From ec6cf1aa5198e04b75c0ec72bea1bffc3df06994 Mon Sep 17 00:00:00 2001 From: Matthieu Coudron Date: Wed, 30 Mar 2022 01:54:26 +0200 Subject: [PATCH 1/4] update.py: updater vim updater We want to support plugins on other hosts than github. A more structured format will allow more features too. --- maintainers/scripts/pluginupdate.py | 187 ++++++++++++++++------------ 1 file changed, 104 insertions(+), 83 deletions(-) diff --git a/maintainers/scripts/pluginupdate.py b/maintainers/scripts/pluginupdate.py index 017e3ac758ac2..3cfdb1387053d 100644 --- a/maintainers/scripts/pluginupdate.py +++ b/maintainers/scripts/pluginupdate.py @@ -8,6 +8,7 @@ # $ nix run nixpkgs.python3Packages.flake8 -c flake8 --ignore E501,E265 update.py import argparse +import csv import functools import http import json @@ -28,7 +29,7 @@ from typing import Dict, List, Optional, Tuple, Union, Any, Callable from urllib.parse import urljoin, urlparse from tempfile import NamedTemporaryFile -from dataclasses import dataclass +from dataclasses import dataclass, asdict import git @@ -85,21 +86,30 @@ def make_request(url: str, token=None) -> urllib.request.Request: headers["Authorization"] = f"token {token}" return urllib.request.Request(url, headers=headers) + +Redirects = Dict['Repo', 'Repo'] + class Repo: def __init__( - self, uri: str, branch: str, alias: Optional[str] + self, uri: str, branch: str ) -> None: self.uri = uri '''Url to the repo''' - self.branch = branch - self.alias = alias - self.redirect: Dict[str, str] = {} + self._branch = branch + # {old_uri: new_uri} + self.redirect: Redirects = {} self.token = "dummy_token" @property def name(self): return self.uri.split('/')[-1] + @property + def branch(self): + return self._branch or "HEAD" + + def __str__(self) -> str: + return f"{self.uri}" def __repr__(self) -> str: return f"Repo({self.name}, {self.uri})" @@ -109,6 +119,7 @@ def has_submodules(self) -> bool: @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) def latest_commit(self) -> Tuple[str, datetime]: + log.debug("Latest commit") loaded = self._prefetch(None) updated = datetime.strptime(loaded['date'], "%Y-%m-%dT%H:%M:%S%z") @@ -124,6 +135,7 @@ def _prefetch(self, ref: Optional[str]): return loaded def prefetch(self, ref: Optional[str]) -> str: + print("Prefetching") loaded = self._prefetch(ref) return loaded["sha256"] @@ -137,21 +149,22 @@ def as_nix(self, plugin: "Plugin") -> str: class RepoGitHub(Repo): def __init__( - self, owner: str, repo: str, branch: str, alias: Optional[str] + self, owner: str, repo: str, branch: str ) -> None: self.owner = owner self.repo = repo self.token = None '''Url to the repo''' - super().__init__(self.url(""), branch, alias) - log.debug("Instantiating github repo %s/%s", self.owner, self.repo) + super().__init__(self.url(""), branch) + log.debug("Instantiating github repo owner=%s and repo=%s", self.owner, self.repo) @property def name(self): return self.repo def url(self, path: str) -> str: - return urljoin(f"https://github.com/{self.owner}/{self.name}/", path) + res = urljoin(f"https://github.com/{self.owner}/{self.repo}/", path) + return res @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) def has_submodules(self) -> bool: @@ -168,6 +181,7 @@ def has_submodules(self) -> bool: @retry(urllib.error.URLError, tries=4, delay=3, backoff=2) def latest_commit(self) -> Tuple[str, datetime]: commit_url = self.url(f"commits/{self.branch}.atom") + log.debug("Sending request to %s", commit_url) commit_req = make_request(commit_url, self.token) with urllib.request.urlopen(commit_req, timeout=10) as req: self._check_for_redirect(commit_url, req) @@ -191,12 +205,9 @@ def _check_for_redirect(self, url: str, req: http.client.HTTPResponse): new_owner, new_name = ( urllib.parse.urlsplit(response_url).path.strip("/").split("/")[:2] ) - end_line = "\n" if self.alias is None else f" as {self.alias}\n" - plugin_line = "{owner}/{name}" + end_line - old_plugin = plugin_line.format(owner=self.owner, name=self.name) - new_plugin = plugin_line.format(owner=new_owner, name=new_name) - self.redirect[old_plugin] = new_plugin + new_repo = RepoGitHub(owner=new_owner, repo=new_name, branch=self.branch) + self.redirect[self] = new_repo def prefetch(self, commit: str) -> str: @@ -207,9 +218,9 @@ def prefetch(self, commit: str) -> str: return sha256 def prefetch_github(self, ref: str) -> str: - data = subprocess.check_output( - ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")] - ) + cmd = ["nix-prefetch-url", "--unpack", self.url(f"archive/{ref}.tar.gz")] + log.debug("Running %s", cmd) + data = subprocess.check_output(cmd) return data.strip().decode("utf-8") def as_nix(self, plugin: "Plugin") -> str: @@ -239,21 +250,38 @@ def name(self): else: return self.alias + def __lt__(self, other): + return self.repo.name < other.repo.name + + @staticmethod + def load_from_csv(config: FetchConfig, row: Dict[str, str]) -> 'PluginDesc': + branch = row["branch"] + repo = make_repo(row['repo'], branch.strip()) + repo.token = config.github_token + return PluginDesc(repo, branch.strip(), row["alias"]) + + + @staticmethod + def load_from_string(config: FetchConfig, line: str) -> 'PluginDesc': + branch = "HEAD" + alias = None + uri = line + if " as " in uri: + uri, alias = uri.split(" as ") + alias = alias.strip() + if "@" in uri: + uri, branch = uri.split("@") + repo = make_repo(uri.strip(), branch.strip()) + repo.token = config.github_token + return PluginDesc(repo, branch.strip(), alias) +@dataclass class Plugin: - def __init__( - self, - name: str, - commit: str, - has_submodules: bool, - sha256: str, - date: Optional[datetime] = None, - ) -> None: - self.name = name - self.commit = commit - self.has_submodules = has_submodules - self.sha256 = sha256 - self.date = date + name: str + commit: str + has_submodules: bool + sha256: str + date: Optional[datetime] = None @property def normalized_name(self) -> str: @@ -270,6 +298,17 @@ def as_json(self) -> Dict[str, str]: return copy +def load_plugins_from_csv(config: FetchConfig, input_file: Path,) -> List[PluginDesc]: + log.debug("Load plugins from csv %s", input_file) + plugins = [] + with open(input_file, newline='') as csvfile: + log.debug("Writing into %s", input_file) + reader = csv.DictReader(csvfile,) + for line in reader: + plugin = PluginDesc.load_from_csv(config, line) + plugins.append(plugin) + + return plugins class Editor: """The configuration of the update script.""" @@ -298,14 +337,8 @@ def get_current_plugins(self): return get_current_plugins(self) def load_plugin_spec(self, config: FetchConfig, plugin_file) -> List[PluginDesc]: - plugins = [] - with open(plugin_file) as f: - for line in f: - if line.startswith("#"): - continue - plugin = parse_plugin_line(config, line) - plugins.append(plugin) - return plugins + '''CSV spec''' + return load_plugins_from_csv(config, plugin_file) def generate_nix(self, plugins, outfile: str): '''Returns nothing for now, writes directly to outfile''' @@ -316,11 +349,11 @@ def get_update(self, input_file: str, outfile: str, config: FetchConfig): _prefetch = functools.partial(prefetch, cache=cache) def update() -> dict: - plugin_names = self.load_plugin_spec(config, input_file) + plugins = self.load_plugin_spec(config, input_file) try: pool = Pool(processes=config.proc) - results = pool.map(_prefetch, plugin_names) + results = pool.map(_prefetch, plugins) finally: cache.store() @@ -423,6 +456,7 @@ def get_current_plugins(editor: Editor) -> List[Plugin]: data = json.loads(out) plugins = [] for name, attr in data.items(): + print("get_current_plugins: name %s" % name) p = Plugin(name, attr["rev"], attr["submodules"], attr["sha256"]) plugins.append(p) return plugins @@ -431,7 +465,7 @@ def get_current_plugins(editor: Editor) -> List[Plugin]: def prefetch_plugin( p: PluginDesc, cache: "Optional[Cache]" = None, -) -> Tuple[Plugin, Dict[str, str]]: +) -> Tuple[Plugin, Redirects]: repo, branch, alias = p.repo, p.branch, p.alias name = alias or p.repo.name commit = None @@ -454,11 +488,6 @@ def prefetch_plugin( ) -def fetch_plugin_from_pluginline(config: FetchConfig, plugin_line: str) -> Plugin: - plugin, _ = prefetch_plugin(parse_plugin_line(config, plugin_line)) - return plugin - - def print_download_error(plugin: str, ex: Exception): print(f"{plugin}: {ex}", file=sys.stderr) ex_traceback = ex.__traceback__ @@ -468,14 +497,14 @@ def print_download_error(plugin: str, ex: Exception): ] print("\n".join(tb_lines)) - def check_results( - results: List[Tuple[PluginDesc, Union[Exception, Plugin], Dict[str, str]]] -) -> Tuple[List[Tuple[PluginDesc, Plugin]], Dict[str, str]]: + results: List[Tuple[PluginDesc, Union[Exception, Plugin], Redirects]] +) -> Tuple[List[Tuple[PluginDesc, Plugin]], Redirects]: ''' ''' failures: List[Tuple[str, Exception]] = [] plugins = [] - redirects: Dict[str, str] = {} + # {old: new} plugindesc + redirects: Dict[Repo, Repo] = {} for (pdesc, result, redirect) in results: if isinstance(result, Exception): failures.append((pdesc.name, result)) @@ -495,31 +524,17 @@ def check_results( sys.exit(1) -def make_repo(uri, branch, alias) -> Repo: +def make_repo(uri: str, branch) -> Repo: '''Instantiate a Repo with the correct specialization depending on server (gitub spec)''' # dumb check to see if it's of the form owner/repo (=> github) or https://... - res = uri.split('/') - if len(res) <= 2: - repo = RepoGitHub(res[0], res[1], branch, alias) + res = urlparse(uri) + if res.netloc in [ "github.com", ""]: + res = res.path.strip('/').split('/') + repo = RepoGitHub(res[0], res[1], branch) else: - repo = Repo(uri.strip(), branch, alias) + repo = Repo(uri.strip(), branch) return repo -def parse_plugin_line(config: FetchConfig, line: str) -> PluginDesc: - branch = "HEAD" - alias = None - uri = line - if " as " in uri: - uri, alias = uri.split(" as ") - alias = alias.strip() - if "@" in uri: - uri, branch = uri.split("@") - - repo = make_repo(uri.strip(), branch.strip(), alias) - repo.token = config.github_token - - return PluginDesc(repo, branch.strip(), alias) - def get_cache_path(cache_file_name: str) -> Optional[Path]: xdg_cache = os.environ.get("XDG_CACHE_HOME", None) @@ -585,27 +600,27 @@ def prefetch( return (pluginDesc, e, {}) + def rewrite_input( config: FetchConfig, input_file: Path, deprecated: Path, - redirects: Dict[str, str] = None, - append: Tuple = (), + # old pluginDesc and the new + redirects: Dict[PluginDesc, PluginDesc] = {}, + append: List[PluginDesc] = [], ): - with open(input_file, "r") as f: - lines = f.readlines() + plugins = load_plugins_from_csv(config, input_file,) - lines.extend(append) + plugins.extend(append) if redirects: - lines = [redirects.get(line, line) for line in lines] cur_date_iso = datetime.now().strftime("%Y-%m-%d") with open(deprecated, "r") as f: deprecations = json.load(f) for old, new in redirects.items(): - old_plugin = fetch_plugin_from_pluginline(config, old) - new_plugin = fetch_plugin_from_pluginline(config, new) + old_plugin, _ = prefetch_plugin(old) + new_plugin, _ = prefetch_plugin(new) if old_plugin.normalized_name != new_plugin.normalized_name: deprecations[old_plugin.normalized_name] = { "new": new_plugin.normalized_name, @@ -615,10 +630,14 @@ def rewrite_input( json.dump(deprecations, f, indent=4, sort_keys=True) f.write("\n") - lines = sorted(lines, key=str.casefold) - with open(input_file, "w") as f: - f.writelines(lines) + log.debug("Writing into %s", input_file) + # fields = dataclasses.fields(PluginDesc) + fieldnames = ['repo', 'branch', 'alias'] + writer = csv.DictWriter(f, fieldnames, dialect='unix', quoting=csv.QUOTE_NONE) + writer.writeheader() + for plugin in sorted(plugins): + writer.writerow(asdict(plugin)) def commit(repo: git.Repo, message: str, files: List[Path]) -> None: @@ -660,9 +679,11 @@ def update_plugins(editor: Editor, args): ) for plugin_line in args.add_plugins: - editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, append=(plugin_line + "\n",)) + pdesc = PluginDesc.load_from_string(fetch_config, plugin_line) + append = [ pdesc ] + editor.rewrite_input(fetch_config, args.input_file, editor.deprecated, append=append) update() - plugin = fetch_plugin_from_pluginline(fetch_config, plugin_line) + plugin, _ = prefetch_plugin(pdesc, ) if autocommit: commit( nixpkgs_repo, From 69daee82431f5ea0d5b3635538b155dd136cdf2b Mon Sep 17 00:00:00 2001 From: Matthieu Coudron Date: Sat, 2 Apr 2022 18:13:21 +0200 Subject: [PATCH 2/4] kakounePlugins: update --- .../kakoune/plugins/kakoune-plugin-names | 39 ++++++++++--------- 1 file changed, 20 insertions(+), 19 deletions(-) diff --git a/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names b/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names index 6cf7d30f27492..a6cae7a4505b3 100644 --- a/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names +++ b/pkgs/applications/editors/kakoune/plugins/kakoune-plugin-names @@ -1,19 +1,20 @@ -alexherbo2/auto-pairs.kak -alexherbo2/replace-mode.kak -alexherbo2/sleuth.kak -andreyorst/fzf.kak -andreyorst/powerline.kak -basbebe/pandoc.kak -danr/kakoune-easymotion -Delapouite/kakoune-buffers -Delapouite/kakoune-registers -enricozb/tabs.kak@main -greenfork/active-window.kak -kakoune-editor/kakoune-extra-filetypes -kakounedotcom/connect.kak -kakounedotcom/prelude.kak -lePerdu/kakboard -listentolist/kakoune-rainbow -mayjs/openscad.kak -occivink/kakoune-buffer-switcher -occivink/kakoune-vertical-selection +repo,branch,alias +alexherbo2/auto-pairs.kak,, +alexherbo2/replace-mode.kak,, +alexherbo2/sleuth.kak,, +andreyorst/fzf.kak,, +andreyorst/powerline.kak,, +basbebe/pandoc.kak,, +danr/kakoune-easymotion,, +Delapouite/kakoune-buffers,, +Delapouite/kakoune-registers,, +enricozb/tabs.kak@main,, +greenfork/active-window.kak,, +kakoune-editor/kakoune-extra-filetypes,, +kakounedotcom/connect.kak,, +kakounedotcom/prelude.kak,, +lePerdu/kakboard,, +listentolist/kakoune-rainbow,, +mayjs/openscad.kak,, +occivink/kakoune-buffer-switcher,, +occivink/kakoune-vertical-selection,, From d525753eacb49512a13d61db7d273472c368956d Mon Sep 17 00:00:00 2001 From: Matthieu Coudron Date: Sat, 2 Apr 2022 17:58:02 +0200 Subject: [PATCH 3/4] vimPlugins: update vimPlugins: update vimPlugins: update --- .../editors/vim/plugins/generated.nix | 1791 +++++++-------- .../editors/vim/plugins/vim-plugin-names | 2022 +++++++++-------- 2 files changed, 1913 insertions(+), 1900 deletions(-) diff --git a/pkgs/applications/editors/vim/plugins/generated.nix b/pkgs/applications/editors/vim/plugins/generated.nix index 92578520b98ec..c62140c66a1ae 100644 --- a/pkgs/applications/editors/vim/plugins/generated.nix +++ b/pkgs/applications/editors/vim/plugins/generated.nix @@ -3,6 +3,451 @@ final: prev: { + BetterLua-vim = buildVimPluginFrom2Nix { + pname = "BetterLua.vim"; + version = "2020-08-14"; + src = fetchFromGitHub { + owner = "euclidianAce"; + repo = "BetterLua.vim"; + rev = "d2d6c115575d09258a794a6f20ac60233eee59d5"; + sha256 = "1rvlx21kw8865dg6q97hx9i2s1n8mn1nyhn0m7dkx625pghsx3js"; + }; + meta.homepage = "https://github.com/euclidianAce/BetterLua.vim/"; + }; + + BufOnly-vim = buildVimPluginFrom2Nix { + pname = "BufOnly.vim"; + version = "2010-10-18"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "BufOnly.vim"; + rev = "43dd92303979bdb234a3cb2f5662847f7a3affe7"; + sha256 = "1gvpaqvvxjma0dl1zai68bpv42608api4054appwkw9pgczkkcdl"; + }; + meta.homepage = "https://github.com/vim-scripts/BufOnly.vim/"; + }; + + CheckAttach = buildVimPluginFrom2Nix { + pname = "CheckAttach"; + version = "2019-05-08"; + src = fetchFromGitHub { + owner = "chrisbra"; + repo = "CheckAttach"; + rev = "8f0b1350431d1d34655a147e6f1cfe6cb5dda5f7"; + sha256 = "1z9a40nbdjd3pnp28nfsi2bijsbaiphc0ia816f5flkchn07gmmj"; + }; + meta.homepage = "https://github.com/chrisbra/CheckAttach/"; + }; + + Colour-Sampler-Pack = buildVimPluginFrom2Nix { + pname = "Colour-Sampler-Pack"; + version = "2012-11-30"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "Colour-Sampler-Pack"; + rev = "05cded87b2ef29aaa9e930230bb88e23abff4441"; + sha256 = "03v2r18sfgs0xbgy9p56pxfdg0lsk6m7wyr5hw63wm1nzpwiipg3"; + }; + meta.homepage = "https://github.com/vim-scripts/Colour-Sampler-Pack/"; + }; + + Coqtail = buildVimPluginFrom2Nix { + pname = "Coqtail"; + version = "2022-03-28"; + src = fetchFromGitHub { + owner = "whonore"; + repo = "Coqtail"; + rev = "cb8f43b2f09f3d41e2821e458901666a82a61298"; + sha256 = "0h5r0r7hh4g7p874l7fajq30k4z3a88vm3db6583q611h9bwcfrf"; + }; + meta.homepage = "https://github.com/whonore/Coqtail/"; + }; + + DoxygenToolkit-vim = buildVimPluginFrom2Nix { + pname = "DoxygenToolkit.vim"; + version = "2010-11-06"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "DoxygenToolkit.vim"; + rev = "afd8663d36d2ec19d26befdb10e89e912d26bbd3"; + sha256 = "1za8li02j4nhqjjsyxg4p78638h5af4izim37zc0p1x55zr3i85r"; + }; + meta.homepage = "https://github.com/vim-scripts/DoxygenToolkit.vim/"; + }; + + FTerm-nvim = buildVimPluginFrom2Nix { + pname = "FTerm.nvim"; + version = "2022-03-13"; + src = fetchFromGitHub { + owner = "numToStr"; + repo = "FTerm.nvim"; + rev = "233633a5f6fe8398187a4eba93eba0828ef3d5f3"; + sha256 = "0sxnii921xia4mrf67qz7ichi9xqr9zf193hb9dx199l7hl6k1p8"; + }; + meta.homepage = "https://github.com/numToStr/FTerm.nvim/"; + }; + + FixCursorHold-nvim = buildVimPluginFrom2Nix { + pname = "FixCursorHold.nvim"; + version = "2022-02-17"; + src = fetchFromGitHub { + owner = "antoinemadec"; + repo = "FixCursorHold.nvim"; + rev = "1bfb32e7ba1344925ad815cb0d7f901dbc0ff7c1"; + sha256 = "0b1iffk6pa2zwd9fvlgqli72r8qj74b7hqkhlw6awhc7r1qj8m1q"; + }; + meta.homepage = "https://github.com/antoinemadec/FixCursorHold.nvim/"; + }; + + Improved-AnsiEsc = buildVimPluginFrom2Nix { + pname = "Improved-AnsiEsc"; + version = "2015-08-26"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "Improved-AnsiEsc"; + rev = "e1c59a8e9203fab6b9150721f30548916da73351"; + sha256 = "1smjs4kz2kmzprzp9az4957675nakb43146hshbby39j5xz4jsbz"; + }; + meta.homepage = "https://github.com/vim-scripts/Improved-AnsiEsc/"; + }; + + Jenkinsfile-vim-syntax = buildVimPluginFrom2Nix { + pname = "Jenkinsfile-vim-syntax"; + version = "2021-01-26"; + src = fetchFromGitHub { + owner = "martinda"; + repo = "Jenkinsfile-vim-syntax"; + rev = "0d05729168ea44d60862f17cffa80024ab30bcc9"; + sha256 = "05z30frs4f5z0l4qgxk08r7mb19bzhqs36hi213yin78cz62b9gy"; + }; + meta.homepage = "https://github.com/martinda/Jenkinsfile-vim-syntax/"; + }; + + LanguageClient-neovim = buildVimPluginFrom2Nix { + pname = "LanguageClient-neovim"; + version = "2020-12-10"; + src = fetchFromGitHub { + owner = "autozimu"; + repo = "LanguageClient-neovim"; + rev = "a42594c9c320b1283e9b9058b85a8097d8325fed"; + sha256 = "0lj9na3g2cl0vj56jz8rhz9lm2d3xps5glk8ds491i2ixy4vdm37"; + }; + meta.homepage = "https://github.com/autozimu/LanguageClient-neovim/"; + }; + + LanguageTool-nvim = buildVimPluginFrom2Nix { + pname = "LanguageTool.nvim"; + version = "2020-10-19"; + src = fetchFromGitHub { + owner = "vigoux"; + repo = "LanguageTool.nvim"; + rev = "809e7d77fec834597f495fec737c59292a10025b"; + sha256 = "1g12dz85xq8qd92dgna0a3w6zgxa74njlvmvly4k20610r63bzrn"; + }; + meta.homepage = "https://github.com/vigoux/LanguageTool.nvim/"; + }; + + LeaderF = buildVimPluginFrom2Nix { + pname = "LeaderF"; + version = "2022-04-03"; + src = fetchFromGitHub { + owner = "Yggdroot"; + repo = "LeaderF"; + rev = "cc21177618270255e4181dfa1ade52abebb71c23"; + sha256 = "0i1dgvn3s0d4k84avb4yz28hm05v3n0krq9clizxg8vi24g58lci"; + }; + meta.homepage = "https://github.com/Yggdroot/LeaderF/"; + }; + + MatchTagAlways = buildVimPluginFrom2Nix { + pname = "MatchTagAlways"; + version = "2017-05-20"; + src = fetchFromGitHub { + owner = "Valloric"; + repo = "MatchTagAlways"; + rev = "352eb479a4ad1608e0880b79ab2357aac2cf4bed"; + sha256 = "0y8gq4cs0wm2ijagc2frpmm664z355iridxyl5893576v5aqp8z1"; + }; + meta.homepage = "https://github.com/Valloric/MatchTagAlways/"; + }; + + Navigator-nvim = buildVimPluginFrom2Nix { + pname = "Navigator.nvim"; + version = "2022-03-28"; + src = fetchFromGitHub { + owner = "numToStr"; + repo = "Navigator.nvim"; + rev = "6c50f278482dc5388743cb5c6eddb146059252f9"; + sha256 = "1qr2blrr6ihr1adld1cyc98b64s2s4y2876bmlbxg4q17y1zv3l6"; + }; + meta.homepage = "https://github.com/numToStr/Navigator.nvim/"; + }; + + NeoSolarized = buildVimPluginFrom2Nix { + pname = "NeoSolarized"; + version = "2020-08-07"; + src = fetchFromGitHub { + owner = "overcache"; + repo = "NeoSolarized"; + rev = "b94b1a9ad51e2de015266f10fdc6e142f97bd617"; + sha256 = "019nz56yirpg1ahg8adfafrxznalw056qwm3xjm9kzg6da8j6v48"; + }; + meta.homepage = "https://github.com/overcache/NeoSolarized/"; + }; + + NrrwRgn = buildVimPluginFrom2Nix { + pname = "NrrwRgn"; + version = "2022-02-13"; + src = fetchFromGitHub { + owner = "chrisbra"; + repo = "NrrwRgn"; + rev = "e027db9d94f94947153cd7b5ac9abd04371ab2b0"; + sha256 = "0mcwyqbfc2m865w44s96ra2k0v1mn5kkkxf8i71iqhvc7fvnrfah"; + }; + meta.homepage = "https://github.com/chrisbra/NrrwRgn/"; + }; + + PreserveNoEOL = buildVimPluginFrom2Nix { + pname = "PreserveNoEOL"; + version = "2013-06-14"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "PreserveNoEOL"; + rev = "940e3ce90e54d8680bec1135a21dcfbd6c9bfb62"; + sha256 = "1726jpr2zf6jrb00pp082ikbx4mll3a877pnzs6i18f9fgpaqqgd"; + }; + meta.homepage = "https://github.com/vim-scripts/PreserveNoEOL/"; + }; + + QFEnter = buildVimPluginFrom2Nix { + pname = "QFEnter"; + version = "2020-10-09"; + src = fetchFromGitHub { + owner = "yssl"; + repo = "QFEnter"; + rev = "df0a75b287c210f98ae353a12bbfdaf73d858beb"; + sha256 = "0gdp7nmjlp8ng2rp2v66d8bincnkwrqqpbggb079f0f9szrqlp54"; + }; + meta.homepage = "https://github.com/yssl/QFEnter/"; + }; + + Recover-vim = buildVimPluginFrom2Nix { + pname = "Recover.vim"; + version = "2015-08-14"; + src = fetchFromGitHub { + owner = "chrisbra"; + repo = "Recover.vim"; + rev = "efa491f6121f65e025f42d79a93081abb8db69d4"; + sha256 = "17szim82bwnhf9q4n0n4jfmqkmhq6p0lh0j4y77a2x6lkn0pns5s"; + }; + meta.homepage = "https://github.com/chrisbra/Recover.vim/"; + }; + + Rename = buildVimPluginFrom2Nix { + pname = "Rename"; + version = "2011-08-31"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "Rename"; + rev = "b240f28d2ede65fa77cd99fe045efe79202f7a34"; + sha256 = "1d1myg4zyc281zcc1ba9idbgcgxndb4a0jwqr4yqxhhzdgszw46r"; + }; + meta.homepage = "https://github.com/vim-scripts/Rename/"; + }; + + ReplaceWithRegister = buildVimPluginFrom2Nix { + pname = "ReplaceWithRegister"; + version = "2014-10-31"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "ReplaceWithRegister"; + rev = "832efc23111d19591d495dc72286de2fb0b09345"; + sha256 = "0mb0sx85j1k59b1zz95r4vkq4kxlb4krhncq70mq7fxrs5bnhq8g"; + }; + meta.homepage = "https://github.com/vim-scripts/ReplaceWithRegister/"; + }; + + SchemaStore-nvim = buildVimPluginFrom2Nix { + pname = "SchemaStore.nvim"; + version = "2022-04-01"; + src = fetchFromGitHub { + owner = "b0o"; + repo = "SchemaStore.nvim"; + rev = "d423f6c7bbf85c701ce0ce5cfd0f3f340e9419d1"; + sha256 = "0mcx09j6b6x7f85m5nhv8h9r2p4h92cv4jh94p4j2w0byh6pfz9b"; + }; + meta.homepage = "https://github.com/b0o/SchemaStore.nvim/"; + }; + + Shade-nvim = buildVimPluginFrom2Nix { + pname = "Shade.nvim"; + version = "2022-02-01"; + src = fetchFromGitHub { + owner = "sunjon"; + repo = "Shade.nvim"; + rev = "4286b5abc47d62d0c9ffb22a4f388b7bf2ac2461"; + sha256 = "0mb0cnf8065qmjq85hlgb4a1mqk1nwl7966l1imb54hpzw828rzl"; + }; + meta.homepage = "https://github.com/sunjon/Shade.nvim/"; + }; + + ShowMultiBase = buildVimPluginFrom2Nix { + pname = "ShowMultiBase"; + version = "2010-10-18"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "ShowMultiBase"; + rev = "85a39fd12668ce973d3d9282263912b2b8f0d338"; + sha256 = "0hg5352ahzgh2kwqha5v8ai024fld93xag93hb53wjf5b8nzsz8i"; + }; + meta.homepage = "https://github.com/vim-scripts/ShowMultiBase/"; + }; + + SimpylFold = buildVimPluginFrom2Nix { + pname = "SimpylFold"; + version = "2021-11-04"; + src = fetchFromGitHub { + owner = "tmhedberg"; + repo = "SimpylFold"; + rev = "b4a87e509c3d873238a39d1c85d0b97d6819f283"; + sha256 = "0ff5x7ay67wn9c0mi8sb6110i93zrf97c4whg0bd7pr2nmadpvk0"; + }; + meta.homepage = "https://github.com/tmhedberg/SimpylFold/"; + }; + + SpaceCamp = buildVimPluginFrom2Nix { + pname = "SpaceCamp"; + version = "2021-04-07"; + src = fetchFromGitHub { + owner = "jaredgorski"; + repo = "SpaceCamp"; + rev = "376af5c2204de61726ea86b596acb2dab9795e1f"; + sha256 = "0h3wxkswd5z9y46d6272sr210i73j5pwf5faw7qhr1plilfgx4gb"; + }; + meta.homepage = "https://github.com/jaredgorski/SpaceCamp/"; + }; + + SpaceVim = buildVimPluginFrom2Nix { + pname = "SpaceVim"; + version = "2022-04-03"; + src = fetchFromGitHub { + owner = "SpaceVim"; + repo = "SpaceVim"; + rev = "bc5e24c6932f5cdb56520c6fc7e3807cae919fdf"; + sha256 = "1iz477kmmvw16mxq7mcaqiznqc42p7qiz2dp6bb474c9mp1b3c4a"; + }; + meta.homepage = "https://github.com/SpaceVim/SpaceVim/"; + }; + + Spacegray-vim = buildVimPluginFrom2Nix { + pname = "Spacegray.vim"; + version = "2021-07-06"; + src = fetchFromGitHub { + owner = "ackyshake"; + repo = "Spacegray.vim"; + rev = "c699ca10ed421c462bd1c87a158faaa570dc8e28"; + sha256 = "0ma8w6p5jh6llka49x5j5ql8fmhv0bx5hhsn5b2phak79yqg1k61"; + }; + meta.homepage = "https://github.com/ackyshake/Spacegray.vim/"; + }; + + SudoEdit-vim = buildVimPluginFrom2Nix { + pname = "SudoEdit.vim"; + version = "2020-02-27"; + src = fetchFromGitHub { + owner = "chrisbra"; + repo = "SudoEdit.vim"; + rev = "e203eada5b563e9134ce2aae26b09edae0904fd7"; + sha256 = "0pf9iix50pw3p430ky51rv11ra1hppdpwa5flzcd5kciybr76n0n"; + }; + meta.homepage = "https://github.com/chrisbra/SudoEdit.vim/"; + }; + + TrueZen-nvim = buildVimPluginFrom2Nix { + pname = "TrueZen.nvim"; + version = "2021-10-12"; + src = fetchFromGitHub { + owner = "Pocco81"; + repo = "TrueZen.nvim"; + rev = "508b977d71650da5c9243698614a9a1416f116d4"; + sha256 = "0sr4y1mg83l28l5ias2pv0gxkcgwailfjn2skx35z63f2il3zkbx"; + }; + meta.homepage = "https://github.com/Pocco81/TrueZen.nvim/"; + }; + + VimCompletesMe = buildVimPluginFrom2Nix { + pname = "VimCompletesMe"; + version = "2022-02-18"; + src = fetchFromGitHub { + owner = "ackyshake"; + repo = "VimCompletesMe"; + rev = "9adf692d7ae6424038458a89d4a411f0a27d1388"; + sha256 = "1sndgb3291dyifaa8adri2mb8cgbinbar3nw1fnf67k9ahwycaz0"; + }; + meta.homepage = "https://github.com/ackyshake/VimCompletesMe/"; + }; + + VimOrganizer = buildVimPluginFrom2Nix { + pname = "VimOrganizer"; + version = "2020-12-15"; + src = fetchFromGitHub { + owner = "hsitz"; + repo = "VimOrganizer"; + rev = "09636aed78441a9de2767fcef6d7c567f322cc40"; + sha256 = "0phpcxmyz562yyp88rbx9pqg46w8r1lyapb700nvxwvqkcd82pfw"; + }; + meta.homepage = "https://github.com/hsitz/VimOrganizer/"; + }; + + Vundle-vim = buildVimPluginFrom2Nix { + pname = "Vundle.vim"; + version = "2019-08-17"; + src = fetchFromGitHub { + owner = "VundleVim"; + repo = "Vundle.vim"; + rev = "b255382d6242d7ea3877bf059d2934125e0c4d95"; + sha256 = "0fkmklcq3fgvd6x6irz9bgyvcdaxafykk3k89gsi9p6b0ikw3rw6"; + }; + meta.homepage = "https://github.com/VundleVim/Vundle.vim/"; + }; + + YUNOcommit-vim = buildVimPluginFrom2Nix { + pname = "YUNOcommit.vim"; + version = "2014-11-26"; + src = fetchFromGitHub { + owner = "esneider"; + repo = "YUNOcommit.vim"; + rev = "981082055a73ef076d7e27477874d2303153a448"; + sha256 = "0mjc7fn405vcx1n7vadl98p5wgm6jxrlbdbkqgjq8f1m1ir81zab"; + }; + meta.homepage = "https://github.com/esneider/YUNOcommit.vim/"; + }; + + YankRing-vim = buildVimPluginFrom2Nix { + pname = "YankRing.vim"; + version = "2015-07-29"; + src = fetchFromGitHub { + owner = "vim-scripts"; + repo = "YankRing.vim"; + rev = "28854abef8fa4ebd3cb219aefcf22566997d8f65"; + sha256 = "0zdp8pdsqgrh6lfw8ipjhrig6psvmdxkim9ik801y3r373sk2hxw"; + }; + meta.homepage = "https://github.com/vim-scripts/YankRing.vim/"; + }; + + YouCompleteMe = buildVimPluginFrom2Nix { + pname = "YouCompleteMe"; + version = "2022-04-02"; + src = fetchFromGitHub { + owner = "ycm-core"; + repo = "YouCompleteMe"; + rev = "3ededaed2f9923d50bf3860ba8dace0f7d2724cd"; + sha256 = "1n2h5wsp9vclsvzr40m1ffb6kjmcg0mccfj790giw77qa2i9s1rl"; + fetchSubmodules = true; + }; + meta.homepage = "https://github.com/ycm-core/YouCompleteMe/"; + }; + a-vim = buildVimPluginFrom2Nix { pname = "a.vim"; version = "2010-11-06"; @@ -41,12 +486,12 @@ final: prev: aerial-nvim = buildVimPluginFrom2Nix { pname = "aerial.nvim"; - version = "2022-03-24"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "stevearc"; repo = "aerial.nvim"; - rev = "b9f6067529ef123b8ace705ea356869f66aad320"; - sha256 = "1wcdshvq2nw1dx8xxzplvq519bzzb3qgf7lh0sqafjd19nzgwiji"; + rev = "0f22463cc1616c0ae7a5a4ad4d81f133035e61c4"; + sha256 = "0r3my7w1pryqfvzyn32x4063y8cqlx5aps399vv4bq79y60n9rch"; }; meta.homepage = "https://github.com/stevearc/aerial.nvim/"; }; @@ -77,12 +522,12 @@ final: prev: ale = buildVimPluginFrom2Nix { pname = "ale"; - version = "2022-03-23"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "dense-analysis"; repo = "ale"; - rev = "80dcd648d389965603246c2c5a4554e3e4aa184c"; - sha256 = "1a38q83sgv13aw3iy40mjzkg1wsc5zmf5mmkjqpdcgv5aixyb8m5"; + rev = "d3df00b89803f1891a772c47fc8eda6a1e9e1baa"; + sha256 = "0cm374asrkp9nbimp73ljsvaqbc2piqyrmci8n0zshyqq1z6klk2"; }; meta.homepage = "https://github.com/dense-analysis/ale/"; }; @@ -101,12 +546,12 @@ final: prev: aniseed = buildVimPluginFrom2Nix { pname = "aniseed"; - version = "2022-03-21"; + version = "2022-03-26"; src = fetchFromGitHub { owner = "Olical"; repo = "aniseed"; - rev = "bd79727af8a21037222a08ec9bcaf1c85488aaa4"; - sha256 = "0l4hvhmf9cgw921956rh97x6aqhjzs2jxsdnk2m38a9fr738hknk"; + rev = "68ad878e7d7546b291ebff43fd53544b2f6de401"; + sha256 = "16jsvpfacks2nw4s7qk8qh1xf9jkg6hnvnryp4p2gi0s3x5rfsws"; }; meta.homepage = "https://github.com/Olical/aniseed/"; }; @@ -365,28 +810,16 @@ final: prev: better-escape-nvim = buildVimPluginFrom2Nix { pname = "better-escape.nvim"; - version = "2022-03-14"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "max397574"; repo = "better-escape.nvim"; - rev = "d2efbf0093235525e81f537f8f4e63f23acedf06"; - sha256 = "1xx23v9jgpzdhyp1diyq0vc36vlxzljx36qnax2cms36kfnc398l"; + rev = "d5ee0cef56a7e41a86048c14f25e964876ac20c1"; + sha256 = "04hi2zmaz02fiyvjs94lqn7imp20fn2vpwww37sg7gim18b1mpl4"; }; meta.homepage = "https://github.com/max397574/better-escape.nvim/"; }; - BetterLua-vim = buildVimPluginFrom2Nix { - pname = "BetterLua.vim"; - version = "2020-08-14"; - src = fetchFromGitHub { - owner = "euclidianAce"; - repo = "BetterLua.vim"; - rev = "d2d6c115575d09258a794a6f20ac60233eee59d5"; - sha256 = "1rvlx21kw8865dg6q97hx9i2s1n8mn1nyhn0m7dkx625pghsx3js"; - }; - meta.homepage = "https://github.com/euclidianAce/BetterLua.vim/"; - }; - bitbake-vim = buildVimPluginFrom2Nix { pname = "bitbake.vim"; version = "2021-02-06"; @@ -461,28 +894,16 @@ final: prev: bufferline-nvim = buildVimPluginFrom2Nix { pname = "bufferline.nvim"; - version = "2022-03-21"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "akinsho"; repo = "bufferline.nvim"; - rev = "e1202c6569353d03ef0cb3da11b839dba26854dd"; - sha256 = "1nd5pvbg0yw8jl4rn56dzhabmiwkvlzb8iv595rrkqdb2msdl4qx"; + rev = "004cd5734fb21e39d48c1fb1469fa63e2797880b"; + sha256 = "1rr69n4mpkr6ky093fxabf3dcnngam3a01zl71ylvz27lv7gphqh"; }; meta.homepage = "https://github.com/akinsho/bufferline.nvim/"; }; - BufOnly-vim = buildVimPluginFrom2Nix { - pname = "BufOnly.vim"; - version = "2010-10-18"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "BufOnly.vim"; - rev = "43dd92303979bdb234a3cb2f5662847f7a3affe7"; - sha256 = "1gvpaqvvxjma0dl1zai68bpv42608api4054appwkw9pgczkkcdl"; - }; - meta.homepage = "https://github.com/vim-scripts/BufOnly.vim/"; - }; - calendar-vim = buildVimPluginFrom2Nix { pname = "calendar.vim"; version = "2022-03-21"; @@ -507,18 +928,6 @@ final: prev: meta.homepage = "https://github.com/bkad/camelcasemotion/"; }; - catppuccin-nvim = buildVimPluginFrom2Nix { - pname = "catppuccin-nvim"; - version = "2022-03-20"; - src = fetchFromGitHub { - owner = "catppuccin"; - repo = "nvim"; - rev = "f079dda3dc23450d69b4bad11bfbd9af2c77f6f3"; - sha256 = "1w0n96fbrkm3vdl64v1yzkly8wpcn5g9qflmpb8r1ww9hhig7a38"; - }; - meta.homepage = "https://github.com/catppuccin/nvim/"; - }; - caw-vim = buildVimPluginFrom2Nix { pname = "caw.vim"; version = "2021-09-20"; @@ -531,18 +940,6 @@ final: prev: meta.homepage = "https://github.com/tyru/caw.vim/"; }; - chadtree = buildVimPluginFrom2Nix { - pname = "chadtree"; - version = "2022-03-24"; - src = fetchFromGitHub { - owner = "ms-jpq"; - repo = "chadtree"; - rev = "e9606bfa350f277d54a61742d560e6122dc4d32c"; - sha256 = "1vyg48ghr8fd15fh41pk5qlgngdqkw8gwhkkyq9hbvs2mxw8x80c"; - }; - meta.homepage = "https://github.com/ms-jpq/chadtree/"; - }; - changeColorScheme-vim = buildVimPluginFrom2Nix { pname = "changeColorScheme.vim"; version = "2010-10-18"; @@ -567,18 +964,6 @@ final: prev: meta.homepage = "https://github.com/sudormrfbin/cheatsheet.nvim/"; }; - CheckAttach = buildVimPluginFrom2Nix { - pname = "CheckAttach"; - version = "2019-05-08"; - src = fetchFromGitHub { - owner = "chrisbra"; - repo = "CheckAttach"; - rev = "8f0b1350431d1d34655a147e6f1cfe6cb5dda5f7"; - sha256 = "1z9a40nbdjd3pnp28nfsi2bijsbaiphc0ia816f5flkchn07gmmj"; - }; - meta.homepage = "https://github.com/chrisbra/CheckAttach/"; - }; - ci_dark = buildVimPluginFrom2Nix { pname = "ci_dark"; version = "2022-03-27"; @@ -821,12 +1206,12 @@ final: prev: cmp-tabnine = buildVimPluginFrom2Nix { pname = "cmp-tabnine"; - version = "2022-01-26"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "tzachar"; repo = "cmp-tabnine"; - rev = "2a051347190a22b738e9784426199b9db745e1da"; - sha256 = "1z3imhw4jgswd957aqhf1yf5dihb1k9dfd22abshziv45fb0fggy"; + rev = "a436b4af861e33ab9281a32cf0369404a3dcdf9f"; + sha256 = "0sqd98qz1ydp9wafnhmnndjx75cm06n27aq24cddnifrxp412f57"; }; meta.homepage = "https://github.com/tzachar/cmp-tabnine/"; }; @@ -881,12 +1266,12 @@ final: prev: cmp_luasnip = buildVimPluginFrom2Nix { pname = "cmp_luasnip"; - version = "2022-03-26"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "saadparwaiz1"; repo = "cmp_luasnip"; - rev = "85f2767842a35064f61128b71b8dab1e38c413c4"; - sha256 = "13s04x9vx3n854q9abb0knls5aycxigbwqgllfmp2xgaycgxqksa"; + rev = "b10829736542e7cc9291e60bab134df1273165c9"; + sha256 = "1qygdas99m7py98rqxyza88lmk2as8yi9khjac603x6anxmq766l"; }; meta.homepage = "https://github.com/saadparwaiz1/cmp_luasnip/"; }; @@ -987,18 +1372,6 @@ final: prev: meta.homepage = "https://github.com/iamcco/coc-tailwindcss/"; }; - coc-nvim = buildVimPluginFrom2Nix { - pname = "coc.nvim"; - version = "2022-03-26"; - src = fetchFromGitHub { - owner = "neoclide"; - repo = "coc.nvim"; - rev = "16e74f9b31d20b8dfc8933132beed4c175d824ea"; - sha256 = "0nrfm8517fz31qrg0gfh888q7wcbxxkbpcp39ycvwkdfxpq1bzwr"; - }; - meta.homepage = "https://github.com/neoclide/coc.nvim/"; - }; - codi-vim = buildVimPluginFrom2Nix { pname = "codi.vim"; version = "2022-03-20"; @@ -1035,18 +1408,6 @@ final: prev: meta.homepage = "https://github.com/lilydjwg/colorizer/"; }; - Colour-Sampler-Pack = buildVimPluginFrom2Nix { - pname = "Colour-Sampler-Pack"; - version = "2012-11-30"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "Colour-Sampler-Pack"; - rev = "05cded87b2ef29aaa9e930230bb88e23abff4441"; - sha256 = "03v2r18sfgs0xbgy9p56pxfdg0lsk6m7wyr5hw63wm1nzpwiipg3"; - }; - meta.homepage = "https://github.com/vim-scripts/Colour-Sampler-Pack/"; - }; - command-t = buildVimPluginFrom2Nix { pname = "command-t"; version = "2022-02-25"; @@ -1062,12 +1423,12 @@ final: prev: comment-nvim = buildVimPluginFrom2Nix { pname = "comment.nvim"; - version = "2022-03-25"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "numtostr"; repo = "comment.nvim"; - rev = "03b2a8f81102f2994f4888760e0f08385d841c3f"; - sha256 = "1ilzpdyis41p1x6wbkavjpva5hvxclagw6hjn76vpmwibnz99pfy"; + rev = "0aaea32f27315e2a99ba4c12ab9def5cbb4842e4"; + sha256 = "17vs6k71x6j6gzs1xhsvsmwh2lvpvwgshi2axg9b6ad20wv2v4dr"; }; meta.homepage = "https://github.com/numtostr/comment.nvim/"; }; @@ -1206,12 +1567,12 @@ final: prev: conjure = buildVimPluginFrom2Nix { pname = "conjure"; - version = "2022-02-15"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "Olical"; repo = "conjure"; - rev = "6c53d863c0843be0f68a138def146d6b8f725b22"; - sha256 = "1f5z99ac72433f2nj714fk6xd76mq7yr5i5z1afwgrhx61zbwn5h"; + rev = "0c85b2ecce542ce8ee336bf01f433950cf51f31e"; + sha256 = "15nqxzf2q8iwkc3b09crd66cb38cnh2sv4q49vv9x6nkxar69hgc"; }; meta.homepage = "https://github.com/Olical/conjure/"; }; @@ -1254,28 +1615,16 @@ final: prev: coq_nvim = buildVimPluginFrom2Nix { pname = "coq_nvim"; - version = "2022-03-26"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "ms-jpq"; repo = "coq_nvim"; - rev = "ad255350b66809d4af3aae75f4fb4dd576a06ab4"; - sha256 = "17l6ajaj03d5v8abi8m754ypqwhz1nw232n15y8av15ll0pb7gk0"; + rev = "ed7e610e42ab70ccbfb2fe08fbdd963fe160a00c"; + sha256 = "1ry1mlcayanmhnlki4ifpkia889adp8rv8kx46k80i9lnpm1mhrq"; }; meta.homepage = "https://github.com/ms-jpq/coq_nvim/"; }; - Coqtail = buildVimPluginFrom2Nix { - pname = "Coqtail"; - version = "2022-03-25"; - src = fetchFromGitHub { - owner = "whonore"; - repo = "Coqtail"; - rev = "7a1cb8fb1cbdf136bba50a22ddcc056e83dc435c"; - sha256 = "0jj966bansbfzbhbfgyqciis36s7z46n9n8ihy2m7vxynibbf9yp"; - }; - meta.homepage = "https://github.com/whonore/Coqtail/"; - }; - cosco-vim = buildVimPluginFrom2Nix { pname = "cosco.vim"; version = "2018-08-07"; @@ -1772,12 +2121,12 @@ final: prev: diffview-nvim = buildVimPluginFrom2Nix { pname = "diffview.nvim"; - version = "2022-02-21"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "sindrets"; repo = "diffview.nvim"; - rev = "cf32c3fcdbc2f6855f6bb883302c9f290e9c3d88"; - sha256 = "0vikawxr40pkprsn8yzpacs33hfakpb98j5lmpf7sjmvyzkb1x8b"; + rev = "6d25771128fd0d2ba272261ac84b3e6798b724b9"; + sha256 = "0d36hqwk9pficiqp3w488g6iy1w167jciy8m8sfx0x5fvybd8rxv"; }; meta.homepage = "https://github.com/sindrets/diffview.nvim/"; }; @@ -1796,48 +2145,24 @@ final: prev: doki-theme-vim = buildVimPluginFrom2Nix { pname = "doki-theme-vim"; - version = "2022-02-16"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "doki-theme"; repo = "doki-theme-vim"; - rev = "fe7112ce7db0c8c65420e82aabfe7a98be2b538b"; - sha256 = "07vy5kf7pqsdqsz5jmqj6lm2aizcncfi4j1vmkpnjw9rpp3c733r"; + rev = "047caeccfe2052d5be42f0e26986c31bd2e0d5f0"; + sha256 = "0zbq3c25q03frav7scch5sghwa27swbamlrdnvkmiqw1qfk27r72"; }; meta.homepage = "https://github.com/doki-theme/doki-theme-vim/"; }; - DoxygenToolkit-vim = buildVimPluginFrom2Nix { - pname = "DoxygenToolkit.vim"; - version = "2010-11-06"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "DoxygenToolkit.vim"; - rev = "afd8663d36d2ec19d26befdb10e89e912d26bbd3"; - sha256 = "1za8li02j4nhqjjsyxg4p78638h5af4izim37zc0p1x55zr3i85r"; - }; - meta.homepage = "https://github.com/vim-scripts/DoxygenToolkit.vim/"; - }; - - dracula-vim = buildVimPluginFrom2Nix { - pname = "dracula-vim"; - version = "2022-03-24"; - src = fetchFromGitHub { - owner = "dracula"; - repo = "vim"; - rev = "d7723a842a6cfa2f62cf85530ab66eb418521dc2"; - sha256 = "1qzil8rwpdzf64gq63ds0cf509ldam77l3fz02g1mia5dry75r02"; - }; - meta.homepage = "https://github.com/dracula/vim/"; - }; - dressing-nvim = buildVimPluginFrom2Nix { pname = "dressing.nvim"; - version = "2022-03-24"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "stevearc"; repo = "dressing.nvim"; - rev = "31f12fff6e71a14ddce30bfc7ec9b29a2137ccde"; - sha256 = "0kjx04q2hnbvw68wh3d9li9p9s5d07j308kfhawpnhnmv6g57nzw"; + rev = "cad08fac5ed6d5e8384d8c0759268e2f6b89b217"; + sha256 = "0lc04cvq6iasg724zhpzp1j3bhwj4gphvqbzfh41ikzsy8d2jrpy"; }; meta.homepage = "https://github.com/stevearc/dressing.nvim/"; }; @@ -1915,18 +2240,6 @@ final: prev: meta.homepage = "https://github.com/dmix/elvish.vim/"; }; - embark-vim = buildVimPluginFrom2Nix { - pname = "embark-vim"; - version = "2022-03-26"; - src = fetchFromGitHub { - owner = "embark-theme"; - repo = "vim"; - rev = "3f7f03aa2ae0d4185792aaf9b960bca0d22c48fd"; - sha256 = "0gv2ivrwsrhnsr2kh56yj3m1l4ydwq27vllzxa5vkpbb11jydf3d"; - }; - meta.homepage = "https://github.com/embark-theme/vim/"; - }; - emmet-vim = buildVimPluginFrom2Nix { pname = "emmet-vim"; version = "2021-12-04"; @@ -2038,12 +2351,12 @@ final: prev: fern-vim = buildVimPluginFrom2Nix { pname = "fern.vim"; - version = "2022-03-24"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "lambdalisue"; repo = "fern.vim"; - rev = "45950d39965150a6c6bff1979303e735460379d0"; - sha256 = "067aild4sr5zd08fn2dna9ndycf5i4w524kkz88yzhyr7h5rc0w4"; + rev = "53d8cf7cd96fcde4138ba1ad67971a594b4abbd4"; + sha256 = "1dicpzqmpxclrv3v48ipk79yfblhlva42kzrl8hxly95isq2kznp"; }; meta.homepage = "https://github.com/lambdalisue/fern.vim/"; }; @@ -2081,19 +2394,7 @@ final: prev: rev = "559088afaf10124ea663ee0f4f73b1de48fb1632"; sha256 = "1w183g0hj8jvzm6m1jw7m6xz3x1dld8n8342vnycsh6hyzdcg3mg"; }; - meta.homepage = "https://github.com/bogado/file-line/"; - }; - - FixCursorHold-nvim = buildVimPluginFrom2Nix { - pname = "FixCursorHold.nvim"; - version = "2022-02-17"; - src = fetchFromGitHub { - owner = "antoinemadec"; - repo = "FixCursorHold.nvim"; - rev = "1bfb32e7ba1344925ad815cb0d7f901dbc0ff7c1"; - sha256 = "0b1iffk6pa2zwd9fvlgqli72r8qj74b7hqkhlw6awhc7r1qj8m1q"; - }; - meta.homepage = "https://github.com/antoinemadec/FixCursorHold.nvim/"; + meta.homepage = "https://github.com/bogado/file-line/"; }; flake8-vim = buildVimPluginFrom2Nix { @@ -2147,12 +2448,12 @@ final: prev: formatter-nvim = buildVimPluginFrom2Nix { pname = "formatter.nvim"; - version = "2022-03-22"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "mhartington"; repo = "formatter.nvim"; - rev = "cc42c16a793cba102ac75574ab187a77995ba06b"; - sha256 = "1qz87l2da378wcbbck6n9p82apl594x2kxldl4sxhy88rbbqi2vb"; + rev = "bec8a57d6e990a503e87eb71ae530cd2c1402e31"; + sha256 = "14llli9s5x58m7z4ay5b9d2pypq378h3i4062rasdqi5c5and07n"; }; meta.homepage = "https://github.com/mhartington/formatter.nvim/"; }; @@ -2193,18 +2494,6 @@ final: prev: meta.homepage = "https://github.com/raghur/fruzzy/"; }; - FTerm-nvim = buildVimPluginFrom2Nix { - pname = "FTerm.nvim"; - version = "2022-03-13"; - src = fetchFromGitHub { - owner = "numToStr"; - repo = "FTerm.nvim"; - rev = "233633a5f6fe8398187a4eba93eba0828ef3d5f3"; - sha256 = "0sxnii921xia4mrf67qz7ichi9xqr9zf193hb9dx199l7hl6k1p8"; - }; - meta.homepage = "https://github.com/numToStr/FTerm.nvim/"; - }; - fugitive-gitlab-vim = buildVimPluginFrom2Nix { pname = "fugitive-gitlab.vim"; version = "2021-09-20"; @@ -2339,12 +2628,12 @@ final: prev: gina-vim = buildVimPluginFrom2Nix { pname = "gina.vim"; - version = "2021-06-12"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "lambdalisue"; repo = "gina.vim"; - rev = "abdbe0fe33f3b6fc59e94f7cc3072768f8dfd8ac"; - sha256 = "1f3shh6jxr5i1an2dbb1vmc0l2xg03fm6ava25ahxg4b5ka59bc5"; + rev = "ff6c2ddeca98f886b57fb42283c12e167d6ab575"; + sha256 = "09jlnpix2dy6kggiz96mrm5l1f9x1gl5afpdmfrxgkighn2rwpzq"; }; meta.homepage = "https://github.com/lambdalisue/gina.vim/"; }; @@ -2411,12 +2700,12 @@ final: prev: gitsigns-nvim = buildVimPluginFrom2Nix { pname = "gitsigns.nvim"; - version = "2022-03-25"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "lewis6991"; repo = "gitsigns.nvim"; - rev = "2a107231d92fa37224efdbc475abfba71f94b5ee"; - sha256 = "0i17r2c48csff7pl0k1vvc5j61xh3qv4xq6v75raz937w0kj6hfg"; + rev = "83ab3ca26ff5038f823060dfddda7a053e579b67"; + sha256 = "1hrzk6nr1w9747h0fn9h5cm1pgx1sw6njyf3pyr7p220gnh87vzp"; }; meta.homepage = "https://github.com/lewis6991/gitsigns.nvim/"; }; @@ -2529,18 +2818,6 @@ final: prev: meta.homepage = "https://github.com/morhetz/gruvbox/"; }; - gruvbox-community = buildVimPluginFrom2Nix { - pname = "gruvbox-community"; - version = "2022-03-06"; - src = fetchFromGitHub { - owner = "gruvbox-community"; - repo = "gruvbox"; - rev = "b6f47ae7031f6746a1f1918c17574aa12c474ef0"; - sha256 = "0m8rrm5v542a2c30sg7hlgm7r6gs4ah1n6nr5dc101l2064kg97g"; - }; - meta.homepage = "https://github.com/gruvbox-community/gruvbox/"; - }; - gruvbox-flat-nvim = buildVimPluginFrom2Nix { pname = "gruvbox-flat.nvim"; version = "2022-01-19"; @@ -2603,12 +2880,12 @@ final: prev: harpoon = buildVimPluginFrom2Nix { pname = "harpoon"; - version = "2022-02-16"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "ThePrimeagen"; repo = "harpoon"; - rev = "b2bb0d6f2b8a55895afda53f0ad04527998d3411"; - sha256 = "0izsscglfk6lpisxvarr0qw4m9br8854wi6jhyp2msd8r9gcrzi7"; + rev = "b6a363c037505c30a41042580729dc09e9bd00ed"; + sha256 = "0v917h34fha7ww2shrnwaqajp5f0s6qb9rbcmf4f504rpkfbnavl"; }; meta.homepage = "https://github.com/ThePrimeagen/harpoon/"; }; @@ -2759,28 +3036,16 @@ final: prev: impatient-nvim = buildVimPluginFrom2Nix { pname = "impatient.nvim"; - version = "2022-03-22"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "lewis6991"; repo = "impatient.nvim"; - rev = "989eefca3539b9958df100e8e3130f55eafe1709"; - sha256 = "0cypb6nm0jlgf4cbsazwplvniiqrnda32nk2nkaqm0dbprs920sv"; + rev = "2337df7d778e17a58d8709f651653b9039946d8d"; + sha256 = "06gz1qsdqil1f2wsfyslk8vsdxxjjrsak0gfar2298ardaqb3dhp"; }; meta.homepage = "https://github.com/lewis6991/impatient.nvim/"; }; - Improved-AnsiEsc = buildVimPluginFrom2Nix { - pname = "Improved-AnsiEsc"; - version = "2015-08-26"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "Improved-AnsiEsc"; - rev = "e1c59a8e9203fab6b9150721f30548916da73351"; - sha256 = "1smjs4kz2kmzprzp9az4957675nakb43146hshbby39j5xz4jsbz"; - }; - meta.homepage = "https://github.com/vim-scripts/Improved-AnsiEsc/"; - }; - increment-activator = buildVimPluginFrom2Nix { pname = "increment-activator"; version = "2021-09-16"; @@ -2819,12 +3084,12 @@ final: prev: indent-blankline-nvim = buildVimPluginFrom2Nix { pname = "indent-blankline.nvim"; - version = "2022-03-25"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "lukas-reineke"; repo = "indent-blankline.nvim"; - rev = "ebedbed53690a53cd15b53c124eb29f9faffc1d2"; - sha256 = "1wsxvlpq78vyvgz6g0ji07dy1b10bsfr1qk9qdpj2n5592zp8zlk"; + rev = "9920ceb79bffd0e6b7064be63439e38da0741d03"; + sha256 = "15wqnd72j98w15i7dhzjdxbyxk766vcb844xdrvany3zwqn5p58x"; }; meta.homepage = "https://github.com/lukas-reineke/indent-blankline.nvim/"; }; @@ -2962,18 +3227,6 @@ final: prev: meta.homepage = "https://github.com/nanotech/jellybeans.vim/"; }; - Jenkinsfile-vim-syntax = buildVimPluginFrom2Nix { - pname = "Jenkinsfile-vim-syntax"; - version = "2021-01-26"; - src = fetchFromGitHub { - owner = "martinda"; - repo = "Jenkinsfile-vim-syntax"; - rev = "0d05729168ea44d60862f17cffa80024ab30bcc9"; - sha256 = "05z30frs4f5z0l4qgxk08r7mb19bzhqs36hi213yin78cz62b9gy"; - }; - meta.homepage = "https://github.com/martinda/Jenkinsfile-vim-syntax/"; - }; - jq-vim = buildVimPluginFrom2Nix { pname = "jq.vim"; version = "2019-05-21"; @@ -3058,30 +3311,6 @@ final: prev: meta.homepage = "https://github.com/qnighy/lalrpop.vim/"; }; - LanguageClient-neovim = buildVimPluginFrom2Nix { - pname = "LanguageClient-neovim"; - version = "2020-12-10"; - src = fetchFromGitHub { - owner = "autozimu"; - repo = "LanguageClient-neovim"; - rev = "a42594c9c320b1283e9b9058b85a8097d8325fed"; - sha256 = "0lj9na3g2cl0vj56jz8rhz9lm2d3xps5glk8ds491i2ixy4vdm37"; - }; - meta.homepage = "https://github.com/autozimu/LanguageClient-neovim/"; - }; - - LanguageTool-nvim = buildVimPluginFrom2Nix { - pname = "LanguageTool.nvim"; - version = "2020-10-19"; - src = fetchFromGitHub { - owner = "vigoux"; - repo = "LanguageTool.nvim"; - rev = "809e7d77fec834597f495fec737c59292a10025b"; - sha256 = "1g12dz85xq8qd92dgna0a3w6zgxa74njlvmvly4k20610r63bzrn"; - }; - meta.homepage = "https://github.com/vigoux/LanguageTool.nvim/"; - }; - last256 = buildVimPluginFrom2Nix { pname = "last256"; version = "2020-12-09"; @@ -3118,26 +3347,14 @@ final: prev: meta.homepage = "https://github.com/kdheepak/lazygit.nvim/"; }; - LeaderF = buildVimPluginFrom2Nix { - pname = "LeaderF"; - version = "2022-03-22"; - src = fetchFromGitHub { - owner = "Yggdroot"; - repo = "LeaderF"; - rev = "60e14a5bbd52a22578d6335c606d0539067b9327"; - sha256 = "05bx5wm8r5rs4y51pkgb2m6bxzddacn7f3bdsgnmbvxz0rxyq8dp"; - }; - meta.homepage = "https://github.com/Yggdroot/LeaderF/"; - }; - lean-nvim = buildVimPluginFrom2Nix { pname = "lean.nvim"; - version = "2022-03-23"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "Julian"; repo = "lean.nvim"; - rev = "c22a0a6d288488a05a74aaa53dac4d2d71f7a30d"; - sha256 = "0rb1gw3ndrjw5k1l2ckm936xp83krrwi3ylr27il8mdf4xllw3y8"; + rev = "d4f1097b8fb659eef47899b5dd04d924e24a893b"; + sha256 = "11garckhnycds1njifczgspl6jwl4is25d6bnp22kvvjjy5bc5px"; }; meta.homepage = "https://github.com/Julian/lean.nvim/"; }; @@ -3192,12 +3409,12 @@ final: prev: lf-vim = buildVimPluginFrom2Nix { pname = "lf.vim"; - version = "2021-02-18"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "ptzz"; repo = "lf.vim"; - rev = "73fb502c6d1470243b1f4d8afa81e289d9edd94b"; - sha256 = "1whrzpavv46r64l3b7vax4sj23kjdfjiwmhfpssb6bprhc9c4j97"; + rev = "eab8f04b2953f08e3fcd425585598d176369ae4b"; + sha256 = "125qdj8grw1vilhfqzmjwcwk3r4f1m2kxnxga9klmgypjmcgnkxd"; }; meta.homepage = "https://github.com/ptzz/lf.vim/"; }; @@ -3288,12 +3505,12 @@ final: prev: lightspeed-nvim = buildVimPluginFrom2Nix { pname = "lightspeed.nvim"; - version = "2022-03-09"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "ggandor"; repo = "lightspeed.nvim"; - rev = "58c9e321b188e040703b01f16922623911f11117"; - sha256 = "1x9w6nk69a6xzhr9jpcvnw3jby09k49y7gikasxyq5gpq6rp9dfs"; + rev = "ecb8bbca37ee1c9d153e0835af507905af05f2b5"; + sha256 = "13b221n9h31i4mqiscdzq6299s6615hvdxc16pwsv18w2mfhpiax"; }; meta.homepage = "https://github.com/ggandor/lightspeed.nvim/"; }; @@ -3360,12 +3577,12 @@ final: prev: litee-filetree-nvim = buildVimPluginFrom2Nix { pname = "litee-filetree.nvim"; - version = "2022-03-08"; + version = "2022-03-26"; src = fetchFromGitHub { owner = "ldelossa"; repo = "litee-filetree.nvim"; - rev = "4f54ff9708c59385dd2f08aad1ba7df879e638fc"; - sha256 = "076wyp90mr43xniv0zc7wh6rfk1wr50cpfw5lvaj6ai7dyys466n"; + rev = "59259b0d0716b628a3e4f44098bd87ff54cf9cba"; + sha256 = "02awfwdzgcqsvs8p8a4m29c648phy6h5x1l49gklrmp8ymg2xgq3"; }; meta.homepage = "https://github.com/ldelossa/litee-filetree.nvim/"; }; @@ -3515,24 +3732,24 @@ final: prev: lualine-nvim = buildVimPluginFrom2Nix { pname = "lualine.nvim"; - version = "2022-03-27"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "nvim-lualine"; repo = "lualine.nvim"; - rev = "f14175e142825c69c5b39e8f1564b9945a97d4aa"; - sha256 = "0x6f88ixb6xd5nh3d8y5sql8yfyqs5fnpvdkdv9ywp7swzaydgqc"; + rev = "c8e5a69085e89c2bac6bd01c74fcb98f9ffa5cdc"; + sha256 = "0b2fwz1kxg0j8pgb1bzr82k916ii4k2vnbyz69w657v5mqmlpcbm"; }; meta.homepage = "https://github.com/nvim-lualine/lualine.nvim/"; }; luasnip = buildVimPluginFrom2Nix { pname = "luasnip"; - version = "2022-03-27"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "l3mon4d3"; repo = "luasnip"; - rev = "d03f0c32b2aa763915401421f6b084315936590f"; - sha256 = "0qrryj40v70wl1mwn3jc0f50ygslc0848gppki5sxv1aq56a58ps"; + rev = "eb5b77e7927e4b28800b4f40c5507d6396b7eeaf"; + sha256 = "03jjrd9k2cksrq5j2js9kdx4np1gy89z2r33baffrfpzy6rnak8b"; }; meta.homepage = "https://github.com/l3mon4d3/luasnip/"; }; @@ -3609,42 +3826,18 @@ final: prev: meta.homepage = "https://github.com/vim-scripts/matchit.zip/"; }; - MatchTagAlways = buildVimPluginFrom2Nix { - pname = "MatchTagAlways"; - version = "2017-05-20"; - src = fetchFromGitHub { - owner = "Valloric"; - repo = "MatchTagAlways"; - rev = "352eb479a4ad1608e0880b79ab2357aac2cf4bed"; - sha256 = "0y8gq4cs0wm2ijagc2frpmm664z355iridxyl5893576v5aqp8z1"; - }; - meta.homepage = "https://github.com/Valloric/MatchTagAlways/"; - }; - material-nvim = buildVimPluginFrom2Nix { pname = "material.nvim"; - version = "2022-03-25"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "marko-cerovac"; repo = "material.nvim"; - rev = "82f74e8ec5d21a8ec9ebe1175c330a0b6e490212"; - sha256 = "0hgcgj84d92js6i6skwzznz0ym8cgzwr4pz5aqi038g8ldpcx0ki"; + rev = "fc3e3d04f9646404dcbf3692e83ad0eecee8bfe8"; + sha256 = "0zqs3hn946gzcsm4qggakd45qnw5mvas1j6i71l8i55xabkgiffj"; }; meta.homepage = "https://github.com/marko-cerovac/material.nvim/"; }; - mattn-calendar-vim = buildVimPluginFrom2Nix { - pname = "mattn-calendar-vim"; - version = "2022-02-10"; - src = fetchFromGitHub { - owner = "mattn"; - repo = "calendar-vim"; - rev = "2083a41e2d310f9bbbbf644517f30e901f1fb04d"; - sha256 = "13wakcprkh93i7afykkpavxqvxssjh573pjjljsgip3y3778ms5q"; - }; - meta.homepage = "https://github.com/mattn/calendar-vim/"; - }; - mayansmoke = buildVimPluginFrom2Nix { pname = "mayansmoke"; version = "2010-10-18"; @@ -3659,12 +3852,12 @@ final: prev: mini-nvim = buildVimPluginFrom2Nix { pname = "mini.nvim"; - version = "2022-03-26"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "echasnovski"; repo = "mini.nvim"; - rev = "b0763e58ccb8b203f87fcd58fe2fecb095119f96"; - sha256 = "0qbyvz7l9p9iia7mh41119zdgz2v8xrkp8wcxl6hyxqri18j49yn"; + rev = "aedcaba7892b8a016bf385672ec70ff99cd7876c"; + sha256 = "0p4q4pxg692b1frs9v8rqbbha7jb4ngjm714ajfiaawn6kgy6r23"; }; meta.homepage = "https://github.com/echasnovski/mini.nvim/"; }; @@ -3729,18 +3922,6 @@ final: prev: meta.homepage = "https://github.com/tomasr/molokai/"; }; - moonlight-nvim = buildVimPluginFrom2Nix { - pname = "moonlight.nvim"; - version = "2021-05-16"; - src = fetchFromGitHub { - owner = "shaunsingh"; - repo = "moonlight.nvim"; - rev = "e24e4218ec680b6396532808abf57ca0ada82e66"; - sha256 = "0m9w3fpypsqxydjd93arbjqb5576nl40iy27i4ijlrqhgdhl49y3"; - }; - meta.homepage = "https://github.com/shaunsingh/moonlight.nvim/"; - }; - mru = buildVimPluginFrom2Nix { pname = "mru"; version = "2022-03-12"; @@ -3753,18 +3934,6 @@ final: prev: meta.homepage = "https://github.com/yegappan/mru/"; }; - Navigator-nvim = buildVimPluginFrom2Nix { - pname = "Navigator.nvim"; - version = "2022-03-25"; - src = fetchFromGitHub { - owner = "numToStr"; - repo = "Navigator.nvim"; - rev = "58d07e658c15b61ef7b6e375073b1f06934bc28f"; - sha256 = "0d40rilwcxi7q36fnk4xpyx1cq3nb4yf22j8k8zq6mwg5h4j648r"; - }; - meta.homepage = "https://github.com/numToStr/Navigator.nvim/"; - }; - ncm2 = buildVimPluginFrom2Nix { pname = "ncm2"; version = "2022-03-17"; @@ -4103,12 +4272,12 @@ final: prev: neorg = buildVimPluginFrom2Nix { pname = "neorg"; - version = "2022-03-26"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "nvim-neorg"; repo = "neorg"; - rev = "8f8c1ae889ffe666423a89271933272ebffec3ef"; - sha256 = "10fgkrr9wn6jj35qa42c353k4rnys9a2wrckjk0kwrx6kvx7m6l6"; + rev = "aec45ca94975c0072516523fec32d69044db36b6"; + sha256 = "1g1kyhwqdxbshbfqzrwzav9afkl7psys8w5i2h4gkn8dda1h59g6"; }; meta.homepage = "https://github.com/nvim-neorg/neorg/"; }; @@ -4127,12 +4296,12 @@ final: prev: neosnippet-snippets = buildVimPluginFrom2Nix { pname = "neosnippet-snippets"; - version = "2021-10-02"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "Shougo"; repo = "neosnippet-snippets"; - rev = "8a6655a034eb7c12138dad505ef1004bf383a45d"; - sha256 = "0mwvcjdrk324azqy5m2lpl3z1gi92jspxvmcjcxqnppfjsv1iyhd"; + rev = "725c989f18e9c134cddd63a7c6b15bed5c244657"; + sha256 = "0657ial95l0jgyj9ld6qbncnnrl5qkh6pqp40lr703ddqkz10s03"; }; meta.homepage = "https://github.com/Shougo/neosnippet-snippets/"; }; @@ -4149,18 +4318,6 @@ final: prev: meta.homepage = "https://github.com/Shougo/neosnippet.vim/"; }; - NeoSolarized = buildVimPluginFrom2Nix { - pname = "NeoSolarized"; - version = "2020-08-07"; - src = fetchFromGitHub { - owner = "overcache"; - repo = "NeoSolarized"; - rev = "b94b1a9ad51e2de015266f10fdc6e142f97bd617"; - sha256 = "019nz56yirpg1ahg8adfafrxznalw056qwm3xjm9kzg6da8j6v48"; - }; - meta.homepage = "https://github.com/overcache/NeoSolarized/"; - }; - neoterm = buildVimPluginFrom2Nix { pname = "neoterm"; version = "2022-01-20"; @@ -4295,12 +4452,12 @@ final: prev: nightfox-nvim = buildVimPluginFrom2Nix { pname = "nightfox.nvim"; - version = "2022-03-27"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "EdenEast"; repo = "nightfox.nvim"; - rev = "2b19e2ad758f078b607408b15bdaf39f3beafac6"; - sha256 = "0xn78z74wldjq7p5xzlbv4562b6i5nha3lj0bc2hv6w9n3m7q494"; + rev = "18fea7708f6195ea26ec87701b59bb61a64532d8"; + sha256 = "1aj6sn20hhdz2kmjgi4gr3m9izhbhjlw7kx2ydkm8bfhjx5wpgjq"; }; meta.homepage = "https://github.com/EdenEast/nightfox.nvim/"; }; @@ -4377,18 +4534,6 @@ final: prev: meta.homepage = "https://github.com/andersevenrud/nordic.nvim/"; }; - NrrwRgn = buildVimPluginFrom2Nix { - pname = "NrrwRgn"; - version = "2022-02-13"; - src = fetchFromGitHub { - owner = "chrisbra"; - repo = "NrrwRgn"; - rev = "e027db9d94f94947153cd7b5ac9abd04371ab2b0"; - sha256 = "0mcwyqbfc2m865w44s96ra2k0v1mn5kkkxf8i71iqhvc7fvnrfah"; - }; - meta.homepage = "https://github.com/chrisbra/NrrwRgn/"; - }; - nterm-nvim = buildVimPluginFrom2Nix { pname = "nterm.nvim"; version = "2021-11-10"; @@ -4415,12 +4560,12 @@ final: prev: null-ls-nvim = buildVimPluginFrom2Nix { pname = "null-ls.nvim"; - version = "2022-03-25"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "jose-elias-alvarez"; repo = "null-ls.nvim"; - rev = "7253974f8bd8c805a2a1cf7456b4d47913f4a094"; - sha256 = "0xy80c1wra3ir8v0ywrrmyswprbzknlwf69q9g33g29zsmgfx9dr"; + rev = "899785c17c8ec701efc618520edf46bc0f3f367b"; + sha256 = "0pwvq4aqfjr4vsymc40ppk6jb0qqclj3k47m6vzp2p1d4wa0qbz9"; }; meta.homepage = "https://github.com/jose-elias-alvarez/null-ls.nvim/"; }; @@ -4463,36 +4608,36 @@ final: prev: nvim-autopairs = buildVimPluginFrom2Nix { pname = "nvim-autopairs"; - version = "2022-03-25"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "windwp"; repo = "nvim-autopairs"; - rev = "f3ebca37d6ef1ff22d1f2c764a9e619d1fe5f3c7"; - sha256 = "0w5xsj55iz30khiw4y47h43i40z2ly607bm8hvddpvrd50i5vcz1"; + rev = "06535b1f1aefc98df464d180efa693bb696736c4"; + sha256 = "12ii6vap3s2c58fmr01r900cidifr50pdpbl2ssx78w26qvc7qz4"; }; meta.homepage = "https://github.com/windwp/nvim-autopairs/"; }; nvim-base16 = buildVimPluginFrom2Nix { pname = "nvim-base16"; - version = "2022-03-13"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "RRethy"; repo = "nvim-base16"; - rev = "9893a06a11b448e05c0bd1f44970acbb7712e8ba"; - sha256 = "0hhlyw9nacyc4pyx2537y145lm9p3s4m4ckh8cwbambp5ypnn8kl"; + rev = "f3c8eaa6c8c0dcd752aa28042f9435c464349776"; + sha256 = "18xlhyyg9yq54p6jnq4dri47zfw62xfnx4ci9j9iiiii1dyzwr2z"; }; meta.homepage = "https://github.com/RRethy/nvim-base16/"; }; nvim-bqf = buildVimPluginFrom2Nix { pname = "nvim-bqf"; - version = "2022-03-21"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "kevinhwang91"; repo = "nvim-bqf"; - rev = "7d3630f1616c2e5cf9f1c8efc1cf186b9249ce7b"; - sha256 = "0y9kp05qgs7mmivs52ab26jhiqj1izz4jhj1n4x26zmaqbpw4viw"; + rev = "d67a9b5173806e3f2297ee42b298d1345acb9c24"; + sha256 = "1g6jvlx78s4a56p0nxg5z3s2g06snnsyq3bllvqf48qy2s43g286"; }; meta.homepage = "https://github.com/kevinhwang91/nvim-bqf/"; }; @@ -4523,12 +4668,12 @@ final: prev: nvim-cmp = buildVimPluginFrom2Nix { pname = "nvim-cmp"; - version = "2022-03-22"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "hrsh7th"; repo = "nvim-cmp"; - rev = "272cbdca3e327bf43e8df85c6f4f00921656c4e4"; - sha256 = "1z3nsrkla35sl6d66bjnk0qvqn1a5m8vn670qyb8y9nqs344fy8d"; + rev = "7dbe34e36d9de4912a5f3aa5279540445765814c"; + sha256 = "0v5z1m7n6q183l9a6pajfqbg6n2cxdkcpx7xmalyh99x9ax0pazf"; }; meta.homepage = "https://github.com/hrsh7th/nvim-cmp/"; }; @@ -4607,24 +4752,24 @@ final: prev: nvim-dap = buildVimPluginFrom2Nix { pname = "nvim-dap"; - version = "2022-03-25"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "mfussenegger"; repo = "nvim-dap"; - rev = "e6d7ba5847fbe5f33ba211cf28d3cea72cfa9865"; - sha256 = "0w57cxj07law5igbxvblfk59pv5c8z714dm80njb168ldgy26kz6"; + rev = "c20c78d7c6c82f16a2d1abec31f4273194e3987b"; + sha256 = "16vlsydx950s6v1nzpw0h38vmykcp9f3wsaxg09sjvc2isgd4f8b"; }; meta.homepage = "https://github.com/mfussenegger/nvim-dap/"; }; nvim-dap-ui = buildVimPluginFrom2Nix { pname = "nvim-dap-ui"; - version = "2022-03-21"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "rcarriga"; repo = "nvim-dap-ui"; - rev = "45805d69273f1ca0753a096abd419e89af8e5f8a"; - sha256 = "03jjhsdl0w5w0s7d9a64fmvwdpm1pkvjvd5gh1hgsavbpf0w71mb"; + rev = "33f33dfced1d7d98e2b934bd663175a062d8db39"; + sha256 = "00achlynnv1qhs0vqp0q40pzx95bxf9cgsgrpwg6p3fwb2f4ssdi"; }; meta.homepage = "https://github.com/rcarriga/nvim-dap-ui/"; }; @@ -4667,12 +4812,12 @@ final: prev: nvim-fzf-commands = buildVimPluginFrom2Nix { pname = "nvim-fzf-commands"; - version = "2021-05-31"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "vijaymarupudi"; repo = "nvim-fzf-commands"; - rev = "c6188c8618ca6b579af37cbc242414e1016bcd45"; - sha256 = "0nn04gpz3n0jqb9kyxbmipkixzp1lk2f67knxqzzzlxm27m839fy"; + rev = "015e77ea3185ca9175544e879e2cbb2cfb08323f"; + sha256 = "1w6s1kl83fyvwycym3i5azcx4q5ryzsjszh6wvk5pxqm2pmzs8lx"; }; meta.homepage = "https://github.com/vijaymarupudi/nvim-fzf-commands/"; }; @@ -4691,12 +4836,12 @@ final: prev: nvim-gps = buildVimPluginFrom2Nix { pname = "nvim-gps"; - version = "2022-03-27"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "smiteshp"; repo = "nvim-gps"; - rev = "1ad35eada2972c055b181c73852438a6ea51b484"; - sha256 = "1kv7p2lcilvkvzl9whdkxgg94vk9fa9d1bikwhahxv2zxzk10qkz"; + rev = "9f2adbce23a383243458f41654c07e57dc1b7635"; + sha256 = "1gwq7qrbcmh4nqdgl4pv83b8x5wxaks4vxgq3yryjj6n4x5b56fw"; }; meta.homepage = "https://github.com/smiteshp/nvim-gps/"; }; @@ -4715,12 +4860,12 @@ final: prev: nvim-hlslens = buildVimPluginFrom2Nix { pname = "nvim-hlslens"; - version = "2022-03-20"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "kevinhwang91"; repo = "nvim-hlslens"; - rev = "22f7df73283c6f947a56fef0355f5a3ee2971152"; - sha256 = "1qjy4n0ly5vmkpfyjanqb76jvh6qa5ldqvhgfgxk91b9l35ca95l"; + rev = "1944094111217db8d40aac697ffc71f16136d9ec"; + sha256 = "0f0lqldrgzi72qrafzwqk3i71v74xvsrhgrfnidnbnvd3jc7sa0b"; }; meta.homepage = "https://github.com/kevinhwang91/nvim-hlslens/"; }; @@ -4787,12 +4932,12 @@ final: prev: nvim-lint = buildVimPluginFrom2Nix { pname = "nvim-lint"; - version = "2022-03-09"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "mfussenegger"; repo = "nvim-lint"; - rev = "8cc31931859dc3cc187fd68509f8649599f72cba"; - sha256 = "006d9l0p86s08vhr5jjm6gi2j27wjbk3c3vfdbq9yi3bz974hgf1"; + rev = "4040e71c86022cf7937bef5d483156c163df8ca1"; + sha256 = "0492x97bl0p9kn2fsb6p587m6lsbn4qgdg7k7sr7vrfi73xw4s3k"; }; meta.homepage = "https://github.com/mfussenegger/nvim-lint/"; }; @@ -4811,12 +4956,12 @@ final: prev: nvim-lspconfig = buildVimPluginFrom2Nix { pname = "nvim-lspconfig"; - version = "2022-03-23"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "neovim"; repo = "nvim-lspconfig"; - rev = "7d5a6dc46dd2ebaeb74b573922f289ae33089fe7"; - sha256 = "1dz2q6n2ibq9l2js088wfp2y5md6z8lqs6hy02xajglvb0d9g3fg"; + rev = "3d1baa811b351078e5711be1a1158e33b074be9e"; + sha256 = "0470h3vaw6zmmayfd9rzlh5myzmdc2wa5qlfmax21k0jna62zzr1"; }; meta.homepage = "https://github.com/neovim/nvim-lspconfig/"; }; @@ -4835,12 +4980,12 @@ final: prev: nvim-metals = buildVimPluginFrom2Nix { pname = "nvim-metals"; - version = "2022-03-20"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "scalameta"; repo = "nvim-metals"; - rev = "3312490ef74ea149121a82fde578a13b1921cef9"; - sha256 = "0xi13qji716kdbbq579pj7rxbjfkwjrsdp3qvfb937spwzbak2jc"; + rev = "64db05106c952bfc29ad165f21c43e7fdc97eaf1"; + sha256 = "0m4ab6774j0yj8b1h6p0y0m5zgs4w3x2vn20ahx3z6dr6bzk2pph"; }; meta.homepage = "https://github.com/scalameta/nvim-metals/"; }; @@ -4919,12 +5064,12 @@ final: prev: nvim-spectre = buildVimPluginFrom2Nix { pname = "nvim-spectre"; - version = "2022-03-22"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "nvim-pack"; repo = "nvim-spectre"; - rev = "3bbf9cb2e36200d67c150d71d49011c133d3bbb8"; - sha256 = "1jif3knz78mqf6sgckfwin1wx6ad4wppdc2y0hcxlj2kwm17xqzk"; + rev = "fbb03990539d5d484fe10de805772b4b86792c1a"; + sha256 = "1iw4gnsc72r5rj7z5g3jbxqcnfzzhi9r84zpik8pfjnx8r79ncnj"; }; meta.homepage = "https://github.com/nvim-pack/nvim-spectre/"; }; @@ -4943,24 +5088,24 @@ final: prev: nvim-tree-lua = buildVimPluginFrom2Nix { pname = "nvim-tree.lua"; - version = "2022-03-27"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "kyazdani42"; repo = "nvim-tree.lua"; - rev = "524758a207f9c5bf3888b446d9f93192a837b8a7"; - sha256 = "0kz7qhirm7gkklmyysanndm4pimvfm0p0qzz3q96hv01hpm3d17y"; + rev = "63688809682af5fcfa6aedec21b1c9ef3aeb2f4c"; + sha256 = "0jmllkfj5l5f5a6nlzlglh48n12rmxwb57vz346ji1a1qrrs6bhj"; }; meta.homepage = "https://github.com/kyazdani42/nvim-tree.lua/"; }; nvim-treesitter = buildVimPluginFrom2Nix { pname = "nvim-treesitter"; - version = "2022-03-27"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "nvim-treesitter"; repo = "nvim-treesitter"; - rev = "b995eebe84df88092a41cbfd591bfc1565f70d8e"; - sha256 = "1738mssq22n1njrpi004apgfv00fxn7yx00r3175qn57bjw9bks9"; + rev = "2472e47e15eb56e8d6d421d7c2c7169140db2813"; + sha256 = "1cyi7h5xpw2hfyniwqyc5fnmvlyjb6bfbg4l586kn8q34hq5s3kq"; }; meta.homepage = "https://github.com/nvim-treesitter/nvim-treesitter/"; }; @@ -5003,12 +5148,12 @@ final: prev: nvim-treesitter-textobjects = buildVimPluginFrom2Nix { pname = "nvim-treesitter-textobjects"; - version = "2022-03-25"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "nvim-treesitter"; repo = "nvim-treesitter-textobjects"; - rev = "2885b60e9f9b90b4e2a32b0f8adf8571bf1f390e"; - sha256 = "0q1dph3pz2ygz1wccjgcdfqyb4faj47rv2v9a4p4ngw2vd00qjgy"; + rev = "c4b41e42dad700b23c6ea86ecb69c9deb55a8fbb"; + sha256 = "1l8fbn1rvyifvaplmyp38sf73payy1wlglnrb5xl4dxpcfd6yvzc"; }; meta.homepage = "https://github.com/nvim-treesitter/nvim-treesitter-textobjects/"; }; @@ -5039,12 +5184,12 @@ final: prev: nvim-ts-rainbow = buildVimPluginFrom2Nix { pname = "nvim-ts-rainbow"; - version = "2022-03-20"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "p00f"; repo = "nvim-ts-rainbow"; - rev = "af1a18d2577ba0be5b59bc4b32aebd2569ff085e"; - sha256 = "1z100akjipzp3zyr7d54vbwwf53dj4f8y8qzf7fv32la142a7idq"; + rev = "dee11b86ae2419e3f7484197c597a0e634a37a56"; + sha256 = "1rmv8lmxx4ji4lacgws3vfaaj8df2zbc3vs6sbj9mmzmfg3q38py"; }; meta.homepage = "https://github.com/p00f/nvim-ts-rainbow/"; }; @@ -5099,12 +5244,12 @@ final: prev: nvimdev-nvim = buildVimPluginFrom2Nix { pname = "nvimdev.nvim"; - version = "2022-03-15"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "neovim"; repo = "nvimdev.nvim"; - rev = "cb0fcc1cdbe3864554a7b1ecbe706eb4de4ec680"; - sha256 = "063fyzawn6i67cv3221s282ln5gpms3qw97blrd80l18syykj2b9"; + rev = "ebe8f689a9867c6ce57d748a80a2157b49764f13"; + sha256 = "0r07x8i7w9rk8n1zrdyvqr9pfjv3dihb2hy1100jl4xxc11g43an"; }; meta.homepage = "https://github.com/neovim/nvimdev.nvim/"; }; @@ -5135,12 +5280,12 @@ final: prev: octo-nvim = buildVimPluginFrom2Nix { pname = "octo.nvim"; - version = "2022-02-28"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "pwntester"; repo = "octo.nvim"; - rev = "5e461b944fbf9b6207cf06102ca09fd7778854f7"; - sha256 = "0s04m3xg98sj74fhhvdmafijmjhpa70hgcylg43yxlgdcscqbd72"; + rev = "a83219f69320fc65c12427d6bcbcea135861bb3d"; + sha256 = "11hqfz7rsxnsxqw06zpj3mq1hxz06hsdjbav00jd4zryvcgs6r3v"; }; meta.homepage = "https://github.com/pwntester/octo.nvim/"; }; @@ -5231,12 +5376,12 @@ final: prev: orgmode = buildVimPluginFrom2Nix { pname = "orgmode"; - version = "2022-03-10"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "nvim-orgmode"; repo = "orgmode"; - rev = "e1f3054987ce054525258d9a3cc5837bf6e75212"; - sha256 = "0hwsajd7lhc04da7yzx770f3bgn2jsibcg1pjhxyib1prr17mpy0"; + rev = "3a87036a0b6315a41b4292885cbe372b2f763d99"; + sha256 = "1fak1pfvyy4wwhc4lww5c2ak6b8x0pwgkbljm5azd943lravya1l"; }; meta.homepage = "https://github.com/nvim-orgmode/orgmode/"; }; @@ -5363,24 +5508,24 @@ final: prev: playground = buildVimPluginFrom2Nix { pname = "playground"; - version = "2022-02-16"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "nvim-treesitter"; repo = "playground"; - rev = "9df82a27a49e1c14e9d7416b537517a79d675086"; - sha256 = "1hhrcsrgcy3vqxn9gsm68r77n6z5bw4cr0r47darffan5rxykz21"; + rev = "7dbcd4d647010a80d135804b3fc1da3fb77083d6"; + sha256 = "0g7rqw2vm00rrbbnhc8b9hyljc7q8qc0lywg63lkj63ks9j4m8y7"; }; meta.homepage = "https://github.com/nvim-treesitter/playground/"; }; plenary-nvim = buildVimPluginFrom2Nix { pname = "plenary.nvim"; - version = "2022-03-20"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "nvim-lua"; repo = "plenary.nvim"; - rev = "0d660152000a40d52158c155625865da2aa7aa1b"; - sha256 = "0r8amnlaqxg9jpqk6v4rzlfrc8q161jy1bpy35jrk7gva76kp9hm"; + rev = "f9c65cd76ffa76a0818923c6bce5771687dfe64c"; + sha256 = "1kgi4q7n8m0hv6hn82bs8xhm8n34qmzcq4l8prki1127gfa2gpqj"; }; meta.homepage = "https://github.com/nvim-lua/plenary.nvim/"; }; @@ -5436,28 +5581,16 @@ final: prev: presenting-vim = buildVimPluginFrom2Nix { pname = "presenting.vim"; - version = "2021-06-02"; + version = "2022-03-27"; src = fetchFromGitHub { owner = "sotte"; repo = "presenting.vim"; - rev = "fd826318582ffccf2f79aff7bef365d68f2ca4fc"; - sha256 = "1s2c44ngv5vpszwg0nkcghb5flzq9pby1m0l7gr7vwb9p7xl3b83"; + rev = "e960e204d8e4526d2650c23eaea908317c6becb9"; + sha256 = "1hpid82gdczis0g0pxvx445n2wg7j4zx66fm43zxq08kcv3k5ara"; }; meta.homepage = "https://github.com/sotte/presenting.vim/"; }; - PreserveNoEOL = buildVimPluginFrom2Nix { - pname = "PreserveNoEOL"; - version = "2013-06-14"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "PreserveNoEOL"; - rev = "940e3ce90e54d8680bec1135a21dcfbd6c9bfb62"; - sha256 = "1726jpr2zf6jrb00pp082ikbx4mll3a877pnzs6i18f9fgpaqqgd"; - }; - meta.homepage = "https://github.com/vim-scripts/PreserveNoEOL/"; - }; - prev_indent = buildVimPluginFrom2Nix { pname = "prev_indent"; version = "2014-03-08"; @@ -5539,23 +5672,10 @@ final: prev: repo = "pywal.nvim"; rev = "bd58195939d31dd0f15a720fba2956e91598cefe"; sha256 = "10fs5assp96rvlcxckd8cwnkfwfckjmf0j8cqq91vb2wx8knxc8g"; - fetchSubmodules = true; }; meta.homepage = "https://github.com/AlphaTechnolog/pywal.nvim/"; }; - QFEnter = buildVimPluginFrom2Nix { - pname = "QFEnter"; - version = "2020-10-09"; - src = fetchFromGitHub { - owner = "yssl"; - repo = "QFEnter"; - rev = "df0a75b287c210f98ae353a12bbfdaf73d858beb"; - sha256 = "0gdp7nmjlp8ng2rp2v66d8bincnkwrqqpbggb079f0f9szrqlp54"; - }; - meta.homepage = "https://github.com/yssl/QFEnter/"; - }; - quick-scope = buildVimPluginFrom2Nix { pname = "quick-scope"; version = "2022-01-29"; @@ -5676,18 +5796,6 @@ final: prev: meta.homepage = "https://github.com/ryvnf/readline.vim/"; }; - Recover-vim = buildVimPluginFrom2Nix { - pname = "Recover.vim"; - version = "2015-08-14"; - src = fetchFromGitHub { - owner = "chrisbra"; - repo = "Recover.vim"; - rev = "efa491f6121f65e025f42d79a93081abb8db69d4"; - sha256 = "17szim82bwnhf9q4n0n4jfmqkmhq6p0lh0j4y77a2x6lkn0pns5s"; - }; - meta.homepage = "https://github.com/chrisbra/Recover.vim/"; - }; - refactoring-nvim = buildVimPluginFrom2Nix { pname = "refactoring.nvim"; version = "2022-03-23"; @@ -5712,40 +5820,16 @@ final: prev: meta.homepage = "https://github.com/tversteeg/registers.nvim/"; }; - Rename = buildVimPluginFrom2Nix { - pname = "Rename"; - version = "2011-08-31"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "Rename"; - rev = "b240f28d2ede65fa77cd99fe045efe79202f7a34"; - sha256 = "1d1myg4zyc281zcc1ba9idbgcgxndb4a0jwqr4yqxhhzdgszw46r"; - }; - meta.homepage = "https://github.com/vim-scripts/Rename/"; - }; - renamer-nvim = buildVimPluginFrom2Nix { pname = "renamer.nvim"; version = "2022-01-15"; src = fetchFromGitHub { - owner = "filipdutescu"; - repo = "renamer.nvim"; - rev = "80d627372f90660f135862c8a7f8941b28ee5373"; - sha256 = "00ls708qx4i39gqdjw7l8i5az0k63i4y0ma30m5zsb1cz8gyzrnp"; - }; - meta.homepage = "https://github.com/filipdutescu/renamer.nvim/"; - }; - - ReplaceWithRegister = buildVimPluginFrom2Nix { - pname = "ReplaceWithRegister"; - version = "2014-10-31"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "ReplaceWithRegister"; - rev = "832efc23111d19591d495dc72286de2fb0b09345"; - sha256 = "0mb0sx85j1k59b1zz95r4vkq4kxlb4krhncq70mq7fxrs5bnhq8g"; + owner = "filipdutescu"; + repo = "renamer.nvim"; + rev = "80d627372f90660f135862c8a7f8941b28ee5373"; + sha256 = "00ls708qx4i39gqdjw7l8i5az0k63i4y0ma30m5zsb1cz8gyzrnp"; }; - meta.homepage = "https://github.com/vim-scripts/ReplaceWithRegister/"; + meta.homepage = "https://github.com/filipdutescu/renamer.nvim/"; }; rest-nvim = buildVimPluginFrom2Nix { @@ -5880,18 +5964,6 @@ final: prev: meta.homepage = "https://github.com/vmware-archive/salt-vim/"; }; - SchemaStore-nvim = buildVimPluginFrom2Nix { - pname = "SchemaStore.nvim"; - version = "2022-03-25"; - src = fetchFromGitHub { - owner = "b0o"; - repo = "SchemaStore.nvim"; - rev = "f665a87f88b7b891aa5e1f91236b5bab29c2faaf"; - sha256 = "1i90yyrm7ji8wf3if431al9ggcnps37k3lsnga3ixqa5pr7xsrg9"; - }; - meta.homepage = "https://github.com/b0o/SchemaStore.nvim/"; - }; - scrollbar-nvim = buildVimPluginFrom2Nix { pname = "scrollbar.nvim"; version = "2021-11-16"; @@ -5976,30 +6048,6 @@ final: prev: meta.homepage = "https://github.com/osyo-manga/shabadou.vim/"; }; - Shade-nvim = buildVimPluginFrom2Nix { - pname = "Shade.nvim"; - version = "2022-02-01"; - src = fetchFromGitHub { - owner = "sunjon"; - repo = "Shade.nvim"; - rev = "4286b5abc47d62d0c9ffb22a4f388b7bf2ac2461"; - sha256 = "0mb0cnf8065qmjq85hlgb4a1mqk1nwl7966l1imb54hpzw828rzl"; - }; - meta.homepage = "https://github.com/sunjon/Shade.nvim/"; - }; - - ShowMultiBase = buildVimPluginFrom2Nix { - pname = "ShowMultiBase"; - version = "2010-10-18"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "ShowMultiBase"; - rev = "85a39fd12668ce973d3d9282263912b2b8f0d338"; - sha256 = "0hg5352ahzgh2kwqha5v8ai024fld93xag93hb53wjf5b8nzsz8i"; - }; - meta.homepage = "https://github.com/vim-scripts/ShowMultiBase/"; - }; - sideways-vim = buildVimPluginFrom2Nix { pname = "sideways.vim"; version = "2022-02-12"; @@ -6013,18 +6061,6 @@ final: prev: meta.homepage = "https://github.com/AndrewRadev/sideways.vim/"; }; - SimpylFold = buildVimPluginFrom2Nix { - pname = "SimpylFold"; - version = "2021-11-04"; - src = fetchFromGitHub { - owner = "tmhedberg"; - repo = "SimpylFold"; - rev = "b4a87e509c3d873238a39d1c85d0b97d6819f283"; - sha256 = "0ff5x7ay67wn9c0mi8sb6110i93zrf97c4whg0bd7pr2nmadpvk0"; - }; - meta.homepage = "https://github.com/tmhedberg/SimpylFold/"; - }; - skim-vim = buildVimPluginFrom2Nix { pname = "skim.vim"; version = "2020-11-11"; @@ -6051,12 +6087,12 @@ final: prev: slimv = buildVimPluginFrom2Nix { pname = "slimv"; - version = "2022-02-11"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "kovisoft"; repo = "slimv"; - rev = "1b88c3a67948b446720883ed8eadb8c2b83a21ef"; - sha256 = "0m0kkc75ifg7lvk8p3vgq5iy8hr254ywj7hhjgxwzm2zbrwkr04s"; + rev = "eb5856c616466b0f463e27a30965ea142003a552"; + sha256 = "1c4hprzqzxkf0yqkqc8261qr7xk817nm28cp38dw4z1rmjcg1l04"; }; meta.homepage = "https://github.com/kovisoft/slimv/"; }; @@ -6133,30 +6169,6 @@ final: prev: meta.homepage = "https://github.com/liuchengxu/space-vim/"; }; - SpaceCamp = buildVimPluginFrom2Nix { - pname = "SpaceCamp"; - version = "2021-04-07"; - src = fetchFromGitHub { - owner = "jaredgorski"; - repo = "SpaceCamp"; - rev = "376af5c2204de61726ea86b596acb2dab9795e1f"; - sha256 = "0h3wxkswd5z9y46d6272sr210i73j5pwf5faw7qhr1plilfgx4gb"; - }; - meta.homepage = "https://github.com/jaredgorski/SpaceCamp/"; - }; - - Spacegray-vim = buildVimPluginFrom2Nix { - pname = "Spacegray.vim"; - version = "2021-07-06"; - src = fetchFromGitHub { - owner = "ackyshake"; - repo = "Spacegray.vim"; - rev = "c699ca10ed421c462bd1c87a158faaa570dc8e28"; - sha256 = "0ma8w6p5jh6llka49x5j5ql8fmhv0bx5hhsn5b2phak79yqg1k61"; - }; - meta.homepage = "https://github.com/ackyshake/Spacegray.vim/"; - }; - spacevim = buildVimPluginFrom2Nix { pname = "spacevim"; version = "2018-03-29"; @@ -6169,18 +6181,6 @@ final: prev: meta.homepage = "https://github.com/ctjhoa/spacevim/"; }; - SpaceVim = buildVimPluginFrom2Nix { - pname = "SpaceVim"; - version = "2022-03-27"; - src = fetchFromGitHub { - owner = "SpaceVim"; - repo = "SpaceVim"; - rev = "a8d183fdd97de3c1ee54c0e5f0efe9e95a19d866"; - sha256 = "0rhpasj5jw7jhij6pqjrsb48gwf4hrpadh8ab9d611v6akkkxlvv"; - }; - meta.homepage = "https://github.com/SpaceVim/SpaceVim/"; - }; - sparkup = buildVimPluginFrom2Nix { pname = "sparkup"; version = "2012-06-11"; @@ -6231,12 +6231,12 @@ final: prev: splitjoin-vim = buildVimPluginFrom2Nix { pname = "splitjoin.vim"; - version = "2022-03-21"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "AndrewRadev"; repo = "splitjoin.vim"; - rev = "c32b18751a81715e3c13cff22fea9fb5ce31ef35"; - sha256 = "12kp185ndag507b7l4qvhr369zyikwgh0wyi9lrjyr2ar5impjqc"; + rev = "dbcd3069fb2b4ecfdd964c1e93aa59fcf7f850b6"; + sha256 = "1rgc9cbfpjnk8pf7wh9pyyljckbn1i88z5bggyn15q3lfhskvidc"; fetchSubmodules = true; }; meta.homepage = "https://github.com/AndrewRadev/splitjoin.vim/"; @@ -6326,18 +6326,6 @@ final: prev: meta.homepage = "https://github.com/lambdalisue/suda.vim/"; }; - SudoEdit-vim = buildVimPluginFrom2Nix { - pname = "SudoEdit.vim"; - version = "2020-02-27"; - src = fetchFromGitHub { - owner = "chrisbra"; - repo = "SudoEdit.vim"; - rev = "e203eada5b563e9134ce2aae26b09edae0904fd7"; - sha256 = "0pf9iix50pw3p430ky51rv11ra1hppdpwa5flzcd5kciybr76n0n"; - }; - meta.homepage = "https://github.com/chrisbra/SudoEdit.vim/"; - }; - supertab = buildVimPluginFrom2Nix { pname = "supertab"; version = "2021-04-30"; @@ -6510,12 +6498,12 @@ final: prev: tagbar = buildVimPluginFrom2Nix { pname = "tagbar"; - version = "2022-03-15"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "preservim"; repo = "tagbar"; - rev = "69659cfc9d081caf31c8d548dd4c19593839317b"; - sha256 = "1wdrn0zvqhz7pd0rgl5z3zri3sy4hb947nmw9imvwi62mpdhsh7d"; + rev = "2137c1437012afc82b5d50404b1404aec8699f7b"; + sha256 = "099000mv3d2l7aidvrwgfrks48xa5xv38fvqrs6svabqg20k2wwk"; }; meta.homepage = "https://github.com/preservim/tagbar/"; }; @@ -6787,12 +6775,12 @@ final: prev: telescope-nvim = buildVimPluginFrom2Nix { pname = "telescope.nvim"; - version = "2022-03-26"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "nvim-telescope"; repo = "telescope.nvim"; - rev = "cf2d6d34282afd90f0f5d2aba265a23b068494c2"; - sha256 = "042w0l8hdcxaj3pmbp0w1mqmivfm48pv3vlcz6d423qiljbkrk9k"; + rev = "6e7ee3829225d5c97c1ebfff686050142ffe5867"; + sha256 = "0qlv63jll4ja4x2njxvz1h9mlh92akzif06qy8gr7f61gfvfaaca"; }; meta.homepage = "https://github.com/nvim-telescope/telescope.nvim/"; }; @@ -6968,12 +6956,12 @@ final: prev: toggleterm-nvim = buildVimPluginFrom2Nix { pname = "toggleterm.nvim"; - version = "2022-03-24"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "akinsho"; repo = "toggleterm.nvim"; - rev = "9f969e7f72d19966756318d61f2562f67dbb1f9c"; - sha256 = "118hwkn9cw2wsqigqvbpvbhbag6ywc325lvn088dfpzbn9k7vfmr"; + rev = "5733b24c684d202f978ccedca4a8c7571889bf28"; + sha256 = "00z21wvgjks5mqrqja1kc1wnwxpjyy2fl3sn8f16692hz2wcavrd"; }; meta.homepage = "https://github.com/akinsho/toggleterm.nvim/"; }; @@ -7038,18 +7026,6 @@ final: prev: meta.homepage = "https://github.com/folke/trouble.nvim/"; }; - TrueZen-nvim = buildVimPluginFrom2Nix { - pname = "TrueZen.nvim"; - version = "2021-10-12"; - src = fetchFromGitHub { - owner = "Pocco81"; - repo = "TrueZen.nvim"; - rev = "508b977d71650da5c9243698614a9a1416f116d4"; - sha256 = "0sr4y1mg83l28l5ias2pv0gxkcgwailfjn2skx35z63f2il3zkbx"; - }; - meta.homepage = "https://github.com/Pocco81/TrueZen.nvim/"; - }; - tslime-vim = buildVimPluginFrom2Nix { pname = "tslime.vim"; version = "2020-09-09"; @@ -7148,12 +7124,12 @@ final: prev: urlview-nvim = buildVimPluginFrom2Nix { pname = "urlview.nvim"; - version = "2022-03-29"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "axieax"; repo = "urlview.nvim"; - rev = "4ca1b22d914ff3187acd5a9486421769928c9d8f"; - sha256 = "1vy977y7favs76mpk6v3x18ph40y0d20kmm6bssvnlql1nh3ihbd"; + rev = "ca2b8bca2fa229275d3c33c13bc61a76cda9b714"; + sha256 = "10q1ifsi4z2g8f2kvij9kmfl41lysr7lnxl73m59zzp27zl2ddd8"; }; meta.homepage = "https://github.com/axieax/urlview.nvim/"; }; @@ -7170,18 +7146,6 @@ final: prev: meta.homepage = "https://github.com/vim-scripts/utl.vim/"; }; - vader-vim = buildVimPluginFrom2Nix { - pname = "vader.vim"; - version = "2020-02-13"; - src = fetchFromGitHub { - owner = "junegunn"; - repo = "vader.vim"; - rev = "6fff477431ac3191c69a3a5e5f187925466e275a"; - sha256 = "153cr1mrf5w5lyr8374brwx1z5yl9h0cnijxnd3xikh3yi3pbmwk"; - }; - meta.homepage = "https://github.com/junegunn/vader.vim/"; - }; - vCoolor-vim = buildVimPluginFrom2Nix { pname = "vCoolor.vim"; version = "2020-10-14"; @@ -7194,6 +7158,18 @@ final: prev: meta.homepage = "https://github.com/KabbAmine/vCoolor.vim/"; }; + vader-vim = buildVimPluginFrom2Nix { + pname = "vader.vim"; + version = "2020-02-13"; + src = fetchFromGitHub { + owner = "junegunn"; + repo = "vader.vim"; + rev = "6fff477431ac3191c69a3a5e5f187925466e275a"; + sha256 = "153cr1mrf5w5lyr8374brwx1z5yl9h0cnijxnd3xikh3yi3pbmwk"; + }; + meta.homepage = "https://github.com/junegunn/vader.vim/"; + }; + venn-nvim = buildVimPluginFrom2Nix { pname = "venn.nvim"; version = "2021-10-19"; @@ -7220,16 +7196,88 @@ final: prev: vifm-vim = buildVimPluginFrom2Nix { pname = "vifm.vim"; - version = "2022-03-24"; + version = "2022-03-28"; src = fetchFromGitHub { owner = "vifm"; repo = "vifm.vim"; - rev = "11d8fb106515a4c4e6016742053356c9f0434fed"; - sha256 = "1gjaqmkrxg5x6mpb7dnznbbzrv3iadcw7snxjx7bzmr0b24mddcp"; + rev = "069349e5dbba9fbb24b88ebedb89f728387fae79"; + sha256 = "1rrzhg8qpvgvcm9fkr05hmkw95gn37pys0h0d6rii6qhbx9z95vs"; }; meta.homepage = "https://github.com/vifm/vifm.vim/"; }; + vim-CtrlXA = buildVimPluginFrom2Nix { + pname = "vim-CtrlXA"; + version = "2021-08-09"; + src = fetchFromGitHub { + owner = "Konfekt"; + repo = "vim-CtrlXA"; + rev = "404ea1e055921db5679b3734108d72850d6faa76"; + sha256 = "10bgyqnwcqly3sxl27np1b690hnj1snqbcvg8pzh4zgdysfgy9xg"; + }; + meta.homepage = "https://github.com/Konfekt/vim-CtrlXA/"; + }; + + vim-DetectSpellLang = buildVimPluginFrom2Nix { + pname = "vim-DetectSpellLang"; + version = "2022-03-15"; + src = fetchFromGitHub { + owner = "konfekt"; + repo = "vim-DetectSpellLang"; + rev = "d5b55e3307e72e45f8d736818c76884016583538"; + sha256 = "0l9bdgqaxfpndpf4v5kxn34zx5pnhf62chp4flzyyhhzlz52dqjw"; + }; + meta.homepage = "https://github.com/konfekt/vim-DetectSpellLang/"; + }; + + vim-LanguageTool = buildVimPluginFrom2Nix { + pname = "vim-LanguageTool"; + version = "2021-02-08"; + src = fetchFromGitHub { + owner = "dpelle"; + repo = "vim-LanguageTool"; + rev = "0372ffae78aa3eac3bfa48ba3bf2f4015a86385a"; + sha256 = "00476l49lczj1rw5gb6vs7s9r0zi1khw0g1v6bsfwl5r32699l7r"; + }; + meta.homepage = "https://github.com/dpelle/vim-LanguageTool/"; + }; + + vim-ReplaceWithRegister = buildVimPluginFrom2Nix { + pname = "vim-ReplaceWithRegister"; + version = "2021-07-05"; + src = fetchFromGitHub { + owner = "inkarkat"; + repo = "vim-ReplaceWithRegister"; + rev = "aad1e8fa31cb4722f20fe40679caa56e25120032"; + sha256 = "1cfgixq5smwbp55x2baaj1kw736w2mykysppphair44vb4w9rlgm"; + }; + meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithRegister/"; + }; + + vim-ReplaceWithSameIndentRegister = buildVimPluginFrom2Nix { + pname = "vim-ReplaceWithSameIndentRegister"; + version = "2020-06-17"; + src = fetchFromGitHub { + owner = "inkarkat"; + repo = "vim-ReplaceWithSameIndentRegister"; + rev = "0b7f542560bd21822a004e8accdf472eb477c9cf"; + sha256 = "04zvhqh9rjfiwfk8r0zci608pw09svqb42nvp8pvqb11xp2ydg2y"; + }; + meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithSameIndentRegister/"; + }; + + vim-SyntaxRange = buildVimPluginFrom2Nix { + pname = "vim-SyntaxRange"; + version = "2021-01-16"; + src = fetchFromGitHub { + owner = "inkarkat"; + repo = "vim-SyntaxRange"; + rev = "3a7fd9ff50fabafe61df12522ed2f275c8e2f45e"; + sha256 = "1b5xyacbn87z8wkacjpnjk82xmxzivlb111427kwb5kxxdh4w7gq"; + }; + meta.homepage = "https://github.com/inkarkat/vim-SyntaxRange/"; + }; + vim-abolish = buildVimPluginFrom2Nix { pname = "vim-abolish"; version = "2021-03-20"; @@ -7484,12 +7532,12 @@ final: prev: vim-airline = buildVimPluginFrom2Nix { pname = "vim-airline"; - version = "2022-03-23"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "vim-airline"; repo = "vim-airline"; - rev = "a306a7abfd8b4450fcfdc0384dadb996148d2c1b"; - sha256 = "0qvz41rpdbcsszh0n4jhjrw9anyzsh4r1j694a3ryjj58gg9smjy"; + rev = "dc65eea5d9225758d4556278b3d808baa6ab4d0e"; + sha256 = "1mkfssssgsaqx770rarpgryp4zimfq7ljv14jzmb2bqx9iyqz5xb"; }; meta.homepage = "https://github.com/vim-airline/vim-airline/"; }; @@ -8024,12 +8072,12 @@ final: prev: vim-cool = buildVimPluginFrom2Nix { pname = "vim-cool"; - version = "2020-04-18"; + version = "2022-03-30"; src = fetchFromGitHub { owner = "romainl"; repo = "vim-cool"; - rev = "27ad4ecf7532b750fadca9f36e1c5498fc225af2"; - sha256 = "1in44gf7hs978nc9328zh1kj3jh04kcinw0m8spcbgj079782sg8"; + rev = "0ad6a212a910cef0aac7af244ee008ddd39a75c2"; + sha256 = "1jv3nl6vdn562zhd387yggwflncmy7vf89md5kkacmkvjz8rkis5"; }; meta.homepage = "https://github.com/romainl/vim-cool/"; }; @@ -8082,18 +8130,6 @@ final: prev: meta.homepage = "https://github.com/ap/vim-css-color/"; }; - vim-CtrlXA = buildVimPluginFrom2Nix { - pname = "vim-CtrlXA"; - version = "2021-08-09"; - src = fetchFromGitHub { - owner = "Konfekt"; - repo = "vim-CtrlXA"; - rev = "404ea1e055921db5679b3734108d72850d6faa76"; - sha256 = "10bgyqnwcqly3sxl27np1b690hnj1snqbcvg8pzh4zgdysfgy9xg"; - }; - meta.homepage = "https://github.com/Konfekt/vim-CtrlXA/"; - }; - vim-cue = buildVimPluginFrom2Nix { pname = "vim-cue"; version = "2021-06-18"; @@ -8178,18 +8214,6 @@ final: prev: meta.homepage = "https://github.com/sunaku/vim-dasht/"; }; - vim-DetectSpellLang = buildVimPluginFrom2Nix { - pname = "vim-DetectSpellLang"; - version = "2022-03-15"; - src = fetchFromGitHub { - owner = "konfekt"; - repo = "vim-DetectSpellLang"; - rev = "d5b55e3307e72e45f8d736818c76884016583538"; - sha256 = "0l9bdgqaxfpndpf4v5kxn34zx5pnhf62chp4flzyyhhzlz52dqjw"; - }; - meta.homepage = "https://github.com/konfekt/vim-DetectSpellLang/"; - }; - vim-deus = buildVimPluginFrom2Nix { pname = "vim-deus"; version = "2021-03-28"; @@ -8298,18 +8322,6 @@ final: prev: meta.homepage = "https://github.com/jhradilek/vim-docbk/"; }; - vim-docbk-snippets = buildVimPluginFrom2Nix { - pname = "vim-docbk-snippets"; - version = "2021-07-30"; - src = fetchFromGitHub { - owner = "jhradilek"; - repo = "vim-snippets"; - rev = "81a8dcb66886a0717e9ca73c8857ee90c3989063"; - sha256 = "0d6532qx66aiawpq2fdji0mnmvnlg5dnbvds5s4pgzafydikpr70"; - }; - meta.homepage = "https://github.com/jhradilek/vim-snippets/"; - }; - vim-easy-align = buildVimPluginFrom2Nix { pname = "vim-easy-align"; version = "2019-04-29"; @@ -8384,12 +8396,12 @@ final: prev: vim-elixir = buildVimPluginFrom2Nix { pname = "vim-elixir"; - version = "2022-01-26"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "elixir-editors"; repo = "vim-elixir"; - rev = "ff7a1223dfc5386c41bb582039a90a262d488607"; - sha256 = "0a82c6vmdjfq1cjiakdxd9mz0ivqivrjcrppqpwch9rzp98qspag"; + rev = "edf880c41ec1768faafc480433ae72ceffaf4362"; + sha256 = "14jgwgwynynlipvmr02i9h4q2mc459fz4jyflcngvpyc9ady9ald"; }; meta.homepage = "https://github.com/elixir-editors/vim-elixir/"; }; @@ -8420,12 +8432,12 @@ final: prev: vim-endwise = buildVimPluginFrom2Nix { pname = "vim-endwise"; - version = "2022-03-24"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-endwise"; - rev = "8faf48b69b04af120e162ce113ea21eac322e3b4"; - sha256 = "0zfgsqs2mal1yh8x4lj1kx2ib80clsh9s9swh44cq5ga5glfkyn8"; + rev = "720b3ee46a86fe8858baeed473e11bca54b997a9"; + sha256 = "1rql1zbzi1ffj0bdw4qkm1rbb5zscxqaml0rx0rh4y3zr7ny7vny"; }; meta.homepage = "https://github.com/tpope/vim-endwise/"; }; @@ -8480,12 +8492,12 @@ final: prev: vim-eunuch = buildVimPluginFrom2Nix { pname = "vim-eunuch"; - version = "2022-03-23"; + version = "2022-03-31"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-eunuch"; - rev = "01aa41b276b45e2df2cb680ab38e78ea7e5786c1"; - sha256 = "149hnk9ja9vnw5vr7axliyqh0l2xz6i4l3lngdlzi1xic0xfwxf5"; + rev = "c70b0ed50b5c0d806df012526104fc5342753749"; + sha256 = "1pj6rzdwalnv3x8xdgfsqh79pc21b0lhlp6ry5yzjcprghw1547d"; }; meta.homepage = "https://github.com/tpope/vim-eunuch/"; }; @@ -8540,12 +8552,12 @@ final: prev: vim-fireplace = buildVimPluginFrom2Nix { pname = "vim-fireplace"; - version = "2022-03-11"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-fireplace"; - rev = "49f213283ffd79e1a397a30ce9e11849eaacf8e1"; - sha256 = "0lk6xxbf111p1d75vagfhf1qydm1mzm4xycmyydfr46acy6a8hbk"; + rev = "2e4540d62fd49523a3aefeab896a33ed6bbcb43b"; + sha256 = "0h6ij4r5i6i72hkn8w7gw69asga7ka5addl74n2i1jhaznn7q1kb"; }; meta.homepage = "https://github.com/tpope/vim-fireplace/"; }; @@ -8672,12 +8684,12 @@ final: prev: vim-fugitive = buildVimPluginFrom2Nix { pname = "vim-fugitive"; - version = "2022-03-26"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-fugitive"; - rev = "321328c6c5901a597348155fc0e83b800544dcb0"; - sha256 = "11sd87c9vw1gs9pkvv0y24yqhkack0yxv5mg50ss6v7mjjdngv66"; + rev = "d725ef529e3de712304ab0f9c7e5e61107a00cad"; + sha256 = "0sw3qxs7j2cqzbdcip4sphmi8jj0y665kacxpgjhry6xa36rh24l"; }; meta.homepage = "https://github.com/tpope/vim-fugitive/"; }; @@ -8816,12 +8828,12 @@ final: prev: vim-go = buildVimPluginFrom2Nix { pname = "vim-go"; - version = "2022-03-19"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "fatih"; repo = "vim-go"; - rev = "dcefd64ba251ffc3d497f8758036735c8f6cc824"; - sha256 = "1j5jrs7kk59ilqsjs0qk5213psv33xnnifsqrjc7h63p28sv3pnw"; + rev = "421563081bddaec1f7a66710b5c8ee305724d2a9"; + sha256 = "0fddj4ara4zpdlri4r0rxbivr7xcf0zaakmq51m4b6k66q21f3fz"; }; meta.homepage = "https://github.com/fatih/vim-go/"; }; @@ -8922,18 +8934,6 @@ final: prev: meta.homepage = "https://github.com/chkno/vim-haskell-module-name/"; }; - vim-haskellconceal = buildVimPluginFrom2Nix { - pname = "vim-haskellconceal"; - version = "2017-06-15"; - src = fetchFromGitHub { - owner = "twinside"; - repo = "vim-haskellconceal"; - rev = "802f82a5afee56e9e1251e6f756104a3bd114234"; - sha256 = "1kh6853hi4rgl4z1xs8kz9l1q9w7lh0r42y2m0rabfpr6yh3091r"; - }; - meta.homepage = "https://github.com/twinside/vim-haskellconceal/"; - }; - vim-haskellConcealPlus = buildVimPluginFrom2Nix { pname = "vim-haskellConcealPlus"; version = "2020-01-21"; @@ -8946,6 +8946,18 @@ final: prev: meta.homepage = "https://github.com/enomsg/vim-haskellConcealPlus/"; }; + vim-haskellconceal = buildVimPluginFrom2Nix { + pname = "vim-haskellconceal"; + version = "2017-06-15"; + src = fetchFromGitHub { + owner = "twinside"; + repo = "vim-haskellconceal"; + rev = "802f82a5afee56e9e1251e6f756104a3bd114234"; + sha256 = "1kh6853hi4rgl4z1xs8kz9l1q9w7lh0r42y2m0rabfpr6yh3091r"; + }; + meta.homepage = "https://github.com/twinside/vim-haskellconceal/"; + }; + vim-hcl = buildVimPluginFrom2Nix { pname = "vim-hcl"; version = "2022-02-25"; @@ -9117,12 +9129,12 @@ final: prev: vim-illuminate = buildVimPluginFrom2Nix { pname = "vim-illuminate"; - version = "2022-03-13"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "RRethy"; repo = "vim-illuminate"; - rev = "487563de7ed6195fd46da178cb38dc1ff110c1ce"; - sha256 = "1k4pzq1gxqpcrx828ywypff1cjrns34rh8q7yz1j8nhlqvgrda9s"; + rev = "3b9b6481a659bdc37a55f488c92839e3804ca098"; + sha256 = "1vki4g6gvmr6l9yb1xhv92yix2595b17j7m75ak15k25w1dnig7h"; }; meta.homepage = "https://github.com/RRethy/vim-illuminate/"; }; @@ -9346,28 +9358,16 @@ final: prev: vim-kitty-navigator = buildVimPluginFrom2Nix { pname = "vim-kitty-navigator"; - version = "2022-02-04"; + version = "2022-03-27"; src = fetchFromGitHub { owner = "knubie"; repo = "vim-kitty-navigator"; - rev = "8d9af030c8a74cdda6ab9a510d9a13bca80e8f9b"; - sha256 = "03rf49w3x67aayfn6hl0jhf4gik1scq4khhnvicp1zabdn8cq175"; + rev = "7bf84bc1253bebb86cbf63efa274a656e1faadc6"; + sha256 = "126z01zqrpnkhi7kprl8kqwkr5ahxyrnx3pvzzmfqb9320v98d18"; }; meta.homepage = "https://github.com/knubie/vim-kitty-navigator/"; }; - vim-LanguageTool = buildVimPluginFrom2Nix { - pname = "vim-LanguageTool"; - version = "2021-02-08"; - src = fetchFromGitHub { - owner = "dpelle"; - repo = "vim-LanguageTool"; - rev = "0372ffae78aa3eac3bfa48ba3bf2f4015a86385a"; - sha256 = "00476l49lczj1rw5gb6vs7s9r0zi1khw0g1v6bsfwl5r32699l7r"; - }; - meta.homepage = "https://github.com/dpelle/vim-LanguageTool/"; - }; - vim-lastplace = buildVimPluginFrom2Nix { pname = "vim-lastplace"; version = "2022-02-22"; @@ -10295,12 +10295,12 @@ final: prev: vim-projectionist = buildVimPluginFrom2Nix { pname = "vim-projectionist"; - version = "2022-03-13"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-projectionist"; - rev = "93b2af188fe0937edea414b8e05a362b74f4b31d"; - sha256 = "13x66y0dp70s2wcz5jkcqyp1r44sn3xdn70khzgl3jlv94ij3s1y"; + rev = "37f6867fb186191bbc99bfc9d7c465dce4b7f94e"; + sha256 = "0siigy1p5iwn5nms94w22kzgajyscdzn8mcnwkmhxdzbs2c4nv9w"; }; meta.homepage = "https://github.com/tpope/vim-projectionist/"; }; @@ -10497,30 +10497,6 @@ final: prev: meta.homepage = "https://github.com/tpope/vim-repeat/"; }; - vim-ReplaceWithRegister = buildVimPluginFrom2Nix { - pname = "vim-ReplaceWithRegister"; - version = "2021-07-05"; - src = fetchFromGitHub { - owner = "inkarkat"; - repo = "vim-ReplaceWithRegister"; - rev = "aad1e8fa31cb4722f20fe40679caa56e25120032"; - sha256 = "1cfgixq5smwbp55x2baaj1kw736w2mykysppphair44vb4w9rlgm"; - }; - meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithRegister/"; - }; - - vim-ReplaceWithSameIndentRegister = buildVimPluginFrom2Nix { - pname = "vim-ReplaceWithSameIndentRegister"; - version = "2020-06-17"; - src = fetchFromGitHub { - owner = "inkarkat"; - repo = "vim-ReplaceWithSameIndentRegister"; - rev = "0b7f542560bd21822a004e8accdf472eb477c9cf"; - sha256 = "04zvhqh9rjfiwfk8r0zci608pw09svqb42nvp8pvqb11xp2ydg2y"; - }; - meta.homepage = "https://github.com/inkarkat/vim-ReplaceWithSameIndentRegister/"; - }; - vim-rhubarb = buildVimPluginFrom2Nix { pname = "vim-rhubarb"; version = "2021-09-13"; @@ -10739,12 +10715,12 @@ final: prev: vim-sleuth = buildVimPluginFrom2Nix { pname = "vim-sleuth"; - version = "2022-03-26"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "tpope"; repo = "vim-sleuth"; - rev = "edffd9ee2cfafa3aba291f105a1d4f9f0e2d5701"; - sha256 = "1rkn4qawz3p0h1pz0g712k3iz72qvapqd8k1f05kbabxymw6yqd7"; + rev = "aade27e2b1a47ae2261d95a4dd622ca2c3d34227"; + sha256 = "1xwav2657qhqaxsql50dh20n7r5n97xb2xb990wikf34mi9j4pn4"; }; meta.homepage = "https://github.com/tpope/vim-sleuth/"; }; @@ -10835,12 +10811,12 @@ final: prev: vim-snippets = buildVimPluginFrom2Nix { pname = "vim-snippets"; - version = "2022-03-27"; + version = "2022-04-02"; src = fetchFromGitHub { owner = "honza"; repo = "vim-snippets"; - rev = "57d23f6f44203374edcbb7d41903a491ec8cbed7"; - sha256 = "0371pv4pl99icxhbqbqfx7ds1i1kwv1k9p28i5pxayngkyhd7l39"; + rev = "c6d4b1cfa7a349ca561b86227cb46c4147b9c23c"; + sha256 = "0idmrcb4xigmds1iwz5rixvdcanqvv0qx7v3yg4d4p1xd4yjsiw1"; }; meta.homepage = "https://github.com/honza/vim-snippets/"; }; @@ -11013,18 +10989,6 @@ final: prev: meta.homepage = "https://github.com/machakann/vim-swap/"; }; - vim-SyntaxRange = buildVimPluginFrom2Nix { - pname = "vim-SyntaxRange"; - version = "2021-01-16"; - src = fetchFromGitHub { - owner = "inkarkat"; - repo = "vim-SyntaxRange"; - rev = "3a7fd9ff50fabafe61df12522ed2f275c8e2f45e"; - sha256 = "1b5xyacbn87z8wkacjpnjk82xmxzivlb111427kwb5kxxdh4w7gq"; - }; - meta.homepage = "https://github.com/inkarkat/vim-SyntaxRange/"; - }; - vim-table-mode = buildVimPluginFrom2Nix { pname = "vim-table-mode"; version = "2022-03-01"; @@ -11662,18 +11626,6 @@ final: prev: meta.homepage = "https://github.com/jreybert/vimagit/"; }; - VimCompletesMe = buildVimPluginFrom2Nix { - pname = "VimCompletesMe"; - version = "2022-02-18"; - src = fetchFromGitHub { - owner = "ackyshake"; - repo = "VimCompletesMe"; - rev = "9adf692d7ae6424038458a89d4a411f0a27d1388"; - sha256 = "1sndgb3291dyifaa8adri2mb8cgbinbar3nw1fnf67k9ahwycaz0"; - }; - meta.homepage = "https://github.com/ackyshake/VimCompletesMe/"; - }; - vimelette = buildVimPluginFrom2Nix { pname = "vimelette"; version = "2019-05-02"; @@ -11698,18 +11650,6 @@ final: prev: meta.homepage = "https://github.com/Shougo/vimfiler.vim/"; }; - VimOrganizer = buildVimPluginFrom2Nix { - pname = "VimOrganizer"; - version = "2020-12-15"; - src = fetchFromGitHub { - owner = "hsitz"; - repo = "VimOrganizer"; - rev = "09636aed78441a9de2767fcef6d7c567f322cc40"; - sha256 = "0phpcxmyz562yyp88rbx9pqg46w8r1lyapb700nvxwvqkcd82pfw"; - }; - meta.homepage = "https://github.com/hsitz/VimOrganizer/"; - }; - vimoutliner = buildVimPluginFrom2Nix { pname = "vimoutliner"; version = "2021-04-24"; @@ -11772,12 +11712,12 @@ final: prev: vimspector = buildVimPluginFrom2Nix { pname = "vimspector"; - version = "2022-03-23"; + version = "2022-03-29"; src = fetchFromGitHub { owner = "puremourning"; repo = "vimspector"; - rev = "99ce7a74699f12e05bf6059125d767b05ceb212b"; - sha256 = "0hj26vyq8cbw5zsq94i4hay27fs9z5xxyniflz975ddii8189qa9"; + rev = "e4b5c76b9c9e333f7cdc853af42e7ef12a1d5e58"; + sha256 = "15ycns70fafhi0nx7sriv9fkxnkkg7hz7amc1pz5rhpnns78gbnz"; fetchSubmodules = true; }; meta.homepage = "https://github.com/puremourning/vimspector/"; @@ -11785,12 +11725,12 @@ final: prev: vimtex = buildVimPluginFrom2Nix { pname = "vimtex"; - version = "2022-03-24"; + version = "2022-04-01"; src = fetchFromGitHub { owner = "lervag"; repo = "vimtex"; - rev = "4eccec4e9fc46a52ba832ac2f8ab749ea33d6790"; - sha256 = "07mydwxqhk9l0ciqpczd51x4s58asmqa3f0bznw7cdvp9qa6a6sn"; + rev = "3c14f6912318ac3d92d32eca7d66c7c1c4f3e92c"; + sha256 = "1wnj1j38gs6xcdyhia6cmd010rv2g85s816hxd1qc1zlimfvi5gr"; }; meta.homepage = "https://github.com/lervag/vimtex/"; }; @@ -11855,18 +11795,6 @@ final: prev: meta.homepage = "https://github.com/liuchengxu/vista.vim/"; }; - Vundle-vim = buildVimPluginFrom2Nix { - pname = "Vundle.vim"; - version = "2019-08-17"; - src = fetchFromGitHub { - owner = "VundleVim"; - repo = "Vundle.vim"; - rev = "b255382d6242d7ea3877bf059d2934125e0c4d95"; - sha256 = "0fkmklcq3fgvd6x6irz9bgyvcdaxafykk3k89gsi9p6b0ikw3rw6"; - }; - meta.homepage = "https://github.com/VundleVim/Vundle.vim/"; - }; - wal-vim = buildVimPluginFrom2Nix { pname = "wal.vim"; version = "2020-11-08"; @@ -11905,12 +11833,12 @@ final: prev: wilder-nvim = buildVimPluginFrom2Nix { pname = "wilder.nvim"; - version = "2022-03-13"; + version = "2022-04-03"; src = fetchFromGitHub { owner = "gelguy"; repo = "wilder.nvim"; - rev = "b59648ad8588bcba377f4eecdea317796ebd1f9d"; - sha256 = "0aic96isjssgmlqkr30m9j3895v27f3hgkgsqbl3zwkvjqa218d6"; + rev = "9c33d9423a3ba205ecdb90ce8a677c2b26f04908"; + sha256 = "19dv7ai4hs04m00w37d7bmb4c5zakfpj3mhgl15ddc6bpk3sbd7h"; }; meta.homepage = "https://github.com/gelguy/wilder.nvim/"; }; @@ -12011,18 +11939,6 @@ final: prev: meta.homepage = "https://github.com/guns/xterm-color-table.vim/"; }; - YankRing-vim = buildVimPluginFrom2Nix { - pname = "YankRing.vim"; - version = "2015-07-29"; - src = fetchFromGitHub { - owner = "vim-scripts"; - repo = "YankRing.vim"; - rev = "28854abef8fa4ebd3cb219aefcf22566997d8f65"; - sha256 = "0zdp8pdsqgrh6lfw8ipjhrig6psvmdxkim9ik801y3r373sk2hxw"; - }; - meta.homepage = "https://github.com/vim-scripts/YankRing.vim/"; - }; - yats-vim = buildVimPluginFrom2Nix { pname = "yats.vim"; version = "2022-01-05"; @@ -12036,31 +11952,6 @@ final: prev: meta.homepage = "https://github.com/HerringtonDarkholme/yats.vim/"; }; - YouCompleteMe = buildVimPluginFrom2Nix { - pname = "YouCompleteMe"; - version = "2022-03-23"; - src = fetchFromGitHub { - owner = "ycm-core"; - repo = "YouCompleteMe"; - rev = "89bba25c96866662ca38c2428f73eb64b0351ba3"; - sha256 = "0yrhvd9c0g6ay02b77sr657hn7ambcifwjfqsjywmnirr4zja45p"; - fetchSubmodules = true; - }; - meta.homepage = "https://github.com/ycm-core/YouCompleteMe/"; - }; - - YUNOcommit-vim = buildVimPluginFrom2Nix { - pname = "YUNOcommit.vim"; - version = "2014-11-26"; - src = fetchFromGitHub { - owner = "esneider"; - repo = "YUNOcommit.vim"; - rev = "981082055a73ef076d7e27477874d2303153a448"; - sha256 = "0mjc7fn405vcx1n7vadl98p5wgm6jxrlbdbkqgjq8f1m1ir81zab"; - }; - meta.homepage = "https://github.com/esneider/YUNOcommit.vim/"; - }; - zeavim-vim = buildVimPluginFrom2Nix { pname = "zeavim.vim"; version = "2019-06-07"; @@ -12145,4 +12036,124 @@ final: prev: meta.homepage = "https://github.com/nanotee/zoxide.vim/"; }; + catppuccin-nvim = buildVimPluginFrom2Nix { + pname = "catppuccin-nvim"; + version = "2022-03-20"; + src = fetchFromGitHub { + owner = "catppuccin"; + repo = "nvim"; + rev = "f079dda3dc23450d69b4bad11bfbd9af2c77f6f3"; + sha256 = "1w0n96fbrkm3vdl64v1yzkly8wpcn5g9qflmpb8r1ww9hhig7a38"; + }; + meta.homepage = "https://github.com/catppuccin/nvim/"; + }; + + chad = buildVimPluginFrom2Nix { + pname = "chad"; + version = "2022-04-03"; + src = fetchFromGitHub { + owner = "ms-jpq"; + repo = "chadtree"; + rev = "08f66a1e9f6befe914a554db90c047fe47d7e228"; + sha256 = "1dgbddn69cd8s3mbav5rs22h6ng065p27kv4wwa2s6zn27wnysky"; + }; + meta.homepage = "https://github.com/ms-jpq/chadtree/"; + }; + + dracula-vim = buildVimPluginFrom2Nix { + pname = "dracula-vim"; + version = "2022-03-24"; + src = fetchFromGitHub { + owner = "dracula"; + repo = "vim"; + rev = "d7723a842a6cfa2f62cf85530ab66eb418521dc2"; + sha256 = "1qzil8rwpdzf64gq63ds0cf509ldam77l3fz02g1mia5dry75r02"; + }; + meta.homepage = "https://github.com/dracula/vim/"; + }; + + embark-vim = buildVimPluginFrom2Nix { + pname = "embark-vim"; + version = "2022-03-28"; + src = fetchFromGitHub { + owner = "embark-theme"; + repo = "vim"; + rev = "a57dbdbd2790c52563e1194c17e6de38a0c941cf"; + sha256 = "07yzy4yjxaf59b6pyf05jrawvc4y37v2x07n1vfc2dbsxkxdygq1"; + }; + meta.homepage = "https://github.com/embark-theme/vim/"; + }; + + gruvbox-community = buildVimPluginFrom2Nix { + pname = "gruvbox-community"; + version = "2022-03-06"; + src = fetchFromGitHub { + owner = "gruvbox-community"; + repo = "gruvbox"; + rev = "b6f47ae7031f6746a1f1918c17574aa12c474ef0"; + sha256 = "0m8rrm5v542a2c30sg7hlgm7r6gs4ah1n6nr5dc101l2064kg97g"; + }; + meta.homepage = "https://github.com/gruvbox-community/gruvbox/"; + }; + + mattn-calendar-vim = buildVimPluginFrom2Nix { + pname = "mattn-calendar-vim"; + version = "2022-02-10"; + src = fetchFromGitHub { + owner = "mattn"; + repo = "calendar-vim"; + rev = "2083a41e2d310f9bbbbf644517f30e901f1fb04d"; + sha256 = "13wakcprkh93i7afykkpavxqvxssjh573pjjljsgip3y3778ms5q"; + }; + meta.homepage = "https://github.com/mattn/calendar-vim/"; + }; + + pure-lua = buildVimPluginFrom2Nix { + pname = "pure-lua"; + version = "2021-05-16"; + src = fetchFromGitHub { + owner = "shaunsingh"; + repo = "moonlight.nvim"; + rev = "e24e4218ec680b6396532808abf57ca0ada82e66"; + sha256 = "0m9w3fpypsqxydjd93arbjqb5576nl40iy27i4ijlrqhgdhl49y3"; + }; + meta.homepage = "https://github.com/shaunsingh/moonlight.nvim/"; + }; + + release = buildVimPluginFrom2Nix { + pname = "release"; + version = "2022-04-02"; + src = fetchFromGitHub { + owner = "neoclide"; + repo = "coc.nvim"; + rev = "d6a665bb13044d4899e2a3529c3ca68104d9b2f5"; + sha256 = "0pgzygvn5x2szm0fz12rlbblf1pk92r8p5fn8c7frxnmb2nsgsvd"; + }; + meta.homepage = "https://github.com/neoclide/coc.nvim/"; + }; + + rose-pine = buildVimPluginFrom2Nix { + pname = "rose-pine"; + version = "2022-04-01"; + src = fetchFromGitHub { + owner = "rose-pine"; + repo = "neovim"; + rev = "40c4fd7f5551710e388e0df85bb43d6e1627ca80"; + sha256 = "0ihzf18146q9bkqa22jq6xa2i394y6bn3fnjjgjz3zf8g8pcr6bl"; + }; + meta.homepage = "https://github.com/rose-pine/neovim/"; + }; + + vim-docbk-snippets = buildVimPluginFrom2Nix { + pname = "vim-docbk-snippets"; + version = "2021-07-30"; + src = fetchFromGitHub { + owner = "jhradilek"; + repo = "vim-snippets"; + rev = "81a8dcb66886a0717e9ca73c8857ee90c3989063"; + sha256 = "0d6532qx66aiawpq2fdji0mnmvnlg5dnbvds5s4pgzafydikpr70"; + }; + meta.homepage = "https://github.com/jhradilek/vim-snippets/"; + }; + } diff --git a/pkgs/applications/editors/vim/plugins/vim-plugin-names b/pkgs/applications/editors/vim/plugins/vim-plugin-names index f138c6d42d9c1..6845738e8a45c 100644 --- a/pkgs/applications/editors/vim/plugins/vim-plugin-names +++ b/pkgs/applications/editors/vim/plugins/vim-plugin-names @@ -1,1010 +1,1012 @@ -907th/vim-auto-save -aca/completion-tabnine -AckslD/nvim-neoclip.lua -AckslD/nvim-whichkey-setup.lua -ackyshake/Spacegray.vim -ackyshake/VimCompletesMe -ahmedkhalf/lsp-rooter.nvim -ahmedkhalf/project.nvim -airblade/vim-gitgutter -airblade/vim-rooter -ajmwagar/vim-deus -akinsho/bufferline.nvim -akinsho/toggleterm.nvim -aklt/plantuml-syntax -allendang/nvim-expand-expr -AlphaTechnolog/pywal.nvim -altercation/vim-colors-solarized -alvan/vim-closetag -alvarosevilla95/luatab.nvim -alx741/vim-hindent -alx741/vim-stylishask -AmeerTaweel/todo.nvim -amiorin/ctrlp-z -andersevenrud/cmp-tmux -andersevenrud/nordic.nvim -andrep/vimacs -andreshazard/vim-logreview -AndrewRadev/sideways.vim -AndrewRadev/splitjoin.vim -AndrewRadev/switch.vim -AndrewRadev/tagalong.vim -andsild/peskcolor.vim -andviro/flake8-vim -andweeb/presence.nvim -andymass/vim-matchup -andys8/vim-elm-syntax -antoinemadec/coc-fzf -antoinemadec/FixCursorHold.nvim -ap/vim-css-color -arcticicestudio/nord-vim@master -arkav/lualine-lsp-progress -arthurxavierx/vim-unicoder -artur-shaik/vim-javacomplete2 -autozimu/LanguageClient-neovim -axelf4/vim-strip-trailing-whitespace -axieax/urlview.nvim -ayu-theme/ayu-vim -b0o/SchemaStore.nvim -b3nj5m1n/kommentary -bakpakin/fennel.vim -bazelbuild/vim-bazel -bbchung/clighter8 -BeneCollyridam/futhark-vim -benizi/vim-automkdir -bhurlow/vim-parinfer -bitc/vim-hdevtools -bkad/camelcasemotion -bling/vim-bufferline -blueballs-theme/blueballs-neovim -blueyed/vim-diminactive -bogado/file-line -bohlender/vim-smt2 -brennanfee/vim-gui-position -bronson/vim-trailing-whitespace -brooth/far.vim -buoto/gotests-vim -camspiers/lens.vim -camspiers/snap -carlitux/deoplete-ternjs -catppuccin/nvim as catppuccin-nvim -ccarpita/rtorrent-syntax-file -cespare/vim-toml -chaoren/vim-wordmotion -chentau/marks.nvim -chikatoike/concealedyank.vim -chikatoike/sourcemap.vim -chkno/vim-haskell-module-name -chr4/nginx.vim -chr4/sslsecure.vim -chrisbra/CheckAttach -chrisbra/csv.vim -chrisbra/NrrwRgn -chrisbra/Recover.vim -chrisbra/SudoEdit.vim -chrisbra/unicode.vim -chrisgeo/sparkup -chriskempson/base16-vim -ChristianChiarulli/nvcode-color-schemes.vim -christoomey/vim-sort-motion -christoomey/vim-tmux-navigator -ciaranm/inkpot -ckarnell/antonys-macro-repeater -clojure-vim/vim-jack-in -cloudhead/neovim-fuzzy -CoatiSoftware/vim-sourcetrail -coc-extensions/coc-svelte -cocopon/iceberg.vim -codota/tabnine-vim -cohama/lexima.vim -ConradIrwin/vim-bracketed-paste -crusoexia/vim-monokai -ctjhoa/spacevim -ctrlpvim/ctrlp.vim -dag/vim-fish -dag/vim2hs -dannyob/quickfixstatus -darfink/starsearch.vim -dart-lang/dart-vim-plugin -david-a-wheeler/vim-metamath -davidhalter/jedi-vim -dcharbon/vim-flatbuffers -dense-analysis/ale -deoplete-plugins/deoplete-clang -deoplete-plugins/deoplete-dictionary -deoplete-plugins/deoplete-go -deoplete-plugins/deoplete-jedi -deoplete-plugins/deoplete-lsp -deoplete-plugins/deoplete-zsh -derekelkins/agda-vim -derekwyatt/vim-scala -dhruvasagar/vim-prosession -dhruvasagar/vim-table-mode -digitaltoad/vim-pug -direnv/direnv.vim -dleonard0/pony-vim-syntax -dmix/elvish.vim -doki-theme/doki-theme-vim -dominikduda/vim_current_word -dpelle/vim-LanguageTool -dracula/vim as dracula-vim -drewtempelmeyer/palenight.vim -drmingdrmer/xptemplate -dstein64/nvim-scrollview -dstein64/vim-startuptime -dylanaraps/wal.vim -eagletmt/ghcmod-vim -eagletmt/neco-ghc -easymotion/vim-easymotion -echasnovski/mini.nvim -eddiebergman/nvim-treesitter-pyfold -eddyekofo94/gruvbox-flat.nvim -EdenEast/nightfox.nvim -editorconfig/editorconfig-vim -edkolev/tmuxline.vim -edluffy/hologram.nvim -edluffy/specs.nvim -edwinb/idris2-vim -ehamberg/vim-cute-python -eigenfoo/stan-vim -eikenb/acp -elixir-editors/vim-elixir -ellisonleao/glow.nvim -ellisonleao/gruvbox.nvim -elmcast/elm-vim -elzr/vim-json -embark-theme/vim as embark-vim -embear/vim-localvimrc -enomsg/vim-haskellConcealPlus -enricobacis/vim-airline-clock -ervandew/supertab -esneider/YUNOcommit.vim -euclidianAce/BetterLua.vim -euclio/vim-markdown-composer -evanleck/vim-svelte -f-person/git-blame.nvim -f3fora/cmp-spell -famiu/bufdelete.nvim -fannheyward/telescope-coc.nvim -farmergreg/vim-lastplace -fatih/vim-go -fcpg/vim-osc52 -FelikZ/ctrlp-py-matcher -feline-nvim/feline.nvim -fenetikm/falcon -fhill2/floating.nvim -fhill2/telescope-ultisnips.nvim -fiatjaf/neuron.vim -filipdutescu/renamer.nvim -fisadev/vim-isort -flazz/vim-colorschemes -floobits/floobits-neovim -folke/lsp-colors.nvim -folke/lua-dev.nvim -folke/todo-comments.nvim -folke/tokyonight.nvim -folke/trouble.nvim -folke/twilight.nvim -folke/which-key.nvim -folke/zen-mode.nvim -FooSoft/vim-argwrap -freitass/todo.txt-vim -frigoeu/psc-ide-vim -fruit-in/brainfuck-vim -fruit-in/vim-nong-theme -fsharp/vim-fsharp -garbas/vim-snipmate -gbrlsnchs/telescope-lsp-handlers.nvim -gcmt/taboo.vim -gcmt/wildfire.vim -gelguy/wilder.nvim -gennaro-tedesco/nvim-jqx -gennaro-tedesco/nvim-peekup -gentoo/gentoo-syntax -GEverding/vim-hocon -gfanto/fzf-lsp.nvim -ggandor/lightspeed.nvim -gibiansky/vim-textobj-haskell -gioele/vim-autoswap -github/copilot.vim -gleam-lang/gleam.vim -glepnir/dashboard-nvim -glepnir/oceanic-material -glepnir/zephyr-nvim -glts/vim-textobj-comment -godlygeek/csapprox -godlygeek/tabular -GoldsteinE/compe-latex-symbols -google/vim-codefmt -google/vim-jsonnet -google/vim-maktaba -gorkunov/smartpairs.vim -gotcha/vimelette -gpanders/editorconfig.nvim -gregsexton/gitv -gruvbox-community/gruvbox as gruvbox-community -gu-fan/riv.vim -guns/vim-clojure-highlight -guns/vim-clojure-static -guns/vim-sexp -guns/xterm-color-table.vim -GustavoKatel/telescope-asynctasks.nvim -gyim/vim-boxdraw -haringsrob/nvim_context_vt -hashivim/vim-packer -hashivim/vim-terraform -hashivim/vim-vagrant -hauleth/sad.vim -haya14busa/incsearch-easymotion.vim -haya14busa/incsearch.vim -haya14busa/is.vim -haya14busa/vim-asterisk -haya14busa/vim-poweryank -heavenshell/vim-jsdoc -hecal3/vim-leader-guide -henrik/vim-indexed-search -HerringtonDarkholme/yats.vim -honza/vim-snippets -hotwatermorning/auto-git-diff -hrsh7th/cmp-buffer -hrsh7th/cmp-calc -hrsh7th/cmp-cmdline -hrsh7th/cmp-emoji -hrsh7th/cmp-nvim-lsp -hrsh7th/cmp-nvim-lsp-document-symbol -hrsh7th/cmp-nvim-lua -hrsh7th/cmp-omni -hrsh7th/cmp-path -hrsh7th/cmp-vsnip -hrsh7th/nvim-cmp -hrsh7th/nvim-compe -hrsh7th/vim-vsnip -hrsh7th/vim-vsnip-integ -hsanson/vim-android -hsitz/VimOrganizer -https://git.sr.ht/~whynothugo/lsp_lines.nvim -hura/vim-asymptote -iamcco/coc-spell-checker -iamcco/coc-tailwindcss -iamcco/markdown-preview.nvim -ianks/vim-tsx -idanarye/vim-merginal -idris-hackers/idris-vim -Inazuma110/deoplete-greek -inkarkat/vim-ReplaceWithRegister -inkarkat/vim-ReplaceWithSameIndentRegister -inkarkat/vim-SyntaxRange -int3/vim-extradite -Iron-E/nvim-highlite -ishan9299/nvim-solarized-lua -itchyny/calendar.vim -itchyny/lightline.vim -itchyny/thumbnail.vim -itchyny/vim-cursorword -itchyny/vim-gitbranch -itspriddle/vim-shellcheck -ivalkeen/vim-simpledb -ivanov/vim-ipython -j-hui/fidget.nvim -jackguo380/vim-lsp-cxx-highlight -jacoborus/tender.vim -jakwings/vim-pony -jamessan/vim-gnupg -jaredgorski/SpaceCamp -jasonccox/vim-wayland-clipboard -jaxbot/semantic-highlight.vim -JazzCore/ctrlp-cmatcher -jbyuki/venn.nvim -jc-doyle/cmp-pandoc-references -jceb/vim-hier -jceb/vim-orgmode -jeetsukumaran/vim-buffergator -jeetsukumaran/vim-indentwise -jeffkreeftmeijer/neovim-sensible -jeffkreeftmeijer/vim-numbertoggle -jelera/vim-javascript-syntax -jgdavey/tslime.vim -jghauser/mkdir.nvim@main -jhradilek/vim-docbk -jhradilek/vim-snippets as vim-docbk-snippets -jiangmiao/auto-pairs -jistr/vim-nerdtree-tabs -jjo/vim-cue -jlanzarotta/bufexplorer -jlesquembre/nterm.nvim -jnurmine/zenburn -jonbri/vim-colorstepper -jonsmithers/vim-html-template-literals -joonty/vim-xdebug -joosepalviste/nvim-ts-context-commentstring -jordwalke/vim-reasonml -josa42/coc-lua -josa42/nvim-lightline-lsp -josa42/vim-lightline-coc -jose-elias-alvarez/minsnip.nvim -jose-elias-alvarez/null-ls.nvim -jose-elias-alvarez/nvim-lsp-ts-utils -joshdick/onedark.vim -jpalardy/vim-slime -jparise/vim-graphql -jparise/vim-phabricator -jreybert/vimagit -jsfaint/gen_tags.vim -JuliaEditorSupport/deoplete-julia -JuliaEditorSupport/julia-vim -Julian/lean.nvim -Julian/vim-textobj-variable-segment -juliosueiras/vim-terraform-completion -junegunn/fzf.vim -junegunn/goyo.vim -junegunn/gv.vim -junegunn/limelight.vim -junegunn/seoul256.vim -junegunn/vader.vim -junegunn/vim-after-object -junegunn/vim-easy-align -junegunn/vim-emoji -junegunn/vim-github-dashboard -junegunn/vim-peekaboo -junegunn/vim-plug -junegunn/vim-slash -justincampbell/vim-eighties -justinj/vim-pico8-syntax -justinmk/vim-dirvish -justinmk/vim-sneak -jvgrootveld/telescope-zoxide -jvirtanen/vim-hcl -jvoorhis/coq.vim -KabbAmine/vCoolor.vim -KabbAmine/zeavim.vim -kalbasit/vim-colemak -kana/vim-niceblock -kana/vim-operator-replace -kana/vim-operator-user -kana/vim-tabpagecd -kana/vim-textobj-entire -kana/vim-textobj-function -kana/vim-textobj-user -karb94/neoscroll.nvim -kassio/neoterm -kbenzie/vim-spirv -kchmck/vim-coffee-script -kdheepak/cmp-latex-symbols -kdheepak/lazygit.nvim -kdheepak/tabline.nvim -KeitaNakamura/neodark.vim -KeitaNakamura/tex-conceal.vim -keith/investigate.vim -keith/rspec.vim -keith/swift.vim -kevinhwang91/nvim-bqf -kevinhwang91/nvim-hlslens -kevinhwang91/rnvimr -kien/rainbow_parentheses.vim -knubie/vim-kitty-navigator -konfekt/fastfold -Konfekt/vim-alias -Konfekt/vim-CtrlXA -konfekt/vim-DetectSpellLang -kosayoda/nvim-lightbulb -kovisoft/slimv -kristijanhusak/defx-git -kristijanhusak/defx-icons -kristijanhusak/deoplete-phpactor -kristijanhusak/vim-carbon-now-sh -kristijanhusak/vim-dadbod-completion -kristijanhusak/vim-dadbod-ui -kristijanhusak/vim-dirvish-git -kristijanhusak/vim-hybrid-material -kshenoy/vim-signature -kyazdani42/nvim-tree.lua -kyazdani42/nvim-web-devicons -l3mon4d3/luasnip -lambdalisue/fern.vim -lambdalisue/gina.vim -lambdalisue/suda.vim -lambdalisue/vim-gista -lambdalisue/vim-manpager -lambdalisue/vim-pager -latex-box-team/latex-box -ldelossa/litee-calltree.nvim -ldelossa/litee-filetree.nvim -ldelossa/litee-symboltree.nvim -ldelossa/litee.nvim -leafgarland/typescript-vim -leanprover/lean.vim -ledger/vim-ledger -lepture/vim-jinja -lervag/vimtex -lewis6991/gitsigns.nvim -lewis6991/impatient.nvim -lf-lang/lingua-franca.vim -lfe-support/vim-lfe -lfilho/cosco.vim -lifepillar/pgsql.vim -lifepillar/vim-gruvbox8 -lifepillar/vim-mucomplete -lighttiger2505/deoplete-vim-lsp -lilydjwg/colorizer -lilydjwg/fcitx.vim@fcitx5 -liuchengxu/graphviz.vim -liuchengxu/space-vim -liuchengxu/vim-clap -liuchengxu/vim-which-key -liuchengxu/vista.vim -LnL7/vim-nix -lotabout/skim.vim -luan/vim-concourse -LucHermitte/lh-brackets -LucHermitte/lh-vim-lib -ludovicchabant/vim-gutentags -ludovicchabant/vim-lawrencium -lukas-reineke/cmp-under-comparator -lukas-reineke/indent-blankline.nvim -lukaszkorecki/workflowish -lumiliet/vim-twig -luochen1990/rainbow -luukvbaal/stabilize.nvim -lyokha/vim-xkbswitch -m-pilia/vim-ccls -machakann/vim-highlightedyank -machakann/vim-sandwich -machakann/vim-swap -maksimr/vim-jsbeautify -MarcWeber/vim-addon-actions -MarcWeber/vim-addon-async -MarcWeber/vim-addon-background-cmd -MarcWeber/vim-addon-commenting -MarcWeber/vim-addon-completion -MarcWeber/vim-addon-errorformats -MarcWeber/vim-addon-goto-thing-at-cursor -MarcWeber/vim-addon-local-vimrc -MarcWeber/vim-addon-manager -MarcWeber/vim-addon-mru -MarcWeber/vim-addon-mw-utils -MarcWeber/vim-addon-nix -MarcWeber/vim-addon-other -MarcWeber/vim-addon-php-manual -MarcWeber/vim-addon-signs -MarcWeber/vim-addon-sql -MarcWeber/vim-addon-syntax-checker -MarcWeber/vim-addon-toggle-buffer -MarcWeber/vim-addon-xdebug -marko-cerovac/material.nvim -markonm/traces.vim -martinda/Jenkinsfile-vim-syntax -MattesGroeger/vim-bookmarks -mattn/calendar-vim as mattn-calendar-vim -mattn/emmet-vim -mattn/vim-gist -mattn/webapi-vim -matze/vim-move -max397574/better-escape.nvim -maximbaz/lightline-ale -maxjacobson/vim-fzf-coauthorship -MaxMEllon/vim-jsx-pretty -mbbill/undotree -mboughaba/i3config.vim -mcchrish/nnn.vim -megaannum/forms -megaannum/self -mengelbrecht/lightline-bufferline -metakirby5/codi.vim -metalelf0/jellybeans-nvim -mfukar/robotframework-vim -mfussenegger/nvim-dap -mfussenegger/nvim-jdtls -mfussenegger/nvim-lint -mg979/vim-visual-multi -mg979/vim-xtabline -mhartington/formatter.nvim -mhartington/oceanic-next -mhinz/vim-crates -mhinz/vim-grepper -mhinz/vim-janah -mhinz/vim-sayonara@7e774f58c5865d9c10d40396850b35ab95af17c5 -mhinz/vim-signify -mhinz/vim-startify -michaeljsmith/vim-indent-object -mileszs/ack.vim -milkypostman/vim-togglelist -mindriot101/vim-yapf -mk12/vim-lean -mkasa/lushtags -mlr-msft/vim-loves-dafny -moll/vim-bbye -mopp/sky-color-clock.vim -morhetz/gruvbox -motus/pig.vim -mpickering/hlint-refactor-vim -ms-jpq/chadtree@chad -ms-jpq/coq_nvim -mtikekar/vim-bsv -MunifTanjim/nui.nvim@main -mustache/vim-mustache-handlebars -mzlogin/vim-markdown-toc -mzlogin/vim-smali -nacro90/numb.nvim -nanotech/jellybeans.vim -nanotee/zoxide.vim -natebosch/vim-lsc -nathanaelkane/vim-indent-guides -nathangrigg/vim-beancount -nathanmsmith/nvim-ale-diagnostic -navarasu/onedark.nvim -navicore/vissort.vim -nbouscal/vim-stylish-haskell -ncm2/float-preview.nvim -ncm2/ncm2 -ncm2/ncm2-bufword -ncm2/ncm2-cssomni -ncm2/ncm2-github -ncm2/ncm2-html-subscope -ncm2/ncm2-jedi -ncm2/ncm2-markdown-subscope -ncm2/ncm2-neoinclude -ncm2/ncm2-neosnippet -ncm2/ncm2-path -ncm2/ncm2-syntax -ncm2/ncm2-tagprefix -ncm2/ncm2-tmux -ncm2/ncm2-ultisnips -ncm2/ncm2-vim -ndmitchell/ghcid -neoclide/coc-denite -neoclide/coc-neco -neoclide/coc.nvim@release -neoclide/denite-extra -neoclide/denite-git -neoclide/jsonc.vim -neoclide/vim-easygit -neomake/neomake -neovim/nvim-lspconfig -neovim/nvimdev.nvim -neovimhaskell/haskell-vim -neovimhaskell/nvim-hs.vim -neutaaaaan/iosvkem -nfnty/vim-nftables -nicoe/deoplete-khard -nishigori/increment-activator -nixprime/cpsm -NLKNguyen/papercolor-theme -noahfrederick/vim-noctu -noc7c9/vim-iced-coffee-script -norcalli/nvim-colorizer.lua -norcalli/nvim-terminal.lua -norcalli/snippets.nvim -NTBBloodbath/galaxyline.nvim -NTBBloodbath/rest.nvim -ntpeters/vim-better-whitespace -numirias/semshi -numtostr/comment.nvim -numToStr/FTerm.nvim -numToStr/Navigator.nvim -nvie/vim-flake8 -nvim-lua/completion-nvim -nvim-lua/diagnostic-nvim -nvim-lua/lsp-status.nvim -nvim-lua/lsp_extensions.nvim -nvim-lua/plenary.nvim -nvim-lua/popup.nvim -nvim-lualine/lualine.nvim -nvim-neorg/neorg -nvim-orgmode/orgmode -nvim-pack/nvim-spectre -nvim-telescope/telescope-cheat.nvim -nvim-telescope/telescope-dap.nvim -nvim-telescope/telescope-file-browser.nvim -nvim-telescope/telescope-frecency.nvim -nvim-telescope/telescope-fzf-native.nvim -nvim-telescope/telescope-fzf-writer.nvim -nvim-telescope/telescope-fzy-native.nvim -nvim-telescope/telescope-github.nvim -nvim-telescope/telescope-project.nvim -nvim-telescope/telescope-symbols.nvim -nvim-telescope/telescope-ui-select.nvim -nvim-telescope/telescope-z.nvim -nvim-telescope/telescope.nvim -nvim-treesitter/completion-treesitter -nvim-treesitter/nvim-treesitter -nvim-treesitter/nvim-treesitter-refactor -nvim-treesitter/nvim-treesitter-textobjects -nvim-treesitter/playground -oberblastmeister/neuron.nvim -oberblastmeister/termwrapper.nvim -ocaml/vim-ocaml -octol/vim-cpp-enhanced-highlight -ojroques/nvim-bufdel -ojroques/vim-oscyank -Olical/aniseed -Olical/conjure -olimorris/onedarkpro.nvim -onsails/diaglist.nvim -onsails/lspkind-nvim -OrangeT/vim-csharp -osyo-manga/shabadou.vim -osyo-manga/vim-anzu -osyo-manga/vim-over -osyo-manga/vim-textobj-multiblock -osyo-manga/vim-watchdogs -overcache/NeoSolarized -p00f/nvim-ts-rainbow -pangloss/vim-javascript -pantharshit00/vim-prisma -parsonsmatt/intero-neovim -PaterJason/cmp-conjure -pearofducks/ansible-vim -peitalin/vim-jsx-typescript -peterbjorgensen/sved -peterhoeg/vim-qml -PeterRincker/vim-argumentative -petRUShka/vim-opencl -phaazon/hop.nvim -phanviet/vim-monokai-pro -Pocco81/TrueZen.nvim -ponko2/deoplete-fish -posva/vim-vue -powerman/vim-plugin-AnsiEsc -PProvost/vim-ps1 -prabirshrestha/async.vim -prabirshrestha/asyncomplete-lsp.vim -prabirshrestha/asyncomplete.vim -prabirshrestha/vim-lsp -preservim/nerdcommenter -preservim/nerdtree -preservim/tagbar -preservim/vim-markdown -preservim/vim-pencil -preservim/vim-wordy -preservim/vimux -prettier/vim-prettier -projekt0n/circles.nvim -psliwka/vim-smoothie -ptzz/lf.vim -puremourning/vimspector -purescript-contrib/purescript-vim -pwntester/octo.nvim -python-mode/python-mode -qnighy/lalrpop.vim -qpkorr/vim-bufkill -quangnguyen30192/cmp-nvim-ultisnips -Quramy/tsuquyomi -racer-rust/vim-racer -radenling/vim-dispatch-neovim -rafamadriz/friendly-snippets -rafamadriz/neon -rafaqz/ranger.vim -rafi/awesome-vim-colorschemes -raghur/fruzzy -raghur/vim-ghost -Raimondi/delimitMate -rakr/vim-one -ray-x/aurora -ray-x/cmp-treesitter -ray-x/lsp_signature.nvim -rbgrouleff/bclose.vim -rbong/vim-flog -rcarriga/nvim-dap-ui -rcarriga/nvim-notify -rcarriga/vim-ultest -rebelot/kanagawa.nvim -rhysd/clever-f.vim -rhysd/committia.vim -rhysd/conflict-marker.vim -rhysd/devdocs.vim -rhysd/git-messenger.vim -rhysd/vim-clang-format -rhysd/vim-grammarous -rhysd/vim-operator-surround -RishabhRD/nvim-lsputils -RishabhRD/popfix -rktjmp/fwatch.nvim -rktjmp/hotpot.nvim -rktjmp/lush.nvim -rmagatti/auto-session -rmagatti/goto-preview -RobertAudi/securemodelines -rodjek/vim-puppet -romainl/vim-cool -romainl/vim-qf -romainl/vim-qlist -roman/golden-ratio -romgrk/barbar.nvim -romgrk/nvim-treesitter-context -ron-rs/ron.vim -ron89/thesaurus_query.vim -roxma/nvim-cm-racer -roxma/nvim-completion-manager -roxma/nvim-yarp -roxma/vim-tmux-clipboard -RRethy/nvim-base16 -RRethy/vim-hexokinase -RRethy/vim-illuminate -rstacruz/vim-closer -ruanyl/vim-gh-line -ruifm/gitlinker.nvim -rust-lang/rust.vim -ryanoasis/vim-devicons -ryvnf/readline.vim -saadparwaiz1/cmp_luasnip -saecki/crates.nvim -sainnhe/edge -sainnhe/everforest -sainnhe/gruvbox-material -sainnhe/sonokai -sakhnik/nvim-gdb -samoshkin/vim-mergetool -sbdchd/neoformat -sblumentritt/bitbake.vim -scalameta/nvim-metals -sdiehl/vim-ormolu -sebastianmarkow/deoplete-rust -SevereOverfl0w/deoplete-github -Shatur/neovim-ayu -shaunsingh/moonlight.nvim@pure-lua -shaunsingh/nord.nvim -sheerun/vim-polyglot -shinchu/lightline-gruvbox.vim -Shougo/context_filetype.vim -Shougo/defx.nvim -Shougo/denite.nvim -Shougo/deol.nvim -Shougo/deoplete.nvim -Shougo/echodoc.vim -Shougo/neco-syntax -Shougo/neco-vim -Shougo/neocomplete.vim -Shougo/neoinclude.vim -Shougo/neomru.vim -Shougo/neosnippet-snippets -Shougo/neosnippet.vim -Shougo/neoyank.vim -Shougo/tabpagebuffer.vim -Shougo/unite.vim -Shougo/vimfiler.vim -Shougo/vimproc.vim -Shougo/vimshell.vim -shumphrey/fugitive-gitlab.vim -sickill/vim-pasta -SidOfc/mkdx -simnalamburt/vim-mundo -simrat39/rust-tools.nvim -simrat39/symbols-outline.nvim -sindrets/diffview.nvim -sindrets/winshift.nvim -SirVer/ultisnips -sjl/gundo.vim -sjl/splice.vim -sk1418/last256 -skywind3000/asyncrun.vim -skywind3000/asynctasks.vim -slashmili/alchemist.vim -smiteshp/nvim-gps -sodapopcan/vim-twiggy -solarnz/arcanist.vim -sonph/onehalf -sotte/presenting.vim -SpaceVim/SpaceVim -spywhere/lightline-lsp -srcery-colors/srcery-vim -steelsojka/completion-buffers -steelsojka/pears.nvim -stefandtw/quickfix-reflector.vim -stephpy/vim-yaml -stevearc/aerial.nvim -stevearc/dressing.nvim -stsewd/fzf-checkout.vim -sudormrfbin/cheatsheet.nvim -sunaku/vim-dasht -sunjon/Shade.nvim -svermeulen/vim-subversive -symphorien/vim-nixhash -t9md/vim-choosewin -t9md/vim-smalls -TaDaa/vimade -takac/vim-hardtime -tamago324/compe-zsh -tamago324/lir.nvim -tami5/compe-conjure -tami5/lispdocs.nvim -tami5/lspsaga.nvim -tami5/sqlite.lua -tbastos/vim-lua -tbodt/deoplete-tabnine -ternjs/tern_for_vim -terrortylor/nvim-comment -terryma/vim-expand-region -terryma/vim-multiple-cursors -tex/vimpreviewpandoc -Th3Whit3Wolf/one-nvim -theHamsta/nvim-dap-virtual-text -ThePrimeagen/git-worktree.nvim -ThePrimeagen/harpoon -theprimeagen/refactoring.nvim -ThePrimeagen/vim-apm -thinca/vim-ft-diff_fold -thinca/vim-prettyprint -thinca/vim-quickrun -thinca/vim-scouter -thinca/vim-themis -thinca/vim-visualstar -thirtythreeforty/lessspace.vim -thosakwe/vim-flutter -tiagofumo/vim-nerdtree-syntax-highlight -tikhomirov/vim-glsl -TimUntersberger/neogit -tjdevries/colorbuddy.nvim -tjdevries/nlua.nvim -tjdevries/train.nvim -tmhedberg/SimpylFold -tmsvg/pear-tree -tmux-plugins/vim-tmux -tmux-plugins/vim-tmux-focus-events -tom-anders/telescope-vim-bookmarks.nvim -tomasiser/vim-code-dark -tomasr/molokai -tomlion/vim-solidity -tommcdo/vim-exchange -tommcdo/vim-fubitive -tommcdo/vim-lion -tommcdo/vim-ninja-feet -tomtom/tcomment_vim -tomtom/tlib_vim -tools-life/taskwiki -towolf/vim-helm -tpope/vim-abolish -tpope/vim-capslock -tpope/vim-commentary -tpope/vim-dadbod -tpope/vim-dispatch -tpope/vim-endwise -tpope/vim-eunuch -tpope/vim-fireplace -tpope/vim-flagship -tpope/vim-fugitive -tpope/vim-git -tpope/vim-liquid -tpope/vim-obsession -tpope/vim-pathogen -tpope/vim-projectionist -tpope/vim-ragtag -tpope/vim-rails -tpope/vim-repeat -tpope/vim-rhubarb -tpope/vim-rsi -tpope/vim-salve -tpope/vim-scriptease -tpope/vim-sensible -tpope/vim-sexp-mappings-for-regular-people -tpope/vim-sleuth -tpope/vim-speeddating -tpope/vim-surround -tpope/vim-tbone -tpope/vim-unimpaired -tpope/vim-vinegar -travitch/hasksyn -tremor-rs/tremor-vim -triglav/vim-visual-increment -troydm/zoomwintab.vim -turbio/bracey.vim -tversteeg/registers.nvim -tweekmonster/wstrip.vim -twerth/ir_black -twinside/vim-haskellconceal -Twinside/vim-hoogle -tyru/caw.vim -tyru/open-browser-github.vim -tyru/open-browser.vim -tzachar/cmp-tabnine -tzachar/compe-tabnine -uarun/vim-protobuf -udalov/kotlin-vim -ujihisa/neco-look -unblevable/quick-scope -ur4ltz/surround.nvim -urbit/hoon.vim -Valloric/MatchTagAlways -Valodim/deoplete-notmuch -vhda/verilog_systemverilog.vim -vifm/vifm.vim -vigoux/LanguageTool.nvim -vijaymarupudi/nvim-fzf -vijaymarupudi/nvim-fzf-commands -vim-airline/vim-airline -vim-airline/vim-airline-themes -vim-autoformat/vim-autoformat -vim-erlang/vim-erlang-compiler -vim-erlang/vim-erlang-omnicomplete -vim-erlang/vim-erlang-runtime -vim-erlang/vim-erlang-tags -vim-pandoc/vim-pandoc -vim-pandoc/vim-pandoc-after -vim-pandoc/vim-pandoc-syntax -vim-python/python-syntax -vim-ruby/vim-ruby -vim-scripts/a.vim -vim-scripts/align -vim-scripts/argtextobj.vim -vim-scripts/autoload_cscope.vim -vim-scripts/bats.vim -vim-scripts/BufOnly.vim -vim-scripts/changeColorScheme.vim -vim-scripts/Colour-Sampler-Pack -vim-scripts/DoxygenToolkit.vim -vim-scripts/emodeline -vim-scripts/gitignore.vim -vim-scripts/Improved-AnsiEsc -vim-scripts/jdaddy.vim -vim-scripts/matchit.zip -vim-scripts/mayansmoke -vim-scripts/PreserveNoEOL -vim-scripts/prev_indent -vim-scripts/random.vim -vim-scripts/rcshell.vim -vim-scripts/Rename -vim-scripts/ReplaceWithRegister -vim-scripts/ShowMultiBase -vim-scripts/tabmerge -vim-scripts/taglist.vim -vim-scripts/timestamp.vim -vim-scripts/utl.vim -vim-scripts/vis -vim-scripts/wombat256.vim -vim-scripts/YankRing.vim -vim-syntastic/syntastic -vim-test/vim-test -vim-utils/vim-husk -Vimjas/vim-python-pep8-indent -vimlab/split-term.vim -vimoutliner/vimoutliner -vimpostor/vim-tpipeline -vimsence/vimsence -vimwiki/vimwiki -vito-c/jq.vim -vmchale/ats-vim -vmchale/dhall-vim -vmware-archive/salt-vim -vn-ki/coc-clap -voldikss/vim-floaterm -vuki656/package-info.nvim -VundleVim/Vundle.vim -w0ng/vim-hybrid -wakatime/vim-wakatime -wannesm/wmgraphviz.vim -wbthomason/packer.nvim -weilbith/nvim-code-action-menu -wellle/targets.vim -wellle/tmux-complete.vim -wesQ3/vim-windowswap -wfxr/minimap.vim -whonore/Coqtail -will133/vim-dirdiff -wincent/command-t -wincent/ferret -wincent/terminus -windwp/nvim-autopairs -windwp/nvim-ts-autotag -winston0410/cmd-parser.nvim -winston0410/range-highlight.nvim -wlangstroth/vim-racket -wsdjeg/vim-fetch -xavierd/clang_complete -xolox/vim-easytags -xolox/vim-misc -xuhdev/vim-latex-live-preview -Xuyuanp/nerdtree-git-plugin -Xuyuanp/scrollbar.nvim -yamatsum/nvim-cursorline -yamatsum/nvim-nonicons -ycm-core/YouCompleteMe -yegappan/mru -Yggdroot/hiPairs -Yggdroot/indentLine -Yggdroot/LeaderF -Yilin-Yang/vim-markbar -yssl/QFEnter -yuki-yano/ncm2-dictionary -yunlingz/ci_dark -zah/nim.vim -zhou13/vim-easyescape -ziglang/zig.vim +repo,branch,alias +https://github.com/euclidianAce/BetterLua.vim/,, +https://github.com/vim-scripts/BufOnly.vim/,, +https://github.com/chrisbra/CheckAttach/,, +https://github.com/vim-scripts/Colour-Sampler-Pack/,, +https://github.com/whonore/Coqtail/,, +https://github.com/vim-scripts/DoxygenToolkit.vim/,, +https://github.com/numToStr/FTerm.nvim/,, +https://github.com/antoinemadec/FixCursorHold.nvim/,, +https://github.com/vim-scripts/Improved-AnsiEsc/,, +https://github.com/martinda/Jenkinsfile-vim-syntax/,, +https://github.com/autozimu/LanguageClient-neovim/,, +https://github.com/vigoux/LanguageTool.nvim/,, +https://github.com/Yggdroot/LeaderF/,, +https://github.com/Valloric/MatchTagAlways/,, +https://github.com/numToStr/Navigator.nvim/,, +https://github.com/overcache/NeoSolarized/,, +https://github.com/chrisbra/NrrwRgn/,, +https://github.com/vim-scripts/PreserveNoEOL/,, +https://github.com/yssl/QFEnter/,, +https://github.com/chrisbra/Recover.vim/,, +https://github.com/vim-scripts/Rename/,, +https://github.com/vim-scripts/ReplaceWithRegister/,, +https://github.com/b0o/SchemaStore.nvim/,, +https://github.com/sunjon/Shade.nvim/,, +https://github.com/vim-scripts/ShowMultiBase/,, +https://github.com/tmhedberg/SimpylFold/,, +https://github.com/jaredgorski/SpaceCamp/,, +https://github.com/SpaceVim/SpaceVim/,, +https://github.com/ackyshake/Spacegray.vim/,, +https://github.com/chrisbra/SudoEdit.vim/,, +https://github.com/Pocco81/TrueZen.nvim/,, +https://github.com/ackyshake/VimCompletesMe/,, +https://github.com/hsitz/VimOrganizer/,, +https://github.com/VundleVim/Vundle.vim/,, +https://github.com/esneider/YUNOcommit.vim/,, +https://github.com/vim-scripts/YankRing.vim/,, +https://github.com/ycm-core/YouCompleteMe/,, +https://github.com/vim-scripts/a.vim/,, +https://github.com/mileszs/ack.vim/,, +https://github.com/eikenb/acp/,, +https://github.com/stevearc/aerial.nvim/,, +https://github.com/derekelkins/agda-vim/,, +https://github.com/slashmili/alchemist.vim/,, +https://github.com/dense-analysis/ale/,, +https://github.com/vim-scripts/align/,, +https://github.com/Olical/aniseed/,, +https://github.com/pearofducks/ansible-vim/,, +https://github.com/ckarnell/antonys-macro-repeater/,, +https://github.com/solarnz/arcanist.vim/,, +https://github.com/vim-scripts/argtextobj.vim/,, +https://github.com/prabirshrestha/async.vim/,, +https://github.com/prabirshrestha/asyncomplete-lsp.vim/,, +https://github.com/prabirshrestha/asyncomplete.vim/,, +https://github.com/skywind3000/asyncrun.vim/,, +https://github.com/skywind3000/asynctasks.vim/,, +https://github.com/vmchale/ats-vim/,, +https://github.com/ray-x/aurora/,, +https://github.com/hotwatermorning/auto-git-diff/,, +https://github.com/jiangmiao/auto-pairs/,, +https://github.com/rmagatti/auto-session/,, +https://github.com/vim-scripts/autoload_cscope.vim/,, +https://github.com/rafi/awesome-vim-colorschemes/,, +https://github.com/ayu-theme/ayu-vim/,, +https://github.com/romgrk/barbar.nvim/,, +https://github.com/chriskempson/base16-vim/,, +https://github.com/vim-scripts/bats.vim/,, +https://github.com/rbgrouleff/bclose.vim/,, +https://github.com/max397574/better-escape.nvim/,, +https://github.com/sblumentritt/bitbake.vim/,, +https://github.com/blueballs-theme/blueballs-neovim/,, +https://github.com/turbio/bracey.vim/,, +https://github.com/fruit-in/brainfuck-vim/,, +https://github.com/famiu/bufdelete.nvim/,, +https://github.com/jlanzarotta/bufexplorer/,, +https://github.com/akinsho/bufferline.nvim/,, +https://github.com/mattn/calendar-vim/,,mattn-calendar-vim +https://github.com/itchyny/calendar.vim/,, +https://github.com/bkad/camelcasemotion/,, +https://github.com/tyru/caw.vim/,, +https://github.com/ms-jpq/chadtree/,,chad +https://github.com/vim-scripts/changeColorScheme.vim/,, +https://github.com/sudormrfbin/cheatsheet.nvim/,, +https://github.com/yunlingz/ci_dark/,, +https://github.com/projekt0n/circles.nvim/,, +https://github.com/xavierd/clang_complete/,, +https://github.com/rhysd/clever-f.vim/,, +https://github.com/bbchung/clighter8/,, +https://github.com/winston0410/cmd-parser.nvim/,, +https://github.com/hrsh7th/cmp-buffer/,, +https://github.com/hrsh7th/cmp-calc/,, +https://github.com/hrsh7th/cmp-cmdline/,, +https://github.com/PaterJason/cmp-conjure/,, +https://github.com/hrsh7th/cmp-emoji/,, +https://github.com/kdheepak/cmp-latex-symbols/,, +https://github.com/hrsh7th/cmp-nvim-lsp/,, +https://github.com/hrsh7th/cmp-nvim-lsp-document-symbol/,, +https://github.com/hrsh7th/cmp-nvim-lua/,, +https://github.com/quangnguyen30192/cmp-nvim-ultisnips/,, +https://github.com/hrsh7th/cmp-omni/,, +https://github.com/jc-doyle/cmp-pandoc-references/,, +https://github.com/hrsh7th/cmp-path/,, +https://github.com/f3fora/cmp-spell/,, +https://github.com/tzachar/cmp-tabnine/,, +https://github.com/andersevenrud/cmp-tmux/,, +https://github.com/ray-x/cmp-treesitter/,, +https://github.com/lukas-reineke/cmp-under-comparator/,, +https://github.com/hrsh7th/cmp-vsnip/,, +https://github.com/saadparwaiz1/cmp_luasnip/,, +https://github.com/vn-ki/coc-clap/,, +https://github.com/neoclide/coc-denite/,, +https://github.com/antoinemadec/coc-fzf/,, +https://github.com/josa42/coc-lua/,, +https://github.com/neoclide/coc-neco/,, +https://github.com/iamcco/coc-spell-checker/,, +https://github.com/coc-extensions/coc-svelte/,, +https://github.com/iamcco/coc-tailwindcss/,, +https://github.com/neoclide/coc.nvim/,,release +https://github.com/metakirby5/codi.vim/,, +https://github.com/tjdevries/colorbuddy.nvim/,, +https://github.com/lilydjwg/colorizer/,, +https://github.com/wincent/command-t/,, +https://github.com/numtostr/comment.nvim/,, +https://github.com/rhysd/committia.vim/,, +https://github.com/tami5/compe-conjure/,, +https://github.com/GoldsteinE/compe-latex-symbols/,, +https://github.com/tzachar/compe-tabnine/,, +https://github.com/tamago324/compe-zsh/,, +https://github.com/steelsojka/completion-buffers/,, +https://github.com/nvim-lua/completion-nvim/,, +https://github.com/aca/completion-tabnine/,, +https://github.com/nvim-treesitter/completion-treesitter/,, +https://github.com/chikatoike/concealedyank.vim/,, +https://github.com/rhysd/conflict-marker.vim/,, +https://github.com/Olical/conjure/,, +https://github.com/Shougo/context_filetype.vim/,, +https://github.com/github/copilot.vim/,, +https://github.com/jvoorhis/coq.vim/,, +https://github.com/ms-jpq/coq_nvim/,, +https://github.com/lfilho/cosco.vim/,, +https://github.com/nixprime/cpsm/,, +https://github.com/saecki/crates.nvim/,, +https://github.com/godlygeek/csapprox/,, +https://github.com/chrisbra/csv.vim/,, +https://github.com/JazzCore/ctrlp-cmatcher/,, +https://github.com/FelikZ/ctrlp-py-matcher/,, +https://github.com/amiorin/ctrlp-z/,, +https://github.com/ctrlpvim/ctrlp.vim/,, +https://github.com/dart-lang/dart-vim-plugin/,, +https://github.com/glepnir/dashboard-nvim/,, +https://github.com/kristijanhusak/defx-git/,, +https://github.com/kristijanhusak/defx-icons/,, +https://github.com/Shougo/defx.nvim/,, +https://github.com/Raimondi/delimitMate/,, +https://github.com/neoclide/denite-extra/,, +https://github.com/neoclide/denite-git/,, +https://github.com/Shougo/denite.nvim/,, +https://github.com/Shougo/deol.nvim/,, +https://github.com/deoplete-plugins/deoplete-clang/,, +https://github.com/deoplete-plugins/deoplete-dictionary/,, +https://github.com/ponko2/deoplete-fish/,, +https://github.com/SevereOverfl0w/deoplete-github/,, +https://github.com/deoplete-plugins/deoplete-go/,, +https://github.com/Inazuma110/deoplete-greek/,, +https://github.com/deoplete-plugins/deoplete-jedi/,, +https://github.com/JuliaEditorSupport/deoplete-julia/,, +https://github.com/nicoe/deoplete-khard/,, +https://github.com/deoplete-plugins/deoplete-lsp/,, +https://github.com/Valodim/deoplete-notmuch/,, +https://github.com/kristijanhusak/deoplete-phpactor/,, +https://github.com/sebastianmarkow/deoplete-rust/,, +https://github.com/tbodt/deoplete-tabnine/,, +https://github.com/carlitux/deoplete-ternjs/,, +https://github.com/lighttiger2505/deoplete-vim-lsp/,, +https://github.com/deoplete-plugins/deoplete-zsh/,, +https://github.com/Shougo/deoplete.nvim/,, +https://github.com/rhysd/devdocs.vim/,, +https://github.com/vmchale/dhall-vim/,, +https://github.com/onsails/diaglist.nvim/,, +https://github.com/nvim-lua/diagnostic-nvim/,, +https://github.com/sindrets/diffview.nvim/,, +https://github.com/direnv/direnv.vim/,, +https://github.com/doki-theme/doki-theme-vim/,, +https://github.com/stevearc/dressing.nvim/,, +https://github.com/Shougo/echodoc.vim/,, +https://github.com/sainnhe/edge/,, +https://github.com/editorconfig/editorconfig-vim/,, +https://github.com/gpanders/editorconfig.nvim/,, +https://github.com/elmcast/elm-vim/,, +https://github.com/dmix/elvish.vim/,, +https://github.com/mattn/emmet-vim/,, +https://github.com/vim-scripts/emodeline/,, +https://github.com/sainnhe/everforest/,, +https://github.com/fenetikm/falcon/,, +https://github.com/brooth/far.vim/,, +https://github.com/konfekt/fastfold/,, +https://github.com/lilydjwg/fcitx.vim/,fcitx5, +https://github.com/feline-nvim/feline.nvim/,, +https://github.com/bakpakin/fennel.vim/,, +https://github.com/lambdalisue/fern.vim/,, +https://github.com/wincent/ferret/,, +https://github.com/j-hui/fidget.nvim/,, +https://github.com/bogado/file-line/,, +https://github.com/andviro/flake8-vim/,, +https://github.com/ncm2/float-preview.nvim/,, +https://github.com/fhill2/floating.nvim/,, +https://github.com/floobits/floobits-neovim/,, +https://github.com/mhartington/formatter.nvim/,, +https://github.com/megaannum/forms/,, +https://github.com/rafamadriz/friendly-snippets/,, +https://github.com/raghur/fruzzy/,, +https://github.com/shumphrey/fugitive-gitlab.vim/,, +https://github.com/BeneCollyridam/futhark-vim/,, +https://github.com/rktjmp/fwatch.nvim/,, +https://github.com/stsewd/fzf-checkout.vim/,, +https://github.com/gfanto/fzf-lsp.nvim/,, +https://github.com/junegunn/fzf.vim/,, +https://github.com/NTBBloodbath/galaxyline.nvim/,, +https://github.com/jsfaint/gen_tags.vim/,, +https://github.com/gentoo/gentoo-syntax/,, +https://github.com/ndmitchell/ghcid/,, +https://github.com/eagletmt/ghcmod-vim/,, +https://github.com/lambdalisue/gina.vim/,, +https://github.com/f-person/git-blame.nvim/,, +https://github.com/rhysd/git-messenger.vim/,, +https://github.com/ThePrimeagen/git-worktree.nvim/,, +https://github.com/vim-scripts/gitignore.vim/,, +https://github.com/ruifm/gitlinker.nvim/,, +https://github.com/lewis6991/gitsigns.nvim/,, +https://github.com/gregsexton/gitv/,, +https://github.com/gleam-lang/gleam.vim/,, +https://github.com/ellisonleao/glow.nvim/,, +https://github.com/roman/golden-ratio/,, +https://github.com/buoto/gotests-vim/,, +https://github.com/rmagatti/goto-preview/,, +https://github.com/junegunn/goyo.vim/,, +https://github.com/liuchengxu/graphviz.vim/,, +https://github.com/gruvbox-community/gruvbox/,,gruvbox-community +https://github.com/morhetz/gruvbox/,, +https://github.com/eddyekofo94/gruvbox-flat.nvim/,, +https://github.com/sainnhe/gruvbox-material/,, +https://github.com/ellisonleao/gruvbox.nvim/,, +https://github.com/sjl/gundo.vim/,, +https://github.com/junegunn/gv.vim/,, +https://github.com/ThePrimeagen/harpoon/,, +https://github.com/neovimhaskell/haskell-vim/,, +https://github.com/travitch/hasksyn/,, +https://github.com/Yggdroot/hiPairs/,, +https://github.com/mpickering/hlint-refactor-vim/,, +https://github.com/edluffy/hologram.nvim/,, +https://github.com/urbit/hoon.vim/,, +https://github.com/phaazon/hop.nvim/,, +https://github.com/rktjmp/hotpot.nvim/,, +https://github.com/mboughaba/i3config.vim/,, +https://github.com/cocopon/iceberg.vim/,, +https://github.com/idris-hackers/idris-vim/,, +https://github.com/edwinb/idris2-vim/,, +https://github.com/lewis6991/impatient.nvim/,, +https://github.com/nishigori/increment-activator/,, +https://github.com/haya14busa/incsearch-easymotion.vim/,, +https://github.com/haya14busa/incsearch.vim/,, +https://github.com/lukas-reineke/indent-blankline.nvim/,, +https://github.com/Yggdroot/indentLine/,, +https://github.com/ciaranm/inkpot/,, +https://github.com/parsonsmatt/intero-neovim/,, +https://github.com/keith/investigate.vim/,, +https://github.com/neutaaaaan/iosvkem/,, +https://github.com/twerth/ir_black/,, +https://github.com/haya14busa/is.vim/,, +https://github.com/vim-scripts/jdaddy.vim/,, +https://github.com/davidhalter/jedi-vim/,, +https://github.com/metalelf0/jellybeans-nvim/,, +https://github.com/nanotech/jellybeans.vim/,, +https://github.com/vito-c/jq.vim/,, +https://github.com/neoclide/jsonc.vim/,, +https://github.com/JuliaEditorSupport/julia-vim/,, +https://github.com/rebelot/kanagawa.nvim/,, +https://github.com/b3nj5m1n/kommentary/,, +https://github.com/udalov/kotlin-vim/,, +https://github.com/qnighy/lalrpop.vim/,, +https://github.com/sk1418/last256/,, +https://github.com/latex-box-team/latex-box/,, +https://github.com/kdheepak/lazygit.nvim/,, +https://github.com/Julian/lean.nvim/,, +https://github.com/leanprover/lean.vim/,, +https://github.com/camspiers/lens.vim/,, +https://github.com/thirtythreeforty/lessspace.vim/,, +https://github.com/cohama/lexima.vim/,, +https://github.com/ptzz/lf.vim/,, +https://github.com/LucHermitte/lh-brackets/,, +https://github.com/LucHermitte/lh-vim-lib/,, +https://github.com/maximbaz/lightline-ale/,, +https://github.com/mengelbrecht/lightline-bufferline/,, +https://github.com/shinchu/lightline-gruvbox.vim/,, +https://github.com/spywhere/lightline-lsp/,, +https://github.com/itchyny/lightline.vim/,, +https://github.com/ggandor/lightspeed.nvim/,, +https://github.com/junegunn/limelight.vim/,, +https://github.com/lf-lang/lingua-franca.vim/,, +https://github.com/tamago324/lir.nvim/,, +https://github.com/tami5/lispdocs.nvim/,, +https://github.com/ldelossa/litee-calltree.nvim/,, +https://github.com/ldelossa/litee-filetree.nvim/,, +https://github.com/ldelossa/litee-symboltree.nvim/,, +https://github.com/ldelossa/litee.nvim/,, +https://github.com/folke/lsp-colors.nvim/,, +https://github.com/ahmedkhalf/lsp-rooter.nvim/,, +https://github.com/nvim-lua/lsp-status.nvim/,, +https://github.com/nvim-lua/lsp_extensions.nvim/,, +https://git.sr.ht/~whynothugo/lsp_lines.nvim,, +https://github.com/ray-x/lsp_signature.nvim/,, +https://github.com/onsails/lspkind-nvim/,, +https://github.com/tami5/lspsaga.nvim/,, +https://github.com/folke/lua-dev.nvim/,, +https://github.com/arkav/lualine-lsp-progress/,, +https://github.com/nvim-lualine/lualine.nvim/,, +https://github.com/l3mon4d3/luasnip/,, +https://github.com/alvarosevilla95/luatab.nvim/,, +https://github.com/rktjmp/lush.nvim/,, +https://github.com/mkasa/lushtags/,, +https://github.com/iamcco/markdown-preview.nvim/,, +https://github.com/chentau/marks.nvim/,, +https://github.com/vim-scripts/matchit.zip/,, +https://github.com/marko-cerovac/material.nvim/,, +https://github.com/vim-scripts/mayansmoke/,, +https://github.com/echasnovski/mini.nvim/,, +https://github.com/wfxr/minimap.vim/,, +https://github.com/jose-elias-alvarez/minsnip.nvim/,, +https://github.com/jghauser/mkdir.nvim/,main, +https://github.com/SidOfc/mkdx/,, +https://github.com/tomasr/molokai/,, +https://github.com/shaunsingh/moonlight.nvim/,,pure-lua +https://github.com/yegappan/mru/,, +https://github.com/ncm2/ncm2/,, +https://github.com/ncm2/ncm2-bufword/,, +https://github.com/ncm2/ncm2-cssomni/,, +https://github.com/yuki-yano/ncm2-dictionary/,, +https://github.com/ncm2/ncm2-github/,, +https://github.com/ncm2/ncm2-html-subscope/,, +https://github.com/ncm2/ncm2-jedi/,, +https://github.com/ncm2/ncm2-markdown-subscope/,, +https://github.com/ncm2/ncm2-neoinclude/,, +https://github.com/ncm2/ncm2-neosnippet/,, +https://github.com/ncm2/ncm2-path/,, +https://github.com/ncm2/ncm2-syntax/,, +https://github.com/ncm2/ncm2-tagprefix/,, +https://github.com/ncm2/ncm2-tmux/,, +https://github.com/ncm2/ncm2-ultisnips/,, +https://github.com/ncm2/ncm2-vim/,, +https://github.com/eagletmt/neco-ghc/,, +https://github.com/ujihisa/neco-look/,, +https://github.com/Shougo/neco-syntax/,, +https://github.com/Shougo/neco-vim/,, +https://github.com/Shougo/neocomplete.vim/,, +https://github.com/KeitaNakamura/neodark.vim/,, +https://github.com/sbdchd/neoformat/,, +https://github.com/TimUntersberger/neogit/,, +https://github.com/Shougo/neoinclude.vim/,, +https://github.com/neomake/neomake/,, +https://github.com/Shougo/neomru.vim/,, +https://github.com/rafamadriz/neon/,, +https://github.com/nvim-neorg/neorg/,, +https://github.com/karb94/neoscroll.nvim/,, +https://github.com/Shougo/neosnippet-snippets/,, +https://github.com/Shougo/neosnippet.vim/,, +https://github.com/kassio/neoterm/,, +https://github.com/rose-pine/neovim/,main,rose-pine +https://github.com/Shatur/neovim-ayu/,, +https://github.com/cloudhead/neovim-fuzzy/,, +https://github.com/jeffkreeftmeijer/neovim-sensible/,, +https://github.com/Shougo/neoyank.vim/,, +https://github.com/preservim/nerdcommenter/,, +https://github.com/preservim/nerdtree/,, +https://github.com/Xuyuanp/nerdtree-git-plugin/,, +https://github.com/oberblastmeister/neuron.nvim/,, +https://github.com/fiatjaf/neuron.vim/,, +https://github.com/chr4/nginx.vim/,, +https://github.com/EdenEast/nightfox.nvim/,, +https://github.com/zah/nim.vim/,, +https://github.com/tjdevries/nlua.nvim/,, +https://github.com/mcchrish/nnn.vim/,, +https://github.com/arcticicestudio/nord-vim/,master, +https://github.com/shaunsingh/nord.nvim/,, +https://github.com/andersevenrud/nordic.nvim/,, +https://github.com/jlesquembre/nterm.nvim/,, +https://github.com/MunifTanjim/nui.nvim/,main, +https://github.com/jose-elias-alvarez/null-ls.nvim/,, +https://github.com/nacro90/numb.nvim/,, +https://github.com/ChristianChiarulli/nvcode-color-schemes.vim/,, +https://github.com/catppuccin/nvim/,,catppuccin-nvim +https://github.com/nathanmsmith/nvim-ale-diagnostic/,, +https://github.com/windwp/nvim-autopairs/,, +https://github.com/RRethy/nvim-base16/,, +https://github.com/kevinhwang91/nvim-bqf/,, +https://github.com/ojroques/nvim-bufdel/,, +https://github.com/roxma/nvim-cm-racer/,, +https://github.com/hrsh7th/nvim-cmp/,, +https://github.com/weilbith/nvim-code-action-menu/,, +https://github.com/norcalli/nvim-colorizer.lua/,, +https://github.com/terrortylor/nvim-comment/,, +https://github.com/hrsh7th/nvim-compe/,, +https://github.com/roxma/nvim-completion-manager/,, +https://github.com/yamatsum/nvim-cursorline/,, +https://github.com/mfussenegger/nvim-dap/,, +https://github.com/rcarriga/nvim-dap-ui/,, +https://github.com/theHamsta/nvim-dap-virtual-text/,, +https://github.com/allendang/nvim-expand-expr/,, +https://github.com/vijaymarupudi/nvim-fzf/,, +https://github.com/vijaymarupudi/nvim-fzf-commands/,, +https://github.com/sakhnik/nvim-gdb/,, +https://github.com/smiteshp/nvim-gps/,, +https://github.com/Iron-E/nvim-highlite/,, +https://github.com/kevinhwang91/nvim-hlslens/,, +https://github.com/neovimhaskell/nvim-hs.vim/,, +https://github.com/mfussenegger/nvim-jdtls/,, +https://github.com/gennaro-tedesco/nvim-jqx/,, +https://github.com/kosayoda/nvim-lightbulb/,, +https://github.com/josa42/nvim-lightline-lsp/,, +https://github.com/mfussenegger/nvim-lint/,, +https://github.com/jose-elias-alvarez/nvim-lsp-ts-utils/,, +https://github.com/neovim/nvim-lspconfig/,, +https://github.com/RishabhRD/nvim-lsputils/,, +https://github.com/scalameta/nvim-metals/,, +https://github.com/AckslD/nvim-neoclip.lua/,, +https://github.com/yamatsum/nvim-nonicons/,, +https://github.com/rcarriga/nvim-notify/,, +https://github.com/gennaro-tedesco/nvim-peekup/,, +https://github.com/dstein64/nvim-scrollview/,, +https://github.com/ishan9299/nvim-solarized-lua/,, +https://github.com/nvim-pack/nvim-spectre/,, +https://github.com/norcalli/nvim-terminal.lua/,, +https://github.com/kyazdani42/nvim-tree.lua/,, +https://github.com/nvim-treesitter/nvim-treesitter/,, +https://github.com/romgrk/nvim-treesitter-context/,, +https://github.com/eddiebergman/nvim-treesitter-pyfold/,, +https://github.com/nvim-treesitter/nvim-treesitter-refactor/,, +https://github.com/nvim-treesitter/nvim-treesitter-textobjects/,, +https://github.com/windwp/nvim-ts-autotag/,, +https://github.com/joosepalviste/nvim-ts-context-commentstring/,, +https://github.com/p00f/nvim-ts-rainbow/,, +https://github.com/kyazdani42/nvim-web-devicons/,, +https://github.com/AckslD/nvim-whichkey-setup.lua/,, +https://github.com/roxma/nvim-yarp/,, +https://github.com/haringsrob/nvim_context_vt/,, +https://github.com/neovim/nvimdev.nvim/,, +https://github.com/glepnir/oceanic-material/,, +https://github.com/mhartington/oceanic-next/,, +https://github.com/pwntester/octo.nvim/,, +https://github.com/Th3Whit3Wolf/one-nvim/,, +https://github.com/navarasu/onedark.nvim/,, +https://github.com/joshdick/onedark.vim/,, +https://github.com/olimorris/onedarkpro.nvim/,, +https://github.com/sonph/onehalf/,, +https://github.com/tyru/open-browser-github.vim/,, +https://github.com/tyru/open-browser.vim/,, +https://github.com/nvim-orgmode/orgmode/,, +https://github.com/vuki656/package-info.nvim/,, +https://github.com/wbthomason/packer.nvim/,, +https://github.com/drewtempelmeyer/palenight.vim/,, +https://github.com/NLKNguyen/papercolor-theme/,, +https://github.com/tmsvg/pear-tree/,, +https://github.com/steelsojka/pears.nvim/,, +https://github.com/andsild/peskcolor.vim/,, +https://github.com/lifepillar/pgsql.vim/,, +https://github.com/motus/pig.vim/,, +https://github.com/aklt/plantuml-syntax/,, +https://github.com/nvim-treesitter/playground/,, +https://github.com/nvim-lua/plenary.nvim/,, +https://github.com/dleonard0/pony-vim-syntax/,, +https://github.com/RishabhRD/popfix/,, +https://github.com/nvim-lua/popup.nvim/,, +https://github.com/andweeb/presence.nvim/,, +https://github.com/sotte/presenting.vim/,, +https://github.com/vim-scripts/prev_indent/,, +https://github.com/ahmedkhalf/project.nvim/,, +https://github.com/frigoeu/psc-ide-vim/,, +https://github.com/purescript-contrib/purescript-vim/,, +https://github.com/python-mode/python-mode/,, +https://github.com/vim-python/python-syntax/,, +https://github.com/AlphaTechnolog/pywal.nvim/,, +https://github.com/unblevable/quick-scope/,, +https://github.com/stefandtw/quickfix-reflector.vim/,, +https://github.com/dannyob/quickfixstatus/,, +https://github.com/luochen1990/rainbow/,, +https://github.com/kien/rainbow_parentheses.vim/,, +https://github.com/vim-scripts/random.vim/,, +https://github.com/winston0410/range-highlight.nvim/,, +https://github.com/rafaqz/ranger.vim/,, +https://github.com/vim-scripts/rcshell.vim/,, +https://github.com/ryvnf/readline.vim/,, +https://github.com/theprimeagen/refactoring.nvim/,, +https://github.com/tversteeg/registers.nvim/,, +https://github.com/filipdutescu/renamer.nvim/,, +https://github.com/NTBBloodbath/rest.nvim/,, +https://github.com/gu-fan/riv.vim/,, +https://github.com/kevinhwang91/rnvimr/,, +https://github.com/mfukar/robotframework-vim/,, +https://github.com/ron-rs/ron.vim/,, +https://github.com/keith/rspec.vim/,, +https://github.com/ccarpita/rtorrent-syntax-file/,, +https://github.com/simrat39/rust-tools.nvim/,, +https://github.com/rust-lang/rust.vim/,, +https://github.com/hauleth/sad.vim/,, +https://github.com/vmware-archive/salt-vim/,, +https://github.com/Xuyuanp/scrollbar.nvim/,, +https://github.com/RobertAudi/securemodelines/,, +https://github.com/megaannum/self/,, +https://github.com/jaxbot/semantic-highlight.vim/,, +https://github.com/numirias/semshi/,, +https://github.com/junegunn/seoul256.vim/,, +https://github.com/osyo-manga/shabadou.vim/,, +https://github.com/AndrewRadev/sideways.vim/,, +https://github.com/lotabout/skim.vim/,, +https://github.com/mopp/sky-color-clock.vim/,, +https://github.com/kovisoft/slimv/,, +https://github.com/gorkunov/smartpairs.vim/,, +https://github.com/camspiers/snap/,, +https://github.com/norcalli/snippets.nvim/,, +https://github.com/sainnhe/sonokai/,, +https://github.com/chikatoike/sourcemap.vim/,, +https://github.com/liuchengxu/space-vim/,, +https://github.com/ctjhoa/spacevim/,, +https://github.com/chrisgeo/sparkup/,, +https://github.com/edluffy/specs.nvim/,, +https://github.com/sjl/splice.vim/,, +https://github.com/vimlab/split-term.vim/,, +https://github.com/AndrewRadev/splitjoin.vim/,, +https://github.com/tami5/sqlite.lua/,, +https://github.com/srcery-colors/srcery-vim/,, +https://github.com/chr4/sslsecure.vim/,, +https://github.com/luukvbaal/stabilize.nvim/,, +https://github.com/eigenfoo/stan-vim/,, +https://github.com/darfink/starsearch.vim/,, +https://github.com/lambdalisue/suda.vim/,, +https://github.com/ervandew/supertab/,, +https://github.com/ur4ltz/surround.nvim/,, +https://github.com/peterbjorgensen/sved/,, +https://github.com/keith/swift.vim/,, +https://github.com/AndrewRadev/switch.vim/,, +https://github.com/simrat39/symbols-outline.nvim/,, +https://github.com/vim-syntastic/syntastic/,, +https://github.com/kdheepak/tabline.nvim/,, +https://github.com/vim-scripts/tabmerge/,, +https://github.com/codota/tabnine-vim/,, +https://github.com/gcmt/taboo.vim/,, +https://github.com/Shougo/tabpagebuffer.vim/,, +https://github.com/godlygeek/tabular/,, +https://github.com/AndrewRadev/tagalong.vim/,, +https://github.com/preservim/tagbar/,, +https://github.com/vim-scripts/taglist.vim/,, +https://github.com/wellle/targets.vim/,, +https://github.com/tools-life/taskwiki/,, +https://github.com/tomtom/tcomment_vim/,, +https://github.com/GustavoKatel/telescope-asynctasks.nvim/,, +https://github.com/nvim-telescope/telescope-cheat.nvim/,, +https://github.com/fannheyward/telescope-coc.nvim/,, +https://github.com/nvim-telescope/telescope-dap.nvim/,, +https://github.com/nvim-telescope/telescope-file-browser.nvim/,, +https://github.com/nvim-telescope/telescope-frecency.nvim/,, +https://github.com/nvim-telescope/telescope-fzf-native.nvim/,, +https://github.com/nvim-telescope/telescope-fzf-writer.nvim/,, +https://github.com/nvim-telescope/telescope-fzy-native.nvim/,, +https://github.com/nvim-telescope/telescope-github.nvim/,, +https://github.com/gbrlsnchs/telescope-lsp-handlers.nvim/,, +https://github.com/nvim-telescope/telescope-project.nvim/,, +https://github.com/nvim-telescope/telescope-symbols.nvim/,, +https://github.com/nvim-telescope/telescope-ui-select.nvim/,, +https://github.com/fhill2/telescope-ultisnips.nvim/,, +https://github.com/tom-anders/telescope-vim-bookmarks.nvim/,, +https://github.com/nvim-telescope/telescope-z.nvim/,, +https://github.com/jvgrootveld/telescope-zoxide/,, +https://github.com/nvim-telescope/telescope.nvim/,, +https://github.com/jacoborus/tender.vim/,, +https://github.com/wincent/terminus/,, +https://github.com/oberblastmeister/termwrapper.nvim/,, +https://github.com/ternjs/tern_for_vim/,, +https://github.com/KeitaNakamura/tex-conceal.vim/,, +https://github.com/ron89/thesaurus_query.vim/,, +https://github.com/itchyny/thumbnail.vim/,, +https://github.com/vim-scripts/timestamp.vim/,, +https://github.com/tomtom/tlib_vim/,, +https://github.com/wellle/tmux-complete.vim/,, +https://github.com/edkolev/tmuxline.vim/,, +https://github.com/folke/todo-comments.nvim/,, +https://github.com/AmeerTaweel/todo.nvim/,, +https://github.com/freitass/todo.txt-vim/,, +https://github.com/akinsho/toggleterm.nvim/,, +https://github.com/folke/tokyonight.nvim/,, +https://github.com/markonm/traces.vim/,, +https://github.com/tjdevries/train.nvim/,, +https://github.com/tremor-rs/tremor-vim/,, +https://github.com/folke/trouble.nvim/,, +https://github.com/jgdavey/tslime.vim/,, +https://github.com/Quramy/tsuquyomi/,, +https://github.com/folke/twilight.nvim/,, +https://github.com/leafgarland/typescript-vim/,, +https://github.com/SirVer/ultisnips/,, +https://github.com/mbbill/undotree/,, +https://github.com/chrisbra/unicode.vim/,, +https://github.com/Shougo/unite.vim/,, +https://github.com/axieax/urlview.nvim/,, +https://github.com/vim-scripts/utl.vim/,, +https://github.com/KabbAmine/vCoolor.vim/,, +https://github.com/junegunn/vader.vim/,, +https://github.com/jbyuki/venn.nvim/,, +https://github.com/vhda/verilog_systemverilog.vim/,, +https://github.com/vifm/vifm.vim/,, +https://github.com/dracula/vim/,,dracula-vim +https://github.com/embark-theme/vim/,,embark-vim +https://github.com/Konfekt/vim-CtrlXA/,, +https://github.com/konfekt/vim-DetectSpellLang/,, +https://github.com/dpelle/vim-LanguageTool/,, +https://github.com/inkarkat/vim-ReplaceWithRegister/,, +https://github.com/inkarkat/vim-ReplaceWithSameIndentRegister/,, +https://github.com/inkarkat/vim-SyntaxRange/,, +https://github.com/tpope/vim-abolish/,, +https://github.com/MarcWeber/vim-addon-actions/,, +https://github.com/MarcWeber/vim-addon-async/,, +https://github.com/MarcWeber/vim-addon-background-cmd/,, +https://github.com/MarcWeber/vim-addon-commenting/,, +https://github.com/MarcWeber/vim-addon-completion/,, +https://github.com/MarcWeber/vim-addon-errorformats/,, +https://github.com/MarcWeber/vim-addon-goto-thing-at-cursor/,, +https://github.com/MarcWeber/vim-addon-local-vimrc/,, +https://github.com/MarcWeber/vim-addon-manager/,, +https://github.com/MarcWeber/vim-addon-mru/,, +https://github.com/MarcWeber/vim-addon-mw-utils/,, +https://github.com/MarcWeber/vim-addon-nix/,, +https://github.com/MarcWeber/vim-addon-other/,, +https://github.com/MarcWeber/vim-addon-php-manual/,, +https://github.com/MarcWeber/vim-addon-signs/,, +https://github.com/MarcWeber/vim-addon-sql/,, +https://github.com/MarcWeber/vim-addon-syntax-checker/,, +https://github.com/MarcWeber/vim-addon-toggle-buffer/,, +https://github.com/MarcWeber/vim-addon-xdebug/,, +https://github.com/junegunn/vim-after-object/,, +https://github.com/vim-airline/vim-airline/,, +https://github.com/enricobacis/vim-airline-clock/,, +https://github.com/vim-airline/vim-airline-themes/,, +https://github.com/Konfekt/vim-alias/,, +https://github.com/hsanson/vim-android/,, +https://github.com/osyo-manga/vim-anzu/,, +https://github.com/ThePrimeagen/vim-apm/,, +https://github.com/PeterRincker/vim-argumentative/,, +https://github.com/FooSoft/vim-argwrap/,, +https://github.com/haya14busa/vim-asterisk/,, +https://github.com/hura/vim-asymptote/,, +https://github.com/907th/vim-auto-save/,, +https://github.com/vim-autoformat/vim-autoformat/,, +https://github.com/benizi/vim-automkdir/,, +https://github.com/gioele/vim-autoswap/,, +https://github.com/bazelbuild/vim-bazel/,, +https://github.com/moll/vim-bbye/,, +https://github.com/nathangrigg/vim-beancount/,, +https://github.com/ntpeters/vim-better-whitespace/,, +https://github.com/MattesGroeger/vim-bookmarks/,, +https://github.com/gyim/vim-boxdraw/,, +https://github.com/ConradIrwin/vim-bracketed-paste/,, +https://github.com/mtikekar/vim-bsv/,, +https://github.com/jeetsukumaran/vim-buffergator/,, +https://github.com/bling/vim-bufferline/,, +https://github.com/qpkorr/vim-bufkill/,, +https://github.com/tpope/vim-capslock/,, +https://github.com/kristijanhusak/vim-carbon-now-sh/,, +https://github.com/m-pilia/vim-ccls/,, +https://github.com/t9md/vim-choosewin/,, +https://github.com/rhysd/vim-clang-format/,, +https://github.com/liuchengxu/vim-clap/,, +https://github.com/guns/vim-clojure-highlight/,, +https://github.com/guns/vim-clojure-static/,, +https://github.com/rstacruz/vim-closer/,, +https://github.com/alvan/vim-closetag/,, +https://github.com/tomasiser/vim-code-dark/,, +https://github.com/google/vim-codefmt/,, +https://github.com/kchmck/vim-coffee-script/,, +https://github.com/kalbasit/vim-colemak/,, +https://github.com/altercation/vim-colors-solarized/,, +https://github.com/flazz/vim-colorschemes/,, +https://github.com/jonbri/vim-colorstepper/,, +https://github.com/tpope/vim-commentary/,, +https://github.com/luan/vim-concourse/,, +https://github.com/romainl/vim-cool/,, +https://github.com/octol/vim-cpp-enhanced-highlight/,, +https://github.com/mhinz/vim-crates/,, +https://github.com/OrangeT/vim-csharp/,, +https://github.com/ap/vim-css-color/,, +https://github.com/jjo/vim-cue/,, +https://github.com/itchyny/vim-cursorword/,, +https://github.com/ehamberg/vim-cute-python/,, +https://github.com/tpope/vim-dadbod/,, +https://github.com/kristijanhusak/vim-dadbod-completion/,, +https://github.com/kristijanhusak/vim-dadbod-ui/,, +https://github.com/sunaku/vim-dasht/,, +https://github.com/ajmwagar/vim-deus/,, +https://github.com/ryanoasis/vim-devicons/,, +https://github.com/blueyed/vim-diminactive/,, +https://github.com/will133/vim-dirdiff/,, +https://github.com/justinmk/vim-dirvish/,, +https://github.com/kristijanhusak/vim-dirvish-git/,, +https://github.com/tpope/vim-dispatch/,, +https://github.com/radenling/vim-dispatch-neovim/,, +https://github.com/jhradilek/vim-docbk/,, +https://github.com/junegunn/vim-easy-align/,, +https://github.com/zhou13/vim-easyescape/,, +https://github.com/neoclide/vim-easygit/,, +https://github.com/easymotion/vim-easymotion/,, +https://github.com/xolox/vim-easytags/,, +https://github.com/justincampbell/vim-eighties/,, +https://github.com/elixir-editors/vim-elixir/,, +https://github.com/andys8/vim-elm-syntax/,, +https://github.com/junegunn/vim-emoji/,, +https://github.com/tpope/vim-endwise/,, +https://github.com/vim-erlang/vim-erlang-compiler/,, +https://github.com/vim-erlang/vim-erlang-omnicomplete/,, +https://github.com/vim-erlang/vim-erlang-runtime/,, +https://github.com/vim-erlang/vim-erlang-tags/,, +https://github.com/tpope/vim-eunuch/,, +https://github.com/tommcdo/vim-exchange/,, +https://github.com/terryma/vim-expand-region/,, +https://github.com/int3/vim-extradite/,, +https://github.com/wsdjeg/vim-fetch/,, +https://github.com/tpope/vim-fireplace/,, +https://github.com/dag/vim-fish/,, +https://github.com/tpope/vim-flagship/,, +https://github.com/nvie/vim-flake8/,, +https://github.com/dcharbon/vim-flatbuffers/,, +https://github.com/voldikss/vim-floaterm/,, +https://github.com/rbong/vim-flog/,, +https://github.com/thosakwe/vim-flutter/,, +https://github.com/fsharp/vim-fsharp/,, +https://github.com/thinca/vim-ft-diff_fold/,, +https://github.com/tommcdo/vim-fubitive/,, +https://github.com/tpope/vim-fugitive/,, +https://github.com/maxjacobson/vim-fzf-coauthorship/,, +https://github.com/ruanyl/vim-gh-line/,, +https://github.com/raghur/vim-ghost/,, +https://github.com/mattn/vim-gist/,, +https://github.com/lambdalisue/vim-gista/,, +https://github.com/tpope/vim-git/,, +https://github.com/itchyny/vim-gitbranch/,, +https://github.com/airblade/vim-gitgutter/,, +https://github.com/junegunn/vim-github-dashboard/,, +https://github.com/tikhomirov/vim-glsl/,, +https://github.com/jamessan/vim-gnupg/,, +https://github.com/fatih/vim-go/,, +https://github.com/rhysd/vim-grammarous/,, +https://github.com/jparise/vim-graphql/,, +https://github.com/mhinz/vim-grepper/,, +https://github.com/lifepillar/vim-gruvbox8/,, +https://github.com/brennanfee/vim-gui-position/,, +https://github.com/ludovicchabant/vim-gutentags/,, +https://github.com/takac/vim-hardtime/,, +https://github.com/chkno/vim-haskell-module-name/,, +https://github.com/enomsg/vim-haskellConcealPlus/,, +https://github.com/twinside/vim-haskellconceal/,, +https://github.com/jvirtanen/vim-hcl/,, +https://github.com/bitc/vim-hdevtools/,, +https://github.com/towolf/vim-helm/,, +https://github.com/RRethy/vim-hexokinase/,, +https://github.com/jceb/vim-hier/,, +https://github.com/machakann/vim-highlightedyank/,, +https://github.com/alx741/vim-hindent/,, +https://github.com/GEverding/vim-hocon/,, +https://github.com/Twinside/vim-hoogle/,, +https://github.com/jonsmithers/vim-html-template-literals/,, +https://github.com/vim-utils/vim-husk/,, +https://github.com/w0ng/vim-hybrid/,, +https://github.com/kristijanhusak/vim-hybrid-material/,, +https://github.com/noc7c9/vim-iced-coffee-script/,, +https://github.com/RRethy/vim-illuminate/,, +https://github.com/nathanaelkane/vim-indent-guides/,, +https://github.com/michaeljsmith/vim-indent-object/,, +https://github.com/jeetsukumaran/vim-indentwise/,, +https://github.com/henrik/vim-indexed-search/,, +https://github.com/ivanov/vim-ipython/,, +https://github.com/fisadev/vim-isort/,, +https://github.com/clojure-vim/vim-jack-in/,, +https://github.com/mhinz/vim-janah/,, +https://github.com/artur-shaik/vim-javacomplete2/,, +https://github.com/pangloss/vim-javascript/,, +https://github.com/jelera/vim-javascript-syntax/,, +https://github.com/lepture/vim-jinja/,, +https://github.com/maksimr/vim-jsbeautify/,, +https://github.com/heavenshell/vim-jsdoc/,, +https://github.com/elzr/vim-json/,, +https://github.com/google/vim-jsonnet/,, +https://github.com/MaxMEllon/vim-jsx-pretty/,, +https://github.com/peitalin/vim-jsx-typescript/,, +https://github.com/knubie/vim-kitty-navigator/,, +https://github.com/farmergreg/vim-lastplace/,, +https://github.com/xuhdev/vim-latex-live-preview/,, +https://github.com/ludovicchabant/vim-lawrencium/,, +https://github.com/hecal3/vim-leader-guide/,, +https://github.com/mk12/vim-lean/,, +https://github.com/ledger/vim-ledger/,, +https://github.com/lfe-support/vim-lfe/,, +https://github.com/josa42/vim-lightline-coc/,, +https://github.com/tommcdo/vim-lion/,, +https://github.com/tpope/vim-liquid/,, +https://github.com/embear/vim-localvimrc/,, +https://github.com/andreshazard/vim-logreview/,, +https://github.com/mlr-msft/vim-loves-dafny/,, +https://github.com/natebosch/vim-lsc/,, +https://github.com/prabirshrestha/vim-lsp/,, +https://github.com/jackguo380/vim-lsp-cxx-highlight/,, +https://github.com/tbastos/vim-lua/,, +https://github.com/google/vim-maktaba/,, +https://github.com/lambdalisue/vim-manpager/,, +https://github.com/Yilin-Yang/vim-markbar/,, +https://github.com/preservim/vim-markdown/,, +https://github.com/euclio/vim-markdown-composer/,, +https://github.com/mzlogin/vim-markdown-toc/,, +https://github.com/andymass/vim-matchup/,, +https://github.com/samoshkin/vim-mergetool/,, +https://github.com/idanarye/vim-merginal/,, +https://github.com/david-a-wheeler/vim-metamath/,, +https://github.com/xolox/vim-misc/,, +https://github.com/crusoexia/vim-monokai/,, +https://github.com/phanviet/vim-monokai-pro/,, +https://github.com/matze/vim-move/,, +https://github.com/lifepillar/vim-mucomplete/,, +https://github.com/terryma/vim-multiple-cursors/,, +https://github.com/simnalamburt/vim-mundo/,, +https://github.com/mustache/vim-mustache-handlebars/,, +https://github.com/tiagofumo/vim-nerdtree-syntax-highlight/,, +https://github.com/jistr/vim-nerdtree-tabs/,, +https://github.com/nfnty/vim-nftables/,, +https://github.com/kana/vim-niceblock/,, +https://github.com/tommcdo/vim-ninja-feet/,, +https://github.com/LnL7/vim-nix/,, +https://github.com/symphorien/vim-nixhash/,, +https://github.com/noahfrederick/vim-noctu/,, +https://github.com/fruit-in/vim-nong-theme/,, +https://github.com/jeffkreeftmeijer/vim-numbertoggle/,, +https://github.com/tpope/vim-obsession/,, +https://github.com/ocaml/vim-ocaml/,, +https://github.com/rakr/vim-one/,, +https://github.com/petRUShka/vim-opencl/,, +https://github.com/kana/vim-operator-replace/,, +https://github.com/rhysd/vim-operator-surround/,, +https://github.com/kana/vim-operator-user/,, +https://github.com/jceb/vim-orgmode/,, +https://github.com/sdiehl/vim-ormolu/,, +https://github.com/fcpg/vim-osc52/,, +https://github.com/ojroques/vim-oscyank/,, +https://github.com/osyo-manga/vim-over/,, +https://github.com/hashivim/vim-packer/,, +https://github.com/lambdalisue/vim-pager/,, +https://github.com/vim-pandoc/vim-pandoc/,, +https://github.com/vim-pandoc/vim-pandoc-after/,, +https://github.com/vim-pandoc/vim-pandoc-syntax/,, +https://github.com/bhurlow/vim-parinfer/,, +https://github.com/sickill/vim-pasta/,, +https://github.com/tpope/vim-pathogen/,, +https://github.com/junegunn/vim-peekaboo/,, +https://github.com/preservim/vim-pencil/,, +https://github.com/jparise/vim-phabricator/,, +https://github.com/justinj/vim-pico8-syntax/,, +https://github.com/junegunn/vim-plug/,, +https://github.com/powerman/vim-plugin-AnsiEsc/,, +https://github.com/sheerun/vim-polyglot/,, +https://github.com/jakwings/vim-pony/,, +https://github.com/haya14busa/vim-poweryank/,, +https://github.com/prettier/vim-prettier/,, +https://github.com/thinca/vim-prettyprint/,, +https://github.com/pantharshit00/vim-prisma/,, +https://github.com/tpope/vim-projectionist/,, +https://github.com/dhruvasagar/vim-prosession/,, +https://github.com/uarun/vim-protobuf/,, +https://github.com/PProvost/vim-ps1/,, +https://github.com/digitaltoad/vim-pug/,, +https://github.com/rodjek/vim-puppet/,, +https://github.com/Vimjas/vim-python-pep8-indent/,, +https://github.com/romainl/vim-qf/,, +https://github.com/romainl/vim-qlist/,, +https://github.com/peterhoeg/vim-qml/,, +https://github.com/thinca/vim-quickrun/,, +https://github.com/racer-rust/vim-racer/,, +https://github.com/wlangstroth/vim-racket/,, +https://github.com/tpope/vim-ragtag/,, +https://github.com/tpope/vim-rails/,, +https://github.com/jordwalke/vim-reasonml/,, +https://github.com/tpope/vim-repeat/,, +https://github.com/tpope/vim-rhubarb/,, +https://github.com/airblade/vim-rooter/,, +https://github.com/tpope/vim-rsi/,, +https://github.com/vim-ruby/vim-ruby/,, +https://github.com/tpope/vim-salve/,, +https://github.com/machakann/vim-sandwich/,, +https://github.com/mhinz/vim-sayonara/,7e774f58c5865d9c10d40396850b35ab95af17c5, +https://github.com/derekwyatt/vim-scala/,, +https://github.com/thinca/vim-scouter/,, +https://github.com/tpope/vim-scriptease/,, +https://github.com/tpope/vim-sensible/,, +https://github.com/guns/vim-sexp/,, +https://github.com/tpope/vim-sexp-mappings-for-regular-people/,, +https://github.com/itspriddle/vim-shellcheck/,, +https://github.com/kshenoy/vim-signature/,, +https://github.com/mhinz/vim-signify/,, +https://github.com/ivalkeen/vim-simpledb/,, +https://github.com/junegunn/vim-slash/,, +https://github.com/tpope/vim-sleuth/,, +https://github.com/jpalardy/vim-slime/,, +https://github.com/mzlogin/vim-smali/,, +https://github.com/t9md/vim-smalls/,, +https://github.com/psliwka/vim-smoothie/,, +https://github.com/bohlender/vim-smt2/,, +https://github.com/justinmk/vim-sneak/,, +https://github.com/garbas/vim-snipmate/,, +https://github.com/honza/vim-snippets/,, +https://github.com/jhradilek/vim-snippets/,,vim-docbk-snippets +https://github.com/tomlion/vim-solidity/,, +https://github.com/christoomey/vim-sort-motion/,, +https://github.com/CoatiSoftware/vim-sourcetrail/,, +https://github.com/tpope/vim-speeddating/,, +https://github.com/kbenzie/vim-spirv/,, +https://github.com/mhinz/vim-startify/,, +https://github.com/dstein64/vim-startuptime/,, +https://github.com/axelf4/vim-strip-trailing-whitespace/,, +https://github.com/nbouscal/vim-stylish-haskell/,, +https://github.com/alx741/vim-stylishask/,, +https://github.com/svermeulen/vim-subversive/,, +https://github.com/tpope/vim-surround/,, +https://github.com/evanleck/vim-svelte/,, +https://github.com/machakann/vim-swap/,, +https://github.com/dhruvasagar/vim-table-mode/,, +https://github.com/kana/vim-tabpagecd/,, +https://github.com/tpope/vim-tbone/,, +https://github.com/hashivim/vim-terraform/,, +https://github.com/juliosueiras/vim-terraform-completion/,, +https://github.com/vim-test/vim-test/,, +https://github.com/glts/vim-textobj-comment/,, +https://github.com/kana/vim-textobj-entire/,, +https://github.com/kana/vim-textobj-function/,, +https://github.com/gibiansky/vim-textobj-haskell/,, +https://github.com/osyo-manga/vim-textobj-multiblock/,, +https://github.com/kana/vim-textobj-user/,, +https://github.com/Julian/vim-textobj-variable-segment/,, +https://github.com/thinca/vim-themis/,, +https://github.com/tmux-plugins/vim-tmux/,, +https://github.com/roxma/vim-tmux-clipboard/,, +https://github.com/tmux-plugins/vim-tmux-focus-events/,, +https://github.com/christoomey/vim-tmux-navigator/,, +https://github.com/milkypostman/vim-togglelist/,, +https://github.com/cespare/vim-toml/,, +https://github.com/vimpostor/vim-tpipeline/,, +https://github.com/bronson/vim-trailing-whitespace/,, +https://github.com/ianks/vim-tsx/,, +https://github.com/lumiliet/vim-twig/,, +https://github.com/sodapopcan/vim-twiggy/,, +https://github.com/rcarriga/vim-ultest/,, +https://github.com/arthurxavierx/vim-unicoder/,, +https://github.com/tpope/vim-unimpaired/,, +https://github.com/hashivim/vim-vagrant/,, +https://github.com/tpope/vim-vinegar/,, +https://github.com/triglav/vim-visual-increment/,, +https://github.com/mg979/vim-visual-multi/,, +https://github.com/thinca/vim-visualstar/,, +https://github.com/hrsh7th/vim-vsnip/,, +https://github.com/hrsh7th/vim-vsnip-integ/,, +https://github.com/posva/vim-vue/,, +https://github.com/wakatime/vim-wakatime/,, +https://github.com/osyo-manga/vim-watchdogs/,, +https://github.com/jasonccox/vim-wayland-clipboard/,, +https://github.com/liuchengxu/vim-which-key/,, +https://github.com/wesQ3/vim-windowswap/,, +https://github.com/chaoren/vim-wordmotion/,, +https://github.com/preservim/vim-wordy/,, +https://github.com/joonty/vim-xdebug/,, +https://github.com/lyokha/vim-xkbswitch/,, +https://github.com/mg979/vim-xtabline/,, +https://github.com/stephpy/vim-yaml/,, +https://github.com/mindriot101/vim-yapf/,, +https://github.com/dag/vim2hs/,, +https://github.com/dominikduda/vim_current_word/,, +https://github.com/andrep/vimacs/,, +https://github.com/TaDaa/vimade/,, +https://github.com/jreybert/vimagit/,, +https://github.com/gotcha/vimelette/,, +https://github.com/Shougo/vimfiler.vim/,, +https://github.com/vimoutliner/vimoutliner/,, +https://github.com/tex/vimpreviewpandoc/,, +https://github.com/Shougo/vimproc.vim/,, +https://github.com/vimsence/vimsence/,, +https://github.com/Shougo/vimshell.vim/,, +https://github.com/puremourning/vimspector/,, +https://github.com/lervag/vimtex/,, +https://github.com/preservim/vimux/,, +https://github.com/vimwiki/vimwiki/,, +https://github.com/vim-scripts/vis/,, +https://github.com/navicore/vissort.vim/,, +https://github.com/liuchengxu/vista.vim/,, +https://github.com/dylanaraps/wal.vim/,, +https://github.com/mattn/webapi-vim/,, +https://github.com/folke/which-key.nvim/,, +https://github.com/gelguy/wilder.nvim/,, +https://github.com/gcmt/wildfire.vim/,, +https://github.com/sindrets/winshift.nvim/,, +https://github.com/wannesm/wmgraphviz.vim/,, +https://github.com/vim-scripts/wombat256.vim/,, +https://github.com/lukaszkorecki/workflowish/,, +https://github.com/tweekmonster/wstrip.vim/,, +https://github.com/drmingdrmer/xptemplate/,, +https://github.com/guns/xterm-color-table.vim/,, +https://github.com/HerringtonDarkholme/yats.vim/,, +https://github.com/KabbAmine/zeavim.vim/,, +https://github.com/folke/zen-mode.nvim/,, +https://github.com/jnurmine/zenburn/,, +https://github.com/glepnir/zephyr-nvim/,, +https://github.com/ziglang/zig.vim/,, +https://github.com/troydm/zoomwintab.vim/,, +https://github.com/nanotee/zoxide.vim/,, From 84fd282788fcf57d1cda6f5cd77ce7ba27577c2c Mon Sep 17 00:00:00 2001 From: Matthieu Coudron Date: Sun, 3 Apr 2022 17:30:24 +0200 Subject: [PATCH 4/4] doc: mention the new format expected by the new vim updater e.g., from simple strings to csv --- .../doc/manual/from_md/release-notes/rl-1803.section.xml | 8 ++++++++ nixos/doc/manual/release-notes/rl-1803.section.md | 2 ++ 2 files changed, 10 insertions(+) diff --git a/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml b/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml index f54f6129e0db9..910cad467e9d8 100644 --- a/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml +++ b/nixos/doc/manual/from_md/release-notes/rl-1803.section.xml @@ -866,6 +866,14 @@ package. + + + The vim/kakoune plugin updater now reads from a CSV file: + check + pkgs/applications/editors/vim/plugins/vim-plugin-names + out to see the new format + + diff --git a/nixos/doc/manual/release-notes/rl-1803.section.md b/nixos/doc/manual/release-notes/rl-1803.section.md index e4e467981047b..c5146015d4499 100644 --- a/nixos/doc/manual/release-notes/rl-1803.section.md +++ b/nixos/doc/manual/release-notes/rl-1803.section.md @@ -282,3 +282,5 @@ When upgrading from a previous release, please be aware of the following incompa - The NixOS test driver supports user services declared by `systemd.user.services`. The methods `waitForUnit`, `getUnitInfo`, `startJob` and `stopJob` provide an optional `$user` argument for that purpose. - Enabling bash completion on NixOS, `programs.bash.enableCompletion`, will now also enable completion for the Nix command line tools by installing the [nix-bash-completions](https://github.com/hedning/nix-bash-completions) package. + +- The vim/kakoune plugin updater now reads from a CSV file: check `pkgs/applications/editors/vim/plugins/vim-plugin-names` out to see the new format