNjYxMzYxNSAyMy45Mjc5OTc5LDE5LjI4NTE3MzYgMjMuNDQzNDA0MiwxOS4yODUxNzM2IFoiLz4KICA8L2RlZnM+CiAgPGcgZmlsbD0ibm9uZSIgZmlsbC1ydWxlPSJldmVub2RkIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMyAtMykiPgogICAgPG1hc2sgaWQ9ImVkaXRfYW5jaG9yLWIiIGZpbGw9IiNmZmYiPgogICAgICA8dXNlIHhsaW5rOmhyZWY9IiNlZGl0X2FuY2hvci1hIi8+CiAgICA8L21hc2s+CiAgICA8dXNlIGZpbGw9IiM1QjVCNUIiIGZpbGwtcnVsZT0ibm9uemVybyIgeGxpbms6aHJlZj0iI2VkaXRfYW5jaG9yLWEiLz4KICAgIDxnIGZpbGw9IiM1QjVCNUIiIG1hc2s9InVybCgjZWRpdF9hbmNob3ItYikiPgogICAgICA8cmVjdCB3aWR0aD0iMzAiIGhlaWdodD0iMzAiLz4KICAgIDwvZz4KICA8L2c+Cjwvc3ZnPgo=); +} +.leaflet-pm-toolbar .leaflet-pm-icon-drag { + background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHhtbG5zOnhsaW5rPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5L3hsaW5rIiB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgPGRlZnM+CiAgICA8cGF0aCBpZD0ibW92ZS1hIiBkPSJNMjEsMTQgTDIxLDEwIEwyNywxNSBMMjEsMjAgTDIxLDE2IEwxNiwxNiBMMTYsMjEgTDIwLDIxIEwxNSwyNyBMMTAsMjEgTDE0LDIxIEwxNCwxNiBMOSwxNiBMOSwyMCBMMywxNSBMOSwxMCBMOSwxNCBMMTQsMTQgTDE0LDkgTDEwLDkgTDE1LDMgTDIwLDkgTDE2LDkgTDE2LDE0IEwyMSwxNCBaIi8+CiAgPC9kZWZzPgogIDxnIGZpbGw9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTMgLTMpIj4KICAgIDxtYXNrIGlkPSJtb3ZlLWIiIGZpbGw9IiNmZmYiPgogICAgICA8dXNlIHhsaW5rOmhyZWY9IiNtb3ZlLWEiLz4KICAgIDwvbWFzaz4KICAgIDx1c2UgZmlsbD0iI0Q4RDhEOCIgeGxpbms6aHJlZj0iI21vdmUtYSIvPgogICAgPGcgZmlsbD0iIzVCNUI1QiIgbWFzaz0idXJsKCNtb3ZlLWIpIj4KICAgICAgPHJlY3Qgd2lkdGg9IjMwIiBoZWlnaHQ9IjMwIi8+CiAgICA8L2c+CiAgPC9nPgo8L3N2Zz4K); +} +.leaflet-pm-toolbar .leaflet-pm-icon-cut { + background-image: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0iVVRGLTgiPz4KPHN2ZyB3aWR0aD0iMjRweCIgaGVpZ2h0PSIyNHB4IiB2aWV3Qm94PSIwIDAgMjQgMjQiIHZlcnNpb249IjEuMSIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiB4bWxuczp4bGluaz0iaHR0cDovL3d3dy53My5vcmcvMTk5OS94bGluayI+CiAgICA8IS0tIEdlbmVyYXRvcjogU2tldGNoIDUyLjUgKDY3NDY5KSAtIGh0dHA6Ly93d3cuYm9oZW1pYW5jb2RpbmcuY29tL3NrZXRjaCAtLT4KICAgIDx0aXRsZT5BdG9tcy9JY29ucy9Ub29scy9TY2lzc29yczwvdGl0bGU+CiAgICA8ZGVzYz5DcmVhdGVkIHdpdGggU2tldGNoLjwvZGVzYz4KICAgIDxkZWZzPgogICAgICAgIDxwYXRoIGQ9Ik0xMi45NjkxNTc0LDEzLjQ5Mzk0MzUgTDIxLjAzMTcwMzIsNS41NDE2NzAxMyBMMjMuNDY0OTQ5OSw1LjY3NzIyOTU3IEwxNy4wNDcwNzEzLDE0LjUxMDY4MTYgTDI3LjU2NjAzMzYsMTcuMTMzMzUzNSBMMjUuNzg5MTk0NCwxOC44MDEyNTg4IEwxNC41ODU0OTUxLDE3Ljg5ODc1MDYgTDEzLjY0ODc5NTUsMTkuMTg4MDA3IEMxMy43OTQ2MzksMTkuMjY1MDk1OCAxMy45MzY3OTg1LDE5LjM1MzQ0MTcgMTQuMDc0MTM3NywxOS40NTMyMjQ1IEMxNS42Mzc5NjQ4LDIwLjU4OTQxMTQgMTUuOTg0NjM1NywyMi43NzgyMDUyIDE0Ljg0ODQ0ODgsMjQuMzQyMDMyNCBDMTMuNzEyMjYxOSwyNS45MDU4NTk1IDExLjUyMzQ2ODEsMjYuMjUyNTMwNCA5Ljk1OTY0MDk2LDI1LjExNjM0MzUgQzguMzk1ODEzODQsMjMuOTgwMTU2NSA4LjA0OTE0Mjk2LDIxLjc5MTM2MjcgOS4xODUzMjk4NiwyMC4yMjc1MzU2IEM5Ljc0NTg3Mjc2LDE5LjQ1NjAxNDUgMTAuNTYyNjE4OCwxOC45ODA3NDc1IDExLjQzNDEyMTgsMTguODMzNjQwNyBMMTIuNjgwNTY1NiwxNy4xMTgwNTc5IEwxMi41MjM5NzI0LDE2LjM3NDcyMTYgTDExLjk1MDY5MzIsMTUuMzAxMjM5MSBMOS44OTMxMDY0NiwxNC43ODgyMjUxIEM5LjEzMDkzNzk2LDE1LjIzNTcyNjEgOC4xOTk3Nzg1NCwxNS4zOTY2NDQ3IDcuMjc0NDUzNTUsMTUuMTY1OTM1MiBDNS4zOTg4NzUxOSwxNC42OTgzMDEgNC4yNTc1MTA5NCwxMi43OTg3NTE5IDQuNzI1MTQ1MTUsMTAuOTIzMTczNiBDNS4xOTI3NzkzNSw5LjA0NzU5NTE5IDcuMDkyMzI4NDYsNy45MDYyMzA5NCA4Ljk2NzkwNjgyLDguMzczODY1MTUgQzEwLjg0MzQ4NTIsOC44NDE0OTkzNSAxMS45ODQ4NDk0LDEwLjc0MTA0ODUgMTEuNTE3MjE1MiwxMi42MTY2MjY4IEMxMS40NzYxNDY0LDEyLjc4MTM0NDkgMTEuNDI0MDMzNSwxMi45NDA0MDAxIDExLjM2MTg2MjcsMTMuMDkzMTk5OSBMMTIuOTY5MTU3NCwxMy40OTM5NDM1IFogTTcuNzU4Mjk3MzUsMTMuMjI1MzQzOCBDOC41NjIxMTY2NCwxMy40MjU3NTg0IDkuMzc2MjA5MTIsMTIuOTM2NjAyMyA5LjU3NjYyMzc4LDEyLjEzMjc4MyBDOS43NzcwMzg0NCwxMS4zMjg5NjM3IDkuMjg3ODgyMzMsMTAuNTE0ODcxMyA4LjQ4NDA2MzAzLDEwLjMxNDQ1NjYgQzcuNjgwMjQzNzMsMTAuMTE0MDQxOSA2Ljg2NjE1MTI2LDEwLjYwMzE5OCA2LjY2NTczNjYsMTEuNDA3MDE3MyBDNi40NjUzMjE5NCwxMi4yMTA4MzY2IDYuOTU0NDc4MDUsMTMuMDI0OTI5MSA3Ljc1ODI5NzM1LDEzLjIyNTM0MzggWiBNMTAuODAzMzYzOSwyMS40MDMxMDYxIEMxMC4zMTY0MjY2LDIyLjA3MzMxNzcgMTAuNDY0OTk5OCwyMy4wMTEzNzIyIDExLjEzNTIxMTUsMjMuNDk4MzA5NSBDMTEuODA1NDIzMSwyMy45ODUyNDY3IDEyLjc0MzQ3NzYsMjMuODM2NjczNSAxMy4yMzA0MTQ4LDIzLjE2NjQ2MTkgQzEzLjcxNzM1MjEsMjIuNDk2MjUwMiAxMy41Njg3Nzg4LDIxLjU1ODE5NTcgMTIuODk4NTY3MiwyMS4wNzEyNTg1IEMxMi4yMjgzNTU2LDIwLjU4NDMyMTIgMTEuMjkwMzAxMSwyMC43MzI4OTQ1IDEwLjgwMzM2MzksMjEuNDAzMTA2MSBaIiBpZD0icGF0aC0xIj48L3BhdGg+CiAgICA8L2RlZnM+CiAgICA8ZyBpZD0iU3ltYm9scyIgc3Ryb2tlPSJub25lIiBzdHJva2Utd2lkdGg9IjEiIGZpbGw9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCI+CiAgICAgICAgPGcgaWQ9IkF0b21zL0ljb25zL1Rvb2xzL1NjaXNzb3JzIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMy4wMDAwMDAsIC0zLjAwMDAwMCkiPgogICAgICAgICAgICA8bWFzayBpZD0ibWFzay0yIiBmaWxsPSJ3aGl0ZSI+CiAgICAgICAgICAgICAgICA8dXNlIHhsaW5rOmhyZWY9IiNwYXRoLTEiPjwvdXNlPgogICAgICAgICAgICA8L21hc2s+CiAgICAgICAgICAgIDx1c2UgaWQ9Ik1hc2siIGZpbGw9IiM1QjVCNUIiIGZpbGwtcnVsZT0ibm9uemVybyIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoMTYuMDkzMTk0LCAxNS42NjMzNTEpIHJvdGF0ZSgtMzIuMDAwMDAwKSB0cmFuc2xhdGUoLTE2LjA5MzE5NCwgLTE1LjY2MzM1MSkgIiB4bGluazpocmVmPSIjcGF0aC0xIj48L3VzZT4KICAgICAgICA8L2c+CiAgICA8L2c+Cjwvc3ZnPg==); +} +.leaflet-pm-toolbar .leaflet-pm-icon-snapping { + background-image: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0iVVRGLTgiPz4KPHN2ZyB3aWR0aD0iMjRweCIgaGVpZ2h0PSIyNHB4IiB2aWV3Qm94PSIwIDAgMjQgMjQiIHZlcnNpb249IjEuMSIgeG1sbnM9Imh0dHA6Ly93d3cudzMub3JnLzIwMDAvc3ZnIiB4bWxuczp4bGluaz0iaHR0cDovL3d3dy53My5vcmcvMTk5OS94bGluayI+CiAgICA8IS0tIEdlbmVyYXRvcjogU2tldGNoIDU3LjEgKDgzMDg4KSAtIGh0dHBzOi8vc2tldGNoLmNvbSAtLT4KICAgIDx0aXRsZT5BdG9tcy9JY29ucy9Ub29scy9NYWduZXQ8L3RpdGxlPgogICAgPGRlc2M+Q3JlYXRlZCB3aXRoIFNrZXRjaC48L2Rlc2M+CiAgICA8ZGVmcz4KICAgICAgICA8cGF0aCBkPSJNMjEuOTk5NDc1OSwxMC45NDI4MTgzIEwyMS45OTk5OTg1LDE2LjM3MTA0MTcgQzIyLDE2LjY4NzIwMDcgMjIsMTcuMDA1ODI3OCAyMiwxNy4zMjY5NDExIEMyMiwyMS41NjQ2NTQ1IDE4LjY0MjEzNTYsMjUgMTQuNSwyNSBDMTAuMzU3ODY0NCwyNSA3LDIxLjU2NDY1NDUgNywxNy4zMjY5NDExIEw3LjAwMDg3NTA4LDEwLjk5MDc1MDcgTDExLjAwMjI4MDgsMTAuOTk4NDEyNSBDMTEuMDAxNzAzMywxMS42OTgwMTE0IDExLjAwMTI0NywxMi40MTY4MjQ4IDExLjAwMDg5OTIsMTMuMTU1NDg4NyBMMTEsMTcuMzI2OTQxMSBDMTEsMTkuMzc1NjgwOSAxMi41ODc2ODQxLDIxIDE0LjUsMjEgQzE2LjQxMjMxNTksMjEgMTgsMTkuMzc1NjgwOSAxOCwxNy4zMjY5NDExIEMxOCwxNS4wNzAyMDMyIDE3Ljk5OTU2OTYsMTIuOTYxOTY2OCAxNy45OTg1MzksMTAuOTkxMDAzMiBMMjEuOTk5NDc1OSwxMC45NDI4MTgzIFogTTEwLDcgQzEwLjU1MjI4NDcsNyAxMSw3LjQ0NzcxNTI1IDExLDggTDExLDEwIEw3LDEwIEw3LDggQzcsNy40NDc3MTUyNSA3LjQ0NzcxNTI1LDcgOCw3IEwxMCw3IFogTTIxLDcgQzIxLjU1MjI4NDcsNyAyMiw3LjQ0NzcxNTI1IDIyLDggTDIyLDEwIEwxOCwxMCBMMTgsOCBDMTgsNy40NDc3MTUyNSAxOC40NDc3MTUzLDcgMTksNyBMMjEsNyBaIiBpZD0icGF0aC0xIj48L3BhdGg+CiAgICA8L2RlZnM+CiAgICA8ZyBpZD0iU3ltYm9scyIgc3Ryb2tlPSJub25lIiBzdHJva2Utd2lkdGg9IjEiIGZpbGw9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCI+CiAgICAgICAgPGcgaWQ9IkF0b21zL0ljb25zL1Rvb2xzL01hZ25ldCIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTMuMDAwMDAwLCAtMy4wMDAwMDApIj4KICAgICAgICAgICAgPG1hc2sgaWQ9Im1hc2stMiIgZmlsbD0id2hpdGUiPgogICAgICAgICAgICAgICAgPHVzZSB4bGluazpocmVmPSIjcGF0aC0xIj48L3VzZT4KICAgICAgICAgICAgPC9tYXNrPgogICAgICAgICAgICA8dXNlIGlkPSJNYXNrIiBmaWxsPSIjNUI1QjVCIiBmaWxsLXJ1bGU9Im5vbnplcm8iIHRyYW5zZm9ybT0idHJhbnNsYXRlKDE0LjUwMDAwMCwgMTYuMDAwMDAwKSByb3RhdGUoNDUuMDAwMDAwKSB0cmFuc2xhdGUoLTE0LjUwMDAwMCwgLTE2LjAwMDAwMCkgIiB4bGluazpocmVmPSIjcGF0aC0xIj48L3VzZT4KICAgICAgICA8L2c+CiAgICA8L2c+Cjwvc3ZnPg==); +} +.leaflet-pm-toolbar .leaflet-pm-icon-rotate { + background-image: url(data:image/svg+xml;base64,PHN2ZyB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHhtbG5zOnhsaW5rPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5L3hsaW5rIiB3aWR0aD0iMjQiIGhlaWdodD0iMjQiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8ZGVmcz4KICAgICAgICA8cGF0aCBpZD0icm90YXRlIiBkPSJNMjEuMiw1LjhjLTAuMS0wLjItMC4yLTAuMy0wLjMtMC41bC0wLjEtMC4yYy0wLjEtMC4yLTAuMi0wLjMtMC4zLTAuNWwtMC4xLTAuMmMtMC4xLTAuMi0wLjItMC4zLTAuNC0wLjVsLTAuMi0wLjNsMi44LTMuMUwxOCwwLjZsLTQuNiwwLjFsMC41LDQuNWwwLjUsNC41bDMuMi0zLjZ2MC4xbDAuMSwwLjJjMC4xLDAuMSwwLjEsMC4yLDAuMiwwLjJsMC4xLDAuMkMxOCw3LDE4LDcuMSwxOC4xLDcuMmMwLjMsMC43LDAuNiwxLjQsMC43LDIuMWMwLjIsMS40LDAsMi45LTAuNiw0LjJMMTgsMTMuOUwxNy45LDE0bC0wLjMsMC41bC0wLjEsMC4yYy0wLjIsMC4yLTAuNCwwLjUtMC42LDAuN2MtMC41LDAuNS0xLjEsMS0xLjcsMS4zYy0wLjYsMC40LTEuMywwLjYtMi4xLDAuOGMtMC43LDAuMS0xLjUsMC4yLTIuMiwwLjFjLTAuOC0wLjEtMS41LTAuMy0yLjItMC41Yy0wLjctMC4zLTEuMy0wLjctMS45LTEuMmwtMC40LTAuNGwtMC4yLTAuM0w2LDE1Yy0wLjEtMC4xLTAuMi0wLjItMC4yLTAuM2wtMC4zLTAuNGwtMC4xLTAuMWwtMC4yLTAuNGMwLTAuMS0wLjEtMC4xLTAuMS0wLjJsLTAuMy0wLjVsLTAuMS0wLjJjLTAuMS0wLjMtMC4yLTAuNi0wLjMtMC45Yy0wLjItMC44LTAuMy0xLjYtMC4zLTIuNGMwLTAuMiwwLTAuMywwLTAuNVY4LjljMC0wLjIsMC0wLjMsMC4xLTAuNGwwLjEtMC42bDAuMi0wLjZjMC4zLTAuOCwwLjctMS41LDEuMi0yLjJjMC41LTAuNywxLjEtMS4zLDEuOC0xLjhjMC4yLTAuMSwwLjMtMC40LDAuMS0wLjZDNy41LDIuNiw3LjQsMi41LDcuMywyLjVINy4xTDcsMi42QzYuMSwzLDUuNCwzLjYsNC43LDQuMkM0LDQuOSwzLjUsNS43LDMsNi42Yy0wLjksMS44LTEuMiwzLjgtMC44LDUuOGMwLjEsMC41LDAuMiwwLjksMC4zLDEuNGwwLjMsMC44QzIuOSwxNC43LDMsMTQuOCwzLDE1bDAuMiwwLjRjMCwwLjEsMC4xLDAuMiwwLjEsMC4ybDAuMywwLjVjMC4xLDAuMiwwLjIsMC4zLDAuMywwLjVsMC4xLDAuMmMwLjEsMC4xLDAuMiwwLjMsMC4zLDAuNEw1LDE3LjhjMC43LDAuNywxLjYsMS4zLDIuNSwxLjhjMC45LDAuNSwxLjksMC44LDMsMC45YzAuNSwwLjEsMSwwLjEsMS41LDAuMWMwLjYsMCwxLjEsMCwxLjYtMC4xYzEtMC4yLDIuMS0wLjUsMy0xbDAuMi0wLjFjMC4yLTAuMSwwLjMtMC4yLDAuNS0wLjNsMC43LTAuNGMwLjItMC4xLDAuMy0wLjIsMC40LTAuM2wwLjItMC4yYzAuMi0wLjEsMC40LTAuMywwLjUtMC41bDAuMS0wLjFjMC4zLTAuMywwLjctMC43LDAuOS0xbDAuNi0wLjlsMC40LTAuNmMxLTEuOSwxLjQtNC4xLDEuMS02LjJDMjIsNy44LDIxLjcsNi43LDIxLjIsNS44eiIvPgogICAgPC9kZWZzPgogICAgPGcgZmlsbD0ibm9uZSIgZmlsbC1ydWxlPSJldmVub2RkIiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgwIDIpIj4KICAgICAgICA8bWFzayBpZD0icm90YXRlLWIiIGZpbGw9IiNmZmYiPgogICAgICAgICAgICA8dXNlIHhsaW5rOmhyZWY9IiNyb3RhdGUiLz4KICAgICAgICA8L21hc2s+CiAgICAgICAgPHVzZSBmaWxsPSIjNUI1QjVCIiBmaWxsLXJ1bGU9Im5vbnplcm8iIHhsaW5rOmhyZWY9IiNyb3RhdGUiLz4KICAgICAgICA8ZyBmaWxsPSIjNUI1QjVCIiBtYXNrPSJ1cmwoI3JvdGF0ZS1iKSI+CiAgICAgICAgICAgIDxyZWN0IHdpZHRoPSIzMCIgaGVpZ2h0PSIzMCIvPgogICAgICAgIDwvZz4KICAgIDwvZz4KPC9zdmc+Cg==); +} + +.leaflet-buttons-control-button:hover, +.leaflet-buttons-control-button:focus { + cursor: pointer; + background-color: #f4f4f4; +} +.active .leaflet-buttons-control-button { + box-shadow: inset 0 -1px 5px 2px rgba(81, 77, 77, 0.31); +} + +.leaflet-buttons-control-text-hide { + display: none; +} + +.button-container { + position: relative; +} + +.button-container .leaflet-pm-actions-container { + z-index: 2; + position: absolute; + top: 0; + left: 100%; + display: none; + white-space: nowrap; + direction: ltr; +} + +.leaflet-right + .leaflet-pm-toolbar + .button-container + .leaflet-pm-actions-container { + right: 100%; + left: auto; +} + +.button-container.active .leaflet-pm-actions-container { + display: block; +} + +.button-container + .leaflet-pm-actions-container:not(.pos-right) + a.leaflet-pm-action:last-child { + border-radius: 0 3px 3px 0; + border-right: 0; +} +.button-container + .leaflet-pm-actions-container.pos-right + a.leaflet-pm-action:first-child { + border-radius: 3px 0 0 3px; +} +.button-container + .leaflet-pm-actions-container.pos-right + a.leaflet-pm-action:last-child { + border-right: 0; +} +.button-container .leaflet-pm-actions-container .leaflet-pm-action { + padding: 0 10px; + background-color: #666; + color: #fff; + display: inline-block; + width: auto; + border-right: 1px solid #eee; + user-select: none; + border-bottom: none; + height: 29px; + line-height: 29px; +} +.leaflet-pm-toolbar + .button-container:first-child.pos-right.active + a.leaflet-buttons-control-button { + border-top-left-radius: 0; +} +.leaflet-pm-toolbar + .button-container:first-child.active:not(.pos-right) + a.leaflet-buttons-control-button { + border-top-right-radius: 0; +} + +.button-container .leaflet-pm-actions-container .leaflet-pm-action:hover, +.button-container .leaflet-pm-actions-container .leaflet-pm-action:focus { + cursor: pointer; + background-color: #777; +} + +/* That the active control is always over the other controls */ +.leaflet-pm-toolbar.activeChild { + z-index: 801; +} + +.leaflet-buttons-control-button.pm-disabled { + background-color: #f4f4f4; +} + +.leaflet-buttons-control-button.pm-disabled > .control-icon { + filter: opacity(0.6); +} + diff --git a/public/js/leaflet/leaflet-geoman.min.js b/public/js/leaflet/leaflet-geoman.min.js new file mode 100644 index 000000000..18ba82fc9 --- /dev/null +++ b/public/js/leaflet/leaflet-geoman.min.js @@ -0,0 +1 @@ +(()=>{var t={9705:(t,e,i)=>{"use strict";var n=i(1540);function r(t){var e=[Infinity,Infinity,-Infinity,-Infinity];return n.coordEach(t,(function(t){e[0]>t[0]&&(e[0]=t[0]),e[1]>t[1]&&(e[1]=t[1]),e[2]{"use strict";function i(t,e,i){void 0===i&&(i={});var n={type:"Feature"};return(0===i.id||i.id)&&(n.id=i.id),i.bbox&&(n.bbox=i.bbox),n.properties=e||{},n.geometry=t,n}function n(t,e,n){if(void 0===n&&(n={}),!t)throw new Error("coordinates is required");if(!Array.isArray(t))throw new Error("coordinates must be an Array");if(t.length<2)throw new Error("coordinates must be at least 2 numbers long");if(!d(t[0])||!d(t[1]))throw new Error("coordinates must contain numbers");return i({type:"Point",coordinates:t},e,n)}function r(t,e,n){void 0===n&&(n={});for(var r=0,a=t;r=0))throw new Error("precision must be a positive number");var i=Math.pow(10,e||0);return Math.round(t*i)/i},e.radiansToLength=u,e.lengthToRadians=c,e.lengthToDegrees=function(t,e){return p(c(t,e))},e.bearingToAzimuth=function(t){var e=t%360;return e<0&&(e+=360),e},e.radiansToDegrees=p,e.degreesToRadians=function(t){return t%360*Math.PI/180},e.convertLength=function(t,e,i){if(void 0===e&&(e="kilometers"),void 0===i&&(i="kilometers"),!(t>=0))throw new Error("length must be a positive number");return u(c(t,e),i)},e.convertArea=function(t,i,n){if(void 0===i&&(i="meters"),void 0===n&&(n="kilometers"),!(t>=0))throw new Error("area must be a positive number");var r=e.areaFactors[i];if(!r)throw new Error("invalid original units");var a=e.areaFactors[n];if(!a)throw new Error("invalid final units");return t/r*a},e.isNumber=d,e.isObject=function(t){return!!t&&t.constructor===Object},e.validateBBox=function(t){if(!t)throw new Error("bbox is required");if(!Array.isArray(t))throw new Error("bbox must be an Array");if(4!==t.length&&6!==t.length)throw new Error("bbox must be an Array of 4 or 6 numbers");t.forEach((function(t){if(!d(t))throw new Error("bbox must only contain numbers")}))},e.validateId=function(t){if(!t)throw new Error("id is required");if(-1===["string","number"].indexOf(typeof t))throw new Error("id must be a number or a string")}},1540:(t,e,i)=>{"use strict";Object.defineProperty(e,"__esModule",{value:!0});var n=i(4102);function r(t,e,i){if(null!==t)for(var n,a,o,s,l,h,u,c,p=0,d=0,f=t.type,g="FeatureCollection"===f,_="Feature"===f,y=g?t.features.length:1,m=0;mh||d>u||f>c)return l=r,h=i,u=d,c=f,void(o=0);var g=n.lineString([l,r],t.properties);if(!1===e(g,i,a,f,o))return!1;o++,l=r}))&&void 0}}}))}function u(t,e){if(!t)throw new Error("geojson is required");l(t,(function(t,i,r){if(null!==t.geometry){var a=t.geometry.type,o=t.geometry.coordinates;switch(a){case"LineString":if(!1===e(t,i,r,0,0))return!1;break;case"Polygon":for(var s=0;s{"use strict";i(7107);var n=i(2492),r=i.n(n);const a=JSON.parse('{"tooltips":{"placeMarker":"Click to place marker","firstVertex":"Click to place first vertex","continueLine":"Click to continue drawing","finishLine":"Click any existing marker to finish","finishPoly":"Click first marker to finish","finishRect":"Click to finish","startCircle":"Click to place circle center","finishCircle":"Click to finish circle","placeCircleMarker":"Click to place circle marker"},"actions":{"finish":"Finish","cancel":"Cancel","removeLastVertex":"Remove Last Vertex"},"buttonTitles":{"drawMarkerButton":"Draw Marker","drawPolyButton":"Draw Polygons","drawLineButton":"Draw Polyline","drawCircleButton":"Draw Circle","drawRectButton":"Draw Rectangle","editButton":"Edit Layers","dragButton":"Drag Layers","cutButton":"Cut Layers","deleteButton":"Remove Layers","drawCircleMarkerButton":"Draw Circle Marker","snappingButton":"Snap dragged marker to other layers and vertices","pinningButton":"Pin shared vertices together","rotateButton":"Rotate Layers"}}'),o=JSON.parse('{"tooltips":{"placeMarker":"Platziere den Marker mit Klick","firstVertex":"Platziere den ersten Marker mit Klick","continueLine":"Klicke, um weiter zu zeichnen","finishLine":"Beende mit Klick auf existierenden Marker","finishPoly":"Beende mit Klick auf ersten Marker","finishRect":"Beende mit Klick","startCircle":"Platziere das Kreiszentrum mit Klick","finishCircle":"Beende den Kreis mit Klick","placeCircleMarker":"Platziere den Kreismarker mit Klick"},"actions":{"finish":"Beenden","cancel":"Abbrechen","removeLastVertex":"Letzten Vertex löschen"},"buttonTitles":{"drawMarkerButton":"Marker zeichnen","drawPolyButton":"Polygon zeichnen","drawLineButton":"Polyline zeichnen","drawCircleButton":"Kreis zeichnen","drawRectButton":"Rechteck zeichnen","editButton":"Layer editieren","dragButton":"Layer bewegen","cutButton":"Layer schneiden","deleteButton":"Layer löschen","drawCircleMarkerButton":"Kreismarker zeichnen","snappingButton":"Bewegter Layer an andere Layer oder Vertexe einhacken","pinningButton":"Vertexe an der gleichen Position verknüpfen","rotateButton":"Layer drehen"}}'),s=JSON.parse('{"tooltips":{"placeMarker":"Clicca per posizionare un Marker","firstVertex":"Clicca per posizionare il primo vertice","continueLine":"Clicca per continuare a disegnare","finishLine":"Clicca qualsiasi marker esistente per terminare","finishPoly":"Clicca il primo marker per terminare","finishRect":"Clicca per terminare","startCircle":"Clicca per posizionare il punto centrale del cerchio","finishCircle":"Clicca per terminare il cerchio","placeCircleMarker":"Clicca per posizionare un Marker del cherchio"},"actions":{"finish":"Termina","cancel":"Annulla","removeLastVertex":"Rimuovi l\'ultimo vertice"},"buttonTitles":{"drawMarkerButton":"Disegna Marker","drawPolyButton":"Disegna Poligoni","drawLineButton":"Disegna Polilinea","drawCircleButton":"Disegna Cerchio","drawRectButton":"Disegna Rettangolo","editButton":"Modifica Livelli","dragButton":"Sposta Livelli","cutButton":"Ritaglia Livelli","deleteButton":"Elimina Livelli","drawCircleMarkerButton":"Disegna Marker del Cerchio","snappingButton":"Snap ha trascinato il pennarello su altri strati e vertici","pinningButton":"Pin condiviso vertici insieme"}}'),l=JSON.parse('{"tooltips":{"placeMarker":"Klik untuk menempatkan marker","firstVertex":"Klik untuk menempatkan vertex pertama","continueLine":"Klik untuk meneruskan digitasi","finishLine":"Klik pada sembarang marker yang ada untuk mengakhiri","finishPoly":"Klik marker pertama untuk mengakhiri","finishRect":"Klik untuk mengakhiri","startCircle":"Klik untuk menempatkan titik pusat lingkaran","finishCircle":"Klik untuk mengakhiri lingkaran","placeCircleMarker":"Klik untuk menempatkan penanda lingkarann"},"actions":{"finish":"Selesai","cancel":"Batal","removeLastVertex":"Hilangkan Vertex Terakhir"},"buttonTitles":{"drawMarkerButton":"Digitasi Marker","drawPolyButton":"Digitasi Polygon","drawLineButton":"Digitasi Polyline","drawCircleButton":"Digitasi Lingkaran","drawRectButton":"Digitasi Segi Empat","editButton":"Edit Layer","dragButton":"Geser Layer","cutButton":"Potong Layer","deleteButton":"Hilangkan Layer","drawCircleMarkerButton":"Digitasi Penanda Lingkaran","snappingButton":"Jepretkan penanda yang ditarik ke lapisan dan simpul lain","pinningButton":"Sematkan simpul bersama bersama"}}'),h=JSON.parse('{"tooltips":{"placeMarker":"Adaugă un punct","firstVertex":"Apasă aici pentru a adăuga primul Vertex","continueLine":"Apasă aici pentru a continua desenul","finishLine":"Apasă pe orice obiect pentru a finisa desenul","finishPoly":"Apasă pe primul obiect pentru a finisa","finishRect":"Apasă pentru a finisa","startCircle":"Apasă pentru a desena un cerc","finishCircle":"Apasă pentru a finisa un cerc","placeCircleMarker":"Adaugă un punct"},"actions":{"finish":"Termină","cancel":"Anulează","removeLastVertex":"Șterge ultimul Vertex"},"buttonTitles":{"drawMarkerButton":"Adaugă o bulină","drawPolyButton":"Desenează un poligon","drawLineButton":"Desenează o linie","drawCircleButton":"Desenează un cerc","drawRectButton":"Desenează un dreptunghi","editButton":"Editează straturile","dragButton":"Mută straturile","cutButton":"Taie straturile","deleteButton":"Șterge straturile","drawCircleMarkerButton":"Desenează marcatorul cercului","snappingButton":"Fixați marcatorul glisat pe alte straturi și vârfuri","pinningButton":"Fixați vârfurile partajate împreună"}}'),u=JSON.parse('{"tooltips":{"placeMarker":"Нажмите, чтобы нанести маркер","firstVertex":"Нажмите, чтобы нанести первый объект","continueLine":"Нажмите, чтобы продолжить рисование","finishLine":"Нажмите любой существующий маркер для завершения","finishPoly":"Выберите первую точку, чтобы закончить","finishRect":"Нажмите, чтобы закончить","startCircle":"Нажмите, чтобы добавить центр круга","finishCircle":"Нажмите, чтобы задать радиус","placeCircleMarker":"Нажмите, чтобы нанести круговой маркер"},"actions":{"finish":"Завершить","cancel":"Отменить","removeLastVertex":"Отменить последнее действие"},"buttonTitles":{"drawMarkerButton":"Добавить маркер","drawPolyButton":"Рисовать полигон","drawLineButton":"Рисовать кривую","drawCircleButton":"Рисовать круг","drawRectButton":"Рисовать прямоугольник","editButton":"Редактировать слой","dragButton":"Перенести слой","cutButton":"Вырезать слой","deleteButton":"Удалить слой","drawCircleMarkerButton":"Добавить круговой маркер","snappingButton":"Привязать перетаскиваемый маркер к другим слоям и вершинам","pinningButton":"Связать общие точки вместе"}}'),c=JSON.parse('{"tooltips":{"placeMarker":"Presiona para colocar un marcador","firstVertex":"Presiona para colocar el primer vértice","continueLine":"Presiona para continuar dibujando","finishLine":"Presiona cualquier marcador existente para finalizar","finishPoly":"Presiona el primer marcador para finalizar","finishRect":"Presiona para finalizar","startCircle":"Presiona para colocar el centro del circulo","finishCircle":"Presiona para finalizar el circulo","placeCircleMarker":"Presiona para colocar un marcador de circulo"},"actions":{"finish":"Finalizar","cancel":"Cancelar","removeLastVertex":"Remover ultimo vértice"},"buttonTitles":{"drawMarkerButton":"Dibujar Marcador","drawPolyButton":"Dibujar Polígono","drawLineButton":"Dibujar Línea","drawCircleButton":"Dibujar Circulo","drawRectButton":"Dibujar Rectángulo","editButton":"Editar Capas","dragButton":"Arrastrar Capas","cutButton":"Cortar Capas","deleteButton":"Remover Capas","drawCircleMarkerButton":"Dibujar Marcador de Circulo","snappingButton":"El marcador de Snap arrastrado a otras capas y vértices","pinningButton":"Fijar juntos los vértices compartidos"}}'),p=JSON.parse('{"tooltips":{"placeMarker":"Klik om een marker te plaatsen","firstVertex":"Klik om het eerste punt te plaatsen","continueLine":"Klik om te blijven tekenen","finishLine":"Klik op een bestaand punt om te beëindigen","finishPoly":"Klik op het eerst punt om te beëindigen","finishRect":"Klik om te beëindigen","startCircle":"Klik om het middelpunt te plaatsen","finishCircle":"Klik om de cirkel te beëindigen","placeCircleMarker":"Klik om een marker te plaatsen"},"actions":{"finish":"Bewaar","cancel":"Annuleer","removeLastVertex":"Verwijder laatste punt"},"buttonTitles":{"drawMarkerButton":"Plaats Marker","drawPolyButton":"Teken een vlak","drawLineButton":"Teken een lijn","drawCircleButton":"Teken een cirkel","drawRectButton":"Teken een vierkant","editButton":"Bewerk","dragButton":"Verplaats","cutButton":"Knip","deleteButton":"Verwijder","drawCircleMarkerButton":"Plaats Marker","snappingButton":"Snap gesleepte marker naar andere lagen en hoekpunten","pinningButton":"Speld gedeelde hoekpunten samen"}}'),d=JSON.parse('{"tooltips":{"placeMarker":"Cliquez pour placer un marqueur","firstVertex":"Cliquez pour placer le premier sommet","continueLine":"Cliquez pour continuer à dessiner","finishLine":"Cliquez sur n\'importe quel marqueur pour terminer","finishPoly":"Cliquez sur le premier marqueur pour terminer","finishRect":"Cliquez pour terminer","startCircle":"Cliquez pour placer le centre du cercle","finishCircle":"Cliquez pour finir le cercle","placeCircleMarker":"Cliquez pour placer le marqueur circulaire"},"actions":{"finish":"Terminer","cancel":"Annuler","removeLastVertex":"Retirer le dernier sommet"},"buttonTitles":{"drawMarkerButton":"Placer des marqueurs","drawPolyButton":"Dessiner des polygones","drawLineButton":"Dessiner des polylignes","drawCircleButton":"Dessiner un cercle","drawRectButton":"Dessiner un rectangle","editButton":"Éditer des calques","dragButton":"Déplacer des calques","cutButton":"Couper des calques","deleteButton":"Supprimer des calques","drawCircleMarkerButton":"Dessiner un marqueur circulaire","snappingButton":"Glisser le marqueur vers d\'autres couches et sommets","pinningButton":"Épingler ensemble les sommets partagés","rotateButton":"Tourner des calques"}}'),f=JSON.parse('{"tooltips":{"placeMarker":"单击放置标记","firstVertex":"单击放置首个顶点","continueLine":"单击继续绘制","finishLine":"单击任何存在的标记以完成","finishPoly":"单击第一个标记以完成","finishRect":"单击完成","startCircle":"单击放置圆心","finishCircle":"单击完成圆形","placeCircleMarker":"点击放置圆形标记"},"actions":{"finish":"完成","cancel":"取消","removeLastVertex":"移除最后的顶点"},"buttonTitles":{"drawMarkerButton":"绘制标记","drawPolyButton":"绘制多边形","drawLineButton":"绘制线段","drawCircleButton":"绘制圆形","drawRectButton":"绘制长方形","editButton":"编辑图层","dragButton":"拖拽图层","cutButton":"剪切图层","deleteButton":"删除图层","drawCircleMarkerButton":"画圆圈标记","snappingButton":"将拖动的标记捕捉到其他图层和顶点","pinningButton":"将共享顶点固定在一起"}}'),g=JSON.parse('{"tooltips":{"placeMarker":"單擊放置標記","firstVertex":"單擊放置第一個頂點","continueLine":"單擊繼續繪製","finishLine":"單擊任何存在的標記以完成","finishPoly":"單擊第一個標記以完成","finishRect":"單擊完成","startCircle":"單擊放置圓心","finishCircle":"單擊完成圓形","placeCircleMarker":"點擊放置圓形標記"},"actions":{"finish":"完成","cancel":"取消","removeLastVertex":"移除最後一個頂點"},"buttonTitles":{"drawMarkerButton":"放置標記","drawPolyButton":"繪製多邊形","drawLineButton":"繪製線段","drawCircleButton":"繪製圓形","drawRectButton":"繪製方形","editButton":"編輯圖形","dragButton":"移動圖形","cutButton":"裁切圖形","deleteButton":"刪除圖形","drawCircleMarkerButton":"畫圓圈標記","snappingButton":"將拖動的標記對齊到其他圖層和頂點","pinningButton":"將共享頂點固定在一起"}}'),_={en:a,de:o,it:s,id:l,ro:h,ru:u,es:c,nl:p,fr:d,pt_br:JSON.parse('{"tooltips":{"placeMarker":"Clique para posicionar o marcador","firstVertex":"Clique para posicionar o primeiro vértice","continueLine":"Clique para continuar desenhando","finishLine":"Clique em qualquer marcador existente para finalizar","finishPoly":"Clique no primeiro ponto para fechar o polígono","finishRect":"Clique para finalizar","startCircle":"Clique para posicionar o centro do círculo","finishCircle":"Clique para fechar o círculo","placeCircleMarker":"Clique para posicionar o marcador circular"},"actions":{"finish":"Finalizar","cancel":"Cancelar","removeLastVertex":"Remover último vértice"},"buttonTitles":{"drawMarkerButton":"Desenhar um marcador","drawPolyButton":"Desenhar um polígono","drawLineButton":"Desenhar uma polilinha","drawCircleButton":"Desenhar um círculo","drawRectButton":"Desenhar um retângulo","editButton":"Editar camada(s)","dragButton":"Mover camada(s)","cutButton":"Recortar camada(s)","deleteButton":"Remover camada(s)","drawCircleMarkerButton":"Marcador de círculos de desenho","snappingButton":"Marcador arrastado para outras camadas e vértices","pinningButton":"Vértices compartilhados de pinos juntos"}}'),zh:f,zh_tw:g,pl:JSON.parse('{"tooltips":{"placeMarker":"Kliknij, aby ustawić znacznik","firstVertex":"Kliknij, aby ustawić pierwszy punkt","continueLine":"Kliknij, aby kontynuować rysowanie","finishLine":"Kliknij dowolny punkt, aby zakończyć","finishPoly":"Kliknij pierwszy punkt, aby zakończyć","finishRect":"Kliknij, aby zakończyć","startCircle":"Kliknij, aby ustawić środek koła","finishCircle":"Kliknij, aby zakończyć rysowanie koła","placeCircleMarker":"Kliknij, aby ustawić okrągły znacznik"},"actions":{"finish":"Zakończ","cancel":"Anuluj","removeLastVertex":"Usuń ostatni punkt"},"buttonTitles":{"drawMarkerButton":"Narysuj znacznik","drawPolyButton":"Narysuj wielokąt","drawLineButton":"Narysuj ścieżkę","drawCircleButton":"Narysuj koło","drawRectButton":"Narysuj prostokąt","editButton":"Edytuj","dragButton":"Przesuń","cutButton":"Wytnij","deleteButton":"Usuń","drawCircleMarkerButton":"Narysuj okrągły znacznik","snappingButton":"Snap przeciągnięty marker na inne warstwy i wierzchołki","pinningButton":"Sworzeń wspólne wierzchołki razem"}}'),sv:JSON.parse('{"tooltips":{"placeMarker":"Klicka för att placera markör","firstVertex":"Klicka för att placera första hörnet","continueLine":"Klicka för att fortsätta rita","finishLine":"Klicka på en existerande punkt för att slutföra","finishPoly":"Klicka på den första punkten för att slutföra","finishRect":"Klicka för att slutföra","startCircle":"Klicka för att placera cirkelns centrum","finishCircle":"Klicka för att slutföra cirkeln","placeCircleMarker":"Klicka för att placera cirkelmarkör"},"actions":{"finish":"Slutför","cancel":"Avbryt","removeLastVertex":"Ta bort sista hörnet"},"buttonTitles":{"drawMarkerButton":"Rita Markör","drawPolyButton":"Rita Polygoner","drawLineButton":"Rita Linje","drawCircleButton":"Rita Cirkel","drawRectButton":"Rita Rektangel","editButton":"Redigera Lager","dragButton":"Dra Lager","cutButton":"Klipp i Lager","deleteButton":"Ta bort Lager","drawCircleMarkerButton":"Rita Cirkelmarkör","snappingButton":"Snäpp dra markören till andra lager och hörn","pinningButton":"Fäst delade hörn tillsammans"}}'),el:JSON.parse('{"tooltips":{"placeMarker":"Κάντε κλικ για να τοποθετήσετε Δείκτη","firstVertex":"Κάντε κλικ για να τοποθετήσετε το πρώτο σημείο","continueLine":"Κάντε κλικ για να συνεχίσετε να σχεδιάζετε","finishLine":"Κάντε κλικ σε οποιονδήποτε υπάρχον σημείο για να ολοκληρωθεί","finishPoly":"Κάντε κλικ στο πρώτο σημείο για να τελειώσετε","finishRect":"Κάντε κλικ για να τελειώσετε","startCircle":"Κάντε κλικ για να τοποθετήσετε κέντρο Κύκλου","finishCircle":"Κάντε κλικ για να ολοκληρώσετε τον Κύκλο","placeCircleMarker":"Κάντε κλικ για να τοποθετήσετε Κυκλικό Δείκτη"},"actions":{"finish":"Τέλος","cancel":"Ακύρωση","removeLastVertex":"Κατάργηση τελευταίου σημείου"},"buttonTitles":{"drawMarkerButton":"Σχεδίαση Δείκτη","drawPolyButton":"Σχεδίαση Πολυγώνου","drawLineButton":"Σχεδίαση Γραμμής","drawCircleButton":"Σχεδίαση Κύκλου","drawRectButton":"Σχεδίαση Ορθογωνίου","editButton":"Επεξεργασία Επιπέδων","dragButton":"Μεταφορά Επιπέδων","cutButton":"Αποκοπή Επιπέδων","deleteButton":"Κατάργηση Επιπέδων","drawCircleMarkerButton":"Σχεδίαση Κυκλικού Δείκτη","snappingButton":"Προσκόλληση του Δείκτη μεταφοράς σε άλλα Επίπεδα και Κορυφές","pinningButton":"Περικοπή κοινών κορυφών μαζί"}}'),hu:JSON.parse('{"tooltips":{"placeMarker":"Kattintson a jelölő elhelyezéséhez","firstVertex":"Kattintson az első pont elhelyezéséhez","continueLine":"Kattintson a következő pont elhelyezéséhez","finishLine":"A befejezéshez kattintson egy meglévő pontra","finishPoly":"A befejezéshez kattintson az első pontra","finishRect":"Kattintson a befejezéshez","startCircle":"Kattintson a kör középpontjának elhelyezéséhez","finishCircle":"Kattintson a kör befejezéséhez","placeCircleMarker":"Kattintson a körjelölő elhelyezéséhez"},"actions":{"finish":"Befejezés","cancel":"Mégse","removeLastVertex":"Utolsó pont eltávolítása"},"buttonTitles":{"drawMarkerButton":"Jelölő rajzolása","drawPolyButton":"Poligon rajzolása","drawLineButton":"Vonal rajzolása","drawCircleButton":"Kör rajzolása","drawRectButton":"Négyzet rajzolása","editButton":"Elemek szerkesztése","dragButton":"Elemek mozgatása","cutButton":"Elemek vágása","deleteButton":"Elemek törlése","drawCircleMarkerButton":"Kör jelölő rajzolása","snappingButton":"Kapcsolja a jelöltőt másik elemhez vagy ponthoz","pinningButton":"Közös pontok összekötése"}}'),da:JSON.parse('{"tooltips":{"placeMarker":"Tryk for at placere en markør","firstVertex":"Tryk for at placere det første punkt","continueLine":"Tryk for at fortsætte linjen","finishLine":"Tryk på et eksisterende punkt for at afslutte","finishPoly":"Tryk på det første punkt for at afslutte","finishRect":"Tryk for at afslutte","startCircle":"Tryk for at placere cirklens center","finishCircle":"Tryk for at afslutte cirklen","placeCircleMarker":"Tryk for at placere en cirkelmarkør"},"actions":{"finish":"Afslut","cancel":"Afbryd","removeLastVertex":"Fjern sidste punkt"},"buttonTitles":{"drawMarkerButton":"Placer markør","drawPolyButton":"Tegn polygon","drawLineButton":"Tegn linje","drawCircleButton":"Tegn cirkel","drawRectButton":"Tegn firkant","editButton":"Rediger","dragButton":"Træk","cutButton":"Klip","deleteButton":"Fjern","drawCircleMarkerButton":"Tegn cirkelmarkør","snappingButton":"Fastgør trukket markør til andre elementer","pinningButton":"Sammenlæg delte elementer"}}'),no:JSON.parse('{"tooltips":{"placeMarker":"Klikk for å plassere punkt","firstVertex":"Klikk for å plassere første punkt","continueLine":"Klikk for å tegne videre","finishLine":"Klikk på et eksisterende punkt for å fullføre","finishPoly":"Klikk første punkt for å fullføre","finishRect":"Klikk for å fullføre","startCircle":"Klikk for å sette sirkel midtpunkt","finishCircle":"Klikk for å fullføre sirkel","placeCircleMarker":"Klikk for å plassere sirkel"},"actions":{"finish":"Fullfør","cancel":"Kanseller","removeLastVertex":"Fjern forrige punkt"},"buttonTitles":{"drawMarkerButton":"Tegn Punkt","drawPolyButton":"Tegn Flate","drawLineButton":"Tegn Linje","drawCircleButton":"Tegn Sirkel","drawRectButton":"Tegn rektangel","editButton":"Rediger Objekter","dragButton":"Dra Objekter","cutButton":"Kutt Objekter","deleteButton":"Fjern Objekter","drawCircleMarkerButton":"Tegn sirkel-punkt","snappingButton":"Fest dratt punkt til andre objekter og punkt","pinningButton":"Pin delte punkt sammen"}}'),fa:JSON.parse('{"tooltips":{"placeMarker":"کلیک برای جانمایی نشان","firstVertex":"کلیک برای رسم اولین رأس","continueLine":"کلیک برای ادامه رسم","finishLine":"کلیک روی هر نشان موجود برای پایان","finishPoly":"کلیک روی اولین نشان برای پایان","finishRect":"کلیک برای پایان","startCircle":"کلیک برای رسم مرکز دایره","finishCircle":"کلیک برای پایان رسم دایره","placeCircleMarker":"کلیک برای رسم نشان دایره"},"actions":{"finish":"پایان","cancel":"لفو","removeLastVertex":"حذف آخرین رأس"},"buttonTitles":{"drawMarkerButton":"درج نشان","drawPolyButton":"رسم چندضلعی","drawLineButton":"رسم خط","drawCircleButton":"رسم دایره","drawRectButton":"رسم چهارضلعی","editButton":"ویرایش لایه‌ها","dragButton":"جابجایی لایه‌ها","cutButton":"برش لایه‌ها","deleteButton":"حذف لایه‌ها","drawCircleMarkerButton":"رسم نشان دایره","snappingButton":"نشانگر را به لایه‌ها و رئوس دیگر بکشید","pinningButton":"رئوس مشترک را با هم پین کنید","rotateButton":"چرخش لایه"}}'),ua:JSON.parse('{"tooltips":{"placeMarker":"Натисніть, щоб нанести маркер","firstVertex":"Натисніть, щоб нанести першу вершину","continueLine":"Натисніть, щоб продовжити малювати","finishLine":"Натисніть будь-який існуючий маркер для завершення","finishPoly":"Виберіть перший маркер, щоб завершити","finishRect":"Натисніть, щоб завершити","startCircle":"Натисніть, щоб додати центр кола","finishCircle":"Натисніть, щоб завершити коло","placeCircleMarker":"Натисніть, щоб нанести круговий маркер"},"actions":{"finish":"Завершити","cancel":"Відмінити","removeLastVertex":"Видалити попередню вершину"},"buttonTitles":{"drawMarkerButton":"Малювати маркер","drawPolyButton":"Малювати полігон","drawLineButton":"Малювати криву","drawCircleButton":"Малювати коло","drawRectButton":"Малювати прямокутник","editButton":"Редагувати шари","dragButton":"Перенести шари","cutButton":"Вирізати шари","deleteButton":"Видалити шари","drawCircleMarkerButton":"Малювати круговий маркер","snappingButton":"Прив’язати перетягнутий маркер до інших шарів та вершин","pinningButton":"Зв\'язати спільні вершини разом"}}'),tr:JSON.parse('{"tooltips":{"placeMarker":"İşaretçi yerleştirmek için tıklayın","firstVertex":"İlk tepe noktasını yerleştirmek için tıklayın","continueLine":"Çizime devam etmek için tıklayın","finishLine":"Bitirmek için mevcut herhangi bir işaretçiyi tıklayın","finishPoly":"Bitirmek için ilk işaretçiyi tıklayın","finishRect":"Bitirmek için tıklayın","startCircle":"Daire merkezine yerleştirmek için tıklayın","finishCircle":"Daireyi bitirmek için tıklayın","placeCircleMarker":"Daire işaretçisi yerleştirmek için tıklayın"},"actions":{"finish":"Bitir","cancel":"İptal","removeLastVertex":"Son köşeyi kaldır"},"buttonTitles":{"drawMarkerButton":"Çizim İşaretçisi","drawPolyButton":"Çokgenler çiz","drawLineButton":"Çoklu çizgi çiz","drawCircleButton":"Çember çiz","drawRectButton":"Dikdörtgen çiz","editButton":"Katmanları düzenle","dragButton":"Katmanları sürükle","cutButton":"Katmanları kes","deleteButton":"Katmanları kaldır","drawCircleMarkerButton":"Daire işaretçisi çiz","snappingButton":"Sürüklenen işaretçiyi diğer katmanlara ve köşelere yapıştır","pinningButton":"Paylaşılan köşeleri birbirine sabitle"}}'),cz:JSON.parse('{"tooltips":{"placeMarker":"Kliknutím vytvoříte značku","firstVertex":"Kliknutím vytvoříte první objekt","continueLine":"Kliknutím pokračujte v kreslení","finishLine":"Kliknutí na libovolnou existující značku pro dokončení","finishPoly":"Vyberte první bod pro dokončení","finishRect":"Klikněte pro dokončení","startCircle":"Kliknutím přidejte střed kruhu","finishCircle":"Нажмите, чтобы задать радиус","placeCircleMarker":"Kliknutím nastavte poloměr"},"actions":{"finish":"Dokončit","cancel":"Zrušit","removeLastVertex":"Zrušit poslední akci"},"buttonTitles":{"drawMarkerButton":"Přidat značku","drawPolyButton":"Nakreslit polygon","drawLineButton":"Nakreslit křivku","drawCircleButton":"Nakreslit kruh","drawRectButton":"Nakreslit obdélník","editButton":"Upravit vrstvu","dragButton":"Přeneste vrstvu","cutButton":"Vyjmout vrstvu","deleteButton":"Smazat vrstvu","drawCircleMarkerButton":"Přidat kruhovou značku","snappingButton":"Navázat tažnou značku k dalším vrstvám a vrcholům","pinningButton":"Spojit společné body dohromady"}}')};function y(t,e){var i=Object.keys(t);if(Object.getOwnPropertySymbols){var n=Object.getOwnPropertySymbols(t);e&&(n=n.filter((function(e){return Object.getOwnPropertyDescriptor(t,e).enumerable}))),i.push.apply(i,n)}return i}function m(t){for(var e=1;e0&&arguments[0]!==undefined?arguments[0]:this.globalOptions;this.globalEditModeEnabled()?this.disableGlobalEditMode():this.enableGlobalEditMode(t)},handleLayerAdditionInGlobalEditMode:function(){var t=this._addedLayers;for(var e in this._addedLayers={},t){var i=t[e];this._isRelevantForEdit(i)&&this.globalEditModeEnabled()&&i.pm.enable(m({},this.globalOptions))}},_layerAdded:function(t){var e=t.layer;this._addedLayers[L.stamp(e)]=e},_isRelevantForEdit:function(t){return t.pm&&!(t instanceof L.LayerGroup)&&(!L.PM.optIn&&!t.options.pmIgnore||L.PM.optIn&&!1===t.options.pmIgnore)&&!t._pmTempLayer&&t.pm.options.allowEditing}};const k={_globalDragModeEnabled:!1,enableGlobalDragMode:function(){var t=L.PM.Utils.findLayers(this.map);this._globalDragModeEnabled=!0,this._addedLayersDrag={},t.forEach((function(t){t.pm.enableLayerDrag()})),this.throttledReInitDrag||(this.throttledReInitDrag=L.Util.throttle(this.reinitGlobalDragMode,100,this)),this.map.on("layeradd",this.throttledReInitDrag,this),this.map.on("layeradd",this._layerAddedDrag,this),this.Toolbar.toggleButton("dragMode",this.globalDragModeEnabled()),this._fireGlobalDragModeToggled(!0)},disableGlobalDragMode:function(){var t=L.PM.Utils.findLayers(this.map);this._globalDragModeEnabled=!1,t.forEach((function(t){t.pm.disableLayerDrag()})),this.map.off("layeradd",this.throttledReInitDrag,this),this.Toolbar.toggleButton("dragMode",this.globalDragModeEnabled()),this._fireGlobalDragModeToggled(!1)},globalDragModeEnabled:function(){return!!this._globalDragModeEnabled},toggleGlobalDragMode:function(){this.globalDragModeEnabled()?this.disableGlobalDragMode():this.enableGlobalDragMode()},reinitGlobalDragMode:function(){var t=this._addedLayersDrag;for(var e in this._addedLayersDrag={},t){var i=t[e];this._isRelevantForDrag(i)&&this.globalDragModeEnabled()&&i.pm.enableLayerDrag()}},_layerAddedDrag:function(t){var e=t.layer;this._addedLayersDrag[L.stamp(e)]=e},_isRelevantForDrag:function(t){return t.pm&&!(t instanceof L.LayerGroup)&&(!L.PM.optIn&&!t.options.pmIgnore||L.PM.optIn&&!1===t.options.pmIgnore)&&!t._pmTempLayer&&t.pm.options.draggable}};const M={_globalRemovalModeEnabled:!1,enableGlobalRemovalMode:function(){var t=this;this._globalRemovalModeEnabled=!0,this.map.eachLayer((function(e){t._isRelevantForRemoval(e)&&(e.pm.disable(),e.on("click",t.removeLayer,t))})),this.throttledReInitRemoval||(this.throttledReInitRemoval=L.Util.throttle(this.reinitGlobalRemovalMode,100,this)),this.map.on("layeradd",this.throttledReInitRemoval,this),this.Toolbar.toggleButton("removalMode",this.globalRemovalModeEnabled()),this._fireGlobalRemovalModeToggled(!0)},disableGlobalRemovalMode:function(){var t=this;this._globalRemovalModeEnabled=!1,this.map.eachLayer((function(e){e.off("click",t.removeLayer,t)})),this.map.off("layeradd",this.throttledReInitRemoval,this),this.Toolbar.toggleButton("removalMode",this.globalRemovalModeEnabled()),this._fireGlobalRemovalModeToggled(!1)},globalRemovalEnabled:function(){return this.globalRemovalModeEnabled()},globalRemovalModeEnabled:function(){return!!this._globalRemovalModeEnabled},toggleGlobalRemovalMode:function(){this.globalRemovalModeEnabled()?this.disableGlobalRemovalMode():this.enableGlobalRemovalMode()},reinitGlobalRemovalMode:function(t){var e=t.layer;this._isRelevantForRemoval(e)&&this.globalRemovalModeEnabled()&&(this.disableGlobalRemovalMode(),this.enableGlobalRemovalMode())},removeLayer:function(t){var e=t.target;this._isRelevantForRemoval(e)&&!e.pm.dragging()&&(e.removeFrom(this.map.pm._getContainingLayer()),e.remove(),e instanceof L.LayerGroup?(this._fireRemoveLayerGroup(e),this._fireRemoveLayerGroup(this.map,e)):(e.pm._fireRemove(e),e.pm._fireRemove(this.map,e)))},_isRelevantForRemoval:function(t){return t.pm&&!(t instanceof L.LayerGroup)&&(!L.PM.optIn&&!t.options.pmIgnore||L.PM.optIn&&!1===t.options.pmIgnore)&&!t._pmTempLayer&&t.pm.options.allowRemoval}};const x={_globalRotateModeEnabled:!1,enableGlobalRotateMode:function(){var t=this;this._globalRotateModeEnabled=!0,L.PM.Utils.findLayers(this.map).filter((function(t){return t instanceof L.Polyline})).forEach((function(e){t._isRelevantForRotate(e)&&e.pm.enableRotate()})),this.throttledReInitRotate||(this.throttledReInitRotate=L.Util.throttle(this._reinitGlobalRotateMode,100,this)),this.map.on("layeradd",this.throttledReInitRotate,this),this.Toolbar.toggleButton("rotateMode",this.globalRotateModeEnabled()),this._fireGlobalRotateModeToggled()},disableGlobalRotateMode:function(){this._globalRotateModeEnabled=!1,L.PM.Utils.findLayers(this.map).filter((function(t){return t instanceof L.Polyline})).forEach((function(t){t.pm.disableRotate()})),this.map.off("layeradd",this.throttledReInitRotate,this),this.Toolbar.toggleButton("rotateMode",this.globalRotateModeEnabled()),this._fireGlobalRotateModeToggled()},globalRotateModeEnabled:function(){return!!this._globalRotateModeEnabled},toggleGlobalRotateMode:function(){this.globalRotateModeEnabled()?this.disableGlobalRotateMode():this.enableGlobalRotateMode()},_reinitGlobalRotateMode:function(t){var e=t.layer;this._isRelevantForRotate(e)&&this.globalRotateModeEnabled()&&(this.disableGlobalRotateMode(),this.enableGlobalRotateMode())},_isRelevantForRotate:function(t){return t.pm&&!(t instanceof L.LayerGroup)&&(!L.PM.optIn&&!t.options.pmIgnore||L.PM.optIn&&!1===t.options.pmIgnore)&&!t._pmTempLayer&&t.pm.options.allowRotation}};function w(t,e){var i=Object.keys(t);if(Object.getOwnPropertySymbols){var n=Object.getOwnPropertySymbols(t);e&&(n=n.filter((function(e){return Object.getOwnPropertyDescriptor(t,e).enumerable}))),i.push.apply(i,n)}return i}function C(t){for(var e=1;e0&&arguments[0]!==undefined?arguments[0]:"Draw",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._map,"pm:drawstart",{shape:this._shape,workingLayer:this._layer},t,e)},_fireDrawEnd:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Draw",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._map,"pm:drawend",{shape:this._shape},t,e)},_fireCreate:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:"Draw",i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:{};this.__fire(this._map,"pm:create",{shape:this._shape,marker:t,layer:t},e,i)},_fireCenterPlaced:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Draw",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{},i="Draw"===t?this._layer:undefined,n="Draw"!==t?this._layer:undefined;this.__fire(this._layer,"pm:centerplaced",{shape:this._shape,workingLayer:i,layer:n,latlng:this._layer.getLatLng()},t,e)},_fireCut:function(t,e,i){var n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:"Draw",r=arguments.length>4&&arguments[4]!==undefined?arguments[4]:{};this.__fire(t,"pm:cut",{shape:this._shape,layer:e,originalLayer:i},n,r)},_fireEdit:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:this._layer,e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:"Edit",i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:{};this.__fire(t,"pm:edit",{layer:this._layer,shape:this.getShape()},e,i)},_fireEnable:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Edit",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._layer,"pm:enable",{layer:this._layer,shape:this.getShape()},t,e)},_fireDisable:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Edit",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._layer,"pm:disable",{layer:this._layer,shape:this.getShape()},t,e)},_fireUpdate:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Edit",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._layer,"pm:update",{layer:this._layer,shape:this.getShape()},t,e)},_fireMarkerDragStart:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:undefined,i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Edit",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(this._layer,"pm:markerdragstart",{layer:this._layer,markerEvent:t,shape:this.getShape(),indexPath:e},i,n)},_fireMarkerDrag:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:undefined,i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Edit",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(this._layer,"pm:markerdrag",{layer:this._layer,markerEvent:t,shape:this.getShape(),indexPath:e},i,n)},_fireMarkerDragEnd:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:undefined,i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:undefined,n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:"Edit",r=arguments.length>4&&arguments[4]!==undefined?arguments[4]:{};this.__fire(this._layer,"pm:markerdragend",{layer:this._layer,markerEvent:t,shape:this.getShape(),indexPath:e,intersectionReset:i},n,r)},_fireDragStart:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Edit",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._layer,"pm:dragstart",{layer:this._layer,shape:this.getShape()},t,e)},_fireDrag:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:"Edit",i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:{};this.__fire(this._layer,"pm:drag",C(C({},t),{},{shape:this.getShape()}),e,i)},_fireDragEnd:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Edit",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._layer,"pm:dragend",{layer:this._layer,shape:this.getShape()},t,e)},_fireDragEnable:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Edit",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._layer,"pm:dragenable",{layer:this._layer,shape:this.getShape()},t,e)},_fireDragDisable:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Edit",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._layer,"pm:dragdisable",{layer:this._layer,shape:this.getShape()},t,e)},_fireRemove:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:t,i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Edit",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(t,"pm:remove",{layer:e,shape:this.getShape()},i,n)},_fireVertexAdded:function(t,e,i){var n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:"Edit",r=arguments.length>4&&arguments[4]!==undefined?arguments[4]:{};this.__fire(this._layer,"pm:vertexadded",{layer:this._layer,workingLayer:this._layer,marker:t,indexPath:e,latlng:i,shape:this.getShape()},n,r)},_fireVertexRemoved:function(t,e){var i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Edit",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(this._layer,"pm:vertexremoved",{layer:this._layer,marker:t,indexPath:e,shape:this.getShape()},i,n)},_fireVertexClick:function(t,e){var i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Edit",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(this._layer,"pm:vertexclick",{layer:this._layer,markerEvent:t,indexPath:e,shape:this.getShape()},i,n)},_fireIntersect:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:"Edit",i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:{};this.__fire(this._layer,"pm:intersect",{layer:this._layer,intersection:t,shape:this.getShape()},e,i)},_fireLayerReset:function(t,e){var i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Edit",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(this._layer,"pm:layerreset",{layer:this._layer,markerEvent:t,indexPath:e,shape:this.getShape()},i,n)},_fireChange:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:"Edit",i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:{};this.__fire(this._layer,"pm:change",{layer:this._layer,latlngs:t,shape:this.getShape()},e,i)},_fireSnapDrag:function(t,e){var i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Snapping",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(t,"pm:snapdrag",e,i,n)},_fireSnap:function(t,e){var i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Snapping",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(t,"pm:snap",e,i,n)},_fireUnsnap:function(t,e){var i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Snapping",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(t,"pm:unsnap",e,i,n)},_fireRotationEnable:function(t,e){var i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Rotation",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(t,"pm:rotateenable",{layer:this._layer,helpLayer:this._rotatePoly,shape:this.getShape()},i,n)},_fireRotationDisable:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:"Rotation",i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:{};this.__fire(t,"pm:rotatedisable",{layer:this._layer,shape:this.getShape()},e,i)},_fireRotationStart:function(t,e){var i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Rotation",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(t,"pm:rotatestart",{layer:this._rotationLayer,helpLayer:this._layer,startAngle:this._startAngle,originLatLngs:e},i,n)},_fireRotation:function(t,e,i){var n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:this._rotationLayer,r=arguments.length>4&&arguments[4]!==undefined?arguments[4]:"Rotation",a=arguments.length>5&&arguments[5]!==undefined?arguments[5]:{};this.__fire(t,"pm:rotate",{layer:n,helpLayer:this._layer,startAngle:this._startAngle,angle:n.pm.getAngle(),angleDiff:e,oldLatLngs:i,newLatLngs:n.getLatLngs()},r,a)},_fireRotationEnd:function(t,e,i){var n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:"Rotation",r=arguments.length>4&&arguments[4]!==undefined?arguments[4]:{};this.__fire(t,"pm:rotateend",{layer:this._rotationLayer,helpLayer:this._layer,startAngle:e,angle:this._rotationLayer.pm.getAngle(),originLatLngs:i,newLatLngs:this._rotationLayer.getLatLngs()},n,r)},_fireActionClick:function(t,e,i){var n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:"Toolbar",r=arguments.length>4&&arguments[4]!==undefined?arguments[4]:{};this.__fire(this._map,"pm:actionclick",{text:t.text,action:t,btnName:e,button:i},n,r)},_fireButtonClick:function(t,e){var i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Toolbar",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(this._map,"pm:buttonclick",{btnName:t,button:e},i,n)},_fireLangChange:function(t,e,i,n){var r=arguments.length>4&&arguments[4]!==undefined?arguments[4]:"Global",a=arguments.length>5&&arguments[5]!==undefined?arguments[5]:{};this.__fire(this.map,"pm:langchange",{oldLang:t,activeLang:e,fallback:i,translations:n},r,a)},_fireGlobalDragModeToggled:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:"Global",i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:{};this.__fire(this.map,"pm:globaldragmodetoggled",{enabled:t,map:this.map},e,i)},_fireGlobalEditModeToggled:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:"Global",i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:{};this.__fire(this.map,"pm:globaleditmodetoggled",{enabled:t,map:this.map},e,i)},_fireGlobalRemovalModeToggled:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:"Global",i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:{};this.__fire(this.map,"pm:globalremovalmodetoggled",{enabled:t,map:this.map},e,i)},_fireGlobalCutModeToggled:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Global",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._map,"pm:globalcutmodetoggled",{enabled:!!this._enabled,map:this._map},t,e)},_fireGlobalDrawModeToggled:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Global",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this._map,"pm:globaldrawmodetoggled",{enabled:this._enabled,shape:this._shape,map:this._map},t,e)},_fireGlobalRotateModeToggled:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Global",e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{};this.__fire(this.map,"pm:globalrotatemodetoggled",{enabled:this.globalRotateModeEnabled(),map:this.map},t,e)},_fireRemoveLayerGroup:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:t,i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"Edit",n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:{};this.__fire(t,"pm:remove",{layer:e,shape:undefined},i,n)},_fireKeyeventEvent:function(t,e,i){var n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:"Global",r=arguments.length>4&&arguments[4]!==undefined?arguments[4]:{};this.__fire(this.map,"pm:keyevent",{event:t,eventType:e,focusOn:i},n,r)},__fire:function(t,e,i,n){var a=arguments.length>4&&arguments[4]!==undefined?arguments[4]:{};i=r()(i,a,{source:n}),L.PM.Utils._fireEvent(t,e,i)}};const S=E;const O={_lastEvents:{keydown:undefined,keyup:undefined,current:undefined},_initKeyListener:function(t){this.map=t,L.DomEvent.on(document,"keydown keyup",this._onKeyListener,this),L.DomEvent.on(document,"blur",this._onKeyListener,this)},_onKeyListener:function(t){var e="document";this.map.getContainer().contains(t.target)&&(e="map");var i={event:t,eventType:t.type,focusOn:e};this._lastEvents[t.type]=i,this._lastEvents.current=i,this.map.pm._fireKeyeventEvent(t,t.type,e)},getLastKeyEvent:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"current";return this._lastEvents[t]},isShiftKeyPressed:function(){var t;return null===(t=this._lastEvents.current)||void 0===t?void 0:t.event.shiftKey},isAltKeyPressed:function(){var t;return null===(t=this._lastEvents.current)||void 0===t?void 0:t.event.altKey},isCtrlKeyPressed:function(){var t;return null===(t=this._lastEvents.current)||void 0===t?void 0:t.event.ctrlKey},isMetaKeyPressed:function(){var t;return null===(t=this._lastEvents.current)||void 0===t?void 0:t.event.metaKey},getPressedKey:function(){var t;return null===(t=this._lastEvents.current)||void 0===t?void 0:t.event.key}};var D=i(7361),R=i.n(D),B=i(8721),T=i.n(B);function I(t){var e=L.PM.activeLang;return T()(_,e)||(e="en"),R()(_[e],t)}function j(t){return!function e(t){return t.filter((function(t){return![null,"",undefined].includes(t)})).reduce((function(t,i){return t.concat(Array.isArray(i)?e(i):i)}),[])}(t).length}function G(t){return t.reduce((function(t,e){return 0!==e.length&&t.push(Array.isArray(e)?G(e):e),t}),[])}function A(t,e,i){for(var n,r,a,o=6378137,s=6356752.3142,l=1/298.257223563,h=t.lng,u=t.lat,c=i,p=Math.PI,d=e*p/180,f=Math.sin(d),g=Math.cos(d),_=(1-l)*Math.tan(u*p/180),y=1/Math.sqrt(1+_*_),m=_*y,v=Math.atan2(_,g),b=y*f,k=1-b*b,M=k*(o*o-s*s)/(s*s),x=1+M/16384*(4096+M*(M*(320-175*M)-768)),w=M/1024*(256+M*(M*(74-47*M)-128)),C=c/(s*x),P=2*Math.PI;Math.abs(C-P)>1e-12;){n=Math.cos(2*v+C),P=C,C=c/(s*x)+w*(r=Math.sin(C))*(n+w/4*((a=Math.cos(C))*(2*n*n-1)-w/6*n*(4*r*r-3)*(4*n*n-3)))}var E=m*r-y*a*g,S=Math.atan2(m*a+y*r*g,(1-l)*Math.sqrt(b*b+E*E)),O=l/16*k*(4+l*(4-3*k)),D=h+180*(Math.atan2(r*f,y*a-m*r*g)-(1-O)*l*b*(C+O*r*(n+O*a*(2*n*n-1))))/p,R=180*S/p;return L.latLng(D,R)}function N(t,e,i,n){for(var r,a,o=!(arguments.length>4&&arguments[4]!==undefined)||arguments[4],s=[],l=0;l180?f-360:f<-180?f+360:f,L.latLng([d*r,f])}(e,r,n)}function U(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:t.getLatLngs();return t instanceof L.Polygon?L.polygon(e).getLatLngs():L.polyline(e).getLatLngs()}function V(t,e){var i,n;if(null!==(i=e.options.crs)&&void 0!==i&&null!==(n=i.projection)&&void 0!==n&&n.MAX_LATITUDE){var r,a,o=null===(r=e.options.crs)||void 0===r||null===(a=r.projection)||void 0===a?void 0:a.MAX_LATITUDE;t.lat=Math.max(Math.min(o,t.lat),-o)}return t}function F(t){return t.options.renderer||t._map._getPaneRenderer(t.options.pane)||t._map.options.renderer||t._map._renderer}const K=L.Class.extend({includes:[b,k,M,x,S],initialize:function(t){this.map=t,this.Draw=new L.PM.Draw(t),this.Toolbar=new L.PM.Toolbar(t),this.Keyboard=O,this.globalOptions={snappable:!0,layerGroup:undefined,snappingOrder:["Marker","CircleMarker","Circle","Line","Polygon","Rectangle"],panes:{vertexPane:"markerPane",layerPane:"overlayPane",markerPane:"markerPane"},draggable:!0},this.Keyboard._initKeyListener(t)},setLang:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"en",e=arguments.length>1?arguments[1]:undefined,i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:"en",n=L.PM.activeLang;e&&(_[t]=r()(_[i],e)),L.PM.activeLang=t,this.map.pm.Toolbar.reinit(),this._fireLangChange(n,t,i,_[t])},addControls:function(t){this.Toolbar.addControls(t)},removeControls:function(){this.Toolbar.removeControls()},toggleControls:function(){this.Toolbar.toggleControls()},controlsVisible:function(){return this.Toolbar.isVisible},enableDraw:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Polygon",e=arguments.length>1?arguments[1]:undefined;"Poly"===t&&(t="Polygon"),this.Draw.enable(t,e)},disableDraw:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:"Polygon";"Poly"===t&&(t="Polygon"),this.Draw.disable(t)},setPathOptions:function(t){var e=this,i=arguments.length>1&&arguments[1]!==undefined?arguments[1]:{},n=i.ignoreShapes||[],r=i.merge||!1;this.map.pm.Draw.shapes.forEach((function(i){-1===n.indexOf(i)&&e.map.pm.Draw[i].setPathOptions(t,r)}))},getGlobalOptions:function(){return this.globalOptions},setGlobalOptions:function(t){var e=this,i=r()(this.globalOptions,t),n=!1;this.map.pm.Draw.CircleMarker.enabled()&&this.map.pm.Draw.CircleMarker.options.editable!==i.editable&&(this.map.pm.Draw.CircleMarker.disable(),n=!0),this.map.pm.Draw.shapes.forEach((function(t){e.map.pm.Draw[t].setOptions(i)})),n&&this.map.pm.Draw.CircleMarker.enable(),L.PM.Utils.findLayers(this.map).forEach((function(t){t.pm.setOptions(i)})),this.applyGlobalOptions(),this.globalOptions=i},applyGlobalOptions:function(){L.PM.Utils.findLayers(this.map).forEach((function(t){t.pm.enabled()&&t.pm.applyOptions()}))},globalDrawModeEnabled:function(){return!!this.Draw.getActiveShape()},globalCutModeEnabled:function(){return!!this.Draw.Cut.enabled()},enableGlobalCutMode:function(t){return this.Draw.Cut.enable(t)},toggleGlobalCutMode:function(t){return this.Draw.Cut.toggle(t)},disableGlobalCutMode:function(){return this.Draw.Cut.disable()},getGeomanLayers:function(){var t=arguments.length>0&&arguments[0]!==undefined&&arguments[0],e=L.PM.Utils.findLayers(this.map);if(!t)return e;var i=L.featureGroup();return i._pmTempLayer=!0,e.forEach((function(t){i.addLayer(t)})),i},getGeomanDrawLayers:function(){var t=arguments.length>0&&arguments[0]!==undefined&&arguments[0],e=L.PM.Utils.findLayers(this.map).filter((function(t){return!0===t._drawnByGeoman}));if(!t)return e;var i=L.featureGroup();return i._pmTempLayer=!0,e.forEach((function(t){i.addLayer(t)})),i},_getContainingLayer:function(){return this.globalOptions.layerGroup&&this.globalOptions.layerGroup instanceof L.LayerGroup?this.globalOptions.layerGroup:this.map},_isCRSSimple:function(){return this.map.options.crs===L.CRS.Simple},_touchEventCounter:0,_addTouchEvents:function(t){0===this._touchEventCounter&&(L.DomEvent.on(t,"touchmove",this._canvasTouchMove,this),L.DomEvent.on(t,"touchstart touchend touchcancel",this._canvasTouchClick,this)),this._touchEventCounter+=1},_removeTouchEvents:function(t){1===this._touchEventCounter&&(L.DomEvent.off(t,"touchmove",this._canvasTouchMove,this),L.DomEvent.off(t,"touchstart touchend touchcancel",this._canvasTouchClick,this)),this._touchEventCounter=this._touchEventCounter<=1?0:this._touchEventCounter-1},_canvasTouchMove:function(t){F(this.map)._onMouseMove(this._createMouseEvent("mousemove",t))},_canvasTouchClick:function(t){var e="";"touchstart"===t.type||"pointerdown"===t.type?e="mousedown":"touchend"===t.type||"pointerup"===t.type?e="mouseup":"touchcancel"!==t.type&&"pointercancel"!==t.type||(e="mouseup"),e&&F(this.map)._onClick(this._createMouseEvent(e,t))},_createMouseEvent:function(t,e){var i,n=e.touches[0]||e.changedTouches[0];try{i=new MouseEvent(t,{bubbles:e.bubbles,cancelable:e.cancelable,view:e.view,detail:n.detail,screenX:n.screenX,screenY:n.screenY,clientX:n.clientX,clientY:n.clientY,ctrlKey:e.ctrlKey,altKey:e.altKey,shiftKey:e.shiftKey,metaKey:e.metaKey,button:e.button,relatedTarget:e.relatedTarget})}catch(r){(i=document.createEvent("MouseEvents")).initMouseEvent(t,e.bubbles,e.cancelable,e.view,n.detail,n.screenX,n.screenY,n.clientX,n.clientY,e.ctrlKey,e.altKey,e.shiftKey,e.metaKey,e.button,e.relatedTarget)}return i}});function H(t,e){var i=Object.keys(t);if(Object.getOwnPropertySymbols){var n=Object.getOwnPropertySymbols(t);e&&(n=n.filter((function(e){return Object.getOwnPropertyDescriptor(t,e).enumerable}))),i.push.apply(i,n)}return i}function q(t){for(var e=1;e-1?"pos-right":"",n=L.DomUtil.create("div","button-container ".concat(i),this._container),r=L.DomUtil.create("a","leaflet-buttons-control-button",n);r.setAttribute("role","button"),r.setAttribute("tabindex","0"),r.href="#";var a=L.DomUtil.create("div","leaflet-pm-actions-container ".concat(i),n),o=t.actions,s={cancel:{text:I("actions.cancel"),onClick:function(){this._triggerClick()}},finishMode:{text:I("actions.finish"),onClick:function(){this._triggerClick()}},removeLastVertex:{text:I("actions.removeLastVertex"),onClick:function(){this._map.pm.Draw[t.jsClass]._removeLastVertex()}},finish:{text:I("actions.finish"),onClick:function(e){this._map.pm.Draw[t.jsClass]._finishShape(e)}}};o.forEach((function(n){var r,o="string"==typeof n?n:n.name;if(s[o])r=s[o];else{if(!n.text)return;r=n}var l=L.DomUtil.create("a","leaflet-pm-action ".concat(i," action-").concat(o),a);if(l.setAttribute("role","button"),l.setAttribute("tabindex","0"),l.href="#",l.innerHTML=r.text,L.DomEvent.disableClickPropagation(l),L.DomEvent.on(l,"click",L.DomEvent.stop),!t.disabled&&r.onClick){L.DomEvent.addListener(l,"click",(function(i){i.preventDefault();var n="",a=e._map.pm.Toolbar.buttons;for(var o in a)if(a[o]._button===t){n=o;break}e._fireActionClick(r,n,t)}),e),L.DomEvent.addListener(l,"click",r.onClick,e)}})),t.toggleStatus&&L.DomUtil.addClass(n,"active");var l=L.DomUtil.create("div","control-icon",r);return t.title&&l.setAttribute("title",t.title),t.iconUrl&&l.setAttribute("src",t.iconUrl),t.className&&L.DomUtil.addClass(l,t.className),L.DomEvent.disableClickPropagation(r),L.DomEvent.on(r,"click",L.DomEvent.stop),t.disabled||(L.DomEvent.addListener(r,"click",this._onBtnClick,this),L.DomEvent.addListener(r,"click",this._triggerClick,this)),t.disabled&&(L.DomUtil.addClass(r,"pm-disabled"),r.setAttribute("aria-disabled","true")),n},_applyStyleClasses:function(){this._container&&(this._button.toggleStatus&&!1!==this._button.cssToggle?(L.DomUtil.addClass(this.buttonsDomNode,"active"),L.DomUtil.addClass(this._container,"activeChild")):(L.DomUtil.removeClass(this.buttonsDomNode,"active"),L.DomUtil.removeClass(this._container,"activeChild")))},_onBtnClick:function(){this._button.disableOtherButtons&&this._map.pm.Toolbar.triggerClickOnToggledButtons(this);var t="",e=this._map.pm.Toolbar.buttons;for(var i in e)if(e[i]._button===this._button){t=i;break}this._fireButtonClick(t,this._button)},_clicked:function(){this._button.doToggle&&this.toggle()},_updateDisabled:function(){var t="pm-disabled",e=this.buttonsDomNode.children[0];this._button.disabled?(L.DomUtil.addClass(e,t),e.setAttribute("aria-disabled","true"),L.DomEvent.off(e,"click",this._triggerClick,this),L.DomEvent.off(e,"click",this._onBtnClick,this)):(L.DomUtil.removeClass(e,t),e.setAttribute("aria-disabled","false"))}});function X(t,e){var i=Object.keys(t);if(Object.getOwnPropertySymbols){var n=Object.getOwnPropertySymbols(t);e&&(n=n.filter((function(e){return Object.getOwnPropertyDescriptor(t,e).enumerable}))),i.push.apply(i,n)}return i}function Z(t){for(var e=1;e0&&arguments[0]!==undefined?arguments[0]:this.options;"undefined"!=typeof t.editPolygon&&(t.editMode=t.editPolygon),"undefined"!=typeof t.deleteLayer&&(t.removalMode=t.deleteLayer),L.Util.setOptions(this,t),this.applyIconStyle(),this.isVisible=!0,this._showHideButtons()},applyIconStyle:function(){var t=this.getButtons(),e={geomanIcons:{drawMarker:"control-icon leaflet-pm-icon-marker",drawPolyline:"control-icon leaflet-pm-icon-polyline",drawRectangle:"control-icon leaflet-pm-icon-rectangle",drawPolygon:"control-icon leaflet-pm-icon-polygon",drawCircle:"control-icon leaflet-pm-icon-circle",drawCircleMarker:"control-icon leaflet-pm-icon-circle-marker",editMode:"control-icon leaflet-pm-icon-edit",dragMode:"control-icon leaflet-pm-icon-drag",cutPolygon:"control-icon leaflet-pm-icon-cut",removalMode:"control-icon leaflet-pm-icon-delete"}};for(var i in t){var n=t[i];L.Util.setOptions(n,{className:e.geomanIcons[i]})}},removeControls:function(){var t=this.getButtons();for(var e in t)t[e].remove();this.isVisible=!1},toggleControls:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:this.options;this.isVisible?this.removeControls():this.addControls(t)},_addButton:function(t,e){return this.buttons[t]=e,this.options[t]=this.options[t]||!1,this.buttons[t]},triggerClickOnToggledButtons:function(t){var e=["snappingOption"];for(var i in this.buttons)!e.includes(i)&&this.buttons[i]!==t&&this.buttons[i].toggled()&&this.buttons[i]._triggerClick()},toggleButton:function(t,e){var i=!(arguments.length>2&&arguments[2]!==undefined)||arguments[2];return"editPolygon"===t&&(t="editMode"),"deleteLayer"===t&&(t="removalMode"),i&&this.triggerClickOnToggledButtons(this.buttons[t]),!!this.buttons[t]&&this.buttons[t].toggle(e)},_defineButtons:function(){var t=this,e={className:"control-icon leaflet-pm-icon-marker",title:I("buttonTitles.drawMarkerButton"),jsClass:"Marker",onClick:function(){},afterClick:function(e,i){t.map.pm.Draw[i.button._button.jsClass].toggle()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,actions:["cancel"]},i={title:I("buttonTitles.drawPolyButton"),className:"control-icon leaflet-pm-icon-polygon",jsClass:"Polygon",onClick:function(){},afterClick:function(e,i){t.map.pm.Draw[i.button._button.jsClass].toggle()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,actions:["finish","removeLastVertex","cancel"]},n={className:"control-icon leaflet-pm-icon-polyline",title:I("buttonTitles.drawLineButton"),jsClass:"Line",onClick:function(){},afterClick:function(e,i){t.map.pm.Draw[i.button._button.jsClass].toggle()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,actions:["finish","removeLastVertex","cancel"]},r={title:I("buttonTitles.drawCircleButton"),className:"control-icon leaflet-pm-icon-circle",jsClass:"Circle",onClick:function(){},afterClick:function(e,i){t.map.pm.Draw[i.button._button.jsClass].toggle()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,actions:["cancel"]},a={title:I("buttonTitles.drawCircleMarkerButton"),className:"control-icon leaflet-pm-icon-circle-marker",jsClass:"CircleMarker",onClick:function(){},afterClick:function(e,i){t.map.pm.Draw[i.button._button.jsClass].toggle()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,actions:["cancel"]},o={title:I("buttonTitles.drawRectButton"),className:"control-icon leaflet-pm-icon-rectangle",jsClass:"Rectangle",onClick:function(){},afterClick:function(e,i){t.map.pm.Draw[i.button._button.jsClass].toggle()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,actions:["cancel"]},s={title:I("buttonTitles.editButton"),className:"control-icon leaflet-pm-icon-edit",onClick:function(){},afterClick:function(){t.map.pm.toggleGlobalEditMode()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,tool:"edit",actions:["finishMode"]},l={title:I("buttonTitles.dragButton"),className:"control-icon leaflet-pm-icon-drag",onClick:function(){},afterClick:function(){t.map.pm.toggleGlobalDragMode()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,tool:"edit",actions:["finishMode"]},h={title:I("buttonTitles.cutButton"),className:"control-icon leaflet-pm-icon-cut",jsClass:"Cut",onClick:function(){},afterClick:function(e,i){t.map.pm.Draw[i.button._button.jsClass].toggle({snappable:!0,cursorMarker:!0,allowSelfIntersection:!1})},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,tool:"edit",actions:["finish","removeLastVertex","cancel"]},u={title:I("buttonTitles.deleteButton"),className:"control-icon leaflet-pm-icon-delete",onClick:function(){},afterClick:function(){t.map.pm.toggleGlobalRemovalMode()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,tool:"edit",actions:["finishMode"]},c={title:I("buttonTitles.rotateButton"),className:"control-icon leaflet-pm-icon-rotate",onClick:function(){},afterClick:function(){t.map.pm.toggleGlobalRotateMode()},doToggle:!0,toggleStatus:!1,disableOtherButtons:!0,position:this.options.position,tool:"edit",actions:["finishMode"]};this._addButton("drawMarker",new L.Control.PMButton(e)),this._addButton("drawPolyline",new L.Control.PMButton(n)),this._addButton("drawRectangle",new L.Control.PMButton(o)),this._addButton("drawPolygon",new L.Control.PMButton(i)),this._addButton("drawCircle",new L.Control.PMButton(r)),this._addButton("drawCircleMarker",new L.Control.PMButton(a)),this._addButton("editMode",new L.Control.PMButton(s)),this._addButton("dragMode",new L.Control.PMButton(l)),this._addButton("cutPolygon",new L.Control.PMButton(h)),this._addButton("removalMode",new L.Control.PMButton(u)),this._addButton("rotateMode",new L.Control.PMButton(c))},_showHideButtons:function(){if(this.isVisible){this.removeControls(),this.isVisible=!0;var t=this.getButtons(),e=[];for(var i in!1===this.options.drawControls&&(e=e.concat(Object.keys(t).filter((function(e){return!t[e]._button.tool})))),!1===this.options.editControls&&(e=e.concat(Object.keys(t).filter((function(e){return"edit"===t[e]._button.tool})))),!1===this.options.optionsControls&&(e=e.concat(Object.keys(t).filter((function(e){return"options"===t[e]._button.tool})))),!1===this.options.customControls&&(e=e.concat(Object.keys(t).filter((function(e){return"custom"===t[e]._button.tool})))),t)if(this.options[i]&&-1===e.indexOf(i)){var n=t[i]._button.tool;n||(n="draw"),t[i].setPosition(this._getBtnPosition(n)),t[i].addTo(this.map)}}},_getBtnPosition:function(t){return this.options.positions&&this.options.positions[t]?this.options.positions[t]:this.options.position},setBlockPosition:function(t,e){this.options.positions[t]=e,this._showHideButtons(),this.changeControlOrder()},getBlockPositions:function(){return this.options.positions},copyDrawControl:function(t,e){if(!e)throw new TypeError("Button has no name");"object"!==W(e)&&(e={name:e});var i=this._btnNameMapping(t);if(!e.name)throw new TypeError("Button has no name");if(this.buttons[e.name])throw new TypeError("Button with this name already exists");var n=this.map.pm.Draw.createNewDrawInstance(e.name,i);return e=Z(Z({},this.buttons[i]._button),e),{drawInstance:n,control:this.createCustomControl(e)}},createCustomControl:function(t){if(!t.name)throw new TypeError("Button has no name");if(this.buttons[t.name])throw new TypeError("Button with this name already exists");t.onClick||(t.onClick=function(){}),t.afterClick||(t.afterClick=function(){}),!1!==t.toggle&&(t.toggle=!0),t.block&&(t.block=t.block.toLowerCase()),t.block&&"draw"!==t.block||(t.block=""),t.className?-1===t.className.indexOf("control-icon")&&(t.className="control-icon ".concat(t.className)):t.className="control-icon";var e={tool:t.block,className:t.className,title:t.title||"",jsClass:t.name,onClick:t.onClick,afterClick:t.afterClick,doToggle:t.toggle,toggleStatus:!1,disableOtherButtons:!0,cssToggle:t.toggle,position:this.options.position,actions:t.actions||[],disabled:!!t.disabled};!1!==this.options[t.name]&&(this.options[t.name]=!0);var i=this._addButton(t.name,new L.Control.PMButton(e));return this.changeControlOrder(),i},changeControlOrder:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:[],e=this._shapeMapping(),i=[];t.forEach((function(t){e[t]?i.push(e[t]):i.push(t)}));var n=this.getButtons(),r={};i.forEach((function(t){n[t]&&(r[t]=n[t])}));var a=Object.keys(n).filter((function(t){return!n[t]._button.tool}));a.forEach((function(t){-1===i.indexOf(t)&&(r[t]=n[t])}));var o=Object.keys(n).filter((function(t){return"edit"===n[t]._button.tool}));o.forEach((function(t){-1===i.indexOf(t)&&(r[t]=n[t])}));var s=Object.keys(n).filter((function(t){return"options"===n[t]._button.tool}));s.forEach((function(t){-1===i.indexOf(t)&&(r[t]=n[t])}));var l=Object.keys(n).filter((function(t){return"custom"===n[t]._button.tool}));l.forEach((function(t){-1===i.indexOf(t)&&(r[t]=n[t])})),Object.keys(n).forEach((function(t){-1===i.indexOf(t)&&(r[t]=n[t])})),this.map.pm.Toolbar.buttons=r,this._showHideButtons()},getControlOrder:function(){var t=this.getButtons(),e=[];for(var i in t)e.push(i);return e},changeActionsOfControl:function(t,e){var i=this._btnNameMapping(t);if(!i)throw new TypeError("No name passed");if(!e)throw new TypeError("No actions passed");if(!this.buttons[i])throw new TypeError("Button with this name not exists");this.buttons[i]._button.actions=e,this.changeControlOrder()},setButtonDisabled:function(t,e){var i=this._btnNameMapping(t);e?this.buttons[i].disable():this.buttons[i].enable()},_shapeMapping:function(){return{Marker:"drawMarker",Circle:"drawCircle",Polygon:"drawPolygon",Rectangle:"drawRectangle",Polyline:"drawPolyline",Line:"drawPolyline",CircleMarker:"drawCircleMarker",Edit:"editMode",Drag:"dragMode",Cut:"cutPolygon",Removal:"removalMode",Rotate:"rotateMode"}},_btnNameMapping:function(t){var e=this._shapeMapping();return e[t]?e[t]:t}});function tt(t,e){var i=Object.keys(t);if(Object.getOwnPropertySymbols){var n=Object.getOwnPropertySymbols(t);e&&(n=n.filter((function(e){return Object.getOwnPropertyDescriptor(t,e).enumerable}))),i.push.apply(i,n)}return i}function et(t){for(var e=1;e2&&arguments[2]!==undefined?arguments[2]:"asc";if(!e||0===Object.keys(e).length)return function(t,e){return t-e};for(var n,r=Object.keys(e),a=r.length-1,o={};a>=0;)n=r[a],o[n.toLowerCase()]=e[n],a-=1;function s(t){return t instanceof L.Marker?"Marker":t instanceof L.Circle?"Circle":t instanceof L.CircleMarker?"CircleMarker":t instanceof L.Rectangle?"Rectangle":t instanceof L.Polygon?"Polygon":t instanceof L.Polyline?"Line":undefined}return function(e,n){var r,a;if("instanceofShape"===t){if(r=s(e.layer).toLowerCase(),a=s(n.layer).toLowerCase(),!r||!a)return 0}else{if(!e.hasOwnProperty(t)||!n.hasOwnProperty(t))return 0;r=e[t].toLowerCase(),a=n[t].toLowerCase()}var l=r in o?o[r]:Number.MAX_SAFE_INTEGER,h=a in o?o[a]:Number.MAX_SAFE_INTEGER,u=0;return lh&&(u=1),"desc"===i?-1*u:u}}("instanceofShape",n)),t[0]||{}},_checkPrioritiySnapping:function(t){var e=this._map,i=t.segment[0],n=t.segment[1],r=t.latlng,a=this._getDistance(e,i,r),o=this._getDistance(e,n,r),s=a1&&arguments[1]!==undefined&&arguments[1];this.options.pathOptions=e?r()(this.options.pathOptions,t):t},getShapes:function(){return this.shapes},getShape:function(){return this._shape},enable:function(t,e){if(!t)throw new Error("Error: Please pass a shape as a parameter. Possible shapes are: ".concat(this.getShapes().join(",")));this.disable(),this[t].enable(e)},disable:function(){var t=this;this.shapes.forEach((function(e){t[e].disable()}))},addControls:function(){var t=this;this.shapes.forEach((function(e){t[e].addButton()}))},getActiveShape:function(){var t,e=this;return this.shapes.forEach((function(i){e[i]._enabled&&(t=i)})),t},_setGlobalDrawMode:function(){"Cut"===this._shape?this._fireGlobalCutModeToggled():this._fireGlobalDrawModeToggled();var t=L.PM.Utils.findLayers(this._map);this._enabled?t.forEach((function(t){L.PM.Utils.disablePopup(t)})):t.forEach((function(t){L.PM.Utils.enablePopup(t)}))},createNewDrawInstance:function(t,e){var i=this._getShapeFromBtnName(e);if(this[t])throw new TypeError("Draw Type already exists");if(!L.PM.Draw[i])throw new TypeError("There is no class L.PM.Draw.".concat(i));return this[t]=new L.PM.Draw[i](this._map),this[t].toolbarButtonName=t,this[t]._shape=t,this.shapes.push(t),this[e]&&this[t].setOptions(this[e].options),this[t].setOptions(this[t].options),this[t]},_getShapeFromBtnName:function(t){var e={drawMarker:"Marker",drawCircle:"Circle",drawPolygon:"Polygon",drawPolyline:"Line",drawRectangle:"Rectangle",drawCircleMarker:"CircleMarker",editMode:"Edit",dragMode:"Drag",cutPolygon:"Cut",removalMode:"Removal",rotateMode:"Rotate"};return e[t]?e[t]:this[t]?this[t]._shape:t},_finishLayer:function(t){t.pm&&(t.pm.setOptions(this.options),t.pm._shape=this._shape,t.pm._map=this._map),this._addDrawnLayerProp(t)},_addDrawnLayerProp:function(t){t._drawnByGeoman=!0},_setPane:function(t,e){"layerPane"===e?t.options.pane=this._map.pm.globalOptions.panes&&this._map.pm.globalOptions.panes.layerPane||"overlayPane":"vertexPane"===e?t.options.pane=this._map.pm.globalOptions.panes&&this._map.pm.globalOptions.panes.vertexPane||"markerPane":"markerPane"===e&&(t.options.pane=this._map.pm.globalOptions.panes&&this._map.pm.globalOptions.panes.markerPane||"markerPane")},_isFirstLayer:function(){return 0===(this._map||this._layer._map).pm.getGeomanLayers().length}});at.Marker=at.extend({initialize:function(t){this._map=t,this._shape="Marker",this.toolbarButtonName="drawMarker"},enable:function(t){var e=this;L.Util.setOptions(this,t),this._enabled=!0,this._map.on("click",this._createMarker,this),this._map.pm.Toolbar.toggleButton(this.toolbarButtonName,!0),this._hintMarker=L.marker([0,0],this.options.markerStyle),this._setPane(this._hintMarker,"markerPane"),this._hintMarker._pmTempLayer=!0,this._hintMarker.addTo(this._map),this.options.tooltips&&this._hintMarker.bindTooltip(I("tooltips.placeMarker"),{permanent:!0,offset:L.point(0,10),direction:"bottom",opacity:.8}).openTooltip(),this._layer=this._hintMarker,this._map.on("mousemove",this._syncHintMarker,this),this.options.markerEditable&&this._map.eachLayer((function(t){e.isRelevantMarker(t)&&t.pm.enable()})),this._fireDrawStart(),this._setGlobalDrawMode()},disable:function(){var t=this;this._enabled&&(this._enabled=!1,this._map.off("click",this._createMarker,this),this._hintMarker.remove(),this._map.off("mousemove",this._syncHintMarker,this),this._map.eachLayer((function(e){t.isRelevantMarker(e)&&e.pm.disable()})),this._map.pm.Toolbar.toggleButton(this.toolbarButtonName,!1),this.options.snappable&&this._cleanupSnapping(),this._fireDrawEnd(),this._setGlobalDrawMode())},enabled:function(){return this._enabled},toggle:function(t){this.enabled()?this.disable():this.enable(t)},isRelevantMarker:function(t){return t instanceof L.Marker&&t.pm&&!t._pmTempLayer},_syncHintMarker:function(t){if(this._hintMarker.setLatLng(t.latlng),this.options.snappable){var e=t;e.target=this._hintMarker,this._handleSnapping(e)}this._fireChange(this._hintMarker.getLatLng(),"Draw")},_createMarker:function(t){if(t.latlng&&(!this.options.requireSnapToFinish||this._hintMarker._snapped||this._isFirstLayer())){this._hintMarker._snapped||this._hintMarker.setLatLng(t.latlng);var e=this._hintMarker.getLatLng(),i=new L.Marker(e,this.options.markerStyle);this._setPane(i,"markerPane"),this._finishLayer(i),i.pm||(i.options.draggable=!1),i.addTo(this._map.pm._getContainingLayer()),i.pm&&this.options.markerEditable?i.pm.enable():i.dragging&&i.dragging.disable(),this._fireCreate(i),this._cleanupSnapping(),this.options.continueDrawing||this.disable()}}});var ot=6371008.8,st={centimeters:637100880,centimetres:637100880,degrees:57.22891354143274,feet:20902260.511392,inches:39.37*ot,kilometers:6371.0088,kilometres:6371.0088,meters:ot,metres:ot,miles:3958.761333810546,millimeters:6371008800,millimetres:6371008800,nauticalmiles:ot/1852,radians:1,yards:6967335.223679999};function lt(t,e,i){void 0===i&&(i={});var n={type:"Feature"};return(0===i.id||i.id)&&(n.id=i.id),i.bbox&&(n.bbox=i.bbox),n.properties=e||{},n.geometry=t,n}function ht(t,e,i){if(void 0===i&&(i={}),!t)throw new Error("coordinates is required");if(!Array.isArray(t))throw new Error("coordinates must be an Array");if(t.length<2)throw new Error("coordinates must be at least 2 numbers long");if(!_t(t[0])||!_t(t[1]))throw new Error("coordinates must contain numbers");return lt({type:"Point",coordinates:t},e,i)}function ut(t,e,i){if(void 0===i&&(i={}),t.length<2)throw new Error("coordinates must be an array of two or more positions");return lt({type:"LineString",coordinates:t},e,i)}function ct(t,e){void 0===e&&(e={});var i={type:"FeatureCollection"};return e.id&&(i.id=e.id),e.bbox&&(i.bbox=e.bbox),i.features=t,i}function pt(t,e){void 0===e&&(e="kilometers");var i=st[e];if(!i)throw new Error(e+" units is invalid");return t*i}function dt(t,e){void 0===e&&(e="kilometers");var i=st[e];if(!i)throw new Error(e+" units is invalid");return t/i}function ft(t){return 180*(t%(2*Math.PI))/Math.PI}function gt(t){return t%360*Math.PI/180}function _t(t){return!isNaN(t)&&null!==t&&!Array.isArray(t)}function yt(t){var e,i,n={type:"FeatureCollection",features:[]};if("LineString"===(i="Feature"===t.type?t.geometry:t).type)e=[i.coordinates];else if("MultiLineString"===i.type)e=i.coordinates;else if("MultiPolygon"===i.type)e=[].concat.apply([],i.coordinates);else{if("Polygon"!==i.type)throw new Error("Input must be a LineString, MultiLineString, Polygon, or MultiPolygon Feature or Geometry");e=i.coordinates}return e.forEach((function(t){e.forEach((function(e){for(var i=0;i=0&&h<=1&&(p.onLine1=!0),u>=0&&u<=1&&(p.onLine2=!0),!(!p.onLine1||!p.onLine2)&&[p.x,p.y])}function vt(t,e){var i=Object.keys(t);if(Object.getOwnPropertySymbols){var n=Object.getOwnPropertySymbols(t);e&&(n=n.filter((function(e){return Object.getOwnPropertyDescriptor(t,e).enumerable}))),i.push.apply(i,n)}return i}function Lt(t){for(var e=1;e=2&&!Array.isArray(t[0])&&!Array.isArray(t[1]))return t;throw new Error("coord must be GeoJSON Point or an Array of numbers")}function Ct(t){if(Array.isArray(t))return t;if("Feature"===t.type){if(null!==t.geometry)return t.geometry.coordinates}else if(t.coordinates)return t.coordinates;throw new Error("coords must be GeoJSON Feature, Geometry Object or an Array")}function Pt(t){return"Feature"===t.type?t.geometry:t}function Et(t,e){return"FeatureCollection"===t.type?"FeatureCollection":"GeometryCollection"===t.type?"GeometryCollection":"Feature"===t.type&&null!==t.geometry?t.geometry.type:t.type}function St(t,e,i){if(null!==t)for(var n,r,a,o,s,l,h,u,c=0,p=0,d=t.type,f="FeatureCollection"===d,g="Feature"===d,_=f?t.features.length:1,y=0;y<_;y++){s=(u=!!(h=f?t.features[y].geometry:g?t.geometry:t)&&"GeometryCollection"===h.type)?h.geometries.length:1;for(var m=0;m0){var e=t[t.length-1];this._hintline.setLatLngs([e,this._hintMarker.getLatLng()])}},_syncHintMarker:function(t){if(this._hintMarker.setLatLng(t.latlng),this.options.snappable){var e=t;e.target=this._hintMarker,this._handleSnapping(e)}this.options.allowSelfIntersection||this._handleSelfIntersection(!0,t.latlng);var i=this._layer._defaultShape().slice();i.push(this._hintMarker.getLatLng()),this._change(i)},hasSelfIntersection:function(){return yt(this._layer.toGeoJSON(15)).features.length>0},_handleSelfIntersection:function(t,e){var i=L.polyline(this._layer.getLatLngs());t&&(e||(e=this._hintMarker.getLatLng()),i.addLatLng(e));var n=yt(i.toGeoJSON(15));this._doesSelfIntersect=n.features.length>0,this._doesSelfIntersect?this._hintline.setStyle({color:"#f00000ff"}):this._hintline.isEmpty()||this._hintline.setStyle(this.options.hintlineStyle)},_createVertex:function(t){if(this.options.allowSelfIntersection||(this._handleSelfIntersection(!0,t.latlng),!this._doesSelfIntersect)){this._hintMarker._snapped||this._hintMarker.setLatLng(t.latlng);var e=this._hintMarker.getLatLng();if(e.equals(this._layer.getLatLngs()[0]))this._finishShape(t);else{this._layer._latlngInfo=this._layer._latlngInfo||[],this._layer._latlngInfo.push({latlng:e,snapInfo:this._hintMarker._snapInfo}),this._layer.addLatLng(e);var i=this._createMarker(e);this._setTooltipText(),this._hintline.setLatLngs([e,e]),this._fireVertexAdded(i,undefined,e,"Draw"),this._change(this._layer.getLatLngs()),"snap"===this.options.finishOn&&this._hintMarker._snapped&&this._finishShape(t)}}},_removeLastVertex:function(){var t=this._layer.getLatLngs(),e=t.pop();if(t.length<1)this.disable();else{var i=this._layerGroup.getLayers().filter((function(t){return t instanceof L.Marker})).filter((function(t){return!L.DomUtil.hasClass(t._icon,"cursor-marker")})).find((function(t){return t.getLatLng()===e})),n=this._layerGroup.getLayers().filter((function(t){return t instanceof L.Marker})),r=L.PM.Utils.findDeepMarkerIndex(n,i).indexPath;this._layerGroup.removeLayer(i),this._layer.setLatLngs(t),this._syncHintLine(),this._setTooltipText(),this._fireVertexRemoved(i,r,"Draw"),this._change(this._layer.getLatLngs())}},_finishShape:function(){if((this.options.allowSelfIntersection||(this._handleSelfIntersection(!1),!this._doesSelfIntersect))&&(!this.options.requireSnapToFinish||this._hintMarker._snapped||this._isFirstLayer())){var t=this._layer.getLatLngs();if(!(t.length<=1)){var e=L.polyline(t,this.options.pathOptions);this._setPane(e,"layerPane"),this._finishLayer(e),e.addTo(this._map.pm._getContainingLayer()),this._fireCreate(e),this.options.snappable&&this._cleanupSnapping(),this.disable(),this.options.continueDrawing&&this.enable()}}},_createMarker:function(t){var e=new L.Marker(t,{draggable:!1,icon:L.divIcon({className:"marker-icon"})});return this._setPane(e,"vertexPane"),e._pmTempLayer=!0,this._layerGroup.addLayer(e),e.on("click",this._finishShape,this),e},_setTooltipText:function(){var t="";t=I(this._layer.getLatLngs().flat().length<=1?"tooltips.continueLine":"tooltips.finishLine"),this._hintMarker.setTooltipContent(t)},_change:function(t){this._fireChange(t,"Draw")}}),at.Polygon=at.Line.extend({initialize:function(t){this._map=t,this._shape="Polygon",this.toolbarButtonName="drawPolygon"},_createMarker:function(t){var e=new L.Marker(t,{draggable:!1,icon:L.divIcon({className:"marker-icon"})});return this._setPane(e,"vertexPane"),e._pmTempLayer=!0,this._layerGroup.addLayer(e),1===this._layer.getLatLngs().flat().length?(e.on("click",this._finishShape,this),this._tempSnapLayerIndex=this._otherSnapLayers.push(e)-1,this.options.snappable&&this._cleanupSnapping()):e.on("click",(function(){return 1})),e},_setTooltipText:function(){var t="";t=I(this._layer.getLatLngs().flat().length<=2?"tooltips.continueLine":"tooltips.finishPoly"),this._hintMarker.setTooltipContent(t)},_finishShape:function(){if((this.options.allowSelfIntersection||(this._handleSelfIntersection(!0,this._layer.getLatLngs()[0]),!this._doesSelfIntersect))&&(!this.options.requireSnapToFinish||this._hintMarker._snapped||this._isFirstLayer())){var t=this._layer.getLatLngs();if(!(t.length<=2)){var e=L.polygon(t,this.options.pathOptions);this._setPane(e,"layerPane"),this._finishLayer(e),e.addTo(this._map.pm._getContainingLayer()),this._fireCreate(e),this._cleanupSnapping(),this._otherSnapLayers.splice(this._tempSnapLayerIndex,1),delete this._tempSnapLayerIndex,this.disable(),this.options.continueDrawing&&this.enable()}}}}),at.Rectangle=at.extend({initialize:function(t){this._map=t,this._shape="Rectangle",this.toolbarButtonName="drawRectangle"},enable:function(t){if(L.Util.setOptions(this,t),this._enabled=!0,this._layerGroup=new L.LayerGroup,this._layerGroup._pmTempLayer=!0,this._layerGroup.addTo(this._map),this._layer=L.rectangle([[0,0],[0,0]],this.options.pathOptions),this._setPane(this._layer,"layerPane"),this._layer._pmTempLayer=!0,this._startMarker=L.marker([0,0],{icon:L.divIcon({className:"marker-icon rect-start-marker"}),draggable:!1,zIndexOffset:-100,opacity:this.options.cursorMarker?1:0}),this._setPane(this._startMarker,"vertexPane"),this._startMarker._pmTempLayer=!0,this._layerGroup.addLayer(this._startMarker),this._hintMarker=L.marker([0,0],{zIndexOffset:150,icon:L.divIcon({className:"marker-icon cursor-marker"})}),this._setPane(this._hintMarker,"vertexPane"),this._hintMarker._pmTempLayer=!0,this._layerGroup.addLayer(this._hintMarker),this.options.tooltips&&this._hintMarker.bindTooltip(I("tooltips.firstVertex"),{permanent:!0,offset:L.point(0,10),direction:"bottom",opacity:.8}).openTooltip(),this.options.cursorMarker){L.DomUtil.addClass(this._hintMarker._icon,"visible"),this._styleMarkers=[];for(var e=0;e<2;e+=1){var i=L.marker([0,0],{icon:L.divIcon({className:"marker-icon rect-style-marker"}),draggable:!1,zIndexOffset:100});this._setPane(i,"vertexPane"),i._pmTempLayer=!0,this._layerGroup.addLayer(i),this._styleMarkers.push(i)}}this._map._container.style.cursor="crosshair",this._map.on("click",this._placeStartingMarkers,this),this._map.on("mousemove",this._syncHintMarker,this),this._map.pm.Toolbar.toggleButton(this.toolbarButtonName,!0),this._otherSnapLayers=[],this._fireDrawStart(),this._setGlobalDrawMode()},disable:function(){this._enabled&&(this._enabled=!1,this._map._container.style.cursor="",this._map.off("click",this._finishShape,this),this._map.off("click",this._placeStartingMarkers,this),this._map.off("mousemove",this._syncHintMarker,this),this._map.removeLayer(this._layerGroup),this._map.pm.Toolbar.toggleButton(this.toolbarButtonName,!1),this.options.snappable&&this._cleanupSnapping(),this._fireDrawEnd(),this._setGlobalDrawMode())},enabled:function(){return this._enabled},toggle:function(t){this.enabled()?this.disable():this.enable(t)},_placeStartingMarkers:function(t){this._hintMarker._snapped||this._hintMarker.setLatLng(t.latlng);var e=this._hintMarker.getLatLng();L.DomUtil.addClass(this._startMarker._icon,"visible"),this._startMarker.setLatLng(e),this.options.cursorMarker&&this._styleMarkers&&this._styleMarkers.forEach((function(t){L.DomUtil.addClass(t._icon,"visible"),t.setLatLng(e)})),this._map.off("click",this._placeStartingMarkers,this),this._map.on("click",this._finishShape,this),this._hintMarker.setTooltipContent(I("tooltips.finishRect")),this._setRectangleOrigin()},_setRectangleOrigin:function(){var t=this._startMarker.getLatLng();t&&(this._layerGroup.addLayer(this._layer),this._layer.setLatLngs([t,t]),this._hintMarker.on("move",this._syncRectangleSize,this))},_syncHintMarker:function(t){if(this._hintMarker.setLatLng(t.latlng),this.options.snappable){var e=t;e.target=this._hintMarker,this._handleSnapping(e)}var i=this._layerGroup&&this._layerGroup.hasLayer(this._layer)?this._layer.getLatLngs():[this._hintMarker.getLatLng()];this._fireChange(i,"Draw")},_syncRectangleSize:function(){var t=this,e=V(this._startMarker.getLatLng(),this._map),i=V(this._hintMarker.getLatLng(),this._map),n=L.PM.Utils._getRotatedRectangle(e,i,this.options.rectangleAngle||0,this._map);if(this._layer.setLatLngs(n),this.options.cursorMarker&&this._styleMarkers){var r=[];n.forEach((function(t){t.equals(e,1e-8)||t.equals(i,1e-8)||r.push(t)})),r.forEach((function(e,i){try{t._styleMarkers[i].setLatLng(e)}catch(n){}}))}},_findCorners:function(){var t=this._layer.getBounds();return[t.getNorthWest(),t.getNorthEast(),t.getSouthEast(),t.getSouthWest()]},_finishShape:function(t){this._hintMarker._snapped||this._hintMarker.setLatLng(t.latlng);var e=this._hintMarker.getLatLng(),i=this._startMarker.getLatLng();if(!this.options.requireSnapToFinish||this._hintMarker._snapped||this._isFirstLayer()){var n=L.rectangle([i,e],this.options.pathOptions);if(this.options.rectangleAngle){var r=L.PM.Utils._getRotatedRectangle(i,e,this.options.rectangleAngle||0,this._map);n.setLatLngs(r),n.pm&&n.pm._setAngle(this.options.rectangleAngle||0)}this._setPane(n,"layerPane"),this._finishLayer(n),n.addTo(this._map.pm._getContainingLayer()),this._fireCreate(n),this.disable(),this.options.continueDrawing&&this.enable()}}}),at.Circle=at.extend({initialize:function(t){this._map=t,this._shape="Circle",this.toolbarButtonName="drawCircle"},enable:function(t){L.Util.setOptions(this,t),this.options.radius=0,this._enabled=!0,this._layerGroup=new L.LayerGroup,this._layerGroup._pmTempLayer=!0,this._layerGroup.addTo(this._map),this._layer=L.circle([0,0],Lt(Lt({},this.options.templineStyle),{},{radius:0})),this._setPane(this._layer,"layerPane"),this._layer._pmTempLayer=!0,this._centerMarker=L.marker([0,0],{icon:L.divIcon({className:"marker-icon"}),draggable:!1,zIndexOffset:100}),this._setPane(this._centerMarker,"vertexPane"),this._centerMarker._pmTempLayer=!0,this._hintMarker=L.marker([0,0],{zIndexOffset:110,icon:L.divIcon({className:"marker-icon cursor-marker"})}),this._setPane(this._hintMarker,"vertexPane"),this._hintMarker._pmTempLayer=!0,this._layerGroup.addLayer(this._hintMarker),this.options.cursorMarker&&L.DomUtil.addClass(this._hintMarker._icon,"visible"),this.options.tooltips&&this._hintMarker.bindTooltip(I("tooltips.startCircle"),{permanent:!0,offset:L.point(0,10),direction:"bottom",opacity:.8}).openTooltip(),this._hintline=L.polyline([],this.options.hintlineStyle),this._setPane(this._hintline,"layerPane"),this._hintline._pmTempLayer=!0,this._layerGroup.addLayer(this._hintline),this._map._container.style.cursor="crosshair",this._map.on("click",this._placeCenterMarker,this),this._map.on("mousemove",this._syncHintMarker,this),this._map.pm.Toolbar.toggleButton(this.toolbarButtonName,!0),this._otherSnapLayers=[],this._fireDrawStart(),this._setGlobalDrawMode()},disable:function(){this._enabled&&(this._enabled=!1,this._map._container.style.cursor="",this._map.off("click",this._finishShape,this),this._map.off("click",this._placeCenterMarker,this),this._map.off("mousemove",this._syncHintMarker,this),this._map.removeLayer(this._layerGroup),this._map.pm.Toolbar.toggleButton(this.toolbarButtonName,!1),this.options.snappable&&this._cleanupSnapping(),this._fireDrawEnd(),this._setGlobalDrawMode())},enabled:function(){return this._enabled},toggle:function(t){this.enabled()?this.disable():this.enable(t)},_syncHintLine:function(){var t=this._centerMarker.getLatLng(),e=this._getNewDestinationOfHintMarker();this._hintline.setLatLngs([t,e])},_syncCircleRadius:function(){var t,e=this._centerMarker.getLatLng(),i=this._hintMarker.getLatLng();t=this._map.options.crs===L.CRS.Simple?this._map.distance(e,i):e.distanceTo(i),this.options.minRadiusCircle&&tthis.options.maxRadiusCircle?this._layer.setRadius(this.options.maxRadiusCircle):this._layer.setRadius(t)},_syncHintMarker:function(t){if(this._hintMarker.setLatLng(t.latlng),this._hintMarker.setLatLng(this._getNewDestinationOfHintMarker()),this.options.snappable){var e=t;e.target=this._hintMarker,this._handleSnapping(e)}this._handleHintMarkerSnapping();var i=this._layerGroup&&this._layerGroup.hasLayer(this._centerMarker)?this._centerMarker.getLatLng():this._hintMarker.getLatLng();this._fireChange(i,"Draw")},_placeCenterMarker:function(t){this._layerGroup.addLayer(this._layer),this._layerGroup.addLayer(this._centerMarker),this._hintMarker._snapped||this._hintMarker.setLatLng(t.latlng);var e=this._hintMarker.getLatLng();this._layerGroup.addLayer(this._layer),this._centerMarker.setLatLng(e),this._map.off("click",this._placeCenterMarker,this),this._map.on("click",this._finishShape,this),this._placeCircleCenter()},_placeCircleCenter:function(){var t=this._centerMarker.getLatLng();t&&(this._layer.setLatLng(t),this._hintMarker.on("move",this._syncHintLine,this),this._hintMarker.on("move",this._syncCircleRadius,this),this._hintMarker.setTooltipContent(I("tooltips.finishCircle")),this._fireCenterPlaced(),this._fireChange(this._layer.getLatLng(),"Draw"))},_finishShape:function(t){if(!this.options.requireSnapToFinish||this._hintMarker._snapped||this._isFirstLayer()){this._hintMarker._snapped||this._hintMarker.setLatLng(t.latlng);var e,i=this._centerMarker.getLatLng(),n=this._hintMarker.getLatLng();e=this._map.options.crs===L.CRS.Simple?this._map.distance(i,n):i.distanceTo(n),this.options.minRadiusCircle&&ethis.options.maxRadiusCircle&&(e=this.options.maxRadiusCircle);var r=Lt(Lt({},this.options.pathOptions),{},{radius:e}),a=L.circle(i,r);this._setPane(a,"layerPane"),this._finishLayer(a),a.addTo(this._map.pm._getContainingLayer()),a.pm&&a.pm._updateHiddenPolyCircle(),this._fireCreate(a),this.disable(),this.options.continueDrawing&&this.enable()}},_getNewDestinationOfHintMarker:function(){var t=this._centerMarker.getLatLng(),e=this._hintMarker.getLatLng(),i=t.distanceTo(e);return t.equals(L.latLng([0,0]))||(this.options.minRadiusCircle&&ithis.options.maxRadiusCircle&&(e=z(this._map,t,e,this.options.maxRadiusCircle))),e},_handleHintMarkerSnapping:function(){if(this._hintMarker._snapped){var t=this._centerMarker.getLatLng(),e=this._hintMarker.getLatLng(),i=t.distanceTo(e);t.equals(L.latLng([0,0]))||(this.options.minRadiusCircle&&ithis.options.maxRadiusCircle)&&this._hintMarker.setLatLng(this._hintMarker._orgLatLng)}this._hintMarker.setLatLng(this._getNewDestinationOfHintMarker())}}),at.CircleMarker=at.Marker.extend({initialize:function(t){this._map=t,this._shape="CircleMarker",this.toolbarButtonName="drawCircleMarker",this._layerIsDragging=!1},enable:function(t){var e=this;if(L.Util.setOptions(this,t),this._enabled=!0,this._map.pm.Toolbar.toggleButton(this.toolbarButtonName,!0),this.options.editable){var i={};L.setOptions(i,this.options.templineStyle),i.radius=0,this._layerGroup=new L.LayerGroup,this._layerGroup._pmTempLayer=!0,this._layerGroup.addTo(this._map),this._layer=L.circleMarker([0,0],i),this._setPane(this._layer,"layerPane"),this._layer._pmTempLayer=!0,this._centerMarker=L.marker([0,0],{icon:L.divIcon({className:"marker-icon"}),draggable:!1,zIndexOffset:100}),this._setPane(this._centerMarker,"vertexPane"),this._centerMarker._pmTempLayer=!0,this._hintMarker=L.marker([0,0],{zIndexOffset:110,icon:L.divIcon({className:"marker-icon cursor-marker"})}),this._setPane(this._hintMarker,"vertexPane"),this._hintMarker._pmTempLayer=!0,this._layerGroup.addLayer(this._hintMarker),this.options.cursorMarker&&L.DomUtil.addClass(this._hintMarker._icon,"visible"),this.options.tooltips&&this._hintMarker.bindTooltip(I("tooltips.startCircle"),{permanent:!0,offset:L.point(0,10),direction:"bottom",opacity:.8}).openTooltip(),this._hintline=L.polyline([],this.options.hintlineStyle),this._setPane(this._hintline,"layerPane"),this._hintline._pmTempLayer=!0,this._layerGroup.addLayer(this._hintline),this._map.on("click",this._placeCenterMarker,this),this._map._container.style.cursor="crosshair"}else this._map.on("click",this._createMarker,this),this._hintMarker=L.circleMarker([0,0],this.options.templineStyle),this._setPane(this._hintMarker,"layerPane"),this._hintMarker._pmTempLayer=!0,this._hintMarker.addTo(this._map),this._layer=this._hintMarker,this.options.tooltips&&this._hintMarker.bindTooltip(I("tooltips.placeCircleMarker"),{permanent:!0,offset:L.point(0,10),direction:"bottom",opacity:.8}).openTooltip();this._map.on("mousemove",this._syncHintMarker,this),!this.options.editable&&this.options.markerEditable&&this._map.eachLayer((function(t){e.isRelevantMarker(t)&&t.pm.enable()})),this._layer.bringToBack(),this._fireDrawStart(),this._setGlobalDrawMode()},disable:function(){var t=this;this._enabled&&(this._enabled=!1,this.options.editable?(this._map._container.style.cursor="",this._map.off("click",this._finishShape,this),this._map.off("click",this._placeCenterMarker,this),this._map.removeLayer(this._layerGroup)):(this._map.off("click",this._createMarker,this),this._map.eachLayer((function(e){t.isRelevantMarker(e)&&e.pm.disable()})),this._hintMarker.remove()),this._map.off("mousemove",this._syncHintMarker,this),this._map.pm.Toolbar.toggleButton(this.toolbarButtonName,!1),this.options.snappable&&this._cleanupSnapping(),this._fireDrawEnd(),this._setGlobalDrawMode())},_placeCenterMarker:function(t){this._layerGroup.addLayer(this._layer),this._layerGroup.addLayer(this._centerMarker),this._hintMarker._snapped||this._hintMarker.setLatLng(t.latlng);var e=this._hintMarker.getLatLng();this._layerGroup.addLayer(this._layer),this._centerMarker.setLatLng(e),this._map.off("click",this._placeCenterMarker,this),this._map.on("click",this._finishShape,this),this._placeCircleCenter()},_placeCircleCenter:function(){var t=this._centerMarker.getLatLng();t&&(this._layer.setLatLng(t),this._hintMarker.on("move",this._syncHintLine,this),this._hintMarker.on("move",this._syncCircleRadius,this),this._hintMarker.setTooltipContent(I("tooltips.finishCircle")),this._fireCenterPlaced(),this._fireChange(this._layer.getLatLng(),"Draw"))},_syncHintLine:function(){var t=this._centerMarker.getLatLng(),e=this._getNewDestinationOfHintMarker();this._hintline.setLatLngs([t,e])},_syncCircleRadius:function(){var t=this._centerMarker.getLatLng(),e=this._hintMarker.getLatLng(),i=this._map.project(t).distanceTo(this._map.project(e));this.options.minRadiusCircleMarker&&ithis.options.maxRadiusCircleMarker?this._layer.setRadius(this.options.maxRadiusCircleMarker):this._layer.setRadius(i)},_syncHintMarker:function(t){if(this._hintMarker.setLatLng(t.latlng),this._hintMarker.setLatLng(this._getNewDestinationOfHintMarker()),this.options.snappable){var e=t;e.target=this._hintMarker,this._handleSnapping(e)}this._handleHintMarkerSnapping();var i=this._layerGroup&&this._layerGroup.hasLayer(this._centerMarker)?this._centerMarker.getLatLng():this._hintMarker.getLatLng();this._fireChange(i,"Draw")},isRelevantMarker:function(t){return t instanceof L.CircleMarker&&!(t instanceof L.Circle)&&t.pm&&!t._pmTempLayer},_createMarker:function(t){if((!this.options.requireSnapToFinish||this._hintMarker._snapped||this._isFirstLayer())&&t.latlng&&!this._layerIsDragging){this._hintMarker._snapped||this._hintMarker.setLatLng(t.latlng);var e=this._hintMarker.getLatLng(),i=L.circleMarker(e,this.options.pathOptions);this._setPane(i,"layerPane"),this._finishLayer(i),i.addTo(this._map.pm._getContainingLayer()),i.pm&&this.options.markerEditable&&i.pm.enable(),this._fireCreate(i),this._cleanupSnapping(),this.options.continueDrawing||this.disable()}},_finishShape:function(t){if(!this.options.requireSnapToFinish||this._hintMarker._snapped||this._isFirstLayer()){this._hintMarker._snapped||this._hintMarker.setLatLng(t.latlng);var e=this._centerMarker.getLatLng(),i=this._hintMarker.getLatLng(),n=this._map.project(e).distanceTo(this._map.project(i));this.options.editable&&(this.options.minRadiusCircleMarker&&nthis.options.maxRadiusCircleMarker&&(n=this.options.maxRadiusCircleMarker));var r=Mt(Mt({},this.options.pathOptions),{},{radius:n}),a=L.circleMarker(e,r);this._setPane(a,"layerPane"),this._finishLayer(a),a.addTo(this._map.pm._getContainingLayer()),a.pm&&a.pm._updateHiddenPolyCircle(),this._fireCreate(a),this.disable(),this.options.continueDrawing&&this.enable()}},_getNewDestinationOfHintMarker:function(){var t=this._hintMarker.getLatLng();if(this.options.editable){var e=this._centerMarker.getLatLng();if(e.equals(L.latLng([0,0])))return t;var i=this._map.project(e).distanceTo(this._map.project(t));this.options.minRadiusCircleMarker&&ithis.options.maxRadiusCircleMarker&&(t=z(this._map,e,t,this._pxRadiusToMeter(this.options.maxRadiusCircleMarker)))}return t},_handleHintMarkerSnapping:function(){if(this.options.editable){if(this._hintMarker._snapped){var t=this._centerMarker.getLatLng(),e=this._hintMarker.getLatLng(),i=this._map.project(t).distanceTo(this._map.project(e));(this.options.minRadiusCircleMarker&&ithis.options.maxRadiusCircleMarker)&&this._hintMarker.setLatLng(this._hintMarker._orgLatLng)}this._hintMarker.setLatLng(this._getNewDestinationOfHintMarker())}},_pxRadiusToMeter:function(t){var e=this._centerMarker.getLatLng(),i=this._map.project(e),n=L.point(i.x+t,i.y);return this._map.unproject(n).distanceTo(e)}});const Bt=function(t){if(!t)throw new Error("geojson is required");var e=[];return Rt(t,(function(t){!function(t,e){var i=[],n=t.geometry;if(null!==n){switch(n.type){case"Polygon":i=Ct(n);break;case"LineString":i=[Ct(n)]}i.forEach((function(i){var n=function(t,e){var i=[];return t.reduce((function(t,n){var r,a,o,s,l,h,u=ut([t,n],e);return u.bbox=(a=n,o=(r=t)[0],s=r[1],l=a[0],h=a[1],[ol?o:l,s>h?s:h]),i.push(u),n})),i}(i,t.properties);n.forEach((function(t){t.id=e.length,e.push(t)}))}))}}(t,e)})),ct(e)};var Tt=i(1787);function It(t,e){var i=Ct(t),n=Ct(e);if(2!==i.length)throw new Error(" line1 must only contain 2 coordinates");if(2!==n.length)throw new Error(" line2 must only contain 2 coordinates");var r=i[0][0],a=i[0][1],o=i[1][0],s=i[1][1],l=n[0][0],h=n[0][1],u=n[1][0],c=n[1][1],p=(c-h)*(o-r)-(u-l)*(s-a),d=(u-l)*(a-h)-(c-h)*(r-l),f=(o-r)*(a-h)-(s-a)*(r-l);if(0===p)return null;var g=d/p,_=f/p;return g>=0&&g<=1&&_>=0&&_<=1?ht([r+g*(o-r),a+g*(s-a)]):null}const jt=function(t,e){var i={},n=[];if("LineString"===t.type&&(t=lt(t)),"LineString"===e.type&&(e=lt(e)),"Feature"===t.type&&"Feature"===e.type&&null!==t.geometry&&null!==e.geometry&&"LineString"===t.geometry.type&&"LineString"===e.geometry.type&&2===t.geometry.coordinates.length&&2===e.geometry.coordinates.length){var r=It(t,e);return r&&n.push(r),ct(n)}var a=Tt();return a.load(Bt(e)),Ot(Bt(t),(function(t){Ot(a.search(t),(function(e){var r=It(t,e);if(r){var a=Ct(r).join(",");i[a]||(i[a]=!0,n.push(r))}}))})),ct(n)};const Gt=function(t,e,i){void 0===i&&(i={});var n=wt(t),r=wt(e),a=gt(r[1]-n[1]),o=gt(r[0]-n[0]),s=gt(n[1]),l=gt(r[1]),h=Math.pow(Math.sin(a/2),2)+Math.pow(Math.sin(o/2),2)*Math.cos(s)*Math.cos(l);return pt(2*Math.atan2(Math.sqrt(h),Math.sqrt(1-h)),i.units)};const At=function(t){var e=t[0],i=t[1],n=t[2],r=t[3];if(Gt(t.slice(0,2),[n,i])>=Gt(t.slice(0,2),[e,r])){var a=(i+r)/2;return[e,a-(n-e)/2,n,a+(n-e)/2]}var o=(e+n)/2;return[o-(r-i)/2,i,o+(r-i)/2,r]};function Nt(t){var e=[Infinity,Infinity,-Infinity,-Infinity];return St(t,(function(t){e[0]>t[0]&&(e[0]=t[0]),e[1]>t[1]&&(e[1]=t[1]),e[2] is required");if("number"!=typeof i)throw new Error(" must be a number");if("number"!=typeof n)throw new Error(" must be a number");!1!==r&&r!==undefined||(t=JSON.parse(JSON.stringify(t)));var a=Math.pow(10,i);return St(t,(function(t){!function(t,e,i){t.length>i&&t.splice(i,t.length);for(var n=0;n0&&((g=f.features[0]).properties.dist=Gt(e,g,i),g.properties.location=r+Gt(s,g,i)),s.properties.dist1&&i.push(ut(h)),ct(i)}function Jt(t,e){if(!e.features.length)throw new Error("lines must contain features");if(1===e.features.length)return e.features[0];var i,n=Infinity;return Ot(e,(function(e){var r=Kt(e,t).properties.dist;r=t[0]&&e[3]>=t[1]}(n,o))return!1;"Polygon"===a&&(s=[s]);for(var l=!1,h=0;ht[1]!=h>t[1]&&t[0]<(l-o)*(t[1]-s)/(h-s)+o&&(n=!n)}return n}function Wt(t,e,i,n,r){var a=i[0],o=i[1],s=t[0],l=t[1],h=e[0],u=e[1],c=h-s,p=u-l,d=(i[0]-s)*p-(i[1]-l)*c;if(null!==r){if(Math.abs(d)>r)return!1}else if(0!==d)return!1;return n?"start"===n?Math.abs(c)>=Math.abs(p)?c>0?s0?l=Math.abs(p)?c>0?s<=a&&a0?l<=o&&o=Math.abs(p)?c>0?s0?l=Math.abs(p)?c>0?s<=a&&a<=h:h<=a&&a<=s:p>0?l<=o&&o<=u:u<=o&&o<=l}const Qt=function(t,e,i){void 0===i&&(i={});for(var n=wt(t),r=Ct(e),a=0;ae[0])&&(!(t[2]e[1])&&!(t[3]1?e.forEach((function(t){n.push(function(t){return oe({type:"LineString",coordinates:t})}(t))})):n.push(t),n}function de(t){var e=[];return t.eachLayer((function(t){e.push(le(t.toGeoJSON(15)))})),function(t){return oe({type:"MultiLineString",coordinates:t})}(e)}function fe(t,e){return function(t){if(Array.isArray(t))return t}(t)||function(t,e){var i=null==t?null:"undefined"!=typeof Symbol&&t[Symbol.iterator]||t["@@iterator"];if(null==i)return;var n,r,a=[],o=!0,s=!1;try{for(i=i.call(t);!(o=(n=i.next()).done)&&(a.push(n.value),!e||a.length!==e);o=!0);}catch(l){s=!0,r=l}finally{try{o||null==i["return"]||i["return"]()}finally{if(s)throw r}}return a}(t,e)||function(t,e){if(!t)return;if("string"==typeof t)return ge(t,e);var i=Object.prototype.toString.call(t).slice(8,-1);"Object"===i&&t.constructor&&(i=t.constructor.name);if("Map"===i||"Set"===i)return Array.from(t);if("Arguments"===i||/^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(i))return ge(t,e)}(t,e)||function(){throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.")}()}function ge(t,e){(null==e||e>t.length)&&(e=t.length);for(var i=0,n=new Array(e);i0)||e.options.layersToCut.indexOf(t)>-1})).filter((function(t){return!e._layerGroup.hasLayer(t)})).filter((function(e){try{var i=!!jt(t.toGeoJSON(15),e.toGeoJSON(15)).features.length>0;return i||e instanceof L.Polyline&&!(e instanceof L.Polygon)?i:(n=t.toGeoJSON(15),r=e.toGeoJSON(15),a=se(n),o=se(r),!(0===(s=ae().intersection(a.coordinates,o.coordinates)).length||!(1===s.length?he(s[0]):ue(s))))}catch(l){return e instanceof L.Polygon&&console.error("You can't cut polygons with self-intersections"),!1}var n,r,a,o,s})).forEach((function(i){var r;if(i instanceof L.Polygon){var a=(r=L.polygon(i.getLatLngs())).getLatLngs();n.forEach((function(t){if(t&&t.snapInfo){var i=t.latlng,n=e._calcClosestLayer(i,[r]);if(n&&n.segment&&n.distance1?R()(a,h):a).splice(u,0,i)}}}}))}else r=i;var o=e._cutLayer(t,r),s=L.geoJSON(o,i.options);if(1===s.getLayers().length){var l=s.getLayers();s=fe(l,1)[0]}e._setPane(s,"layerPane");var h=s.addTo(e._map.pm._getContainingLayer());if(h.pm.enable(i.pm.options),h.pm.disable(),i._pmTempLayer=!0,t._pmTempLayer=!0,i.remove(),i.removeFrom(e._map.pm._getContainingLayer()),t.remove(),t.removeFrom(e._map.pm._getContainingLayer()),h.getLayers&&0===h.getLayers().length&&e._map.pm.removeLayer({target:h}),h instanceof L.LayerGroup?(h.eachLayer((function(t){e._addDrawnLayerProp(t)})),e._addDrawnLayerProp(h)):e._addDrawnLayerProp(h),e.options.layersToCut&&L.Util.isArray(e.options.layersToCut)&&e.options.layersToCut.length>0){var u=e.options.layersToCut.indexOf(i);u>-1&&e.options.layersToCut.splice(u,1)}e._editedLayers.push({layer:h,originalLayer:i})}))},_cutLayer:function(t,e){var i,n,r,a,o,s,l=L.geoJSON();if(e instanceof L.Polygon)n=e.toGeoJSON(15),r=t.toGeoJSON(15),a=se(n),o=se(r),i=0===(s=ae().difference(a.coordinates,o.coordinates)).length?null:1===s.length?he(s[0]):ue(s);else{var h=pe(e);h.forEach((function(e){var i=Xt(e,t.toGeoJSON(15));(i&&i.features.length>0?L.geoJSON(i):L.geoJSON(e)).getLayers().forEach((function(e){te(t.toGeoJSON(15),e.toGeoJSON(15))||e.addTo(l)}))})),i=h.length>1?de(l):l.toGeoJSON(15)}return i},_change:L.Util.falseFn});const _e={enableLayerDrag:function(){if(this.options.draggable&&this._layer._map){this.disable(),this._layerDragEnabled=!0,this._map||(this._map=this._layer._map),(this._layer instanceof L.Marker||this._layer instanceof L.ImageOverlay)&&L.DomEvent.on(this._getDOMElem(),"dragstart",this._stopDOMImageDrag),this._layer.dragging&&this._layer.dragging.disable(),this._tempDragCoord=null,F(this._layer)instanceof L.Canvas?(this._layer.on("mouseout",this.removeDraggingClass,this),this._layer.on("mouseover",this.addDraggingClass,this)):this.addDraggingClass(),this._originalMapDragState=this._layer._map.dragging._enabled,this._safeToCacheDragState=!0;var t=this._getDOMElem();t&&(F(this._layer)instanceof L.Canvas?(this._layer.on("touchstart mousedown",this._dragMixinOnMouseDown,this),this._map.pm._addTouchEvents(t)):L.DomEvent.on(t,"touchstart mousedown",this._simulateMouseDownEvent,this)),this._fireDragEnable()}},disableLayerDrag:function(){this._layerDragEnabled=!1,F(this._layer)instanceof L.Canvas?(this._layer.off("mouseout",this.removeDraggingClass,this),this._layer.off("mouseover",this.addDraggingClass,this)):this.removeDraggingClass(),this._originalMapDragState&&this._dragging&&this._map.dragging.enable(),this._safeToCacheDragState=!1,this._layer.dragging&&this._layer.dragging.disable();var t=this._getDOMElem();t&&(F(this._layer)instanceof L.Canvas?(this._layer.off("touchstart mousedown",this._dragMixinOnMouseDown,this),this._map.pm._removeTouchEvents(t)):L.DomEvent.off(t,"touchstart mousedown",this._simulateMouseDownEvent,this)),this._layerDragged&&this._fireUpdate(),this._layerDragged=!1,this._fireDragDisable()},dragging:function(){return this._dragging},layerDragEnabled:function(){return!!this._layerDragEnabled},_simulateMouseDownEvent:function(t){var e={originalEvent:t,target:this._layer},i=t.touches?t.touches[0]:t;return e.containerPoint=this._map.mouseEventToContainerPoint(i),e.latlng=this._map.containerPointToLatLng(e.containerPoint),this._dragMixinOnMouseDown(e),!1},_simulateMouseMoveEvent:function(t){var e={originalEvent:t,target:this._layer},i=t.touches?t.touches[0]:t;return e.containerPoint=this._map.mouseEventToContainerPoint(i),e.latlng=this._map.containerPointToLatLng(e.containerPoint),this._dragMixinOnMouseMove(e),!1},_simulateMouseUpEvent:function(t){var e={originalEvent:t,target:this._layer};return-1===t.type.indexOf("touch")&&(e.containerPoint=this._map.mouseEventToContainerPoint(t),e.latlng=this._map.containerPointToLatLng(e.containerPoint)),this._dragMixinOnMouseUp(e),!1},_dragMixinOnMouseDown:function(t){if(!(t.originalEvent.button>0)){this._overwriteEventIfItComesFromMarker(t);var e=t._fromLayerSync,i=this._syncLayers("_dragMixinOnMouseDown",t);this._layer instanceof L.Marker&&(!this.options.snappable||e||i?this._disableSnapping():this._initSnappableMarkers()),this._layer instanceof L.CircleMarker&&!(this._layer instanceof L.Circle)&&(!this.options.snappable||e||i?this._layer.pm.options.editable?this._layer.pm._disableSnapping():this._layer.pm._disableSnappingDrag():this._layer.pm.options.editable||this._initSnappableMarkersDrag()),this._safeToCacheDragState&&(this._originalMapDragState=this._layer._map.dragging._enabled,this._safeToCacheDragState=!1),this._tempDragCoord=t.latlng,L.DomEvent.on(this._map.getContainer(),"touchend mouseup",this._simulateMouseUpEvent,this),L.DomEvent.on(this._map.getContainer(),"touchmove mousemove",this._simulateMouseMoveEvent,this)}},_dragMixinOnMouseMove:function(t){this._overwriteEventIfItComesFromMarker(t);var e=this._getDOMElem();this._syncLayers("_dragMixinOnMouseMove",t),this._dragging||(this._dragging=!0,L.DomUtil.addClass(e,"leaflet-pm-dragging"),this._layer instanceof L.Marker||this._layer.bringToFront(),this._originalMapDragState&&this._map.dragging.disable(),this._fireDragStart()),this._tempDragCoord||(this._tempDragCoord=t.latlng),this._onLayerDrag(t),this._layer instanceof L.CircleMarker&&this._layer.pm._updateHiddenPolyCircle()},_dragMixinOnMouseUp:function(t){var e=this,i=this._getDOMElem();return this._syncLayers("_dragMixinOnMouseUp",t),this._originalMapDragState&&this._map.dragging.enable(),this._safeToCacheDragState=!0,L.DomEvent.off(this._map.getContainer(),"touchmove mousemove",this._simulateMouseMoveEvent,this),L.DomEvent.off(this._map.getContainer(),"touchend mouseup",this._simulateMouseUpEvent,this),!!this._dragging&&(this._layer instanceof L.CircleMarker&&this._layer.pm._updateHiddenPolyCircle(),this._layerDragged=!0,window.setTimeout((function(){e._dragging=!1,i&&L.DomUtil.removeClass(i,"leaflet-pm-dragging"),e._fireDragEnd(),e._fireEdit()}),10),!0)},_onLayerDrag:function(t){var e=t.latlng,i=e.lat-this._tempDragCoord.lat,n=e.lng-this._tempDragCoord.lng,r=function u(t){return t.map((function(t){if(Array.isArray(t))return u(t);var e={lat:t.lat+i,lng:t.lng+n};return(t.alt||0===t.alt)&&(e.alt=t.alt),e}))};if(this._layer instanceof L.Circle||this._layer instanceof L.CircleMarker&&this._layer.options.editable){var a=r([this._layer.getLatLng()]);this._layer.setLatLng(a[0]),this._fireChange(this._layer.getLatLng(),"Edit")}else if(this._layer instanceof L.CircleMarker||this._layer instanceof L.Marker){var o=this._layer.getLatLng();this._layer._snapped&&(o=this._layer._orgLatLng);var s=r([o]);this._layer.setLatLng(s[0]),this._fireChange(this._layer.getLatLng(),"Edit")}else if(this._layer instanceof L.ImageOverlay){var l=r([this._layer.getBounds().getNorthWest(),this._layer.getBounds().getSouthEast()]);this._layer.setBounds(l),this._fireChange(this._layer.getBounds(),"Edit")}else{var h=r(this._layer.getLatLngs());this._layer.setLatLngs(h),this._fireChange(this._layer.getLatLngs(),"Edit")}this._tempDragCoord=e,t.layer=this._layer,this._fireDrag(t)},addDraggingClass:function(){var t=this._getDOMElem();t&&L.DomUtil.addClass(t,"leaflet-pm-draggable")},removeDraggingClass:function(){var t=this._getDOMElem();t&&L.DomUtil.removeClass(t,"leaflet-pm-draggable")},_getDOMElem:function(){var t=null;return this._layer._path?t=this._layer._path:this._layer._renderer&&this._layer._renderer._container?t=this._layer._renderer._container:this._layer._image?t=this._layer._image:this._layer._icon&&(t=this._layer._icon),t},_overwriteEventIfItComesFromMarker:function(t){t.target.getLatLng&&(!t.target._radius||t.target._radius<=10)&&(t.containerPoint=this._map.mouseEventToContainerPoint(t.originalEvent),t.latlng=this._map.containerPointToLatLng(t.containerPoint))},_syncLayers:function(t,e){var i=this;if(this.enabled())return!1;if(!e._fromLayerSync&&this._layer===e.target&&this.options.syncLayersOnDrag){e._fromLayerSync=!0;var n=[];if(L.Util.isArray(this.options.syncLayersOnDrag))n=this.options.syncLayersOnDrag,this.options.syncLayersOnDrag.forEach((function(t){t instanceof L.LayerGroup&&(n=n.concat(t.pm.getLayers(!0)))}));else if(!0===this.options.syncLayersOnDrag&&this._parentLayerGroup)for(var r in this._parentLayerGroup){var a=this._parentLayerGroup[r];a.pm&&(n=a.pm.getLayers(!0))}return L.Util.isArray(n)&&n.length>0&&(n=n.filter((function(t){return!!t.pm})).filter((function(t){return!!t.pm.options.draggable}))).forEach((function(n){n!==i._layer&&n.pm[t]&&(n._snapped=!1,n.pm[t](e))})),n.length>0}return!1},_stopDOMImageDrag:function(t){return t.preventDefault(),!1}};function ye(t,e,i){var n=i.getMaxZoom();if(n===Infinity&&(n=i.getZoom()),L.Util.isArray(t)){var r=[];return t.forEach((function(t){r.push(ye(t,e,i))})),r}return t instanceof L.LatLng?function(t,e,i,n){return i.unproject(e.transform(i.project(t,n)),n)}(t,e,i,n):null}function me(t,e){e instanceof L.Layer&&(e=e.getLatLng());var i=t.getMaxZoom();return i===Infinity&&(i=t.getZoom()),t.project(e,i)}function ve(t,e){var i=t.getMaxZoom();return i===Infinity&&(i=t.getZoom()),t.unproject(e,i)}var Le={_onRotateStart:function(t){this._preventRenderingMarkers(!0),this._rotationOriginLatLng=this._getRotationCenter().clone(),this._rotationOriginPoint=me(this._map,this._rotationOriginLatLng),this._rotationStartPoint=me(this._map,t.target.getLatLng()),this._initialRotateLatLng=U(this._layer),this._startAngle=this.getAngle();var e=U(this._rotationLayer,this._rotationLayer.pm._rotateOrgLatLng);this._fireRotationStart(this._rotationLayer,e),this._fireRotationStart(this._map,e)},_onRotate:function(t){var e=me(this._map,t.target.getLatLng()),i=this._rotationStartPoint,n=this._rotationOriginPoint,r=Math.atan2(e.y-n.y,e.x-n.x)-Math.atan2(i.y-n.y,i.x-n.x);this._layer.setLatLngs(this._rotateLayer(r,this._initialRotateLatLng,this._rotationOriginLatLng,L.PM.Matrix.init(),this._map));var a=this;!function h(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:[],i=arguments.length>2&&arguments[2]!==undefined?arguments[2]:-1;if(i>-1&&e.push(i),L.Util.isArray(t[0]))t.forEach((function(t,i){return h(t,e.slice(),i)}));else{var n=R()(a._markers,e);t.forEach((function(t,e){n[e].setLatLng(t)}))}}(this._layer.getLatLngs());var o=U(this._rotationLayer);this._rotationLayer.setLatLngs(this._rotateLayer(r,this._rotationLayer.pm._rotateOrgLatLng,this._rotationOriginLatLng,L.PM.Matrix.init(),this._map));var s=180*r/Math.PI,l=(s=s<0?s+360:s)+this._startAngle;this._setAngle(l),this._rotationLayer.pm._setAngle(l),this._fireRotation(this._rotationLayer,s,o),this._fireRotation(this._map,s,o),this._rotationLayer.pm._fireChange(this._rotationLayer.getLatLngs(),"Rotation")},_onRotateEnd:function(){var t=this._startAngle;delete this._rotationOriginLatLng,delete this._rotationOriginPoint,delete this._rotationStartPoint,delete this._initialRotateLatLng,delete this._startAngle;var e=U(this._rotationLayer,this._rotationLayer.pm._rotateOrgLatLng);this._rotationLayer.pm._rotateOrgLatLng=U(this._rotationLayer),this._fireRotationEnd(this._rotationLayer,t,e),this._fireRotationEnd(this._map,t,e),this._rotationLayer.pm._fireEdit(this._rotationLayer,"Rotation"),this._preventRenderingMarkers(!1),this._layerRotated=!0},_rotateLayer:function(t,e,i,n,r){var a=me(r,i);return this._matrix=n.clone().rotate(t,a).flip(),ye(e,this._matrix,r)},_setAngle:function(t){t=t<0?t+360:t,this._angle=t%360},_getRotationCenter:function(){var t=L.polygon(this._layer.getLatLngs(),{stroke:!1,fill:!1,pmIgnore:!0}).addTo(this._layer._map),e=t.getCenter();return t.removeFrom(this._layer._map),e},enableRotate:function(){if(this.options.allowRotation){this._rotatePoly=L.polygon(this._layer.getLatLngs(),{fill:!1,stroke:!1,pmIgnore:!1,snapIgnore:!0}).addTo(this._layer._map),this._rotatePoly.pm._setAngle(this.getAngle()),this._rotatePoly.pm.setOptions(this._layer._map.pm.getGlobalOptions()),this._rotatePoly.pm.setOptions({rotate:!0,snappable:!1,hideMiddleMarkers:!0}),this._rotatePoly.pm._rotationLayer=this._layer,this._rotatePoly.pm.enable(),this._rotateOrgLatLng=U(this._layer),this._rotateEnabled=!0,this._layer.on("remove",this.disableRotate,this),this._fireRotationEnable(this._layer),this._fireRotationEnable(this._layer._map)}else this.disableRotate()},disableRotate:function(){this.rotateEnabled()&&(this._rotatePoly.pm._layerRotated&&this._fireUpdate(),this._rotatePoly.pm._layerRotated=!1,this._rotatePoly.pm.disable(),this._rotatePoly.remove(),this._rotatePoly.pm.setOptions({rotate:!1}),this._rotatePoly=undefined,this._rotateOrgLatLng=undefined,this._layer.off("remove",this.disableRotate,this),this._rotateEnabled=!1,this._fireRotationDisable(this._layer),this._fireRotationDisable(this._layer._map))},rotateEnabled:function(){return this._rotateEnabled},rotateLayer:function(t){var e=this.getAngle(),i=this._layer.getLatLngs(),n=t*(Math.PI/180);this._layer.setLatLngs(this._rotateLayer(n,this._layer.getLatLngs(),this._getRotationCenter(),L.PM.Matrix.init(),this._layer._map)),this._rotateOrgLatLng=L.polygon(this._layer.getLatLngs()).getLatLngs(),this._setAngle(this.getAngle()+t),this.rotateEnabled()&&this._rotatePoly&&this._rotatePoly.pm.enabled()&&(this._rotatePoly.setLatLngs(this._rotateLayer(n,this._rotatePoly.getLatLngs(),this._getRotationCenter(),L.PM.Matrix.init(),this._rotatePoly._map)),this._rotatePoly.pm._initMarkers());var r=this.getAngle()-e;r=r<0?r+360:r,this._startAngle=e,this._fireRotation(this._layer,r,i,this._layer),this._fireRotation(this._map,r,i,this._layer),delete this._startAngle,this._fireChange(this._layer.getLatLngs(),"Rotation")},rotateLayerToAngle:function(t){var e=t-this.getAngle();this.rotateLayer(e)},getAngle:function(){return this._angle||0}};const be=Le;const ke=L.Class.extend({includes:[_e,rt,be,S],options:{snappable:!0,snapDistance:20,allowSelfIntersection:!0,allowSelfIntersectionEdit:!1,preventMarkerRemoval:!1,removeLayerBelowMinVertexCount:!0,limitMarkersToCount:-1,hideMiddleMarkers:!1,snapSegment:!0,syncLayersOnDrag:!1,draggable:!0,allowEditing:!0,allowRemoval:!0,allowCutting:!0,allowRotation:!0,addVertexOn:"click",removeVertexOn:"contextmenu",removeVertexValidation:undefined,addVertexValidation:undefined,moveVertexValidation:undefined},setOptions:function(t){L.Util.setOptions(this,t)},getOptions:function(){return this.options},applyOptions:function(){},isPolygon:function(){return this._layer instanceof L.Polygon},getShape:function(){return this._shape},_setPane:function(t,e){"layerPane"===e?t.options.pane=this._map.pm.globalOptions.panes&&this._map.pm.globalOptions.panes.layerPane||"overlayPane":"vertexPane"===e?t.options.pane=this._map.pm.globalOptions.panes&&this._map.pm.globalOptions.panes.vertexPane||"markerPane":"markerPane"===e&&(t.options.pane=this._map.pm.globalOptions.panes&&this._map.pm.globalOptions.panes.markerPane||"markerPane")},remove:function(){(this._map||this._layer._map).pm.removeLayer({target:this._layer})},_vertexValidation:function(t,e){var i=e.target,n={layer:this._layer,marker:i,event:e},r="";return"move"===t?r="moveVertexValidation":"add"===t?r="addVertexValidation":"remove"===t&&(r="removeVertexValidation"),this.options[r]&&"function"==typeof this.options[r]&&!this.options[r](n)?("move"===t&&(i._cancelDragEventChain=i.getLatLng()),!1):(i._cancelDragEventChain=null,!0)},_vertexValidationDrag:function(t){return!t._cancelDragEventChain||(t._latlng=t._cancelDragEventChain,t.update(),!1)},_vertexValidationDragEnd:function(t){return!t._cancelDragEventChain||(t._cancelDragEventChain=null,!1)}});function Me(t){return function(t){if(Array.isArray(t))return xe(t)}(t)||function(t){if("undefined"!=typeof Symbol&&null!=t[Symbol.iterator]||null!=t["@@iterator"])return Array.from(t)}(t)||function(t,e){if(!t)return;if("string"==typeof t)return xe(t,e);var i=Object.prototype.toString.call(t).slice(8,-1);"Object"===i&&t.constructor&&(i=t.constructor.name);if("Map"===i||"Set"===i)return Array.from(t);if("Arguments"===i||/^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(i))return xe(t,e)}(t)||function(){throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.")}()}function xe(t,e){(null==e||e>t.length)&&(e=t.length);for(var i=0,n=new Array(e);i0&&e._getMap()&&e._getMap().pm.globalEditModeEnabled()&&e.enabled()&&e.enable(e.getOptions())}}),100,this),this),this._layerGroup.on("layerremove",(function(t){e._removeLayerFromGroup(t.target)}),this);this._layerGroup.on("layerremove",L.Util.throttle((function(t){t.target._pmTempLayer||(e._layers=e.getLayers())}),100,this),this)},enable:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:[];0===e.length&&(this._layers=this.getLayers()),this._options=t,this._layers.forEach((function(i){i instanceof L.LayerGroup?-1===e.indexOf(i._leaflet_id)&&(e.push(i._leaflet_id),i.pm.enable(t,e)):i.pm.enable(t)}))},disable:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:[];0===t.length&&(this._layers=this.getLayers()),this._layers.forEach((function(e){e instanceof L.LayerGroup?-1===t.indexOf(e._leaflet_id)&&(t.push(e._leaflet_id),e.pm.disable(t)):e.pm.disable()}))},enabled:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:[];0===t.length&&(this._layers=this.getLayers());var e=this._layers.find((function(e){return e instanceof L.LayerGroup?-1===t.indexOf(e._leaflet_id)&&(t.push(e._leaflet_id),e.pm.enabled(t)):e.pm.enabled()}));return!!e},toggleEdit:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:[];0===e.length&&(this._layers=this.getLayers()),this._options=t,this._layers.forEach((function(i){i instanceof L.LayerGroup?-1===e.indexOf(i._leaflet_id)&&(e.push(i._leaflet_id),i.pm.toggleEdit(t,e)):i.pm.toggleEdit(t)}))},_initLayer:function(t){var e=L.Util.stamp(this._layerGroup);t.pm._parentLayerGroup||(t.pm._parentLayerGroup={}),t.pm._parentLayerGroup[e]=this._layerGroup},_removeLayerFromGroup:function(t){if(t.pm&&t.pm._layerGroup){var e=L.Util.stamp(this._layerGroup);delete t.pm._layerGroup[e]}},dragging:function(){if(this._layers=this.getLayers(),this._layers){var t=this._layers.find((function(t){return t.pm.dragging()}));return!!t}return!1},getOptions:function(){return this.options},_getMap:function(){var t;return this._map||(null===(t=this._layers.find((function(t){return!!t._map})))||void 0===t?void 0:t._map)||null},getLayers:function(){var t=arguments.length>0&&arguments[0]!==undefined&&arguments[0],e=!(arguments.length>1&&arguments[1]!==undefined)||arguments[1],i=!(arguments.length>2&&arguments[2]!==undefined)||arguments[2],n=arguments.length>3&&arguments[3]!==undefined?arguments[3]:[],r=[];return t?this._layerGroup.getLayers().forEach((function(t){r.push(t),t instanceof L.LayerGroup&&-1===n.indexOf(t._leaflet_id)&&(n.push(t._leaflet_id),r=r.concat(t.pm.getLayers(!0,!0,!0,n)))})):r=this._layerGroup.getLayers(),i&&(r=r.filter((function(t){return!(t instanceof L.LayerGroup)}))),e&&(r=(r=(r=r.filter((function(t){return!!t.pm}))).filter((function(t){return!t._pmTempLayer}))).filter((function(t){return!L.PM.optIn&&!t.options.pmIgnore||L.PM.optIn&&!1===t.options.pmIgnore}))),r},setOptions:function(t){var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:[];0===e.length&&(this._layers=this.getLayers()),this.options=t,this._layers.forEach((function(i){i.pm&&(i instanceof L.LayerGroup?-1===e.indexOf(i._leaflet_id)&&(e.push(i._leaflet_id),i.pm.setOptions(t,e)):i.pm.setOptions(t))}))}}),ke.Marker=ke.extend({_shape:"Marker",initialize:function(t){this._layer=t,this._enabled=!1,this._layer.on("dragend",this._onDragEnd,this)},enable:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:{draggable:!0};L.Util.setOptions(this,t),this.options.allowEditing&&this._layer._map?(this._map=this._layer._map,this.enabled()&&this.disable(),this.applyOptions(),this._layer.on("remove",this.disable,this),this._enabled=!0,this._fireEnable()):this.disable()},disable:function(){this.enabled()&&(this.disableLayerDrag(),this._layer.off("remove",this.disable,this),this._layer.off("contextmenu",this._removeMarker,this),this._layerEdited&&this._fireUpdate(),this._layerEdited=!1,this._fireDisable(),this._enabled=!1)},enabled:function(){return this._enabled},toggleEdit:function(t){this.enabled()?this.disable():this.enable(t)},applyOptions:function(){this.options.snappable?this._initSnappableMarkers():this._disableSnapping(),this.options.draggable?this.enableLayerDrag():this.disableLayerDrag(),this.options.preventMarkerRemoval||this._layer.on("contextmenu",this._removeMarker,this)},_removeMarker:function(t){var e=t.target;e.remove(),this._fireRemove(e),this._fireRemove(this._map,e)},_onDragEnd:function(){this._fireEdit(),this._layerEdited=!0},_initSnappableMarkers:function(){var t=this._layer;this.options.snapDistance=this.options.snapDistance||30,this.options.snapSegment=this.options.snapSegment===undefined||this.options.snapSegment,t.off("pm:drag",this._handleSnapping,this),t.on("pm:drag",this._handleSnapping,this),t.off("pm:dragend",this._cleanupSnapping,this),t.on("pm:dragend",this._cleanupSnapping,this),t.off("pm:dragstart",this._unsnap,this),t.on("pm:dragstart",this._unsnap,this)},_disableSnapping:function(){var t=this._layer;t.off("pm:drag",this._handleSnapping,this),t.off("pm:dragend",this._cleanupSnapping,this),t.off("pm:dragstart",this._unsnap,this)}});const we={filterMarkerGroup:function(){this.markerCache=[],this.createCache(),this._layer.on("pm:edit",this.createCache,this),this.applyLimitFilters({}),this._layer.on("pm:disable",this._removeMarkerLimitEvents,this),this.options.limitMarkersToCount>-1&&(this._layer.on("pm:vertexremoved",this._initMarkers,this),this._map.on("mousemove",this.applyLimitFilters,this))},_removeMarkerLimitEvents:function(){this._map.off("mousemove",this.applyLimitFilters,this),this._layer.off("pm:edit",this.createCache,this),this._layer.off("pm:disable",this._removeMarkerLimitEvents,this),this._layer.off("pm:vertexremoved",this._initMarkers,this)},createCache:function(){var t=[].concat(Me(this._markerGroup.getLayers()),Me(this.markerCache));this.markerCache=t.filter((function(t,e,i){return i.indexOf(t)===e}))},renderLimits:function(t){var e=this;this.markerCache.forEach((function(i){t.includes(i)?e._markerGroup.addLayer(i):e._markerGroup.removeLayer(i)}))},applyLimitFilters:function(t){var e=t.latlng,i=void 0===e?{lat:0,lng:0}:e;if(!this._preventRenderMarkers){var n=Me(this._filterClosestMarkers(i));this.renderLimits(n)}},_filterClosestMarkers:function(t){var e=Me(this.markerCache),i=this.options.limitMarkersToCount;return e.sort((function(e,i){return e._latlng.distanceTo(t)-i._latlng.distanceTo(t)})),e.filter((function(t,e){return!(i>-1)||et.length)&&(e=t.length);for(var i=0,n=new Array(e);i1?R()(r,l):r,u=o.length>1?R()(this._markers,l):this._markers;h.splice(s+1,0,n),u.splice(s+1,0,t),this._layer.setLatLngs(r),!0!==this.options.hideMiddleMarkers&&(this._createMiddleMarker(e,t),this._createMiddleMarker(t,i)),this._fireEdit(),this._layerEdited=!0,this._fireChange(this._layer.getLatLngs(),"Edit"),this._fireVertexAdded(t,L.PM.Utils.findDeepMarkerIndex(this._markers,t).indexPath,n),this.options.snappable&&this._initSnappableMarkers()},hasSelfIntersection:function(){return yt(this._layer.toGeoJSON(15)).features.length>0},_handleSelfIntersectionOnVertexRemoval:function(){this._handleLayerStyle(!0),this.hasSelfIntersection()&&(this._layer.setLatLngs(this._coordsBeforeEdit),this._coordsBeforeEdit=null,this._initMarkers())},_handleLayerStyle:function(t){var e=this._layer;if(this.hasSelfIntersection()){if(!this.options.allowSelfIntersection&&this.options.allowSelfIntersectionEdit&&this._updateDisabledMarkerStyle(this._markers,!0),this.isRed)return;t?this._flashLayer():(e.setStyle({color:"#f00000ff"}),this.isRed=!0),this._fireIntersect(yt(this._layer.toGeoJSON(15)))}else e.setStyle({color:this.cachedColor}),this.isRed=!1,!this.options.allowSelfIntersection&&this.options.allowSelfIntersectionEdit&&this._updateDisabledMarkerStyle(this._markers,!1)},_flashLayer:function(){var t=this;this.cachedColor||(this.cachedColor=this._layer.options.color),this._layer.setStyle({color:"#f00000ff"}),this.isRed=!0,window.setTimeout((function(){t._layer.setStyle({color:t.cachedColor}),t.isRed=!1}),200)},_updateDisabledMarkerStyle:function(t,e){var i=this;t.forEach((function(t){Array.isArray(t)?i._updateDisabledMarkerStyle(t,e):t._icon&&(e&&!i._checkMarkerAllowedToDrag(t)?L.DomUtil.addClass(t._icon,"vertexmarker-disabled"):L.DomUtil.removeClass(t._icon,"vertexmarker-disabled"))}))},_removeMarker:function(t){var e=t.target;if(this._vertexValidation("remove",t)){if(!this.options.allowSelfIntersection){var i=this._layer.getLatLngs();this._coordsBeforeEdit=JSON.parse(JSON.stringify(i))}var n=this._layer.getLatLngs(),r=L.PM.Utils.findDeepMarkerIndex(this._markers,e),a=r.indexPath,o=r.index,s=r.parentPath;if(a){var l=a.length>1?R()(n,s):n,h=a.length>1?R()(this._markers,s):this._markers;if(this.options.removeLayerBelowMinVertexCount||!(l.length<=2||this.isPolygon()&&l.length<=3)){l.splice(o,1),this._layer.setLatLngs(n),this.isPolygon()&&l.length<=2&&l.splice(0,l.length);var u=!1;if(l.length<=1&&(l.splice(0,l.length),this._layer.setLatLngs(n),this.disable(),this.enable(this.options),u=!0),j(n)&&this._layer.remove(),n=G(n),this._layer.setLatLngs(n),this._markers=G(this._markers),!u&&(h=a.length>1?R()(this._markers,s):this._markers,e._middleMarkerPrev&&this._markerGroup.removeLayer(e._middleMarkerPrev),e._middleMarkerNext&&this._markerGroup.removeLayer(e._middleMarkerNext),this._markerGroup.removeLayer(e),h)){var c,p;if(this.isPolygon()?(c=(o+1)%h.length,p=(o+(h.length-1))%h.length):(p=o-1<0?undefined:o-1,c=o+1>=h.length?undefined:o+1),c!==p){var d=h[p],f=h[c];!0!==this.options.hideMiddleMarkers&&this._createMiddleMarker(d,f)}h.splice(o,1)}this._fireEdit(),this._layerEdited=!0,this._fireVertexRemoved(e,a),this._fireChange(this._layer.getLatLngs(),"Edit")}else this._flashLayer()}}},updatePolygonCoordsFromMarkerDrag:function(t){var e=this._layer.getLatLngs(),i=t.getLatLng(),n=L.PM.Utils.findDeepMarkerIndex(this._markers,t),r=n.indexPath,a=n.index,o=n.parentPath;(r.length>1?R()(e,o):e).splice(a,1,i),this._layer.setLatLngs(e)},_getNeighborMarkers:function(t){var e=L.PM.Utils.findDeepMarkerIndex(this._markers,t),i=e.indexPath,n=e.index,r=e.parentPath,a=i.length>1?R()(this._markers,r):this._markers,o=(n+1)%a.length;return{prevMarker:a[(n+(a.length-1))%a.length],nextMarker:a[o]}},_checkMarkerAllowedToDrag:function(t){var e=this._getNeighborMarkers(t),i=e.prevMarker,n=e.nextMarker,r=L.polyline([i.getLatLng(),t.getLatLng()]),a=L.polyline([t.getLatLng(),n.getLatLng()]),o=jt(this._layer.toGeoJSON(15),r.toGeoJSON(15)).features.length,s=jt(this._layer.toGeoJSON(15),a.toGeoJSON(15)).features.length;return t.getLatLng()===this._markers[0][0].getLatLng()?s+=1:t.getLatLng()===this._markers[0][this._markers[0].length-1].getLatLng()&&(o+=1),!(o<=2&&s<=2)},_onMarkerDragStart:function(t){var e=t.target;if(this.cachedColor||(this.cachedColor=this._layer.options.color),this._vertexValidation("move",t)){var i=L.PM.Utils.findDeepMarkerIndex(this._markers,e).indexPath;this._fireMarkerDragStart(t,i),this.options.allowSelfIntersection||(this._coordsBeforeEdit=this._layer.getLatLngs()),!this.options.allowSelfIntersection&&this.options.allowSelfIntersectionEdit&&this.hasSelfIntersection()?this._markerAllowedToDrag=this._checkMarkerAllowedToDrag(e):this._markerAllowedToDrag=null}},_onMarkerDrag:function(t){var e=t.target;if(this._vertexValidationDrag(e)){var i=L.PM.Utils.findDeepMarkerIndex(this._markers,e),n=i.indexPath,r=i.index,a=i.parentPath;if(n){if(!this.options.allowSelfIntersection&&this.options.allowSelfIntersectionEdit&&this.hasSelfIntersection()&&!1===this._markerAllowedToDrag)return this._layer.setLatLngs(this._coordsBeforeEdit),this._initMarkers(),void this._handleLayerStyle();this.updatePolygonCoordsFromMarkerDrag(e);var o=n.length>1?R()(this._markers,a):this._markers,s=(r+1)%o.length,l=(r+(o.length-1))%o.length,h=e.getLatLng(),u=o[l].getLatLng(),c=o[s].getLatLng();if(e._middleMarkerNext){var p=L.PM.Utils.calcMiddleLatLng(this._map,h,c);e._middleMarkerNext.setLatLng(p)}if(e._middleMarkerPrev){var d=L.PM.Utils.calcMiddleLatLng(this._map,h,u);e._middleMarkerPrev.setLatLng(d)}this.options.allowSelfIntersection||this._handleLayerStyle(),this._fireMarkerDrag(t,n),this._fireChange(this._layer.getLatLngs(),"Edit")}}},_onMarkerDragEnd:function(t){var e=t.target;if(this._vertexValidationDragEnd(e)){var i=L.PM.Utils.findDeepMarkerIndex(this._markers,e).indexPath,n=this.hasSelfIntersection();n&&this.options.allowSelfIntersectionEdit&&this._markerAllowedToDrag&&(n=!1);var r=!this.options.allowSelfIntersection&&n;if(this._fireMarkerDragEnd(t,i,r),r)return this._layer.setLatLngs(this._coordsBeforeEdit),this._coordsBeforeEdit=null,this._initMarkers(),this.options.snappable&&this._initSnappableMarkers(),this._handleLayerStyle(),void this._fireLayerReset(t,i);!this.options.allowSelfIntersection&&this.options.allowSelfIntersectionEdit&&this._handleLayerStyle(),this._fireEdit(),this._layerEdited=!0,this._fireChange(this._layer.getLatLngs(),"Edit")}},_onVertexClick:function(t){var e=t.target;if(!e._dragging){var i=L.PM.Utils.findDeepMarkerIndex(this._markers,e).indexPath;this._fireVertexClick(t,i)}}}),ke.Polygon=ke.Line.extend({_shape:"Polygon",_checkMarkerAllowedToDrag:function(t){var e=this._getNeighborMarkers(t),i=e.prevMarker,n=e.nextMarker,r=L.polyline([i.getLatLng(),t.getLatLng()]),a=L.polyline([t.getLatLng(),n.getLatLng()]),o=jt(this._layer.toGeoJSON(15),r.toGeoJSON(15)).features.length,s=jt(this._layer.toGeoJSON(15),a.toGeoJSON(15)).features.length;return!(o<=2&&s<=2)}}),ke.Rectangle=ke.Polygon.extend({_shape:"Rectangle",_initMarkers:function(){var t=this,e=this._map,i=this._findCorners();this._markerGroup&&this._markerGroup.clearLayers(),this._markerGroup=new L.LayerGroup,this._markerGroup._pmTempLayer=!0,e.addLayer(this._markerGroup),this._markers=[],this._markers[0]=i.map(this._createMarker,this);var n=Ce(this._markers,1);this._cornerMarkers=n[0],this._layer.getLatLngs()[0].forEach((function(e,i){var n=t._cornerMarkers.find((function(t){return t._index===i}));n&&n.setLatLng(e)}))},applyOptions:function(){this.options.snappable?this._initSnappableMarkers():this._disableSnapping(),this._addMarkerEvents()},_createMarker:function(t,e){var i=new L.Marker(t,{draggable:!0,icon:L.divIcon({className:"marker-icon"})});return this._setPane(i,"vertexPane"),i._origLatLng=t,i._index=e,i._pmTempLayer=!0,this._markerGroup.addLayer(i),i},_addMarkerEvents:function(){var t=this;this._markers[0].forEach((function(e){e.on("dragstart",t._onMarkerDragStart,t),e.on("drag",t._onMarkerDrag,t),e.on("dragend",t._onMarkerDragEnd,t),t.options.preventMarkerRemoval||e.on("contextmenu",t._removeMarker,t)}))},_removeMarker:function(){return null},_onMarkerDragStart:function(t){if(this._vertexValidation("move",t)){var e=t.target,i=this._cornerMarkers;e._oppositeCornerLatLng=i.find((function(t){return t._index===(e._index+2)%4})).getLatLng(),e._snapped=!1,this._fireMarkerDragStart(t)}},_onMarkerDrag:function(t){var e=t.target;this._vertexValidationDrag(e)&&e._index!==undefined&&(this._adjustRectangleForMarkerMove(e),this._fireMarkerDrag(t),this._fireChange(this._layer.getLatLngs(),"Edit"))},_onMarkerDragEnd:function(t){var e=t.target;this._vertexValidationDragEnd(e)&&(this._cornerMarkers.forEach((function(t){delete t._oppositeCornerLatLng})),this._fireMarkerDragEnd(t),this._fireEdit(),this._layerEdited=!0,this._fireChange(this._layer.getLatLngs(),"Edit"))},_adjustRectangleForMarkerMove:function(t){L.extend(t._origLatLng,t._latlng);var e=L.PM.Utils._getRotatedRectangle(t.getLatLng(),t._oppositeCornerLatLng,this._angle||0,this._map);this._layer.setLatLngs(e),this._adjustAllMarkers(),this._layer.redraw()},_adjustAllMarkers:function(){var t=this,e=this._layer.getLatLngs()[0];e&&4!==e.length&&e.length>0?(e.forEach((function(e,i){t._cornerMarkers[i].setLatLng(e)})),this._cornerMarkers.slice(e.length).forEach((function(t){t.setLatLng(e[0])}))):e&&e.length?this._cornerMarkers.forEach((function(t){t.setLatLng(e[t._index])})):console.error("The layer has no LatLngs")},_findCorners:function(){var t=this._layer.getLatLngs()[0];return L.PM.Utils._getRotatedRectangle(t[0],t[2],this._angle||0,this._map)}}),ke.Circle=ke.extend({_shape:"Circle",initialize:function(t){this._layer=t,this._enabled=!1,this._updateHiddenPolyCircle()},enable:function(t){L.Util.setOptions(this,t),this._map=this._layer._map,this.options.allowEditing?(this.enabled()||this.disable(),this._enabled=!0,this._initMarkers(),this.applyOptions(),this._layer.on("remove",this.disable,this),this._updateHiddenPolyCircle(),this._fireEnable()):this.disable()},disable:function(){if(this.enabled()&&!this._dragging){this._centerMarker.off("dragstart",this._onCircleDragStart,this),this._centerMarker.off("drag",this._onCircleDrag,this),this._centerMarker.off("dragend",this._onCircleDragEnd,this),this._outerMarker.off("drag",this._handleOuterMarkerSnapping,this),this._layer.off("remove",this.disable,this),this._enabled=!1,this._helperLayers.clearLayers();var t=this._layer._path?this._layer._path:this._layer._renderer._container;L.DomUtil.removeClass(t,"leaflet-pm-draggable"),this._layerEdited&&this._fireUpdate(),this._layerEdited=!1,this._fireDisable()}},enabled:function(){return this._enabled},toggleEdit:function(t){this.enabled()?this.disable():this.enable(t)},_initMarkers:function(){var t=this._map;this._helperLayers&&this._helperLayers.clearLayers(),this._helperLayers=new L.LayerGroup,this._helperLayers._pmTempLayer=!0,this._helperLayers.addTo(t);var e=this._layer.getLatLng(),i=this._layer._radius,n=this._getLatLngOnCircle(e,i);this._centerMarker=this._createCenterMarker(e),this._outerMarker=this._createOuterMarker(n),this._markers=[this._centerMarker,this._outerMarker],this._createHintLine(this._centerMarker,this._outerMarker)},applyOptions:function(){this.options.snappable?(this._initSnappableMarkers(),this._outerMarker.on("drag",this._handleOuterMarkerSnapping,this),this._outerMarker.on("move",this._syncHintLine,this),this._outerMarker.on("move",this._syncCircleRadius,this),this._centerMarker.on("move",this._moveCircle,this)):this._disableSnapping()},_createHintLine:function(t,e){var i=t.getLatLng(),n=e.getLatLng();this._hintline=L.polyline([i,n],this.options.hintlineStyle),this._setPane(this._hintline,"layerPane"),this._hintline._pmTempLayer=!0,this._helperLayers.addLayer(this._hintline)},_createCenterMarker:function(t){var e=this._createMarker(t);return L.DomUtil.addClass(e._icon,"leaflet-pm-draggable"),e.on("drag",this._moveCircle,this),e.on("dragstart",this._onCircleDragStart,this),e.on("drag",this._onCircleDrag,this),e.on("dragend",this._onCircleDragEnd,this),e},_createOuterMarker:function(t){var e=this._createMarker(t);return e.on("drag",this._resizeCircle,this),e},_createMarker:function(t){var e=new L.Marker(t,{draggable:!0,icon:L.divIcon({className:"marker-icon"})});return this._setPane(e,"vertexPane"),e._origLatLng=t,e._pmTempLayer=!0,e.on("dragstart",this._onMarkerDragStart,this),e.on("drag",this._onMarkerDrag,this),e.on("dragend",this._onMarkerDragEnd,this),this._helperLayers.addLayer(e),e},_resizeCircle:function(){this._outerMarker.setLatLng(this._getNewDestinationOfOuterMarker()),this._syncHintLine(),this._syncCircleRadius()},_moveCircle:function(t){if(!t.target._cancelDragEventChain){var e=t.latlng;this._layer.setLatLng(e);var i=this._layer._radius,n=this._getLatLngOnCircle(e,i);this._outerMarker._latlng=n,this._outerMarker.update(),this._syncHintLine(),this._updateHiddenPolyCircle(),this._fireCenterPlaced("Edit"),this._fireChange(this._layer.getLatLng(),"Edit")}},_syncCircleRadius:function(){var t=this._centerMarker.getLatLng(),e=this._outerMarker.getLatLng(),i=this._map.distance(t,e);this.options.minRadiusCircle&&ithis.options.maxRadiusCircle?this._layer.setRadius(this.options.maxRadiusCircle):this._layer.setRadius(i),this._updateHiddenPolyCircle(),this._fireChange(this._layer.getLatLng(),"Edit")},_syncHintLine:function(){var t=this._centerMarker.getLatLng(),e=this._outerMarker.getLatLng();this._hintline.setLatLngs([t,e])},_disableSnapping:function(){var t=this;this._markers.forEach((function(e){e.off("move",t._syncHintLine,t),e.off("move",t._syncCircleRadius,t),e.off("drag",t._handleSnapping,t),e.off("dragend",t._cleanupSnapping,t)})),this._layer.off("pm:dragstart",this._unsnap,this)},_onMarkerDragStart:function(t){this._vertexValidation("move",t)&&this._fireMarkerDragStart(t)},_onMarkerDrag:function(t){var e=t.target;this._vertexValidationDrag(e)&&this._fireMarkerDrag(t)},_onMarkerDragEnd:function(t){var e=t.target;this._vertexValidationDragEnd(e)&&(this._fireEdit(),this._layerEdited=!0,this._fireMarkerDragEnd(t))},_onCircleDragStart:function(t){this._vertexValidationDrag(t.target)?(delete this._vertexValidationReset,this._fireDragStart()):this._vertexValidationReset=!0},_onCircleDrag:function(t){this._vertexValidationReset||this._fireDrag(t)},_onCircleDragEnd:function(){this._vertexValidationReset?delete this._vertexValidationReset:this._fireDragEnd()},_updateHiddenPolyCircle:function(){var t=this._map&&this._map.pm._isCRSSimple();this._hiddenPolyCircle?this._hiddenPolyCircle.setLatLngs(L.PM.Utils.circleToPolygon(this._layer,200,!t).getLatLngs()):this._hiddenPolyCircle=L.PM.Utils.circleToPolygon(this._layer,200,!t),this._hiddenPolyCircle._parentCopy||(this._hiddenPolyCircle._parentCopy=this._layer)},_getLatLngOnCircle:function(t,e){var i=this._map.project(t),n=L.point(i.x+e,i.y);return this._map.unproject(n)},_getNewDestinationOfOuterMarker:function(){var t=this._centerMarker.getLatLng(),e=this._outerMarker.getLatLng(),i=this._map.distance(t,e);return this.options.minRadiusCircle&&ithis.options.maxRadiusCircle&&(e=z(this._map,t,e,this.options.maxRadiusCircle)),e},_handleOuterMarkerSnapping:function(){if(this._outerMarker._snapped){var t=this._centerMarker.getLatLng(),e=this._outerMarker.getLatLng(),i=this._map.distance(t,e);(this.options.minRadiusCircle&&ithis.options.maxRadiusCircle)&&this._outerMarker.setLatLng(this._outerMarker._orgLatLng)}this._outerMarker.setLatLng(this._getNewDestinationOfOuterMarker())}}),ke.CircleMarker=ke.extend({_shape:"CircleMarker",initialize:function(t){this._layer=t,this._enabled=!1,this._updateHiddenPolyCircle()},enable:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:{draggable:!0,snappable:!0};L.Util.setOptions(this,t),this.options.allowEditing&&this._layer._map?(this._map=this._layer._map,this.enabled()&&this.disable(),this.applyOptions(),this._layer.on("remove",this.disable,this),this._enabled=!0,this._layer.on("pm:dragstart",this._onDragStart,this),this._layer.on("pm:drag",this._onMarkerDrag,this),this._layer.on("pm:dragend",this._onMarkerDragEnd,this),this._updateHiddenPolyCircle(),this._fireEnable()):this.disable()},disable:function(){this._dragging||(this._helperLayers&&this._helperLayers.clearLayers(),this._map||(this._map=this._layer._map),this._map||(this.options.editable?(this._map.off("move",this._syncMarkers,this),this._outerMarker&&this._outerMarker.on("drag",this._handleOuterMarkerSnapping,this)):this._map.off("move",this._updateHiddenPolyCircle,this)),this.disableLayerDrag(),this._layer.off("contextmenu",this._removeMarker,this),this._layer.off("remove",this.disable,this),this.enabled()&&(this._layerEdited&&this._fireUpdate(),this._layerEdited=!1,this._fireDisable()),this._enabled=!1)},enabled:function(){return this._enabled},toggleEdit:function(t){this.enabled()?this.disable():this.enable(t)},applyOptions:function(){!this.options.editable&&this.options.draggable?this.enableLayerDrag():this.disableLayerDrag(),this.options.editable?(this._initMarkers(),this._map.on("move",this._syncMarkers,this)):this._map.on("move",this._updateHiddenPolyCircle,this),this.options.snappable?this.options.editable?(this._initSnappableMarkers(),this._centerMarker.on("drag",this._moveCircle,this),this.options.editable&&this._outerMarker.on("drag",this._handleOuterMarkerSnapping,this),this._outerMarker.on("move",this._syncHintLine,this),this._outerMarker.on("move",this._syncCircleRadius,this)):this._initSnappableMarkersDrag():this.options.editable?this._disableSnapping():this._disableSnappingDrag(),this.options.preventMarkerRemoval||this._layer.on("contextmenu",this._removeMarker,this)},_initMarkers:function(){var t=this._map;this._helperLayers&&this._helperLayers.clearLayers(),this._helperLayers=new L.LayerGroup,this._helperLayers._pmTempLayer=!0,this._helperLayers.addTo(t);var e=this._layer.getLatLng(),i=this._layer._radius,n=this._getLatLngOnCircle(e,i);this._centerMarker=this._createCenterMarker(e),this._outerMarker=this._createOuterMarker(n),this._markers=[this._centerMarker,this._outerMarker],this._createHintLine(this._centerMarker,this._outerMarker)},_getLatLngOnCircle:function(t,e){var i=this._map.project(t),n=L.point(i.x+e,i.y);return this._map.unproject(n)},_createHintLine:function(t,e){var i=t.getLatLng(),n=e.getLatLng();this._hintline=L.polyline([i,n],this.options.hintlineStyle),this._setPane(this._hintline,"layerPane"),this._hintline._pmTempLayer=!0,this._helperLayers.addLayer(this._hintline)},_createCenterMarker:function(t){var e=this._createMarker(t);return this.options.draggable?L.DomUtil.addClass(e._icon,"leaflet-pm-draggable"):e.dragging.disable(),e},_createOuterMarker:function(t){var e=this._createMarker(t);return e.on("drag",this._resizeCircle,this),e},_createMarker:function(t){var e=new L.Marker(t,{draggable:!0,icon:L.divIcon({className:"marker-icon"})});return this._setPane(e,"vertexPane"),e._origLatLng=t,e._pmTempLayer=!0,e.on("dragstart",this._onMarkerDragStart,this),e.on("drag",this._onMarkerDrag,this),e.on("dragend",this._onMarkerDragEnd,this),this._helperLayers.addLayer(e),e},_moveCircle:function(){var t=this._centerMarker.getLatLng();this._layer.setLatLng(t);var e=this._layer._radius,i=this._getLatLngOnCircle(t,e);this._outerMarker._latlng=i,this._outerMarker.update(),this._syncHintLine(),this._updateHiddenPolyCircle(),this._fireCenterPlaced("Edit"),this._fireChange(this._layer.getLatLng(),"Edit")},_syncMarkers:function(){var t=this._layer.getLatLng(),e=this._layer._radius,i=this._getLatLngOnCircle(t,e);this._outerMarker.setLatLng(i),this._centerMarker.setLatLng(t),this._syncHintLine(),this._updateHiddenPolyCircle()},_resizeCircle:function(){this._outerMarker.setLatLng(this._getNewDestinationOfOuterMarker()),this._syncHintLine(),this._syncCircleRadius()},_syncCircleRadius:function(){var t=this._centerMarker.getLatLng(),e=this._outerMarker.getLatLng(),i=this._map.project(t).distanceTo(this._map.project(e));this.options.minRadiusCircleMarker&&ithis.options.maxRadiusCircleMarker?this._layer.setRadius(this.options.maxRadiusCircleMarker):this._layer.setRadius(i),this._updateHiddenPolyCircle(),this._fireChange(this._layer.getLatLng(),"Edit")},_syncHintLine:function(){var t=this._centerMarker.getLatLng(),e=this._outerMarker.getLatLng();this._hintline.setLatLngs([t,e])},_removeMarker:function(){this.options.editable&&this.disable(),this._layer.remove(),this._fireRemove(this._layer),this._fireRemove(this._map,this._layer)},_onDragStart:function(){this._map.pm.Draw.CircleMarker._layerIsDragging=!0},_onMarkerDragStart:function(t){this._vertexValidation("move",t)&&this._fireMarkerDragStart(t)},_onMarkerDrag:function(t){var e=t.target;e instanceof L.Marker&&!this._vertexValidationDrag(e)||this._fireMarkerDrag(t)},_onMarkerDragEnd:function(t){this._map.pm.Draw.CircleMarker._layerIsDragging=!1;var e=t.target;this._vertexValidationDragEnd(e)&&(this.options.editable&&(this._fireEdit(),this._layerEdited=!0),this._fireMarkerDragEnd(t))},_initSnappableMarkersDrag:function(){var t=this._layer;this.options.snapDistance=this.options.snapDistance||30,this.options.snapSegment=this.options.snapSegment===undefined||this.options.snapSegment,t.off("pm:drag",this._handleSnapping,this),t.on("pm:drag",this._handleSnapping,this),t.off("pm:dragend",this._cleanupSnapping,this),t.on("pm:dragend",this._cleanupSnapping,this),t.off("pm:dragstart",this._unsnap,this),t.on("pm:dragstart",this._unsnap,this)},_disableSnappingDrag:function(){var t=this._layer;t.off("pm:drag",this._handleSnapping,this),t.off("pm:dragend",this._cleanupSnapping,this),t.off("pm:dragstart",this._unsnap,this)},_updateHiddenPolyCircle:function(){var t=this._layer._map||this._map;if(t){var e=L.PM.Utils.pxRadiusToMeterRadius(this._layer.getRadius(),t,this._layer.getLatLng()),i=L.circle(this._layer.getLatLng(),this._layer.options);i.setRadius(e);var n=t&&t.pm._isCRSSimple();this._hiddenPolyCircle?this._hiddenPolyCircle.setLatLngs(L.PM.Utils.circleToPolygon(i,200,!n).getLatLngs()):this._hiddenPolyCircle=L.PM.Utils.circleToPolygon(i,200,!n),this._hiddenPolyCircle._parentCopy||(this._hiddenPolyCircle._parentCopy=this._layer)}},_getNewDestinationOfOuterMarker:function(){var t=this._centerMarker.getLatLng(),e=this._outerMarker.getLatLng(),i=this._map.project(t).distanceTo(this._map.project(e));return this.options.minRadiusCircleMarker&&ithis.options.maxRadiusCircleMarker&&(e=z(this._map,t,e,L.PM.Utils.pxRadiusToMeterRadius(this.options.maxRadiusCircleMarker,this._map,t))),e},_handleOuterMarkerSnapping:function(){if(this._outerMarker._snapped){var t=this._centerMarker.getLatLng(),e=this._outerMarker.getLatLng(),i=this._map.project(t).distanceTo(this._map.project(e));(this.options.minRadiusCircleMarker&&ithis.options.maxRadiusCircleMarker)&&this._outerMarker.setLatLng(this._outerMarker._orgLatLng)}this._outerMarker.setLatLng(this._getNewDestinationOfOuterMarker())}}),ke.ImageOverlay=ke.extend({_shape:"ImageOverlay",initialize:function(t){this._layer=t,this._enabled=!1},toggleEdit:function(t){this.enabled()?this.disable():this.enable(t)},enabled:function(){return this._enabled},enable:function(){var t=arguments.length>0&&arguments[0]!==undefined?arguments[0]:{draggable:!0,snappable:!0};L.Util.setOptions(this,t),this._map=this._layer._map,this._map&&(this.options.allowEditing?(this.enabled()||this.disable(),this.enableLayerDrag(),this._layer.on("remove",this.disable,this),this._enabled=!0,this._otherSnapLayers=this._findCorners(),this._fireEnable()):this.disable())},disable:function(){this._dragging||(this._map||(this._map=this._layer._map),this.disableLayerDrag(),this._layer.off("remove",this.disable,this),this.enabled()||(this._layerEdited&&this._fireUpdate(),this._layerEdited=!1,this._fireDisable()),this._enabled=!1)},_findCorners:function(){var t=this._layer.getBounds();return[t.getNorthWest(),t.getNorthEast(),t.getSouthEast(),t.getSouthWest()]}});var Ee=function(t,e,i,n,r,a){this._matrix=[t,e,i,n,r,a]};Ee.init=function(){return new L.PM.Matrix(1,0,0,1,0,0)},Ee.prototype={transform:function(t){return this._transform(t.clone())},_transform:function(t){var e=this._matrix,i=t.x,n=t.y;return t.x=e[0]*i+e[1]*n+e[4],t.y=e[2]*i+e[3]*n+e[5],t},untransform:function(t){var e=this._matrix;return new L.Point((t.x/e[0]-e[4])/e[0],(t.y/e[2]-e[5])/e[2])},clone:function(){var t=this._matrix;return new L.PM.Matrix(t[0],t[1],t[2],t[3],t[4],t[5])},translate:function(t){return t===undefined?new L.Point(this._matrix[4],this._matrix[5]):("number"==typeof t?(e=t,i=t):(e=t.x,i=t.y),this._add(1,0,0,1,e,i));var e,i},scale:function(t,e){return t===undefined?new L.Point(this._matrix[0],this._matrix[3]):(e=e||L.point(0,0),"number"==typeof t?(i=t,n=t):(i=t.x,n=t.y),this._add(i,0,0,n,e.x,e.y)._add(1,0,0,1,-e.x,-e.y));var i,n},rotate:function(t,e){var i=Math.cos(t),n=Math.sin(t);return e=e||new L.Point(0,0),this._add(i,n,-n,i,e.x,e.y)._add(1,0,0,1,-e.x,-e.y)},flip:function(){return this._matrix[1]*=-1,this._matrix[2]*=-1,this},_add:function(t,e,i,n,r,a){var o,s=[[],[],[]],l=this._matrix,h=[[l[0],l[2],l[4]],[l[1],l[3],l[5]],[0,0,1]],u=[[t,i,r],[e,n,a],[0,0,1]];t&&t instanceof L.PM.Matrix&&(u=[[(l=t._matrix)[0],l[2],l[4]],[l[1],l[3],l[5]],[0,0,1]]);for(var c=0;c<3;c+=1)for(var p=0;p<3;p+=1){o=0;for(var d=0;d<3;d+=1)o+=h[c][d]*u[d][p];s[c][p]=o}return this._matrix=[s[0][0],s[1][0],s[0][1],s[1][1],s[0][2],s[1][2]],this}};const Se=Ee;var Oe={calcMiddleLatLng:function(t,e,i){var n=t.project(e),r=t.project(i);return t.unproject(n._add(r)._divideBy(2))},findLayers:function(t){var e=[];return t.eachLayer((function(t){(t instanceof L.Polyline||t instanceof L.Marker||t instanceof L.Circle||t instanceof L.CircleMarker||t instanceof L.ImageOverlay)&&e.push(t)})),e=(e=(e=e.filter((function(t){return!!t.pm}))).filter((function(t){return!t._pmTempLayer}))).filter((function(t){return!L.PM.optIn&&!t.options.pmIgnore||L.PM.optIn&&!1===t.options.pmIgnore}))},circleToPolygon:function(t){for(var e=arguments.length>1&&arguments[1]!==undefined?arguments[1]:60,i=!(arguments.length>2&&arguments[2]!==undefined)||arguments[2],n=t.getLatLng(),r=t.getRadius(),a=N(n,r,e,0,i),o=[],s=0;s3&&arguments[3]!==undefined&&arguments[3];t.fire(e,i,n);var r=this.getAllParentGroups(t),a=r.groups;a.forEach((function(t){t.fire(e,i,n)}))},getAllParentGroups:function(t){var e=[],i=[];return!t._pmLastGroupFetch||!t._pmLastGroupFetch.time||(new Date).getTime()-t._pmLastGroupFetch.time>1e3?(function n(t){for(var r in t._eventParents)if(-1===e.indexOf(r)){e.push(r);var a=t._eventParents[r];i.push(a),n(a)}}(t),t._pmLastGroupFetch={time:(new Date).getTime(),groups:i,groupIds:e},{groupIds:e,groups:i}):{groups:t._pmLastGroupFetch.groups,groupIds:t._pmLastGroupFetch.groupIds}},createGeodesicPolygon:N,getTranslation:I,findDeepCoordIndex:function(t,e){var i;t.some(function r(t){return function(n,a){var o=t.concat(a);return n.lat&&n.lat===e.lat&&n.lng===e.lng?(i=o,!0):Array.isArray(n)&&n.some(r(o))}}([]));var n={};return i&&(n={indexPath:i,index:i[i.length-1],parentPath:i.slice(0,i.length-1)}),n},findDeepMarkerIndex:function(t,e){var i;t.some(function r(t){return function(n,a){var o=t.concat(a);return n._leaflet_id===e._leaflet_id?(i=o,!0):Array.isArray(n)&&n.some(r(o))}}([]));var n={};return i&&(n={indexPath:i,index:i[i.length-1],parentPath:i.slice(0,i.length-1)}),n},_getIndexFromSegment:function(t,e){if(e&&2===e.length){var i=this.findDeepCoordIndex(t,e[0]),n=this.findDeepCoordIndex(t,e[1]),r=Math.max(i.index,n.index);return 0!==i.index&&0!==n.index||1===r||(r+=1),{indexA:i,indexB:n,newIndex:r,indexPath:i.indexPath,parentPath:i.parentPath}}return null},_getRotatedRectangle:function(t,e,i,n){var r=me(n,t),a=me(n,e),o=i*Math.PI/180,s=Math.cos(o),l=Math.sin(o),h=(a.x-r.x)*s+(a.y-r.y)*l,u=(a.y-r.y)*s-(a.x-r.x)*l,c=h*s+r.x,p=h*l+r.y,d=-u*l+r.x,f=u*s+r.y;return[ve(n,r),ve(n,{x:c,y:p}),ve(n,a),ve(n,{x:d,y:f})]},pxRadiusToMeterRadius:function(t,e,i){var n=e.project(i),r=L.point(n.x+t,n.y);return e.distance(e.unproject(r),i)}};const De=Oe;L.PM=L.PM||{version:"2.12.0",Map:K,Toolbar:Q,Draw:at,Edit:ke,Utils:De,Matrix:Se,activeLang:"en",optIn:!1,initialize:function(t){this.addInitHooks(t)},setOptIn:function(t){this.optIn=!!t},addInitHooks:function(){L.Map.addInitHook((function(){this.pm=undefined,L.PM.optIn?!1===this.options.pmIgnore&&(this.pm=new L.PM.Map(this)):this.options.pmIgnore||(this.pm=new L.PM.Map(this))})),L.LayerGroup.addInitHook((function(){this.pm=undefined,L.PM.optIn?!1===this.options.pmIgnore&&(this.pm=new L.PM.Edit.LayerGroup(this)):this.options.pmIgnore||(this.pm=new L.PM.Edit.LayerGroup(this))})),L.Marker.addInitHook((function(){this.pm=undefined,L.PM.optIn?!1===this.options.pmIgnore&&(this.pm=new L.PM.Edit.Marker(this)):this.options.pmIgnore||(this.pm=new L.PM.Edit.Marker(this))})),L.CircleMarker.addInitHook((function(){this.pm=undefined,L.PM.optIn?!1===this.options.pmIgnore&&(this.pm=new L.PM.Edit.CircleMarker(this)):this.options.pmIgnore||(this.pm=new L.PM.Edit.CircleMarker(this))})),L.Polyline.addInitHook((function(){this.pm=undefined,L.PM.optIn?!1===this.options.pmIgnore&&(this.pm=new L.PM.Edit.Line(this)):this.options.pmIgnore||(this.pm=new L.PM.Edit.Line(this))})),L.Polygon.addInitHook((function(){this.pm=undefined,L.PM.optIn?!1===this.options.pmIgnore&&(this.pm=new L.PM.Edit.Polygon(this)):this.options.pmIgnore||(this.pm=new L.PM.Edit.Polygon(this))})),L.Rectangle.addInitHook((function(){this.pm=undefined,L.PM.optIn?!1===this.options.pmIgnore&&(this.pm=new L.PM.Edit.Rectangle(this)):this.options.pmIgnore||(this.pm=new L.PM.Edit.Rectangle(this))})),L.Circle.addInitHook((function(){this.pm=undefined,L.PM.optIn?!1===this.options.pmIgnore&&(this.pm=new L.PM.Edit.Circle(this)):this.options.pmIgnore||(this.pm=new L.PM.Edit.Circle(this))})),L.ImageOverlay.addInitHook((function(){this.pm=undefined,L.PM.optIn?!1===this.options.pmIgnore&&(this.pm=new L.PM.Edit.ImageOverlay(this)):this.options.pmIgnore||(this.pm=new L.PM.Edit.ImageOverlay(this))}))},reInitLayer:function(t){var e=this;t instanceof L.LayerGroup&&t.eachLayer((function(t){e.reInitLayer(t)})),t.pm||L.PM.optIn&&!1!==t.options.pmIgnore||t.options.pmIgnore||(t instanceof L.Map?t.pm=new L.PM.Map(t):t instanceof L.Marker?t.pm=new L.PM.Edit.Marker(t):t instanceof L.Circle?t.pm=new L.PM.Edit.Circle(t):t instanceof L.CircleMarker?t.pm=new L.PM.Edit.CircleMarker(t):t instanceof L.Rectangle?t.pm=new L.PM.Edit.Rectangle(t):t instanceof L.Polygon?t.pm=new L.PM.Edit.Polygon(t):t instanceof L.Polyline?t.pm=new L.PM.Edit.Line(t):t instanceof L.LayerGroup?t.pm=new L.PM.Edit.LayerGroup(t):t instanceof L.ImageOverlay&&(t.pm=new L.PM.Edit.ImageOverlay(t)))}},L.PM.initialize()},7107:()=>{Array.prototype.findIndex=Array.prototype.findIndex||function(t){if(null===this)throw new TypeError("Array.prototype.findIndex called on null or undefined");if("function"!=typeof t)throw new TypeError("callback must be a function");for(var e=Object(this),i=e.length>>>0,n=arguments[1],r=0;r>>0,n=arguments[1],r=0;r>>0;if(0===n)return!1;var r,a,o=0|e,s=Math.max(o>=0?o:n-Math.abs(o),0);for(;s{var n=i(2582),r=i(4102),a=i(1540),o=i(9705).Z,s=a.featureEach,l=(a.coordEach,r.polygon,r.featureCollection);function h(t){var e=new n(t);return e.insert=function(t){if("Feature"!==t.type)throw new Error("invalid feature");return t.bbox=t.bbox?t.bbox:o(t),n.prototype.insert.call(this,t)},e.load=function(t){var e=[];return Array.isArray(t)?t.forEach((function(t){if("Feature"!==t.type)throw new Error("invalid features");t.bbox=t.bbox?t.bbox:o(t),e.push(t)})):s(t,(function(t){if("Feature"!==t.type)throw new Error("invalid features");t.bbox=t.bbox?t.bbox:o(t),e.push(t)})),n.prototype.load.call(this,e)},e.remove=function(t,e){if("Feature"!==t.type)throw new Error("invalid feature");return t.bbox=t.bbox?t.bbox:o(t),n.prototype.remove.call(this,t,e)},e.clear=function(){return n.prototype.clear.call(this)},e.search=function(t){var e=n.prototype.search.call(this,this.toBBox(t));return l(e)},e.collides=function(t){return n.prototype.collides.call(this,this.toBBox(t))},e.all=function(){var t=n.prototype.all.call(this);return l(t)},e.toJSON=function(){return n.prototype.toJSON.call(this)},e.fromJSON=function(t){return n.prototype.fromJSON.call(this,t)},e.toBBox=function(t){var e;if(t.bbox)e=t.bbox;else if(Array.isArray(t)&&4===t.length)e=t;else if(Array.isArray(t)&&6===t.length)e=[t[0],t[1],t[3],t[4]];else if("Feature"===t.type)e=o(t);else{if("FeatureCollection"!==t.type)throw new Error("invalid geojson");e=o(t)}return{minX:e[0],minY:e[1],maxX:e[2],maxY:e[3]}},e}t.exports=h,t.exports["default"]=h},1989:(t,e,i)=>{var n=i(1789),r=i(401),a=i(7667),o=i(1327),s=i(1866);function l(t){var e=-1,i=null==t?0:t.length;for(this.clear();++e{var n=i(7040),r=i(4125),a=i(2117),o=i(7518),s=i(4705);function l(t){var e=-1,i=null==t?0:t.length;for(this.clear();++e{var n=i(852)(i(5639),"Map");t.exports=n},3369:(t,e,i)=>{var n=i(4785),r=i(1285),a=i(6e3),o=i(9916),s=i(5265);function l(t){var e=-1,i=null==t?0:t.length;for(this.clear();++e{var n=i(8407),r=i(7465),a=i(3779),o=i(7599),s=i(4758),l=i(4309);function h(t){var e=this.__data__=new n(t);this.size=e.size}h.prototype.clear=r,h.prototype["delete"]=a,h.prototype.get=o,h.prototype.has=s,h.prototype.set=l,t.exports=h},2705:(t,e,i)=>{var n=i(5639).Symbol;t.exports=n},1149:(t,e,i)=>{var n=i(5639).Uint8Array;t.exports=n},6874:t=>{t.exports=function(t,e,i){switch(i.length){case 0:return t.call(e);case 1:return t.call(e,i[0]);case 2:return t.call(e,i[0],i[1]);case 3:return t.call(e,i[0],i[1],i[2])}return t.apply(e,i)}},4636:(t,e,i)=>{var n=i(2545),r=i(5694),a=i(1469),o=i(4144),s=i(5776),l=i(6719),h=Object.prototype.hasOwnProperty;t.exports=function(t,e){var i=a(t),u=!i&&r(t),c=!i&&!u&&o(t),p=!i&&!u&&!c&&l(t),d=i||u||c||p,f=d?n(t.length,String):[],g=f.length;for(var _ in t)!e&&!h.call(t,_)||d&&("length"==_||c&&("offset"==_||"parent"==_)||p&&("buffer"==_||"byteLength"==_||"byteOffset"==_)||s(_,g))||f.push(_);return f}},9932:t=>{t.exports=function(t,e){for(var i=-1,n=null==t?0:t.length,r=Array(n);++i{var n=i(9465),r=i(7813);t.exports=function(t,e,i){(i!==undefined&&!r(t[e],i)||i===undefined&&!(e in t))&&n(t,e,i)}},4865:(t,e,i)=>{var n=i(9465),r=i(7813),a=Object.prototype.hasOwnProperty;t.exports=function(t,e,i){var o=t[e];a.call(t,e)&&r(o,i)&&(i!==undefined||e in t)||n(t,e,i)}},8470:(t,e,i)=>{var n=i(7813);t.exports=function(t,e){for(var i=t.length;i--;)if(n(t[i][0],e))return i;return-1}},9465:(t,e,i)=>{var n=i(8777);t.exports=function(t,e,i){"__proto__"==e&&n?n(t,e,{configurable:!0,enumerable:!0,value:i,writable:!0}):t[e]=i}},3118:(t,e,i)=>{var n=i(3218),r=Object.create,a=function(){function t(){}return function(e){if(!n(e))return{};if(r)return r(e);t.prototype=e;var i=new t;return t.prototype=undefined,i}}();t.exports=a},8483:(t,e,i)=>{var n=i(5063)();t.exports=n},7786:(t,e,i)=>{var n=i(1811),r=i(327);t.exports=function(t,e){for(var i=0,a=(e=n(e,t)).length;null!=t&&i{var n=i(2705),r=i(9607),a=i(2333),o=n?n.toStringTag:undefined;t.exports=function(t){return null==t?t===undefined?"[object Undefined]":"[object Null]":o&&o in Object(t)?r(t):a(t)}},8565:t=>{var e=Object.prototype.hasOwnProperty;t.exports=function(t,i){return null!=t&&e.call(t,i)}},9454:(t,e,i)=>{var n=i(4239),r=i(7005);t.exports=function(t){return r(t)&&"[object Arguments]"==n(t)}},8458:(t,e,i)=>{var n=i(3560),r=i(5346),a=i(3218),o=i(346),s=/^\[object .+?Constructor\]$/,l=Function.prototype,h=Object.prototype,u=l.toString,c=h.hasOwnProperty,p=RegExp("^"+u.call(c).replace(/[\\^$.*+?()[\]{}|]/g,"\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g,"$1.*?")+"$");t.exports=function(t){return!(!a(t)||r(t))&&(n(t)?p:s).test(o(t))}},8749:(t,e,i)=>{var n=i(4239),r=i(1780),a=i(7005),o={};o["[object Float32Array]"]=o["[object Float64Array]"]=o["[object Int8Array]"]=o["[object Int16Array]"]=o["[object Int32Array]"]=o["[object Uint8Array]"]=o["[object Uint8ClampedArray]"]=o["[object Uint16Array]"]=o["[object Uint32Array]"]=!0,o["[object Arguments]"]=o["[object Array]"]=o["[object ArrayBuffer]"]=o["[object Boolean]"]=o["[object DataView]"]=o["[object Date]"]=o["[object Error]"]=o["[object Function]"]=o["[object Map]"]=o["[object Number]"]=o["[object Object]"]=o["[object RegExp]"]=o["[object Set]"]=o["[object String]"]=o["[object WeakMap]"]=!1,t.exports=function(t){return a(t)&&r(t.length)&&!!o[n(t)]}},313:(t,e,i)=>{var n=i(3218),r=i(5726),a=i(3498),o=Object.prototype.hasOwnProperty;t.exports=function(t){if(!n(t))return a(t);var e=r(t),i=[];for(var s in t)("constructor"!=s||!e&&o.call(t,s))&&i.push(s);return i}},2980:(t,e,i)=>{var n=i(6384),r=i(6556),a=i(8483),o=i(9783),s=i(3218),l=i(1704),h=i(6390);t.exports=function u(t,e,i,c,p){t!==e&&a(e,(function(a,l){if(p||(p=new n),s(a))o(t,e,l,i,u,c,p);else{var d=c?c(h(t,l),a,l+"",t,e,p):undefined;d===undefined&&(d=a),r(t,l,d)}}),l)}},9783:(t,e,i)=>{var n=i(6556),r=i(4626),a=i(7133),o=i(278),s=i(8517),l=i(5694),h=i(1469),u=i(9246),c=i(4144),p=i(3560),d=i(3218),f=i(8630),g=i(6719),_=i(6390),y=i(9881);t.exports=function(t,e,i,m,v,L,b){var k=_(t,i),M=_(e,i),x=b.get(M);if(x)n(t,i,x);else{var w=L?L(k,M,i+"",t,e,b):undefined,C=w===undefined;if(C){var P=h(M),E=!P&&c(M),S=!P&&!E&&g(M);w=M,P||E||S?h(k)?w=k:u(k)?w=o(k):E?(C=!1,w=r(M,!0)):S?(C=!1,w=a(M,!0)):w=[]:f(M)||l(M)?(w=k,l(k)?w=y(k):d(k)&&!p(k)||(w=s(M))):C=!1}C&&(b.set(M,w),v(w,M,m,L,b),b["delete"](M)),n(t,i,w)}}},5976:(t,e,i)=>{var n=i(6557),r=i(5357),a=i(61);t.exports=function(t,e){return a(r(t,e,n),t+"")}},6560:(t,e,i)=>{var n=i(5703),r=i(8777),a=i(6557),o=r?function(t,e){return r(t,"toString",{configurable:!0,enumerable:!1,value:n(e),writable:!0})}:a;t.exports=o},2545:t=>{t.exports=function(t,e){for(var i=-1,n=Array(t);++i{var n=i(2705),r=i(9932),a=i(1469),o=i(3448),s=n?n.prototype:undefined,l=s?s.toString:undefined;t.exports=function h(t){if("string"==typeof t)return t;if(a(t))return r(t,h)+"";if(o(t))return l?l.call(t):"";var e=t+"";return"0"==e&&1/t==-Infinity?"-0":e}},1717:t=>{t.exports=function(t){return function(e){return t(e)}}},1811:(t,e,i)=>{var n=i(1469),r=i(5403),a=i(5514),o=i(9833);t.exports=function(t,e){return n(t)?t:r(t,e)?[t]:a(o(t))}},4318:(t,e,i)=>{var n=i(1149);t.exports=function(t){var e=new t.constructor(t.byteLength);return new n(e).set(new n(t)),e}},4626:(t,e,i)=>{t=i.nmd(t);var n=i(5639),r=e&&!e.nodeType&&e,a=r&&t&&!t.nodeType&&t,o=a&&a.exports===r?n.Buffer:undefined,s=o?o.allocUnsafe:undefined;t.exports=function(t,e){if(e)return t.slice();var i=t.length,n=s?s(i):new t.constructor(i);return t.copy(n),n}},7133:(t,e,i)=>{var n=i(4318);t.exports=function(t,e){var i=e?n(t.buffer):t.buffer;return new t.constructor(i,t.byteOffset,t.length)}},278:t=>{t.exports=function(t,e){var i=-1,n=t.length;for(e||(e=Array(n));++i{var n=i(4865),r=i(9465);t.exports=function(t,e,i,a){var o=!i;i||(i={});for(var s=-1,l=e.length;++s{var n=i(5639)["__core-js_shared__"];t.exports=n},1463:(t,e,i)=>{var n=i(5976),r=i(6612);t.exports=function(t){return n((function(e,i){var n=-1,a=i.length,o=a>1?i[a-1]:undefined,s=a>2?i[2]:undefined;for(o=t.length>3&&"function"==typeof o?(a--,o):undefined,s&&r(i[0],i[1],s)&&(o=a<3?undefined:o,a=1),e=Object(e);++n{t.exports=function(t){return function(e,i,n){for(var r=-1,a=Object(e),o=n(e),s=o.length;s--;){var l=o[t?s:++r];if(!1===i(a[l],l,a))break}return e}}},8777:(t,e,i)=>{var n=i(852),r=function(){try{var t=n(Object,"defineProperty");return t({},"",{}),t}catch(e){}}();t.exports=r},1957:(t,e,i)=>{var n="object"==typeof i.g&&i.g&&i.g.Object===Object&&i.g;t.exports=n},5050:(t,e,i)=>{var n=i(7019);t.exports=function(t,e){var i=t.__data__;return n(e)?i["string"==typeof e?"string":"hash"]:i.map}},852:(t,e,i)=>{var n=i(8458),r=i(7801);t.exports=function(t,e){var i=r(t,e);return n(i)?i:undefined}},5924:(t,e,i)=>{var n=i(5569)(Object.getPrototypeOf,Object);t.exports=n},9607:(t,e,i)=>{var n=i(2705),r=Object.prototype,a=r.hasOwnProperty,o=r.toString,s=n?n.toStringTag:undefined;t.exports=function(t){var e=a.call(t,s),i=t[s];try{t[s]=undefined;var n=!0}catch(l){}var r=o.call(t);return n&&(e?t[s]=i:delete t[s]),r}},7801:t=>{t.exports=function(t,e){return null==t?undefined:t[e]}},222:(t,e,i)=>{var n=i(1811),r=i(5694),a=i(1469),o=i(5776),s=i(1780),l=i(327);t.exports=function(t,e,i){for(var h=-1,u=(e=n(e,t)).length,c=!1;++h{var n=i(4536);t.exports=function(){this.__data__=n?n(null):{},this.size=0}},401:t=>{t.exports=function(t){var e=this.has(t)&&delete this.__data__[t];return this.size-=e?1:0,e}},7667:(t,e,i)=>{var n=i(4536),r=Object.prototype.hasOwnProperty;t.exports=function(t){var e=this.__data__;if(n){var i=e[t];return"__lodash_hash_undefined__"===i?undefined:i}return r.call(e,t)?e[t]:undefined}},1327:(t,e,i)=>{var n=i(4536),r=Object.prototype.hasOwnProperty;t.exports=function(t){var e=this.__data__;return n?e[t]!==undefined:r.call(e,t)}},1866:(t,e,i)=>{var n=i(4536);t.exports=function(t,e){var i=this.__data__;return this.size+=this.has(t)?0:1,i[t]=n&&e===undefined?"__lodash_hash_undefined__":e,this}},8517:(t,e,i)=>{var n=i(3118),r=i(5924),a=i(5726);t.exports=function(t){return"function"!=typeof t.constructor||a(t)?{}:n(r(t))}},5776:t=>{var e=/^(?:0|[1-9]\d*)$/;t.exports=function(t,i){var n=typeof t;return!!(i=null==i?9007199254740991:i)&&("number"==n||"symbol"!=n&&e.test(t))&&t>-1&&t%1==0&&t{var n=i(7813),r=i(8612),a=i(5776),o=i(3218);t.exports=function(t,e,i){if(!o(i))return!1;var s=typeof e;return!!("number"==s?r(i)&&a(e,i.length):"string"==s&&e in i)&&n(i[e],t)}},5403:(t,e,i)=>{var n=i(1469),r=i(3448),a=/\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,o=/^\w*$/;t.exports=function(t,e){if(n(t))return!1;var i=typeof t;return!("number"!=i&&"symbol"!=i&&"boolean"!=i&&null!=t&&!r(t))||(o.test(t)||!a.test(t)||null!=e&&t in Object(e))}},7019:t=>{t.exports=function(t){var e=typeof t;return"string"==e||"number"==e||"symbol"==e||"boolean"==e?"__proto__"!==t:null===t}},5346:(t,e,i)=>{var n,r=i(4429),a=(n=/[^.]+$/.exec(r&&r.keys&&r.keys.IE_PROTO||""))?"Symbol(src)_1."+n:"";t.exports=function(t){return!!a&&a in t}},5726:t=>{var e=Object.prototype;t.exports=function(t){var i=t&&t.constructor;return t===("function"==typeof i&&i.prototype||e)}},7040:t=>{t.exports=function(){this.__data__=[],this.size=0}},4125:(t,e,i)=>{var n=i(8470),r=Array.prototype.splice;t.exports=function(t){var e=this.__data__,i=n(e,t);return!(i<0)&&(i==e.length-1?e.pop():r.call(e,i,1),--this.size,!0)}},2117:(t,e,i)=>{var n=i(8470);t.exports=function(t){var e=this.__data__,i=n(e,t);return i<0?undefined:e[i][1]}},7518:(t,e,i)=>{var n=i(8470);t.exports=function(t){return n(this.__data__,t)>-1}},4705:(t,e,i)=>{var n=i(8470);t.exports=function(t,e){var i=this.__data__,r=n(i,t);return r<0?(++this.size,i.push([t,e])):i[r][1]=e,this}},4785:(t,e,i)=>{var n=i(1989),r=i(8407),a=i(7071);t.exports=function(){this.size=0,this.__data__={hash:new n,map:new(a||r),string:new n}}},1285:(t,e,i)=>{var n=i(5050);t.exports=function(t){var e=n(this,t)["delete"](t);return this.size-=e?1:0,e}},6e3:(t,e,i)=>{var n=i(5050);t.exports=function(t){return n(this,t).get(t)}},9916:(t,e,i)=>{var n=i(5050);t.exports=function(t){return n(this,t).has(t)}},5265:(t,e,i)=>{var n=i(5050);t.exports=function(t,e){var i=n(this,t),r=i.size;return i.set(t,e),this.size+=i.size==r?0:1,this}},4523:(t,e,i)=>{var n=i(8306);t.exports=function(t){var e=n(t,(function(t){return 500===i.size&&i.clear(),t})),i=e.cache;return e}},4536:(t,e,i)=>{var n=i(852)(Object,"create");t.exports=n},3498:t=>{t.exports=function(t){var e=[];if(null!=t)for(var i in Object(t))e.push(i);return e}},1167:(t,e,i)=>{t=i.nmd(t);var n=i(1957),r=e&&!e.nodeType&&e,a=r&&t&&!t.nodeType&&t,o=a&&a.exports===r&&n.process,s=function(){try{var t=a&&a.require&&a.require("util").types;return t||o&&o.binding&&o.binding("util")}catch(e){}}();t.exports=s},2333:t=>{var e=Object.prototype.toString;t.exports=function(t){return e.call(t)}},5569:t=>{t.exports=function(t,e){return function(i){return t(e(i))}}},5357:(t,e,i)=>{var n=i(6874),r=Math.max;t.exports=function(t,e,i){return e=r(e===undefined?t.length-1:e,0),function(){for(var a=arguments,o=-1,s=r(a.length-e,0),l=Array(s);++o{var n=i(1957),r="object"==typeof self&&self&&self.Object===Object&&self,a=n||r||Function("return this")();t.exports=a},6390:t=>{t.exports=function(t,e){if(("constructor"!==e||"function"!=typeof t[e])&&"__proto__"!=e)return t[e]}},61:(t,e,i)=>{var n=i(6560),r=i(1275)(n);t.exports=r},1275:t=>{var e=Date.now;t.exports=function(t){var i=0,n=0;return function(){var r=e(),a=16-(r-n);if(n=r,a>0){if(++i>=800)return arguments[0]}else i=0;return t.apply(undefined,arguments)}}},7465:(t,e,i)=>{var n=i(8407);t.exports=function(){this.__data__=new n,this.size=0}},3779:t=>{t.exports=function(t){var e=this.__data__,i=e["delete"](t);return this.size=e.size,i}},7599:t=>{t.exports=function(t){return this.__data__.get(t)}},4758:t=>{t.exports=function(t){return this.__data__.has(t)}},4309:(t,e,i)=>{var n=i(8407),r=i(7071),a=i(3369);t.exports=function(t,e){var i=this.__data__;if(i instanceof n){var o=i.__data__;if(!r||o.length<199)return o.push([t,e]),this.size=++i.size,this;i=this.__data__=new a(o)}return i.set(t,e),this.size=i.size,this}},5514:(t,e,i)=>{var n=i(4523),r=/[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g,a=/\\(\\)?/g,o=n((function(t){var e=[];return 46===t.charCodeAt(0)&&e.push(""),t.replace(r,(function(t,i,n,r){e.push(n?r.replace(a,"$1"):i||t)})),e}));t.exports=o},327:(t,e,i)=>{var n=i(3448);t.exports=function(t){if("string"==typeof t||n(t))return t;var e=t+"";return"0"==e&&1/t==-Infinity?"-0":e}},346:t=>{var e=Function.prototype.toString;t.exports=function(t){if(null!=t){try{return e.call(t)}catch(i){}try{return t+""}catch(i){}}return""}},5703:t=>{t.exports=function(t){return function(){return t}}},7813:t=>{t.exports=function(t,e){return t===e||t!=t&&e!=e}},7361:(t,e,i)=>{var n=i(7786);t.exports=function(t,e,i){var r=null==t?undefined:n(t,e);return r===undefined?i:r}},8721:(t,e,i)=>{var n=i(8565),r=i(222);t.exports=function(t,e){return null!=t&&r(t,e,n)}},6557:t=>{t.exports=function(t){return t}},5694:(t,e,i)=>{var n=i(9454),r=i(7005),a=Object.prototype,o=a.hasOwnProperty,s=a.propertyIsEnumerable,l=n(function(){return arguments}())?n:function(t){return r(t)&&o.call(t,"callee")&&!s.call(t,"callee")};t.exports=l},1469:t=>{var e=Array.isArray;t.exports=e},8612:(t,e,i)=>{var n=i(3560),r=i(1780);t.exports=function(t){return null!=t&&r(t.length)&&!n(t)}},9246:(t,e,i)=>{var n=i(8612),r=i(7005);t.exports=function(t){return r(t)&&n(t)}},4144:(t,e,i)=>{t=i.nmd(t);var n=i(5639),r=i(5062),a=e&&!e.nodeType&&e,o=a&&t&&!t.nodeType&&t,s=o&&o.exports===a?n.Buffer:undefined,l=(s?s.isBuffer:undefined)||r;t.exports=l},3560:(t,e,i)=>{var n=i(4239),r=i(3218);t.exports=function(t){if(!r(t))return!1;var e=n(t);return"[object Function]"==e||"[object GeneratorFunction]"==e||"[object AsyncFunction]"==e||"[object Proxy]"==e}},1780:t=>{t.exports=function(t){return"number"==typeof t&&t>-1&&t%1==0&&t<=9007199254740991}},3218:t=>{t.exports=function(t){var e=typeof t;return null!=t&&("object"==e||"function"==e)}},7005:t=>{t.exports=function(t){return null!=t&&"object"==typeof t}},8630:(t,e,i)=>{var n=i(4239),r=i(5924),a=i(7005),o=Function.prototype,s=Object.prototype,l=o.toString,h=s.hasOwnProperty,u=l.call(Object);t.exports=function(t){if(!a(t)||"[object Object]"!=n(t))return!1;var e=r(t);if(null===e)return!0;var i=h.call(e,"constructor")&&e.constructor;return"function"==typeof i&&i instanceof i&&l.call(i)==u}},3448:(t,e,i)=>{var n=i(4239),r=i(7005);t.exports=function(t){return"symbol"==typeof t||r(t)&&"[object Symbol]"==n(t)}},6719:(t,e,i)=>{var n=i(8749),r=i(1717),a=i(1167),o=a&&a.isTypedArray,s=o?r(o):n;t.exports=s},1704:(t,e,i)=>{var n=i(4636),r=i(313),a=i(8612);t.exports=function(t){return a(t)?n(t,!0):r(t)}},8306:(t,e,i)=>{var n=i(3369);function r(t,e){if("function"!=typeof t||null!=e&&"function"!=typeof e)throw new TypeError("Expected a function");var i=function(){var n=arguments,r=e?e.apply(this,n):n[0],a=i.cache;if(a.has(r))return a.get(r);var o=t.apply(this,n);return i.cache=a.set(r,o)||a,o};return i.cache=new(r.Cache||n),i}r.Cache=n,t.exports=r},2492:(t,e,i)=>{var n=i(2980),r=i(1463)((function(t,e,i){n(t,e,i)}));t.exports=r},5062:t=>{t.exports=function(){return!1}},9881:(t,e,i)=>{var n=i(8363),r=i(1704);t.exports=function(t){return n(t,r(t))}},9833:(t,e,i)=>{var n=i(531);t.exports=function(t){return null==t?"":n(t)}},2676:function(t){t.exports=function(){"use strict";function t(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}function e(t,e){for(var i=0;ie?1:t0))break;if(null===e.right)break;if(i(t,e.right.key)>0&&(l=e.right,e.right=l.left,l.left=e,null===(e=l).right))break;a.right=e,a=e,e=e.right}}return a.right=e.left,o.left=e.right,e.left=r.right,e.right=r.left,e}function o(t,e,i,r){var o=new n(t,e);if(null===i)return o.left=o.right=null,o;var s=r(t,(i=a(t,i,r)).key);return s<0?(o.left=i.left,o.right=i,i.left=null):s>=0&&(o.right=i.right,o.left=i,i.right=null),o}function s(t,e,i){var n=null,r=null;if(e){var o=i((e=a(t,e,i)).key,t);0===o?(n=e.left,r=e.right):o<0?(r=e.right,e.right=null,n=e):(n=e.left,e.left=null,r=e)}return{left:n,right:r}}function l(t,e,i){return null===e?t:(null===t||((e=a(t.key,e,i)).left=t),e)}function h(t,e,i,n,r){if(t){n(e+(i?"└── ":"├── ")+r(t)+"\n");var a=e+(i?" ":"│ ");t.left&&h(t.left,a,!1,n,r),t.right&&h(t.right,a,!0,n,r)}}var u=function(){function t(t){void 0===t&&(t=r),this._root=null,this._size=0,this._comparator=t}return t.prototype.insert=function(t,e){return this._size++,this._root=o(t,e,this._root,this._comparator)},t.prototype.add=function(t,e){var i=new n(t,e);null===this._root&&(i.left=i.right=null,this._size++,this._root=i);var r=this._comparator,o=a(t,this._root,r),s=r(t,o.key);return 0===s?this._root=o:(s<0?(i.left=o.left,i.right=o,o.left=null):s>0&&(i.right=o.right,i.left=o,o.right=null),this._size++,this._root=i),this._root},t.prototype.remove=function(t){this._root=this._remove(t,this._root,this._comparator)},t.prototype._remove=function(t,e,i){var n;return null===e?null:0===i(t,(e=a(t,e,i)).key)?(null===e.left?n=e.right:(n=a(t,e.left,i)).right=e.right,this._size--,n):e},t.prototype.pop=function(){var t=this._root;if(t){for(;t.left;)t=t.left;return this._root=a(t.key,this._root,this._comparator),this._root=this._remove(t.key,this._root,this._comparator),{key:t.key,data:t.data}}return null},t.prototype.findStatic=function(t){for(var e=this._root,i=this._comparator;e;){var n=i(t,e.key);if(0===n)return e;e=n<0?e.left:e.right}return null},t.prototype.find=function(t){return this._root&&(this._root=a(t,this._root,this._comparator),0!==this._comparator(t,this._root.key))?null:this._root},t.prototype.contains=function(t){for(var e=this._root,i=this._comparator;e;){var n=i(t,e.key);if(0===n)return!0;e=n<0?e.left:e.right}return!1},t.prototype.forEach=function(t,e){for(var i=this._root,n=[],r=!1;!r;)null!==i?(n.push(i),i=i.left):0!==n.length?(i=n.pop(),t.call(e,i),i=i.right):r=!0;return this},t.prototype.range=function(t,e,i,n){for(var r=[],a=this._comparator,o=this._root;0!==r.length||o;)if(o)r.push(o),o=o.left;else{if(a((o=r.pop()).key,e)>0)break;if(a(o.key,t)>=0&&i.call(n,o))return this;o=o.right}return this},t.prototype.keys=function(){var t=[];return this.forEach((function(e){var i=e.key;return t.push(i)})),t},t.prototype.values=function(){var t=[];return this.forEach((function(e){var i=e.data;return t.push(i)})),t},t.prototype.min=function(){return this._root?this.minNode(this._root).key:null},t.prototype.max=function(){return this._root?this.maxNode(this._root).key:null},t.prototype.minNode=function(t){if(void 0===t&&(t=this._root),t)for(;t.left;)t=t.left;return t},t.prototype.maxNode=function(t){if(void 0===t&&(t=this._root),t)for(;t.right;)t=t.right;return t},t.prototype.at=function(t){for(var e=this._root,i=!1,n=0,r=[];!i;)if(e)r.push(e),e=e.left;else if(r.length>0){if(e=r.pop(),n===t)return e;n++,e=e.right}else i=!0;return null},t.prototype.next=function(t){var e=this._root,i=null;if(t.right){for(i=t.right;i.left;)i=i.left;return i}for(var n=this._comparator;e;){var r=n(t.key,e.key);if(0===r)break;r<0?(i=e,e=e.left):e=e.right}return i},t.prototype.prev=function(t){var e=this._root,i=null;if(null!==t.left){for(i=t.left;i.right;)i=i.right;return i}for(var n=this._comparator;e;){var r=n(t.key,e.key);if(0===r)break;r<0?e=e.left:(i=e,e=e.right)}return i},t.prototype.clear=function(){return this._root=null,this._size=0,this},t.prototype.toList=function(){return d(this._root)},t.prototype.load=function(t,e,i){void 0===e&&(e=[]),void 0===i&&(i=!1);var n=t.length,r=this._comparator;if(i&&_(t,e,0,n-1,r),null===this._root)this._root=c(t,e,0,n),this._size=n;else{var a=g(this.toList(),p(t,e),r);n=this._size+n,this._root=f({head:a},0,n)}return this},t.prototype.isEmpty=function(){return null===this._root},Object.defineProperty(t.prototype,"size",{get:function(){return this._size},enumerable:!0,configurable:!0}),Object.defineProperty(t.prototype,"root",{get:function(){return this._root},enumerable:!0,configurable:!0}),t.prototype.toString=function(t){void 0===t&&(t=function(t){return String(t.key)});var e=[];return h(this._root,"",!0,(function(t){return e.push(t)}),t),e.join("")},t.prototype.update=function(t,e,i){var n=this._comparator,r=s(t,this._root,n),a=r.left,h=r.right;n(t,e)<0?h=o(e,i,h,n):a=o(e,i,a,n),this._root=l(a,h,n)},t.prototype.split=function(t){return s(t,this._root,this._comparator)},t}();function c(t,e,i,r){var a=r-i;if(a>0){var o=i+Math.floor(a/2),s=t[o],l=e[o],h=new n(s,l);return h.left=c(t,e,i,o),h.right=c(t,e,o+1,r),h}return null}function p(t,e){for(var i=new n(null,null),r=i,a=0;a0?e=(e=o=o.next=i.pop()).right:r=!0;return o.next=null,a.next}function f(t,e,i){var n=i-e;if(n>0){var r=e+Math.floor(n/2),a=f(t,e,r),o=t.head;return o.left=a,t.head=t.head.next,o.right=f(t,r+1,i),o}return null}function g(t,e,i){for(var r=new n(null,null),a=r,o=t,s=e;null!==o&&null!==s;)i(o.key,s.key)<0?(a.next=o,o=o.next):(a.next=s,s=s.next),a=a.next;return null!==o?a.next=o:null!==s&&(a.next=s),r.next}function _(t,e,i,n,r){if(!(i>=n)){for(var a=t[i+n>>1],o=i-1,s=n+1;;){do{o++}while(r(t[o],a)<0);do{s--}while(r(t[s],a)>0);if(o>=s)break;var l=t[o];t[o]=t[s],t[s]=l,l=e[o],e[o]=e[s],e[s]=l}_(t,e,i,s,r),_(t,e,s+1,n,r)}}var y=function(t,e){return t.ll.x<=e.x&&e.x<=t.ur.x&&t.ll.y<=e.y&&e.y<=t.ur.y},m=function(t,e){if(e.ur.xe.x?1:t.ye.y?1:0}}]),i(e,[{key:"link",value:function(t){if(t.point===this.point)throw new Error("Tried to link already linked events");for(var e=t.point.events,i=0,n=e.length;i=0&&l>=0?oh?-1:0:a<0&&l<0?oh?1:0:la?1:0}}}]),e}(),I=0,j=function(){function e(i,n,r,a){t(this,e),this.id=++I,this.leftSE=i,i.segment=this,i.otherSE=n,this.rightSE=n,n.segment=this,n.otherSE=i,this.rings=r,this.windings=a}return i(e,null,[{key:"compare",value:function(t,e){var i=t.leftSE.point.x,n=e.leftSE.point.x,r=t.rightSE.point.x,a=e.rightSE.point.x;if(ao&&s>l)return-1;var u=t.comparePoint(e.leftSE.point);if(u<0)return 1;if(u>0)return-1;var c=e.comparePoint(t.rightSE.point);return 0!==c?c:-1}if(i>n){if(os&&o>h)return 1;var p=e.comparePoint(t.leftSE.point);if(0!==p)return p;var d=t.comparePoint(e.rightSE.point);return d<0?1:d>0?-1:1}if(os)return 1;if(ra){var g=t.comparePoint(e.rightSE.point);if(g<0)return 1;if(g>0)return-1}if(r!==a){var _=l-o,y=r-i,m=h-s,v=a-n;if(_>y&&mv)return-1}return r>a?1:rh?1:t.ide.id?1:0}}]),i(e,[{key:"replaceRightSE",value:function(t){this.rightSE=t,this.rightSE.segment=this,this.rightSE.otherSE=this.leftSE,this.leftSE.otherSE=this.rightSE}},{key:"bbox",value:function(){var t=this.leftSE.point.y,e=this.rightSE.point.y;return{ll:{x:this.leftSE.point.x,y:te?t:e}}}},{key:"vector",value:function(){return{x:this.rightSE.point.x-this.leftSE.point.x,y:this.rightSE.point.y-this.leftSE.point.y}}},{key:"isAnEndpoint",value:function(t){return t.x===this.leftSE.point.x&&t.y===this.leftSE.point.y||t.x===this.rightSE.point.x&&t.y===this.rightSE.point.y}},{key:"comparePoint",value:function(t){if(this.isAnEndpoint(t))return 0;var e=this.leftSE.point,i=this.rightSE.point,n=this.vector();if(e.x===i.x)return t.x===e.x?0:t.x0&&s.swapEvents(),T.comparePoints(this.leftSE.point,this.rightSE.point)>0&&this.swapEvents(),n&&(r.checkForConsuming(),a.checkForConsuming()),i}},{key:"swapEvents",value:function(){var t=this.rightSE;this.rightSE=this.leftSE,this.leftSE=t,this.leftSE.isLeft=!0,this.rightSE.isLeft=!1;for(var e=0,i=this.windings.length;e0){var a=i;i=n,n=a}if(i.prev===n){var o=i;i=n,n=o}for(var s=0,l=n.rings.length;s0))throw new Error("Tried to create degenerate segment at [".concat(t.x,", ").concat(t.y,"]"));r=i,a=t,o=-1}return new e(new T(r,!0),new T(a,!1),[n],[o])}}]),e}(),G=function(){function e(i,n,r){if(t(this,e),!Array.isArray(i)||0===i.length)throw new Error("Input geometry is not a valid Polygon or MultiPolygon");if(this.poly=n,this.isExterior=r,this.segments=[],"number"!=typeof i[0][0]||"number"!=typeof i[0][1])throw new Error("Input geometry is not a valid Polygon or MultiPolygon");var a=x.round(i[0][0],i[0][1]);this.bbox={ll:{x:a.x,y:a.y},ur:{x:a.x,y:a.y}};for(var o=a,s=1,l=i.length;sthis.bbox.ur.x&&(this.bbox.ur.x=h.x),h.y>this.bbox.ur.y&&(this.bbox.ur.y=h.y),o=h)}a.x===o.x&&a.y===o.y||this.segments.push(j.fromRing(o,a,this))}return i(e,[{key:"getSweepEvents",value:function(){for(var t=[],e=0,i=this.segments.length;ethis.bbox.ur.x&&(this.bbox.ur.x=o.bbox.ur.x),o.bbox.ur.y>this.bbox.ur.y&&(this.bbox.ur.y=o.bbox.ur.y),this.interiorRings.push(o)}this.multiPoly=n}return i(e,[{key:"getSweepEvents",value:function(){for(var t=this.exteriorRing.getSweepEvents(),e=0,i=this.interiorRings.length;ethis.bbox.ur.x&&(this.bbox.ur.x=o.bbox.ur.x),o.bbox.ur.y>this.bbox.ur.y&&(this.bbox.ur.y=o.bbox.ur.y),this.polys.push(o)}this.isSubject=n}return i(e,[{key:"getSweepEvents",value:function(){for(var t=[],e=0,i=this.polys.length;e0&&(t=n)}for(var r=t.segment.prevInResult(),a=r?r.prevInResult():null;;){if(!r)return null;if(!a)return r.ringOut;if(a.ringOut!==r.ringOut)return a.ringOut.enclosingRing()!==r.ringOut?r.ringOut:r.ringOut.enclosingRing();r=a.prevInResult(),a=r?r.prevInResult():null}}}]),e}(),U=function(){function e(i){t(this,e),this.exteriorRing=i,i.poly=this,this.interiorRings=[]}return i(e,[{key:"addInterior",value:function(t){this.interiorRings.push(t),t.poly=this}},{key:"getGeom",value:function(){var t=[this.exteriorRing.getGeom()];if(null===t[0])return null;for(var e=0,i=this.interiorRings.length;e1&&arguments[1]!==undefined?arguments[1]:j.compare;t(this,e),this.queue=i,this.tree=new u(n),this.segments=[]}return i(e,[{key:"process",value:function(t){var e=t.segment,i=[];if(t.consumedBy)return t.isLeft?this.queue.remove(t.otherSE):this.tree.remove(e),i;var n=t.isLeft?this.tree.insert(e):this.tree.find(e);if(!n)throw new Error("Unable to find segment #".concat(e.id," ")+"[".concat(e.leftSE.point.x,", ").concat(e.leftSE.point.y,"] -> ")+"[".concat(e.rightSE.point.x,", ").concat(e.rightSE.point.y,"] ")+"in SweepLine tree. Please submit a bug report.");for(var r=n,a=n,o=undefined,s=undefined;o===undefined;)null===(r=this.tree.prev(r))?o=null:r.key.consumedBy===undefined&&(o=r.key);for(;s===undefined;)null===(a=this.tree.next(a))?s=null:a.key.consumedBy===undefined&&(s=a.key);if(t.isLeft){var l=null;if(o){var h=o.getIntersection(e);if(null!==h&&(e.isAnEndpoint(h)||(l=h),!o.isAnEndpoint(h)))for(var u=this._splitSafely(o,h),c=0,p=u.length;c0?(this.tree.remove(e),i.push(t)):(this.segments.push(e),e.prev=o)}else{if(o&&s){var k=o.getIntersection(s);if(null!==k){if(!o.isAnEndpoint(k))for(var M=this._splitSafely(o,k),x=0,w=M.length;xK)throw new Error("Infinite loop when putting segment endpoints in a priority queue (queue size too big). Please file a bug report.");for(var b=new F(f),k=f.size,M=f.pop();M;){var w=M.key;if(f.size===k){var C=w.segment;throw new Error("Unable to pop() ".concat(w.isLeft?"left":"right"," SweepEvent ")+"[".concat(w.point.x,", ").concat(w.point.y,"] from segment #").concat(C.id," ")+"[".concat(C.leftSE.point.x,", ").concat(C.leftSE.point.y,"] -> ")+"[".concat(C.rightSE.point.x,", ").concat(C.rightSE.point.y,"] from queue. ")+"Please file a bug report.")}if(f.size>K)throw new Error("Infinite loop when passing sweep line over endpoints (queue size too big). Please file a bug report.");if(b.segments.length>H)throw new Error("Infinite loop when passing sweep line over endpoints (too many sweep line segments). Please file a bug report.");for(var P=b.process(w),E=0,S=P.length;E1?e-1:0),n=1;n1?e-1:0),n=1;n1?e-1:0),n=1;n1?e-1:0),n=1;nn;){if(r-n>600){var o=r-n+1,l=i-n+1,h=Math.log(o),u=.5*Math.exp(2*h/3),c=.5*Math.sqrt(h*u*(o-u)/o)*(l-o/2<0?-1:1);s(t,i,Math.max(n,Math.floor(i-l*u/o+c)),Math.min(r,Math.floor(i+(o-l)*u/o+c)),a)}var p=t[i],d=n,f=r;for(e(t,n,i),a(t[r],p)>0&&e(t,n,r);d0;)f--}0===a(t[n],p)?e(t,n,f):e(t,++f,r),f<=i&&(n=f+1),i<=f&&(r=f-1)}}(t,n,r||0,a||t.length-1,o||i)}function e(t,e,i){var n=t[e];t[e]=t[i],t[i]=n}function i(t,e){return te?1:0}var n=function(t){void 0===t&&(t=9),this._maxEntries=Math.max(4,t),this._minEntries=Math.max(2,Math.ceil(.4*this._maxEntries)),this.clear()};function r(t,e,i){if(!i)return e.indexOf(t);for(var n=0;n=t.minX&&e.maxY>=t.minY}function f(t){return{children:t,height:1,leaf:!0,minX:1/0,minY:1/0,maxX:-1/0,maxY:-1/0}}function g(e,i,n,r,a){for(var o=[i,n];o.length;)if(!((n=o.pop())-(i=o.pop())<=r)){var s=i+Math.ceil((n-i)/r/2)*r;t(e,s,i,n,a),o.push(i,s,s,n)}}return n.prototype.all=function(){return this._all(this.data,[])},n.prototype.search=function(t){var e=this.data,i=[];if(!d(t,e))return i;for(var n=this.toBBox,r=[];e;){for(var a=0;a=0&&r[e].children.length>this._maxEntries;)this._split(r,e),e--;this._adjustParentBBoxes(n,r,e)},n.prototype._split=function(t,e){var i=t[e],n=i.children.length,r=this._minEntries;this._chooseSplitAxis(i,r,n);var o=this._chooseSplitIndex(i,r,n),s=f(i.children.splice(o,i.children.length-o));s.height=i.height,s.leaf=i.leaf,a(i,this.toBBox),a(s,this.toBBox),e?t[e-1].children.push(s):this._splitRoot(i,s)},n.prototype._splitRoot=function(t,e){this.data=f([t,e]),this.data.height=t.height+1,this.data.leaf=!1,a(this.data,this.toBBox)},n.prototype._chooseSplitIndex=function(t,e,i){for(var n,r,a,s,l,h,c,p=1/0,d=1/0,f=e;f<=i-e;f++){var g=o(t,0,f,this.toBBox),_=o(t,f,i,this.toBBox),y=(r=g,a=_,s=void 0,l=void 0,h=void 0,c=void 0,s=Math.max(r.minX,a.minX),l=Math.max(r.minY,a.minY),h=Math.min(r.maxX,a.maxX),c=Math.min(r.maxY,a.maxY),Math.max(0,h-s)*Math.max(0,c-l)),m=u(g)+u(_);y=e;d--){var f=t.children[d];s(l,t.leaf?r(f):f),h+=c(l)}return h},n.prototype._adjustParentBBoxes=function(t,e,i){for(var n=i;n>=0;n--)s(e[n],t)},n.prototype._condense=function(t){for(var e=t.length-1,i=void 0;e>=0;e--)0===t[e].children.length?e>0?(i=t[e-1].children).splice(i.indexOf(t[e]),1):this.clear():a(t[e],this.toBBox)},n}()}},e={};function i(n){var r=e[n];if(r!==undefined)return r.exports;var a=e[n]={id:n,loaded:!1,exports:{}};return t[n].call(a.exports,a,a.exports,i),a.loaded=!0,a.exports}i.n=t=>{var e=t&&t.__esModule?()=>t["default"]:()=>t;return i.d(e,{a:e}),e},i.d=(t,e)=>{for(var n in e)i.o(e,n)&&!i.o(t,n)&&Object.defineProperty(t,n,{enumerable:!0,get:e[n]})},i.g=function(){if("object"==typeof globalThis)return globalThis;try{return this||new Function("return this")()}catch(t){if("object"==typeof window)return window}}(),i.o=(t,e)=>Object.prototype.hasOwnProperty.call(t,e),i.nmd=t=>(t.paths=[],t.children||(t.children=[]),t);i(1052)})(); \ No newline at end of file diff --git a/public/js/leaflet/leaflet-providers.js b/public/js/leaflet/leaflet-providers.js new file mode 100644 index 000000000..e9986a973 --- /dev/null +++ b/public/js/leaflet/leaflet-providers.js @@ -0,0 +1,1100 @@ +(function (root, factory) { + if (typeof define === 'function' && define.amd) { + // AMD. Register as an anonymous module. + define(['leaflet'], factory); + } else if (typeof modules === 'object' && module.exports) { + // define a Common JS module that relies on 'leaflet' + module.exports = factory(require('leaflet')); + } else { + // Assume Leaflet is loaded into global object L already + factory(L); + } +}(this, function (L) { + 'use strict'; + + L.TileLayer.Provider = L.TileLayer.extend({ + initialize: function (arg, options) { + var providers = L.TileLayer.Provider.providers; + + var parts = arg.split('.'); + + var providerName = parts[0]; + var variantName = parts[1]; + + if (!providers[providerName]) { + throw 'No such provider (' + providerName + ')'; + } + + var provider = { + url: providers[providerName].url, + options: providers[providerName].options + }; + + // overwrite values in provider from variant. + if (variantName && 'variants' in providers[providerName]) { + if (!(variantName in providers[providerName].variants)) { + throw 'No such variant of ' + providerName + ' (' + variantName + ')'; + } + var variant = providers[providerName].variants[variantName]; + var variantOptions; + if (typeof variant === 'string') { + variantOptions = { + variant: variant + }; + } else { + variantOptions = variant.options; + } + provider = { + url: variant.url || provider.url, + options: L.Util.extend({}, provider.options, variantOptions) + }; + } + + // replace attribution placeholders with their values from toplevel provider attribution, + // recursively + var attributionReplacer = function (attr) { + if (attr.indexOf('{attribution.') === -1) { + return attr; + } + return attr.replace(/\{attribution.(\w*)\}/g, + function (match, attributionName) { + return attributionReplacer(providers[attributionName].options.attribution); + } + ); + }; + provider.options.attribution = attributionReplacer(provider.options.attribution); + + // Compute final options combining provider options with any user overrides + var layerOpts = L.Util.extend({}, provider.options, options); + L.TileLayer.prototype.initialize.call(this, provider.url, layerOpts); + } + }); + + /** + * Definition of providers. + * see http://leafletjs.com/reference.html#tilelayer for options in the options map. + */ + + L.TileLayer.Provider.providers = { + OpenStreetMap: { + url: 'https://{s}.tile.openstreetmap.org/{z}/{x}/{y}.png', + options: { + maxZoom: 19, + attribution: + '© OpenStreetMap contributors' + }, + variants: { + Mapnik: {}, + DE: { + url: 'https://{s}.tile.openstreetmap.de/tiles/osmde/{z}/{x}/{y}.png', + options: { + maxZoom: 18 + } + }, + CH: { + url: 'https://tile.osm.ch/switzerland/{z}/{x}/{y}.png', + options: { + maxZoom: 18, + bounds: [[45, 5], [48, 11]] + } + }, + France: { + url: 'https://{s}.tile.openstreetmap.fr/osmfr/{z}/{x}/{y}.png', + options: { + maxZoom: 20, + attribution: '© OpenStreetMap France | {attribution.OpenStreetMap}' + } + }, + HOT: { + url: 'https://{s}.tile.openstreetmap.fr/hot/{z}/{x}/{y}.png', + options: { + attribution: + '{attribution.OpenStreetMap}, ' + + 'Tiles style by Humanitarian OpenStreetMap Team ' + + 'hosted by OpenStreetMap France' + } + }, + BZH: { + url: 'https://tile.openstreetmap.bzh/br/{z}/{x}/{y}.png', + options: { + attribution: '{attribution.OpenStreetMap}, Tiles courtesy of Breton OpenStreetMap Team', + bounds: [[46.2, -5.5], [50, 0.7]] + } + } + } + }, + OpenSeaMap: { + url: 'https://tiles.openseamap.org/seamark/{z}/{x}/{y}.png', + options: { + attribution: 'Map data: © OpenSeaMap contributors' + } + }, + OPNVKarte: { + url: 'https://tileserver.memomaps.de/tilegen/{z}/{x}/{y}.png', + options: { + maxZoom: 18, + attribution: 'Map memomaps.de CC-BY-SA, map data {attribution.OpenStreetMap}' + } + }, + OpenTopoMap: { + url: 'https://{s}.tile.opentopomap.org/{z}/{x}/{y}.png', + options: { + maxZoom: 17, + attribution: 'Map data: {attribution.OpenStreetMap}, SRTM | Map style: © OpenTopoMap (CC-BY-SA)' + } + }, + OpenRailwayMap: { + url: 'https://{s}.tiles.openrailwaymap.org/standard/{z}/{x}/{y}.png', + options: { + maxZoom: 19, + attribution: 'Map data: {attribution.OpenStreetMap} | Map style: © OpenRailwayMap (CC-BY-SA)' + } + }, + OpenFireMap: { + url: 'http://openfiremap.org/hytiles/{z}/{x}/{y}.png', + options: { + maxZoom: 19, + attribution: 'Map data: {attribution.OpenStreetMap} | Map style: © OpenFireMap (CC-BY-SA)' + } + }, + SafeCast: { + url: 'https://s3.amazonaws.com/te512.safecast.org/{z}/{x}/{y}.png', + options: { + maxZoom: 16, + attribution: 'Map data: {attribution.OpenStreetMap} | Map style: © SafeCast (CC-BY-SA)' + } + }, + Stadia: { + url: 'https://tiles.stadiamaps.com/tiles/alidade_smooth/{z}/{x}/{y}{r}.png', + options: { + maxZoom: 20, + attribution: '© Stadia Maps, © OpenMapTiles © OpenStreetMap contributors' + }, + variants: { + AlidadeSmooth: { + url: 'https://tiles.stadiamaps.com/tiles/alidade_smooth/{z}/{x}/{y}{r}.png' + }, + AlidadeSmoothDark: { + url: 'https://tiles.stadiamaps.com/tiles/alidade_smooth_dark/{z}/{x}/{y}{r}.png' + }, + OSMBright: { + url: 'https://tiles.stadiamaps.com/tiles/osm_bright/{z}/{x}/{y}{r}.png' + }, + Outdoors: { + url: 'https://tiles.stadiamaps.com/tiles/outdoors/{z}/{x}/{y}{r}.png' + } + } + }, + Thunderforest: { + url: 'https://{s}.tile.thunderforest.com/{variant}/{z}/{x}/{y}.png?apikey={apikey}', + options: { + attribution: + '© Thunderforest, {attribution.OpenStreetMap}', + variant: 'cycle', + apikey: '', + maxZoom: 22 + }, + variants: { + OpenCycleMap: 'cycle', + Transport: { + options: { + variant: 'transport' + } + }, + TransportDark: { + options: { + variant: 'transport-dark' + } + }, + SpinalMap: { + options: { + variant: 'spinal-map' + } + }, + Landscape: 'landscape', + Outdoors: 'outdoors', + Pioneer: 'pioneer', + MobileAtlas: 'mobile-atlas', + Neighbourhood: 'neighbourhood' + } + }, + CyclOSM: { + url: 'https://{s}.tile-cyclosm.openstreetmap.fr/cyclosm/{z}/{x}/{y}.png', + options: { + maxZoom: 20, + attribution: 'CyclOSM | Map data: {attribution.OpenStreetMap}' + } + }, + Hydda: { + url: 'https://{s}.tile.openstreetmap.se/hydda/{variant}/{z}/{x}/{y}.png', + options: { + maxZoom: 20, + variant: 'full', + attribution: 'Tiles courtesy of OpenStreetMap Sweden — Map data {attribution.OpenStreetMap}' + }, + variants: { + Full: 'full', + Base: 'base', + RoadsAndLabels: 'roads_and_labels' + } + }, + Jawg: { + url: 'https://{s}.tile.jawg.io/{variant}/{z}/{x}/{y}{r}.png?access-token={accessToken}', + options: { + attribution: + '© JawgMaps ' + + '{attribution.OpenStreetMap}', + minZoom: 0, + maxZoom: 22, + subdomains: 'abcd', + variant: 'jawg-terrain', + // Get your own Jawg access token here : https://www.jawg.io/lab/ + // NB : this is a demonstration key that comes with no guarantee + accessToken: '', + }, + variants: { + Streets: 'jawg-streets', + Terrain: 'jawg-terrain', + Sunny: 'jawg-sunny', + Dark: 'jawg-dark', + Light: 'jawg-light', + Matrix: 'jawg-matrix' + } + }, + MapBox: { + url: 'https://api.mapbox.com/styles/v1/{id}/tiles/{z}/{x}/{y}{r}?access_token={accessToken}', + options: { + attribution: + '© Mapbox ' + + '{attribution.OpenStreetMap} ' + + 'Improve this map', + tileSize: 512, + maxZoom: 18, + zoomOffset: -1, + id: 'mapbox/streets-v11', + accessToken: '', + } + }, + MapTiler: { + url: 'https://api.maptiler.com/maps/{variant}/{z}/{x}/{y}{r}.{ext}?key={key}', + options: { + attribution: + '© MapTiler © OpenStreetMap contributors', + variant: 'streets', + ext: 'png', + key: '', + tileSize: 512, + zoomOffset: -1, + minZoom: 0, + maxZoom: 21 + }, + variants: { + Streets: 'streets', + Basic: 'basic', + Bright: 'bright', + Pastel: 'pastel', + Positron: 'positron', + Hybrid: { + options: { + variant: 'hybrid', + ext: 'jpg' + } + }, + Toner: 'toner', + Topo: 'topo', + Voyager: 'voyager' + } + }, + Stamen: { + url: 'https://stamen-tiles-{s}.a.ssl.fastly.net/{variant}/{z}/{x}/{y}{r}.{ext}', + options: { + attribution: + 'Map tiles by Stamen Design, ' + + 'CC BY 3.0 — ' + + 'Map data {attribution.OpenStreetMap}', + subdomains: 'abcd', + minZoom: 0, + maxZoom: 20, + variant: 'toner', + ext: 'png' + }, + variants: { + Toner: 'toner', + TonerBackground: 'toner-background', + TonerHybrid: 'toner-hybrid', + TonerLines: 'toner-lines', + TonerLabels: 'toner-labels', + TonerLite: 'toner-lite', + Watercolor: { + url: 'https://stamen-tiles-{s}.a.ssl.fastly.net/{variant}/{z}/{x}/{y}.{ext}', + options: { + variant: 'watercolor', + ext: 'jpg', + minZoom: 1, + maxZoom: 16 + } + }, + Terrain: { + options: { + variant: 'terrain', + minZoom: 0, + maxZoom: 18 + } + }, + TerrainBackground: { + options: { + variant: 'terrain-background', + minZoom: 0, + maxZoom: 18 + } + }, + TerrainLabels: { + options: { + variant: 'terrain-labels', + minZoom: 0, + maxZoom: 18 + } + }, + TopOSMRelief: { + url: 'https://stamen-tiles-{s}.a.ssl.fastly.net/{variant}/{z}/{x}/{y}.{ext}', + options: { + variant: 'toposm-color-relief', + ext: 'jpg', + bounds: [[22, -132], [51, -56]] + } + }, + TopOSMFeatures: { + options: { + variant: 'toposm-features', + bounds: [[22, -132], [51, -56]], + opacity: 0.9 + } + } + } + }, + TomTom: { + url: 'https://{s}.api.tomtom.com/map/1/tile/{variant}/{style}/{z}/{x}/{y}.{ext}?key={apikey}', + options: { + variant: 'basic', + maxZoom: 22, + attribution: + '© 1992 - ' + new Date().getFullYear() + ' TomTom. ', + subdomains: 'abcd', + style: 'main', + ext: 'png', + apikey: '', + }, + variants: { + Basic: 'basic', + Hybrid: 'hybrid', + Labels: 'labels' + } + }, + Esri: { + url: 'https://server.arcgisonline.com/ArcGIS/rest/services/{variant}/MapServer/tile/{z}/{y}/{x}', + options: { + variant: 'World_Street_Map', + attribution: 'Tiles © Esri' + }, + variants: { + WorldStreetMap: { + options: { + attribution: + '{attribution.Esri} — ' + + 'Source: Esri, DeLorme, NAVTEQ, USGS, Intermap, iPC, NRCAN, Esri Japan, METI, Esri China (Hong Kong), Esri (Thailand), TomTom, 2012' + } + }, + DeLorme: { + options: { + variant: 'Specialty/DeLorme_World_Base_Map', + minZoom: 1, + maxZoom: 11, + attribution: '{attribution.Esri} — Copyright: ©2012 DeLorme' + } + }, + WorldTopoMap: { + options: { + variant: 'World_Topo_Map', + attribution: + '{attribution.Esri} — ' + + 'Esri, DeLorme, NAVTEQ, TomTom, Intermap, iPC, USGS, FAO, NPS, NRCAN, GeoBase, Kadaster NL, Ordnance Survey, Esri Japan, METI, Esri China (Hong Kong), and the GIS User Community' + } + }, + WorldImagery: { + options: { + variant: 'World_Imagery', + attribution: + '{attribution.Esri} — ' + + 'Source: Esri, i-cubed, USDA, USGS, AEX, GeoEye, Getmapping, Aerogrid, IGN, IGP, UPR-EGP, and the GIS User Community' + } + }, + WorldTerrain: { + options: { + variant: 'World_Terrain_Base', + maxZoom: 13, + attribution: + '{attribution.Esri} — ' + + 'Source: USGS, Esri, TANA, DeLorme, and NPS' + } + }, + WorldShadedRelief: { + options: { + variant: 'World_Shaded_Relief', + maxZoom: 13, + attribution: '{attribution.Esri} — Source: Esri' + } + }, + WorldPhysical: { + options: { + variant: 'World_Physical_Map', + maxZoom: 8, + attribution: '{attribution.Esri} — Source: US National Park Service' + } + }, + OceanBasemap: { + options: { + variant: 'Ocean_Basemap', + maxZoom: 13, + attribution: '{attribution.Esri} — Sources: GEBCO, NOAA, CHS, OSU, UNH, CSUMB, National Geographic, DeLorme, NAVTEQ, and Esri' + } + }, + NatGeoWorldMap: { + options: { + variant: 'NatGeo_World_Map', + maxZoom: 16, + attribution: '{attribution.Esri} — National Geographic, Esri, DeLorme, NAVTEQ, UNEP-WCMC, USGS, NASA, ESA, METI, NRCAN, GEBCO, NOAA, iPC' + } + }, + WorldGrayCanvas: { + options: { + variant: 'Canvas/World_Light_Gray_Base', + maxZoom: 16, + attribution: '{attribution.Esri} — Esri, DeLorme, NAVTEQ' + } + } + } + }, + OpenWeatherMap: { + url: 'http://{s}.tile.openweathermap.org/map/{variant}/{z}/{x}/{y}.png?appid={apiKey}', + options: { + maxZoom: 19, + attribution: 'Map data © OpenWeatherMap', + apiKey: '', + opacity: 0.5 + }, + variants: { + Clouds: 'clouds', + CloudsClassic: 'clouds_cls', + Precipitation: 'precipitation', + PrecipitationClassic: 'precipitation_cls', + Rain: 'rain', + RainClassic: 'rain_cls', + Pressure: 'pressure', + PressureContour: 'pressure_cntr', + Wind: 'wind', + Temperature: 'temp', + Snow: 'snow' + } + }, + HERE: { + /* + * HERE maps, formerly Nokia maps. + * These basemaps are free, but you need an api id and app key. Please sign up at + * https://developer.here.com/plans + */ + url: + 'https://{s}.{base}.maps.api.here.com/maptile/2.1/' + + '{type}/{mapID}/{variant}/{z}/{x}/{y}/{size}/{format}?' + + 'app_id={app_id}&app_code={app_code}&lg={language}', + options: { + attribution: + 'Map © 1987-' + new Date().getFullYear() + ' HERE', + subdomains: '1234', + mapID: 'newest', + 'app_id': '', + 'app_code': '', + base: 'base', + variant: 'normal.day', + maxZoom: 20, + type: 'maptile', + language: 'eng', + format: 'png8', + size: '256' + }, + variants: { + normalDay: 'normal.day', + normalDayCustom: 'normal.day.custom', + normalDayGrey: 'normal.day.grey', + normalDayMobile: 'normal.day.mobile', + normalDayGreyMobile: 'normal.day.grey.mobile', + normalDayTransit: 'normal.day.transit', + normalDayTransitMobile: 'normal.day.transit.mobile', + normalDayTraffic: { + options: { + variant: 'normal.traffic.day', + base: 'traffic', + type: 'traffictile' + } + }, + normalNight: 'normal.night', + normalNightMobile: 'normal.night.mobile', + normalNightGrey: 'normal.night.grey', + normalNightGreyMobile: 'normal.night.grey.mobile', + normalNightTransit: 'normal.night.transit', + normalNightTransitMobile: 'normal.night.transit.mobile', + reducedDay: 'reduced.day', + reducedNight: 'reduced.night', + basicMap: { + options: { + type: 'basetile' + } + }, + mapLabels: { + options: { + type: 'labeltile', + format: 'png' + } + }, + trafficFlow: { + options: { + base: 'traffic', + type: 'flowtile' + } + }, + carnavDayGrey: 'carnav.day.grey', + hybridDay: { + options: { + base: 'aerial', + variant: 'hybrid.day' + } + }, + hybridDayMobile: { + options: { + base: 'aerial', + variant: 'hybrid.day.mobile' + } + }, + hybridDayTransit: { + options: { + base: 'aerial', + variant: 'hybrid.day.transit' + } + }, + hybridDayGrey: { + options: { + base: 'aerial', + variant: 'hybrid.grey.day' + } + }, + hybridDayTraffic: { + options: { + variant: 'hybrid.traffic.day', + base: 'traffic', + type: 'traffictile' + } + }, + pedestrianDay: 'pedestrian.day', + pedestrianNight: 'pedestrian.night', + satelliteDay: { + options: { + base: 'aerial', + variant: 'satellite.day' + } + }, + terrainDay: { + options: { + base: 'aerial', + variant: 'terrain.day' + } + }, + terrainDayMobile: { + options: { + base: 'aerial', + variant: 'terrain.day.mobile' + } + } + } + }, + HEREv3: { + /* + * HERE maps API Version 3. + * These basemaps are free, but you need an API key. Please sign up at + * https://developer.here.com/plans + * Version 3 deprecates the app_id and app_code access in favor of apiKey + * + * Supported access methods as of 2019/12/21: + * @see https://developer.here.com/faqs#access-control-1--how-do-you-control-access-to-here-location-services + */ + url: + 'https://{s}.{base}.maps.ls.hereapi.com/maptile/2.1/' + + '{type}/{mapID}/{variant}/{z}/{x}/{y}/{size}/{format}?' + + 'apiKey={apiKey}&lg={language}', + options: { + attribution: + 'Map © 1987-' + new Date().getFullYear() + ' HERE', + subdomains: '1234', + mapID: 'newest', + apiKey: '', + base: 'base', + variant: 'normal.day', + maxZoom: 20, + type: 'maptile', + language: 'eng', + format: 'png8', + size: '256' + }, + variants: { + normalDay: 'normal.day', + normalDayCustom: 'normal.day.custom', + normalDayGrey: 'normal.day.grey', + normalDayMobile: 'normal.day.mobile', + normalDayGreyMobile: 'normal.day.grey.mobile', + normalDayTransit: 'normal.day.transit', + normalDayTransitMobile: 'normal.day.transit.mobile', + normalNight: 'normal.night', + normalNightMobile: 'normal.night.mobile', + normalNightGrey: 'normal.night.grey', + normalNightGreyMobile: 'normal.night.grey.mobile', + normalNightTransit: 'normal.night.transit', + normalNightTransitMobile: 'normal.night.transit.mobile', + reducedDay: 'reduced.day', + reducedNight: 'reduced.night', + basicMap: { + options: { + type: 'basetile' + } + }, + mapLabels: { + options: { + type: 'labeltile', + format: 'png' + } + }, + trafficFlow: { + options: { + base: 'traffic', + type: 'flowtile' + } + }, + carnavDayGrey: 'carnav.day.grey', + hybridDay: { + options: { + base: 'aerial', + variant: 'hybrid.day' + } + }, + hybridDayMobile: { + options: { + base: 'aerial', + variant: 'hybrid.day.mobile' + } + }, + hybridDayTransit: { + options: { + base: 'aerial', + variant: 'hybrid.day.transit' + } + }, + hybridDayGrey: { + options: { + base: 'aerial', + variant: 'hybrid.grey.day' + } + }, + pedestrianDay: 'pedestrian.day', + pedestrianNight: 'pedestrian.night', + satelliteDay: { + options: { + base: 'aerial', + variant: 'satellite.day' + } + }, + terrainDay: { + options: { + base: 'aerial', + variant: 'terrain.day' + } + }, + terrainDayMobile: { + options: { + base: 'aerial', + variant: 'terrain.day.mobile' + } + } + } + }, + FreeMapSK: { + url: 'https://{s}.freemap.sk/T/{z}/{x}/{y}.jpeg', + options: { + minZoom: 8, + maxZoom: 16, + subdomains: 'abcd', + bounds: [[47.204642, 15.996093], [49.830896, 22.576904]], + attribution: + '{attribution.OpenStreetMap}, vizualization CC-By-SA 2.0 Freemap.sk' + } + }, + MtbMap: { + url: 'http://tile.mtbmap.cz/mtbmap_tiles/{z}/{x}/{y}.png', + options: { + attribution: + '{attribution.OpenStreetMap} & USGS' + } + }, + CartoDB: { + url: 'https://{s}.basemaps.cartocdn.com/{variant}/{z}/{x}/{y}{r}.png', + options: { + attribution: '{attribution.OpenStreetMap} © CARTO', + subdomains: 'abcd', + maxZoom: 20, + variant: 'light_all' + }, + variants: { + Positron: 'light_all', + PositronNoLabels: 'light_nolabels', + PositronOnlyLabels: 'light_only_labels', + DarkMatter: 'dark_all', + DarkMatterNoLabels: 'dark_nolabels', + DarkMatterOnlyLabels: 'dark_only_labels', + Voyager: 'rastertiles/voyager', + VoyagerNoLabels: 'rastertiles/voyager_nolabels', + VoyagerOnlyLabels: 'rastertiles/voyager_only_labels', + VoyagerLabelsUnder: 'rastertiles/voyager_labels_under' + } + }, + HikeBike: { + url: 'https://tiles.wmflabs.org/{variant}/{z}/{x}/{y}.png', + options: { + maxZoom: 19, + attribution: '{attribution.OpenStreetMap}', + variant: 'hikebike' + }, + variants: { + HikeBike: {}, + HillShading: { + options: { + maxZoom: 15, + variant: 'hillshading' + } + } + } + }, + BasemapAT: { + url: 'https://maps{s}.wien.gv.at/basemap/{variant}/{type}/google3857/{z}/{y}/{x}.{format}', + options: { + maxZoom: 19, + attribution: 'Datenquelle: basemap.at', + subdomains: ['', '1', '2', '3', '4'], + type: 'normal', + format: 'png', + bounds: [[46.358770, 8.782379], [49.037872, 17.189532]], + variant: 'geolandbasemap' + }, + variants: { + basemap: { + options: { + maxZoom: 20, // currently only in Vienna + variant: 'geolandbasemap' + } + }, + grau: 'bmapgrau', + overlay: 'bmapoverlay', + terrain: { + options: { + variant: 'bmapgelaende', + type: 'grau', + format: 'jpeg' + } + }, + surface: { + options: { + variant: 'bmapoberflaeche', + type: 'grau', + format: 'jpeg' + } + }, + highdpi: { + options: { + variant: 'bmaphidpi', + format: 'jpeg' + } + }, + orthofoto: { + options: { + maxZoom: 20, // currently only in Vienna + variant: 'bmaporthofoto30cm', + format: 'jpeg' + } + } + } + }, + nlmaps: { + url: 'https://geodata.nationaalgeoregister.nl/tiles/service/wmts/{variant}/EPSG:3857/{z}/{x}/{y}.png', + options: { + minZoom: 6, + maxZoom: 19, + bounds: [[50.5, 3.25], [54, 7.6]], + attribution: 'Kaartgegevens © Kadaster' + }, + variants: { + 'standaard': 'brtachtergrondkaart', + 'pastel': 'brtachtergrondkaartpastel', + 'grijs': 'brtachtergrondkaartgrijs', + 'luchtfoto': { + 'url': 'https://service.pdok.nl/hwh/luchtfotorgb/wmts/v1_0/Actueel_ortho25/EPSG:3857/{z}/{x}/{y}.jpeg', + } + } + }, + NASAGIBS: { + url: 'https://map1.vis.earthdata.nasa.gov/wmts-webmerc/{variant}/default/{time}/{tilematrixset}{maxZoom}/{z}/{y}/{x}.{format}', + options: { + attribution: + 'Imagery provided by services from the Global Imagery Browse Services (GIBS), operated by the NASA/GSFC/Earth Science Data and Information System ' + + '(ESDIS) with funding provided by NASA/HQ.', + bounds: [[-85.0511287776, -179.999999975], [85.0511287776, 179.999999975]], + minZoom: 1, + maxZoom: 9, + format: 'jpg', + time: '', + tilematrixset: 'GoogleMapsCompatible_Level' + }, + variants: { + ModisTerraTrueColorCR: 'MODIS_Terra_CorrectedReflectance_TrueColor', + ModisTerraBands367CR: 'MODIS_Terra_CorrectedReflectance_Bands367', + ViirsEarthAtNight2012: { + options: { + variant: 'VIIRS_CityLights_2012', + maxZoom: 8 + } + }, + ModisTerraLSTDay: { + options: { + variant: 'MODIS_Terra_Land_Surface_Temp_Day', + format: 'png', + maxZoom: 7, + opacity: 0.75 + } + }, + ModisTerraSnowCover: { + options: { + variant: 'MODIS_Terra_NDSI_Snow_Cover', + format: 'png', + maxZoom: 8, + opacity: 0.75 + } + }, + ModisTerraAOD: { + options: { + variant: 'MODIS_Terra_Aerosol', + format: 'png', + maxZoom: 6, + opacity: 0.75 + } + }, + ModisTerraChlorophyll: { + options: { + variant: 'MODIS_Terra_Chlorophyll_A', + format: 'png', + maxZoom: 7, + opacity: 0.75 + } + } + } + }, + NLS: { + // NLS maps are copyright National library of Scotland. + // http://maps.nls.uk/projects/api/index.html + // Please contact NLS for anything other than non-commercial low volume usage + // + // Map sources: Ordnance Survey 1:1m to 1:63K, 1920s-1940s + // z0-9 - 1:1m + // z10-11 - quarter inch (1:253440) + // z12-18 - one inch (1:63360) + url: 'https://nls-{s}.tileserver.com/nls/{z}/{x}/{y}.jpg', + options: { + attribution: 'National Library of Scotland Historic Maps', + bounds: [[49.6, -12], [61.7, 3]], + minZoom: 1, + maxZoom: 18, + subdomains: '0123', + } + }, + JusticeMap: { + // Justice Map (http://www.justicemap.org/) + // Visualize race and income data for your community, county and country. + // Includes tools for data journalists, bloggers and community activists. + url: 'https://www.justicemap.org/tile/{size}/{variant}/{z}/{x}/{y}.png', + options: { + attribution: 'Justice Map', + // one of 'county', 'tract', 'block' + size: 'county', + // Bounds for USA, including Alaska and Hawaii + bounds: [[14, -180], [72, -56]] + }, + variants: { + income: 'income', + americanIndian: 'indian', + asian: 'asian', + black: 'black', + hispanic: 'hispanic', + multi: 'multi', + nonWhite: 'nonwhite', + white: 'white', + plurality: 'plural' + } + }, + GeoportailFrance: { + url: 'https://wxs.ign.fr/{apikey}/geoportail/wmts?REQUEST=GetTile&SERVICE=WMTS&VERSION=1.0.0&STYLE={style}&TILEMATRIXSET=PM&FORMAT={format}&LAYER={variant}&TILEMATRIX={z}&TILEROW={y}&TILECOL={x}', + options: { + attribution: 'Geoportail France', + bounds: [[-75, -180], [81, 180]], + minZoom: 2, + maxZoom: 18, + // Get your own geoportail apikey here : http://professionnels.ign.fr/ign/contrats/ + // NB : 'choisirgeoportail' is a demonstration key that comes with no guarantee + apikey: 'choisirgeoportail', + format: 'image/png', + style: 'normal', + variant: 'GEOGRAPHICALGRIDSYSTEMS.PLANIGNV2' + }, + variants: { + plan: 'GEOGRAPHICALGRIDSYSTEMS.PLANIGNV2', + parcels: { + options: { + variant: 'CADASTRALPARCELS.PARCELLAIRE_EXPRESS', + style: 'PCI vecteur', + maxZoom: 20 + } + }, + orthos: { + options: { + maxZoom: 19, + format: 'image/jpeg', + variant: 'ORTHOIMAGERY.ORTHOPHOTOS' + } + } + } + }, + OneMapSG: { + url: 'https://maps-{s}.onemap.sg/v3/{variant}/{z}/{x}/{y}.png', + options: { + variant: 'Default', + minZoom: 11, + maxZoom: 18, + bounds: [[1.56073, 104.11475], [1.16, 103.502]], + attribution: ' New OneMap | Map data © contributors, Singapore Land Authority' + }, + variants: { + Default: 'Default', + Night: 'Night', + Original: 'Original', + Grey: 'Grey', + LandLot: 'LandLot' + } + }, + USGS: { + url: 'https://basemap.nationalmap.gov/arcgis/rest/services/USGSTopo/MapServer/tile/{z}/{y}/{x}', + options: { + maxZoom: 20, + attribution: 'Tiles courtesy of the U.S. Geological Survey' + }, + variants: { + USTopo: {}, + USImagery: { + url: 'https://basemap.nationalmap.gov/arcgis/rest/services/USGSImageryOnly/MapServer/tile/{z}/{y}/{x}' + }, + USImageryTopo: { + url: 'https://basemap.nationalmap.gov/arcgis/rest/services/USGSImageryTopo/MapServer/tile/{z}/{y}/{x}' + } + } + }, + WaymarkedTrails: { + url: 'https://tile.waymarkedtrails.org/{variant}/{z}/{x}/{y}.png', + options: { + maxZoom: 18, + attribution: 'Map data: {attribution.OpenStreetMap} | Map style: © waymarkedtrails.org (CC-BY-SA)' + }, + variants: { + hiking: 'hiking', + cycling: 'cycling', + mtb: 'mtb', + slopes: 'slopes', + riding: 'riding', + skating: 'skating' + } + }, + OpenAIP: { + url: 'https://{s}.tile.maps.openaip.net/geowebcache/service/tms/1.0.0/openaip_basemap@EPSG%3A900913@png/{z}/{x}/{y}.{ext}', + options: { + attribution: 'openAIP Data (CC-BY-NC-SA)', + ext: 'png', + minZoom: 4, + maxZoom: 14, + tms: true, + detectRetina: true, + subdomains: '12' + } + }, + OpenSnowMap: { + url: 'https://tiles.opensnowmap.org/{variant}/{z}/{x}/{y}.png', + options: { + minZoom: 9, + maxZoom: 18, + attribution: 'Map data: {attribution.OpenStreetMap} & ODbL, © www.opensnowmap.org CC-BY-SA' + }, + variants: { + pistes: 'pistes', + } + }, + AzureMaps: { + url: + 'https://atlas.microsoft.com/map/tile?api-version={apiVersion}'+ + '&tilesetId={variant}&x={x}&y={y}&zoom={z}&language={language}'+ + '&subscription-key={subscriptionKey}', + options: { + attribution: 'See https://docs.microsoft.com/en-US/rest/api/maps/renderv2/getmaptilepreview for details.', + apiVersion: '2.0', + variant: 'microsoft.imagery', + subscriptionKey: '', + language: 'en-US', + }, + variants: { + MicrosoftImagery: 'microsoft.imagery', + MicrosoftBaseDarkGrey: 'microsoft.base.darkgrey', + MicrosoftBaseRoad: 'microsoft.base.road', + MicrosoftBaseHybridRoad: 'microsoft.base.hybrid.road', + MicrosoftTerraMain: 'microsoft.terra.main', + MicrosoftWeatherInfraredMain: { + url: + 'https://atlas.microsoft.com/map/tile?api-version={apiVersion}'+ + '&tilesetId={variant}&x={x}&y={y}&zoom={z}'+ + '&timeStamp={timeStamp}&language={language}' + + '&subscription-key={subscriptionKey}', + options: { + timeStamp: '2021-05-08T09:03:00Z', + attribution: 'See https://docs.microsoft.com/en-US/rest/api/maps/renderv2/getmaptilepreview#uri-parameters for details.', + variant: 'microsoft.weather.infrared.main', + }, + }, + MicrosoftWeatherRadarMain: { + url: + 'https://atlas.microsoft.com/map/tile?api-version={apiVersion}'+ + '&tilesetId={variant}&x={x}&y={y}&zoom={z}'+ + '&timeStamp={timeStamp}&language={language}' + + '&subscription-key={subscriptionKey}', + options: { + timeStamp: '2021-05-08T09:03:00Z', + attribution: 'See https://docs.microsoft.com/en-US/rest/api/maps/renderv2/getmaptilepreview#uri-parameters for details.', + variant: 'microsoft.weather.radar.main', + }, + } + }, + } + }; + + L.tileLayer.provider = function (provider, options) { + return new L.TileLayer.Provider(provider, options); + }; + + return L; +})); diff --git a/public/js/leaflet/leaflet-src.esm.js b/public/js/leaflet/leaflet-src.esm.js new file mode 100644 index 000000000..415fbfda4 --- /dev/null +++ b/public/js/leaflet/leaflet-src.esm.js @@ -0,0 +1,14033 @@ +/* @preserve + * Leaflet 1.8.0, a JS library for interactive maps. https://leafletjs.com + * (c) 2010-2022 Vladimir Agafonkin, (c) 2010-2011 CloudMade + */ + +var version = "1.8.0"; + +/* + * @namespace Util + * + * Various utility functions, used by Leaflet internally. + */ + +// @function extend(dest: Object, src?: Object): Object +// Merges the properties of the `src` object (or multiple objects) into `dest` object and returns the latter. Has an `L.extend` shortcut. +function extend(dest) { + var i, j, len, src; + + for (j = 1, len = arguments.length; j < len; j++) { + src = arguments[j]; + for (i in src) { + dest[i] = src[i]; + } + } + return dest; +} + +// @function create(proto: Object, properties?: Object): Object +// Compatibility polyfill for [Object.create](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Object/create) +var create$2 = Object.create || (function () { + function F() {} + return function (proto) { + F.prototype = proto; + return new F(); + }; +})(); + +// @function bind(fn: Function, …): Function +// Returns a new function bound to the arguments passed, like [Function.prototype.bind](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Function/bind). +// Has a `L.bind()` shortcut. +function bind(fn, obj) { + var slice = Array.prototype.slice; + + if (fn.bind) { + return fn.bind.apply(fn, slice.call(arguments, 1)); + } + + var args = slice.call(arguments, 2); + + return function () { + return fn.apply(obj, args.length ? args.concat(slice.call(arguments)) : arguments); + }; +} + +// @property lastId: Number +// Last unique ID used by [`stamp()`](#util-stamp) +var lastId = 0; + +// @function stamp(obj: Object): Number +// Returns the unique ID of an object, assigning it one if it doesn't have it. +function stamp(obj) { + if (!('_leaflet_id' in obj)) { + obj['_leaflet_id'] = ++lastId; + } + return obj._leaflet_id; +} + +// @function throttle(fn: Function, time: Number, context: Object): Function +// Returns a function which executes function `fn` with the given scope `context` +// (so that the `this` keyword refers to `context` inside `fn`'s code). The function +// `fn` will be called no more than one time per given amount of `time`. The arguments +// received by the bound function will be any arguments passed when binding the +// function, followed by any arguments passed when invoking the bound function. +// Has an `L.throttle` shortcut. +function throttle(fn, time, context) { + var lock, args, wrapperFn, later; + + later = function () { + // reset lock and call if queued + lock = false; + if (args) { + wrapperFn.apply(context, args); + args = false; + } + }; + + wrapperFn = function () { + if (lock) { + // called too soon, queue to call later + args = arguments; + + } else { + // call and lock until later + fn.apply(context, arguments); + setTimeout(later, time); + lock = true; + } + }; + + return wrapperFn; +} + +// @function wrapNum(num: Number, range: Number[], includeMax?: Boolean): Number +// Returns the number `num` modulo `range` in such a way so it lies within +// `range[0]` and `range[1]`. The returned value will be always smaller than +// `range[1]` unless `includeMax` is set to `true`. +function wrapNum(x, range, includeMax) { + var max = range[1], + min = range[0], + d = max - min; + return x === max && includeMax ? x : ((x - min) % d + d) % d + min; +} + +// @function falseFn(): Function +// Returns a function which always returns `false`. +function falseFn() { return false; } + +// @function formatNum(num: Number, precision?: Number|false): Number +// Returns the number `num` rounded with specified `precision`. +// The default `precision` value is 6 decimal places. +// `false` can be passed to skip any processing (can be useful to avoid round-off errors). +function formatNum(num, precision) { + if (precision === false) { return num; } + var pow = Math.pow(10, precision === undefined ? 6 : precision); + return Math.round(num * pow) / pow; +} + +// @function trim(str: String): String +// Compatibility polyfill for [String.prototype.trim](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/String/Trim) +function trim(str) { + return str.trim ? str.trim() : str.replace(/^\s+|\s+$/g, ''); +} + +// @function splitWords(str: String): String[] +// Trims and splits the string on whitespace and returns the array of parts. +function splitWords(str) { + return trim(str).split(/\s+/); +} + +// @function setOptions(obj: Object, options: Object): Object +// Merges the given properties to the `options` of the `obj` object, returning the resulting options. See `Class options`. Has an `L.setOptions` shortcut. +function setOptions(obj, options) { + if (!Object.prototype.hasOwnProperty.call(obj, 'options')) { + obj.options = obj.options ? create$2(obj.options) : {}; + } + for (var i in options) { + obj.options[i] = options[i]; + } + return obj.options; +} + +// @function getParamString(obj: Object, existingUrl?: String, uppercase?: Boolean): String +// Converts an object into a parameter URL string, e.g. `{a: "foo", b: "bar"}` +// translates to `'?a=foo&b=bar'`. If `existingUrl` is set, the parameters will +// be appended at the end. If `uppercase` is `true`, the parameter names will +// be uppercased (e.g. `'?A=foo&B=bar'`) +function getParamString(obj, existingUrl, uppercase) { + var params = []; + for (var i in obj) { + params.push(encodeURIComponent(uppercase ? i.toUpperCase() : i) + '=' + encodeURIComponent(obj[i])); + } + return ((!existingUrl || existingUrl.indexOf('?') === -1) ? '?' : '&') + params.join('&'); +} + +var templateRe = /\{ *([\w_ -]+) *\}/g; + +// @function template(str: String, data: Object): String +// Simple templating facility, accepts a template string of the form `'Hello {a}, {b}'` +// and a data object like `{a: 'foo', b: 'bar'}`, returns evaluated string +// `('Hello foo, bar')`. You can also specify functions instead of strings for +// data values — they will be evaluated passing `data` as an argument. +function template(str, data) { + return str.replace(templateRe, function (str, key) { + var value = data[key]; + + if (value === undefined) { + throw new Error('No value provided for variable ' + str); + + } else if (typeof value === 'function') { + value = value(data); + } + return value; + }); +} + +// @function isArray(obj): Boolean +// Compatibility polyfill for [Array.isArray](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/isArray) +var isArray = Array.isArray || function (obj) { + return (Object.prototype.toString.call(obj) === '[object Array]'); +}; + +// @function indexOf(array: Array, el: Object): Number +// Compatibility polyfill for [Array.prototype.indexOf](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/indexOf) +function indexOf(array, el) { + for (var i = 0; i < array.length; i++) { + if (array[i] === el) { return i; } + } + return -1; +} + +// @property emptyImageUrl: String +// Data URI string containing a base64-encoded empty GIF image. +// Used as a hack to free memory from unused images on WebKit-powered +// mobile devices (by setting image `src` to this string). +var emptyImageUrl = 'data:image/gif;base64,R0lGODlhAQABAAD/ACwAAAAAAQABAAACADs='; + +// inspired by https://paulirish.com/2011/requestanimationframe-for-smart-animating/ + +function getPrefixed(name) { + return window['webkit' + name] || window['moz' + name] || window['ms' + name]; +} + +var lastTime = 0; + +// fallback for IE 7-8 +function timeoutDefer(fn) { + var time = +new Date(), + timeToCall = Math.max(0, 16 - (time - lastTime)); + + lastTime = time + timeToCall; + return window.setTimeout(fn, timeToCall); +} + +var requestFn = window.requestAnimationFrame || getPrefixed('RequestAnimationFrame') || timeoutDefer; +var cancelFn = window.cancelAnimationFrame || getPrefixed('CancelAnimationFrame') || + getPrefixed('CancelRequestAnimationFrame') || function (id) { window.clearTimeout(id); }; + +// @function requestAnimFrame(fn: Function, context?: Object, immediate?: Boolean): Number +// Schedules `fn` to be executed when the browser repaints. `fn` is bound to +// `context` if given. When `immediate` is set, `fn` is called immediately if +// the browser doesn't have native support for +// [`window.requestAnimationFrame`](https://developer.mozilla.org/docs/Web/API/window/requestAnimationFrame), +// otherwise it's delayed. Returns a request ID that can be used to cancel the request. +function requestAnimFrame(fn, context, immediate) { + if (immediate && requestFn === timeoutDefer) { + fn.call(context); + } else { + return requestFn.call(window, bind(fn, context)); + } +} + +// @function cancelAnimFrame(id: Number): undefined +// Cancels a previous `requestAnimFrame`. See also [window.cancelAnimationFrame](https://developer.mozilla.org/docs/Web/API/window/cancelAnimationFrame). +function cancelAnimFrame(id) { + if (id) { + cancelFn.call(window, id); + } +} + +var Util = { + __proto__: null, + extend: extend, + create: create$2, + bind: bind, + get lastId () { return lastId; }, + stamp: stamp, + throttle: throttle, + wrapNum: wrapNum, + falseFn: falseFn, + formatNum: formatNum, + trim: trim, + splitWords: splitWords, + setOptions: setOptions, + getParamString: getParamString, + template: template, + isArray: isArray, + indexOf: indexOf, + emptyImageUrl: emptyImageUrl, + requestFn: requestFn, + cancelFn: cancelFn, + requestAnimFrame: requestAnimFrame, + cancelAnimFrame: cancelAnimFrame +}; + +// @class Class +// @aka L.Class + +// @section +// @uninheritable + +// Thanks to John Resig and Dean Edwards for inspiration! + +function Class() {} + +Class.extend = function (props) { + + // @function extend(props: Object): Function + // [Extends the current class](#class-inheritance) given the properties to be included. + // Returns a Javascript function that is a class constructor (to be called with `new`). + var NewClass = function () { + + setOptions(this); + + // call the constructor + if (this.initialize) { + this.initialize.apply(this, arguments); + } + + // call all constructor hooks + this.callInitHooks(); + }; + + var parentProto = NewClass.__super__ = this.prototype; + + var proto = create$2(parentProto); + proto.constructor = NewClass; + + NewClass.prototype = proto; + + // inherit parent's statics + for (var i in this) { + if (Object.prototype.hasOwnProperty.call(this, i) && i !== 'prototype' && i !== '__super__') { + NewClass[i] = this[i]; + } + } + + // mix static properties into the class + if (props.statics) { + extend(NewClass, props.statics); + } + + // mix includes into the prototype + if (props.includes) { + checkDeprecatedMixinEvents(props.includes); + extend.apply(null, [proto].concat(props.includes)); + } + + // mix given properties into the prototype + extend(proto, props); + delete proto.statics; + delete proto.includes; + + // merge options + if (proto.options) { + proto.options = parentProto.options ? create$2(parentProto.options) : {}; + extend(proto.options, props.options); + } + + proto._initHooks = []; + + // add method for calling all hooks + proto.callInitHooks = function () { + + if (this._initHooksCalled) { return; } + + if (parentProto.callInitHooks) { + parentProto.callInitHooks.call(this); + } + + this._initHooksCalled = true; + + for (var i = 0, len = proto._initHooks.length; i < len; i++) { + proto._initHooks[i].call(this); + } + }; + + return NewClass; +}; + + +// @function include(properties: Object): this +// [Includes a mixin](#class-includes) into the current class. +Class.include = function (props) { + var parentOptions = this.prototype.options; + extend(this.prototype, props); + if (props.options) { + this.prototype.options = parentOptions; + this.mergeOptions(props.options); + } + return this; +}; + +// @function mergeOptions(options: Object): this +// [Merges `options`](#class-options) into the defaults of the class. +Class.mergeOptions = function (options) { + extend(this.prototype.options, options); + return this; +}; + +// @function addInitHook(fn: Function): this +// Adds a [constructor hook](#class-constructor-hooks) to the class. +Class.addInitHook = function (fn) { // (Function) || (String, args...) + var args = Array.prototype.slice.call(arguments, 1); + + var init = typeof fn === 'function' ? fn : function () { + this[fn].apply(this, args); + }; + + this.prototype._initHooks = this.prototype._initHooks || []; + this.prototype._initHooks.push(init); + return this; +}; + +function checkDeprecatedMixinEvents(includes) { + if (typeof L === 'undefined' || !L || !L.Mixin) { return; } + + includes = isArray(includes) ? includes : [includes]; + + for (var i = 0; i < includes.length; i++) { + if (includes[i] === L.Mixin.Events) { + console.warn('Deprecated include of L.Mixin.Events: ' + + 'this property will be removed in future releases, ' + + 'please inherit from L.Evented instead.', new Error().stack); + } + } +} + +/* + * @class Evented + * @aka L.Evented + * @inherits Class + * + * A set of methods shared between event-powered classes (like `Map` and `Marker`). Generally, events allow you to execute some function when something happens with an object (e.g. the user clicks on the map, causing the map to fire `'click'` event). + * + * @example + * + * ```js + * map.on('click', function(e) { + * alert(e.latlng); + * } ); + * ``` + * + * Leaflet deals with event listeners by reference, so if you want to add a listener and then remove it, define it as a function: + * + * ```js + * function onClick(e) { ... } + * + * map.on('click', onClick); + * map.off('click', onClick); + * ``` + */ + +var Events = { + /* @method on(type: String, fn: Function, context?: Object): this + * Adds a listener function (`fn`) to a particular event type of the object. You can optionally specify the context of the listener (object the this keyword will point to). You can also pass several space-separated types (e.g. `'click dblclick'`). + * + * @alternative + * @method on(eventMap: Object): this + * Adds a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}` + */ + on: function (types, fn, context) { + + // types can be a map of types/handlers + if (typeof types === 'object') { + for (var type in types) { + // we don't process space-separated events here for performance; + // it's a hot path since Layer uses the on(obj) syntax + this._on(type, types[type], fn); + } + + } else { + // types can be a string of space-separated words + types = splitWords(types); + + for (var i = 0, len = types.length; i < len; i++) { + this._on(types[i], fn, context); + } + } + + return this; + }, + + /* @method off(type: String, fn?: Function, context?: Object): this + * Removes a previously added listener function. If no function is specified, it will remove all the listeners of that particular event from the object. Note that if you passed a custom context to `on`, you must pass the same context to `off` in order to remove the listener. + * + * @alternative + * @method off(eventMap: Object): this + * Removes a set of type/listener pairs. + * + * @alternative + * @method off: this + * Removes all listeners to all events on the object. This includes implicitly attached events. + */ + off: function (types, fn, context) { + + if (!arguments.length) { + // clear all listeners if called without arguments + delete this._events; + + } else if (typeof types === 'object') { + for (var type in types) { + this._off(type, types[type], fn); + } + + } else { + types = splitWords(types); + + var removeAll = arguments.length === 1; + for (var i = 0, len = types.length; i < len; i++) { + if (removeAll) { + this._off(types[i]); + } else { + this._off(types[i], fn, context); + } + } + } + + return this; + }, + + // attach listener (without syntactic sugar now) + _on: function (type, fn, context) { + if (typeof fn !== 'function') { + console.warn('wrong listener type: ' + typeof fn); + return; + } + this._events = this._events || {}; + + /* get/init listeners for type */ + var typeListeners = this._events[type]; + if (!typeListeners) { + typeListeners = []; + this._events[type] = typeListeners; + } + + if (context === this) { + // Less memory footprint. + context = undefined; + } + var newListener = {fn: fn, ctx: context}, + listeners = typeListeners; + + // check if fn already there + for (var i = 0, len = listeners.length; i < len; i++) { + if (listeners[i].fn === fn && listeners[i].ctx === context) { + return; + } + } + + listeners.push(newListener); + }, + + _off: function (type, fn, context) { + var listeners, + i, + len; + + if (!this._events) { return; } + + listeners = this._events[type]; + + if (!listeners) { + return; + } + + if (arguments.length === 1) { // remove all + if (this._firingCount) { + // Set all removed listeners to noop + // so they are not called if remove happens in fire + for (i = 0, len = listeners.length; i < len; i++) { + listeners[i].fn = falseFn; + } + } + // clear all listeners for a type if function isn't specified + delete this._events[type]; + return; + } + + if (context === this) { + context = undefined; + } + + if (typeof fn !== 'function') { + console.warn('wrong listener type: ' + typeof fn); + return; + } + // find fn and remove it + for (i = 0, len = listeners.length; i < len; i++) { + var l = listeners[i]; + if (l.ctx !== context) { continue; } + if (l.fn === fn) { + if (this._firingCount) { + // set the removed listener to noop so that's not called if remove happens in fire + l.fn = falseFn; + + /* copy array in case events are being fired */ + this._events[type] = listeners = listeners.slice(); + } + listeners.splice(i, 1); + + return; + } + } + console.warn('listener not found'); + }, + + // @method fire(type: String, data?: Object, propagate?: Boolean): this + // Fires an event of the specified type. You can optionally provide a data + // object — the first argument of the listener function will contain its + // properties. The event can optionally be propagated to event parents. + fire: function (type, data, propagate) { + if (!this.listens(type, propagate)) { return this; } + + var event = extend({}, data, { + type: type, + target: this, + sourceTarget: data && data.sourceTarget || this + }); + + if (this._events) { + var listeners = this._events[type]; + + if (listeners) { + this._firingCount = (this._firingCount + 1) || 1; + for (var i = 0, len = listeners.length; i < len; i++) { + var l = listeners[i]; + l.fn.call(l.ctx || this, event); + } + + this._firingCount--; + } + } + + if (propagate) { + // propagate the event to parents (set with addEventParent) + this._propagateEvent(event); + } + + return this; + }, + + // @method listens(type: String, propagate?: Boolean): Boolean + // Returns `true` if a particular event type has any listeners attached to it. + // The verification can optionally be propagated, it will return `true` if parents have the listener attached to it. + listens: function (type, propagate) { + if (typeof type !== 'string') { + console.warn('"string" type argument expected'); + } + var listeners = this._events && this._events[type]; + if (listeners && listeners.length) { return true; } + + if (propagate) { + // also check parents for listeners if event propagates + for (var id in this._eventParents) { + if (this._eventParents[id].listens(type, propagate)) { return true; } + } + } + return false; + }, + + // @method once(…): this + // Behaves as [`on(…)`](#evented-on), except the listener will only get fired once and then removed. + once: function (types, fn, context) { + + if (typeof types === 'object') { + for (var type in types) { + this.once(type, types[type], fn); + } + return this; + } + + var handler = bind(function () { + this + .off(types, fn, context) + .off(types, handler, context); + }, this); + + // add a listener that's executed once and removed after that + return this + .on(types, fn, context) + .on(types, handler, context); + }, + + // @method addEventParent(obj: Evented): this + // Adds an event parent - an `Evented` that will receive propagated events + addEventParent: function (obj) { + this._eventParents = this._eventParents || {}; + this._eventParents[stamp(obj)] = obj; + return this; + }, + + // @method removeEventParent(obj: Evented): this + // Removes an event parent, so it will stop receiving propagated events + removeEventParent: function (obj) { + if (this._eventParents) { + delete this._eventParents[stamp(obj)]; + } + return this; + }, + + _propagateEvent: function (e) { + for (var id in this._eventParents) { + this._eventParents[id].fire(e.type, extend({ + layer: e.target, + propagatedFrom: e.target + }, e), true); + } + } +}; + +// aliases; we should ditch those eventually + +// @method addEventListener(…): this +// Alias to [`on(…)`](#evented-on) +Events.addEventListener = Events.on; + +// @method removeEventListener(…): this +// Alias to [`off(…)`](#evented-off) + +// @method clearAllEventListeners(…): this +// Alias to [`off()`](#evented-off) +Events.removeEventListener = Events.clearAllEventListeners = Events.off; + +// @method addOneTimeEventListener(…): this +// Alias to [`once(…)`](#evented-once) +Events.addOneTimeEventListener = Events.once; + +// @method fireEvent(…): this +// Alias to [`fire(…)`](#evented-fire) +Events.fireEvent = Events.fire; + +// @method hasEventListeners(…): Boolean +// Alias to [`listens(…)`](#evented-listens) +Events.hasEventListeners = Events.listens; + +var Evented = Class.extend(Events); + +/* + * @class Point + * @aka L.Point + * + * Represents a point with `x` and `y` coordinates in pixels. + * + * @example + * + * ```js + * var point = L.point(200, 300); + * ``` + * + * All Leaflet methods and options that accept `Point` objects also accept them in a simple Array form (unless noted otherwise), so these lines are equivalent: + * + * ```js + * map.panBy([200, 300]); + * map.panBy(L.point(200, 300)); + * ``` + * + * Note that `Point` does not inherit from Leaflet's `Class` object, + * which means new classes can't inherit from it, and new methods + * can't be added to it with the `include` function. + */ + +function Point(x, y, round) { + // @property x: Number; The `x` coordinate of the point + this.x = (round ? Math.round(x) : x); + // @property y: Number; The `y` coordinate of the point + this.y = (round ? Math.round(y) : y); +} + +var trunc = Math.trunc || function (v) { + return v > 0 ? Math.floor(v) : Math.ceil(v); +}; + +Point.prototype = { + + // @method clone(): Point + // Returns a copy of the current point. + clone: function () { + return new Point(this.x, this.y); + }, + + // @method add(otherPoint: Point): Point + // Returns the result of addition of the current and the given points. + add: function (point) { + // non-destructive, returns a new point + return this.clone()._add(toPoint(point)); + }, + + _add: function (point) { + // destructive, used directly for performance in situations where it's safe to modify existing point + this.x += point.x; + this.y += point.y; + return this; + }, + + // @method subtract(otherPoint: Point): Point + // Returns the result of subtraction of the given point from the current. + subtract: function (point) { + return this.clone()._subtract(toPoint(point)); + }, + + _subtract: function (point) { + this.x -= point.x; + this.y -= point.y; + return this; + }, + + // @method divideBy(num: Number): Point + // Returns the result of division of the current point by the given number. + divideBy: function (num) { + return this.clone()._divideBy(num); + }, + + _divideBy: function (num) { + this.x /= num; + this.y /= num; + return this; + }, + + // @method multiplyBy(num: Number): Point + // Returns the result of multiplication of the current point by the given number. + multiplyBy: function (num) { + return this.clone()._multiplyBy(num); + }, + + _multiplyBy: function (num) { + this.x *= num; + this.y *= num; + return this; + }, + + // @method scaleBy(scale: Point): Point + // Multiply each coordinate of the current point by each coordinate of + // `scale`. In linear algebra terms, multiply the point by the + // [scaling matrix](https://en.wikipedia.org/wiki/Scaling_%28geometry%29#Matrix_representation) + // defined by `scale`. + scaleBy: function (point) { + return new Point(this.x * point.x, this.y * point.y); + }, + + // @method unscaleBy(scale: Point): Point + // Inverse of `scaleBy`. Divide each coordinate of the current point by + // each coordinate of `scale`. + unscaleBy: function (point) { + return new Point(this.x / point.x, this.y / point.y); + }, + + // @method round(): Point + // Returns a copy of the current point with rounded coordinates. + round: function () { + return this.clone()._round(); + }, + + _round: function () { + this.x = Math.round(this.x); + this.y = Math.round(this.y); + return this; + }, + + // @method floor(): Point + // Returns a copy of the current point with floored coordinates (rounded down). + floor: function () { + return this.clone()._floor(); + }, + + _floor: function () { + this.x = Math.floor(this.x); + this.y = Math.floor(this.y); + return this; + }, + + // @method ceil(): Point + // Returns a copy of the current point with ceiled coordinates (rounded up). + ceil: function () { + return this.clone()._ceil(); + }, + + _ceil: function () { + this.x = Math.ceil(this.x); + this.y = Math.ceil(this.y); + return this; + }, + + // @method trunc(): Point + // Returns a copy of the current point with truncated coordinates (rounded towards zero). + trunc: function () { + return this.clone()._trunc(); + }, + + _trunc: function () { + this.x = trunc(this.x); + this.y = trunc(this.y); + return this; + }, + + // @method distanceTo(otherPoint: Point): Number + // Returns the cartesian distance between the current and the given points. + distanceTo: function (point) { + point = toPoint(point); + + var x = point.x - this.x, + y = point.y - this.y; + + return Math.sqrt(x * x + y * y); + }, + + // @method equals(otherPoint: Point): Boolean + // Returns `true` if the given point has the same coordinates. + equals: function (point) { + point = toPoint(point); + + return point.x === this.x && + point.y === this.y; + }, + + // @method contains(otherPoint: Point): Boolean + // Returns `true` if both coordinates of the given point are less than the corresponding current point coordinates (in absolute values). + contains: function (point) { + point = toPoint(point); + + return Math.abs(point.x) <= Math.abs(this.x) && + Math.abs(point.y) <= Math.abs(this.y); + }, + + // @method toString(): String + // Returns a string representation of the point for debugging purposes. + toString: function () { + return 'Point(' + + formatNum(this.x) + ', ' + + formatNum(this.y) + ')'; + } +}; + +// @factory L.point(x: Number, y: Number, round?: Boolean) +// Creates a Point object with the given `x` and `y` coordinates. If optional `round` is set to true, rounds the `x` and `y` values. + +// @alternative +// @factory L.point(coords: Number[]) +// Expects an array of the form `[x, y]` instead. + +// @alternative +// @factory L.point(coords: Object) +// Expects a plain object of the form `{x: Number, y: Number}` instead. +function toPoint(x, y, round) { + if (x instanceof Point) { + return x; + } + if (isArray(x)) { + return new Point(x[0], x[1]); + } + if (x === undefined || x === null) { + return x; + } + if (typeof x === 'object' && 'x' in x && 'y' in x) { + return new Point(x.x, x.y); + } + return new Point(x, y, round); +} + +/* + * @class Bounds + * @aka L.Bounds + * + * Represents a rectangular area in pixel coordinates. + * + * @example + * + * ```js + * var p1 = L.point(10, 10), + * p2 = L.point(40, 60), + * bounds = L.bounds(p1, p2); + * ``` + * + * All Leaflet methods that accept `Bounds` objects also accept them in a simple Array form (unless noted otherwise), so the bounds example above can be passed like this: + * + * ```js + * otherBounds.intersects([[10, 10], [40, 60]]); + * ``` + * + * Note that `Bounds` does not inherit from Leaflet's `Class` object, + * which means new classes can't inherit from it, and new methods + * can't be added to it with the `include` function. + */ + +function Bounds(a, b) { + if (!a) { return; } + + var points = b ? [a, b] : a; + + for (var i = 0, len = points.length; i < len; i++) { + this.extend(points[i]); + } +} + +Bounds.prototype = { + // @method extend(point: Point): this + // Extends the bounds to contain the given point. + extend: function (point) { // (Point) + point = toPoint(point); + + // @property min: Point + // The top left corner of the rectangle. + // @property max: Point + // The bottom right corner of the rectangle. + if (!this.min && !this.max) { + this.min = point.clone(); + this.max = point.clone(); + } else { + this.min.x = Math.min(point.x, this.min.x); + this.max.x = Math.max(point.x, this.max.x); + this.min.y = Math.min(point.y, this.min.y); + this.max.y = Math.max(point.y, this.max.y); + } + return this; + }, + + // @method getCenter(round?: Boolean): Point + // Returns the center point of the bounds. + getCenter: function (round) { + return new Point( + (this.min.x + this.max.x) / 2, + (this.min.y + this.max.y) / 2, round); + }, + + // @method getBottomLeft(): Point + // Returns the bottom-left point of the bounds. + getBottomLeft: function () { + return new Point(this.min.x, this.max.y); + }, + + // @method getTopRight(): Point + // Returns the top-right point of the bounds. + getTopRight: function () { // -> Point + return new Point(this.max.x, this.min.y); + }, + + // @method getTopLeft(): Point + // Returns the top-left point of the bounds (i.e. [`this.min`](#bounds-min)). + getTopLeft: function () { + return this.min; // left, top + }, + + // @method getBottomRight(): Point + // Returns the bottom-right point of the bounds (i.e. [`this.max`](#bounds-max)). + getBottomRight: function () { + return this.max; // right, bottom + }, + + // @method getSize(): Point + // Returns the size of the given bounds + getSize: function () { + return this.max.subtract(this.min); + }, + + // @method contains(otherBounds: Bounds): Boolean + // Returns `true` if the rectangle contains the given one. + // @alternative + // @method contains(point: Point): Boolean + // Returns `true` if the rectangle contains the given point. + contains: function (obj) { + var min, max; + + if (typeof obj[0] === 'number' || obj instanceof Point) { + obj = toPoint(obj); + } else { + obj = toBounds(obj); + } + + if (obj instanceof Bounds) { + min = obj.min; + max = obj.max; + } else { + min = max = obj; + } + + return (min.x >= this.min.x) && + (max.x <= this.max.x) && + (min.y >= this.min.y) && + (max.y <= this.max.y); + }, + + // @method intersects(otherBounds: Bounds): Boolean + // Returns `true` if the rectangle intersects the given bounds. Two bounds + // intersect if they have at least one point in common. + intersects: function (bounds) { // (Bounds) -> Boolean + bounds = toBounds(bounds); + + var min = this.min, + max = this.max, + min2 = bounds.min, + max2 = bounds.max, + xIntersects = (max2.x >= min.x) && (min2.x <= max.x), + yIntersects = (max2.y >= min.y) && (min2.y <= max.y); + + return xIntersects && yIntersects; + }, + + // @method overlaps(otherBounds: Bounds): Boolean + // Returns `true` if the rectangle overlaps the given bounds. Two bounds + // overlap if their intersection is an area. + overlaps: function (bounds) { // (Bounds) -> Boolean + bounds = toBounds(bounds); + + var min = this.min, + max = this.max, + min2 = bounds.min, + max2 = bounds.max, + xOverlaps = (max2.x > min.x) && (min2.x < max.x), + yOverlaps = (max2.y > min.y) && (min2.y < max.y); + + return xOverlaps && yOverlaps; + }, + + isValid: function () { + return !!(this.min && this.max); + } +}; + + +// @factory L.bounds(corner1: Point, corner2: Point) +// Creates a Bounds object from two corners coordinate pairs. +// @alternative +// @factory L.bounds(points: Point[]) +// Creates a Bounds object from the given array of points. +function toBounds(a, b) { + if (!a || a instanceof Bounds) { + return a; + } + return new Bounds(a, b); +} + +/* + * @class LatLngBounds + * @aka L.LatLngBounds + * + * Represents a rectangular geographical area on a map. + * + * @example + * + * ```js + * var corner1 = L.latLng(40.712, -74.227), + * corner2 = L.latLng(40.774, -74.125), + * bounds = L.latLngBounds(corner1, corner2); + * ``` + * + * All Leaflet methods that accept LatLngBounds objects also accept them in a simple Array form (unless noted otherwise), so the bounds example above can be passed like this: + * + * ```js + * map.fitBounds([ + * [40.712, -74.227], + * [40.774, -74.125] + * ]); + * ``` + * + * Caution: if the area crosses the antimeridian (often confused with the International Date Line), you must specify corners _outside_ the [-180, 180] degrees longitude range. + * + * Note that `LatLngBounds` does not inherit from Leaflet's `Class` object, + * which means new classes can't inherit from it, and new methods + * can't be added to it with the `include` function. + */ + +function LatLngBounds(corner1, corner2) { // (LatLng, LatLng) or (LatLng[]) + if (!corner1) { return; } + + var latlngs = corner2 ? [corner1, corner2] : corner1; + + for (var i = 0, len = latlngs.length; i < len; i++) { + this.extend(latlngs[i]); + } +} + +LatLngBounds.prototype = { + + // @method extend(latlng: LatLng): this + // Extend the bounds to contain the given point + + // @alternative + // @method extend(otherBounds: LatLngBounds): this + // Extend the bounds to contain the given bounds + extend: function (obj) { + var sw = this._southWest, + ne = this._northEast, + sw2, ne2; + + if (obj instanceof LatLng) { + sw2 = obj; + ne2 = obj; + + } else if (obj instanceof LatLngBounds) { + sw2 = obj._southWest; + ne2 = obj._northEast; + + if (!sw2 || !ne2) { return this; } + + } else { + return obj ? this.extend(toLatLng(obj) || toLatLngBounds(obj)) : this; + } + + if (!sw && !ne) { + this._southWest = new LatLng(sw2.lat, sw2.lng); + this._northEast = new LatLng(ne2.lat, ne2.lng); + } else { + sw.lat = Math.min(sw2.lat, sw.lat); + sw.lng = Math.min(sw2.lng, sw.lng); + ne.lat = Math.max(ne2.lat, ne.lat); + ne.lng = Math.max(ne2.lng, ne.lng); + } + + return this; + }, + + // @method pad(bufferRatio: Number): LatLngBounds + // Returns bounds created by extending or retracting the current bounds by a given ratio in each direction. + // For example, a ratio of 0.5 extends the bounds by 50% in each direction. + // Negative values will retract the bounds. + pad: function (bufferRatio) { + var sw = this._southWest, + ne = this._northEast, + heightBuffer = Math.abs(sw.lat - ne.lat) * bufferRatio, + widthBuffer = Math.abs(sw.lng - ne.lng) * bufferRatio; + + return new LatLngBounds( + new LatLng(sw.lat - heightBuffer, sw.lng - widthBuffer), + new LatLng(ne.lat + heightBuffer, ne.lng + widthBuffer)); + }, + + // @method getCenter(): LatLng + // Returns the center point of the bounds. + getCenter: function () { + return new LatLng( + (this._southWest.lat + this._northEast.lat) / 2, + (this._southWest.lng + this._northEast.lng) / 2); + }, + + // @method getSouthWest(): LatLng + // Returns the south-west point of the bounds. + getSouthWest: function () { + return this._southWest; + }, + + // @method getNorthEast(): LatLng + // Returns the north-east point of the bounds. + getNorthEast: function () { + return this._northEast; + }, + + // @method getNorthWest(): LatLng + // Returns the north-west point of the bounds. + getNorthWest: function () { + return new LatLng(this.getNorth(), this.getWest()); + }, + + // @method getSouthEast(): LatLng + // Returns the south-east point of the bounds. + getSouthEast: function () { + return new LatLng(this.getSouth(), this.getEast()); + }, + + // @method getWest(): Number + // Returns the west longitude of the bounds + getWest: function () { + return this._southWest.lng; + }, + + // @method getSouth(): Number + // Returns the south latitude of the bounds + getSouth: function () { + return this._southWest.lat; + }, + + // @method getEast(): Number + // Returns the east longitude of the bounds + getEast: function () { + return this._northEast.lng; + }, + + // @method getNorth(): Number + // Returns the north latitude of the bounds + getNorth: function () { + return this._northEast.lat; + }, + + // @method contains(otherBounds: LatLngBounds): Boolean + // Returns `true` if the rectangle contains the given one. + + // @alternative + // @method contains (latlng: LatLng): Boolean + // Returns `true` if the rectangle contains the given point. + contains: function (obj) { // (LatLngBounds) or (LatLng) -> Boolean + if (typeof obj[0] === 'number' || obj instanceof LatLng || 'lat' in obj) { + obj = toLatLng(obj); + } else { + obj = toLatLngBounds(obj); + } + + var sw = this._southWest, + ne = this._northEast, + sw2, ne2; + + if (obj instanceof LatLngBounds) { + sw2 = obj.getSouthWest(); + ne2 = obj.getNorthEast(); + } else { + sw2 = ne2 = obj; + } + + return (sw2.lat >= sw.lat) && (ne2.lat <= ne.lat) && + (sw2.lng >= sw.lng) && (ne2.lng <= ne.lng); + }, + + // @method intersects(otherBounds: LatLngBounds): Boolean + // Returns `true` if the rectangle intersects the given bounds. Two bounds intersect if they have at least one point in common. + intersects: function (bounds) { + bounds = toLatLngBounds(bounds); + + var sw = this._southWest, + ne = this._northEast, + sw2 = bounds.getSouthWest(), + ne2 = bounds.getNorthEast(), + + latIntersects = (ne2.lat >= sw.lat) && (sw2.lat <= ne.lat), + lngIntersects = (ne2.lng >= sw.lng) && (sw2.lng <= ne.lng); + + return latIntersects && lngIntersects; + }, + + // @method overlaps(otherBounds: LatLngBounds): Boolean + // Returns `true` if the rectangle overlaps the given bounds. Two bounds overlap if their intersection is an area. + overlaps: function (bounds) { + bounds = toLatLngBounds(bounds); + + var sw = this._southWest, + ne = this._northEast, + sw2 = bounds.getSouthWest(), + ne2 = bounds.getNorthEast(), + + latOverlaps = (ne2.lat > sw.lat) && (sw2.lat < ne.lat), + lngOverlaps = (ne2.lng > sw.lng) && (sw2.lng < ne.lng); + + return latOverlaps && lngOverlaps; + }, + + // @method toBBoxString(): String + // Returns a string with bounding box coordinates in a 'southwest_lng,southwest_lat,northeast_lng,northeast_lat' format. Useful for sending requests to web services that return geo data. + toBBoxString: function () { + return [this.getWest(), this.getSouth(), this.getEast(), this.getNorth()].join(','); + }, + + // @method equals(otherBounds: LatLngBounds, maxMargin?: Number): Boolean + // Returns `true` if the rectangle is equivalent (within a small margin of error) to the given bounds. The margin of error can be overridden by setting `maxMargin` to a small number. + equals: function (bounds, maxMargin) { + if (!bounds) { return false; } + + bounds = toLatLngBounds(bounds); + + return this._southWest.equals(bounds.getSouthWest(), maxMargin) && + this._northEast.equals(bounds.getNorthEast(), maxMargin); + }, + + // @method isValid(): Boolean + // Returns `true` if the bounds are properly initialized. + isValid: function () { + return !!(this._southWest && this._northEast); + } +}; + +// TODO International date line? + +// @factory L.latLngBounds(corner1: LatLng, corner2: LatLng) +// Creates a `LatLngBounds` object by defining two diagonally opposite corners of the rectangle. + +// @alternative +// @factory L.latLngBounds(latlngs: LatLng[]) +// Creates a `LatLngBounds` object defined by the geographical points it contains. Very useful for zooming the map to fit a particular set of locations with [`fitBounds`](#map-fitbounds). +function toLatLngBounds(a, b) { + if (a instanceof LatLngBounds) { + return a; + } + return new LatLngBounds(a, b); +} + +/* @class LatLng + * @aka L.LatLng + * + * Represents a geographical point with a certain latitude and longitude. + * + * @example + * + * ``` + * var latlng = L.latLng(50.5, 30.5); + * ``` + * + * All Leaflet methods that accept LatLng objects also accept them in a simple Array form and simple object form (unless noted otherwise), so these lines are equivalent: + * + * ``` + * map.panTo([50, 30]); + * map.panTo({lon: 30, lat: 50}); + * map.panTo({lat: 50, lng: 30}); + * map.panTo(L.latLng(50, 30)); + * ``` + * + * Note that `LatLng` does not inherit from Leaflet's `Class` object, + * which means new classes can't inherit from it, and new methods + * can't be added to it with the `include` function. + */ + +function LatLng(lat, lng, alt) { + if (isNaN(lat) || isNaN(lng)) { + throw new Error('Invalid LatLng object: (' + lat + ', ' + lng + ')'); + } + + // @property lat: Number + // Latitude in degrees + this.lat = +lat; + + // @property lng: Number + // Longitude in degrees + this.lng = +lng; + + // @property alt: Number + // Altitude in meters (optional) + if (alt !== undefined) { + this.alt = +alt; + } +} + +LatLng.prototype = { + // @method equals(otherLatLng: LatLng, maxMargin?: Number): Boolean + // Returns `true` if the given `LatLng` point is at the same position (within a small margin of error). The margin of error can be overridden by setting `maxMargin` to a small number. + equals: function (obj, maxMargin) { + if (!obj) { return false; } + + obj = toLatLng(obj); + + var margin = Math.max( + Math.abs(this.lat - obj.lat), + Math.abs(this.lng - obj.lng)); + + return margin <= (maxMargin === undefined ? 1.0E-9 : maxMargin); + }, + + // @method toString(): String + // Returns a string representation of the point (for debugging purposes). + toString: function (precision) { + return 'LatLng(' + + formatNum(this.lat, precision) + ', ' + + formatNum(this.lng, precision) + ')'; + }, + + // @method distanceTo(otherLatLng: LatLng): Number + // Returns the distance (in meters) to the given `LatLng` calculated using the [Spherical Law of Cosines](https://en.wikipedia.org/wiki/Spherical_law_of_cosines). + distanceTo: function (other) { + return Earth.distance(this, toLatLng(other)); + }, + + // @method wrap(): LatLng + // Returns a new `LatLng` object with the longitude wrapped so it's always between -180 and +180 degrees. + wrap: function () { + return Earth.wrapLatLng(this); + }, + + // @method toBounds(sizeInMeters: Number): LatLngBounds + // Returns a new `LatLngBounds` object in which each boundary is `sizeInMeters/2` meters apart from the `LatLng`. + toBounds: function (sizeInMeters) { + var latAccuracy = 180 * sizeInMeters / 40075017, + lngAccuracy = latAccuracy / Math.cos((Math.PI / 180) * this.lat); + + return toLatLngBounds( + [this.lat - latAccuracy, this.lng - lngAccuracy], + [this.lat + latAccuracy, this.lng + lngAccuracy]); + }, + + clone: function () { + return new LatLng(this.lat, this.lng, this.alt); + } +}; + + + +// @factory L.latLng(latitude: Number, longitude: Number, altitude?: Number): LatLng +// Creates an object representing a geographical point with the given latitude and longitude (and optionally altitude). + +// @alternative +// @factory L.latLng(coords: Array): LatLng +// Expects an array of the form `[Number, Number]` or `[Number, Number, Number]` instead. + +// @alternative +// @factory L.latLng(coords: Object): LatLng +// Expects an plain object of the form `{lat: Number, lng: Number}` or `{lat: Number, lng: Number, alt: Number}` instead. + +function toLatLng(a, b, c) { + if (a instanceof LatLng) { + return a; + } + if (isArray(a) && typeof a[0] !== 'object') { + if (a.length === 3) { + return new LatLng(a[0], a[1], a[2]); + } + if (a.length === 2) { + return new LatLng(a[0], a[1]); + } + return null; + } + if (a === undefined || a === null) { + return a; + } + if (typeof a === 'object' && 'lat' in a) { + return new LatLng(a.lat, 'lng' in a ? a.lng : a.lon, a.alt); + } + if (b === undefined) { + return null; + } + return new LatLng(a, b, c); +} + +/* + * @namespace CRS + * @crs L.CRS.Base + * Object that defines coordinate reference systems for projecting + * geographical points into pixel (screen) coordinates and back (and to + * coordinates in other units for [WMS](https://en.wikipedia.org/wiki/Web_Map_Service) services). See + * [spatial reference system](https://en.wikipedia.org/wiki/Spatial_reference_system). + * + * Leaflet defines the most usual CRSs by default. If you want to use a + * CRS not defined by default, take a look at the + * [Proj4Leaflet](https://github.com/kartena/Proj4Leaflet) plugin. + * + * Note that the CRS instances do not inherit from Leaflet's `Class` object, + * and can't be instantiated. Also, new classes can't inherit from them, + * and methods can't be added to them with the `include` function. + */ + +var CRS = { + // @method latLngToPoint(latlng: LatLng, zoom: Number): Point + // Projects geographical coordinates into pixel coordinates for a given zoom. + latLngToPoint: function (latlng, zoom) { + var projectedPoint = this.projection.project(latlng), + scale = this.scale(zoom); + + return this.transformation._transform(projectedPoint, scale); + }, + + // @method pointToLatLng(point: Point, zoom: Number): LatLng + // The inverse of `latLngToPoint`. Projects pixel coordinates on a given + // zoom into geographical coordinates. + pointToLatLng: function (point, zoom) { + var scale = this.scale(zoom), + untransformedPoint = this.transformation.untransform(point, scale); + + return this.projection.unproject(untransformedPoint); + }, + + // @method project(latlng: LatLng): Point + // Projects geographical coordinates into coordinates in units accepted for + // this CRS (e.g. meters for EPSG:3857, for passing it to WMS services). + project: function (latlng) { + return this.projection.project(latlng); + }, + + // @method unproject(point: Point): LatLng + // Given a projected coordinate returns the corresponding LatLng. + // The inverse of `project`. + unproject: function (point) { + return this.projection.unproject(point); + }, + + // @method scale(zoom: Number): Number + // Returns the scale used when transforming projected coordinates into + // pixel coordinates for a particular zoom. For example, it returns + // `256 * 2^zoom` for Mercator-based CRS. + scale: function (zoom) { + return 256 * Math.pow(2, zoom); + }, + + // @method zoom(scale: Number): Number + // Inverse of `scale()`, returns the zoom level corresponding to a scale + // factor of `scale`. + zoom: function (scale) { + return Math.log(scale / 256) / Math.LN2; + }, + + // @method getProjectedBounds(zoom: Number): Bounds + // Returns the projection's bounds scaled and transformed for the provided `zoom`. + getProjectedBounds: function (zoom) { + if (this.infinite) { return null; } + + var b = this.projection.bounds, + s = this.scale(zoom), + min = this.transformation.transform(b.min, s), + max = this.transformation.transform(b.max, s); + + return new Bounds(min, max); + }, + + // @method distance(latlng1: LatLng, latlng2: LatLng): Number + // Returns the distance between two geographical coordinates. + + // @property code: String + // Standard code name of the CRS passed into WMS services (e.g. `'EPSG:3857'`) + // + // @property wrapLng: Number[] + // An array of two numbers defining whether the longitude (horizontal) coordinate + // axis wraps around a given range and how. Defaults to `[-180, 180]` in most + // geographical CRSs. If `undefined`, the longitude axis does not wrap around. + // + // @property wrapLat: Number[] + // Like `wrapLng`, but for the latitude (vertical) axis. + + // wrapLng: [min, max], + // wrapLat: [min, max], + + // @property infinite: Boolean + // If true, the coordinate space will be unbounded (infinite in both axes) + infinite: false, + + // @method wrapLatLng(latlng: LatLng): LatLng + // Returns a `LatLng` where lat and lng has been wrapped according to the + // CRS's `wrapLat` and `wrapLng` properties, if they are outside the CRS's bounds. + wrapLatLng: function (latlng) { + var lng = this.wrapLng ? wrapNum(latlng.lng, this.wrapLng, true) : latlng.lng, + lat = this.wrapLat ? wrapNum(latlng.lat, this.wrapLat, true) : latlng.lat, + alt = latlng.alt; + + return new LatLng(lat, lng, alt); + }, + + // @method wrapLatLngBounds(bounds: LatLngBounds): LatLngBounds + // Returns a `LatLngBounds` with the same size as the given one, ensuring + // that its center is within the CRS's bounds. + // Only accepts actual `L.LatLngBounds` instances, not arrays. + wrapLatLngBounds: function (bounds) { + var center = bounds.getCenter(), + newCenter = this.wrapLatLng(center), + latShift = center.lat - newCenter.lat, + lngShift = center.lng - newCenter.lng; + + if (latShift === 0 && lngShift === 0) { + return bounds; + } + + var sw = bounds.getSouthWest(), + ne = bounds.getNorthEast(), + newSw = new LatLng(sw.lat - latShift, sw.lng - lngShift), + newNe = new LatLng(ne.lat - latShift, ne.lng - lngShift); + + return new LatLngBounds(newSw, newNe); + } +}; + +/* + * @namespace CRS + * @crs L.CRS.Earth + * + * Serves as the base for CRS that are global such that they cover the earth. + * Can only be used as the base for other CRS and cannot be used directly, + * since it does not have a `code`, `projection` or `transformation`. `distance()` returns + * meters. + */ + +var Earth = extend({}, CRS, { + wrapLng: [-180, 180], + + // Mean Earth Radius, as recommended for use by + // the International Union of Geodesy and Geophysics, + // see https://rosettacode.org/wiki/Haversine_formula + R: 6371000, + + // distance between two geographical points using spherical law of cosines approximation + distance: function (latlng1, latlng2) { + var rad = Math.PI / 180, + lat1 = latlng1.lat * rad, + lat2 = latlng2.lat * rad, + sinDLat = Math.sin((latlng2.lat - latlng1.lat) * rad / 2), + sinDLon = Math.sin((latlng2.lng - latlng1.lng) * rad / 2), + a = sinDLat * sinDLat + Math.cos(lat1) * Math.cos(lat2) * sinDLon * sinDLon, + c = 2 * Math.atan2(Math.sqrt(a), Math.sqrt(1 - a)); + return this.R * c; + } +}); + +/* + * @namespace Projection + * @projection L.Projection.SphericalMercator + * + * Spherical Mercator projection — the most common projection for online maps, + * used by almost all free and commercial tile providers. Assumes that Earth is + * a sphere. Used by the `EPSG:3857` CRS. + */ + +var earthRadius = 6378137; + +var SphericalMercator = { + + R: earthRadius, + MAX_LATITUDE: 85.0511287798, + + project: function (latlng) { + var d = Math.PI / 180, + max = this.MAX_LATITUDE, + lat = Math.max(Math.min(max, latlng.lat), -max), + sin = Math.sin(lat * d); + + return new Point( + this.R * latlng.lng * d, + this.R * Math.log((1 + sin) / (1 - sin)) / 2); + }, + + unproject: function (point) { + var d = 180 / Math.PI; + + return new LatLng( + (2 * Math.atan(Math.exp(point.y / this.R)) - (Math.PI / 2)) * d, + point.x * d / this.R); + }, + + bounds: (function () { + var d = earthRadius * Math.PI; + return new Bounds([-d, -d], [d, d]); + })() +}; + +/* + * @class Transformation + * @aka L.Transformation + * + * Represents an affine transformation: a set of coefficients `a`, `b`, `c`, `d` + * for transforming a point of a form `(x, y)` into `(a*x + b, c*y + d)` and doing + * the reverse. Used by Leaflet in its projections code. + * + * @example + * + * ```js + * var transformation = L.transformation(2, 5, -1, 10), + * p = L.point(1, 2), + * p2 = transformation.transform(p), // L.point(7, 8) + * p3 = transformation.untransform(p2); // L.point(1, 2) + * ``` + */ + + +// factory new L.Transformation(a: Number, b: Number, c: Number, d: Number) +// Creates a `Transformation` object with the given coefficients. +function Transformation(a, b, c, d) { + if (isArray(a)) { + // use array properties + this._a = a[0]; + this._b = a[1]; + this._c = a[2]; + this._d = a[3]; + return; + } + this._a = a; + this._b = b; + this._c = c; + this._d = d; +} + +Transformation.prototype = { + // @method transform(point: Point, scale?: Number): Point + // Returns a transformed point, optionally multiplied by the given scale. + // Only accepts actual `L.Point` instances, not arrays. + transform: function (point, scale) { // (Point, Number) -> Point + return this._transform(point.clone(), scale); + }, + + // destructive transform (faster) + _transform: function (point, scale) { + scale = scale || 1; + point.x = scale * (this._a * point.x + this._b); + point.y = scale * (this._c * point.y + this._d); + return point; + }, + + // @method untransform(point: Point, scale?: Number): Point + // Returns the reverse transformation of the given point, optionally divided + // by the given scale. Only accepts actual `L.Point` instances, not arrays. + untransform: function (point, scale) { + scale = scale || 1; + return new Point( + (point.x / scale - this._b) / this._a, + (point.y / scale - this._d) / this._c); + } +}; + +// factory L.transformation(a: Number, b: Number, c: Number, d: Number) + +// @factory L.transformation(a: Number, b: Number, c: Number, d: Number) +// Instantiates a Transformation object with the given coefficients. + +// @alternative +// @factory L.transformation(coefficients: Array): Transformation +// Expects an coefficients array of the form +// `[a: Number, b: Number, c: Number, d: Number]`. + +function toTransformation(a, b, c, d) { + return new Transformation(a, b, c, d); +} + +/* + * @namespace CRS + * @crs L.CRS.EPSG3857 + * + * The most common CRS for online maps, used by almost all free and commercial + * tile providers. Uses Spherical Mercator projection. Set in by default in + * Map's `crs` option. + */ + +var EPSG3857 = extend({}, Earth, { + code: 'EPSG:3857', + projection: SphericalMercator, + + transformation: (function () { + var scale = 0.5 / (Math.PI * SphericalMercator.R); + return toTransformation(scale, 0.5, -scale, 0.5); + }()) +}); + +var EPSG900913 = extend({}, EPSG3857, { + code: 'EPSG:900913' +}); + +// @namespace SVG; @section +// There are several static functions which can be called without instantiating L.SVG: + +// @function create(name: String): SVGElement +// Returns a instance of [SVGElement](https://developer.mozilla.org/docs/Web/API/SVGElement), +// corresponding to the class name passed. For example, using 'line' will return +// an instance of [SVGLineElement](https://developer.mozilla.org/docs/Web/API/SVGLineElement). +function svgCreate(name) { + return document.createElementNS('http://www.w3.org/2000/svg', name); +} + +// @function pointsToPath(rings: Point[], closed: Boolean): String +// Generates a SVG path string for multiple rings, with each ring turning +// into "M..L..L.." instructions +function pointsToPath(rings, closed) { + var str = '', + i, j, len, len2, points, p; + + for (i = 0, len = rings.length; i < len; i++) { + points = rings[i]; + + for (j = 0, len2 = points.length; j < len2; j++) { + p = points[j]; + str += (j ? 'L' : 'M') + p.x + ' ' + p.y; + } + + // closes the ring for polygons; "x" is VML syntax + str += closed ? (Browser.svg ? 'z' : 'x') : ''; + } + + // SVG complains about empty path strings + return str || 'M0 0'; +} + +/* + * @namespace Browser + * @aka L.Browser + * + * A namespace with static properties for browser/feature detection used by Leaflet internally. + * + * @example + * + * ```js + * if (L.Browser.ielt9) { + * alert('Upgrade your browser, dude!'); + * } + * ``` + */ + +var style = document.documentElement.style; + +// @property ie: Boolean; `true` for all Internet Explorer versions (not Edge). +var ie = 'ActiveXObject' in window; + +// @property ielt9: Boolean; `true` for Internet Explorer versions less than 9. +var ielt9 = ie && !document.addEventListener; + +// @property edge: Boolean; `true` for the Edge web browser. +var edge = 'msLaunchUri' in navigator && !('documentMode' in document); + +// @property webkit: Boolean; +// `true` for webkit-based browsers like Chrome and Safari (including mobile versions). +var webkit = userAgentContains('webkit'); + +// @property android: Boolean +// **Deprecated.** `true` for any browser running on an Android platform. +var android = userAgentContains('android'); + +// @property android23: Boolean; **Deprecated.** `true` for browsers running on Android 2 or Android 3. +var android23 = userAgentContains('android 2') || userAgentContains('android 3'); + +/* See https://stackoverflow.com/a/17961266 for details on detecting stock Android */ +var webkitVer = parseInt(/WebKit\/([0-9]+)|$/.exec(navigator.userAgent)[1], 10); // also matches AppleWebKit +// @property androidStock: Boolean; **Deprecated.** `true` for the Android stock browser (i.e. not Chrome) +var androidStock = android && userAgentContains('Google') && webkitVer < 537 && !('AudioNode' in window); + +// @property opera: Boolean; `true` for the Opera browser +var opera = !!window.opera; + +// @property chrome: Boolean; `true` for the Chrome browser. +var chrome = !edge && userAgentContains('chrome'); + +// @property gecko: Boolean; `true` for gecko-based browsers like Firefox. +var gecko = userAgentContains('gecko') && !webkit && !opera && !ie; + +// @property safari: Boolean; `true` for the Safari browser. +var safari = !chrome && userAgentContains('safari'); + +var phantom = userAgentContains('phantom'); + +// @property opera12: Boolean +// `true` for the Opera browser supporting CSS transforms (version 12 or later). +var opera12 = 'OTransition' in style; + +// @property win: Boolean; `true` when the browser is running in a Windows platform +var win = navigator.platform.indexOf('Win') === 0; + +// @property ie3d: Boolean; `true` for all Internet Explorer versions supporting CSS transforms. +var ie3d = ie && ('transition' in style); + +// @property webkit3d: Boolean; `true` for webkit-based browsers supporting CSS transforms. +var webkit3d = ('WebKitCSSMatrix' in window) && ('m11' in new window.WebKitCSSMatrix()) && !android23; + +// @property gecko3d: Boolean; `true` for gecko-based browsers supporting CSS transforms. +var gecko3d = 'MozPerspective' in style; + +// @property any3d: Boolean +// `true` for all browsers supporting CSS transforms. +var any3d = !window.L_DISABLE_3D && (ie3d || webkit3d || gecko3d) && !opera12 && !phantom; + +// @property mobile: Boolean; `true` for all browsers running in a mobile device. +var mobile = typeof orientation !== 'undefined' || userAgentContains('mobile'); + +// @property mobileWebkit: Boolean; `true` for all webkit-based browsers in a mobile device. +var mobileWebkit = mobile && webkit; + +// @property mobileWebkit3d: Boolean +// `true` for all webkit-based browsers in a mobile device supporting CSS transforms. +var mobileWebkit3d = mobile && webkit3d; + +// @property msPointer: Boolean +// `true` for browsers implementing the Microsoft touch events model (notably IE10). +var msPointer = !window.PointerEvent && window.MSPointerEvent; + +// @property pointer: Boolean +// `true` for all browsers supporting [pointer events](https://msdn.microsoft.com/en-us/library/dn433244%28v=vs.85%29.aspx). +var pointer = !!(window.PointerEvent || msPointer); + +// @property touchNative: Boolean +// `true` for all browsers supporting [touch events](https://developer.mozilla.org/docs/Web/API/Touch_events). +// **This does not necessarily mean** that the browser is running in a computer with +// a touchscreen, it only means that the browser is capable of understanding +// touch events. +var touchNative = 'ontouchstart' in window || !!window.TouchEvent; + +// @property touch: Boolean +// `true` for all browsers supporting either [touch](#browser-touch) or [pointer](#browser-pointer) events. +// Note: pointer events will be preferred (if available), and processed for all `touch*` listeners. +var touch = !window.L_NO_TOUCH && (touchNative || pointer); + +// @property mobileOpera: Boolean; `true` for the Opera browser in a mobile device. +var mobileOpera = mobile && opera; + +// @property mobileGecko: Boolean +// `true` for gecko-based browsers running in a mobile device. +var mobileGecko = mobile && gecko; + +// @property retina: Boolean +// `true` for browsers on a high-resolution "retina" screen or on any screen when browser's display zoom is more than 100%. +var retina = (window.devicePixelRatio || (window.screen.deviceXDPI / window.screen.logicalXDPI)) > 1; + +// @property passiveEvents: Boolean +// `true` for browsers that support passive events. +var passiveEvents = (function () { + var supportsPassiveOption = false; + try { + var opts = Object.defineProperty({}, 'passive', { + get: function () { // eslint-disable-line getter-return + supportsPassiveOption = true; + } + }); + window.addEventListener('testPassiveEventSupport', falseFn, opts); + window.removeEventListener('testPassiveEventSupport', falseFn, opts); + } catch (e) { + // Errors can safely be ignored since this is only a browser support test. + } + return supportsPassiveOption; +}()); + +// @property canvas: Boolean +// `true` when the browser supports [``](https://developer.mozilla.org/docs/Web/API/Canvas_API). +var canvas$1 = (function () { + return !!document.createElement('canvas').getContext; +}()); + +// @property svg: Boolean +// `true` when the browser supports [SVG](https://developer.mozilla.org/docs/Web/SVG). +var svg$1 = !!(document.createElementNS && svgCreate('svg').createSVGRect); + +var inlineSvg = !!svg$1 && (function () { + var div = document.createElement('div'); + div.innerHTML = ''; + return (div.firstChild && div.firstChild.namespaceURI) === 'http://www.w3.org/2000/svg'; +})(); + +// @property vml: Boolean +// `true` if the browser supports [VML](https://en.wikipedia.org/wiki/Vector_Markup_Language). +var vml = !svg$1 && (function () { + try { + var div = document.createElement('div'); + div.innerHTML = ''; + + var shape = div.firstChild; + shape.style.behavior = 'url(#default#VML)'; + + return shape && (typeof shape.adj === 'object'); + + } catch (e) { + return false; + } +}()); + +function userAgentContains(str) { + return navigator.userAgent.toLowerCase().indexOf(str) >= 0; +} + + +var Browser = { + ie: ie, + ielt9: ielt9, + edge: edge, + webkit: webkit, + android: android, + android23: android23, + androidStock: androidStock, + opera: opera, + chrome: chrome, + gecko: gecko, + safari: safari, + phantom: phantom, + opera12: opera12, + win: win, + ie3d: ie3d, + webkit3d: webkit3d, + gecko3d: gecko3d, + any3d: any3d, + mobile: mobile, + mobileWebkit: mobileWebkit, + mobileWebkit3d: mobileWebkit3d, + msPointer: msPointer, + pointer: pointer, + touch: touch, + touchNative: touchNative, + mobileOpera: mobileOpera, + mobileGecko: mobileGecko, + retina: retina, + passiveEvents: passiveEvents, + canvas: canvas$1, + svg: svg$1, + vml: vml, + inlineSvg: inlineSvg +}; + +/* + * Extends L.DomEvent to provide touch support for Internet Explorer and Windows-based devices. + */ + +var POINTER_DOWN = Browser.msPointer ? 'MSPointerDown' : 'pointerdown'; +var POINTER_MOVE = Browser.msPointer ? 'MSPointerMove' : 'pointermove'; +var POINTER_UP = Browser.msPointer ? 'MSPointerUp' : 'pointerup'; +var POINTER_CANCEL = Browser.msPointer ? 'MSPointerCancel' : 'pointercancel'; +var pEvent = { + touchstart : POINTER_DOWN, + touchmove : POINTER_MOVE, + touchend : POINTER_UP, + touchcancel : POINTER_CANCEL +}; +var handle = { + touchstart : _onPointerStart, + touchmove : _handlePointer, + touchend : _handlePointer, + touchcancel : _handlePointer +}; +var _pointers = {}; +var _pointerDocListener = false; + +// Provides a touch events wrapper for (ms)pointer events. +// ref https://www.w3.org/TR/pointerevents/ https://www.w3.org/Bugs/Public/show_bug.cgi?id=22890 + +function addPointerListener(obj, type, handler) { + if (type === 'touchstart') { + _addPointerDocListener(); + } + if (!handle[type]) { + console.warn('wrong event specified:', type); + return L.Util.falseFn; + } + handler = handle[type].bind(this, handler); + obj.addEventListener(pEvent[type], handler, false); + return handler; +} + +function removePointerListener(obj, type, handler) { + if (!pEvent[type]) { + console.warn('wrong event specified:', type); + return; + } + obj.removeEventListener(pEvent[type], handler, false); +} + +function _globalPointerDown(e) { + _pointers[e.pointerId] = e; +} + +function _globalPointerMove(e) { + if (_pointers[e.pointerId]) { + _pointers[e.pointerId] = e; + } +} + +function _globalPointerUp(e) { + delete _pointers[e.pointerId]; +} + +function _addPointerDocListener() { + // need to keep track of what pointers and how many are active to provide e.touches emulation + if (!_pointerDocListener) { + // we listen document as any drags that end by moving the touch off the screen get fired there + document.addEventListener(POINTER_DOWN, _globalPointerDown, true); + document.addEventListener(POINTER_MOVE, _globalPointerMove, true); + document.addEventListener(POINTER_UP, _globalPointerUp, true); + document.addEventListener(POINTER_CANCEL, _globalPointerUp, true); + + _pointerDocListener = true; + } +} + +function _handlePointer(handler, e) { + if (e.pointerType === (e.MSPOINTER_TYPE_MOUSE || 'mouse')) { return; } + + e.touches = []; + for (var i in _pointers) { + e.touches.push(_pointers[i]); + } + e.changedTouches = [e]; + + handler(e); +} + +function _onPointerStart(handler, e) { + // IE10 specific: MsTouch needs preventDefault. See #2000 + if (e.MSPOINTER_TYPE_TOUCH && e.pointerType === e.MSPOINTER_TYPE_TOUCH) { + preventDefault(e); + } + _handlePointer(handler, e); +} + +/* + * Extends the event handling code with double tap support for mobile browsers. + * + * Note: currently most browsers fire native dblclick, with only a few exceptions + * (see https://github.com/Leaflet/Leaflet/issues/7012#issuecomment-595087386) + */ + +function makeDblclick(event) { + // in modern browsers `type` cannot be just overridden: + // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Errors/Getter_only + var newEvent = {}, + prop, i; + for (i in event) { + prop = event[i]; + newEvent[i] = prop && prop.bind ? prop.bind(event) : prop; + } + event = newEvent; + newEvent.type = 'dblclick'; + newEvent.detail = 2; + newEvent.isTrusted = false; + newEvent._simulated = true; // for debug purposes + return newEvent; +} + +var delay = 200; +function addDoubleTapListener(obj, handler) { + // Most browsers handle double tap natively + obj.addEventListener('dblclick', handler); + + // On some platforms the browser doesn't fire native dblclicks for touch events. + // It seems that in all such cases `detail` property of `click` event is always `1`. + // So here we rely on that fact to avoid excessive 'dblclick' simulation when not needed. + var last = 0, + detail; + function simDblclick(e) { + if (e.detail !== 1) { + detail = e.detail; // keep in sync to avoid false dblclick in some cases + return; + } + + if (e.pointerType === 'mouse' || + (e.sourceCapabilities && !e.sourceCapabilities.firesTouchEvents)) { + + return; + } + + var now = Date.now(); + if (now - last <= delay) { + detail++; + if (detail === 2) { + handler(makeDblclick(e)); + } + } else { + detail = 1; + } + last = now; + } + + obj.addEventListener('click', simDblclick); + + return { + dblclick: handler, + simDblclick: simDblclick + }; +} + +function removeDoubleTapListener(obj, handlers) { + obj.removeEventListener('dblclick', handlers.dblclick); + obj.removeEventListener('click', handlers.simDblclick); +} + +/* + * @namespace DomUtil + * + * Utility functions to work with the [DOM](https://developer.mozilla.org/docs/Web/API/Document_Object_Model) + * tree, used by Leaflet internally. + * + * Most functions expecting or returning a `HTMLElement` also work for + * SVG elements. The only difference is that classes refer to CSS classes + * in HTML and SVG classes in SVG. + */ + + +// @property TRANSFORM: String +// Vendor-prefixed transform style name (e.g. `'webkitTransform'` for WebKit). +var TRANSFORM = testProp( + ['transform', 'webkitTransform', 'OTransform', 'MozTransform', 'msTransform']); + +// webkitTransition comes first because some browser versions that drop vendor prefix don't do +// the same for the transitionend event, in particular the Android 4.1 stock browser + +// @property TRANSITION: String +// Vendor-prefixed transition style name. +var TRANSITION = testProp( + ['webkitTransition', 'transition', 'OTransition', 'MozTransition', 'msTransition']); + +// @property TRANSITION_END: String +// Vendor-prefixed transitionend event name. +var TRANSITION_END = + TRANSITION === 'webkitTransition' || TRANSITION === 'OTransition' ? TRANSITION + 'End' : 'transitionend'; + + +// @function get(id: String|HTMLElement): HTMLElement +// Returns an element given its DOM id, or returns the element itself +// if it was passed directly. +function get(id) { + return typeof id === 'string' ? document.getElementById(id) : id; +} + +// @function getStyle(el: HTMLElement, styleAttrib: String): String +// Returns the value for a certain style attribute on an element, +// including computed values or values set through CSS. +function getStyle(el, style) { + var value = el.style[style] || (el.currentStyle && el.currentStyle[style]); + + if ((!value || value === 'auto') && document.defaultView) { + var css = document.defaultView.getComputedStyle(el, null); + value = css ? css[style] : null; + } + return value === 'auto' ? null : value; +} + +// @function create(tagName: String, className?: String, container?: HTMLElement): HTMLElement +// Creates an HTML element with `tagName`, sets its class to `className`, and optionally appends it to `container` element. +function create$1(tagName, className, container) { + var el = document.createElement(tagName); + el.className = className || ''; + + if (container) { + container.appendChild(el); + } + return el; +} + +// @function remove(el: HTMLElement) +// Removes `el` from its parent element +function remove(el) { + var parent = el.parentNode; + if (parent) { + parent.removeChild(el); + } +} + +// @function empty(el: HTMLElement) +// Removes all of `el`'s children elements from `el` +function empty(el) { + while (el.firstChild) { + el.removeChild(el.firstChild); + } +} + +// @function toFront(el: HTMLElement) +// Makes `el` the last child of its parent, so it renders in front of the other children. +function toFront(el) { + var parent = el.parentNode; + if (parent && parent.lastChild !== el) { + parent.appendChild(el); + } +} + +// @function toBack(el: HTMLElement) +// Makes `el` the first child of its parent, so it renders behind the other children. +function toBack(el) { + var parent = el.parentNode; + if (parent && parent.firstChild !== el) { + parent.insertBefore(el, parent.firstChild); + } +} + +// @function hasClass(el: HTMLElement, name: String): Boolean +// Returns `true` if the element's class attribute contains `name`. +function hasClass(el, name) { + if (el.classList !== undefined) { + return el.classList.contains(name); + } + var className = getClass(el); + return className.length > 0 && new RegExp('(^|\\s)' + name + '(\\s|$)').test(className); +} + +// @function addClass(el: HTMLElement, name: String) +// Adds `name` to the element's class attribute. +function addClass(el, name) { + if (el.classList !== undefined) { + var classes = splitWords(name); + for (var i = 0, len = classes.length; i < len; i++) { + el.classList.add(classes[i]); + } + } else if (!hasClass(el, name)) { + var className = getClass(el); + setClass(el, (className ? className + ' ' : '') + name); + } +} + +// @function removeClass(el: HTMLElement, name: String) +// Removes `name` from the element's class attribute. +function removeClass(el, name) { + if (el.classList !== undefined) { + el.classList.remove(name); + } else { + setClass(el, trim((' ' + getClass(el) + ' ').replace(' ' + name + ' ', ' '))); + } +} + +// @function setClass(el: HTMLElement, name: String) +// Sets the element's class. +function setClass(el, name) { + if (el.className.baseVal === undefined) { + el.className = name; + } else { + // in case of SVG element + el.className.baseVal = name; + } +} + +// @function getClass(el: HTMLElement): String +// Returns the element's class. +function getClass(el) { + // Check if the element is an SVGElementInstance and use the correspondingElement instead + // (Required for linked SVG elements in IE11.) + if (el.correspondingElement) { + el = el.correspondingElement; + } + return el.className.baseVal === undefined ? el.className : el.className.baseVal; +} + +// @function setOpacity(el: HTMLElement, opacity: Number) +// Set the opacity of an element (including old IE support). +// `opacity` must be a number from `0` to `1`. +function setOpacity(el, value) { + if ('opacity' in el.style) { + el.style.opacity = value; + } else if ('filter' in el.style) { + _setOpacityIE(el, value); + } +} + +function _setOpacityIE(el, value) { + var filter = false, + filterName = 'DXImageTransform.Microsoft.Alpha'; + + // filters collection throws an error if we try to retrieve a filter that doesn't exist + try { + filter = el.filters.item(filterName); + } catch (e) { + // don't set opacity to 1 if we haven't already set an opacity, + // it isn't needed and breaks transparent pngs. + if (value === 1) { return; } + } + + value = Math.round(value * 100); + + if (filter) { + filter.Enabled = (value !== 100); + filter.Opacity = value; + } else { + el.style.filter += ' progid:' + filterName + '(opacity=' + value + ')'; + } +} + +// @function testProp(props: String[]): String|false +// Goes through the array of style names and returns the first name +// that is a valid style name for an element. If no such name is found, +// it returns false. Useful for vendor-prefixed styles like `transform`. +function testProp(props) { + var style = document.documentElement.style; + + for (var i = 0; i < props.length; i++) { + if (props[i] in style) { + return props[i]; + } + } + return false; +} + +// @function setTransform(el: HTMLElement, offset: Point, scale?: Number) +// Resets the 3D CSS transform of `el` so it is translated by `offset` pixels +// and optionally scaled by `scale`. Does not have an effect if the +// browser doesn't support 3D CSS transforms. +function setTransform(el, offset, scale) { + var pos = offset || new Point(0, 0); + + el.style[TRANSFORM] = + (Browser.ie3d ? + 'translate(' + pos.x + 'px,' + pos.y + 'px)' : + 'translate3d(' + pos.x + 'px,' + pos.y + 'px,0)') + + (scale ? ' scale(' + scale + ')' : ''); +} + +// @function setPosition(el: HTMLElement, position: Point) +// Sets the position of `el` to coordinates specified by `position`, +// using CSS translate or top/left positioning depending on the browser +// (used by Leaflet internally to position its layers). +function setPosition(el, point) { + + /*eslint-disable */ + el._leaflet_pos = point; + /* eslint-enable */ + + if (Browser.any3d) { + setTransform(el, point); + } else { + el.style.left = point.x + 'px'; + el.style.top = point.y + 'px'; + } +} + +// @function getPosition(el: HTMLElement): Point +// Returns the coordinates of an element previously positioned with setPosition. +function getPosition(el) { + // this method is only used for elements previously positioned using setPosition, + // so it's safe to cache the position for performance + + return el._leaflet_pos || new Point(0, 0); +} + +// @function disableTextSelection() +// Prevents the user from generating `selectstart` DOM events, usually generated +// when the user drags the mouse through a page with text. Used internally +// by Leaflet to override the behaviour of any click-and-drag interaction on +// the map. Affects drag interactions on the whole document. + +// @function enableTextSelection() +// Cancels the effects of a previous [`L.DomUtil.disableTextSelection`](#domutil-disabletextselection). +var disableTextSelection; +var enableTextSelection; +var _userSelect; +if ('onselectstart' in document) { + disableTextSelection = function () { + on(window, 'selectstart', preventDefault); + }; + enableTextSelection = function () { + off(window, 'selectstart', preventDefault); + }; +} else { + var userSelectProperty = testProp( + ['userSelect', 'WebkitUserSelect', 'OUserSelect', 'MozUserSelect', 'msUserSelect']); + + disableTextSelection = function () { + if (userSelectProperty) { + var style = document.documentElement.style; + _userSelect = style[userSelectProperty]; + style[userSelectProperty] = 'none'; + } + }; + enableTextSelection = function () { + if (userSelectProperty) { + document.documentElement.style[userSelectProperty] = _userSelect; + _userSelect = undefined; + } + }; +} + +// @function disableImageDrag() +// As [`L.DomUtil.disableTextSelection`](#domutil-disabletextselection), but +// for `dragstart` DOM events, usually generated when the user drags an image. +function disableImageDrag() { + on(window, 'dragstart', preventDefault); +} + +// @function enableImageDrag() +// Cancels the effects of a previous [`L.DomUtil.disableImageDrag`](#domutil-disabletextselection). +function enableImageDrag() { + off(window, 'dragstart', preventDefault); +} + +var _outlineElement, _outlineStyle; +// @function preventOutline(el: HTMLElement) +// Makes the [outline](https://developer.mozilla.org/docs/Web/CSS/outline) +// of the element `el` invisible. Used internally by Leaflet to prevent +// focusable elements from displaying an outline when the user performs a +// drag interaction on them. +function preventOutline(element) { + while (element.tabIndex === -1) { + element = element.parentNode; + } + if (!element.style) { return; } + restoreOutline(); + _outlineElement = element; + _outlineStyle = element.style.outline; + element.style.outline = 'none'; + on(window, 'keydown', restoreOutline); +} + +// @function restoreOutline() +// Cancels the effects of a previous [`L.DomUtil.preventOutline`](). +function restoreOutline() { + if (!_outlineElement) { return; } + _outlineElement.style.outline = _outlineStyle; + _outlineElement = undefined; + _outlineStyle = undefined; + off(window, 'keydown', restoreOutline); +} + +// @function getSizedParentNode(el: HTMLElement): HTMLElement +// Finds the closest parent node which size (width and height) is not null. +function getSizedParentNode(element) { + do { + element = element.parentNode; + } while ((!element.offsetWidth || !element.offsetHeight) && element !== document.body); + return element; +} + +// @function getScale(el: HTMLElement): Object +// Computes the CSS scale currently applied on the element. +// Returns an object with `x` and `y` members as horizontal and vertical scales respectively, +// and `boundingClientRect` as the result of [`getBoundingClientRect()`](https://developer.mozilla.org/en-US/docs/Web/API/Element/getBoundingClientRect). +function getScale(element) { + var rect = element.getBoundingClientRect(); // Read-only in old browsers. + + return { + x: rect.width / element.offsetWidth || 1, + y: rect.height / element.offsetHeight || 1, + boundingClientRect: rect + }; +} + +var DomUtil = { + __proto__: null, + TRANSFORM: TRANSFORM, + TRANSITION: TRANSITION, + TRANSITION_END: TRANSITION_END, + get: get, + getStyle: getStyle, + create: create$1, + remove: remove, + empty: empty, + toFront: toFront, + toBack: toBack, + hasClass: hasClass, + addClass: addClass, + removeClass: removeClass, + setClass: setClass, + getClass: getClass, + setOpacity: setOpacity, + testProp: testProp, + setTransform: setTransform, + setPosition: setPosition, + getPosition: getPosition, + get disableTextSelection () { return disableTextSelection; }, + get enableTextSelection () { return enableTextSelection; }, + disableImageDrag: disableImageDrag, + enableImageDrag: enableImageDrag, + preventOutline: preventOutline, + restoreOutline: restoreOutline, + getSizedParentNode: getSizedParentNode, + getScale: getScale +}; + +/* + * @namespace DomEvent + * Utility functions to work with the [DOM events](https://developer.mozilla.org/docs/Web/API/Event), used by Leaflet internally. + */ + +// Inspired by John Resig, Dean Edwards and YUI addEvent implementations. + +// @function on(el: HTMLElement, types: String, fn: Function, context?: Object): this +// Adds a listener function (`fn`) to a particular DOM event type of the +// element `el`. You can optionally specify the context of the listener +// (object the `this` keyword will point to). You can also pass several +// space-separated types (e.g. `'click dblclick'`). + +// @alternative +// @function on(el: HTMLElement, eventMap: Object, context?: Object): this +// Adds a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}` +function on(obj, types, fn, context) { + + if (types && typeof types === 'object') { + for (var type in types) { + addOne(obj, type, types[type], fn); + } + } else { + types = splitWords(types); + + for (var i = 0, len = types.length; i < len; i++) { + addOne(obj, types[i], fn, context); + } + } + + return this; +} + +var eventsKey = '_leaflet_events'; + +// @function off(el: HTMLElement, types: String, fn: Function, context?: Object): this +// Removes a previously added listener function. +// Note that if you passed a custom context to on, you must pass the same +// context to `off` in order to remove the listener. + +// @alternative +// @function off(el: HTMLElement, eventMap: Object, context?: Object): this +// Removes a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}` + +// @alternative +// @function off(el: HTMLElement, types: String): this +// Removes all previously added listeners of given types. + +// @alternative +// @function off(el: HTMLElement): this +// Removes all previously added listeners from given HTMLElement +function off(obj, types, fn, context) { + + if (arguments.length === 1) { + batchRemove(obj); + delete obj[eventsKey]; + + } else if (types && typeof types === 'object') { + for (var type in types) { + removeOne(obj, type, types[type], fn); + } + + } else { + types = splitWords(types); + + if (arguments.length === 2) { + batchRemove(obj, function (type) { + return indexOf(types, type) !== -1; + }); + } else { + for (var i = 0, len = types.length; i < len; i++) { + removeOne(obj, types[i], fn, context); + } + } + } + + return this; +} + +function batchRemove(obj, filterFn) { + for (var id in obj[eventsKey]) { + var type = id.split(/\d/)[0]; + if (!filterFn || filterFn(type)) { + removeOne(obj, type, null, null, id); + } + } +} + +var mouseSubst = { + mouseenter: 'mouseover', + mouseleave: 'mouseout', + wheel: !('onwheel' in window) && 'mousewheel' +}; + +function addOne(obj, type, fn, context) { + var id = type + stamp(fn) + (context ? '_' + stamp(context) : ''); + + if (obj[eventsKey] && obj[eventsKey][id]) { return this; } + + var handler = function (e) { + return fn.call(context || obj, e || window.event); + }; + + var originalHandler = handler; + + if (!Browser.touchNative && Browser.pointer && type.indexOf('touch') === 0) { + // Needs DomEvent.Pointer.js + handler = addPointerListener(obj, type, handler); + + } else if (Browser.touch && (type === 'dblclick')) { + handler = addDoubleTapListener(obj, handler); + + } else if ('addEventListener' in obj) { + + if (type === 'touchstart' || type === 'touchmove' || type === 'wheel' || type === 'mousewheel') { + obj.addEventListener(mouseSubst[type] || type, handler, Browser.passiveEvents ? {passive: false} : false); + + } else if (type === 'mouseenter' || type === 'mouseleave') { + handler = function (e) { + e = e || window.event; + if (isExternalTarget(obj, e)) { + originalHandler(e); + } + }; + obj.addEventListener(mouseSubst[type], handler, false); + + } else { + obj.addEventListener(type, originalHandler, false); + } + + } else { + obj.attachEvent('on' + type, handler); + } + + obj[eventsKey] = obj[eventsKey] || {}; + obj[eventsKey][id] = handler; +} + +function removeOne(obj, type, fn, context, id) { + id = id || type + stamp(fn) + (context ? '_' + stamp(context) : ''); + var handler = obj[eventsKey] && obj[eventsKey][id]; + + if (!handler) { return this; } + + if (!Browser.touchNative && Browser.pointer && type.indexOf('touch') === 0) { + removePointerListener(obj, type, handler); + + } else if (Browser.touch && (type === 'dblclick')) { + removeDoubleTapListener(obj, handler); + + } else if ('removeEventListener' in obj) { + + obj.removeEventListener(mouseSubst[type] || type, handler, false); + + } else { + obj.detachEvent('on' + type, handler); + } + + obj[eventsKey][id] = null; +} + +// @function stopPropagation(ev: DOMEvent): this +// Stop the given event from propagation to parent elements. Used inside the listener functions: +// ```js +// L.DomEvent.on(div, 'click', function (ev) { +// L.DomEvent.stopPropagation(ev); +// }); +// ``` +function stopPropagation(e) { + + if (e.stopPropagation) { + e.stopPropagation(); + } else if (e.originalEvent) { // In case of Leaflet event. + e.originalEvent._stopped = true; + } else { + e.cancelBubble = true; + } + + return this; +} + +// @function disableScrollPropagation(el: HTMLElement): this +// Adds `stopPropagation` to the element's `'wheel'` events (plus browser variants). +function disableScrollPropagation(el) { + addOne(el, 'wheel', stopPropagation); + return this; +} + +// @function disableClickPropagation(el: HTMLElement): this +// Adds `stopPropagation` to the element's `'click'`, `'dblclick'`, `'contextmenu'`, +// `'mousedown'` and `'touchstart'` events (plus browser variants). +function disableClickPropagation(el) { + on(el, 'mousedown touchstart dblclick contextmenu', stopPropagation); + el['_leaflet_disable_click'] = true; + return this; +} + +// @function preventDefault(ev: DOMEvent): this +// Prevents the default action of the DOM Event `ev` from happening (such as +// following a link in the href of the a element, or doing a POST request +// with page reload when a `
` is submitted). +// Use it inside listener functions. +function preventDefault(e) { + if (e.preventDefault) { + e.preventDefault(); + } else { + e.returnValue = false; + } + return this; +} + +// @function stop(ev: DOMEvent): this +// Does `stopPropagation` and `preventDefault` at the same time. +function stop(e) { + preventDefault(e); + stopPropagation(e); + return this; +} + +// @function getMousePosition(ev: DOMEvent, container?: HTMLElement): Point +// Gets normalized mouse position from a DOM event relative to the +// `container` (border excluded) or to the whole page if not specified. +function getMousePosition(e, container) { + if (!container) { + return new Point(e.clientX, e.clientY); + } + + var scale = getScale(container), + offset = scale.boundingClientRect; // left and top values are in page scale (like the event clientX/Y) + + return new Point( + // offset.left/top values are in page scale (like clientX/Y), + // whereas clientLeft/Top (border width) values are the original values (before CSS scale applies). + (e.clientX - offset.left) / scale.x - container.clientLeft, + (e.clientY - offset.top) / scale.y - container.clientTop + ); +} + +// Chrome on Win scrolls double the pixels as in other platforms (see #4538), +// and Firefox scrolls device pixels, not CSS pixels +var wheelPxFactor = + (Browser.win && Browser.chrome) ? 2 * window.devicePixelRatio : + Browser.gecko ? window.devicePixelRatio : 1; + +// @function getWheelDelta(ev: DOMEvent): Number +// Gets normalized wheel delta from a wheel DOM event, in vertical +// pixels scrolled (negative if scrolling down). +// Events from pointing devices without precise scrolling are mapped to +// a best guess of 60 pixels. +function getWheelDelta(e) { + return (Browser.edge) ? e.wheelDeltaY / 2 : // Don't trust window-geometry-based delta + (e.deltaY && e.deltaMode === 0) ? -e.deltaY / wheelPxFactor : // Pixels + (e.deltaY && e.deltaMode === 1) ? -e.deltaY * 20 : // Lines + (e.deltaY && e.deltaMode === 2) ? -e.deltaY * 60 : // Pages + (e.deltaX || e.deltaZ) ? 0 : // Skip horizontal/depth wheel events + e.wheelDelta ? (e.wheelDeltaY || e.wheelDelta) / 2 : // Legacy IE pixels + (e.detail && Math.abs(e.detail) < 32765) ? -e.detail * 20 : // Legacy Moz lines + e.detail ? e.detail / -32765 * 60 : // Legacy Moz pages + 0; +} + +// check if element really left/entered the event target (for mouseenter/mouseleave) +function isExternalTarget(el, e) { + + var related = e.relatedTarget; + + if (!related) { return true; } + + try { + while (related && (related !== el)) { + related = related.parentNode; + } + } catch (err) { + return false; + } + return (related !== el); +} + +var DomEvent = { + __proto__: null, + on: on, + off: off, + stopPropagation: stopPropagation, + disableScrollPropagation: disableScrollPropagation, + disableClickPropagation: disableClickPropagation, + preventDefault: preventDefault, + stop: stop, + getMousePosition: getMousePosition, + getWheelDelta: getWheelDelta, + isExternalTarget: isExternalTarget, + addListener: on, + removeListener: off +}; + +/* + * @class PosAnimation + * @aka L.PosAnimation + * @inherits Evented + * Used internally for panning animations, utilizing CSS3 Transitions for modern browsers and a timer fallback for IE6-9. + * + * @example + * ```js + * var fx = new L.PosAnimation(); + * fx.run(el, [300, 500], 0.5); + * ``` + * + * @constructor L.PosAnimation() + * Creates a `PosAnimation` object. + * + */ + +var PosAnimation = Evented.extend({ + + // @method run(el: HTMLElement, newPos: Point, duration?: Number, easeLinearity?: Number) + // Run an animation of a given element to a new position, optionally setting + // duration in seconds (`0.25` by default) and easing linearity factor (3rd + // argument of the [cubic bezier curve](https://cubic-bezier.com/#0,0,.5,1), + // `0.5` by default). + run: function (el, newPos, duration, easeLinearity) { + this.stop(); + + this._el = el; + this._inProgress = true; + this._duration = duration || 0.25; + this._easeOutPower = 1 / Math.max(easeLinearity || 0.5, 0.2); + + this._startPos = getPosition(el); + this._offset = newPos.subtract(this._startPos); + this._startTime = +new Date(); + + // @event start: Event + // Fired when the animation starts + this.fire('start'); + + this._animate(); + }, + + // @method stop() + // Stops the animation (if currently running). + stop: function () { + if (!this._inProgress) { return; } + + this._step(true); + this._complete(); + }, + + _animate: function () { + // animation loop + this._animId = requestAnimFrame(this._animate, this); + this._step(); + }, + + _step: function (round) { + var elapsed = (+new Date()) - this._startTime, + duration = this._duration * 1000; + + if (elapsed < duration) { + this._runFrame(this._easeOut(elapsed / duration), round); + } else { + this._runFrame(1); + this._complete(); + } + }, + + _runFrame: function (progress, round) { + var pos = this._startPos.add(this._offset.multiplyBy(progress)); + if (round) { + pos._round(); + } + setPosition(this._el, pos); + + // @event step: Event + // Fired continuously during the animation. + this.fire('step'); + }, + + _complete: function () { + cancelAnimFrame(this._animId); + + this._inProgress = false; + // @event end: Event + // Fired when the animation ends. + this.fire('end'); + }, + + _easeOut: function (t) { + return 1 - Math.pow(1 - t, this._easeOutPower); + } +}); + +/* + * @class Map + * @aka L.Map + * @inherits Evented + * + * The central class of the API — it is used to create a map on a page and manipulate it. + * + * @example + * + * ```js + * // initialize the map on the "map" div with a given center and zoom + * var map = L.map('map', { + * center: [51.505, -0.09], + * zoom: 13 + * }); + * ``` + * + */ + +var Map = Evented.extend({ + + options: { + // @section Map State Options + // @option crs: CRS = L.CRS.EPSG3857 + // The [Coordinate Reference System](#crs) to use. Don't change this if you're not + // sure what it means. + crs: EPSG3857, + + // @option center: LatLng = undefined + // Initial geographic center of the map + center: undefined, + + // @option zoom: Number = undefined + // Initial map zoom level + zoom: undefined, + + // @option minZoom: Number = * + // Minimum zoom level of the map. + // If not specified and at least one `GridLayer` or `TileLayer` is in the map, + // the lowest of their `minZoom` options will be used instead. + minZoom: undefined, + + // @option maxZoom: Number = * + // Maximum zoom level of the map. + // If not specified and at least one `GridLayer` or `TileLayer` is in the map, + // the highest of their `maxZoom` options will be used instead. + maxZoom: undefined, + + // @option layers: Layer[] = [] + // Array of layers that will be added to the map initially + layers: [], + + // @option maxBounds: LatLngBounds = null + // When this option is set, the map restricts the view to the given + // geographical bounds, bouncing the user back if the user tries to pan + // outside the view. To set the restriction dynamically, use + // [`setMaxBounds`](#map-setmaxbounds) method. + maxBounds: undefined, + + // @option renderer: Renderer = * + // The default method for drawing vector layers on the map. `L.SVG` + // or `L.Canvas` by default depending on browser support. + renderer: undefined, + + + // @section Animation Options + // @option zoomAnimation: Boolean = true + // Whether the map zoom animation is enabled. By default it's enabled + // in all browsers that support CSS3 Transitions except Android. + zoomAnimation: true, + + // @option zoomAnimationThreshold: Number = 4 + // Won't animate zoom if the zoom difference exceeds this value. + zoomAnimationThreshold: 4, + + // @option fadeAnimation: Boolean = true + // Whether the tile fade animation is enabled. By default it's enabled + // in all browsers that support CSS3 Transitions except Android. + fadeAnimation: true, + + // @option markerZoomAnimation: Boolean = true + // Whether markers animate their zoom with the zoom animation, if disabled + // they will disappear for the length of the animation. By default it's + // enabled in all browsers that support CSS3 Transitions except Android. + markerZoomAnimation: true, + + // @option transform3DLimit: Number = 2^23 + // Defines the maximum size of a CSS translation transform. The default + // value should not be changed unless a web browser positions layers in + // the wrong place after doing a large `panBy`. + transform3DLimit: 8388608, // Precision limit of a 32-bit float + + // @section Interaction Options + // @option zoomSnap: Number = 1 + // Forces the map's zoom level to always be a multiple of this, particularly + // right after a [`fitBounds()`](#map-fitbounds) or a pinch-zoom. + // By default, the zoom level snaps to the nearest integer; lower values + // (e.g. `0.5` or `0.1`) allow for greater granularity. A value of `0` + // means the zoom level will not be snapped after `fitBounds` or a pinch-zoom. + zoomSnap: 1, + + // @option zoomDelta: Number = 1 + // Controls how much the map's zoom level will change after a + // [`zoomIn()`](#map-zoomin), [`zoomOut()`](#map-zoomout), pressing `+` + // or `-` on the keyboard, or using the [zoom controls](#control-zoom). + // Values smaller than `1` (e.g. `0.5`) allow for greater granularity. + zoomDelta: 1, + + // @option trackResize: Boolean = true + // Whether the map automatically handles browser window resize to update itself. + trackResize: true + }, + + initialize: function (id, options) { // (HTMLElement or String, Object) + options = setOptions(this, options); + + // Make sure to assign internal flags at the beginning, + // to avoid inconsistent state in some edge cases. + this._handlers = []; + this._layers = {}; + this._zoomBoundLayers = {}; + this._sizeChanged = true; + + this._initContainer(id); + this._initLayout(); + + // hack for https://github.com/Leaflet/Leaflet/issues/1980 + this._onResize = bind(this._onResize, this); + + this._initEvents(); + + if (options.maxBounds) { + this.setMaxBounds(options.maxBounds); + } + + if (options.zoom !== undefined) { + this._zoom = this._limitZoom(options.zoom); + } + + if (options.center && options.zoom !== undefined) { + this.setView(toLatLng(options.center), options.zoom, {reset: true}); + } + + this.callInitHooks(); + + // don't animate on browsers without hardware-accelerated transitions or old Android/Opera + this._zoomAnimated = TRANSITION && Browser.any3d && !Browser.mobileOpera && + this.options.zoomAnimation; + + // zoom transitions run with the same duration for all layers, so if one of transitionend events + // happens after starting zoom animation (propagating to the map pane), we know that it ended globally + if (this._zoomAnimated) { + this._createAnimProxy(); + on(this._proxy, TRANSITION_END, this._catchTransitionEnd, this); + } + + this._addLayers(this.options.layers); + }, + + + // @section Methods for modifying map state + + // @method setView(center: LatLng, zoom: Number, options?: Zoom/pan options): this + // Sets the view of the map (geographical center and zoom) with the given + // animation options. + setView: function (center, zoom, options) { + + zoom = zoom === undefined ? this._zoom : this._limitZoom(zoom); + center = this._limitCenter(toLatLng(center), zoom, this.options.maxBounds); + options = options || {}; + + this._stop(); + + if (this._loaded && !options.reset && options !== true) { + + if (options.animate !== undefined) { + options.zoom = extend({animate: options.animate}, options.zoom); + options.pan = extend({animate: options.animate, duration: options.duration}, options.pan); + } + + // try animating pan or zoom + var moved = (this._zoom !== zoom) ? + this._tryAnimatedZoom && this._tryAnimatedZoom(center, zoom, options.zoom) : + this._tryAnimatedPan(center, options.pan); + + if (moved) { + // prevent resize handler call, the view will refresh after animation anyway + clearTimeout(this._sizeTimer); + return this; + } + } + + // animation didn't start, just reset the map view + this._resetView(center, zoom); + + return this; + }, + + // @method setZoom(zoom: Number, options?: Zoom/pan options): this + // Sets the zoom of the map. + setZoom: function (zoom, options) { + if (!this._loaded) { + this._zoom = zoom; + return this; + } + return this.setView(this.getCenter(), zoom, {zoom: options}); + }, + + // @method zoomIn(delta?: Number, options?: Zoom options): this + // Increases the zoom of the map by `delta` ([`zoomDelta`](#map-zoomdelta) by default). + zoomIn: function (delta, options) { + delta = delta || (Browser.any3d ? this.options.zoomDelta : 1); + return this.setZoom(this._zoom + delta, options); + }, + + // @method zoomOut(delta?: Number, options?: Zoom options): this + // Decreases the zoom of the map by `delta` ([`zoomDelta`](#map-zoomdelta) by default). + zoomOut: function (delta, options) { + delta = delta || (Browser.any3d ? this.options.zoomDelta : 1); + return this.setZoom(this._zoom - delta, options); + }, + + // @method setZoomAround(latlng: LatLng, zoom: Number, options: Zoom options): this + // Zooms the map while keeping a specified geographical point on the map + // stationary (e.g. used internally for scroll zoom and double-click zoom). + // @alternative + // @method setZoomAround(offset: Point, zoom: Number, options: Zoom options): this + // Zooms the map while keeping a specified pixel on the map (relative to the top-left corner) stationary. + setZoomAround: function (latlng, zoom, options) { + var scale = this.getZoomScale(zoom), + viewHalf = this.getSize().divideBy(2), + containerPoint = latlng instanceof Point ? latlng : this.latLngToContainerPoint(latlng), + + centerOffset = containerPoint.subtract(viewHalf).multiplyBy(1 - 1 / scale), + newCenter = this.containerPointToLatLng(viewHalf.add(centerOffset)); + + return this.setView(newCenter, zoom, {zoom: options}); + }, + + _getBoundsCenterZoom: function (bounds, options) { + + options = options || {}; + bounds = bounds.getBounds ? bounds.getBounds() : toLatLngBounds(bounds); + + var paddingTL = toPoint(options.paddingTopLeft || options.padding || [0, 0]), + paddingBR = toPoint(options.paddingBottomRight || options.padding || [0, 0]), + + zoom = this.getBoundsZoom(bounds, false, paddingTL.add(paddingBR)); + + zoom = (typeof options.maxZoom === 'number') ? Math.min(options.maxZoom, zoom) : zoom; + + if (zoom === Infinity) { + return { + center: bounds.getCenter(), + zoom: zoom + }; + } + + var paddingOffset = paddingBR.subtract(paddingTL).divideBy(2), + + swPoint = this.project(bounds.getSouthWest(), zoom), + nePoint = this.project(bounds.getNorthEast(), zoom), + center = this.unproject(swPoint.add(nePoint).divideBy(2).add(paddingOffset), zoom); + + return { + center: center, + zoom: zoom + }; + }, + + // @method fitBounds(bounds: LatLngBounds, options?: fitBounds options): this + // Sets a map view that contains the given geographical bounds with the + // maximum zoom level possible. + fitBounds: function (bounds, options) { + + bounds = toLatLngBounds(bounds); + + if (!bounds.isValid()) { + throw new Error('Bounds are not valid.'); + } + + var target = this._getBoundsCenterZoom(bounds, options); + return this.setView(target.center, target.zoom, options); + }, + + // @method fitWorld(options?: fitBounds options): this + // Sets a map view that mostly contains the whole world with the maximum + // zoom level possible. + fitWorld: function (options) { + return this.fitBounds([[-90, -180], [90, 180]], options); + }, + + // @method panTo(latlng: LatLng, options?: Pan options): this + // Pans the map to a given center. + panTo: function (center, options) { // (LatLng) + return this.setView(center, this._zoom, {pan: options}); + }, + + // @method panBy(offset: Point, options?: Pan options): this + // Pans the map by a given number of pixels (animated). + panBy: function (offset, options) { + offset = toPoint(offset).round(); + options = options || {}; + + if (!offset.x && !offset.y) { + return this.fire('moveend'); + } + // If we pan too far, Chrome gets issues with tiles + // and makes them disappear or appear in the wrong place (slightly offset) #2602 + if (options.animate !== true && !this.getSize().contains(offset)) { + this._resetView(this.unproject(this.project(this.getCenter()).add(offset)), this.getZoom()); + return this; + } + + if (!this._panAnim) { + this._panAnim = new PosAnimation(); + + this._panAnim.on({ + 'step': this._onPanTransitionStep, + 'end': this._onPanTransitionEnd + }, this); + } + + // don't fire movestart if animating inertia + if (!options.noMoveStart) { + this.fire('movestart'); + } + + // animate pan unless animate: false specified + if (options.animate !== false) { + addClass(this._mapPane, 'leaflet-pan-anim'); + + var newPos = this._getMapPanePos().subtract(offset).round(); + this._panAnim.run(this._mapPane, newPos, options.duration || 0.25, options.easeLinearity); + } else { + this._rawPanBy(offset); + this.fire('move').fire('moveend'); + } + + return this; + }, + + // @method flyTo(latlng: LatLng, zoom?: Number, options?: Zoom/pan options): this + // Sets the view of the map (geographical center and zoom) performing a smooth + // pan-zoom animation. + flyTo: function (targetCenter, targetZoom, options) { + + options = options || {}; + if (options.animate === false || !Browser.any3d) { + return this.setView(targetCenter, targetZoom, options); + } + + this._stop(); + + var from = this.project(this.getCenter()), + to = this.project(targetCenter), + size = this.getSize(), + startZoom = this._zoom; + + targetCenter = toLatLng(targetCenter); + targetZoom = targetZoom === undefined ? startZoom : targetZoom; + + var w0 = Math.max(size.x, size.y), + w1 = w0 * this.getZoomScale(startZoom, targetZoom), + u1 = (to.distanceTo(from)) || 1, + rho = 1.42, + rho2 = rho * rho; + + function r(i) { + var s1 = i ? -1 : 1, + s2 = i ? w1 : w0, + t1 = w1 * w1 - w0 * w0 + s1 * rho2 * rho2 * u1 * u1, + b1 = 2 * s2 * rho2 * u1, + b = t1 / b1, + sq = Math.sqrt(b * b + 1) - b; + + // workaround for floating point precision bug when sq = 0, log = -Infinite, + // thus triggering an infinite loop in flyTo + var log = sq < 0.000000001 ? -18 : Math.log(sq); + + return log; + } + + function sinh(n) { return (Math.exp(n) - Math.exp(-n)) / 2; } + function cosh(n) { return (Math.exp(n) + Math.exp(-n)) / 2; } + function tanh(n) { return sinh(n) / cosh(n); } + + var r0 = r(0); + + function w(s) { return w0 * (cosh(r0) / cosh(r0 + rho * s)); } + function u(s) { return w0 * (cosh(r0) * tanh(r0 + rho * s) - sinh(r0)) / rho2; } + + function easeOut(t) { return 1 - Math.pow(1 - t, 1.5); } + + var start = Date.now(), + S = (r(1) - r0) / rho, + duration = options.duration ? 1000 * options.duration : 1000 * S * 0.8; + + function frame() { + var t = (Date.now() - start) / duration, + s = easeOut(t) * S; + + if (t <= 1) { + this._flyToFrame = requestAnimFrame(frame, this); + + this._move( + this.unproject(from.add(to.subtract(from).multiplyBy(u(s) / u1)), startZoom), + this.getScaleZoom(w0 / w(s), startZoom), + {flyTo: true}); + + } else { + this + ._move(targetCenter, targetZoom) + ._moveEnd(true); + } + } + + this._moveStart(true, options.noMoveStart); + + frame.call(this); + return this; + }, + + // @method flyToBounds(bounds: LatLngBounds, options?: fitBounds options): this + // Sets the view of the map with a smooth animation like [`flyTo`](#map-flyto), + // but takes a bounds parameter like [`fitBounds`](#map-fitbounds). + flyToBounds: function (bounds, options) { + var target = this._getBoundsCenterZoom(bounds, options); + return this.flyTo(target.center, target.zoom, options); + }, + + // @method setMaxBounds(bounds: LatLngBounds): this + // Restricts the map view to the given bounds (see the [maxBounds](#map-maxbounds) option). + setMaxBounds: function (bounds) { + bounds = toLatLngBounds(bounds); + + if (!bounds.isValid()) { + this.options.maxBounds = null; + return this.off('moveend', this._panInsideMaxBounds); + } else if (this.options.maxBounds) { + this.off('moveend', this._panInsideMaxBounds); + } + + this.options.maxBounds = bounds; + + if (this._loaded) { + this._panInsideMaxBounds(); + } + + return this.on('moveend', this._panInsideMaxBounds); + }, + + // @method setMinZoom(zoom: Number): this + // Sets the lower limit for the available zoom levels (see the [minZoom](#map-minzoom) option). + setMinZoom: function (zoom) { + var oldZoom = this.options.minZoom; + this.options.minZoom = zoom; + + if (this._loaded && oldZoom !== zoom) { + this.fire('zoomlevelschange'); + + if (this.getZoom() < this.options.minZoom) { + return this.setZoom(zoom); + } + } + + return this; + }, + + // @method setMaxZoom(zoom: Number): this + // Sets the upper limit for the available zoom levels (see the [maxZoom](#map-maxzoom) option). + setMaxZoom: function (zoom) { + var oldZoom = this.options.maxZoom; + this.options.maxZoom = zoom; + + if (this._loaded && oldZoom !== zoom) { + this.fire('zoomlevelschange'); + + if (this.getZoom() > this.options.maxZoom) { + return this.setZoom(zoom); + } + } + + return this; + }, + + // @method panInsideBounds(bounds: LatLngBounds, options?: Pan options): this + // Pans the map to the closest view that would lie inside the given bounds (if it's not already), controlling the animation using the options specific, if any. + panInsideBounds: function (bounds, options) { + this._enforcingBounds = true; + var center = this.getCenter(), + newCenter = this._limitCenter(center, this._zoom, toLatLngBounds(bounds)); + + if (!center.equals(newCenter)) { + this.panTo(newCenter, options); + } + + this._enforcingBounds = false; + return this; + }, + + // @method panInside(latlng: LatLng, options?: padding options): this + // Pans the map the minimum amount to make the `latlng` visible. Use + // padding options to fit the display to more restricted bounds. + // If `latlng` is already within the (optionally padded) display bounds, + // the map will not be panned. + panInside: function (latlng, options) { + options = options || {}; + + var paddingTL = toPoint(options.paddingTopLeft || options.padding || [0, 0]), + paddingBR = toPoint(options.paddingBottomRight || options.padding || [0, 0]), + pixelCenter = this.project(this.getCenter()), + pixelPoint = this.project(latlng), + pixelBounds = this.getPixelBounds(), + paddedBounds = toBounds([pixelBounds.min.add(paddingTL), pixelBounds.max.subtract(paddingBR)]), + paddedSize = paddedBounds.getSize(); + + if (!paddedBounds.contains(pixelPoint)) { + this._enforcingBounds = true; + var centerOffset = pixelPoint.subtract(paddedBounds.getCenter()); + var offset = paddedBounds.extend(pixelPoint).getSize().subtract(paddedSize); + pixelCenter.x += centerOffset.x < 0 ? -offset.x : offset.x; + pixelCenter.y += centerOffset.y < 0 ? -offset.y : offset.y; + this.panTo(this.unproject(pixelCenter), options); + this._enforcingBounds = false; + } + return this; + }, + + // @method invalidateSize(options: Zoom/pan options): this + // Checks if the map container size changed and updates the map if so — + // call it after you've changed the map size dynamically, also animating + // pan by default. If `options.pan` is `false`, panning will not occur. + // If `options.debounceMoveend` is `true`, it will delay `moveend` event so + // that it doesn't happen often even if the method is called many + // times in a row. + + // @alternative + // @method invalidateSize(animate: Boolean): this + // Checks if the map container size changed and updates the map if so — + // call it after you've changed the map size dynamically, also animating + // pan by default. + invalidateSize: function (options) { + if (!this._loaded) { return this; } + + options = extend({ + animate: false, + pan: true + }, options === true ? {animate: true} : options); + + var oldSize = this.getSize(); + this._sizeChanged = true; + this._lastCenter = null; + + var newSize = this.getSize(), + oldCenter = oldSize.divideBy(2).round(), + newCenter = newSize.divideBy(2).round(), + offset = oldCenter.subtract(newCenter); + + if (!offset.x && !offset.y) { return this; } + + if (options.animate && options.pan) { + this.panBy(offset); + + } else { + if (options.pan) { + this._rawPanBy(offset); + } + + this.fire('move'); + + if (options.debounceMoveend) { + clearTimeout(this._sizeTimer); + this._sizeTimer = setTimeout(bind(this.fire, this, 'moveend'), 200); + } else { + this.fire('moveend'); + } + } + + // @section Map state change events + // @event resize: ResizeEvent + // Fired when the map is resized. + return this.fire('resize', { + oldSize: oldSize, + newSize: newSize + }); + }, + + // @section Methods for modifying map state + // @method stop(): this + // Stops the currently running `panTo` or `flyTo` animation, if any. + stop: function () { + this.setZoom(this._limitZoom(this._zoom)); + if (!this.options.zoomSnap) { + this.fire('viewreset'); + } + return this._stop(); + }, + + // @section Geolocation methods + // @method locate(options?: Locate options): this + // Tries to locate the user using the Geolocation API, firing a [`locationfound`](#map-locationfound) + // event with location data on success or a [`locationerror`](#map-locationerror) event on failure, + // and optionally sets the map view to the user's location with respect to + // detection accuracy (or to the world view if geolocation failed). + // Note that, if your page doesn't use HTTPS, this method will fail in + // modern browsers ([Chrome 50 and newer](https://sites.google.com/a/chromium.org/dev/Home/chromium-security/deprecating-powerful-features-on-insecure-origins)) + // See `Locate options` for more details. + locate: function (options) { + + options = this._locateOptions = extend({ + timeout: 10000, + watch: false + // setView: false + // maxZoom: + // maximumAge: 0 + // enableHighAccuracy: false + }, options); + + if (!('geolocation' in navigator)) { + this._handleGeolocationError({ + code: 0, + message: 'Geolocation not supported.' + }); + return this; + } + + var onResponse = bind(this._handleGeolocationResponse, this), + onError = bind(this._handleGeolocationError, this); + + if (options.watch) { + this._locationWatchId = + navigator.geolocation.watchPosition(onResponse, onError, options); + } else { + navigator.geolocation.getCurrentPosition(onResponse, onError, options); + } + return this; + }, + + // @method stopLocate(): this + // Stops watching location previously initiated by `map.locate({watch: true})` + // and aborts resetting the map view if map.locate was called with + // `{setView: true}`. + stopLocate: function () { + if (navigator.geolocation && navigator.geolocation.clearWatch) { + navigator.geolocation.clearWatch(this._locationWatchId); + } + if (this._locateOptions) { + this._locateOptions.setView = false; + } + return this; + }, + + _handleGeolocationError: function (error) { + if (!this._container._leaflet_id) { return; } + + var c = error.code, + message = error.message || + (c === 1 ? 'permission denied' : + (c === 2 ? 'position unavailable' : 'timeout')); + + if (this._locateOptions.setView && !this._loaded) { + this.fitWorld(); + } + + // @section Location events + // @event locationerror: ErrorEvent + // Fired when geolocation (using the [`locate`](#map-locate) method) failed. + this.fire('locationerror', { + code: c, + message: 'Geolocation error: ' + message + '.' + }); + }, + + _handleGeolocationResponse: function (pos) { + if (!this._container._leaflet_id) { return; } + + var lat = pos.coords.latitude, + lng = pos.coords.longitude, + latlng = new LatLng(lat, lng), + bounds = latlng.toBounds(pos.coords.accuracy * 2), + options = this._locateOptions; + + if (options.setView) { + var zoom = this.getBoundsZoom(bounds); + this.setView(latlng, options.maxZoom ? Math.min(zoom, options.maxZoom) : zoom); + } + + var data = { + latlng: latlng, + bounds: bounds, + timestamp: pos.timestamp + }; + + for (var i in pos.coords) { + if (typeof pos.coords[i] === 'number') { + data[i] = pos.coords[i]; + } + } + + // @event locationfound: LocationEvent + // Fired when geolocation (using the [`locate`](#map-locate) method) + // went successfully. + this.fire('locationfound', data); + }, + + // TODO Appropriate docs section? + // @section Other Methods + // @method addHandler(name: String, HandlerClass: Function): this + // Adds a new `Handler` to the map, given its name and constructor function. + addHandler: function (name, HandlerClass) { + if (!HandlerClass) { return this; } + + var handler = this[name] = new HandlerClass(this); + + this._handlers.push(handler); + + if (this.options[name]) { + handler.enable(); + } + + return this; + }, + + // @method remove(): this + // Destroys the map and clears all related event listeners. + remove: function () { + + this._initEvents(true); + if (this.options.maxBounds) { this.off('moveend', this._panInsideMaxBounds); } + + if (this._containerId !== this._container._leaflet_id) { + throw new Error('Map container is being reused by another instance'); + } + + try { + // throws error in IE6-8 + delete this._container._leaflet_id; + delete this._containerId; + } catch (e) { + /*eslint-disable */ + this._container._leaflet_id = undefined; + /* eslint-enable */ + this._containerId = undefined; + } + + if (this._locationWatchId !== undefined) { + this.stopLocate(); + } + + this._stop(); + + remove(this._mapPane); + + if (this._clearControlPos) { + this._clearControlPos(); + } + if (this._resizeRequest) { + cancelAnimFrame(this._resizeRequest); + this._resizeRequest = null; + } + + this._clearHandlers(); + + if (this._loaded) { + // @section Map state change events + // @event unload: Event + // Fired when the map is destroyed with [remove](#map-remove) method. + this.fire('unload'); + } + + var i; + for (i in this._layers) { + this._layers[i].remove(); + } + for (i in this._panes) { + remove(this._panes[i]); + } + + this._layers = []; + this._panes = []; + delete this._mapPane; + delete this._renderer; + + return this; + }, + + // @section Other Methods + // @method createPane(name: String, container?: HTMLElement): HTMLElement + // Creates a new [map pane](#map-pane) with the given name if it doesn't exist already, + // then returns it. The pane is created as a child of `container`, or + // as a child of the main map pane if not set. + createPane: function (name, container) { + var className = 'leaflet-pane' + (name ? ' leaflet-' + name.replace('Pane', '') + '-pane' : ''), + pane = create$1('div', className, container || this._mapPane); + + if (name) { + this._panes[name] = pane; + } + return pane; + }, + + // @section Methods for Getting Map State + + // @method getCenter(): LatLng + // Returns the geographical center of the map view + getCenter: function () { + this._checkIfLoaded(); + + if (this._lastCenter && !this._moved()) { + return this._lastCenter; + } + return this.layerPointToLatLng(this._getCenterLayerPoint()); + }, + + // @method getZoom(): Number + // Returns the current zoom level of the map view + getZoom: function () { + return this._zoom; + }, + + // @method getBounds(): LatLngBounds + // Returns the geographical bounds visible in the current map view + getBounds: function () { + var bounds = this.getPixelBounds(), + sw = this.unproject(bounds.getBottomLeft()), + ne = this.unproject(bounds.getTopRight()); + + return new LatLngBounds(sw, ne); + }, + + // @method getMinZoom(): Number + // Returns the minimum zoom level of the map (if set in the `minZoom` option of the map or of any layers), or `0` by default. + getMinZoom: function () { + return this.options.minZoom === undefined ? this._layersMinZoom || 0 : this.options.minZoom; + }, + + // @method getMaxZoom(): Number + // Returns the maximum zoom level of the map (if set in the `maxZoom` option of the map or of any layers). + getMaxZoom: function () { + return this.options.maxZoom === undefined ? + (this._layersMaxZoom === undefined ? Infinity : this._layersMaxZoom) : + this.options.maxZoom; + }, + + // @method getBoundsZoom(bounds: LatLngBounds, inside?: Boolean, padding?: Point): Number + // Returns the maximum zoom level on which the given bounds fit to the map + // view in its entirety. If `inside` (optional) is set to `true`, the method + // instead returns the minimum zoom level on which the map view fits into + // the given bounds in its entirety. + getBoundsZoom: function (bounds, inside, padding) { // (LatLngBounds[, Boolean, Point]) -> Number + bounds = toLatLngBounds(bounds); + padding = toPoint(padding || [0, 0]); + + var zoom = this.getZoom() || 0, + min = this.getMinZoom(), + max = this.getMaxZoom(), + nw = bounds.getNorthWest(), + se = bounds.getSouthEast(), + size = this.getSize().subtract(padding), + boundsSize = toBounds(this.project(se, zoom), this.project(nw, zoom)).getSize(), + snap = Browser.any3d ? this.options.zoomSnap : 1, + scalex = size.x / boundsSize.x, + scaley = size.y / boundsSize.y, + scale = inside ? Math.max(scalex, scaley) : Math.min(scalex, scaley); + + zoom = this.getScaleZoom(scale, zoom); + + if (snap) { + zoom = Math.round(zoom / (snap / 100)) * (snap / 100); // don't jump if within 1% of a snap level + zoom = inside ? Math.ceil(zoom / snap) * snap : Math.floor(zoom / snap) * snap; + } + + return Math.max(min, Math.min(max, zoom)); + }, + + // @method getSize(): Point + // Returns the current size of the map container (in pixels). + getSize: function () { + if (!this._size || this._sizeChanged) { + this._size = new Point( + this._container.clientWidth || 0, + this._container.clientHeight || 0); + + this._sizeChanged = false; + } + return this._size.clone(); + }, + + // @method getPixelBounds(): Bounds + // Returns the bounds of the current map view in projected pixel + // coordinates (sometimes useful in layer and overlay implementations). + getPixelBounds: function (center, zoom) { + var topLeftPoint = this._getTopLeftPoint(center, zoom); + return new Bounds(topLeftPoint, topLeftPoint.add(this.getSize())); + }, + + // TODO: Check semantics - isn't the pixel origin the 0,0 coord relative to + // the map pane? "left point of the map layer" can be confusing, specially + // since there can be negative offsets. + // @method getPixelOrigin(): Point + // Returns the projected pixel coordinates of the top left point of + // the map layer (useful in custom layer and overlay implementations). + getPixelOrigin: function () { + this._checkIfLoaded(); + return this._pixelOrigin; + }, + + // @method getPixelWorldBounds(zoom?: Number): Bounds + // Returns the world's bounds in pixel coordinates for zoom level `zoom`. + // If `zoom` is omitted, the map's current zoom level is used. + getPixelWorldBounds: function (zoom) { + return this.options.crs.getProjectedBounds(zoom === undefined ? this.getZoom() : zoom); + }, + + // @section Other Methods + + // @method getPane(pane: String|HTMLElement): HTMLElement + // Returns a [map pane](#map-pane), given its name or its HTML element (its identity). + getPane: function (pane) { + return typeof pane === 'string' ? this._panes[pane] : pane; + }, + + // @method getPanes(): Object + // Returns a plain object containing the names of all [panes](#map-pane) as keys and + // the panes as values. + getPanes: function () { + return this._panes; + }, + + // @method getContainer: HTMLElement + // Returns the HTML element that contains the map. + getContainer: function () { + return this._container; + }, + + + // @section Conversion Methods + + // @method getZoomScale(toZoom: Number, fromZoom: Number): Number + // Returns the scale factor to be applied to a map transition from zoom level + // `fromZoom` to `toZoom`. Used internally to help with zoom animations. + getZoomScale: function (toZoom, fromZoom) { + // TODO replace with universal implementation after refactoring projections + var crs = this.options.crs; + fromZoom = fromZoom === undefined ? this._zoom : fromZoom; + return crs.scale(toZoom) / crs.scale(fromZoom); + }, + + // @method getScaleZoom(scale: Number, fromZoom: Number): Number + // Returns the zoom level that the map would end up at, if it is at `fromZoom` + // level and everything is scaled by a factor of `scale`. Inverse of + // [`getZoomScale`](#map-getZoomScale). + getScaleZoom: function (scale, fromZoom) { + var crs = this.options.crs; + fromZoom = fromZoom === undefined ? this._zoom : fromZoom; + var zoom = crs.zoom(scale * crs.scale(fromZoom)); + return isNaN(zoom) ? Infinity : zoom; + }, + + // @method project(latlng: LatLng, zoom: Number): Point + // Projects a geographical coordinate `LatLng` according to the projection + // of the map's CRS, then scales it according to `zoom` and the CRS's + // `Transformation`. The result is pixel coordinate relative to + // the CRS origin. + project: function (latlng, zoom) { + zoom = zoom === undefined ? this._zoom : zoom; + return this.options.crs.latLngToPoint(toLatLng(latlng), zoom); + }, + + // @method unproject(point: Point, zoom: Number): LatLng + // Inverse of [`project`](#map-project). + unproject: function (point, zoom) { + zoom = zoom === undefined ? this._zoom : zoom; + return this.options.crs.pointToLatLng(toPoint(point), zoom); + }, + + // @method layerPointToLatLng(point: Point): LatLng + // Given a pixel coordinate relative to the [origin pixel](#map-getpixelorigin), + // returns the corresponding geographical coordinate (for the current zoom level). + layerPointToLatLng: function (point) { + var projectedPoint = toPoint(point).add(this.getPixelOrigin()); + return this.unproject(projectedPoint); + }, + + // @method latLngToLayerPoint(latlng: LatLng): Point + // Given a geographical coordinate, returns the corresponding pixel coordinate + // relative to the [origin pixel](#map-getpixelorigin). + latLngToLayerPoint: function (latlng) { + var projectedPoint = this.project(toLatLng(latlng))._round(); + return projectedPoint._subtract(this.getPixelOrigin()); + }, + + // @method wrapLatLng(latlng: LatLng): LatLng + // Returns a `LatLng` where `lat` and `lng` has been wrapped according to the + // map's CRS's `wrapLat` and `wrapLng` properties, if they are outside the + // CRS's bounds. + // By default this means longitude is wrapped around the dateline so its + // value is between -180 and +180 degrees. + wrapLatLng: function (latlng) { + return this.options.crs.wrapLatLng(toLatLng(latlng)); + }, + + // @method wrapLatLngBounds(bounds: LatLngBounds): LatLngBounds + // Returns a `LatLngBounds` with the same size as the given one, ensuring that + // its center is within the CRS's bounds. + // By default this means the center longitude is wrapped around the dateline so its + // value is between -180 and +180 degrees, and the majority of the bounds + // overlaps the CRS's bounds. + wrapLatLngBounds: function (latlng) { + return this.options.crs.wrapLatLngBounds(toLatLngBounds(latlng)); + }, + + // @method distance(latlng1: LatLng, latlng2: LatLng): Number + // Returns the distance between two geographical coordinates according to + // the map's CRS. By default this measures distance in meters. + distance: function (latlng1, latlng2) { + return this.options.crs.distance(toLatLng(latlng1), toLatLng(latlng2)); + }, + + // @method containerPointToLayerPoint(point: Point): Point + // Given a pixel coordinate relative to the map container, returns the corresponding + // pixel coordinate relative to the [origin pixel](#map-getpixelorigin). + containerPointToLayerPoint: function (point) { // (Point) + return toPoint(point).subtract(this._getMapPanePos()); + }, + + // @method layerPointToContainerPoint(point: Point): Point + // Given a pixel coordinate relative to the [origin pixel](#map-getpixelorigin), + // returns the corresponding pixel coordinate relative to the map container. + layerPointToContainerPoint: function (point) { // (Point) + return toPoint(point).add(this._getMapPanePos()); + }, + + // @method containerPointToLatLng(point: Point): LatLng + // Given a pixel coordinate relative to the map container, returns + // the corresponding geographical coordinate (for the current zoom level). + containerPointToLatLng: function (point) { + var layerPoint = this.containerPointToLayerPoint(toPoint(point)); + return this.layerPointToLatLng(layerPoint); + }, + + // @method latLngToContainerPoint(latlng: LatLng): Point + // Given a geographical coordinate, returns the corresponding pixel coordinate + // relative to the map container. + latLngToContainerPoint: function (latlng) { + return this.layerPointToContainerPoint(this.latLngToLayerPoint(toLatLng(latlng))); + }, + + // @method mouseEventToContainerPoint(ev: MouseEvent): Point + // Given a MouseEvent object, returns the pixel coordinate relative to the + // map container where the event took place. + mouseEventToContainerPoint: function (e) { + return getMousePosition(e, this._container); + }, + + // @method mouseEventToLayerPoint(ev: MouseEvent): Point + // Given a MouseEvent object, returns the pixel coordinate relative to + // the [origin pixel](#map-getpixelorigin) where the event took place. + mouseEventToLayerPoint: function (e) { + return this.containerPointToLayerPoint(this.mouseEventToContainerPoint(e)); + }, + + // @method mouseEventToLatLng(ev: MouseEvent): LatLng + // Given a MouseEvent object, returns geographical coordinate where the + // event took place. + mouseEventToLatLng: function (e) { // (MouseEvent) + return this.layerPointToLatLng(this.mouseEventToLayerPoint(e)); + }, + + + // map initialization methods + + _initContainer: function (id) { + var container = this._container = get(id); + + if (!container) { + throw new Error('Map container not found.'); + } else if (container._leaflet_id) { + throw new Error('Map container is already initialized.'); + } + + on(container, 'scroll', this._onScroll, this); + this._containerId = stamp(container); + }, + + _initLayout: function () { + var container = this._container; + + this._fadeAnimated = this.options.fadeAnimation && Browser.any3d; + + addClass(container, 'leaflet-container' + + (Browser.touch ? ' leaflet-touch' : '') + + (Browser.retina ? ' leaflet-retina' : '') + + (Browser.ielt9 ? ' leaflet-oldie' : '') + + (Browser.safari ? ' leaflet-safari' : '') + + (this._fadeAnimated ? ' leaflet-fade-anim' : '')); + + var position = getStyle(container, 'position'); + + if (position !== 'absolute' && position !== 'relative' && position !== 'fixed') { + container.style.position = 'relative'; + } + + this._initPanes(); + + if (this._initControlPos) { + this._initControlPos(); + } + }, + + _initPanes: function () { + var panes = this._panes = {}; + this._paneRenderers = {}; + + // @section + // + // Panes are DOM elements used to control the ordering of layers on the map. You + // can access panes with [`map.getPane`](#map-getpane) or + // [`map.getPanes`](#map-getpanes) methods. New panes can be created with the + // [`map.createPane`](#map-createpane) method. + // + // Every map has the following default panes that differ only in zIndex. + // + // @pane mapPane: HTMLElement = 'auto' + // Pane that contains all other map panes + + this._mapPane = this.createPane('mapPane', this._container); + setPosition(this._mapPane, new Point(0, 0)); + + // @pane tilePane: HTMLElement = 200 + // Pane for `GridLayer`s and `TileLayer`s + this.createPane('tilePane'); + // @pane overlayPane: HTMLElement = 400 + // Pane for vectors (`Path`s, like `Polyline`s and `Polygon`s), `ImageOverlay`s and `VideoOverlay`s + this.createPane('overlayPane'); + // @pane shadowPane: HTMLElement = 500 + // Pane for overlay shadows (e.g. `Marker` shadows) + this.createPane('shadowPane'); + // @pane markerPane: HTMLElement = 600 + // Pane for `Icon`s of `Marker`s + this.createPane('markerPane'); + // @pane tooltipPane: HTMLElement = 650 + // Pane for `Tooltip`s. + this.createPane('tooltipPane'); + // @pane popupPane: HTMLElement = 700 + // Pane for `Popup`s. + this.createPane('popupPane'); + + if (!this.options.markerZoomAnimation) { + addClass(panes.markerPane, 'leaflet-zoom-hide'); + addClass(panes.shadowPane, 'leaflet-zoom-hide'); + } + }, + + + // private methods that modify map state + + // @section Map state change events + _resetView: function (center, zoom) { + setPosition(this._mapPane, new Point(0, 0)); + + var loading = !this._loaded; + this._loaded = true; + zoom = this._limitZoom(zoom); + + this.fire('viewprereset'); + + var zoomChanged = this._zoom !== zoom; + this + ._moveStart(zoomChanged, false) + ._move(center, zoom) + ._moveEnd(zoomChanged); + + // @event viewreset: Event + // Fired when the map needs to redraw its content (this usually happens + // on map zoom or load). Very useful for creating custom overlays. + this.fire('viewreset'); + + // @event load: Event + // Fired when the map is initialized (when its center and zoom are set + // for the first time). + if (loading) { + this.fire('load'); + } + }, + + _moveStart: function (zoomChanged, noMoveStart) { + // @event zoomstart: Event + // Fired when the map zoom is about to change (e.g. before zoom animation). + // @event movestart: Event + // Fired when the view of the map starts changing (e.g. user starts dragging the map). + if (zoomChanged) { + this.fire('zoomstart'); + } + if (!noMoveStart) { + this.fire('movestart'); + } + return this; + }, + + _move: function (center, zoom, data, supressEvent) { + if (zoom === undefined) { + zoom = this._zoom; + } + var zoomChanged = this._zoom !== zoom; + + this._zoom = zoom; + this._lastCenter = center; + this._pixelOrigin = this._getNewPixelOrigin(center); + + if (!supressEvent) { + // @event zoom: Event + // Fired repeatedly during any change in zoom level, + // including zoom and fly animations. + if (zoomChanged || (data && data.pinch)) { // Always fire 'zoom' if pinching because #3530 + this.fire('zoom', data); + } + + // @event move: Event + // Fired repeatedly during any movement of the map, + // including pan and fly animations. + this.fire('move', data); + } else if (data && data.pinch) { // Always fire 'zoom' if pinching because #3530 + this.fire('zoom', data); + } + return this; + }, + + _moveEnd: function (zoomChanged) { + // @event zoomend: Event + // Fired when the map zoom changed, after any animations. + if (zoomChanged) { + this.fire('zoomend'); + } + + // @event moveend: Event + // Fired when the center of the map stops changing + // (e.g. user stopped dragging the map or after non-centered zoom). + return this.fire('moveend'); + }, + + _stop: function () { + cancelAnimFrame(this._flyToFrame); + if (this._panAnim) { + this._panAnim.stop(); + } + return this; + }, + + _rawPanBy: function (offset) { + setPosition(this._mapPane, this._getMapPanePos().subtract(offset)); + }, + + _getZoomSpan: function () { + return this.getMaxZoom() - this.getMinZoom(); + }, + + _panInsideMaxBounds: function () { + if (!this._enforcingBounds) { + this.panInsideBounds(this.options.maxBounds); + } + }, + + _checkIfLoaded: function () { + if (!this._loaded) { + throw new Error('Set map center and zoom first.'); + } + }, + + // DOM event handling + + // @section Interaction events + _initEvents: function (remove) { + this._targets = {}; + this._targets[stamp(this._container)] = this; + + var onOff = remove ? off : on; + + // @event click: MouseEvent + // Fired when the user clicks (or taps) the map. + // @event dblclick: MouseEvent + // Fired when the user double-clicks (or double-taps) the map. + // @event mousedown: MouseEvent + // Fired when the user pushes the mouse button on the map. + // @event mouseup: MouseEvent + // Fired when the user releases the mouse button on the map. + // @event mouseover: MouseEvent + // Fired when the mouse enters the map. + // @event mouseout: MouseEvent + // Fired when the mouse leaves the map. + // @event mousemove: MouseEvent + // Fired while the mouse moves over the map. + // @event contextmenu: MouseEvent + // Fired when the user pushes the right mouse button on the map, prevents + // default browser context menu from showing if there are listeners on + // this event. Also fired on mobile when the user holds a single touch + // for a second (also called long press). + // @event keypress: KeyboardEvent + // Fired when the user presses a key from the keyboard that produces a character value while the map is focused. + // @event keydown: KeyboardEvent + // Fired when the user presses a key from the keyboard while the map is focused. Unlike the `keypress` event, + // the `keydown` event is fired for keys that produce a character value and for keys + // that do not produce a character value. + // @event keyup: KeyboardEvent + // Fired when the user releases a key from the keyboard while the map is focused. + onOff(this._container, 'click dblclick mousedown mouseup ' + + 'mouseover mouseout mousemove contextmenu keypress keydown keyup', this._handleDOMEvent, this); + + if (this.options.trackResize) { + onOff(window, 'resize', this._onResize, this); + } + + if (Browser.any3d && this.options.transform3DLimit) { + (remove ? this.off : this.on).call(this, 'moveend', this._onMoveEnd); + } + }, + + _onResize: function () { + cancelAnimFrame(this._resizeRequest); + this._resizeRequest = requestAnimFrame( + function () { this.invalidateSize({debounceMoveend: true}); }, this); + }, + + _onScroll: function () { + this._container.scrollTop = 0; + this._container.scrollLeft = 0; + }, + + _onMoveEnd: function () { + var pos = this._getMapPanePos(); + if (Math.max(Math.abs(pos.x), Math.abs(pos.y)) >= this.options.transform3DLimit) { + // https://bugzilla.mozilla.org/show_bug.cgi?id=1203873 but Webkit also have + // a pixel offset on very high values, see: https://jsfiddle.net/dg6r5hhb/ + this._resetView(this.getCenter(), this.getZoom()); + } + }, + + _findEventTargets: function (e, type) { + var targets = [], + target, + isHover = type === 'mouseout' || type === 'mouseover', + src = e.target || e.srcElement, + dragging = false; + + while (src) { + target = this._targets[stamp(src)]; + if (target && (type === 'click' || type === 'preclick') && this._draggableMoved(target)) { + // Prevent firing click after you just dragged an object. + dragging = true; + break; + } + if (target && target.listens(type, true)) { + if (isHover && !isExternalTarget(src, e)) { break; } + targets.push(target); + if (isHover) { break; } + } + if (src === this._container) { break; } + src = src.parentNode; + } + if (!targets.length && !dragging && !isHover && this.listens(type, true)) { + targets = [this]; + } + return targets; + }, + + _isClickDisabled: function (el) { + while (el !== this._container) { + if (el['_leaflet_disable_click']) { return true; } + el = el.parentNode; + } + }, + + _handleDOMEvent: function (e) { + var el = (e.target || e.srcElement); + if (!this._loaded || el['_leaflet_disable_events'] || e.type === 'click' && this._isClickDisabled(el)) { + return; + } + + var type = e.type; + + if (type === 'mousedown') { + // prevents outline when clicking on keyboard-focusable element + preventOutline(el); + } + + this._fireDOMEvent(e, type); + }, + + _mouseEvents: ['click', 'dblclick', 'mouseover', 'mouseout', 'contextmenu'], + + _fireDOMEvent: function (e, type, canvasTargets) { + + if (e.type === 'click') { + // Fire a synthetic 'preclick' event which propagates up (mainly for closing popups). + // @event preclick: MouseEvent + // Fired before mouse click on the map (sometimes useful when you + // want something to happen on click before any existing click + // handlers start running). + var synth = extend({}, e); + synth.type = 'preclick'; + this._fireDOMEvent(synth, synth.type, canvasTargets); + } + + // Find the layer the event is propagating from and its parents. + var targets = this._findEventTargets(e, type); + + if (canvasTargets) { + var filtered = []; // pick only targets with listeners + for (var i = 0; i < canvasTargets.length; i++) { + if (canvasTargets[i].listens(type, true)) { + filtered.push(canvasTargets[i]); + } + } + targets = filtered.concat(targets); + } + + if (!targets.length) { return; } + + if (type === 'contextmenu') { + preventDefault(e); + } + + var target = targets[0]; + var data = { + originalEvent: e + }; + + if (e.type !== 'keypress' && e.type !== 'keydown' && e.type !== 'keyup') { + var isMarker = target.getLatLng && (!target._radius || target._radius <= 10); + data.containerPoint = isMarker ? + this.latLngToContainerPoint(target.getLatLng()) : this.mouseEventToContainerPoint(e); + data.layerPoint = this.containerPointToLayerPoint(data.containerPoint); + data.latlng = isMarker ? target.getLatLng() : this.layerPointToLatLng(data.layerPoint); + } + + for (i = 0; i < targets.length; i++) { + targets[i].fire(type, data, true); + if (data.originalEvent._stopped || + (targets[i].options.bubblingMouseEvents === false && indexOf(this._mouseEvents, type) !== -1)) { return; } + } + }, + + _draggableMoved: function (obj) { + obj = obj.dragging && obj.dragging.enabled() ? obj : this; + return (obj.dragging && obj.dragging.moved()) || (this.boxZoom && this.boxZoom.moved()); + }, + + _clearHandlers: function () { + for (var i = 0, len = this._handlers.length; i < len; i++) { + this._handlers[i].disable(); + } + }, + + // @section Other Methods + + // @method whenReady(fn: Function, context?: Object): this + // Runs the given function `fn` when the map gets initialized with + // a view (center and zoom) and at least one layer, or immediately + // if it's already initialized, optionally passing a function context. + whenReady: function (callback, context) { + if (this._loaded) { + callback.call(context || this, {target: this}); + } else { + this.on('load', callback, context); + } + return this; + }, + + + // private methods for getting map state + + _getMapPanePos: function () { + return getPosition(this._mapPane) || new Point(0, 0); + }, + + _moved: function () { + var pos = this._getMapPanePos(); + return pos && !pos.equals([0, 0]); + }, + + _getTopLeftPoint: function (center, zoom) { + var pixelOrigin = center && zoom !== undefined ? + this._getNewPixelOrigin(center, zoom) : + this.getPixelOrigin(); + return pixelOrigin.subtract(this._getMapPanePos()); + }, + + _getNewPixelOrigin: function (center, zoom) { + var viewHalf = this.getSize()._divideBy(2); + return this.project(center, zoom)._subtract(viewHalf)._add(this._getMapPanePos())._round(); + }, + + _latLngToNewLayerPoint: function (latlng, zoom, center) { + var topLeft = this._getNewPixelOrigin(center, zoom); + return this.project(latlng, zoom)._subtract(topLeft); + }, + + _latLngBoundsToNewLayerBounds: function (latLngBounds, zoom, center) { + var topLeft = this._getNewPixelOrigin(center, zoom); + return toBounds([ + this.project(latLngBounds.getSouthWest(), zoom)._subtract(topLeft), + this.project(latLngBounds.getNorthWest(), zoom)._subtract(topLeft), + this.project(latLngBounds.getSouthEast(), zoom)._subtract(topLeft), + this.project(latLngBounds.getNorthEast(), zoom)._subtract(topLeft) + ]); + }, + + // layer point of the current center + _getCenterLayerPoint: function () { + return this.containerPointToLayerPoint(this.getSize()._divideBy(2)); + }, + + // offset of the specified place to the current center in pixels + _getCenterOffset: function (latlng) { + return this.latLngToLayerPoint(latlng).subtract(this._getCenterLayerPoint()); + }, + + // adjust center for view to get inside bounds + _limitCenter: function (center, zoom, bounds) { + + if (!bounds) { return center; } + + var centerPoint = this.project(center, zoom), + viewHalf = this.getSize().divideBy(2), + viewBounds = new Bounds(centerPoint.subtract(viewHalf), centerPoint.add(viewHalf)), + offset = this._getBoundsOffset(viewBounds, bounds, zoom); + + // If offset is less than a pixel, ignore. + // This prevents unstable projections from getting into + // an infinite loop of tiny offsets. + if (offset.round().equals([0, 0])) { + return center; + } + + return this.unproject(centerPoint.add(offset), zoom); + }, + + // adjust offset for view to get inside bounds + _limitOffset: function (offset, bounds) { + if (!bounds) { return offset; } + + var viewBounds = this.getPixelBounds(), + newBounds = new Bounds(viewBounds.min.add(offset), viewBounds.max.add(offset)); + + return offset.add(this._getBoundsOffset(newBounds, bounds)); + }, + + // returns offset needed for pxBounds to get inside maxBounds at a specified zoom + _getBoundsOffset: function (pxBounds, maxBounds, zoom) { + var projectedMaxBounds = toBounds( + this.project(maxBounds.getNorthEast(), zoom), + this.project(maxBounds.getSouthWest(), zoom) + ), + minOffset = projectedMaxBounds.min.subtract(pxBounds.min), + maxOffset = projectedMaxBounds.max.subtract(pxBounds.max), + + dx = this._rebound(minOffset.x, -maxOffset.x), + dy = this._rebound(minOffset.y, -maxOffset.y); + + return new Point(dx, dy); + }, + + _rebound: function (left, right) { + return left + right > 0 ? + Math.round(left - right) / 2 : + Math.max(0, Math.ceil(left)) - Math.max(0, Math.floor(right)); + }, + + _limitZoom: function (zoom) { + var min = this.getMinZoom(), + max = this.getMaxZoom(), + snap = Browser.any3d ? this.options.zoomSnap : 1; + if (snap) { + zoom = Math.round(zoom / snap) * snap; + } + return Math.max(min, Math.min(max, zoom)); + }, + + _onPanTransitionStep: function () { + this.fire('move'); + }, + + _onPanTransitionEnd: function () { + removeClass(this._mapPane, 'leaflet-pan-anim'); + this.fire('moveend'); + }, + + _tryAnimatedPan: function (center, options) { + // difference between the new and current centers in pixels + var offset = this._getCenterOffset(center)._trunc(); + + // don't animate too far unless animate: true specified in options + if ((options && options.animate) !== true && !this.getSize().contains(offset)) { return false; } + + this.panBy(offset, options); + + return true; + }, + + _createAnimProxy: function () { + + var proxy = this._proxy = create$1('div', 'leaflet-proxy leaflet-zoom-animated'); + this._panes.mapPane.appendChild(proxy); + + this.on('zoomanim', function (e) { + var prop = TRANSFORM, + transform = this._proxy.style[prop]; + + setTransform(this._proxy, this.project(e.center, e.zoom), this.getZoomScale(e.zoom, 1)); + + // workaround for case when transform is the same and so transitionend event is not fired + if (transform === this._proxy.style[prop] && this._animatingZoom) { + this._onZoomTransitionEnd(); + } + }, this); + + this.on('load moveend', this._animMoveEnd, this); + + this._on('unload', this._destroyAnimProxy, this); + }, + + _destroyAnimProxy: function () { + remove(this._proxy); + this.off('load moveend', this._animMoveEnd, this); + delete this._proxy; + }, + + _animMoveEnd: function () { + var c = this.getCenter(), + z = this.getZoom(); + setTransform(this._proxy, this.project(c, z), this.getZoomScale(z, 1)); + }, + + _catchTransitionEnd: function (e) { + if (this._animatingZoom && e.propertyName.indexOf('transform') >= 0) { + this._onZoomTransitionEnd(); + } + }, + + _nothingToAnimate: function () { + return !this._container.getElementsByClassName('leaflet-zoom-animated').length; + }, + + _tryAnimatedZoom: function (center, zoom, options) { + + if (this._animatingZoom) { return true; } + + options = options || {}; + + // don't animate if disabled, not supported or zoom difference is too large + if (!this._zoomAnimated || options.animate === false || this._nothingToAnimate() || + Math.abs(zoom - this._zoom) > this.options.zoomAnimationThreshold) { return false; } + + // offset is the pixel coords of the zoom origin relative to the current center + var scale = this.getZoomScale(zoom), + offset = this._getCenterOffset(center)._divideBy(1 - 1 / scale); + + // don't animate if the zoom origin isn't within one screen from the current center, unless forced + if (options.animate !== true && !this.getSize().contains(offset)) { return false; } + + requestAnimFrame(function () { + this + ._moveStart(true, false) + ._animateZoom(center, zoom, true); + }, this); + + return true; + }, + + _animateZoom: function (center, zoom, startAnim, noUpdate) { + if (!this._mapPane) { return; } + + if (startAnim) { + this._animatingZoom = true; + + // remember what center/zoom to set after animation + this._animateToCenter = center; + this._animateToZoom = zoom; + + addClass(this._mapPane, 'leaflet-zoom-anim'); + } + + // @section Other Events + // @event zoomanim: ZoomAnimEvent + // Fired at least once per zoom animation. For continuous zoom, like pinch zooming, fired once per frame during zoom. + this.fire('zoomanim', { + center: center, + zoom: zoom, + noUpdate: noUpdate + }); + + if (!this._tempFireZoomEvent) { + this._tempFireZoomEvent = this._zoom !== this._animateToZoom; + } + + this._move(this._animateToCenter, this._animateToZoom, undefined, true); + + // Work around webkit not firing 'transitionend', see https://github.com/Leaflet/Leaflet/issues/3689, 2693 + setTimeout(bind(this._onZoomTransitionEnd, this), 250); + }, + + _onZoomTransitionEnd: function () { + if (!this._animatingZoom) { return; } + + if (this._mapPane) { + removeClass(this._mapPane, 'leaflet-zoom-anim'); + } + + this._animatingZoom = false; + + this._move(this._animateToCenter, this._animateToZoom, undefined, true); + + if (this._tempFireZoomEvent) { + this.fire('zoom'); + } + delete this._tempFireZoomEvent; + + this.fire('move'); + + this._moveEnd(true); + } +}); + +// @section + +// @factory L.map(id: String, options?: Map options) +// Instantiates a map object given the DOM ID of a `
` element +// and optionally an object literal with `Map options`. +// +// @alternative +// @factory L.map(el: HTMLElement, options?: Map options) +// Instantiates a map object given an instance of a `
` HTML element +// and optionally an object literal with `Map options`. +function createMap(id, options) { + return new Map(id, options); +} + +/* + * @class Control + * @aka L.Control + * @inherits Class + * + * L.Control is a base class for implementing map controls. Handles positioning. + * All other controls extend from this class. + */ + +var Control = Class.extend({ + // @section + // @aka Control Options + options: { + // @option position: String = 'topright' + // The position of the control (one of the map corners). Possible values are `'topleft'`, + // `'topright'`, `'bottomleft'` or `'bottomright'` + position: 'topright' + }, + + initialize: function (options) { + setOptions(this, options); + }, + + /* @section + * Classes extending L.Control will inherit the following methods: + * + * @method getPosition: string + * Returns the position of the control. + */ + getPosition: function () { + return this.options.position; + }, + + // @method setPosition(position: string): this + // Sets the position of the control. + setPosition: function (position) { + var map = this._map; + + if (map) { + map.removeControl(this); + } + + this.options.position = position; + + if (map) { + map.addControl(this); + } + + return this; + }, + + // @method getContainer: HTMLElement + // Returns the HTMLElement that contains the control. + getContainer: function () { + return this._container; + }, + + // @method addTo(map: Map): this + // Adds the control to the given map. + addTo: function (map) { + this.remove(); + this._map = map; + + var container = this._container = this.onAdd(map), + pos = this.getPosition(), + corner = map._controlCorners[pos]; + + addClass(container, 'leaflet-control'); + + if (pos.indexOf('bottom') !== -1) { + corner.insertBefore(container, corner.firstChild); + } else { + corner.appendChild(container); + } + + this._map.on('unload', this.remove, this); + + return this; + }, + + // @method remove: this + // Removes the control from the map it is currently active on. + remove: function () { + if (!this._map) { + return this; + } + + remove(this._container); + + if (this.onRemove) { + this.onRemove(this._map); + } + + this._map.off('unload', this.remove, this); + this._map = null; + + return this; + }, + + _refocusOnMap: function (e) { + // if map exists and event is not a keyboard event + if (this._map && e && e.screenX > 0 && e.screenY > 0) { + this._map.getContainer().focus(); + } + } +}); + +var control = function (options) { + return new Control(options); +}; + +/* @section Extension methods + * @uninheritable + * + * Every control should extend from `L.Control` and (re-)implement the following methods. + * + * @method onAdd(map: Map): HTMLElement + * Should return the container DOM element for the control and add listeners on relevant map events. Called on [`control.addTo(map)`](#control-addTo). + * + * @method onRemove(map: Map) + * Optional method. Should contain all clean up code that removes the listeners previously added in [`onAdd`](#control-onadd). Called on [`control.remove()`](#control-remove). + */ + +/* @namespace Map + * @section Methods for Layers and Controls + */ +Map.include({ + // @method addControl(control: Control): this + // Adds the given control to the map + addControl: function (control) { + control.addTo(this); + return this; + }, + + // @method removeControl(control: Control): this + // Removes the given control from the map + removeControl: function (control) { + control.remove(); + return this; + }, + + _initControlPos: function () { + var corners = this._controlCorners = {}, + l = 'leaflet-', + container = this._controlContainer = + create$1('div', l + 'control-container', this._container); + + function createCorner(vSide, hSide) { + var className = l + vSide + ' ' + l + hSide; + + corners[vSide + hSide] = create$1('div', className, container); + } + + createCorner('top', 'left'); + createCorner('top', 'right'); + createCorner('bottom', 'left'); + createCorner('bottom', 'right'); + }, + + _clearControlPos: function () { + for (var i in this._controlCorners) { + remove(this._controlCorners[i]); + } + remove(this._controlContainer); + delete this._controlCorners; + delete this._controlContainer; + } +}); + +/* + * @class Control.Layers + * @aka L.Control.Layers + * @inherits Control + * + * The layers control gives users the ability to switch between different base layers and switch overlays on/off (check out the [detailed example](https://leafletjs.com/examples/layers-control/)). Extends `Control`. + * + * @example + * + * ```js + * var baseLayers = { + * "Mapbox": mapbox, + * "OpenStreetMap": osm + * }; + * + * var overlays = { + * "Marker": marker, + * "Roads": roadsLayer + * }; + * + * L.control.layers(baseLayers, overlays).addTo(map); + * ``` + * + * The `baseLayers` and `overlays` parameters are object literals with layer names as keys and `Layer` objects as values: + * + * ```js + * { + * "": layer1, + * "": layer2 + * } + * ``` + * + * The layer names can contain HTML, which allows you to add additional styling to the items: + * + * ```js + * {" My Layer": myLayer} + * ``` + */ + +var Layers = Control.extend({ + // @section + // @aka Control.Layers options + options: { + // @option collapsed: Boolean = true + // If `true`, the control will be collapsed into an icon and expanded on mouse hover, touch, or keyboard activation. + collapsed: true, + position: 'topright', + + // @option autoZIndex: Boolean = true + // If `true`, the control will assign zIndexes in increasing order to all of its layers so that the order is preserved when switching them on/off. + autoZIndex: true, + + // @option hideSingleBase: Boolean = false + // If `true`, the base layers in the control will be hidden when there is only one. + hideSingleBase: false, + + // @option sortLayers: Boolean = false + // Whether to sort the layers. When `false`, layers will keep the order + // in which they were added to the control. + sortLayers: false, + + // @option sortFunction: Function = * + // A [compare function](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/sort) + // that will be used for sorting the layers, when `sortLayers` is `true`. + // The function receives both the `L.Layer` instances and their names, as in + // `sortFunction(layerA, layerB, nameA, nameB)`. + // By default, it sorts layers alphabetically by their name. + sortFunction: function (layerA, layerB, nameA, nameB) { + return nameA < nameB ? -1 : (nameB < nameA ? 1 : 0); + } + }, + + initialize: function (baseLayers, overlays, options) { + setOptions(this, options); + + this._layerControlInputs = []; + this._layers = []; + this._lastZIndex = 0; + this._handlingClick = false; + + for (var i in baseLayers) { + this._addLayer(baseLayers[i], i); + } + + for (i in overlays) { + this._addLayer(overlays[i], i, true); + } + }, + + onAdd: function (map) { + this._initLayout(); + this._update(); + + this._map = map; + map.on('zoomend', this._checkDisabledLayers, this); + + for (var i = 0; i < this._layers.length; i++) { + this._layers[i].layer.on('add remove', this._onLayerChange, this); + } + + return this._container; + }, + + addTo: function (map) { + Control.prototype.addTo.call(this, map); + // Trigger expand after Layers Control has been inserted into DOM so that is now has an actual height. + return this._expandIfNotCollapsed(); + }, + + onRemove: function () { + this._map.off('zoomend', this._checkDisabledLayers, this); + + for (var i = 0; i < this._layers.length; i++) { + this._layers[i].layer.off('add remove', this._onLayerChange, this); + } + }, + + // @method addBaseLayer(layer: Layer, name: String): this + // Adds a base layer (radio button entry) with the given name to the control. + addBaseLayer: function (layer, name) { + this._addLayer(layer, name); + return (this._map) ? this._update() : this; + }, + + // @method addOverlay(layer: Layer, name: String): this + // Adds an overlay (checkbox entry) with the given name to the control. + addOverlay: function (layer, name) { + this._addLayer(layer, name, true); + return (this._map) ? this._update() : this; + }, + + // @method removeLayer(layer: Layer): this + // Remove the given layer from the control. + removeLayer: function (layer) { + layer.off('add remove', this._onLayerChange, this); + + var obj = this._getLayer(stamp(layer)); + if (obj) { + this._layers.splice(this._layers.indexOf(obj), 1); + } + return (this._map) ? this._update() : this; + }, + + // @method expand(): this + // Expand the control container if collapsed. + expand: function () { + addClass(this._container, 'leaflet-control-layers-expanded'); + this._section.style.height = null; + var acceptableHeight = this._map.getSize().y - (this._container.offsetTop + 50); + if (acceptableHeight < this._section.clientHeight) { + addClass(this._section, 'leaflet-control-layers-scrollbar'); + this._section.style.height = acceptableHeight + 'px'; + } else { + removeClass(this._section, 'leaflet-control-layers-scrollbar'); + } + this._checkDisabledLayers(); + return this; + }, + + // @method collapse(): this + // Collapse the control container if expanded. + collapse: function () { + removeClass(this._container, 'leaflet-control-layers-expanded'); + return this; + }, + + _initLayout: function () { + var className = 'leaflet-control-layers', + container = this._container = create$1('div', className), + collapsed = this.options.collapsed; + + // makes this work on IE touch devices by stopping it from firing a mouseout event when the touch is released + container.setAttribute('aria-haspopup', true); + + disableClickPropagation(container); + disableScrollPropagation(container); + + var section = this._section = create$1('section', className + '-list'); + + if (collapsed) { + this._map.on('click', this.collapse, this); + + on(container, { + mouseenter: function () { + on(section, 'click', preventDefault); + this.expand(); + setTimeout(function () { + off(section, 'click', preventDefault); + }); + }, + mouseleave: this.collapse + }, this); + } + + var link = this._layersLink = create$1('a', className + '-toggle', container); + link.href = '#'; + link.title = 'Layers'; + link.setAttribute('role', 'button'); + + on(link, 'click', preventDefault); // prevent link function + on(link, 'focus', this.expand, this); + + if (!collapsed) { + this.expand(); + } + + this._baseLayersList = create$1('div', className + '-base', section); + this._separator = create$1('div', className + '-separator', section); + this._overlaysList = create$1('div', className + '-overlays', section); + + container.appendChild(section); + }, + + _getLayer: function (id) { + for (var i = 0; i < this._layers.length; i++) { + + if (this._layers[i] && stamp(this._layers[i].layer) === id) { + return this._layers[i]; + } + } + }, + + _addLayer: function (layer, name, overlay) { + if (this._map) { + layer.on('add remove', this._onLayerChange, this); + } + + this._layers.push({ + layer: layer, + name: name, + overlay: overlay + }); + + if (this.options.sortLayers) { + this._layers.sort(bind(function (a, b) { + return this.options.sortFunction(a.layer, b.layer, a.name, b.name); + }, this)); + } + + if (this.options.autoZIndex && layer.setZIndex) { + this._lastZIndex++; + layer.setZIndex(this._lastZIndex); + } + + this._expandIfNotCollapsed(); + }, + + _update: function () { + if (!this._container) { return this; } + + empty(this._baseLayersList); + empty(this._overlaysList); + + this._layerControlInputs = []; + var baseLayersPresent, overlaysPresent, i, obj, baseLayersCount = 0; + + for (i = 0; i < this._layers.length; i++) { + obj = this._layers[i]; + this._addItem(obj); + overlaysPresent = overlaysPresent || obj.overlay; + baseLayersPresent = baseLayersPresent || !obj.overlay; + baseLayersCount += !obj.overlay ? 1 : 0; + } + + // Hide base layers section if there's only one layer. + if (this.options.hideSingleBase) { + baseLayersPresent = baseLayersPresent && baseLayersCount > 1; + this._baseLayersList.style.display = baseLayersPresent ? '' : 'none'; + } + + this._separator.style.display = overlaysPresent && baseLayersPresent ? '' : 'none'; + + return this; + }, + + _onLayerChange: function (e) { + if (!this._handlingClick) { + this._update(); + } + + var obj = this._getLayer(stamp(e.target)); + + // @namespace Map + // @section Layer events + // @event baselayerchange: LayersControlEvent + // Fired when the base layer is changed through the [layers control](#control-layers). + // @event overlayadd: LayersControlEvent + // Fired when an overlay is selected through the [layers control](#control-layers). + // @event overlayremove: LayersControlEvent + // Fired when an overlay is deselected through the [layers control](#control-layers). + // @namespace Control.Layers + var type = obj.overlay ? + (e.type === 'add' ? 'overlayadd' : 'overlayremove') : + (e.type === 'add' ? 'baselayerchange' : null); + + if (type) { + this._map.fire(type, obj); + } + }, + + // IE7 bugs out if you create a radio dynamically, so you have to do it this hacky way (see https://stackoverflow.com/a/119079) + _createRadioElement: function (name, checked) { + + var radioHtml = ''; + + var radioFragment = document.createElement('div'); + radioFragment.innerHTML = radioHtml; + + return radioFragment.firstChild; + }, + + _addItem: function (obj) { + var label = document.createElement('label'), + checked = this._map.hasLayer(obj.layer), + input; + + if (obj.overlay) { + input = document.createElement('input'); + input.type = 'checkbox'; + input.className = 'leaflet-control-layers-selector'; + input.defaultChecked = checked; + } else { + input = this._createRadioElement('leaflet-base-layers_' + stamp(this), checked); + } + + this._layerControlInputs.push(input); + input.layerId = stamp(obj.layer); + + on(input, 'click', this._onInputClick, this); + + var name = document.createElement('span'); + name.innerHTML = ' ' + obj.name; + + // Helps from preventing layer control flicker when checkboxes are disabled + // https://github.com/Leaflet/Leaflet/issues/2771 + var holder = document.createElement('span'); + + label.appendChild(holder); + holder.appendChild(input); + holder.appendChild(name); + + var container = obj.overlay ? this._overlaysList : this._baseLayersList; + container.appendChild(label); + + this._checkDisabledLayers(); + return label; + }, + + _onInputClick: function () { + var inputs = this._layerControlInputs, + input, layer; + var addedLayers = [], + removedLayers = []; + + this._handlingClick = true; + + for (var i = inputs.length - 1; i >= 0; i--) { + input = inputs[i]; + layer = this._getLayer(input.layerId).layer; + + if (input.checked) { + addedLayers.push(layer); + } else if (!input.checked) { + removedLayers.push(layer); + } + } + + // Bugfix issue 2318: Should remove all old layers before readding new ones + for (i = 0; i < removedLayers.length; i++) { + if (this._map.hasLayer(removedLayers[i])) { + this._map.removeLayer(removedLayers[i]); + } + } + for (i = 0; i < addedLayers.length; i++) { + if (!this._map.hasLayer(addedLayers[i])) { + this._map.addLayer(addedLayers[i]); + } + } + + this._handlingClick = false; + + this._refocusOnMap(); + }, + + _checkDisabledLayers: function () { + var inputs = this._layerControlInputs, + input, + layer, + zoom = this._map.getZoom(); + + for (var i = inputs.length - 1; i >= 0; i--) { + input = inputs[i]; + layer = this._getLayer(input.layerId).layer; + input.disabled = (layer.options.minZoom !== undefined && zoom < layer.options.minZoom) || + (layer.options.maxZoom !== undefined && zoom > layer.options.maxZoom); + + } + }, + + _expandIfNotCollapsed: function () { + if (this._map && !this.options.collapsed) { + this.expand(); + } + return this; + } + +}); + + +// @factory L.control.layers(baselayers?: Object, overlays?: Object, options?: Control.Layers options) +// Creates a layers control with the given layers. Base layers will be switched with radio buttons, while overlays will be switched with checkboxes. Note that all base layers should be passed in the base layers object, but only one should be added to the map during map instantiation. +var layers = function (baseLayers, overlays, options) { + return new Layers(baseLayers, overlays, options); +}; + +/* + * @class Control.Zoom + * @aka L.Control.Zoom + * @inherits Control + * + * A basic zoom control with two buttons (zoom in and zoom out). It is put on the map by default unless you set its [`zoomControl` option](#map-zoomcontrol) to `false`. Extends `Control`. + */ + +var Zoom = Control.extend({ + // @section + // @aka Control.Zoom options + options: { + position: 'topleft', + + // @option zoomInText: String = '' + // The text set on the 'zoom in' button. + zoomInText: '', + + // @option zoomInTitle: String = 'Zoom in' + // The title set on the 'zoom in' button. + zoomInTitle: 'Zoom in', + + // @option zoomOutText: String = '' + // The text set on the 'zoom out' button. + zoomOutText: '', + + // @option zoomOutTitle: String = 'Zoom out' + // The title set on the 'zoom out' button. + zoomOutTitle: 'Zoom out' + }, + + onAdd: function (map) { + var zoomName = 'leaflet-control-zoom', + container = create$1('div', zoomName + ' leaflet-bar'), + options = this.options; + + this._zoomInButton = this._createButton(options.zoomInText, options.zoomInTitle, + zoomName + '-in', container, this._zoomIn); + this._zoomOutButton = this._createButton(options.zoomOutText, options.zoomOutTitle, + zoomName + '-out', container, this._zoomOut); + + this._updateDisabled(); + map.on('zoomend zoomlevelschange', this._updateDisabled, this); + + return container; + }, + + onRemove: function (map) { + map.off('zoomend zoomlevelschange', this._updateDisabled, this); + }, + + disable: function () { + this._disabled = true; + this._updateDisabled(); + return this; + }, + + enable: function () { + this._disabled = false; + this._updateDisabled(); + return this; + }, + + _zoomIn: function (e) { + if (!this._disabled && this._map._zoom < this._map.getMaxZoom()) { + this._map.zoomIn(this._map.options.zoomDelta * (e.shiftKey ? 3 : 1)); + } + }, + + _zoomOut: function (e) { + if (!this._disabled && this._map._zoom > this._map.getMinZoom()) { + this._map.zoomOut(this._map.options.zoomDelta * (e.shiftKey ? 3 : 1)); + } + }, + + _createButton: function (html, title, className, container, fn) { + var link = create$1('a', className, container); + link.innerHTML = html; + link.href = '#'; + link.title = title; + + /* + * Will force screen readers like VoiceOver to read this as "Zoom in - button" + */ + link.setAttribute('role', 'button'); + link.setAttribute('aria-label', title); + + disableClickPropagation(link); + on(link, 'click', stop); + on(link, 'click', fn, this); + on(link, 'click', this._refocusOnMap, this); + + return link; + }, + + _updateDisabled: function () { + var map = this._map, + className = 'leaflet-disabled'; + + removeClass(this._zoomInButton, className); + removeClass(this._zoomOutButton, className); + this._zoomInButton.setAttribute('aria-disabled', 'false'); + this._zoomOutButton.setAttribute('aria-disabled', 'false'); + + if (this._disabled || map._zoom === map.getMinZoom()) { + addClass(this._zoomOutButton, className); + this._zoomOutButton.setAttribute('aria-disabled', 'true'); + } + if (this._disabled || map._zoom === map.getMaxZoom()) { + addClass(this._zoomInButton, className); + this._zoomInButton.setAttribute('aria-disabled', 'true'); + } + } +}); + +// @namespace Map +// @section Control options +// @option zoomControl: Boolean = true +// Whether a [zoom control](#control-zoom) is added to the map by default. +Map.mergeOptions({ + zoomControl: true +}); + +Map.addInitHook(function () { + if (this.options.zoomControl) { + // @section Controls + // @property zoomControl: Control.Zoom + // The default zoom control (only available if the + // [`zoomControl` option](#map-zoomcontrol) was `true` when creating the map). + this.zoomControl = new Zoom(); + this.addControl(this.zoomControl); + } +}); + +// @namespace Control.Zoom +// @factory L.control.zoom(options: Control.Zoom options) +// Creates a zoom control +var zoom = function (options) { + return new Zoom(options); +}; + +/* + * @class Control.Scale + * @aka L.Control.Scale + * @inherits Control + * + * A simple scale control that shows the scale of the current center of screen in metric (m/km) and imperial (mi/ft) systems. Extends `Control`. + * + * @example + * + * ```js + * L.control.scale().addTo(map); + * ``` + */ + +var Scale = Control.extend({ + // @section + // @aka Control.Scale options + options: { + position: 'bottomleft', + + // @option maxWidth: Number = 100 + // Maximum width of the control in pixels. The width is set dynamically to show round values (e.g. 100, 200, 500). + maxWidth: 100, + + // @option metric: Boolean = True + // Whether to show the metric scale line (m/km). + metric: true, + + // @option imperial: Boolean = True + // Whether to show the imperial scale line (mi/ft). + imperial: true + + // @option updateWhenIdle: Boolean = false + // If `true`, the control is updated on [`moveend`](#map-moveend), otherwise it's always up-to-date (updated on [`move`](#map-move)). + }, + + onAdd: function (map) { + var className = 'leaflet-control-scale', + container = create$1('div', className), + options = this.options; + + this._addScales(options, className + '-line', container); + + map.on(options.updateWhenIdle ? 'moveend' : 'move', this._update, this); + map.whenReady(this._update, this); + + return container; + }, + + onRemove: function (map) { + map.off(this.options.updateWhenIdle ? 'moveend' : 'move', this._update, this); + }, + + _addScales: function (options, className, container) { + if (options.metric) { + this._mScale = create$1('div', className, container); + } + if (options.imperial) { + this._iScale = create$1('div', className, container); + } + }, + + _update: function () { + var map = this._map, + y = map.getSize().y / 2; + + var maxMeters = map.distance( + map.containerPointToLatLng([0, y]), + map.containerPointToLatLng([this.options.maxWidth, y])); + + this._updateScales(maxMeters); + }, + + _updateScales: function (maxMeters) { + if (this.options.metric && maxMeters) { + this._updateMetric(maxMeters); + } + if (this.options.imperial && maxMeters) { + this._updateImperial(maxMeters); + } + }, + + _updateMetric: function (maxMeters) { + var meters = this._getRoundNum(maxMeters), + label = meters < 1000 ? meters + ' m' : (meters / 1000) + ' km'; + + this._updateScale(this._mScale, label, meters / maxMeters); + }, + + _updateImperial: function (maxMeters) { + var maxFeet = maxMeters * 3.2808399, + maxMiles, miles, feet; + + if (maxFeet > 5280) { + maxMiles = maxFeet / 5280; + miles = this._getRoundNum(maxMiles); + this._updateScale(this._iScale, miles + ' mi', miles / maxMiles); + + } else { + feet = this._getRoundNum(maxFeet); + this._updateScale(this._iScale, feet + ' ft', feet / maxFeet); + } + }, + + _updateScale: function (scale, text, ratio) { + scale.style.width = Math.round(this.options.maxWidth * ratio) + 'px'; + scale.innerHTML = text; + }, + + _getRoundNum: function (num) { + var pow10 = Math.pow(10, (Math.floor(num) + '').length - 1), + d = num / pow10; + + d = d >= 10 ? 10 : + d >= 5 ? 5 : + d >= 3 ? 3 : + d >= 2 ? 2 : 1; + + return pow10 * d; + } +}); + + +// @factory L.control.scale(options?: Control.Scale options) +// Creates an scale control with the given options. +var scale = function (options) { + return new Scale(options); +}; + +var ukrainianFlag = ''; + + +/* + * @class Control.Attribution + * @aka L.Control.Attribution + * @inherits Control + * + * The attribution control allows you to display attribution data in a small text box on a map. It is put on the map by default unless you set its [`attributionControl` option](#map-attributioncontrol) to `false`, and it fetches attribution texts from layers with the [`getAttribution` method](#layer-getattribution) automatically. Extends Control. + */ + +var Attribution = Control.extend({ + // @section + // @aka Control.Attribution options + options: { + position: 'bottomright', + + // @option prefix: String|false = 'Leaflet' + // The HTML text shown before the attributions. Pass `false` to disable. + prefix: '' + (Browser.inlineSvg ? ukrainianFlag + ' ' : '') + 'Leaflet' + }, + + initialize: function (options) { + setOptions(this, options); + + this._attributions = {}; + }, + + onAdd: function (map) { + map.attributionControl = this; + this._container = create$1('div', 'leaflet-control-attribution'); + disableClickPropagation(this._container); + + // TODO ugly, refactor + for (var i in map._layers) { + if (map._layers[i].getAttribution) { + this.addAttribution(map._layers[i].getAttribution()); + } + } + + this._update(); + + map.on('layeradd', this._addAttribution, this); + + return this._container; + }, + + onRemove: function (map) { + map.off('layeradd', this._addAttribution, this); + }, + + _addAttribution: function (ev) { + if (ev.layer.getAttribution) { + this.addAttribution(ev.layer.getAttribution()); + ev.layer.once('remove', function () { + this.removeAttribution(ev.layer.getAttribution()); + }, this); + } + }, + + // @method setPrefix(prefix: String|false): this + // The HTML text shown before the attributions. Pass `false` to disable. + setPrefix: function (prefix) { + this.options.prefix = prefix; + this._update(); + return this; + }, + + // @method addAttribution(text: String): this + // Adds an attribution text (e.g. `'Vector data © Mapbox'`). + addAttribution: function (text) { + if (!text) { return this; } + + if (!this._attributions[text]) { + this._attributions[text] = 0; + } + this._attributions[text]++; + + this._update(); + + return this; + }, + + // @method removeAttribution(text: String): this + // Removes an attribution text. + removeAttribution: function (text) { + if (!text) { return this; } + + if (this._attributions[text]) { + this._attributions[text]--; + this._update(); + } + + return this; + }, + + _update: function () { + if (!this._map) { return; } + + var attribs = []; + + for (var i in this._attributions) { + if (this._attributions[i]) { + attribs.push(i); + } + } + + var prefixAndAttribs = []; + + if (this.options.prefix) { + prefixAndAttribs.push(this.options.prefix); + } + if (attribs.length) { + prefixAndAttribs.push(attribs.join(', ')); + } + + this._container.innerHTML = prefixAndAttribs.join(' '); + } +}); + +// @namespace Map +// @section Control options +// @option attributionControl: Boolean = true +// Whether a [attribution control](#control-attribution) is added to the map by default. +Map.mergeOptions({ + attributionControl: true +}); + +Map.addInitHook(function () { + if (this.options.attributionControl) { + new Attribution().addTo(this); + } +}); + +// @namespace Control.Attribution +// @factory L.control.attribution(options: Control.Attribution options) +// Creates an attribution control. +var attribution = function (options) { + return new Attribution(options); +}; + +Control.Layers = Layers; +Control.Zoom = Zoom; +Control.Scale = Scale; +Control.Attribution = Attribution; + +control.layers = layers; +control.zoom = zoom; +control.scale = scale; +control.attribution = attribution; + +/* + L.Handler is a base class for handler classes that are used internally to inject + interaction features like dragging to classes like Map and Marker. +*/ + +// @class Handler +// @aka L.Handler +// Abstract class for map interaction handlers + +var Handler = Class.extend({ + initialize: function (map) { + this._map = map; + }, + + // @method enable(): this + // Enables the handler + enable: function () { + if (this._enabled) { return this; } + + this._enabled = true; + this.addHooks(); + return this; + }, + + // @method disable(): this + // Disables the handler + disable: function () { + if (!this._enabled) { return this; } + + this._enabled = false; + this.removeHooks(); + return this; + }, + + // @method enabled(): Boolean + // Returns `true` if the handler is enabled + enabled: function () { + return !!this._enabled; + } + + // @section Extension methods + // Classes inheriting from `Handler` must implement the two following methods: + // @method addHooks() + // Called when the handler is enabled, should add event hooks. + // @method removeHooks() + // Called when the handler is disabled, should remove the event hooks added previously. +}); + +// @section There is static function which can be called without instantiating L.Handler: +// @function addTo(map: Map, name: String): this +// Adds a new Handler to the given map with the given name. +Handler.addTo = function (map, name) { + map.addHandler(name, this); + return this; +}; + +var Mixin = {Events: Events}; + +/* + * @class Draggable + * @aka L.Draggable + * @inherits Evented + * + * A class for making DOM elements draggable (including touch support). + * Used internally for map and marker dragging. Only works for elements + * that were positioned with [`L.DomUtil.setPosition`](#domutil-setposition). + * + * @example + * ```js + * var draggable = new L.Draggable(elementToDrag); + * draggable.enable(); + * ``` + */ + +var START = Browser.touch ? 'touchstart mousedown' : 'mousedown'; + +var Draggable = Evented.extend({ + + options: { + // @section + // @aka Draggable options + // @option clickTolerance: Number = 3 + // The max number of pixels a user can shift the mouse pointer during a click + // for it to be considered a valid click (as opposed to a mouse drag). + clickTolerance: 3 + }, + + // @constructor L.Draggable(el: HTMLElement, dragHandle?: HTMLElement, preventOutline?: Boolean, options?: Draggable options) + // Creates a `Draggable` object for moving `el` when you start dragging the `dragHandle` element (equals `el` itself by default). + initialize: function (element, dragStartTarget, preventOutline, options) { + setOptions(this, options); + + this._element = element; + this._dragStartTarget = dragStartTarget || element; + this._preventOutline = preventOutline; + }, + + // @method enable() + // Enables the dragging ability + enable: function () { + if (this._enabled) { return; } + + on(this._dragStartTarget, START, this._onDown, this); + + this._enabled = true; + }, + + // @method disable() + // Disables the dragging ability + disable: function () { + if (!this._enabled) { return; } + + // If we're currently dragging this draggable, + // disabling it counts as first ending the drag. + if (Draggable._dragging === this) { + this.finishDrag(true); + } + + off(this._dragStartTarget, START, this._onDown, this); + + this._enabled = false; + this._moved = false; + }, + + _onDown: function (e) { + // Ignore the event if disabled; this happens in IE11 + // under some circumstances, see #3666. + if (!this._enabled) { return; } + + this._moved = false; + + if (hasClass(this._element, 'leaflet-zoom-anim')) { return; } + + if (e.touches && e.touches.length !== 1) { + // Finish dragging to avoid conflict with touchZoom + if (Draggable._dragging === this) { + this.finishDrag(); + } + return; + } + + if (Draggable._dragging || e.shiftKey || ((e.which !== 1) && (e.button !== 1) && !e.touches)) { return; } + Draggable._dragging = this; // Prevent dragging multiple objects at once. + + if (this._preventOutline) { + preventOutline(this._element); + } + + disableImageDrag(); + disableTextSelection(); + + if (this._moving) { return; } + + // @event down: Event + // Fired when a drag is about to start. + this.fire('down'); + + var first = e.touches ? e.touches[0] : e, + sizedParent = getSizedParentNode(this._element); + + this._startPoint = new Point(first.clientX, first.clientY); + this._startPos = getPosition(this._element); + + // Cache the scale, so that we can continuously compensate for it during drag (_onMove). + this._parentScale = getScale(sizedParent); + + var mouseevent = e.type === 'mousedown'; + on(document, mouseevent ? 'mousemove' : 'touchmove', this._onMove, this); + on(document, mouseevent ? 'mouseup' : 'touchend touchcancel', this._onUp, this); + }, + + _onMove: function (e) { + // Ignore the event if disabled; this happens in IE11 + // under some circumstances, see #3666. + if (!this._enabled) { return; } + + if (e.touches && e.touches.length > 1) { + this._moved = true; + return; + } + + var first = (e.touches && e.touches.length === 1 ? e.touches[0] : e), + offset = new Point(first.clientX, first.clientY)._subtract(this._startPoint); + + if (!offset.x && !offset.y) { return; } + if (Math.abs(offset.x) + Math.abs(offset.y) < this.options.clickTolerance) { return; } + + // We assume that the parent container's position, border and scale do not change for the duration of the drag. + // Therefore there is no need to account for the position and border (they are eliminated by the subtraction) + // and we can use the cached value for the scale. + offset.x /= this._parentScale.x; + offset.y /= this._parentScale.y; + + preventDefault(e); + + if (!this._moved) { + // @event dragstart: Event + // Fired when a drag starts + this.fire('dragstart'); + + this._moved = true; + + addClass(document.body, 'leaflet-dragging'); + + this._lastTarget = e.target || e.srcElement; + // IE and Edge do not give the element, so fetch it + // if necessary + if (window.SVGElementInstance && this._lastTarget instanceof window.SVGElementInstance) { + this._lastTarget = this._lastTarget.correspondingUseElement; + } + addClass(this._lastTarget, 'leaflet-drag-target'); + } + + this._newPos = this._startPos.add(offset); + this._moving = true; + + this._lastEvent = e; + this._updatePosition(); + }, + + _updatePosition: function () { + var e = {originalEvent: this._lastEvent}; + + // @event predrag: Event + // Fired continuously during dragging *before* each corresponding + // update of the element's position. + this.fire('predrag', e); + setPosition(this._element, this._newPos); + + // @event drag: Event + // Fired continuously during dragging. + this.fire('drag', e); + }, + + _onUp: function () { + // Ignore the event if disabled; this happens in IE11 + // under some circumstances, see #3666. + if (!this._enabled) { return; } + this.finishDrag(); + }, + + finishDrag: function (noInertia) { + removeClass(document.body, 'leaflet-dragging'); + + if (this._lastTarget) { + removeClass(this._lastTarget, 'leaflet-drag-target'); + this._lastTarget = null; + } + + off(document, 'mousemove touchmove', this._onMove, this); + off(document, 'mouseup touchend touchcancel', this._onUp, this); + + enableImageDrag(); + enableTextSelection(); + + if (this._moved && this._moving) { + + // @event dragend: DragEndEvent + // Fired when the drag ends. + this.fire('dragend', { + noInertia: noInertia, + distance: this._newPos.distanceTo(this._startPos) + }); + } + + this._moving = false; + Draggable._dragging = false; + } + +}); + +/* + * @namespace LineUtil + * + * Various utility functions for polyline points processing, used by Leaflet internally to make polylines lightning-fast. + */ + +// Simplify polyline with vertex reduction and Douglas-Peucker simplification. +// Improves rendering performance dramatically by lessening the number of points to draw. + +// @function simplify(points: Point[], tolerance: Number): Point[] +// Dramatically reduces the number of points in a polyline while retaining +// its shape and returns a new array of simplified points, using the +// [Ramer-Douglas-Peucker algorithm](https://en.wikipedia.org/wiki/Ramer-Douglas-Peucker_algorithm). +// Used for a huge performance boost when processing/displaying Leaflet polylines for +// each zoom level and also reducing visual noise. tolerance affects the amount of +// simplification (lesser value means higher quality but slower and with more points). +// Also released as a separated micro-library [Simplify.js](https://mourner.github.io/simplify-js/). +function simplify(points, tolerance) { + if (!tolerance || !points.length) { + return points.slice(); + } + + var sqTolerance = tolerance * tolerance; + + // stage 1: vertex reduction + points = _reducePoints(points, sqTolerance); + + // stage 2: Douglas-Peucker simplification + points = _simplifyDP(points, sqTolerance); + + return points; +} + +// @function pointToSegmentDistance(p: Point, p1: Point, p2: Point): Number +// Returns the distance between point `p` and segment `p1` to `p2`. +function pointToSegmentDistance(p, p1, p2) { + return Math.sqrt(_sqClosestPointOnSegment(p, p1, p2, true)); +} + +// @function closestPointOnSegment(p: Point, p1: Point, p2: Point): Number +// Returns the closest point from a point `p` on a segment `p1` to `p2`. +function closestPointOnSegment(p, p1, p2) { + return _sqClosestPointOnSegment(p, p1, p2); +} + +// Ramer-Douglas-Peucker simplification, see https://en.wikipedia.org/wiki/Ramer-Douglas-Peucker_algorithm +function _simplifyDP(points, sqTolerance) { + + var len = points.length, + ArrayConstructor = typeof Uint8Array !== undefined + '' ? Uint8Array : Array, + markers = new ArrayConstructor(len); + + markers[0] = markers[len - 1] = 1; + + _simplifyDPStep(points, markers, sqTolerance, 0, len - 1); + + var i, + newPoints = []; + + for (i = 0; i < len; i++) { + if (markers[i]) { + newPoints.push(points[i]); + } + } + + return newPoints; +} + +function _simplifyDPStep(points, markers, sqTolerance, first, last) { + + var maxSqDist = 0, + index, i, sqDist; + + for (i = first + 1; i <= last - 1; i++) { + sqDist = _sqClosestPointOnSegment(points[i], points[first], points[last], true); + + if (sqDist > maxSqDist) { + index = i; + maxSqDist = sqDist; + } + } + + if (maxSqDist > sqTolerance) { + markers[index] = 1; + + _simplifyDPStep(points, markers, sqTolerance, first, index); + _simplifyDPStep(points, markers, sqTolerance, index, last); + } +} + +// reduce points that are too close to each other to a single point +function _reducePoints(points, sqTolerance) { + var reducedPoints = [points[0]]; + + for (var i = 1, prev = 0, len = points.length; i < len; i++) { + if (_sqDist(points[i], points[prev]) > sqTolerance) { + reducedPoints.push(points[i]); + prev = i; + } + } + if (prev < len - 1) { + reducedPoints.push(points[len - 1]); + } + return reducedPoints; +} + +var _lastCode; + +// @function clipSegment(a: Point, b: Point, bounds: Bounds, useLastCode?: Boolean, round?: Boolean): Point[]|Boolean +// Clips the segment a to b by rectangular bounds with the +// [Cohen-Sutherland algorithm](https://en.wikipedia.org/wiki/Cohen%E2%80%93Sutherland_algorithm) +// (modifying the segment points directly!). Used by Leaflet to only show polyline +// points that are on the screen or near, increasing performance. +function clipSegment(a, b, bounds, useLastCode, round) { + var codeA = useLastCode ? _lastCode : _getBitCode(a, bounds), + codeB = _getBitCode(b, bounds), + + codeOut, p, newCode; + + // save 2nd code to avoid calculating it on the next segment + _lastCode = codeB; + + while (true) { + // if a,b is inside the clip window (trivial accept) + if (!(codeA | codeB)) { + return [a, b]; + } + + // if a,b is outside the clip window (trivial reject) + if (codeA & codeB) { + return false; + } + + // other cases + codeOut = codeA || codeB; + p = _getEdgeIntersection(a, b, codeOut, bounds, round); + newCode = _getBitCode(p, bounds); + + if (codeOut === codeA) { + a = p; + codeA = newCode; + } else { + b = p; + codeB = newCode; + } + } +} + +function _getEdgeIntersection(a, b, code, bounds, round) { + var dx = b.x - a.x, + dy = b.y - a.y, + min = bounds.min, + max = bounds.max, + x, y; + + if (code & 8) { // top + x = a.x + dx * (max.y - a.y) / dy; + y = max.y; + + } else if (code & 4) { // bottom + x = a.x + dx * (min.y - a.y) / dy; + y = min.y; + + } else if (code & 2) { // right + x = max.x; + y = a.y + dy * (max.x - a.x) / dx; + + } else if (code & 1) { // left + x = min.x; + y = a.y + dy * (min.x - a.x) / dx; + } + + return new Point(x, y, round); +} + +function _getBitCode(p, bounds) { + var code = 0; + + if (p.x < bounds.min.x) { // left + code |= 1; + } else if (p.x > bounds.max.x) { // right + code |= 2; + } + + if (p.y < bounds.min.y) { // bottom + code |= 4; + } else if (p.y > bounds.max.y) { // top + code |= 8; + } + + return code; +} + +// square distance (to avoid unnecessary Math.sqrt calls) +function _sqDist(p1, p2) { + var dx = p2.x - p1.x, + dy = p2.y - p1.y; + return dx * dx + dy * dy; +} + +// return closest point on segment or distance to that point +function _sqClosestPointOnSegment(p, p1, p2, sqDist) { + var x = p1.x, + y = p1.y, + dx = p2.x - x, + dy = p2.y - y, + dot = dx * dx + dy * dy, + t; + + if (dot > 0) { + t = ((p.x - x) * dx + (p.y - y) * dy) / dot; + + if (t > 1) { + x = p2.x; + y = p2.y; + } else if (t > 0) { + x += dx * t; + y += dy * t; + } + } + + dx = p.x - x; + dy = p.y - y; + + return sqDist ? dx * dx + dy * dy : new Point(x, y); +} + + +// @function isFlat(latlngs: LatLng[]): Boolean +// Returns true if `latlngs` is a flat array, false is nested. +function isFlat(latlngs) { + return !isArray(latlngs[0]) || (typeof latlngs[0][0] !== 'object' && typeof latlngs[0][0] !== 'undefined'); +} + +function _flat(latlngs) { + console.warn('Deprecated use of _flat, please use L.LineUtil.isFlat instead.'); + return isFlat(latlngs); +} + +var LineUtil = { + __proto__: null, + simplify: simplify, + pointToSegmentDistance: pointToSegmentDistance, + closestPointOnSegment: closestPointOnSegment, + clipSegment: clipSegment, + _getEdgeIntersection: _getEdgeIntersection, + _getBitCode: _getBitCode, + _sqClosestPointOnSegment: _sqClosestPointOnSegment, + isFlat: isFlat, + _flat: _flat +}; + +/* + * @namespace PolyUtil + * Various utility functions for polygon geometries. + */ + +/* @function clipPolygon(points: Point[], bounds: Bounds, round?: Boolean): Point[] + * Clips the polygon geometry defined by the given `points` by the given bounds (using the [Sutherland-Hodgman algorithm](https://en.wikipedia.org/wiki/Sutherland%E2%80%93Hodgman_algorithm)). + * Used by Leaflet to only show polygon points that are on the screen or near, increasing + * performance. Note that polygon points needs different algorithm for clipping + * than polyline, so there's a separate method for it. + */ +function clipPolygon(points, bounds, round) { + var clippedPoints, + edges = [1, 4, 2, 8], + i, j, k, + a, b, + len, edge, p; + + for (i = 0, len = points.length; i < len; i++) { + points[i]._code = _getBitCode(points[i], bounds); + } + + // for each edge (left, bottom, right, top) + for (k = 0; k < 4; k++) { + edge = edges[k]; + clippedPoints = []; + + for (i = 0, len = points.length, j = len - 1; i < len; j = i++) { + a = points[i]; + b = points[j]; + + // if a is inside the clip window + if (!(a._code & edge)) { + // if b is outside the clip window (a->b goes out of screen) + if (b._code & edge) { + p = _getEdgeIntersection(b, a, edge, bounds, round); + p._code = _getBitCode(p, bounds); + clippedPoints.push(p); + } + clippedPoints.push(a); + + // else if b is inside the clip window (a->b enters the screen) + } else if (!(b._code & edge)) { + p = _getEdgeIntersection(b, a, edge, bounds, round); + p._code = _getBitCode(p, bounds); + clippedPoints.push(p); + } + } + points = clippedPoints; + } + + return points; +} + +var PolyUtil = { + __proto__: null, + clipPolygon: clipPolygon +}; + +/* + * @namespace Projection + * @section + * Leaflet comes with a set of already defined Projections out of the box: + * + * @projection L.Projection.LonLat + * + * Equirectangular, or Plate Carree projection — the most simple projection, + * mostly used by GIS enthusiasts. Directly maps `x` as longitude, and `y` as + * latitude. Also suitable for flat worlds, e.g. game maps. Used by the + * `EPSG:4326` and `Simple` CRS. + */ + +var LonLat = { + project: function (latlng) { + return new Point(latlng.lng, latlng.lat); + }, + + unproject: function (point) { + return new LatLng(point.y, point.x); + }, + + bounds: new Bounds([-180, -90], [180, 90]) +}; + +/* + * @namespace Projection + * @projection L.Projection.Mercator + * + * Elliptical Mercator projection — more complex than Spherical Mercator. Assumes that Earth is an ellipsoid. Used by the EPSG:3395 CRS. + */ + +var Mercator = { + R: 6378137, + R_MINOR: 6356752.314245179, + + bounds: new Bounds([-20037508.34279, -15496570.73972], [20037508.34279, 18764656.23138]), + + project: function (latlng) { + var d = Math.PI / 180, + r = this.R, + y = latlng.lat * d, + tmp = this.R_MINOR / r, + e = Math.sqrt(1 - tmp * tmp), + con = e * Math.sin(y); + + var ts = Math.tan(Math.PI / 4 - y / 2) / Math.pow((1 - con) / (1 + con), e / 2); + y = -r * Math.log(Math.max(ts, 1E-10)); + + return new Point(latlng.lng * d * r, y); + }, + + unproject: function (point) { + var d = 180 / Math.PI, + r = this.R, + tmp = this.R_MINOR / r, + e = Math.sqrt(1 - tmp * tmp), + ts = Math.exp(-point.y / r), + phi = Math.PI / 2 - 2 * Math.atan(ts); + + for (var i = 0, dphi = 0.1, con; i < 15 && Math.abs(dphi) > 1e-7; i++) { + con = e * Math.sin(phi); + con = Math.pow((1 - con) / (1 + con), e / 2); + dphi = Math.PI / 2 - 2 * Math.atan(ts * con) - phi; + phi += dphi; + } + + return new LatLng(phi * d, point.x * d / r); + } +}; + +/* + * @class Projection + + * An object with methods for projecting geographical coordinates of the world onto + * a flat surface (and back). See [Map projection](https://en.wikipedia.org/wiki/Map_projection). + + * @property bounds: Bounds + * The bounds (specified in CRS units) where the projection is valid + + * @method project(latlng: LatLng): Point + * Projects geographical coordinates into a 2D point. + * Only accepts actual `L.LatLng` instances, not arrays. + + * @method unproject(point: Point): LatLng + * The inverse of `project`. Projects a 2D point into a geographical location. + * Only accepts actual `L.Point` instances, not arrays. + + * Note that the projection instances do not inherit from Leaflet's `Class` object, + * and can't be instantiated. Also, new classes can't inherit from them, + * and methods can't be added to them with the `include` function. + + */ + +var index = { + __proto__: null, + LonLat: LonLat, + Mercator: Mercator, + SphericalMercator: SphericalMercator +}; + +/* + * @namespace CRS + * @crs L.CRS.EPSG3395 + * + * Rarely used by some commercial tile providers. Uses Elliptical Mercator projection. + */ +var EPSG3395 = extend({}, Earth, { + code: 'EPSG:3395', + projection: Mercator, + + transformation: (function () { + var scale = 0.5 / (Math.PI * Mercator.R); + return toTransformation(scale, 0.5, -scale, 0.5); + }()) +}); + +/* + * @namespace CRS + * @crs L.CRS.EPSG4326 + * + * A common CRS among GIS enthusiasts. Uses simple Equirectangular projection. + * + * Leaflet 1.0.x complies with the [TMS coordinate scheme for EPSG:4326](https://wiki.osgeo.org/wiki/Tile_Map_Service_Specification#global-geodetic), + * which is a breaking change from 0.7.x behaviour. If you are using a `TileLayer` + * with this CRS, ensure that there are two 256x256 pixel tiles covering the + * whole earth at zoom level zero, and that the tile coordinate origin is (-180,+90), + * or (-180,-90) for `TileLayer`s with [the `tms` option](#tilelayer-tms) set. + */ + +var EPSG4326 = extend({}, Earth, { + code: 'EPSG:4326', + projection: LonLat, + transformation: toTransformation(1 / 180, 1, -1 / 180, 0.5) +}); + +/* + * @namespace CRS + * @crs L.CRS.Simple + * + * A simple CRS that maps longitude and latitude into `x` and `y` directly. + * May be used for maps of flat surfaces (e.g. game maps). Note that the `y` + * axis should still be inverted (going from bottom to top). `distance()` returns + * simple euclidean distance. + */ + +var Simple = extend({}, CRS, { + projection: LonLat, + transformation: toTransformation(1, 0, -1, 0), + + scale: function (zoom) { + return Math.pow(2, zoom); + }, + + zoom: function (scale) { + return Math.log(scale) / Math.LN2; + }, + + distance: function (latlng1, latlng2) { + var dx = latlng2.lng - latlng1.lng, + dy = latlng2.lat - latlng1.lat; + + return Math.sqrt(dx * dx + dy * dy); + }, + + infinite: true +}); + +CRS.Earth = Earth; +CRS.EPSG3395 = EPSG3395; +CRS.EPSG3857 = EPSG3857; +CRS.EPSG900913 = EPSG900913; +CRS.EPSG4326 = EPSG4326; +CRS.Simple = Simple; + +/* + * @class Layer + * @inherits Evented + * @aka L.Layer + * @aka ILayer + * + * A set of methods from the Layer base class that all Leaflet layers use. + * Inherits all methods, options and events from `L.Evented`. + * + * @example + * + * ```js + * var layer = L.marker(latlng).addTo(map); + * layer.addTo(map); + * layer.remove(); + * ``` + * + * @event add: Event + * Fired after the layer is added to a map + * + * @event remove: Event + * Fired after the layer is removed from a map + */ + + +var Layer = Evented.extend({ + + // Classes extending `L.Layer` will inherit the following options: + options: { + // @option pane: String = 'overlayPane' + // By default the layer will be added to the map's [overlay pane](#map-overlaypane). Overriding this option will cause the layer to be placed on another pane by default. + pane: 'overlayPane', + + // @option attribution: String = null + // String to be shown in the attribution control, e.g. "© OpenStreetMap contributors". It describes the layer data and is often a legal obligation towards copyright holders and tile providers. + attribution: null, + + bubblingMouseEvents: true + }, + + /* @section + * Classes extending `L.Layer` will inherit the following methods: + * + * @method addTo(map: Map|LayerGroup): this + * Adds the layer to the given map or layer group. + */ + addTo: function (map) { + map.addLayer(this); + return this; + }, + + // @method remove: this + // Removes the layer from the map it is currently active on. + remove: function () { + return this.removeFrom(this._map || this._mapToAdd); + }, + + // @method removeFrom(map: Map): this + // Removes the layer from the given map + // + // @alternative + // @method removeFrom(group: LayerGroup): this + // Removes the layer from the given `LayerGroup` + removeFrom: function (obj) { + if (obj) { + obj.removeLayer(this); + } + return this; + }, + + // @method getPane(name? : String): HTMLElement + // Returns the `HTMLElement` representing the named pane on the map. If `name` is omitted, returns the pane for this layer. + getPane: function (name) { + return this._map.getPane(name ? (this.options[name] || name) : this.options.pane); + }, + + addInteractiveTarget: function (targetEl) { + this._map._targets[stamp(targetEl)] = this; + return this; + }, + + removeInteractiveTarget: function (targetEl) { + delete this._map._targets[stamp(targetEl)]; + return this; + }, + + // @method getAttribution: String + // Used by the `attribution control`, returns the [attribution option](#gridlayer-attribution). + getAttribution: function () { + return this.options.attribution; + }, + + _layerAdd: function (e) { + var map = e.target; + + // check in case layer gets added and then removed before the map is ready + if (!map.hasLayer(this)) { return; } + + this._map = map; + this._zoomAnimated = map._zoomAnimated; + + if (this.getEvents) { + var events = this.getEvents(); + map.on(events, this); + this.once('remove', function () { + map.off(events, this); + }, this); + } + + this.onAdd(map); + + this.fire('add'); + map.fire('layeradd', {layer: this}); + } +}); + +/* @section Extension methods + * @uninheritable + * + * Every layer should extend from `L.Layer` and (re-)implement the following methods. + * + * @method onAdd(map: Map): this + * Should contain code that creates DOM elements for the layer, adds them to `map panes` where they should belong and puts listeners on relevant map events. Called on [`map.addLayer(layer)`](#map-addlayer). + * + * @method onRemove(map: Map): this + * Should contain all clean up code that removes the layer's elements from the DOM and removes listeners previously added in [`onAdd`](#layer-onadd). Called on [`map.removeLayer(layer)`](#map-removelayer). + * + * @method getEvents(): Object + * This optional method should return an object like `{ viewreset: this._reset }` for [`addEventListener`](#evented-addeventlistener). The event handlers in this object will be automatically added and removed from the map with your layer. + * + * @method getAttribution(): String + * This optional method should return a string containing HTML to be shown on the `Attribution control` whenever the layer is visible. + * + * @method beforeAdd(map: Map): this + * Optional method. Called on [`map.addLayer(layer)`](#map-addlayer), before the layer is added to the map, before events are initialized, without waiting until the map is in a usable state. Use for early initialization only. + */ + + +/* @namespace Map + * @section Layer events + * + * @event layeradd: LayerEvent + * Fired when a new layer is added to the map. + * + * @event layerremove: LayerEvent + * Fired when some layer is removed from the map + * + * @section Methods for Layers and Controls + */ +Map.include({ + // @method addLayer(layer: Layer): this + // Adds the given layer to the map + addLayer: function (layer) { + if (!layer._layerAdd) { + throw new Error('The provided object is not a Layer.'); + } + + var id = stamp(layer); + if (this._layers[id]) { return this; } + this._layers[id] = layer; + + layer._mapToAdd = this; + + if (layer.beforeAdd) { + layer.beforeAdd(this); + } + + this.whenReady(layer._layerAdd, layer); + + return this; + }, + + // @method removeLayer(layer: Layer): this + // Removes the given layer from the map. + removeLayer: function (layer) { + var id = stamp(layer); + + if (!this._layers[id]) { return this; } + + if (this._loaded) { + layer.onRemove(this); + } + + delete this._layers[id]; + + if (this._loaded) { + this.fire('layerremove', {layer: layer}); + layer.fire('remove'); + } + + layer._map = layer._mapToAdd = null; + + return this; + }, + + // @method hasLayer(layer: Layer): Boolean + // Returns `true` if the given layer is currently added to the map + hasLayer: function (layer) { + return stamp(layer) in this._layers; + }, + + /* @method eachLayer(fn: Function, context?: Object): this + * Iterates over the layers of the map, optionally specifying context of the iterator function. + * ``` + * map.eachLayer(function(layer){ + * layer.bindPopup('Hello'); + * }); + * ``` + */ + eachLayer: function (method, context) { + for (var i in this._layers) { + method.call(context, this._layers[i]); + } + return this; + }, + + _addLayers: function (layers) { + layers = layers ? (isArray(layers) ? layers : [layers]) : []; + + for (var i = 0, len = layers.length; i < len; i++) { + this.addLayer(layers[i]); + } + }, + + _addZoomLimit: function (layer) { + if (!isNaN(layer.options.maxZoom) || !isNaN(layer.options.minZoom)) { + this._zoomBoundLayers[stamp(layer)] = layer; + this._updateZoomLevels(); + } + }, + + _removeZoomLimit: function (layer) { + var id = stamp(layer); + + if (this._zoomBoundLayers[id]) { + delete this._zoomBoundLayers[id]; + this._updateZoomLevels(); + } + }, + + _updateZoomLevels: function () { + var minZoom = Infinity, + maxZoom = -Infinity, + oldZoomSpan = this._getZoomSpan(); + + for (var i in this._zoomBoundLayers) { + var options = this._zoomBoundLayers[i].options; + + minZoom = options.minZoom === undefined ? minZoom : Math.min(minZoom, options.minZoom); + maxZoom = options.maxZoom === undefined ? maxZoom : Math.max(maxZoom, options.maxZoom); + } + + this._layersMaxZoom = maxZoom === -Infinity ? undefined : maxZoom; + this._layersMinZoom = minZoom === Infinity ? undefined : minZoom; + + // @section Map state change events + // @event zoomlevelschange: Event + // Fired when the number of zoomlevels on the map is changed due + // to adding or removing a layer. + if (oldZoomSpan !== this._getZoomSpan()) { + this.fire('zoomlevelschange'); + } + + if (this.options.maxZoom === undefined && this._layersMaxZoom && this.getZoom() > this._layersMaxZoom) { + this.setZoom(this._layersMaxZoom); + } + if (this.options.minZoom === undefined && this._layersMinZoom && this.getZoom() < this._layersMinZoom) { + this.setZoom(this._layersMinZoom); + } + } +}); + +/* + * @class LayerGroup + * @aka L.LayerGroup + * @inherits Interactive layer + * + * Used to group several layers and handle them as one. If you add it to the map, + * any layers added or removed from the group will be added/removed on the map as + * well. Extends `Layer`. + * + * @example + * + * ```js + * L.layerGroup([marker1, marker2]) + * .addLayer(polyline) + * .addTo(map); + * ``` + */ + +var LayerGroup = Layer.extend({ + + initialize: function (layers, options) { + setOptions(this, options); + + this._layers = {}; + + var i, len; + + if (layers) { + for (i = 0, len = layers.length; i < len; i++) { + this.addLayer(layers[i]); + } + } + }, + + // @method addLayer(layer: Layer): this + // Adds the given layer to the group. + addLayer: function (layer) { + var id = this.getLayerId(layer); + + this._layers[id] = layer; + + if (this._map) { + this._map.addLayer(layer); + } + + return this; + }, + + // @method removeLayer(layer: Layer): this + // Removes the given layer from the group. + // @alternative + // @method removeLayer(id: Number): this + // Removes the layer with the given internal ID from the group. + removeLayer: function (layer) { + var id = layer in this._layers ? layer : this.getLayerId(layer); + + if (this._map && this._layers[id]) { + this._map.removeLayer(this._layers[id]); + } + + delete this._layers[id]; + + return this; + }, + + // @method hasLayer(layer: Layer): Boolean + // Returns `true` if the given layer is currently added to the group. + // @alternative + // @method hasLayer(id: Number): Boolean + // Returns `true` if the given internal ID is currently added to the group. + hasLayer: function (layer) { + var layerId = typeof layer === 'number' ? layer : this.getLayerId(layer); + return layerId in this._layers; + }, + + // @method clearLayers(): this + // Removes all the layers from the group. + clearLayers: function () { + return this.eachLayer(this.removeLayer, this); + }, + + // @method invoke(methodName: String, …): this + // Calls `methodName` on every layer contained in this group, passing any + // additional parameters. Has no effect if the layers contained do not + // implement `methodName`. + invoke: function (methodName) { + var args = Array.prototype.slice.call(arguments, 1), + i, layer; + + for (i in this._layers) { + layer = this._layers[i]; + + if (layer[methodName]) { + layer[methodName].apply(layer, args); + } + } + + return this; + }, + + onAdd: function (map) { + this.eachLayer(map.addLayer, map); + }, + + onRemove: function (map) { + this.eachLayer(map.removeLayer, map); + }, + + // @method eachLayer(fn: Function, context?: Object): this + // Iterates over the layers of the group, optionally specifying context of the iterator function. + // ```js + // group.eachLayer(function (layer) { + // layer.bindPopup('Hello'); + // }); + // ``` + eachLayer: function (method, context) { + for (var i in this._layers) { + method.call(context, this._layers[i]); + } + return this; + }, + + // @method getLayer(id: Number): Layer + // Returns the layer with the given internal ID. + getLayer: function (id) { + return this._layers[id]; + }, + + // @method getLayers(): Layer[] + // Returns an array of all the layers added to the group. + getLayers: function () { + var layers = []; + this.eachLayer(layers.push, layers); + return layers; + }, + + // @method setZIndex(zIndex: Number): this + // Calls `setZIndex` on every layer contained in this group, passing the z-index. + setZIndex: function (zIndex) { + return this.invoke('setZIndex', zIndex); + }, + + // @method getLayerId(layer: Layer): Number + // Returns the internal ID for a layer + getLayerId: function (layer) { + return stamp(layer); + } +}); + + +// @factory L.layerGroup(layers?: Layer[], options?: Object) +// Create a layer group, optionally given an initial set of layers and an `options` object. +var layerGroup = function (layers, options) { + return new LayerGroup(layers, options); +}; + +/* + * @class FeatureGroup + * @aka L.FeatureGroup + * @inherits LayerGroup + * + * Extended `LayerGroup` that makes it easier to do the same thing to all its member layers: + * * [`bindPopup`](#layer-bindpopup) binds a popup to all of the layers at once (likewise with [`bindTooltip`](#layer-bindtooltip)) + * * Events are propagated to the `FeatureGroup`, so if the group has an event + * handler, it will handle events from any of the layers. This includes mouse events + * and custom events. + * * Has `layeradd` and `layerremove` events + * + * @example + * + * ```js + * L.featureGroup([marker1, marker2, polyline]) + * .bindPopup('Hello world!') + * .on('click', function() { alert('Clicked on a member of the group!'); }) + * .addTo(map); + * ``` + */ + +var FeatureGroup = LayerGroup.extend({ + + addLayer: function (layer) { + if (this.hasLayer(layer)) { + return this; + } + + layer.addEventParent(this); + + LayerGroup.prototype.addLayer.call(this, layer); + + // @event layeradd: LayerEvent + // Fired when a layer is added to this `FeatureGroup` + return this.fire('layeradd', {layer: layer}); + }, + + removeLayer: function (layer) { + if (!this.hasLayer(layer)) { + return this; + } + if (layer in this._layers) { + layer = this._layers[layer]; + } + + layer.removeEventParent(this); + + LayerGroup.prototype.removeLayer.call(this, layer); + + // @event layerremove: LayerEvent + // Fired when a layer is removed from this `FeatureGroup` + return this.fire('layerremove', {layer: layer}); + }, + + // @method setStyle(style: Path options): this + // Sets the given path options to each layer of the group that has a `setStyle` method. + setStyle: function (style) { + return this.invoke('setStyle', style); + }, + + // @method bringToFront(): this + // Brings the layer group to the top of all other layers + bringToFront: function () { + return this.invoke('bringToFront'); + }, + + // @method bringToBack(): this + // Brings the layer group to the back of all other layers + bringToBack: function () { + return this.invoke('bringToBack'); + }, + + // @method getBounds(): LatLngBounds + // Returns the LatLngBounds of the Feature Group (created from bounds and coordinates of its children). + getBounds: function () { + var bounds = new LatLngBounds(); + + for (var id in this._layers) { + var layer = this._layers[id]; + bounds.extend(layer.getBounds ? layer.getBounds() : layer.getLatLng()); + } + return bounds; + } +}); + +// @factory L.featureGroup(layers?: Layer[], options?: Object) +// Create a feature group, optionally given an initial set of layers and an `options` object. +var featureGroup = function (layers, options) { + return new FeatureGroup(layers, options); +}; + +/* + * @class Icon + * @aka L.Icon + * + * Represents an icon to provide when creating a marker. + * + * @example + * + * ```js + * var myIcon = L.icon({ + * iconUrl: 'my-icon.png', + * iconRetinaUrl: 'my-icon@2x.png', + * iconSize: [38, 95], + * iconAnchor: [22, 94], + * popupAnchor: [-3, -76], + * shadowUrl: 'my-icon-shadow.png', + * shadowRetinaUrl: 'my-icon-shadow@2x.png', + * shadowSize: [68, 95], + * shadowAnchor: [22, 94] + * }); + * + * L.marker([50.505, 30.57], {icon: myIcon}).addTo(map); + * ``` + * + * `L.Icon.Default` extends `L.Icon` and is the blue icon Leaflet uses for markers by default. + * + */ + +var Icon = Class.extend({ + + /* @section + * @aka Icon options + * + * @option iconUrl: String = null + * **(required)** The URL to the icon image (absolute or relative to your script path). + * + * @option iconRetinaUrl: String = null + * The URL to a retina sized version of the icon image (absolute or relative to your + * script path). Used for Retina screen devices. + * + * @option iconSize: Point = null + * Size of the icon image in pixels. + * + * @option iconAnchor: Point = null + * The coordinates of the "tip" of the icon (relative to its top left corner). The icon + * will be aligned so that this point is at the marker's geographical location. Centered + * by default if size is specified, also can be set in CSS with negative margins. + * + * @option popupAnchor: Point = [0, 0] + * The coordinates of the point from which popups will "open", relative to the icon anchor. + * + * @option tooltipAnchor: Point = [0, 0] + * The coordinates of the point from which tooltips will "open", relative to the icon anchor. + * + * @option shadowUrl: String = null + * The URL to the icon shadow image. If not specified, no shadow image will be created. + * + * @option shadowRetinaUrl: String = null + * + * @option shadowSize: Point = null + * Size of the shadow image in pixels. + * + * @option shadowAnchor: Point = null + * The coordinates of the "tip" of the shadow (relative to its top left corner) (the same + * as iconAnchor if not specified). + * + * @option className: String = '' + * A custom class name to assign to both icon and shadow images. Empty by default. + */ + + options: { + popupAnchor: [0, 0], + tooltipAnchor: [0, 0], + + // @option crossOrigin: Boolean|String = false + // Whether the crossOrigin attribute will be added to the tiles. + // If a String is provided, all tiles will have their crossOrigin attribute set to the String provided. This is needed if you want to access tile pixel data. + // Refer to [CORS Settings](https://developer.mozilla.org/en-US/docs/Web/HTML/CORS_settings_attributes) for valid String values. + crossOrigin: false + }, + + initialize: function (options) { + setOptions(this, options); + }, + + // @method createIcon(oldIcon?: HTMLElement): HTMLElement + // Called internally when the icon has to be shown, returns a `` HTML element + // styled according to the options. + createIcon: function (oldIcon) { + return this._createIcon('icon', oldIcon); + }, + + // @method createShadow(oldIcon?: HTMLElement): HTMLElement + // As `createIcon`, but for the shadow beneath it. + createShadow: function (oldIcon) { + return this._createIcon('shadow', oldIcon); + }, + + _createIcon: function (name, oldIcon) { + var src = this._getIconUrl(name); + + if (!src) { + if (name === 'icon') { + throw new Error('iconUrl not set in Icon options (see the docs).'); + } + return null; + } + + var img = this._createImg(src, oldIcon && oldIcon.tagName === 'IMG' ? oldIcon : null); + this._setIconStyles(img, name); + + if (this.options.crossOrigin || this.options.crossOrigin === '') { + img.crossOrigin = this.options.crossOrigin === true ? '' : this.options.crossOrigin; + } + + return img; + }, + + _setIconStyles: function (img, name) { + var options = this.options; + var sizeOption = options[name + 'Size']; + + if (typeof sizeOption === 'number') { + sizeOption = [sizeOption, sizeOption]; + } + + var size = toPoint(sizeOption), + anchor = toPoint(name === 'shadow' && options.shadowAnchor || options.iconAnchor || + size && size.divideBy(2, true)); + + img.className = 'leaflet-marker-' + name + ' ' + (options.className || ''); + + if (anchor) { + img.style.marginLeft = (-anchor.x) + 'px'; + img.style.marginTop = (-anchor.y) + 'px'; + } + + if (size) { + img.style.width = size.x + 'px'; + img.style.height = size.y + 'px'; + } + }, + + _createImg: function (src, el) { + el = el || document.createElement('img'); + el.src = src; + return el; + }, + + _getIconUrl: function (name) { + return Browser.retina && this.options[name + 'RetinaUrl'] || this.options[name + 'Url']; + } +}); + + +// @factory L.icon(options: Icon options) +// Creates an icon instance with the given options. +function icon(options) { + return new Icon(options); +} + +/* + * @miniclass Icon.Default (Icon) + * @aka L.Icon.Default + * @section + * + * A trivial subclass of `Icon`, represents the icon to use in `Marker`s when + * no icon is specified. Points to the blue marker image distributed with Leaflet + * releases. + * + * In order to customize the default icon, just change the properties of `L.Icon.Default.prototype.options` + * (which is a set of `Icon options`). + * + * If you want to _completely_ replace the default icon, override the + * `L.Marker.prototype.options.icon` with your own icon instead. + */ + +var IconDefault = Icon.extend({ + + options: { + iconUrl: 'marker-icon.png', + iconRetinaUrl: 'marker-icon-2x.png', + shadowUrl: 'marker-shadow.png', + iconSize: [25, 41], + iconAnchor: [12, 41], + popupAnchor: [1, -34], + tooltipAnchor: [16, -28], + shadowSize: [41, 41] + }, + + _getIconUrl: function (name) { + if (typeof IconDefault.imagePath !== 'string') { // Deprecated, backwards-compatibility only + IconDefault.imagePath = this._detectIconPath(); + } + + // @option imagePath: String + // `Icon.Default` will try to auto-detect the location of the + // blue icon images. If you are placing these images in a non-standard + // way, set this option to point to the right path. + return (this.options.imagePath || IconDefault.imagePath) + Icon.prototype._getIconUrl.call(this, name); + }, + + _stripUrl: function (path) { // separate function to use in tests + var strip = function (str, re, idx) { + var match = re.exec(str); + return match && match[idx]; + }; + path = strip(path, /^url\((['"])?(.+)\1\)$/, 2); + return path && strip(path, /^(.*)marker-icon\.png$/, 1); + }, + + _detectIconPath: function () { + var el = create$1('div', 'leaflet-default-icon-path', document.body); + var path = getStyle(el, 'background-image') || + getStyle(el, 'backgroundImage'); // IE8 + + document.body.removeChild(el); + path = this._stripUrl(path); + if (path) { return path; } + var link = document.querySelector('link[href$="leaflet.css"]'); + if (!link) { return ''; } + return link.href.substring(0, link.href.length - 'leaflet.css'.length - 1); + } +}); + +/* + * L.Handler.MarkerDrag is used internally by L.Marker to make the markers draggable. + */ + + +/* @namespace Marker + * @section Interaction handlers + * + * Interaction handlers are properties of a marker instance that allow you to control interaction behavior in runtime, enabling or disabling certain features such as dragging (see `Handler` methods). Example: + * + * ```js + * marker.dragging.disable(); + * ``` + * + * @property dragging: Handler + * Marker dragging handler (by both mouse and touch). Only valid when the marker is on the map (Otherwise set [`marker.options.draggable`](#marker-draggable)). + */ + +var MarkerDrag = Handler.extend({ + initialize: function (marker) { + this._marker = marker; + }, + + addHooks: function () { + var icon = this._marker._icon; + + if (!this._draggable) { + this._draggable = new Draggable(icon, icon, true); + } + + this._draggable.on({ + dragstart: this._onDragStart, + predrag: this._onPreDrag, + drag: this._onDrag, + dragend: this._onDragEnd + }, this).enable(); + + addClass(icon, 'leaflet-marker-draggable'); + }, + + removeHooks: function () { + this._draggable.off({ + dragstart: this._onDragStart, + predrag: this._onPreDrag, + drag: this._onDrag, + dragend: this._onDragEnd + }, this).disable(); + + if (this._marker._icon) { + removeClass(this._marker._icon, 'leaflet-marker-draggable'); + } + }, + + moved: function () { + return this._draggable && this._draggable._moved; + }, + + _adjustPan: function (e) { + var marker = this._marker, + map = marker._map, + speed = this._marker.options.autoPanSpeed, + padding = this._marker.options.autoPanPadding, + iconPos = getPosition(marker._icon), + bounds = map.getPixelBounds(), + origin = map.getPixelOrigin(); + + var panBounds = toBounds( + bounds.min._subtract(origin).add(padding), + bounds.max._subtract(origin).subtract(padding) + ); + + if (!panBounds.contains(iconPos)) { + // Compute incremental movement + var movement = toPoint( + (Math.max(panBounds.max.x, iconPos.x) - panBounds.max.x) / (bounds.max.x - panBounds.max.x) - + (Math.min(panBounds.min.x, iconPos.x) - panBounds.min.x) / (bounds.min.x - panBounds.min.x), + + (Math.max(panBounds.max.y, iconPos.y) - panBounds.max.y) / (bounds.max.y - panBounds.max.y) - + (Math.min(panBounds.min.y, iconPos.y) - panBounds.min.y) / (bounds.min.y - panBounds.min.y) + ).multiplyBy(speed); + + map.panBy(movement, {animate: false}); + + this._draggable._newPos._add(movement); + this._draggable._startPos._add(movement); + + setPosition(marker._icon, this._draggable._newPos); + this._onDrag(e); + + this._panRequest = requestAnimFrame(this._adjustPan.bind(this, e)); + } + }, + + _onDragStart: function () { + // @section Dragging events + // @event dragstart: Event + // Fired when the user starts dragging the marker. + + // @event movestart: Event + // Fired when the marker starts moving (because of dragging). + + this._oldLatLng = this._marker.getLatLng(); + + // When using ES6 imports it could not be set when `Popup` was not imported as well + this._marker.closePopup && this._marker.closePopup(); + + this._marker + .fire('movestart') + .fire('dragstart'); + }, + + _onPreDrag: function (e) { + if (this._marker.options.autoPan) { + cancelAnimFrame(this._panRequest); + this._panRequest = requestAnimFrame(this._adjustPan.bind(this, e)); + } + }, + + _onDrag: function (e) { + var marker = this._marker, + shadow = marker._shadow, + iconPos = getPosition(marker._icon), + latlng = marker._map.layerPointToLatLng(iconPos); + + // update shadow position + if (shadow) { + setPosition(shadow, iconPos); + } + + marker._latlng = latlng; + e.latlng = latlng; + e.oldLatLng = this._oldLatLng; + + // @event drag: Event + // Fired repeatedly while the user drags the marker. + marker + .fire('move', e) + .fire('drag', e); + }, + + _onDragEnd: function (e) { + // @event dragend: DragEndEvent + // Fired when the user stops dragging the marker. + + cancelAnimFrame(this._panRequest); + + // @event moveend: Event + // Fired when the marker stops moving (because of dragging). + delete this._oldLatLng; + this._marker + .fire('moveend') + .fire('dragend', e); + } +}); + +/* + * @class Marker + * @inherits Interactive layer + * @aka L.Marker + * L.Marker is used to display clickable/draggable icons on the map. Extends `Layer`. + * + * @example + * + * ```js + * L.marker([50.5, 30.5]).addTo(map); + * ``` + */ + +var Marker = Layer.extend({ + + // @section + // @aka Marker options + options: { + // @option icon: Icon = * + // Icon instance to use for rendering the marker. + // See [Icon documentation](#L.Icon) for details on how to customize the marker icon. + // If not specified, a common instance of `L.Icon.Default` is used. + icon: new IconDefault(), + + // Option inherited from "Interactive layer" abstract class + interactive: true, + + // @option keyboard: Boolean = true + // Whether the marker can be tabbed to with a keyboard and clicked by pressing enter. + keyboard: true, + + // @option title: String = '' + // Text for the browser tooltip that appear on marker hover (no tooltip by default). + // [Useful for accessibility](https://leafletjs.com/examples/accessibility/#markers-must-be-labelled). + title: '', + + // @option alt: String = 'Marker' + // Text for the `alt` attribute of the icon image. + // [Useful for accessibility](https://leafletjs.com/examples/accessibility/#markers-must-be-labelled). + alt: 'Marker', + + // @option zIndexOffset: Number = 0 + // By default, marker images zIndex is set automatically based on its latitude. Use this option if you want to put the marker on top of all others (or below), specifying a high value like `1000` (or high negative value, respectively). + zIndexOffset: 0, + + // @option opacity: Number = 1.0 + // The opacity of the marker. + opacity: 1, + + // @option riseOnHover: Boolean = false + // If `true`, the marker will get on top of others when you hover the mouse over it. + riseOnHover: false, + + // @option riseOffset: Number = 250 + // The z-index offset used for the `riseOnHover` feature. + riseOffset: 250, + + // @option pane: String = 'markerPane' + // `Map pane` where the markers icon will be added. + pane: 'markerPane', + + // @option shadowPane: String = 'shadowPane' + // `Map pane` where the markers shadow will be added. + shadowPane: 'shadowPane', + + // @option bubblingMouseEvents: Boolean = false + // When `true`, a mouse event on this marker will trigger the same event on the map + // (unless [`L.DomEvent.stopPropagation`](#domevent-stoppropagation) is used). + bubblingMouseEvents: false, + + // @option autoPanOnFocus: Boolean = true + // When `true`, the map will pan whenever the marker is focused (via + // e.g. pressing `tab` on the keyboard) to ensure the marker is + // visible within the map's bounds + autoPanOnFocus: true, + + // @section Draggable marker options + // @option draggable: Boolean = false + // Whether the marker is draggable with mouse/touch or not. + draggable: false, + + // @option autoPan: Boolean = false + // Whether to pan the map when dragging this marker near its edge or not. + autoPan: false, + + // @option autoPanPadding: Point = Point(50, 50) + // Distance (in pixels to the left/right and to the top/bottom) of the + // map edge to start panning the map. + autoPanPadding: [50, 50], + + // @option autoPanSpeed: Number = 10 + // Number of pixels the map should pan by. + autoPanSpeed: 10 + }, + + /* @section + * + * In addition to [shared layer methods](#Layer) like `addTo()` and `remove()` and [popup methods](#Popup) like bindPopup() you can also use the following methods: + */ + + initialize: function (latlng, options) { + setOptions(this, options); + this._latlng = toLatLng(latlng); + }, + + onAdd: function (map) { + this._zoomAnimated = this._zoomAnimated && map.options.markerZoomAnimation; + + if (this._zoomAnimated) { + map.on('zoomanim', this._animateZoom, this); + } + + this._initIcon(); + this.update(); + }, + + onRemove: function (map) { + if (this.dragging && this.dragging.enabled()) { + this.options.draggable = true; + this.dragging.removeHooks(); + } + delete this.dragging; + + if (this._zoomAnimated) { + map.off('zoomanim', this._animateZoom, this); + } + + this._removeIcon(); + this._removeShadow(); + }, + + getEvents: function () { + return { + zoom: this.update, + viewreset: this.update + }; + }, + + // @method getLatLng: LatLng + // Returns the current geographical position of the marker. + getLatLng: function () { + return this._latlng; + }, + + // @method setLatLng(latlng: LatLng): this + // Changes the marker position to the given point. + setLatLng: function (latlng) { + var oldLatLng = this._latlng; + this._latlng = toLatLng(latlng); + this.update(); + + // @event move: Event + // Fired when the marker is moved via [`setLatLng`](#marker-setlatlng) or by [dragging](#marker-dragging). Old and new coordinates are included in event arguments as `oldLatLng`, `latlng`. + return this.fire('move', {oldLatLng: oldLatLng, latlng: this._latlng}); + }, + + // @method setZIndexOffset(offset: Number): this + // Changes the [zIndex offset](#marker-zindexoffset) of the marker. + setZIndexOffset: function (offset) { + this.options.zIndexOffset = offset; + return this.update(); + }, + + // @method getIcon: Icon + // Returns the current icon used by the marker + getIcon: function () { + return this.options.icon; + }, + + // @method setIcon(icon: Icon): this + // Changes the marker icon. + setIcon: function (icon) { + + this.options.icon = icon; + + if (this._map) { + this._initIcon(); + this.update(); + } + + if (this._popup) { + this.bindPopup(this._popup, this._popup.options); + } + + return this; + }, + + getElement: function () { + return this._icon; + }, + + update: function () { + + if (this._icon && this._map) { + var pos = this._map.latLngToLayerPoint(this._latlng).round(); + this._setPos(pos); + } + + return this; + }, + + _initIcon: function () { + var options = this.options, + classToAdd = 'leaflet-zoom-' + (this._zoomAnimated ? 'animated' : 'hide'); + + var icon = options.icon.createIcon(this._icon), + addIcon = false; + + // if we're not reusing the icon, remove the old one and init new one + if (icon !== this._icon) { + if (this._icon) { + this._removeIcon(); + } + addIcon = true; + + if (options.title) { + icon.title = options.title; + } + + if (icon.tagName === 'IMG') { + icon.alt = options.alt || ''; + } + } + + addClass(icon, classToAdd); + + if (options.keyboard) { + icon.tabIndex = '0'; + icon.setAttribute('role', 'button'); + } + + this._icon = icon; + + if (options.riseOnHover) { + this.on({ + mouseover: this._bringToFront, + mouseout: this._resetZIndex + }); + } + + if (this.options.autoPanOnFocus) { + on(icon, 'focus', this._panOnFocus, this); + } + + var newShadow = options.icon.createShadow(this._shadow), + addShadow = false; + + if (newShadow !== this._shadow) { + this._removeShadow(); + addShadow = true; + } + + if (newShadow) { + addClass(newShadow, classToAdd); + newShadow.alt = ''; + } + this._shadow = newShadow; + + + if (options.opacity < 1) { + this._updateOpacity(); + } + + + if (addIcon) { + this.getPane().appendChild(this._icon); + } + this._initInteraction(); + if (newShadow && addShadow) { + this.getPane(options.shadowPane).appendChild(this._shadow); + } + }, + + _removeIcon: function () { + if (this.options.riseOnHover) { + this.off({ + mouseover: this._bringToFront, + mouseout: this._resetZIndex + }); + } + + if (this.options.autoPanOnFocus) { + off(this._icon, 'focus', this._panOnFocus, this); + } + + remove(this._icon); + this.removeInteractiveTarget(this._icon); + + this._icon = null; + }, + + _removeShadow: function () { + if (this._shadow) { + remove(this._shadow); + } + this._shadow = null; + }, + + _setPos: function (pos) { + + if (this._icon) { + setPosition(this._icon, pos); + } + + if (this._shadow) { + setPosition(this._shadow, pos); + } + + this._zIndex = pos.y + this.options.zIndexOffset; + + this._resetZIndex(); + }, + + _updateZIndex: function (offset) { + if (this._icon) { + this._icon.style.zIndex = this._zIndex + offset; + } + }, + + _animateZoom: function (opt) { + var pos = this._map._latLngToNewLayerPoint(this._latlng, opt.zoom, opt.center).round(); + + this._setPos(pos); + }, + + _initInteraction: function () { + + if (!this.options.interactive) { return; } + + addClass(this._icon, 'leaflet-interactive'); + + this.addInteractiveTarget(this._icon); + + if (MarkerDrag) { + var draggable = this.options.draggable; + if (this.dragging) { + draggable = this.dragging.enabled(); + this.dragging.disable(); + } + + this.dragging = new MarkerDrag(this); + + if (draggable) { + this.dragging.enable(); + } + } + }, + + // @method setOpacity(opacity: Number): this + // Changes the opacity of the marker. + setOpacity: function (opacity) { + this.options.opacity = opacity; + if (this._map) { + this._updateOpacity(); + } + + return this; + }, + + _updateOpacity: function () { + var opacity = this.options.opacity; + + if (this._icon) { + setOpacity(this._icon, opacity); + } + + if (this._shadow) { + setOpacity(this._shadow, opacity); + } + }, + + _bringToFront: function () { + this._updateZIndex(this.options.riseOffset); + }, + + _resetZIndex: function () { + this._updateZIndex(0); + }, + + _panOnFocus: function () { + var map = this._map; + if (!map) { return; } + + var iconOpts = this.options.icon.options; + var size = iconOpts.iconSize ? toPoint(iconOpts.iconSize) : toPoint(0, 0); + var anchor = iconOpts.iconAnchor ? toPoint(iconOpts.iconAnchor) : toPoint(0, 0); + + map.panInside(this._latlng, { + paddingTopLeft: anchor, + paddingBottomRight: size.subtract(anchor) + }); + }, + + _getPopupAnchor: function () { + return this.options.icon.options.popupAnchor; + }, + + _getTooltipAnchor: function () { + return this.options.icon.options.tooltipAnchor; + } +}); + + +// factory L.marker(latlng: LatLng, options? : Marker options) + +// @factory L.marker(latlng: LatLng, options? : Marker options) +// Instantiates a Marker object given a geographical point and optionally an options object. +function marker(latlng, options) { + return new Marker(latlng, options); +} + +/* + * @class Path + * @aka L.Path + * @inherits Interactive layer + * + * An abstract class that contains options and constants shared between vector + * overlays (Polygon, Polyline, Circle). Do not use it directly. Extends `Layer`. + */ + +var Path = Layer.extend({ + + // @section + // @aka Path options + options: { + // @option stroke: Boolean = true + // Whether to draw stroke along the path. Set it to `false` to disable borders on polygons or circles. + stroke: true, + + // @option color: String = '#3388ff' + // Stroke color + color: '#3388ff', + + // @option weight: Number = 3 + // Stroke width in pixels + weight: 3, + + // @option opacity: Number = 1.0 + // Stroke opacity + opacity: 1, + + // @option lineCap: String= 'round' + // A string that defines [shape to be used at the end](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-linecap) of the stroke. + lineCap: 'round', + + // @option lineJoin: String = 'round' + // A string that defines [shape to be used at the corners](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-linejoin) of the stroke. + lineJoin: 'round', + + // @option dashArray: String = null + // A string that defines the stroke [dash pattern](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-dasharray). Doesn't work on `Canvas`-powered layers in [some old browsers](https://developer.mozilla.org/docs/Web/API/CanvasRenderingContext2D/setLineDash#Browser_compatibility). + dashArray: null, + + // @option dashOffset: String = null + // A string that defines the [distance into the dash pattern to start the dash](https://developer.mozilla.org/docs/Web/SVG/Attribute/stroke-dashoffset). Doesn't work on `Canvas`-powered layers in [some old browsers](https://developer.mozilla.org/docs/Web/API/CanvasRenderingContext2D/setLineDash#Browser_compatibility). + dashOffset: null, + + // @option fill: Boolean = depends + // Whether to fill the path with color. Set it to `false` to disable filling on polygons or circles. + fill: false, + + // @option fillColor: String = * + // Fill color. Defaults to the value of the [`color`](#path-color) option + fillColor: null, + + // @option fillOpacity: Number = 0.2 + // Fill opacity. + fillOpacity: 0.2, + + // @option fillRule: String = 'evenodd' + // A string that defines [how the inside of a shape](https://developer.mozilla.org/docs/Web/SVG/Attribute/fill-rule) is determined. + fillRule: 'evenodd', + + // className: '', + + // Option inherited from "Interactive layer" abstract class + interactive: true, + + // @option bubblingMouseEvents: Boolean = true + // When `true`, a mouse event on this path will trigger the same event on the map + // (unless [`L.DomEvent.stopPropagation`](#domevent-stoppropagation) is used). + bubblingMouseEvents: true + }, + + beforeAdd: function (map) { + // Renderer is set here because we need to call renderer.getEvents + // before this.getEvents. + this._renderer = map.getRenderer(this); + }, + + onAdd: function () { + this._renderer._initPath(this); + this._reset(); + this._renderer._addPath(this); + }, + + onRemove: function () { + this._renderer._removePath(this); + }, + + // @method redraw(): this + // Redraws the layer. Sometimes useful after you changed the coordinates that the path uses. + redraw: function () { + if (this._map) { + this._renderer._updatePath(this); + } + return this; + }, + + // @method setStyle(style: Path options): this + // Changes the appearance of a Path based on the options in the `Path options` object. + setStyle: function (style) { + setOptions(this, style); + if (this._renderer) { + this._renderer._updateStyle(this); + if (this.options.stroke && style && Object.prototype.hasOwnProperty.call(style, 'weight')) { + this._updateBounds(); + } + } + return this; + }, + + // @method bringToFront(): this + // Brings the layer to the top of all path layers. + bringToFront: function () { + if (this._renderer) { + this._renderer._bringToFront(this); + } + return this; + }, + + // @method bringToBack(): this + // Brings the layer to the bottom of all path layers. + bringToBack: function () { + if (this._renderer) { + this._renderer._bringToBack(this); + } + return this; + }, + + getElement: function () { + return this._path; + }, + + _reset: function () { + // defined in child classes + this._project(); + this._update(); + }, + + _clickTolerance: function () { + // used when doing hit detection for Canvas layers + return (this.options.stroke ? this.options.weight / 2 : 0) + + (this._renderer.options.tolerance || 0); + } +}); + +/* + * @class CircleMarker + * @aka L.CircleMarker + * @inherits Path + * + * A circle of a fixed size with radius specified in pixels. Extends `Path`. + */ + +var CircleMarker = Path.extend({ + + // @section + // @aka CircleMarker options + options: { + fill: true, + + // @option radius: Number = 10 + // Radius of the circle marker, in pixels + radius: 10 + }, + + initialize: function (latlng, options) { + setOptions(this, options); + this._latlng = toLatLng(latlng); + this._radius = this.options.radius; + }, + + // @method setLatLng(latLng: LatLng): this + // Sets the position of a circle marker to a new location. + setLatLng: function (latlng) { + var oldLatLng = this._latlng; + this._latlng = toLatLng(latlng); + this.redraw(); + + // @event move: Event + // Fired when the marker is moved via [`setLatLng`](#circlemarker-setlatlng). Old and new coordinates are included in event arguments as `oldLatLng`, `latlng`. + return this.fire('move', {oldLatLng: oldLatLng, latlng: this._latlng}); + }, + + // @method getLatLng(): LatLng + // Returns the current geographical position of the circle marker + getLatLng: function () { + return this._latlng; + }, + + // @method setRadius(radius: Number): this + // Sets the radius of a circle marker. Units are in pixels. + setRadius: function (radius) { + this.options.radius = this._radius = radius; + return this.redraw(); + }, + + // @method getRadius(): Number + // Returns the current radius of the circle + getRadius: function () { + return this._radius; + }, + + setStyle : function (options) { + var radius = options && options.radius || this._radius; + Path.prototype.setStyle.call(this, options); + this.setRadius(radius); + return this; + }, + + _project: function () { + this._point = this._map.latLngToLayerPoint(this._latlng); + this._updateBounds(); + }, + + _updateBounds: function () { + var r = this._radius, + r2 = this._radiusY || r, + w = this._clickTolerance(), + p = [r + w, r2 + w]; + this._pxBounds = new Bounds(this._point.subtract(p), this._point.add(p)); + }, + + _update: function () { + if (this._map) { + this._updatePath(); + } + }, + + _updatePath: function () { + this._renderer._updateCircle(this); + }, + + _empty: function () { + return this._radius && !this._renderer._bounds.intersects(this._pxBounds); + }, + + // Needed by the `Canvas` renderer for interactivity + _containsPoint: function (p) { + return p.distanceTo(this._point) <= this._radius + this._clickTolerance(); + } +}); + + +// @factory L.circleMarker(latlng: LatLng, options?: CircleMarker options) +// Instantiates a circle marker object given a geographical point, and an optional options object. +function circleMarker(latlng, options) { + return new CircleMarker(latlng, options); +} + +/* + * @class Circle + * @aka L.Circle + * @inherits CircleMarker + * + * A class for drawing circle overlays on a map. Extends `CircleMarker`. + * + * It's an approximation and starts to diverge from a real circle closer to poles (due to projection distortion). + * + * @example + * + * ```js + * L.circle([50.5, 30.5], {radius: 200}).addTo(map); + * ``` + */ + +var Circle = CircleMarker.extend({ + + initialize: function (latlng, options, legacyOptions) { + if (typeof options === 'number') { + // Backwards compatibility with 0.7.x factory (latlng, radius, options?) + options = extend({}, legacyOptions, {radius: options}); + } + setOptions(this, options); + this._latlng = toLatLng(latlng); + + if (isNaN(this.options.radius)) { throw new Error('Circle radius cannot be NaN'); } + + // @section + // @aka Circle options + // @option radius: Number; Radius of the circle, in meters. + this._mRadius = this.options.radius; + }, + + // @method setRadius(radius: Number): this + // Sets the radius of a circle. Units are in meters. + setRadius: function (radius) { + this._mRadius = radius; + return this.redraw(); + }, + + // @method getRadius(): Number + // Returns the current radius of a circle. Units are in meters. + getRadius: function () { + return this._mRadius; + }, + + // @method getBounds(): LatLngBounds + // Returns the `LatLngBounds` of the path. + getBounds: function () { + var half = [this._radius, this._radiusY || this._radius]; + + return new LatLngBounds( + this._map.layerPointToLatLng(this._point.subtract(half)), + this._map.layerPointToLatLng(this._point.add(half))); + }, + + setStyle: Path.prototype.setStyle, + + _project: function () { + + var lng = this._latlng.lng, + lat = this._latlng.lat, + map = this._map, + crs = map.options.crs; + + if (crs.distance === Earth.distance) { + var d = Math.PI / 180, + latR = (this._mRadius / Earth.R) / d, + top = map.project([lat + latR, lng]), + bottom = map.project([lat - latR, lng]), + p = top.add(bottom).divideBy(2), + lat2 = map.unproject(p).lat, + lngR = Math.acos((Math.cos(latR * d) - Math.sin(lat * d) * Math.sin(lat2 * d)) / + (Math.cos(lat * d) * Math.cos(lat2 * d))) / d; + + if (isNaN(lngR) || lngR === 0) { + lngR = latR / Math.cos(Math.PI / 180 * lat); // Fallback for edge case, #2425 + } + + this._point = p.subtract(map.getPixelOrigin()); + this._radius = isNaN(lngR) ? 0 : p.x - map.project([lat2, lng - lngR]).x; + this._radiusY = p.y - top.y; + + } else { + var latlng2 = crs.unproject(crs.project(this._latlng).subtract([this._mRadius, 0])); + + this._point = map.latLngToLayerPoint(this._latlng); + this._radius = this._point.x - map.latLngToLayerPoint(latlng2).x; + } + + this._updateBounds(); + } +}); + +// @factory L.circle(latlng: LatLng, options?: Circle options) +// Instantiates a circle object given a geographical point, and an options object +// which contains the circle radius. +// @alternative +// @factory L.circle(latlng: LatLng, radius: Number, options?: Circle options) +// Obsolete way of instantiating a circle, for compatibility with 0.7.x code. +// Do not use in new applications or plugins. +function circle(latlng, options, legacyOptions) { + return new Circle(latlng, options, legacyOptions); +} + +/* + * @class Polyline + * @aka L.Polyline + * @inherits Path + * + * A class for drawing polyline overlays on a map. Extends `Path`. + * + * @example + * + * ```js + * // create a red polyline from an array of LatLng points + * var latlngs = [ + * [45.51, -122.68], + * [37.77, -122.43], + * [34.04, -118.2] + * ]; + * + * var polyline = L.polyline(latlngs, {color: 'red'}).addTo(map); + * + * // zoom the map to the polyline + * map.fitBounds(polyline.getBounds()); + * ``` + * + * You can also pass a multi-dimensional array to represent a `MultiPolyline` shape: + * + * ```js + * // create a red polyline from an array of arrays of LatLng points + * var latlngs = [ + * [[45.51, -122.68], + * [37.77, -122.43], + * [34.04, -118.2]], + * [[40.78, -73.91], + * [41.83, -87.62], + * [32.76, -96.72]] + * ]; + * ``` + */ + + +var Polyline = Path.extend({ + + // @section + // @aka Polyline options + options: { + // @option smoothFactor: Number = 1.0 + // How much to simplify the polyline on each zoom level. More means + // better performance and smoother look, and less means more accurate representation. + smoothFactor: 1.0, + + // @option noClip: Boolean = false + // Disable polyline clipping. + noClip: false + }, + + initialize: function (latlngs, options) { + setOptions(this, options); + this._setLatLngs(latlngs); + }, + + // @method getLatLngs(): LatLng[] + // Returns an array of the points in the path, or nested arrays of points in case of multi-polyline. + getLatLngs: function () { + return this._latlngs; + }, + + // @method setLatLngs(latlngs: LatLng[]): this + // Replaces all the points in the polyline with the given array of geographical points. + setLatLngs: function (latlngs) { + this._setLatLngs(latlngs); + return this.redraw(); + }, + + // @method isEmpty(): Boolean + // Returns `true` if the Polyline has no LatLngs. + isEmpty: function () { + return !this._latlngs.length; + }, + + // @method closestLayerPoint(p: Point): Point + // Returns the point closest to `p` on the Polyline. + closestLayerPoint: function (p) { + var minDistance = Infinity, + minPoint = null, + closest = _sqClosestPointOnSegment, + p1, p2; + + for (var j = 0, jLen = this._parts.length; j < jLen; j++) { + var points = this._parts[j]; + + for (var i = 1, len = points.length; i < len; i++) { + p1 = points[i - 1]; + p2 = points[i]; + + var sqDist = closest(p, p1, p2, true); + + if (sqDist < minDistance) { + minDistance = sqDist; + minPoint = closest(p, p1, p2); + } + } + } + if (minPoint) { + minPoint.distance = Math.sqrt(minDistance); + } + return minPoint; + }, + + // @method getCenter(): LatLng + // Returns the center ([centroid](https://en.wikipedia.org/wiki/Centroid)) of the polyline. + getCenter: function () { + // throws error when not yet added to map as this center calculation requires projected coordinates + if (!this._map) { + throw new Error('Must add layer to map before using getCenter()'); + } + + var i, halfDist, segDist, dist, p1, p2, ratio, + points = this._rings[0], + len = points.length; + + if (!len) { return null; } + + // polyline centroid algorithm; only uses the first ring if there are multiple + + for (i = 0, halfDist = 0; i < len - 1; i++) { + halfDist += points[i].distanceTo(points[i + 1]) / 2; + } + + // The line is so small in the current view that all points are on the same pixel. + if (halfDist === 0) { + return this._map.layerPointToLatLng(points[0]); + } + + for (i = 0, dist = 0; i < len - 1; i++) { + p1 = points[i]; + p2 = points[i + 1]; + segDist = p1.distanceTo(p2); + dist += segDist; + + if (dist > halfDist) { + ratio = (dist - halfDist) / segDist; + return this._map.layerPointToLatLng([ + p2.x - ratio * (p2.x - p1.x), + p2.y - ratio * (p2.y - p1.y) + ]); + } + } + }, + + // @method getBounds(): LatLngBounds + // Returns the `LatLngBounds` of the path. + getBounds: function () { + return this._bounds; + }, + + // @method addLatLng(latlng: LatLng, latlngs?: LatLng[]): this + // Adds a given point to the polyline. By default, adds to the first ring of + // the polyline in case of a multi-polyline, but can be overridden by passing + // a specific ring as a LatLng array (that you can earlier access with [`getLatLngs`](#polyline-getlatlngs)). + addLatLng: function (latlng, latlngs) { + latlngs = latlngs || this._defaultShape(); + latlng = toLatLng(latlng); + latlngs.push(latlng); + this._bounds.extend(latlng); + return this.redraw(); + }, + + _setLatLngs: function (latlngs) { + this._bounds = new LatLngBounds(); + this._latlngs = this._convertLatLngs(latlngs); + }, + + _defaultShape: function () { + return isFlat(this._latlngs) ? this._latlngs : this._latlngs[0]; + }, + + // recursively convert latlngs input into actual LatLng instances; calculate bounds along the way + _convertLatLngs: function (latlngs) { + var result = [], + flat = isFlat(latlngs); + + for (var i = 0, len = latlngs.length; i < len; i++) { + if (flat) { + result[i] = toLatLng(latlngs[i]); + this._bounds.extend(result[i]); + } else { + result[i] = this._convertLatLngs(latlngs[i]); + } + } + + return result; + }, + + _project: function () { + var pxBounds = new Bounds(); + this._rings = []; + this._projectLatlngs(this._latlngs, this._rings, pxBounds); + + if (this._bounds.isValid() && pxBounds.isValid()) { + this._rawPxBounds = pxBounds; + this._updateBounds(); + } + }, + + _updateBounds: function () { + var w = this._clickTolerance(), + p = new Point(w, w); + + if (!this._rawPxBounds) { + return; + } + + this._pxBounds = new Bounds([ + this._rawPxBounds.min.subtract(p), + this._rawPxBounds.max.add(p) + ]); + }, + + // recursively turns latlngs into a set of rings with projected coordinates + _projectLatlngs: function (latlngs, result, projectedBounds) { + var flat = latlngs[0] instanceof LatLng, + len = latlngs.length, + i, ring; + + if (flat) { + ring = []; + for (i = 0; i < len; i++) { + ring[i] = this._map.latLngToLayerPoint(latlngs[i]); + projectedBounds.extend(ring[i]); + } + result.push(ring); + } else { + for (i = 0; i < len; i++) { + this._projectLatlngs(latlngs[i], result, projectedBounds); + } + } + }, + + // clip polyline by renderer bounds so that we have less to render for performance + _clipPoints: function () { + var bounds = this._renderer._bounds; + + this._parts = []; + if (!this._pxBounds || !this._pxBounds.intersects(bounds)) { + return; + } + + if (this.options.noClip) { + this._parts = this._rings; + return; + } + + var parts = this._parts, + i, j, k, len, len2, segment, points; + + for (i = 0, k = 0, len = this._rings.length; i < len; i++) { + points = this._rings[i]; + + for (j = 0, len2 = points.length; j < len2 - 1; j++) { + segment = clipSegment(points[j], points[j + 1], bounds, j, true); + + if (!segment) { continue; } + + parts[k] = parts[k] || []; + parts[k].push(segment[0]); + + // if segment goes out of screen, or it's the last one, it's the end of the line part + if ((segment[1] !== points[j + 1]) || (j === len2 - 2)) { + parts[k].push(segment[1]); + k++; + } + } + } + }, + + // simplify each clipped part of the polyline for performance + _simplifyPoints: function () { + var parts = this._parts, + tolerance = this.options.smoothFactor; + + for (var i = 0, len = parts.length; i < len; i++) { + parts[i] = simplify(parts[i], tolerance); + } + }, + + _update: function () { + if (!this._map) { return; } + + this._clipPoints(); + this._simplifyPoints(); + this._updatePath(); + }, + + _updatePath: function () { + this._renderer._updatePoly(this); + }, + + // Needed by the `Canvas` renderer for interactivity + _containsPoint: function (p, closed) { + var i, j, k, len, len2, part, + w = this._clickTolerance(); + + if (!this._pxBounds || !this._pxBounds.contains(p)) { return false; } + + // hit detection for polylines + for (i = 0, len = this._parts.length; i < len; i++) { + part = this._parts[i]; + + for (j = 0, len2 = part.length, k = len2 - 1; j < len2; k = j++) { + if (!closed && (j === 0)) { continue; } + + if (pointToSegmentDistance(p, part[k], part[j]) <= w) { + return true; + } + } + } + return false; + } +}); + +// @factory L.polyline(latlngs: LatLng[], options?: Polyline options) +// Instantiates a polyline object given an array of geographical points and +// optionally an options object. You can create a `Polyline` object with +// multiple separate lines (`MultiPolyline`) by passing an array of arrays +// of geographic points. +function polyline(latlngs, options) { + return new Polyline(latlngs, options); +} + +// Retrocompat. Allow plugins to support Leaflet versions before and after 1.1. +Polyline._flat = _flat; + +/* + * @class Polygon + * @aka L.Polygon + * @inherits Polyline + * + * A class for drawing polygon overlays on a map. Extends `Polyline`. + * + * Note that points you pass when creating a polygon shouldn't have an additional last point equal to the first one — it's better to filter out such points. + * + * + * @example + * + * ```js + * // create a red polygon from an array of LatLng points + * var latlngs = [[37, -109.05],[41, -109.03],[41, -102.05],[37, -102.04]]; + * + * var polygon = L.polygon(latlngs, {color: 'red'}).addTo(map); + * + * // zoom the map to the polygon + * map.fitBounds(polygon.getBounds()); + * ``` + * + * You can also pass an array of arrays of latlngs, with the first array representing the outer shape and the other arrays representing holes in the outer shape: + * + * ```js + * var latlngs = [ + * [[37, -109.05],[41, -109.03],[41, -102.05],[37, -102.04]], // outer ring + * [[37.29, -108.58],[40.71, -108.58],[40.71, -102.50],[37.29, -102.50]] // hole + * ]; + * ``` + * + * Additionally, you can pass a multi-dimensional array to represent a MultiPolygon shape. + * + * ```js + * var latlngs = [ + * [ // first polygon + * [[37, -109.05],[41, -109.03],[41, -102.05],[37, -102.04]], // outer ring + * [[37.29, -108.58],[40.71, -108.58],[40.71, -102.50],[37.29, -102.50]] // hole + * ], + * [ // second polygon + * [[41, -111.03],[45, -111.04],[45, -104.05],[41, -104.05]] + * ] + * ]; + * ``` + */ + +var Polygon = Polyline.extend({ + + options: { + fill: true + }, + + isEmpty: function () { + return !this._latlngs.length || !this._latlngs[0].length; + }, + + getCenter: function () { + // throws error when not yet added to map as this center calculation requires projected coordinates + if (!this._map) { + throw new Error('Must add layer to map before using getCenter()'); + } + + var i, j, p1, p2, f, area, x, y, center, + points = this._rings[0], + len = points.length; + + if (!len) { return null; } + + // polygon centroid algorithm; only uses the first ring if there are multiple + + area = x = y = 0; + + for (i = 0, j = len - 1; i < len; j = i++) { + p1 = points[i]; + p2 = points[j]; + + f = p1.y * p2.x - p2.y * p1.x; + x += (p1.x + p2.x) * f; + y += (p1.y + p2.y) * f; + area += f * 3; + } + + if (area === 0) { + // Polygon is so small that all points are on same pixel. + center = points[0]; + } else { + center = [x / area, y / area]; + } + return this._map.layerPointToLatLng(center); + }, + + _convertLatLngs: function (latlngs) { + var result = Polyline.prototype._convertLatLngs.call(this, latlngs), + len = result.length; + + // remove last point if it equals first one + if (len >= 2 && result[0] instanceof LatLng && result[0].equals(result[len - 1])) { + result.pop(); + } + return result; + }, + + _setLatLngs: function (latlngs) { + Polyline.prototype._setLatLngs.call(this, latlngs); + if (isFlat(this._latlngs)) { + this._latlngs = [this._latlngs]; + } + }, + + _defaultShape: function () { + return isFlat(this._latlngs[0]) ? this._latlngs[0] : this._latlngs[0][0]; + }, + + _clipPoints: function () { + // polygons need a different clipping algorithm so we redefine that + + var bounds = this._renderer._bounds, + w = this.options.weight, + p = new Point(w, w); + + // increase clip padding by stroke width to avoid stroke on clip edges + bounds = new Bounds(bounds.min.subtract(p), bounds.max.add(p)); + + this._parts = []; + if (!this._pxBounds || !this._pxBounds.intersects(bounds)) { + return; + } + + if (this.options.noClip) { + this._parts = this._rings; + return; + } + + for (var i = 0, len = this._rings.length, clipped; i < len; i++) { + clipped = clipPolygon(this._rings[i], bounds, true); + if (clipped.length) { + this._parts.push(clipped); + } + } + }, + + _updatePath: function () { + this._renderer._updatePoly(this, true); + }, + + // Needed by the `Canvas` renderer for interactivity + _containsPoint: function (p) { + var inside = false, + part, p1, p2, i, j, k, len, len2; + + if (!this._pxBounds || !this._pxBounds.contains(p)) { return false; } + + // ray casting algorithm for detecting if point is in polygon + for (i = 0, len = this._parts.length; i < len; i++) { + part = this._parts[i]; + + for (j = 0, len2 = part.length, k = len2 - 1; j < len2; k = j++) { + p1 = part[j]; + p2 = part[k]; + + if (((p1.y > p.y) !== (p2.y > p.y)) && (p.x < (p2.x - p1.x) * (p.y - p1.y) / (p2.y - p1.y) + p1.x)) { + inside = !inside; + } + } + } + + // also check if it's on polygon stroke + return inside || Polyline.prototype._containsPoint.call(this, p, true); + } + +}); + + +// @factory L.polygon(latlngs: LatLng[], options?: Polyline options) +function polygon(latlngs, options) { + return new Polygon(latlngs, options); +} + +/* + * @class GeoJSON + * @aka L.GeoJSON + * @inherits FeatureGroup + * + * Represents a GeoJSON object or an array of GeoJSON objects. Allows you to parse + * GeoJSON data and display it on the map. Extends `FeatureGroup`. + * + * @example + * + * ```js + * L.geoJSON(data, { + * style: function (feature) { + * return {color: feature.properties.color}; + * } + * }).bindPopup(function (layer) { + * return layer.feature.properties.description; + * }).addTo(map); + * ``` + */ + +var GeoJSON = FeatureGroup.extend({ + + /* @section + * @aka GeoJSON options + * + * @option pointToLayer: Function = * + * A `Function` defining how GeoJSON points spawn Leaflet layers. It is internally + * called when data is added, passing the GeoJSON point feature and its `LatLng`. + * The default is to spawn a default `Marker`: + * ```js + * function(geoJsonPoint, latlng) { + * return L.marker(latlng); + * } + * ``` + * + * @option style: Function = * + * A `Function` defining the `Path options` for styling GeoJSON lines and polygons, + * called internally when data is added. + * The default value is to not override any defaults: + * ```js + * function (geoJsonFeature) { + * return {} + * } + * ``` + * + * @option onEachFeature: Function = * + * A `Function` that will be called once for each created `Feature`, after it has + * been created and styled. Useful for attaching events and popups to features. + * The default is to do nothing with the newly created layers: + * ```js + * function (feature, layer) {} + * ``` + * + * @option filter: Function = * + * A `Function` that will be used to decide whether to include a feature or not. + * The default is to include all features: + * ```js + * function (geoJsonFeature) { + * return true; + * } + * ``` + * Note: dynamically changing the `filter` option will have effect only on newly + * added data. It will _not_ re-evaluate already included features. + * + * @option coordsToLatLng: Function = * + * A `Function` that will be used for converting GeoJSON coordinates to `LatLng`s. + * The default is the `coordsToLatLng` static method. + * + * @option markersInheritOptions: Boolean = false + * Whether default Markers for "Point" type Features inherit from group options. + */ + + initialize: function (geojson, options) { + setOptions(this, options); + + this._layers = {}; + + if (geojson) { + this.addData(geojson); + } + }, + + // @method addData( data ): this + // Adds a GeoJSON object to the layer. + addData: function (geojson) { + var features = isArray(geojson) ? geojson : geojson.features, + i, len, feature; + + if (features) { + for (i = 0, len = features.length; i < len; i++) { + // only add this if geometry or geometries are set and not null + feature = features[i]; + if (feature.geometries || feature.geometry || feature.features || feature.coordinates) { + this.addData(feature); + } + } + return this; + } + + var options = this.options; + + if (options.filter && !options.filter(geojson)) { return this; } + + var layer = geometryToLayer(geojson, options); + if (!layer) { + return this; + } + layer.feature = asFeature(geojson); + + layer.defaultOptions = layer.options; + this.resetStyle(layer); + + if (options.onEachFeature) { + options.onEachFeature(geojson, layer); + } + + return this.addLayer(layer); + }, + + // @method resetStyle( layer? ): this + // Resets the given vector layer's style to the original GeoJSON style, useful for resetting style after hover events. + // If `layer` is omitted, the style of all features in the current layer is reset. + resetStyle: function (layer) { + if (layer === undefined) { + return this.eachLayer(this.resetStyle, this); + } + // reset any custom styles + layer.options = extend({}, layer.defaultOptions); + this._setLayerStyle(layer, this.options.style); + return this; + }, + + // @method setStyle( style ): this + // Changes styles of GeoJSON vector layers with the given style function. + setStyle: function (style) { + return this.eachLayer(function (layer) { + this._setLayerStyle(layer, style); + }, this); + }, + + _setLayerStyle: function (layer, style) { + if (layer.setStyle) { + if (typeof style === 'function') { + style = style(layer.feature); + } + layer.setStyle(style); + } + } +}); + +// @section +// There are several static functions which can be called without instantiating L.GeoJSON: + +// @function geometryToLayer(featureData: Object, options?: GeoJSON options): Layer +// Creates a `Layer` from a given GeoJSON feature. Can use a custom +// [`pointToLayer`](#geojson-pointtolayer) and/or [`coordsToLatLng`](#geojson-coordstolatlng) +// functions if provided as options. +function geometryToLayer(geojson, options) { + + var geometry = geojson.type === 'Feature' ? geojson.geometry : geojson, + coords = geometry ? geometry.coordinates : null, + layers = [], + pointToLayer = options && options.pointToLayer, + _coordsToLatLng = options && options.coordsToLatLng || coordsToLatLng, + latlng, latlngs, i, len; + + if (!coords && !geometry) { + return null; + } + + switch (geometry.type) { + case 'Point': + latlng = _coordsToLatLng(coords); + return _pointToLayer(pointToLayer, geojson, latlng, options); + + case 'MultiPoint': + for (i = 0, len = coords.length; i < len; i++) { + latlng = _coordsToLatLng(coords[i]); + layers.push(_pointToLayer(pointToLayer, geojson, latlng, options)); + } + return new FeatureGroup(layers); + + case 'LineString': + case 'MultiLineString': + latlngs = coordsToLatLngs(coords, geometry.type === 'LineString' ? 0 : 1, _coordsToLatLng); + return new Polyline(latlngs, options); + + case 'Polygon': + case 'MultiPolygon': + latlngs = coordsToLatLngs(coords, geometry.type === 'Polygon' ? 1 : 2, _coordsToLatLng); + return new Polygon(latlngs, options); + + case 'GeometryCollection': + for (i = 0, len = geometry.geometries.length; i < len; i++) { + var layer = geometryToLayer({ + geometry: geometry.geometries[i], + type: 'Feature', + properties: geojson.properties + }, options); + + if (layer) { + layers.push(layer); + } + } + return new FeatureGroup(layers); + + default: + throw new Error('Invalid GeoJSON object.'); + } +} + +function _pointToLayer(pointToLayerFn, geojson, latlng, options) { + return pointToLayerFn ? + pointToLayerFn(geojson, latlng) : + new Marker(latlng, options && options.markersInheritOptions && options); +} + +// @function coordsToLatLng(coords: Array): LatLng +// Creates a `LatLng` object from an array of 2 numbers (longitude, latitude) +// or 3 numbers (longitude, latitude, altitude) used in GeoJSON for points. +function coordsToLatLng(coords) { + return new LatLng(coords[1], coords[0], coords[2]); +} + +// @function coordsToLatLngs(coords: Array, levelsDeep?: Number, coordsToLatLng?: Function): Array +// Creates a multidimensional array of `LatLng`s from a GeoJSON coordinates array. +// `levelsDeep` specifies the nesting level (0 is for an array of points, 1 for an array of arrays of points, etc., 0 by default). +// Can use a custom [`coordsToLatLng`](#geojson-coordstolatlng) function. +function coordsToLatLngs(coords, levelsDeep, _coordsToLatLng) { + var latlngs = []; + + for (var i = 0, len = coords.length, latlng; i < len; i++) { + latlng = levelsDeep ? + coordsToLatLngs(coords[i], levelsDeep - 1, _coordsToLatLng) : + (_coordsToLatLng || coordsToLatLng)(coords[i]); + + latlngs.push(latlng); + } + + return latlngs; +} + +// @function latLngToCoords(latlng: LatLng, precision?: Number|false): Array +// Reverse of [`coordsToLatLng`](#geojson-coordstolatlng) +// Coordinates values are rounded with [`formatNum`](#util-formatnum) function. +function latLngToCoords(latlng, precision) { + latlng = toLatLng(latlng); + return latlng.alt !== undefined ? + [formatNum(latlng.lng, precision), formatNum(latlng.lat, precision), formatNum(latlng.alt, precision)] : + [formatNum(latlng.lng, precision), formatNum(latlng.lat, precision)]; +} + +// @function latLngsToCoords(latlngs: Array, levelsDeep?: Number, closed?: Boolean, precision?: Number|false): Array +// Reverse of [`coordsToLatLngs`](#geojson-coordstolatlngs) +// `closed` determines whether the first point should be appended to the end of the array to close the feature, only used when `levelsDeep` is 0. False by default. +// Coordinates values are rounded with [`formatNum`](#util-formatnum) function. +function latLngsToCoords(latlngs, levelsDeep, closed, precision) { + var coords = []; + + for (var i = 0, len = latlngs.length; i < len; i++) { + coords.push(levelsDeep ? + latLngsToCoords(latlngs[i], levelsDeep - 1, closed, precision) : + latLngToCoords(latlngs[i], precision)); + } + + if (!levelsDeep && closed) { + coords.push(coords[0]); + } + + return coords; +} + +function getFeature(layer, newGeometry) { + return layer.feature ? + extend({}, layer.feature, {geometry: newGeometry}) : + asFeature(newGeometry); +} + +// @function asFeature(geojson: Object): Object +// Normalize GeoJSON geometries/features into GeoJSON features. +function asFeature(geojson) { + if (geojson.type === 'Feature' || geojson.type === 'FeatureCollection') { + return geojson; + } + + return { + type: 'Feature', + properties: {}, + geometry: geojson + }; +} + +var PointToGeoJSON = { + toGeoJSON: function (precision) { + return getFeature(this, { + type: 'Point', + coordinates: latLngToCoords(this.getLatLng(), precision) + }); + } +}; + +// @namespace Marker +// @section Other methods +// @method toGeoJSON(precision?: Number|false): Object +// Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`. +// Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the marker (as a GeoJSON `Point` Feature). +Marker.include(PointToGeoJSON); + +// @namespace CircleMarker +// @method toGeoJSON(precision?: Number|false): Object +// Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`. +// Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the circle marker (as a GeoJSON `Point` Feature). +Circle.include(PointToGeoJSON); +CircleMarker.include(PointToGeoJSON); + + +// @namespace Polyline +// @method toGeoJSON(precision?: Number|false): Object +// Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`. +// Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the polyline (as a GeoJSON `LineString` or `MultiLineString` Feature). +Polyline.include({ + toGeoJSON: function (precision) { + var multi = !isFlat(this._latlngs); + + var coords = latLngsToCoords(this._latlngs, multi ? 1 : 0, false, precision); + + return getFeature(this, { + type: (multi ? 'Multi' : '') + 'LineString', + coordinates: coords + }); + } +}); + +// @namespace Polygon +// @method toGeoJSON(precision?: Number|false): Object +// Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`. +// Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the polygon (as a GeoJSON `Polygon` or `MultiPolygon` Feature). +Polygon.include({ + toGeoJSON: function (precision) { + var holes = !isFlat(this._latlngs), + multi = holes && !isFlat(this._latlngs[0]); + + var coords = latLngsToCoords(this._latlngs, multi ? 2 : holes ? 1 : 0, true, precision); + + if (!holes) { + coords = [coords]; + } + + return getFeature(this, { + type: (multi ? 'Multi' : '') + 'Polygon', + coordinates: coords + }); + } +}); + + +// @namespace LayerGroup +LayerGroup.include({ + toMultiPoint: function (precision) { + var coords = []; + + this.eachLayer(function (layer) { + coords.push(layer.toGeoJSON(precision).geometry.coordinates); + }); + + return getFeature(this, { + type: 'MultiPoint', + coordinates: coords + }); + }, + + // @method toGeoJSON(precision?: Number|false): Object + // Coordinates values are rounded with [`formatNum`](#util-formatnum) function with given `precision`. + // Returns a [`GeoJSON`](https://en.wikipedia.org/wiki/GeoJSON) representation of the layer group (as a GeoJSON `FeatureCollection`, `GeometryCollection`, or `MultiPoint`). + toGeoJSON: function (precision) { + + var type = this.feature && this.feature.geometry && this.feature.geometry.type; + + if (type === 'MultiPoint') { + return this.toMultiPoint(precision); + } + + var isGeometryCollection = type === 'GeometryCollection', + jsons = []; + + this.eachLayer(function (layer) { + if (layer.toGeoJSON) { + var json = layer.toGeoJSON(precision); + if (isGeometryCollection) { + jsons.push(json.geometry); + } else { + var feature = asFeature(json); + // Squash nested feature collections + if (feature.type === 'FeatureCollection') { + jsons.push.apply(jsons, feature.features); + } else { + jsons.push(feature); + } + } + } + }); + + if (isGeometryCollection) { + return getFeature(this, { + geometries: jsons, + type: 'GeometryCollection' + }); + } + + return { + type: 'FeatureCollection', + features: jsons + }; + } +}); + +// @namespace GeoJSON +// @factory L.geoJSON(geojson?: Object, options?: GeoJSON options) +// Creates a GeoJSON layer. Optionally accepts an object in +// [GeoJSON format](https://tools.ietf.org/html/rfc7946) to display on the map +// (you can alternatively add it later with `addData` method) and an `options` object. +function geoJSON(geojson, options) { + return new GeoJSON(geojson, options); +} + +// Backward compatibility. +var geoJson = geoJSON; + +/* + * @class ImageOverlay + * @aka L.ImageOverlay + * @inherits Interactive layer + * + * Used to load and display a single image over specific bounds of the map. Extends `Layer`. + * + * @example + * + * ```js + * var imageUrl = 'https://maps.lib.utexas.edu/maps/historical/newark_nj_1922.jpg', + * imageBounds = [[40.712216, -74.22655], [40.773941, -74.12544]]; + * L.imageOverlay(imageUrl, imageBounds).addTo(map); + * ``` + */ + +var ImageOverlay = Layer.extend({ + + // @section + // @aka ImageOverlay options + options: { + // @option opacity: Number = 1.0 + // The opacity of the image overlay. + opacity: 1, + + // @option alt: String = '' + // Text for the `alt` attribute of the image (useful for accessibility). + alt: '', + + // @option interactive: Boolean = false + // If `true`, the image overlay will emit [mouse events](#interactive-layer) when clicked or hovered. + interactive: false, + + // @option crossOrigin: Boolean|String = false + // Whether the crossOrigin attribute will be added to the image. + // If a String is provided, the image will have its crossOrigin attribute set to the String provided. This is needed if you want to access image pixel data. + // Refer to [CORS Settings](https://developer.mozilla.org/en-US/docs/Web/HTML/CORS_settings_attributes) for valid String values. + crossOrigin: false, + + // @option errorOverlayUrl: String = '' + // URL to the overlay image to show in place of the overlay that failed to load. + errorOverlayUrl: '', + + // @option zIndex: Number = 1 + // The explicit [zIndex](https://developer.mozilla.org/docs/Web/CSS/CSS_Positioning/Understanding_z_index) of the overlay layer. + zIndex: 1, + + // @option className: String = '' + // A custom class name to assign to the image. Empty by default. + className: '' + }, + + initialize: function (url, bounds, options) { // (String, LatLngBounds, Object) + this._url = url; + this._bounds = toLatLngBounds(bounds); + + setOptions(this, options); + }, + + onAdd: function () { + if (!this._image) { + this._initImage(); + + if (this.options.opacity < 1) { + this._updateOpacity(); + } + } + + if (this.options.interactive) { + addClass(this._image, 'leaflet-interactive'); + this.addInteractiveTarget(this._image); + } + + this.getPane().appendChild(this._image); + this._reset(); + }, + + onRemove: function () { + remove(this._image); + if (this.options.interactive) { + this.removeInteractiveTarget(this._image); + } + }, + + // @method setOpacity(opacity: Number): this + // Sets the opacity of the overlay. + setOpacity: function (opacity) { + this.options.opacity = opacity; + + if (this._image) { + this._updateOpacity(); + } + return this; + }, + + setStyle: function (styleOpts) { + if (styleOpts.opacity) { + this.setOpacity(styleOpts.opacity); + } + return this; + }, + + // @method bringToFront(): this + // Brings the layer to the top of all overlays. + bringToFront: function () { + if (this._map) { + toFront(this._image); + } + return this; + }, + + // @method bringToBack(): this + // Brings the layer to the bottom of all overlays. + bringToBack: function () { + if (this._map) { + toBack(this._image); + } + return this; + }, + + // @method setUrl(url: String): this + // Changes the URL of the image. + setUrl: function (url) { + this._url = url; + + if (this._image) { + this._image.src = url; + } + return this; + }, + + // @method setBounds(bounds: LatLngBounds): this + // Update the bounds that this ImageOverlay covers + setBounds: function (bounds) { + this._bounds = toLatLngBounds(bounds); + + if (this._map) { + this._reset(); + } + return this; + }, + + getEvents: function () { + var events = { + zoom: this._reset, + viewreset: this._reset + }; + + if (this._zoomAnimated) { + events.zoomanim = this._animateZoom; + } + + return events; + }, + + // @method setZIndex(value: Number): this + // Changes the [zIndex](#imageoverlay-zindex) of the image overlay. + setZIndex: function (value) { + this.options.zIndex = value; + this._updateZIndex(); + return this; + }, + + // @method getBounds(): LatLngBounds + // Get the bounds that this ImageOverlay covers + getBounds: function () { + return this._bounds; + }, + + // @method getElement(): HTMLElement + // Returns the instance of [`HTMLImageElement`](https://developer.mozilla.org/docs/Web/API/HTMLImageElement) + // used by this overlay. + getElement: function () { + return this._image; + }, + + _initImage: function () { + var wasElementSupplied = this._url.tagName === 'IMG'; + var img = this._image = wasElementSupplied ? this._url : create$1('img'); + + addClass(img, 'leaflet-image-layer'); + if (this._zoomAnimated) { addClass(img, 'leaflet-zoom-animated'); } + if (this.options.className) { addClass(img, this.options.className); } + + img.onselectstart = falseFn; + img.onmousemove = falseFn; + + // @event load: Event + // Fired when the ImageOverlay layer has loaded its image + img.onload = bind(this.fire, this, 'load'); + img.onerror = bind(this._overlayOnError, this, 'error'); + + if (this.options.crossOrigin || this.options.crossOrigin === '') { + img.crossOrigin = this.options.crossOrigin === true ? '' : this.options.crossOrigin; + } + + if (this.options.zIndex) { + this._updateZIndex(); + } + + if (wasElementSupplied) { + this._url = img.src; + return; + } + + img.src = this._url; + img.alt = this.options.alt; + }, + + _animateZoom: function (e) { + var scale = this._map.getZoomScale(e.zoom), + offset = this._map._latLngBoundsToNewLayerBounds(this._bounds, e.zoom, e.center).min; + + setTransform(this._image, offset, scale); + }, + + _reset: function () { + var image = this._image, + bounds = new Bounds( + this._map.latLngToLayerPoint(this._bounds.getNorthWest()), + this._map.latLngToLayerPoint(this._bounds.getSouthEast())), + size = bounds.getSize(); + + setPosition(image, bounds.min); + + image.style.width = size.x + 'px'; + image.style.height = size.y + 'px'; + }, + + _updateOpacity: function () { + setOpacity(this._image, this.options.opacity); + }, + + _updateZIndex: function () { + if (this._image && this.options.zIndex !== undefined && this.options.zIndex !== null) { + this._image.style.zIndex = this.options.zIndex; + } + }, + + _overlayOnError: function () { + // @event error: Event + // Fired when the ImageOverlay layer fails to load its image + this.fire('error'); + + var errorUrl = this.options.errorOverlayUrl; + if (errorUrl && this._url !== errorUrl) { + this._url = errorUrl; + this._image.src = errorUrl; + } + }, + + // @method getCenter(): LatLng + // Returns the center of the ImageOverlay. + getCenter: function () { + return this._bounds.getCenter(); + } +}); + +// @factory L.imageOverlay(imageUrl: String, bounds: LatLngBounds, options?: ImageOverlay options) +// Instantiates an image overlay object given the URL of the image and the +// geographical bounds it is tied to. +var imageOverlay = function (url, bounds, options) { + return new ImageOverlay(url, bounds, options); +}; + +/* + * @class VideoOverlay + * @aka L.VideoOverlay + * @inherits ImageOverlay + * + * Used to load and display a video player over specific bounds of the map. Extends `ImageOverlay`. + * + * A video overlay uses the [`